From 76b1cdc17e2e5f212f30de3515585ff78028678f Mon Sep 17 00:00:00 2001 From: Dmitry Rodionov Date: Mon, 10 Jul 2023 11:23:37 +0300 Subject: [PATCH 01/58] Order tenant_id argument before timeline_id, use references (#4671) It started from few config methods that have various orderings and sometimes use references sometimes not. So I unified path manipulation methods to always order tenant_id before timeline_id and use referenced because we dont need owned values. Similar changes happened to call-sites of config methods. I'd say its a good idea to always order tenant_id before timeline_id so it is consistent across the whole codebase. --- pageserver/src/config.rs | 16 ++++---- pageserver/src/tenant.rs | 40 +++++++++---------- pageserver/src/tenant/ephemeral_file.rs | 4 +- pageserver/src/tenant/metadata.rs | 12 +++--- pageserver/src/tenant/mgr.rs | 25 +++++------- .../src/tenant/remote_timeline_client.rs | 18 ++++----- .../tenant/remote_timeline_client/download.rs | 8 ++-- .../tenant/remote_timeline_client/upload.rs | 6 +-- .../src/tenant/storage_layer/delta_layer.rs | 22 +++++----- .../src/tenant/storage_layer/image_layer.rs | 4 +- pageserver/src/tenant/timeline.rs | 16 ++++---- 11 files changed, 83 insertions(+), 88 deletions(-) diff --git a/pageserver/src/config.rs b/pageserver/src/config.rs index 2046d27b1e..f870c85355 100644 --- a/pageserver/src/config.rs +++ b/pageserver/src/config.rs @@ -570,21 +570,21 @@ impl PageServerConf { .join(TENANT_ATTACHING_MARKER_FILENAME) } - pub fn tenant_ignore_mark_file_path(&self, tenant_id: TenantId) -> PathBuf { - self.tenant_path(&tenant_id).join(IGNORED_TENANT_FILE_NAME) + pub fn tenant_ignore_mark_file_path(&self, tenant_id: &TenantId) -> PathBuf { + self.tenant_path(tenant_id).join(IGNORED_TENANT_FILE_NAME) } /// Points to a place in pageserver's local directory, /// where certain tenant's tenantconf file should be located. - pub fn tenant_config_path(&self, tenant_id: TenantId) -> PathBuf { - self.tenant_path(&tenant_id).join(TENANT_CONFIG_NAME) + pub fn tenant_config_path(&self, tenant_id: &TenantId) -> PathBuf { + self.tenant_path(tenant_id).join(TENANT_CONFIG_NAME) } pub fn timelines_path(&self, tenant_id: &TenantId) -> PathBuf { self.tenant_path(tenant_id).join(TIMELINES_SEGMENT_NAME) } - pub fn timeline_path(&self, timeline_id: &TimelineId, tenant_id: &TenantId) -> PathBuf { + pub fn timeline_path(&self, tenant_id: &TenantId, timeline_id: &TimelineId) -> PathBuf { self.timelines_path(tenant_id).join(timeline_id.to_string()) } @@ -594,7 +594,7 @@ impl PageServerConf { timeline_id: TimelineId, ) -> PathBuf { path_with_suffix_extension( - self.timeline_path(&timeline_id, &tenant_id), + self.timeline_path(&tenant_id, &timeline_id), TIMELINE_UNINIT_MARK_SUFFIX, ) } @@ -617,8 +617,8 @@ impl PageServerConf { /// Points to a place in pageserver's local directory, /// where certain timeline's metadata file should be located. - pub fn metadata_path(&self, timeline_id: TimelineId, tenant_id: TenantId) -> PathBuf { - self.timeline_path(&timeline_id, &tenant_id) + pub fn metadata_path(&self, tenant_id: &TenantId, timeline_id: &TimelineId) -> PathBuf { + self.timeline_path(tenant_id, timeline_id) .join(METADATA_FILE_NAME) } diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index 1650b267f1..5e207408cc 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -421,8 +421,8 @@ impl Tenant { if !picked_local { save_metadata( self.conf, - timeline_id, - tenant_id, + &tenant_id, + &timeline_id, up_to_date_metadata, first_save, ) @@ -451,7 +451,7 @@ impl Tenant { ) -> anyhow::Result> { // TODO dedup with spawn_load let tenant_conf = - Self::load_tenant_config(conf, tenant_id).context("load tenant config")?; + Self::load_tenant_config(conf, &tenant_id).context("load tenant config")?; let wal_redo_manager = Arc::new(PostgresRedoManager::new(conf, tenant_id)); let tenant = Arc::new(Tenant::new( @@ -646,7 +646,7 @@ impl Tenant { span::debug_assert_current_span_has_tenant_id(); info!("downloading index file for timeline {}", timeline_id); - tokio::fs::create_dir_all(self.conf.timeline_path(&timeline_id, &self.tenant_id)) + tokio::fs::create_dir_all(self.conf.timeline_path(&self.tenant_id, &timeline_id)) .await .context("Failed to create new timeline directory")?; @@ -724,7 +724,7 @@ impl Tenant { ) -> Arc { span::debug_assert_current_span_has_tenant_id(); - let tenant_conf = match Self::load_tenant_config(conf, tenant_id) { + let tenant_conf = match Self::load_tenant_config(conf, &tenant_id) { Ok(conf) => conf, Err(e) => { error!("load tenant config failed: {:?}", e); @@ -835,7 +835,7 @@ impl Tenant { timeline_uninit_mark_file.display() ) })?; - let timeline_dir = self.conf.timeline_path(&timeline_id, &self.tenant_id); + let timeline_dir = self.conf.timeline_path(&self.tenant_id, &timeline_id); if let Err(e) = remove_timeline_and_uninit_mark(&timeline_dir, timeline_uninit_mark_file) { @@ -880,7 +880,7 @@ impl Tenant { if let Ok(timeline_id) = file_name.to_str().unwrap_or_default().parse::() { - let metadata = load_metadata(self.conf, timeline_id, self.tenant_id) + let metadata = load_metadata(self.conf, &self.tenant_id, &timeline_id) .context("failed to load metadata")?; timelines_to_load.insert(timeline_id, metadata); } else { @@ -1445,7 +1445,7 @@ impl Tenant { let local_timeline_directory = self .conf - .timeline_path(&timeline.timeline_id, &self.tenant_id); + .timeline_path(&self.tenant_id, &timeline.timeline_id); fail::fail_point!("timeline-delete-before-rm", |_| { Err(anyhow::anyhow!("failpoint: timeline-delete-before-rm"))? @@ -2226,7 +2226,7 @@ impl Tenant { /// Locate and load config pub(super) fn load_tenant_config( conf: &'static PageServerConf, - tenant_id: TenantId, + tenant_id: &TenantId, ) -> anyhow::Result { let target_config_path = conf.tenant_config_path(tenant_id); let target_config_display = target_config_path.display(); @@ -2813,7 +2813,7 @@ impl Tenant { timeline_struct.init_empty_layer_map(start_lsn); if let Err(e) = - self.create_timeline_files(&uninit_mark.timeline_path, new_timeline_id, new_metadata) + self.create_timeline_files(&uninit_mark.timeline_path, &new_timeline_id, new_metadata) { error!("Failed to create initial files for timeline {tenant_id}/{new_timeline_id}, cleaning up: {e:?}"); cleanup_timeline_directory(uninit_mark); @@ -2832,7 +2832,7 @@ impl Tenant { fn create_timeline_files( &self, timeline_path: &Path, - new_timeline_id: TimelineId, + new_timeline_id: &TimelineId, new_metadata: &TimelineMetadata, ) -> anyhow::Result<()> { crashsafe::create_dir(timeline_path).context("Failed to create timeline directory")?; @@ -2843,8 +2843,8 @@ impl Tenant { save_metadata( self.conf, + &self.tenant_id, new_timeline_id, - self.tenant_id, new_metadata, true, ) @@ -2867,7 +2867,7 @@ impl Tenant { timelines.get(&timeline_id).is_none(), "Timeline {tenant_id}/{timeline_id} already exists in pageserver's memory" ); - let timeline_path = self.conf.timeline_path(&timeline_id, &tenant_id); + let timeline_path = self.conf.timeline_path(&tenant_id, &timeline_id); anyhow::ensure!( !timeline_path.exists(), "Timeline {} already exists, cannot create its uninit mark file", @@ -2998,10 +2998,10 @@ pub(crate) enum CreateTenantFilesMode { pub(crate) fn create_tenant_files( conf: &'static PageServerConf, tenant_conf: TenantConfOpt, - tenant_id: TenantId, + tenant_id: &TenantId, mode: CreateTenantFilesMode, ) -> anyhow::Result { - let target_tenant_directory = conf.tenant_path(&tenant_id); + let target_tenant_directory = conf.tenant_path(tenant_id); anyhow::ensure!( !target_tenant_directory .try_exists() @@ -3052,7 +3052,7 @@ pub(crate) fn create_tenant_files( fn try_create_target_tenant_dir( conf: &'static PageServerConf, tenant_conf: TenantConfOpt, - tenant_id: TenantId, + tenant_id: &TenantId, mode: CreateTenantFilesMode, temporary_tenant_dir: &Path, target_tenant_directory: &Path, @@ -3076,7 +3076,7 @@ fn try_create_target_tenant_dir( } let temporary_tenant_timelines_dir = rebase_directory( - &conf.timelines_path(&tenant_id), + &conf.timelines_path(tenant_id), target_tenant_directory, temporary_tenant_dir, ) @@ -3088,7 +3088,7 @@ fn try_create_target_tenant_dir( ) .with_context(|| format!("resolve tenant {tenant_id} temporary config path"))?; - Tenant::persist_tenant_config(&tenant_id, &temporary_tenant_config_path, tenant_conf, true)?; + Tenant::persist_tenant_config(tenant_id, &temporary_tenant_config_path, tenant_conf, true)?; crashsafe::create_dir(&temporary_tenant_timelines_dir).with_context(|| { format!( @@ -3376,7 +3376,7 @@ pub mod harness { } pub fn timeline_path(&self, timeline_id: &TimelineId) -> PathBuf { - self.conf.timeline_path(timeline_id, &self.tenant_id) + self.conf.timeline_path(&self.tenant_id, timeline_id) } } @@ -4370,7 +4370,7 @@ mod tests { assert!(!harness .conf - .timeline_path(&TIMELINE_ID, &tenant.tenant_id) + .timeline_path(&tenant.tenant_id, &TIMELINE_ID) .exists()); assert!(!harness diff --git a/pageserver/src/tenant/ephemeral_file.rs b/pageserver/src/tenant/ephemeral_file.rs index 4379438896..0d3c5da91c 100644 --- a/pageserver/src/tenant/ephemeral_file.rs +++ b/pageserver/src/tenant/ephemeral_file.rs @@ -55,7 +55,7 @@ impl EphemeralFile { l.next_file_id += 1; let filename = conf - .timeline_path(&timeline_id, &tenant_id) + .timeline_path(&tenant_id, &timeline_id) .join(PathBuf::from(format!("ephemeral-{}", file_id))); let file = VirtualFile::open_with_options( @@ -346,7 +346,7 @@ mod tests { let tenant_id = TenantId::from_str("11000000000000000000000000000000").unwrap(); let timeline_id = TimelineId::from_str("22000000000000000000000000000000").unwrap(); - fs::create_dir_all(conf.timeline_path(&timeline_id, &tenant_id))?; + fs::create_dir_all(conf.timeline_path(&tenant_id, &timeline_id))?; Ok((conf, tenant_id, timeline_id)) } diff --git a/pageserver/src/tenant/metadata.rs b/pageserver/src/tenant/metadata.rs index 1ea61fa26b..0ce10c7bc8 100644 --- a/pageserver/src/tenant/metadata.rs +++ b/pageserver/src/tenant/metadata.rs @@ -232,13 +232,13 @@ impl TimelineMetadata { /// Save timeline metadata to file pub fn save_metadata( conf: &'static PageServerConf, - timeline_id: TimelineId, - tenant_id: TenantId, + tenant_id: &TenantId, + timeline_id: &TimelineId, data: &TimelineMetadata, first_save: bool, ) -> anyhow::Result<()> { let _enter = info_span!("saving metadata").entered(); - let path = conf.metadata_path(timeline_id, tenant_id); + let path = conf.metadata_path(tenant_id, timeline_id); // use OpenOptions to ensure file presence is consistent with first_save let mut file = VirtualFile::open_with_options( &path, @@ -267,10 +267,10 @@ pub fn save_metadata( pub fn load_metadata( conf: &'static PageServerConf, - timeline_id: TimelineId, - tenant_id: TenantId, + tenant_id: &TenantId, + timeline_id: &TimelineId, ) -> anyhow::Result { - let metadata_path = conf.metadata_path(timeline_id, tenant_id); + let metadata_path = conf.metadata_path(tenant_id, timeline_id); let metadata_bytes = std::fs::read(&metadata_path).with_context(|| { format!( "Failed to read metadata bytes from path {}", diff --git a/pageserver/src/tenant/mgr.rs b/pageserver/src/tenant/mgr.rs index 09b825d2e9..8e31cc2ef1 100644 --- a/pageserver/src/tenant/mgr.rs +++ b/pageserver/src/tenant/mgr.rs @@ -184,9 +184,9 @@ pub fn schedule_local_tenant_processing( format!("Could not parse tenant id out of the tenant dir name in path {tenant_path:?}") })?; - let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(tenant_id); + let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(&tenant_id); anyhow::ensure!( - !conf.tenant_ignore_mark_file_path(tenant_id).exists(), + !conf.tenant_ignore_mark_file_path(&tenant_id).exists(), "Cannot load tenant, ignore mark found at {tenant_ignore_mark:?}" ); @@ -310,7 +310,7 @@ pub async fn create_tenant( // We're holding the tenants lock in write mode while doing local IO. // If this section ever becomes contentious, introduce a new `TenantState::Creating` // and do the work in that state. - let tenant_directory = super::create_tenant_files(conf, tenant_conf, tenant_id, CreateTenantFilesMode::Create)?; + let tenant_directory = super::create_tenant_files(conf, tenant_conf, &tenant_id, CreateTenantFilesMode::Create)?; // TODO: tenant directory remains on disk if we bail out from here on. // See https://github.com/neondatabase/neon/issues/4233 @@ -344,14 +344,9 @@ pub async fn set_new_tenant_config( info!("configuring tenant {tenant_id}"); let tenant = get_tenant(tenant_id, true).await?; - let tenant_config_path = conf.tenant_config_path(tenant_id); - Tenant::persist_tenant_config( - &tenant.tenant_id(), - &tenant_config_path, - new_tenant_conf, - false, - ) - .map_err(SetNewTenantConfigError::Persist)?; + let tenant_config_path = conf.tenant_config_path(&tenant_id); + Tenant::persist_tenant_config(&tenant_id, &tenant_config_path, new_tenant_conf, false) + .map_err(SetNewTenantConfigError::Persist)?; tenant.set_new_tenant_config(new_tenant_conf); Ok(()) } @@ -435,7 +430,7 @@ pub async fn detach_tenant( // Ignored tenants are not present in memory and will bail the removal from memory operation. // Before returning the error, check for ignored tenant removal case — we only need to clean its local files then. if detach_ignored && matches!(removal_result, Err(TenantStateError::NotFound(_))) { - let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(tenant_id); + let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(&tenant_id); if tenant_ignore_mark.exists() { info!("Detaching an ignored tenant"); local_files_cleanup_operation(tenant_id) @@ -457,7 +452,7 @@ pub async fn load_tenant( ) -> Result<(), TenantMapInsertError> { tenant_map_insert(tenant_id, || { let tenant_path = conf.tenant_path(&tenant_id); - let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(tenant_id); + let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(&tenant_id); if tenant_ignore_mark.exists() { std::fs::remove_file(&tenant_ignore_mark) .with_context(|| format!("Failed to remove tenant ignore mark {tenant_ignore_mark:?} during tenant loading"))?; @@ -478,7 +473,7 @@ pub async fn ignore_tenant( tenant_id: TenantId, ) -> Result<(), TenantStateError> { remove_tenant_from_memory(tenant_id, async { - let ignore_mark_file = conf.tenant_ignore_mark_file_path(tenant_id); + let ignore_mark_file = conf.tenant_ignore_mark_file_path(&tenant_id); fs::File::create(&ignore_mark_file) .await .context("Failed to create ignore mark file") @@ -525,7 +520,7 @@ pub async fn attach_tenant( ctx: &RequestContext, ) -> Result<(), TenantMapInsertError> { tenant_map_insert(tenant_id, || { - let tenant_dir = create_tenant_files(conf, tenant_conf, tenant_id, CreateTenantFilesMode::Attach)?; + let tenant_dir = create_tenant_files(conf, tenant_conf, &tenant_id, CreateTenantFilesMode::Attach)?; // TODO: tenant directory remains on disk if we bail out from here on. // See https://github.com/neondatabase/neon/issues/4233 diff --git a/pageserver/src/tenant/remote_timeline_client.rs b/pageserver/src/tenant/remote_timeline_client.rs index 964a3ebe3f..bc185b4f7a 100644 --- a/pageserver/src/tenant/remote_timeline_client.rs +++ b/pageserver/src/tenant/remote_timeline_client.rs @@ -442,8 +442,8 @@ impl RemoteTimelineClient { let index_part = download::download_index_part( self.conf, &self.storage_impl, - self.tenant_id, - self.timeline_id, + &self.tenant_id, + &self.timeline_id, ) .measure_remote_op( self.tenant_id, @@ -765,8 +765,8 @@ impl RemoteTimelineClient { upload::upload_index_part( self.conf, &self.storage_impl, - self.tenant_id, - self.timeline_id, + &self.tenant_id, + &self.timeline_id, &index_part_with_deleted_at, ) .await?; @@ -841,7 +841,7 @@ impl RemoteTimelineClient { // Do not delete index part yet, it is needed for possible retry. If we remove it first // and retry will arrive to different pageserver there wont be any traces of it on remote storage - let timeline_path = self.conf.timeline_path(&self.timeline_id, &self.tenant_id); + let timeline_path = self.conf.timeline_path(&self.tenant_id, &self.timeline_id); let timeline_storage_path = self.conf.remote_path(&timeline_path)?; let remaining = self @@ -1003,7 +1003,7 @@ impl RemoteTimelineClient { UploadOp::UploadLayer(ref layer_file_name, ref layer_metadata) => { let path = &self .conf - .timeline_path(&self.timeline_id, &self.tenant_id) + .timeline_path(&self.tenant_id, &self.timeline_id) .join(layer_file_name.file_name()); upload::upload_timeline_layer( self.conf, @@ -1024,8 +1024,8 @@ impl RemoteTimelineClient { let res = upload::upload_index_part( self.conf, &self.storage_impl, - self.tenant_id, - self.timeline_id, + &self.tenant_id, + &self.timeline_id, index_part, ) .measure_remote_op( @@ -1044,7 +1044,7 @@ impl RemoteTimelineClient { UploadOp::Delete(delete) => { let path = &self .conf - .timeline_path(&self.timeline_id, &self.tenant_id) + .timeline_path(&self.tenant_id, &self.timeline_id) .join(delete.layer_file_name.file_name()); delete::delete_layer(self.conf, &self.storage_impl, path) .measure_remote_op( diff --git a/pageserver/src/tenant/remote_timeline_client/download.rs b/pageserver/src/tenant/remote_timeline_client/download.rs index 87b1026a76..64f4a0a113 100644 --- a/pageserver/src/tenant/remote_timeline_client/download.rs +++ b/pageserver/src/tenant/remote_timeline_client/download.rs @@ -46,7 +46,7 @@ pub async fn download_layer_file<'a>( ) -> Result { debug_assert_current_span_has_tenant_and_timeline_id(); - let timeline_path = conf.timeline_path(&timeline_id, &tenant_id); + let timeline_path = conf.timeline_path(&tenant_id, &timeline_id); let local_path = timeline_path.join(layer_file_name.file_name()); @@ -229,11 +229,11 @@ pub async fn list_remote_timelines<'a>( pub(super) async fn download_index_part( conf: &'static PageServerConf, storage: &GenericRemoteStorage, - tenant_id: TenantId, - timeline_id: TimelineId, + tenant_id: &TenantId, + timeline_id: &TimelineId, ) -> Result { let index_part_path = conf - .metadata_path(timeline_id, tenant_id) + .metadata_path(tenant_id, timeline_id) .with_file_name(IndexPart::FILE_NAME); let part_storage_path = conf .remote_path(&index_part_path) diff --git a/pageserver/src/tenant/remote_timeline_client/upload.rs b/pageserver/src/tenant/remote_timeline_client/upload.rs index b520bb4b0c..098c661622 100644 --- a/pageserver/src/tenant/remote_timeline_client/upload.rs +++ b/pageserver/src/tenant/remote_timeline_client/upload.rs @@ -15,8 +15,8 @@ use super::index::LayerFileMetadata; pub(super) async fn upload_index_part<'a>( conf: &'static PageServerConf, storage: &'a GenericRemoteStorage, - tenant_id: TenantId, - timeline_id: TimelineId, + tenant_id: &TenantId, + timeline_id: &TimelineId, index_part: &'a IndexPart, ) -> anyhow::Result<()> { tracing::trace!("uploading new index part"); @@ -31,7 +31,7 @@ pub(super) async fn upload_index_part<'a>( let index_part_bytes = tokio::io::BufReader::new(std::io::Cursor::new(index_part_bytes)); let index_part_path = conf - .metadata_path(timeline_id, tenant_id) + .metadata_path(tenant_id, timeline_id) .with_file_name(IndexPart::FILE_NAME); let storage_path = conf.remote_path(&index_part_path)?; diff --git a/pageserver/src/tenant/storage_layer/delta_layer.rs b/pageserver/src/tenant/storage_layer/delta_layer.rs index c92a2898e4..78b8910921 100644 --- a/pageserver/src/tenant/storage_layer/delta_layer.rs +++ b/pageserver/src/tenant/storage_layer/delta_layer.rs @@ -459,22 +459,22 @@ impl PersistentLayer for DeltaLayer { impl DeltaLayer { fn path_for( path_or_conf: &PathOrConf, - timeline_id: TimelineId, - tenant_id: TenantId, + tenant_id: &TenantId, + timeline_id: &TimelineId, fname: &DeltaFileName, ) -> PathBuf { match path_or_conf { PathOrConf::Path(path) => path.clone(), PathOrConf::Conf(conf) => conf - .timeline_path(&timeline_id, &tenant_id) + .timeline_path(tenant_id, timeline_id) .join(fname.to_string()), } } fn temp_path_for( conf: &PageServerConf, - timeline_id: TimelineId, - tenant_id: TenantId, + tenant_id: &TenantId, + timeline_id: &TimelineId, key_start: Key, lsn_range: &Range, ) -> PathBuf { @@ -484,7 +484,7 @@ impl DeltaLayer { .map(char::from) .collect(); - conf.timeline_path(&timeline_id, &tenant_id).join(format!( + conf.timeline_path(tenant_id, timeline_id).join(format!( "{}-XXX__{:016X}-{:016X}.{}.{}", key_start, u64::from(lsn_range.start), @@ -606,8 +606,8 @@ impl DeltaLayer { pub fn path(&self) -> PathBuf { Self::path_for( &self.path_or_conf, - self.desc.timeline_id, - self.desc.tenant_id, + &self.desc.tenant_id, + &self.desc.timeline_id, &self.layer_name(), ) } @@ -655,7 +655,7 @@ impl DeltaLayerWriterInner { // // Note: This overwrites any existing file. There shouldn't be any. // FIXME: throw an error instead? - let path = DeltaLayer::temp_path_for(conf, timeline_id, tenant_id, key_start, &lsn_range); + let path = DeltaLayer::temp_path_for(conf, &tenant_id, &timeline_id, key_start, &lsn_range); let mut file = VirtualFile::create(&path)?; // make room for the header block @@ -770,8 +770,8 @@ impl DeltaLayerWriterInner { // FIXME: throw an error instead? let final_path = DeltaLayer::path_for( &PathOrConf::Conf(self.conf), - self.timeline_id, - self.tenant_id, + &self.tenant_id, + &self.timeline_id, &DeltaFileName { key_range: self.key_start..key_end, lsn_range: self.lsn_range, diff --git a/pageserver/src/tenant/storage_layer/image_layer.rs b/pageserver/src/tenant/storage_layer/image_layer.rs index 30a7d2f179..cef04df523 100644 --- a/pageserver/src/tenant/storage_layer/image_layer.rs +++ b/pageserver/src/tenant/storage_layer/image_layer.rs @@ -288,7 +288,7 @@ impl ImageLayer { match path_or_conf { PathOrConf::Path(path) => path.to_path_buf(), PathOrConf::Conf(conf) => conf - .timeline_path(&timeline_id, &tenant_id) + .timeline_path(&tenant_id, &timeline_id) .join(fname.to_string()), } } @@ -305,7 +305,7 @@ impl ImageLayer { .map(char::from) .collect(); - conf.timeline_path(&timeline_id, &tenant_id) + conf.timeline_path(&tenant_id, &timeline_id) .join(format!("{fname}.{rand_string}.{TEMP_FILE_SUFFIX}")) } diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index 626729859c..626fdad0cf 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -1613,7 +1613,7 @@ impl Timeline { // Scan timeline directory and create ImageFileName and DeltaFilename // structs representing all files on disk - let timeline_path = self.conf.timeline_path(&self.timeline_id, &self.tenant_id); + let timeline_path = self.conf.timeline_path(&self.tenant_id, &self.timeline_id); // total size of layer files in the current timeline directory let mut total_physical_size = 0; @@ -2208,7 +2208,7 @@ impl Timeline { fail::fail_point!("timeline-calculate-logical-size-check-dir-exists", |_| { if !self .conf - .metadata_path(self.timeline_id, self.tenant_id) + .metadata_path(&self.tenant_id, &self.timeline_id) .exists() { error!("timeline-calculate-logical-size-pre metadata file does not exist") @@ -3003,8 +3003,8 @@ impl Timeline { save_metadata( self.conf, - self.timeline_id, - self.tenant_id, + &self.tenant_id, + &self.timeline_id, &metadata, false, ) @@ -3053,7 +3053,7 @@ impl Timeline { par_fsync::par_fsync(&[new_delta_path]).context("fsync of delta layer")?; par_fsync::par_fsync(&[self_clone .conf - .timeline_path(&self_clone.timeline_id, &self_clone.tenant_id)]) + .timeline_path(&self_clone.tenant_id, &self_clone.timeline_id)]) .context("fsync of timeline dir")?; anyhow::Ok(new_delta) @@ -3296,7 +3296,7 @@ impl Timeline { .await .context("fsync of newly created layer files")?; - par_fsync::par_fsync_async(&[self.conf.timeline_path(&self.timeline_id, &self.tenant_id)]) + par_fsync::par_fsync_async(&[self.conf.timeline_path(&self.tenant_id, &self.timeline_id)]) .await .context("fsync of timeline dir")?; @@ -3305,7 +3305,7 @@ impl Timeline { let mut guard = self.layers.write().await; let (layers, mapping) = &mut *guard; let mut updates = layers.batch_update(); - let timeline_path = self.conf.timeline_path(&self.timeline_id, &self.tenant_id); + let timeline_path = self.conf.timeline_path(&self.tenant_id, &self.timeline_id); for l in image_layers { let path = l.filename(); @@ -3820,7 +3820,7 @@ impl Timeline { // minimize latency. par_fsync::par_fsync(&layer_paths).context("fsync all new layers")?; - par_fsync::par_fsync(&[self.conf.timeline_path(&self.timeline_id, &self.tenant_id)]) + par_fsync::par_fsync(&[self.conf.timeline_path(&self.tenant_id, &self.timeline_id)]) .context("fsync of timeline dir")?; layer_paths.pop().unwrap(); From 49efcc37734a3f78fb504e8c0da1334d39248b86 Mon Sep 17 00:00:00 2001 From: Christian Schwarz Date: Mon, 10 Jul 2023 11:49:22 +0200 Subject: [PATCH 02/58] walredo: add tenant_id to span of NoLeakChild::drop (#4640) We see the following log lines occasionally in prod: ``` kill_and_wait_impl{pid=1983042}: wait successful exit_status=signal: 9 (SIGKILL) ``` This PR makes it easier to find the tenant for the pid, by including the tenant id as a field in the span. --- pageserver/src/walredo.rs | 21 +++++++++++++++------ 1 file changed, 15 insertions(+), 6 deletions(-) diff --git a/pageserver/src/walredo.rs b/pageserver/src/walredo.rs index 8bac8ed42d..bc250166ce 100644 --- a/pageserver/src/walredo.rs +++ b/pageserver/src/walredo.rs @@ -685,7 +685,7 @@ impl PostgresRedoManager { // as close-on-exec by default, but that's not enough, since we use // libraries that directly call libc open without setting that flag. .close_fds() - .spawn_no_leak_child() + .spawn_no_leak_child(self.tenant_id) .map_err(|e| { Error::new( e.kind(), @@ -989,6 +989,7 @@ impl PostgresRedoManager { /// Wrapper type around `std::process::Child` which guarantees that the child /// will be killed and waited-for by this process before being dropped. struct NoLeakChild { + tenant_id: TenantId, child: Option, } @@ -1007,9 +1008,12 @@ impl DerefMut for NoLeakChild { } impl NoLeakChild { - fn spawn(command: &mut Command) -> io::Result { + fn spawn(tenant_id: TenantId, command: &mut Command) -> io::Result { let child = command.spawn()?; - Ok(NoLeakChild { child: Some(child) }) + Ok(NoLeakChild { + tenant_id, + child: Some(child), + }) } fn kill_and_wait(mut self) { @@ -1056,11 +1060,16 @@ impl Drop for NoLeakChild { Some(child) => child, None => return, }; + let tenant_id = self.tenant_id; // Offload the kill+wait of the child process into the background. // If someone stops the runtime, we'll leak the child process. // We can ignore that case because we only stop the runtime on pageserver exit. BACKGROUND_RUNTIME.spawn(async move { tokio::task::spawn_blocking(move || { + // Intentionally don't inherit the tracing context from whoever is dropping us. + // This thread here is going to outlive of our dropper. + let span = tracing::info_span!("walredo", %tenant_id); + let _entered = span.enter(); Self::kill_and_wait_impl(child); }) .await @@ -1069,12 +1078,12 @@ impl Drop for NoLeakChild { } trait NoLeakChildCommandExt { - fn spawn_no_leak_child(&mut self) -> io::Result; + fn spawn_no_leak_child(&mut self, tenant_id: TenantId) -> io::Result; } impl NoLeakChildCommandExt for Command { - fn spawn_no_leak_child(&mut self) -> io::Result { - NoLeakChild::spawn(self) + fn spawn_no_leak_child(&mut self, tenant_id: TenantId) -> io::Result { + NoLeakChild::spawn(tenant_id, self) } } From 5177c1e4b1d1387e15761f8fad28d0c976069f79 Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Mon, 10 Jul 2023 09:22:06 -0400 Subject: [PATCH 03/58] pagectl: separate xy margin for draw timeline (#4669) We were computing margin by lsn range, but this will cause problems for layer maps with large overlapping LSN range. Now we compute x, y margin separately to avoid this issue. ## Summary of changes before: image we have a lot of rectangles of negative width, and they disappear in the layer map. after: image Signed-off-by: Alex Chi Z --- pageserver/ctl/src/draw_timeline_dir.rs | 13 +++++++------ 1 file changed, 7 insertions(+), 6 deletions(-) diff --git a/pageserver/ctl/src/draw_timeline_dir.rs b/pageserver/ctl/src/draw_timeline_dir.rs index bfde5ba054..43e0c4422c 100644 --- a/pageserver/ctl/src/draw_timeline_dir.rs +++ b/pageserver/ctl/src/draw_timeline_dir.rs @@ -117,7 +117,8 @@ pub fn main() -> Result<()> { let mut lsn_diff = (lsn_end - lsn_start) as f32; let mut fill = Fill::None; - let mut margin = 0.05 * lsn_diff; // Height-dependent margin to disambiguate overlapping deltas + let mut ymargin = 0.05 * lsn_diff; // Height-dependent margin to disambiguate overlapping deltas + let xmargin = 0.05; // Height-dependent margin to disambiguate overlapping deltas let mut lsn_offset = 0.0; // Fill in and thicken rectangle if it's an @@ -128,7 +129,7 @@ pub fn main() -> Result<()> { num_images += 1; lsn_diff = 0.3; lsn_offset = -lsn_diff / 2.0; - margin = 0.05; + ymargin = 0.05; fill = Fill::Color(rgb(0, 0, 0)); } Ordering::Greater => panic!("Invalid lsn range {}-{}", lsn_start, lsn_end), @@ -137,10 +138,10 @@ pub fn main() -> Result<()> { println!( " {}", rectangle( - key_start as f32 + stretch * margin, - stretch * (lsn_max as f32 - (lsn_end as f32 - margin - lsn_offset)), - key_diff as f32 - stretch * 2.0 * margin, - stretch * (lsn_diff - 2.0 * margin) + key_start as f32 + stretch * xmargin, + stretch * (lsn_max as f32 - (lsn_end as f32 - ymargin - lsn_offset)), + key_diff as f32 - stretch * 2.0 * xmargin, + stretch * (lsn_diff - 2.0 * ymargin) ) .fill(fill) .stroke(Stroke::Color(rgb(0, 0, 0), 0.1)) From 65ff256bb87e9a86e78b15464c8f0d48ca06fe88 Mon Sep 17 00:00:00 2001 From: Christian Schwarz Date: Mon, 10 Jul 2023 15:23:40 +0200 Subject: [PATCH 04/58] page_service: add peer_addr span field, and set tenant_id / timeline_id fields earlier (#4638) Before this PR, during shutdown, we'd find naked logs like this one for every active page service connection: ``` 2023-07-05T14:13:50.791992Z INFO shutdown request received in run_message_loop ``` This PR 1. adds a peer_addr span field to distinguish the connections in logs 2. sets the tenant_id / timeline_id fields earlier It would be nice to have `tenant_id` and `timeline_id` directly on the `page_service_conn_main` span (empty, initially), then set them at the top of `process_query`. The problem is that the debug asserts for `tenant_id` and `timeline_id` presence in the tracing span doesn't support detecting empty values [1]. So, I'm a bit hesitant about over-using `Span::record`. [1] https://github.com/neondatabase/neon/issues/4676 --- pageserver/src/page_service.rs | 46 +++++++++++++++++++++++++++++++--- 1 file changed, 42 insertions(+), 4 deletions(-) diff --git a/pageserver/src/page_service.rs b/pageserver/src/page_service.rs index 8728559d72..118b0c0bae 100644 --- a/pageserver/src/page_service.rs +++ b/pageserver/src/page_service.rs @@ -33,6 +33,7 @@ use std::sync::Arc; use std::time::Duration; use tokio::io::{AsyncRead, AsyncWrite}; use tokio_util::io::StreamReader; +use tracing::field; use tracing::*; use utils::id::ConnectionId; use utils::{ @@ -51,6 +52,7 @@ use crate::metrics::{LIVE_CONNECTIONS_COUNT, SMGR_QUERY_TIME}; use crate::task_mgr; use crate::task_mgr::TaskKind; use crate::tenant; +use crate::tenant::debug_assert_current_span_has_tenant_and_timeline_id; use crate::tenant::mgr; use crate::tenant::mgr::GetTenantError; use crate::tenant::{Tenant, Timeline}; @@ -238,6 +240,7 @@ pub async fn libpq_listener_main( Ok(()) } +#[instrument(skip_all, fields(peer_addr))] async fn page_service_conn_main( conf: &'static PageServerConf, broker_client: storage_broker::BrokerClientChannel, @@ -260,6 +263,7 @@ async fn page_service_conn_main( .context("could not set TCP_NODELAY")?; let peer_addr = socket.peer_addr().context("get peer address")?; + tracing::Span::current().record("peer_addr", field::display(peer_addr)); // setup read timeout of 10 minutes. the timeout is rather arbitrary for requirements: // - long enough for most valid compute connections @@ -362,7 +366,7 @@ impl PageServerHandler { } } - #[instrument(skip(self, pgb, ctx))] + #[instrument(skip_all)] async fn handle_pagerequests( &self, pgb: &mut PostgresBackend, @@ -373,6 +377,8 @@ impl PageServerHandler { where IO: AsyncRead + AsyncWrite + Send + Sync + Unpin, { + debug_assert_current_span_has_tenant_and_timeline_id(); + // NOTE: pagerequests handler exits when connection is closed, // so there is no need to reset the association task_mgr::associate_with(Some(tenant_id), Some(timeline_id)); @@ -473,7 +479,7 @@ impl PageServerHandler { } #[allow(clippy::too_many_arguments)] - #[instrument(skip(self, pgb, ctx))] + #[instrument(skip_all, fields(%base_lsn, end_lsn=%_end_lsn, %pg_version))] async fn handle_import_basebackup( &self, pgb: &mut PostgresBackend, @@ -487,6 +493,8 @@ impl PageServerHandler { where IO: AsyncRead + AsyncWrite + Send + Sync + Unpin, { + debug_assert_current_span_has_tenant_and_timeline_id(); + task_mgr::associate_with(Some(tenant_id), Some(timeline_id)); // Create empty timeline info!("creating new timeline"); @@ -531,7 +539,7 @@ impl PageServerHandler { Ok(()) } - #[instrument(skip(self, pgb, ctx))] + #[instrument(skip_all, fields(%start_lsn, %end_lsn))] async fn handle_import_wal( &self, pgb: &mut PostgresBackend, @@ -544,6 +552,7 @@ impl PageServerHandler { where IO: AsyncRead + AsyncWrite + Send + Sync + Unpin, { + debug_assert_current_span_has_tenant_and_timeline_id(); task_mgr::associate_with(Some(tenant_id), Some(timeline_id)); let timeline = get_active_tenant_timeline(tenant_id, timeline_id, &ctx).await?; @@ -738,7 +747,7 @@ impl PageServerHandler { } #[allow(clippy::too_many_arguments)] - #[instrument(skip(self, pgb, ctx))] + #[instrument(skip_all, fields(?lsn, ?prev_lsn, %full_backup))] async fn handle_basebackup_request( &mut self, pgb: &mut PostgresBackend, @@ -752,6 +761,8 @@ impl PageServerHandler { where IO: AsyncRead + AsyncWrite + Send + Sync + Unpin, { + debug_assert_current_span_has_tenant_and_timeline_id(); + let started = std::time::Instant::now(); // check that the timeline exists @@ -862,6 +873,7 @@ where Ok(()) } + #[instrument(skip_all, fields(tenant_id, timeline_id))] async fn process_query( &mut self, pgb: &mut PostgresBackend, @@ -883,6 +895,10 @@ where let timeline_id = TimelineId::from_str(params[1]) .with_context(|| format!("Failed to parse timeline id from {}", params[1]))?; + tracing::Span::current() + .record("tenant_id", field::display(tenant_id)) + .record("timeline_id", field::display(timeline_id)); + self.check_permission(Some(tenant_id))?; self.handle_pagerequests(pgb, tenant_id, timeline_id, ctx) @@ -902,6 +918,10 @@ where let timeline_id = TimelineId::from_str(params[1]) .with_context(|| format!("Failed to parse timeline id from {}", params[1]))?; + tracing::Span::current() + .record("tenant_id", field::display(tenant_id)) + .record("timeline_id", field::display(timeline_id)); + self.check_permission(Some(tenant_id))?; let lsn = if params.len() >= 3 { @@ -948,6 +968,10 @@ where let timeline_id = TimelineId::from_str(params[1]) .with_context(|| format!("Failed to parse timeline id from {}", params[1]))?; + tracing::Span::current() + .record("tenant_id", field::display(tenant_id)) + .record("timeline_id", field::display(timeline_id)); + self.check_permission(Some(tenant_id))?; let timeline = get_active_tenant_timeline(tenant_id, timeline_id, &ctx).await?; @@ -979,6 +1003,10 @@ where let timeline_id = TimelineId::from_str(params[1]) .with_context(|| format!("Failed to parse timeline id from {}", params[1]))?; + tracing::Span::current() + .record("tenant_id", field::display(tenant_id)) + .record("timeline_id", field::display(timeline_id)); + // The caller is responsible for providing correct lsn and prev_lsn. let lsn = if params.len() > 2 { Some( @@ -1033,6 +1061,10 @@ where let pg_version = u32::from_str(params[4]) .with_context(|| format!("Failed to parse pg_version from {}", params[4]))?; + tracing::Span::current() + .record("tenant_id", field::display(tenant_id)) + .record("timeline_id", field::display(timeline_id)); + self.check_permission(Some(tenant_id))?; match self @@ -1077,6 +1109,10 @@ where let end_lsn = Lsn::from_str(params[3]) .with_context(|| format!("Failed to parse Lsn from {}", params[3]))?; + tracing::Span::current() + .record("tenant_id", field::display(tenant_id)) + .record("timeline_id", field::display(timeline_id)); + self.check_permission(Some(tenant_id))?; match self @@ -1108,6 +1144,8 @@ where let tenant_id = TenantId::from_str(params[0]) .with_context(|| format!("Failed to parse tenant id from {}", params[0]))?; + tracing::Span::current().record("tenant_id", field::display(tenant_id)); + self.check_permission(Some(tenant_id))?; let tenant = get_active_tenant_with_timeout(tenant_id, &ctx).await?; From 08bfe1c8264465ba99e97815fc62f2fcd78afc58 Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Mon, 10 Jul 2023 12:40:37 -0400 Subject: [PATCH 05/58] remove `LayerDescriptor` and use `LayerObject` for tests (#4637) ## Problem part of https://github.com/neondatabase/neon/pull/4340 ## Summary of changes Remove LayerDescriptor and remove `todo!`. At the same time, this PR adds `AsLayerDesc` trait for all persistent layers and changed `LayerFileManager` to have a generic type. For tests, we are now using `LayerObject`, which is a wrapper around `PersistentLayerDesc`. --------- Signed-off-by: Alex Chi Z --- pageserver/benches/bench_layer_map.rs | 14 +- pageserver/src/tenant/layer_map.rs | 34 +++-- pageserver/src/tenant/storage_layer.rs | 135 ++++-------------- .../src/tenant/storage_layer/delta_layer.rs | 8 +- .../src/tenant/storage_layer/image_layer.rs | 8 +- .../src/tenant/storage_layer/remote_layer.rs | 8 +- pageserver/src/tenant/timeline.rs | 22 ++- 7 files changed, 84 insertions(+), 145 deletions(-) diff --git a/pageserver/benches/bench_layer_map.rs b/pageserver/benches/bench_layer_map.rs index 03bb7a5bfd..f7a5832844 100644 --- a/pageserver/benches/bench_layer_map.rs +++ b/pageserver/benches/bench_layer_map.rs @@ -1,8 +1,8 @@ use pageserver::keyspace::{KeyPartitioning, KeySpace}; use pageserver::repository::Key; use pageserver::tenant::layer_map::LayerMap; -use pageserver::tenant::storage_layer::{tests::LayerDescriptor, Layer, LayerFileName}; -use pageserver::tenant::storage_layer::{PersistentLayer, PersistentLayerDesc}; +use pageserver::tenant::storage_layer::LayerFileName; +use pageserver::tenant::storage_layer::PersistentLayerDesc; use rand::prelude::{SeedableRng, SliceRandom, StdRng}; use std::cmp::{max, min}; use std::fs::File; @@ -28,13 +28,13 @@ fn build_layer_map(filename_dump: PathBuf) -> LayerMap { for fname in filenames { let fname = fname.unwrap(); let fname = LayerFileName::from_str(&fname).unwrap(); - let layer = LayerDescriptor::from(fname); + let layer = PersistentLayerDesc::from(fname); let lsn_range = layer.get_lsn_range(); min_lsn = min(min_lsn, lsn_range.start); max_lsn = max(max_lsn, Lsn(lsn_range.end.0 - 1)); - updates.insert_historic(layer.layer_desc().clone()); + updates.insert_historic(layer); } println!("min: {min_lsn}, max: {max_lsn}"); @@ -210,15 +210,15 @@ fn bench_sequential(c: &mut Criterion) { for i in 0..100_000 { let i32 = (i as u32) % 100; let zero = Key::from_hex("000000000000000000000000000000000000").unwrap(); - let layer = LayerDescriptor::from(PersistentLayerDesc::new_img( + let layer = PersistentLayerDesc::new_img( TenantId::generate(), TimelineId::generate(), zero.add(10 * i32)..zero.add(10 * i32 + 1), Lsn(i), false, 0, - )); - updates.insert_historic(layer.layer_desc().clone()); + ); + updates.insert_historic(layer); } updates.flush(); println!("Finished layer map init in {:?}", now.elapsed()); diff --git a/pageserver/src/tenant/layer_map.rs b/pageserver/src/tenant/layer_map.rs index 1c407d7133..13fa7ccc7b 100644 --- a/pageserver/src/tenant/layer_map.rs +++ b/pageserver/src/tenant/layer_map.rs @@ -651,19 +651,35 @@ impl LayerMap { #[cfg(test)] mod tests { use super::LayerMap; - use crate::tenant::storage_layer::{tests::LayerDescriptor, LayerFileName}; + use crate::tenant::storage_layer::LayerFileName; use std::str::FromStr; use std::sync::Arc; mod l0_delta_layers_updated { use crate::tenant::{ - storage_layer::{PersistentLayer, PersistentLayerDesc}, + storage_layer::{AsLayerDesc, PersistentLayerDesc}, timeline::LayerFileManager, }; use super::*; + struct LayerObject(PersistentLayerDesc); + + impl AsLayerDesc for LayerObject { + fn layer_desc(&self) -> &PersistentLayerDesc { + &self.0 + } + } + + impl LayerObject { + fn new(desc: PersistentLayerDesc) -> Self { + LayerObject(desc) + } + } + + type TestLayerFileManager = LayerFileManager; + #[test] fn for_full_range_delta() { // l0_delta_layers are used by compaction, and should observe all buffered updates @@ -700,18 +716,18 @@ mod tests { let layer = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69"; let layer = LayerFileName::from_str(layer).unwrap(); - let layer = LayerDescriptor::from(layer); + let layer = PersistentLayerDesc::from(layer); // same skeletan construction; see scenario below - let not_found = Arc::new(layer.clone()); - let new_version = Arc::new(layer); + let not_found = Arc::new(LayerObject::new(layer.clone())); + let new_version = Arc::new(LayerObject::new(layer)); // after the immutable storage state refactor, the replace operation // will not use layer map any more. We keep it here for consistency in test cases // and can remove it in the future. let _map = LayerMap::default(); - let mut mapping = LayerFileManager::new(); + let mut mapping = TestLayerFileManager::new(); mapping .replace_and_verify(not_found, new_version) @@ -720,10 +736,10 @@ mod tests { fn l0_delta_layers_updated_scenario(layer_name: &str, expected_l0: bool) { let name = LayerFileName::from_str(layer_name).unwrap(); - let skeleton = LayerDescriptor::from(name); + let skeleton = PersistentLayerDesc::from(name); - let remote = Arc::new(skeleton.clone()); - let downloaded = Arc::new(skeleton); + let remote = Arc::new(LayerObject::new(skeleton.clone())); + let downloaded = Arc::new(LayerObject::new(skeleton)); let mut map = LayerMap::default(); let mut mapping = LayerFileManager::new(); diff --git a/pageserver/src/tenant/storage_layer.rs b/pageserver/src/tenant/storage_layer.rs index f2aaa7cec6..72b2bfb1de 100644 --- a/pageserver/src/tenant/storage_layer.rs +++ b/pageserver/src/tenant/storage_layer.rs @@ -376,6 +376,12 @@ pub type LayerIter<'i> = Box> + 'i /// Returned by [`Layer::key_iter`] pub type LayerKeyIter<'i> = Box + 'i + Send>; +/// Get a layer descriptor from a layer. +pub trait AsLayerDesc { + /// Get the layer descriptor. + fn layer_desc(&self) -> &PersistentLayerDesc; +} + /// A Layer contains all data in a "rectangle" consisting of a range of keys and /// range of LSNs. /// @@ -389,10 +395,8 @@ pub type LayerKeyIter<'i> = Box + 'i + Send /// A delta layer contains all modifications within a range of LSNs and keys. /// An image layer is a snapshot of all the data in a key-range, at a single /// LSN. -pub trait PersistentLayer: Layer { - /// Get the layer descriptor. - fn layer_desc(&self) -> &PersistentLayerDesc; - +pub trait PersistentLayer: Layer + AsLayerDesc { + /// Identify the tenant this layer belongs to fn get_tenant_id(&self) -> TenantId { self.layer_desc().tenant_id } @@ -458,119 +462,32 @@ pub fn downcast_remote_layer( pub mod tests { use super::*; - /// Holds metadata about a layer without any content. Used mostly for testing. - /// - /// To use filenames as fixtures, parse them as [`LayerFileName`] then convert from that to a - /// LayerDescriptor. - #[derive(Clone, Debug)] - pub struct LayerDescriptor { - base: PersistentLayerDesc, - } - - impl From for LayerDescriptor { - fn from(base: PersistentLayerDesc) -> Self { - Self { base } - } - } - - impl Layer for LayerDescriptor { - fn get_value_reconstruct_data( - &self, - _key: Key, - _lsn_range: Range, - _reconstruct_data: &mut ValueReconstructState, - _ctx: &RequestContext, - ) -> Result { - todo!("This method shouldn't be part of the Layer trait") - } - - fn dump(&self, _verbose: bool, _ctx: &RequestContext) -> Result<()> { - todo!() - } - - /// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers. - fn get_key_range(&self) -> Range { - self.layer_desc().key_range.clone() - } - - /// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers. - fn get_lsn_range(&self) -> Range { - self.layer_desc().lsn_range.clone() - } - - /// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers. - fn is_incremental(&self) -> bool { - self.layer_desc().is_incremental - } - } - - /// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers. - impl std::fmt::Display for LayerDescriptor { - fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { - write!(f, "{}", self.layer_desc().short_id()) - } - } - - impl PersistentLayer for LayerDescriptor { - fn layer_desc(&self) -> &PersistentLayerDesc { - &self.base - } - - fn local_path(&self) -> Option { - unimplemented!() - } - - fn iter(&self, _: &RequestContext) -> Result> { - unimplemented!() - } - - fn key_iter(&self, _: &RequestContext) -> Result> { - unimplemented!() - } - - fn delete_resident_layer_file(&self) -> Result<()> { - unimplemented!() - } - - fn info(&self, _: LayerAccessStatsReset) -> HistoricLayerInfo { - unimplemented!() - } - - fn access_stats(&self) -> &LayerAccessStats { - unimplemented!() - } - } - - impl From for LayerDescriptor { + impl From for PersistentLayerDesc { fn from(value: DeltaFileName) -> Self { - LayerDescriptor { - base: PersistentLayerDesc::new_delta( - TenantId::from_array([0; 16]), - TimelineId::from_array([0; 16]), - value.key_range, - value.lsn_range, - 233, - ), - } + PersistentLayerDesc::new_delta( + TenantId::from_array([0; 16]), + TimelineId::from_array([0; 16]), + value.key_range, + value.lsn_range, + 233, + ) } } - impl From for LayerDescriptor { + impl From for PersistentLayerDesc { fn from(value: ImageFileName) -> Self { - LayerDescriptor { - base: PersistentLayerDesc::new_img( - TenantId::from_array([0; 16]), - TimelineId::from_array([0; 16]), - value.key_range, - value.lsn, - false, - 233, - ), - } + PersistentLayerDesc::new_img( + TenantId::from_array([0; 16]), + TimelineId::from_array([0; 16]), + value.key_range, + value.lsn, + false, + 233, + ) } } - impl From for LayerDescriptor { + impl From for PersistentLayerDesc { fn from(value: LayerFileName) -> Self { match value { LayerFileName::Delta(d) => Self::from(d), diff --git a/pageserver/src/tenant/storage_layer/delta_layer.rs b/pageserver/src/tenant/storage_layer/delta_layer.rs index 78b8910921..aafab1dd8e 100644 --- a/pageserver/src/tenant/storage_layer/delta_layer.rs +++ b/pageserver/src/tenant/storage_layer/delta_layer.rs @@ -56,8 +56,8 @@ use utils::{ }; use super::{ - DeltaFileName, Layer, LayerAccessStats, LayerAccessStatsReset, LayerIter, LayerKeyIter, - PathOrConf, PersistentLayerDesc, + AsLayerDesc, DeltaFileName, Layer, LayerAccessStats, LayerAccessStatsReset, LayerIter, + LayerKeyIter, PathOrConf, PersistentLayerDesc, }; /// @@ -403,11 +403,13 @@ impl std::fmt::Display for DeltaLayer { } } -impl PersistentLayer for DeltaLayer { +impl AsLayerDesc for DeltaLayer { fn layer_desc(&self) -> &PersistentLayerDesc { &self.desc } +} +impl PersistentLayer for DeltaLayer { fn local_path(&self) -> Option { Some(self.path()) } diff --git a/pageserver/src/tenant/storage_layer/image_layer.rs b/pageserver/src/tenant/storage_layer/image_layer.rs index cef04df523..e46a6d84f6 100644 --- a/pageserver/src/tenant/storage_layer/image_layer.rs +++ b/pageserver/src/tenant/storage_layer/image_layer.rs @@ -53,7 +53,9 @@ use utils::{ }; use super::filename::ImageFileName; -use super::{Layer, LayerAccessStatsReset, LayerIter, PathOrConf, PersistentLayerDesc}; +use super::{ + AsLayerDesc, Layer, LayerAccessStatsReset, LayerIter, PathOrConf, PersistentLayerDesc, +}; /// /// Header stored in the beginning of the file @@ -241,11 +243,13 @@ impl std::fmt::Display for ImageLayer { } } -impl PersistentLayer for ImageLayer { +impl AsLayerDesc for ImageLayer { fn layer_desc(&self) -> &PersistentLayerDesc { &self.desc } +} +impl PersistentLayer for ImageLayer { fn local_path(&self) -> Option { Some(self.path()) } diff --git a/pageserver/src/tenant/storage_layer/remote_layer.rs b/pageserver/src/tenant/storage_layer/remote_layer.rs index 14975629a9..54954fdb80 100644 --- a/pageserver/src/tenant/storage_layer/remote_layer.rs +++ b/pageserver/src/tenant/storage_layer/remote_layer.rs @@ -20,8 +20,8 @@ use utils::{ use super::filename::{DeltaFileName, ImageFileName}; use super::{ - DeltaLayer, ImageLayer, LayerAccessStats, LayerAccessStatsReset, LayerIter, LayerKeyIter, - LayerResidenceStatus, PersistentLayer, PersistentLayerDesc, + AsLayerDesc, DeltaLayer, ImageLayer, LayerAccessStats, LayerAccessStatsReset, LayerIter, + LayerKeyIter, LayerResidenceStatus, PersistentLayer, PersistentLayerDesc, }; /// RemoteLayer is a not yet downloaded [`ImageLayer`] or @@ -115,11 +115,13 @@ impl std::fmt::Display for RemoteLayer { } } -impl PersistentLayer for RemoteLayer { +impl AsLayerDesc for RemoteLayer { fn layer_desc(&self) -> &PersistentLayerDesc { &self.desc } +} +impl PersistentLayer for RemoteLayer { fn local_path(&self) -> Option { None } diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index 626fdad0cf..d790f0da1c 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -90,7 +90,8 @@ use super::layer_map::BatchedUpdates; use super::remote_timeline_client::index::IndexPart; use super::remote_timeline_client::RemoteTimelineClient; use super::storage_layer::{ - DeltaLayer, ImageLayer, Layer, LayerAccessStatsReset, PersistentLayerDesc, PersistentLayerKey, + AsLayerDesc, DeltaLayer, ImageLayer, Layer, LayerAccessStatsReset, PersistentLayerDesc, + PersistentLayerKey, }; #[derive(Debug, PartialEq, Eq, Clone, Copy)] @@ -124,10 +125,12 @@ impl PartialOrd for Hole { } } -pub struct LayerFileManager(HashMap>); +pub struct LayerFileManager( + HashMap>, +); -impl LayerFileManager { - fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc { +impl LayerFileManager { + fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc { // The assumption for the `expect()` is that all code maintains the following invariant: // A layer's descriptor is present in the LayerMap => the LayerFileManager contains a layer for the descriptor. self.0 @@ -137,7 +140,7 @@ impl LayerFileManager { .clone() } - pub(crate) fn insert(&mut self, layer: Arc) { + pub(crate) fn insert(&mut self, layer: Arc) { let present = self.0.insert(layer.layer_desc().key(), layer.clone()); if present.is_some() && cfg!(debug_assertions) { panic!("overwriting a layer: {:?}", layer.layer_desc()) @@ -148,7 +151,7 @@ impl LayerFileManager { Self(HashMap::new()) } - pub(crate) fn remove(&mut self, layer: Arc) { + pub(crate) fn remove(&mut self, layer: Arc) { let present = self.0.remove(&layer.layer_desc().key()); if present.is_none() && cfg!(debug_assertions) { panic!( @@ -158,11 +161,7 @@ impl LayerFileManager { } } - pub(crate) fn replace_and_verify( - &mut self, - expected: Arc, - new: Arc, - ) -> Result<()> { + pub(crate) fn replace_and_verify(&mut self, expected: Arc, new: Arc) -> Result<()> { let key = expected.layer_desc().key(); let other = new.layer_desc().key(); @@ -209,7 +208,6 @@ fn drop_rlock(rlock: tokio::sync::OwnedRwLockReadGuard) { fn drop_wlock(rlock: tokio::sync::RwLockWriteGuard<'_, T>) { drop(rlock) } - pub struct Timeline { conf: &'static PageServerConf, tenant_conf: Arc>, From 33c2d94ba670e3ac6e15d9aee0f1dd6ecbfe6ced Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Mon, 10 Jul 2023 20:01:01 +0100 Subject: [PATCH 06/58] Fix git-env version for PRs (#4641) ## Problem Binaries created from PRs (both in docker images and for tests) have wrong git-env versions, they point to phantom merge commits. ## Summary of changes - Prefer GIT_VERSION env variable even if git information was accessible - Use `${{ github.event.pull_request.head.sha || github.sha }}` instead of `${{ github.sha }}` for `GIT_VERSION` in workflows So the builds will still happen from this phantom commit, but we will report the PR commit. --------- Co-authored-by: Joonas Koivunen --- .github/workflows/build_and_test.yml | 10 ++-- Cargo.lock | 1 + libs/utils/Cargo.toml | 2 + libs/utils/src/lib.rs | 41 ++++++++++---- test_runner/fixtures/neon_fixtures.py | 15 +++++ test_runner/regress/test_compatibility.py | 3 +- test_runner/regress/test_neon_cli.py | 69 +++++++++++++++++++++++ 7 files changed, 123 insertions(+), 18 deletions(-) diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index cd4906579e..e74973fe0d 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -155,7 +155,7 @@ jobs: build_type: [ debug, release ] env: BUILD_TYPE: ${{ matrix.build_type }} - GIT_VERSION: ${{ github.sha }} + GIT_VERSION: ${{ github.event.pull_request.head.sha || github.sha }} steps: - name: Fix git ownership @@ -614,7 +614,7 @@ jobs: /kaniko/executor --reproducible --snapshot-mode=redo --skip-unused-stages --cache=true --cache-repo 369495373322.dkr.ecr.eu-central-1.amazonaws.com/cache --context . - --build-arg GIT_VERSION=${{ github.sha }} + --build-arg GIT_VERSION=${{ github.event.pull_request.head.sha || github.sha }} --build-arg REPOSITORY=369495373322.dkr.ecr.eu-central-1.amazonaws.com --destination 369495373322.dkr.ecr.eu-central-1.amazonaws.com/neon:${{needs.tag.outputs.build-tag}} --destination neondatabase/neon:${{needs.tag.outputs.build-tag}} @@ -658,7 +658,7 @@ jobs: /kaniko/executor --reproducible --snapshot-mode=redo --skip-unused-stages --cache=true --cache-repo 369495373322.dkr.ecr.eu-central-1.amazonaws.com/cache --context . - --build-arg GIT_VERSION=${{ github.sha }} + --build-arg GIT_VERSION=${{ github.event.pull_request.head.sha || github.sha }} --build-arg BUILD_TAG=${{needs.tag.outputs.build-tag}} --build-arg REPOSITORY=369495373322.dkr.ecr.eu-central-1.amazonaws.com --dockerfile Dockerfile.compute-tools @@ -715,7 +715,7 @@ jobs: /kaniko/executor --reproducible --snapshot-mode=redo --skip-unused-stages --cache=true --cache-repo 369495373322.dkr.ecr.eu-central-1.amazonaws.com/cache --context . - --build-arg GIT_VERSION=${{ github.sha }} + --build-arg GIT_VERSION=${{ github.event.pull_request.head.sha || github.sha }} --build-arg PG_VERSION=${{ matrix.version }} --build-arg BUILD_TAG=${{needs.tag.outputs.build-tag}} --build-arg REPOSITORY=369495373322.dkr.ecr.eu-central-1.amazonaws.com @@ -742,7 +742,7 @@ jobs: /kaniko/executor --reproducible --snapshot-mode=redo --skip-unused-stages --cache=true \ --cache-repo 369495373322.dkr.ecr.eu-central-1.amazonaws.com/cache \ --context . \ - --build-arg GIT_VERSION=${{ github.sha }} \ + --build-arg GIT_VERSION=${{ github.event.pull_request.head.sha || github.sha }} \ --build-arg PG_VERSION=${{ matrix.version }} \ --build-arg BUILD_TAG=${{needs.tag.outputs.build-tag}} \ --build-arg REPOSITORY=369495373322.dkr.ecr.eu-central-1.amazonaws.com \ diff --git a/Cargo.lock b/Cargo.lock index b163d4fe46..7b5539bdf5 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -4817,6 +4817,7 @@ dependencies = [ "byteorder", "bytes", "chrono", + "const_format", "criterion", "futures", "heapless", diff --git a/libs/utils/Cargo.toml b/libs/utils/Cargo.toml index 87b0082356..e7c8323c1d 100644 --- a/libs/utils/Cargo.toml +++ b/libs/utils/Cargo.toml @@ -40,6 +40,8 @@ pq_proto.workspace = true metrics.workspace = true workspace_hack.workspace = true +const_format.workspace = true + [dev-dependencies] byteorder.workspace = true bytes.workspace = true diff --git a/libs/utils/src/lib.rs b/libs/utils/src/lib.rs index 69d3a1b9f2..c3558443c3 100644 --- a/libs/utils/src/lib.rs +++ b/libs/utils/src/lib.rs @@ -109,10 +109,16 @@ pub use failpoint_macro_helpers::failpoint_sleep_helper; /// * building in docker (either in CI or locally) /// /// One thing to note is that .git is not available in docker (and it is bad to include it there). -/// So everything becides docker build is covered by git_version crate, and docker uses a `GIT_VERSION` argument to get the value required. -/// It takes variable from build process env and puts it to the rustc env. And then we can retrieve it here by using env! macro. -/// Git version received from environment variable used as a fallback in git_version invocation. -/// And to avoid running buildscript every recompilation, we use rerun-if-env-changed option. +/// When building locally, the `git_version` is used to query .git. When building on CI and docker, +/// we don't build the actual PR branch commits, but always a "phantom" would be merge commit to +/// the target branch -- the actual PR commit from which we build from is supplied as GIT_VERSION +/// environment variable. +/// +/// We ended up with this compromise between phantom would be merge commits vs. pull request branch +/// heads due to old logs becoming more reliable (github could gc the phantom merge commit +/// anytime) in #4641. +/// +/// To avoid running buildscript every recompilation, we use rerun-if-env-changed option. /// So the build script will be run only when GIT_VERSION envvar has changed. /// /// Why not to use buildscript to get git commit sha directly without procmacro from different crate? @@ -132,17 +138,28 @@ pub use failpoint_macro_helpers::failpoint_sleep_helper; #[macro_export] macro_rules! project_git_version { ($const_identifier:ident) => { - const $const_identifier: &str = git_version::git_version!( - prefix = "git:", - fallback = concat!( - "git-env:", - env!("GIT_VERSION", "Missing GIT_VERSION envvar") - ), - args = ["--abbrev=40", "--always", "--dirty=-modified"] // always use full sha - ); + // this should try GIT_VERSION first only then git_version::git_version! + const $const_identifier: &::core::primitive::str = { + const __COMMIT_FROM_GIT: &::core::primitive::str = git_version::git_version! { + prefix = "", + fallback = "unknown", + args = ["--abbrev=40", "--always", "--dirty=-modified"] // always use full sha + }; + + const __ARG: &[&::core::primitive::str; 2] = &match ::core::option_env!("GIT_VERSION") { + ::core::option::Option::Some(x) => ["git-env:", x], + ::core::option::Option::None => ["git:", __COMMIT_FROM_GIT], + }; + + $crate::__const_format::concatcp!(__ARG[0], __ARG[1]) + }; }; } +/// Re-export for `project_git_version` macro +#[doc(hidden)] +pub use const_format as __const_format; + /// Same as `assert!`, but evaluated during compilation and gets optimized out in runtime. #[macro_export] macro_rules! const_assert { diff --git a/test_runner/fixtures/neon_fixtures.py b/test_runner/fixtures/neon_fixtures.py index c3e9853978..d3d7d7f04e 100644 --- a/test_runner/fixtures/neon_fixtures.py +++ b/test_runner/fixtures/neon_fixtures.py @@ -3109,3 +3109,18 @@ def last_flush_lsn_upload( ps_http.timeline_checkpoint(tenant_id, timeline_id) wait_for_upload(ps_http, tenant_id, timeline_id, last_flush_lsn) return last_flush_lsn + + +def parse_project_git_version_output(s: str) -> str: + """ + Parses the git commit hash out of the --version output supported at least by neon_local. + + The information is generated by utils::project_git_version! + """ + import re + + res = re.search(r"git(-env)?:([0-9a-fA-F]{8,40})(-\S+)?", s) + if res and (commit := res.group(2)): + return commit + + raise ValueError(f"unable to parse --version output: '{s}'") diff --git a/test_runner/regress/test_compatibility.py b/test_runner/regress/test_compatibility.py index 51e7b01eba..00e916394b 100644 --- a/test_runner/regress/test_compatibility.py +++ b/test_runner/regress/test_compatibility.py @@ -14,6 +14,7 @@ from fixtures.neon_fixtures import ( NeonEnvBuilder, PgBin, PortDistributor, + parse_project_git_version_output, ) from fixtures.pageserver.http import PageserverHttpClient from fixtures.pageserver.utils import ( @@ -352,7 +353,7 @@ def prepare_snapshot( # get git SHA of neon binary def get_neon_version(neon_binpath: Path): out = subprocess.check_output([neon_binpath / "neon_local", "--version"]).decode("utf-8") - return out.split("git:", 1)[1].rstrip() + return parse_project_git_version_output(out) def check_neon_works( diff --git a/test_runner/regress/test_neon_cli.py b/test_runner/regress/test_neon_cli.py index cd481e69eb..9d24594cb6 100644 --- a/test_runner/regress/test_neon_cli.py +++ b/test_runner/regress/test_neon_cli.py @@ -1,12 +1,18 @@ +import os +import subprocess +from pathlib import Path from typing import cast +import pytest import requests from fixtures.neon_fixtures import ( DEFAULT_BRANCH_NAME, NeonEnv, NeonEnvBuilder, + parse_project_git_version_output, ) from fixtures.pageserver.http import PageserverHttpClient +from fixtures.pg_version import PgVersion, skip_on_postgres from fixtures.types import TenantId, TimelineId @@ -131,3 +137,66 @@ def test_cli_start_stop(neon_env_builder: NeonEnvBuilder): # Default stop res = env.neon_cli.raw_cli(["stop"]) res.check_returncode() + + +@skip_on_postgres(PgVersion.V14, reason="does not use postgres") +@pytest.mark.skipif( + os.environ.get("BUILD_TYPE") == "debug", reason="unit test for test support, either build works" +) +def test_parse_project_git_version_output_positive(): + commit = "b6f77b5816cf1dba12a3bc8747941182ce220846" + + positive = [ + # most likely when developing locally + f"Neon CLI git:{commit}-modified", + # when developing locally + f"Neon CLI git:{commit}", + # this is not produced in practice, but the impl supports it + f"Neon CLI git-env:{commit}-modified", + # most likely from CI or docker build + f"Neon CLI git-env:{commit}", + ] + + for example in positive: + assert parse_project_git_version_output(example) == commit + + +@skip_on_postgres(PgVersion.V14, reason="does not use postgres") +@pytest.mark.skipif( + os.environ.get("BUILD_TYPE") == "debug", reason="unit test for test support, either build works" +) +def test_parse_project_git_version_output_local_docker(): + """ + Makes sure the tests don't accept the default version in Dockerfile one gets without providing + a commit lookalike in --build-arg GIT_VERSION=XXX + """ + input = "Neon CLI git-env:local" + + with pytest.raises(ValueError) as e: + parse_project_git_version_output(input) + + assert input in str(e) + + +@skip_on_postgres(PgVersion.V14, reason="does not use postgres") +@pytest.mark.skipif( + os.environ.get("BUILD_TYPE") == "debug", reason="cli api sanity, either build works" +) +def test_binaries_version_parses(neon_binpath: Path): + """ + Ensures that we can parse the actual outputs of --version from a set of binaries. + + The list is not meant to be exhaustive, and compute_ctl has a different way for example. + """ + + binaries = [ + "neon_local", + "pageserver", + "safekeeper", + "proxy", + "pg_sni_router", + "storage_broker", + ] + for bin in binaries: + out = subprocess.check_output([neon_binpath / bin, "--version"]).decode("utf-8") + parse_project_git_version_output(out) From 618d36ee6d9d9b3d5956587e5d91b386d2bac11a Mon Sep 17 00:00:00 2001 From: bojanserafimov Date: Mon, 10 Jul 2023 15:34:26 -0400 Subject: [PATCH 07/58] compute_ctl: log a structured event on successful start (#4679) --- compute_tools/src/compute.rs | 7 +++++++ 1 file changed, 7 insertions(+) diff --git a/compute_tools/src/compute.rs b/compute_tools/src/compute.rs index aec4e49725..9fcdae73a4 100644 --- a/compute_tools/src/compute.rs +++ b/compute_tools/src/compute.rs @@ -549,6 +549,13 @@ impl ComputeNode { pspec.spec.cluster.cluster_id.as_deref().unwrap_or("None") ); + // Log metrics so that we can search for slow operations in logs + let metrics = { + let state = self.state.lock().unwrap(); + state.metrics.clone() + }; + info!(?metrics, "compute start finished"); + Ok(pg) } From 5e2f29491f0551b992350660c4b517aa07570105 Mon Sep 17 00:00:00 2001 From: Em Sharnoff Date: Tue, 11 Jul 2023 03:45:25 -0700 Subject: [PATCH 08/58] Update vm-builder v0.11.1 -> v0.12.1 (#4680) This should only affect the version of the vm-informant used. The only PR changing the informant since v0.11.1 was: * https://github.com/neondatabase/autoscaling/pull/389 The bug that autoscaling#389 fixed impacts all pooled VMs, so the updated images from this PR must be released before https://github.com/neondatabase/cloud/pull/5721. --- .github/workflows/build_and_test.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index e74973fe0d..d026aa67d0 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -767,7 +767,7 @@ jobs: run: shell: sh -eu {0} env: - VM_BUILDER_VERSION: v0.11.1 + VM_BUILDER_VERSION: v0.12.1 steps: - name: Checkout From 92aee7e07f347a0cc125462705811963ab5c78e9 Mon Sep 17 00:00:00 2001 From: bojanserafimov Date: Tue, 11 Jul 2023 13:11:23 -0400 Subject: [PATCH 09/58] cold starts: basebackup compression (#4482) Co-authored-by: Alex Chi Z --- Cargo.lock | 38 +++++++++++++- Cargo.toml | 2 + compute_tools/Cargo.toml | 2 + compute_tools/src/compute.rs | 44 ++++++++++++++-- libs/compute_api/src/responses.rs | 1 + libs/utils/src/measured_stream.rs | 32 ++++++++++++ pageserver/Cargo.toml | 2 + pageserver/src/page_service.rs | 69 +++++++++++++++++++++++-- test_runner/performance/test_startup.py | 5 ++ 9 files changed, 185 insertions(+), 10 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 7b5539bdf5..45f5acce7d 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -158,6 +158,19 @@ dependencies = [ "syn 1.0.109", ] +[[package]] +name = "async-compression" +version = "0.4.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "5b0122885821398cc923ece939e24d1056a2384ee719432397fa9db87230ff11" +dependencies = [ + "flate2", + "futures-core", + "memchr", + "pin-project-lite", + "tokio", +] + [[package]] name = "async-stream" version = "0.3.5" @@ -593,7 +606,7 @@ dependencies = [ "cc", "cfg-if", "libc", - "miniz_oxide", + "miniz_oxide 0.6.2", "object", "rustc-demangle", ] @@ -882,9 +895,11 @@ name = "compute_tools" version = "0.1.0" dependencies = [ "anyhow", + "async-compression", "chrono", "clap", "compute_api", + "flate2", "futures", "hyper", "notify", @@ -1367,6 +1382,16 @@ version = "0.4.2" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0ce7134b9999ecaf8bcd65542e436736ef32ddca1b3e06094cb6ec5755203b80" +[[package]] +name = "flate2" +version = "1.0.26" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3b9429470923de8e8cbd4d2dc513535400b4b3fef0319fb5c4e1f520a7bef743" +dependencies = [ + "crc32fast", + "miniz_oxide 0.7.1", +] + [[package]] name = "fnv" version = "1.0.7" @@ -2151,6 +2176,15 @@ dependencies = [ "adler", ] +[[package]] +name = "miniz_oxide" +version = "0.7.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "e7810e0be55b428ada41041c41f32c9f1a42817901b4ccf45fa3d4b6561e74c7" +dependencies = [ + "adler", +] + [[package]] name = "mio" version = "0.8.6" @@ -2482,6 +2516,7 @@ name = "pageserver" version = "0.1.0" dependencies = [ "anyhow", + "async-compression", "async-stream", "async-trait", "byteorder", @@ -2498,6 +2533,7 @@ dependencies = [ "enum-map", "enumset", "fail", + "flate2", "futures", "git-version", "hex", diff --git a/Cargo.toml b/Cargo.toml index f36e8f6569..6d35334deb 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -32,6 +32,8 @@ license = "Apache-2.0" ## All dependency versions, used in the project [workspace.dependencies] anyhow = { version = "1.0", features = ["backtrace"] } +async-compression = { version = "0.4.0", features = ["tokio", "gzip"] } +flate2 = "1.0.26" async-stream = "0.3" async-trait = "0.1" aws-config = { version = "0.55", default-features = false, features=["rustls"] } diff --git a/compute_tools/Cargo.toml b/compute_tools/Cargo.toml index 21226249cf..f8f8f729ce 100644 --- a/compute_tools/Cargo.toml +++ b/compute_tools/Cargo.toml @@ -6,8 +6,10 @@ license.workspace = true [dependencies] anyhow.workspace = true +async-compression.workspace = true chrono.workspace = true clap.workspace = true +flate2.workspace = true futures.workspace = true hyper = { workspace = true, features = ["full"] } notify.workspace = true diff --git a/compute_tools/src/compute.rs b/compute_tools/src/compute.rs index 9fcdae73a4..38f3b53f65 100644 --- a/compute_tools/src/compute.rs +++ b/compute_tools/src/compute.rs @@ -1,4 +1,5 @@ use std::fs; +use std::io::BufRead; use std::os::unix::fs::PermissionsExt; use std::path::Path; use std::process::{Command, Stdio}; @@ -15,6 +16,7 @@ use utils::lsn::Lsn; use compute_api::responses::{ComputeMetrics, ComputeStatus}; use compute_api::spec::{ComputeMode, ComputeSpec}; +use utils::measured_stream::MeasuredReader; use crate::config; use crate::pg_helpers::*; @@ -253,20 +255,52 @@ impl ComputeNode { let mut client = config.connect(NoTls)?; let basebackup_cmd = match lsn { - Lsn(0) => format!("basebackup {} {}", spec.tenant_id, spec.timeline_id), // First start of the compute - _ => format!("basebackup {} {} {}", spec.tenant_id, spec.timeline_id, lsn), + // HACK We don't use compression on first start (Lsn(0)) because there's no API for it + Lsn(0) => format!("basebackup {} {}", spec.tenant_id, spec.timeline_id), + _ => format!( + "basebackup {} {} {} --gzip", + spec.tenant_id, spec.timeline_id, lsn + ), }; + let copyreader = client.copy_out(basebackup_cmd.as_str())?; + let mut measured_reader = MeasuredReader::new(copyreader); + + // Check the magic number to see if it's a gzip or not. Even though + // we might explicitly ask for gzip, an old pageserver with no implementation + // of gzip compression might send us uncompressed data. After some time + // passes we can assume all pageservers know how to compress and we can + // delete this check. + // + // If the data is not gzip, it will be tar. It will not be mistakenly + // recognized as gzip because tar starts with an ascii encoding of a filename, + // and 0x1f and 0x8b are unlikely first characters for any filename. Moreover, + // we send the "global" directory first from the pageserver, so it definitely + // won't be recognized as gzip. + let mut bufreader = std::io::BufReader::new(&mut measured_reader); + let gzip = { + let peek = bufreader.fill_buf().unwrap(); + peek[0] == 0x1f && peek[1] == 0x8b + }; // Read the archive directly from the `CopyOutReader` // // Set `ignore_zeros` so that unpack() reads all the Copy data and // doesn't stop at the end-of-archive marker. Otherwise, if the server // sends an Error after finishing the tarball, we will not notice it. - let mut ar = tar::Archive::new(copyreader); - ar.set_ignore_zeros(true); - ar.unpack(&self.pgdata)?; + if gzip { + let mut ar = tar::Archive::new(flate2::read::GzDecoder::new(&mut bufreader)); + ar.set_ignore_zeros(true); + ar.unpack(&self.pgdata)?; + } else { + let mut ar = tar::Archive::new(&mut bufreader); + ar.set_ignore_zeros(true); + ar.unpack(&self.pgdata)?; + }; + // Report metrics + self.state.lock().unwrap().metrics.basebackup_bytes = + measured_reader.get_byte_count() as u64; self.state.lock().unwrap().metrics.basebackup_ms = Utc::now() .signed_duration_since(start_time) .to_std() diff --git a/libs/compute_api/src/responses.rs b/libs/compute_api/src/responses.rs index 80e5341216..6124c81f50 100644 --- a/libs/compute_api/src/responses.rs +++ b/libs/compute_api/src/responses.rs @@ -71,6 +71,7 @@ pub struct ComputeMetrics { pub wait_for_spec_ms: u64, pub sync_safekeepers_ms: u64, pub basebackup_ms: u64, + pub basebackup_bytes: u64, pub start_postgres_ms: u64, pub config_ms: u64, pub total_startup_ms: u64, diff --git a/libs/utils/src/measured_stream.rs b/libs/utils/src/measured_stream.rs index c37d686a1d..c82fc13109 100644 --- a/libs/utils/src/measured_stream.rs +++ b/libs/utils/src/measured_stream.rs @@ -1,4 +1,5 @@ use pin_project_lite::pin_project; +use std::io::Read; use std::pin::Pin; use std::{io, task}; use tokio::io::{AsyncRead, AsyncWrite, ReadBuf}; @@ -75,3 +76,34 @@ impl AsyncWrite for MeasuredStream { + inner: R, + byte_count: usize, +} + +impl MeasuredReader { + pub fn new(reader: R) -> Self { + Self { + inner: reader, + byte_count: 0, + } + } + + pub fn get_byte_count(&self) -> usize { + self.byte_count + } +} + +impl Read for MeasuredReader { + fn read(&mut self, buf: &mut [u8]) -> std::io::Result { + let result = self.inner.read(buf); + if let Ok(n_bytes) = result { + self.byte_count += n_bytes + } + result + } +} diff --git a/pageserver/Cargo.toml b/pageserver/Cargo.toml index ea81544cbe..9381ed0bfa 100644 --- a/pageserver/Cargo.toml +++ b/pageserver/Cargo.toml @@ -12,6 +12,7 @@ testing = ["fail/failpoints"] [dependencies] anyhow.workspace = true +async-compression.workspace = true async-stream.workspace = true async-trait.workspace = true byteorder.workspace = true @@ -24,6 +25,7 @@ consumption_metrics.workspace = true crc32c.workspace = true crossbeam-utils.workspace = true either.workspace = true +flate2.workspace = true fail.workspace = true futures.workspace = true git-version.workspace = true diff --git a/pageserver/src/page_service.rs b/pageserver/src/page_service.rs index 118b0c0bae..35dd5ecdb5 100644 --- a/pageserver/src/page_service.rs +++ b/pageserver/src/page_service.rs @@ -10,6 +10,7 @@ // use anyhow::Context; +use async_compression::tokio::write::GzipEncoder; use bytes::Buf; use bytes::Bytes; use futures::Stream; @@ -31,6 +32,7 @@ use std::str; use std::str::FromStr; use std::sync::Arc; use std::time::Duration; +use tokio::io::AsyncWriteExt; use tokio::io::{AsyncRead, AsyncWrite}; use tokio_util::io::StreamReader; use tracing::field; @@ -756,6 +758,7 @@ impl PageServerHandler { lsn: Option, prev_lsn: Option, full_backup: bool, + gzip: bool, ctx: RequestContext, ) -> anyhow::Result<()> where @@ -783,8 +786,9 @@ impl PageServerHandler { pgb.write_message_noflush(&BeMessage::CopyOutResponse)?; pgb.flush().await?; - // Send a tarball of the latest layer on the timeline - { + // Send a tarball of the latest layer on the timeline. Compress if not + // fullbackup. TODO Compress in that case too (tests need to be updated) + if full_backup { let mut writer = pgb.copyout_writer(); basebackup::send_basebackup_tarball( &mut writer, @@ -795,6 +799,40 @@ impl PageServerHandler { &ctx, ) .await?; + } else { + let mut writer = pgb.copyout_writer(); + if gzip { + let mut encoder = GzipEncoder::with_quality( + writer, + // NOTE using fast compression because it's on the critical path + // for compute startup. For an empty database, we get + // <100KB with this method. The Level::Best compression method + // gives us <20KB, but maybe we should add basebackup caching + // on compute shutdown first. + async_compression::Level::Fastest, + ); + basebackup::send_basebackup_tarball( + &mut encoder, + &timeline, + lsn, + prev_lsn, + full_backup, + &ctx, + ) + .await?; + // shutdown the encoder to ensure the gzip footer is written + encoder.shutdown().await?; + } else { + basebackup::send_basebackup_tarball( + &mut writer, + &timeline, + lsn, + prev_lsn, + full_backup, + &ctx, + ) + .await?; + } } pgb.write_message_noflush(&BeMessage::CopyDone)?; @@ -933,6 +971,19 @@ where None }; + let gzip = if params.len() >= 4 { + if params[3] == "--gzip" { + true + } else { + return Err(QueryError::Other(anyhow::anyhow!( + "Parameter in position 3 unknown {}", + params[3], + ))); + } + } else { + false + }; + metrics::metric_vec_duration::observe_async_block_duration_by_result( &*crate::metrics::BASEBACKUP_QUERY_TIME, async move { @@ -943,6 +994,7 @@ where lsn, None, false, + gzip, ctx, ) .await?; @@ -1028,8 +1080,17 @@ where self.check_permission(Some(tenant_id))?; // Check that the timeline exists - self.handle_basebackup_request(pgb, tenant_id, timeline_id, lsn, prev_lsn, true, ctx) - .await?; + self.handle_basebackup_request( + pgb, + tenant_id, + timeline_id, + lsn, + prev_lsn, + true, + false, + ctx, + ) + .await?; pgb.write_message_noflush(&BeMessage::CommandComplete(b"SELECT 1"))?; } else if query_string.starts_with("import basebackup ") { // Import the `base` section (everything but the wal) of a basebackup. diff --git a/test_runner/performance/test_startup.py b/test_runner/performance/test_startup.py index 4744c1ed2e..d897df1bcb 100644 --- a/test_runner/performance/test_startup.py +++ b/test_runner/performance/test_startup.py @@ -60,6 +60,11 @@ def test_startup_simple(neon_env_builder: NeonEnvBuilder, zenbenchmark: NeonBenc value = metrics[key] zenbenchmark.record(name, value, "ms", report=MetricReport.LOWER_IS_BETTER) + # Check basebackup size makes sense + basebackup_bytes = metrics["basebackup_bytes"] + if i > 0: + assert basebackup_bytes < 100 * 1024 + # Stop so we can restart endpoint.stop() From a1d6b1a4af5252e1215571257d4e79e40d961c11 Mon Sep 17 00:00:00 2001 From: Conrad Ludgate Date: Wed, 12 Jul 2023 11:38:36 +0100 Subject: [PATCH 10/58] proxy wake_compute loop (#4675) ## Problem If we fail to wake up the compute node, a subsequent connect attempt will definitely fail. However, kubernetes won't fail the connection immediately, instead it hangs until we timeout (10s). ## Summary of changes Refactor the loop to allow fast retries of compute_wake and to skip a connect attempt. --- proxy/src/http/conn_pool.rs | 81 ++++++++++++++++----------- proxy/src/proxy.rs | 108 ++++++++++++++++++++++++------------ proxy/src/proxy/tests.rs | 9 +-- 3 files changed, 121 insertions(+), 77 deletions(-) diff --git a/proxy/src/http/conn_pool.rs b/proxy/src/http/conn_pool.rs index 27950d3a20..fb53c663c8 100644 --- a/proxy/src/http/conn_pool.rs +++ b/proxy/src/http/conn_pool.rs @@ -1,6 +1,7 @@ use parking_lot::Mutex; use pq_proto::StartupMessageParams; use std::fmt; +use std::ops::ControlFlow; use std::{collections::HashMap, sync::Arc}; use tokio::time; @@ -9,8 +10,7 @@ use crate::{auth, console}; use super::sql_over_http::MAX_RESPONSE_SIZE; -use crate::proxy::try_wake; -use crate::proxy::{BASE_RETRY_WAIT_DURATION, NUM_RETRIES_WAKE_COMPUTE}; +use crate::proxy::{invalidate_cache, retry_after, try_wake, NUM_RETRIES_WAKE_COMPUTE}; use tracing::error; use tracing::info; @@ -184,11 +184,10 @@ impl GlobalConnPool { } } -// // Wake up the destination if needed. Code here is a bit involved because // we reuse the code from the usual proxy and we need to prepare few structures // that this code expects. -// +#[tracing::instrument(skip_all)] async fn connect_to_compute( config: &config::ProxyConfig, conn_info: &ConnInfo, @@ -220,54 +219,72 @@ async fn connect_to_compute( let node_info = &mut creds.wake_compute(&extra).await?.expect("msg"); - // This code is a copy of `connect_to_compute` from `src/proxy.rs` with - // the difference that it uses `tokio_postgres` for the connection. let mut num_retries = 0; - let mut should_wake = true; + let mut wait_duration = time::Duration::ZERO; + let mut should_wake_with_error = None; loop { + if !wait_duration.is_zero() { + time::sleep(wait_duration).await; + } + + // try wake the compute node if we have determined it's sensible to do so + if let Some(err) = should_wake_with_error.take() { + match try_wake(node_info, &extra, &creds).await { + // we can't wake up the compute node + Ok(None) => return Err(err), + // there was an error communicating with the control plane + Err(e) => return Err(e.into()), + // failed to wake up but we can continue to retry + Ok(Some(ControlFlow::Continue(()))) => { + wait_duration = retry_after(num_retries); + should_wake_with_error = Some(err); + + num_retries += 1; + info!(num_retries, "retrying wake compute"); + continue; + } + // successfully woke up a compute node and can break the wakeup loop + Ok(Some(ControlFlow::Break(()))) => {} + } + } + match connect_to_compute_once(node_info, conn_info).await { - Err(e) if num_retries == NUM_RETRIES_WAKE_COMPUTE => { - if let Some(wait_duration) = retry_connect_in(&e, num_retries) { - error!(error = ?e, "could not connect to compute node"); - if should_wake { - match try_wake(node_info, &extra, &creds).await { - Ok(Some(x)) => should_wake = x, - Ok(None) => return Err(e.into()), - Err(e) => return Err(e.into()), - } - } - if !wait_duration.is_zero() { - time::sleep(wait_duration).await; - } - } else { + Ok(res) => return Ok(res), + Err(e) => { + error!(error = ?e, "could not connect to compute node"); + if !can_retry_error(&e, num_retries) { return Err(e.into()); } + wait_duration = retry_after(num_retries); + + // after the first connect failure, + // we should invalidate the cache and wake up a new compute node + if num_retries == 0 { + invalidate_cache(node_info); + should_wake_with_error = Some(e.into()); + } } - other => return Ok(other?), } num_retries += 1; - info!(retries_left = num_retries, "retrying connect"); + info!(num_retries, "retrying connect"); } } -fn retry_connect_in(err: &tokio_postgres::Error, num_retries: u32) -> Option { +fn can_retry_error(err: &tokio_postgres::Error, num_retries: u32) -> bool { use tokio_postgres::error::SqlState; match err.code() { - // retry all errors at least once immediately - _ if num_retries == 0 => Some(time::Duration::ZERO), - // keep retrying connection errors every 100ms + // retry all errors at least once + _ if num_retries == 0 => true, + // keep retrying connection errors Some( &SqlState::CONNECTION_FAILURE | &SqlState::CONNECTION_EXCEPTION | &SqlState::CONNECTION_DOES_NOT_EXIST | &SqlState::SQLCLIENT_UNABLE_TO_ESTABLISH_SQLCONNECTION, - ) => { - // 3/2 = 1.5 which seems to be an ok growth factor heuristic - Some(BASE_RETRY_WAIT_DURATION * 3_u32.pow(num_retries) / 2_u32.pow(num_retries)) - } + ) if num_retries < NUM_RETRIES_WAKE_COMPUTE => true, // otherwise, don't retry - _ => None, + _ => false, } } diff --git a/proxy/src/proxy.rs b/proxy/src/proxy.rs index 5c5353a63e..12ca9c5187 100644 --- a/proxy/src/proxy.rs +++ b/proxy/src/proxy.rs @@ -20,7 +20,7 @@ use hyper::StatusCode; use metrics::{register_int_counter, register_int_counter_vec, IntCounter, IntCounterVec}; use once_cell::sync::Lazy; use pq_proto::{BeMessage as Be, FeStartupPacket, StartupMessageParams}; -use std::sync::Arc; +use std::{ops::ControlFlow, sync::Arc}; use tokio::{ io::{AsyncRead, AsyncWrite, AsyncWriteExt}, time, @@ -32,7 +32,7 @@ use utils::measured_stream::MeasuredStream; /// Number of times we should retry the `/proxy_wake_compute` http request. /// Retry duration is BASE_RETRY_WAIT_DURATION * 1.5^n pub const NUM_RETRIES_WAKE_COMPUTE: u32 = 10; -pub const BASE_RETRY_WAIT_DURATION: time::Duration = time::Duration::from_millis(100); +const BASE_RETRY_WAIT_DURATION: time::Duration = time::Duration::from_millis(100); const ERR_INSECURE_CONNECTION: &str = "connection is insecure (try using `sslmode=require`)"; const ERR_PROTO_VIOLATION: &str = "protocol violation"; @@ -335,11 +335,37 @@ async fn connect_to_compute( creds: &auth::BackendType<'_, auth::ClientCredentials<'_>>, ) -> Result { let mut num_retries = 0; - let mut should_wake = true; + let mut wait_duration = time::Duration::ZERO; + let mut should_wake_with_error = None; loop { // Apply startup params to the (possibly, cached) compute node info. node_info.config.set_startup_params(params); + if !wait_duration.is_zero() { + time::sleep(wait_duration).await; + } + + // try wake the compute node if we have determined it's sensible to do so + if let Some(err) = should_wake_with_error.take() { + match try_wake(node_info, extra, creds).await { + // we can't wake up the compute node + Ok(None) => return Err(err), + // there was an error communicating with the control plane + Err(e) => return Err(io_error(e).into()), + // failed to wake up but we can continue to retry + Ok(Some(ControlFlow::Continue(()))) => { + wait_duration = retry_after(num_retries); + should_wake_with_error = Some(err); + + num_retries += 1; + info!(num_retries, "retrying wake compute"); + continue; + } + // successfully woke up a compute node and can break the wakeup loop + Ok(Some(ControlFlow::Break(()))) => {} + } + } + // Set a shorter timeout for the initial connection attempt. // // In case we try to connect to an outdated address that is no longer valid, the @@ -359,31 +385,29 @@ async fn connect_to_compute( time::Duration::from_secs(10) }; + // do this again to ensure we have username? + node_info.config.set_startup_params(params); + match connect_to_compute_once(node_info, timeout).await { - Err(e) if num_retries < NUM_RETRIES_WAKE_COMPUTE => { - if let Some(wait_duration) = retry_connect_in(&e, num_retries) { - error!(error = ?e, "could not connect to compute node"); - if should_wake { - match try_wake(node_info, extra, creds).await { - Ok(Some(x)) => { - should_wake = x; - } - Ok(None) => return Err(e), - Err(e) => return Err(io_error(e).into()), - } - } - if !wait_duration.is_zero() { - time::sleep(wait_duration).await; - } - } else { + Ok(res) => return Ok(res), + Err(e) => { + error!(error = ?e, "could not connect to compute node"); + if !can_retry_error(&e, num_retries) { return Err(e); } + wait_duration = retry_after(num_retries); + + // after the first connect failure, + // we should invalidate the cache and wake up a new compute node + if num_retries == 0 { + invalidate_cache(node_info); + should_wake_with_error = Some(e); + } } - other => return other, } num_retries += 1; - info!(retries_left = num_retries, "retrying connect"); + info!(num_retries, "retrying connect"); } } @@ -395,41 +419,51 @@ pub async fn try_wake( node_info: &mut console::CachedNodeInfo, extra: &console::ConsoleReqExtra<'_>, creds: &auth::BackendType<'_, auth::ClientCredentials<'_>>, -) -> Result, WakeComputeError> { +) -> Result>, WakeComputeError> { info!("compute node's state has likely changed; requesting a wake-up"); - invalidate_cache(node_info); match creds.wake_compute(extra).await { // retry wake if the compute was in an invalid state Err(WakeComputeError::ApiError(ApiError::Console { status: StatusCode::BAD_REQUEST, .. - })) => Ok(Some(true)), + })) => Ok(Some(ControlFlow::Continue(()))), // Update `node_info` and try again. Ok(Some(mut new)) => { new.config.reuse_password(&node_info.config); *node_info = new; - Ok(Some(false)) + Ok(Some(ControlFlow::Break(()))) } Err(e) => Err(e), Ok(None) => Ok(None), } } -fn retry_connect_in(err: &compute::ConnectionError, num_retries: u32) -> Option { +fn can_retry_error(err: &compute::ConnectionError, num_retries: u32) -> bool { use std::io::ErrorKind; match err { - // retry all errors at least once immediately - _ if num_retries == 0 => Some(time::Duration::ZERO), - // keep retrying connection errors every 100ms - compute::ConnectionError::CouldNotConnect(io_err) => match io_err.kind() { - ErrorKind::ConnectionRefused | ErrorKind::AddrNotAvailable => { - // 3/2 = 1.5 which seems to be an ok growth factor heuristic - Some(BASE_RETRY_WAIT_DURATION * 3_u32.pow(num_retries) / 2_u32.pow(num_retries)) - } - _ => None, - }, + // retry all errors at least once + _ if num_retries == 0 => true, + // keep retrying connection errors + compute::ConnectionError::CouldNotConnect(io_err) + if num_retries < NUM_RETRIES_WAKE_COMPUTE => + { + matches!( + io_err.kind(), + ErrorKind::ConnectionRefused | ErrorKind::AddrNotAvailable + ) + } // otherwise, don't retry - _ => None, + _ => false, + } +} + +pub fn retry_after(num_retries: u32) -> time::Duration { + match num_retries { + 0 => time::Duration::ZERO, + _ => { + // 3/2 = 1.5 which seems to be an ok growth factor heuristic + BASE_RETRY_WAIT_DURATION * 3_u32.pow(num_retries) / 2_u32.pow(num_retries) + } } } diff --git a/proxy/src/proxy/tests.rs b/proxy/src/proxy/tests.rs index a1f6cd3ed4..b9215cd90e 100644 --- a/proxy/src/proxy/tests.rs +++ b/proxy/src/proxy/tests.rs @@ -1,6 +1,4 @@ //! A group of high-level tests for connection establishing logic and auth. -use std::io; - use super::*; use crate::{auth, sasl, scram}; use async_trait::async_trait; @@ -299,14 +297,9 @@ async fn scram_auth_mock() -> anyhow::Result<()> { #[test] fn connect_compute_total_wait() { - let err = compute::ConnectionError::CouldNotConnect(io::Error::new( - io::ErrorKind::ConnectionRefused, - "conn refused", - )); - let mut total_wait = tokio::time::Duration::ZERO; for num_retries in 0..10 { - total_wait += retry_connect_in(&err, num_retries).unwrap(); + total_wait += retry_after(num_retries); } assert!(total_wait < tokio::time::Duration::from_secs(12)); assert!(total_wait > tokio::time::Duration::from_secs(10)); From 1355bd0ac58fed09a31ff984d7f72977c1526847 Mon Sep 17 00:00:00 2001 From: arpad-m Date: Wed, 12 Jul 2023 15:52:14 +0200 Subject: [PATCH 11/58] layer deletion: Improve a comment and fix TOCTOU (#4673) The comment referenced an issue that was already closed. Remove that reference and replace it with an explanation why we already don't print an error. See discussion in https://github.com/neondatabase/neon/issues/2934#issuecomment-1626505916 For the TOCTOU fixes, the two calls after the `.exists()` both didn't handle the situation well where the file was deleted after the initial `.exists()`: one would assume that the path wasn't a file, giving a bad error, the second would give an accurate error but that's not wanted either. We remove both racy `exists` and `is_file` checks, and instead just look for errors about files not being found. --- libs/remote_storage/src/local_fs.rs | 15 ++++++--------- .../src/tenant/remote_timeline_client/delete.rs | 7 ++++--- 2 files changed, 10 insertions(+), 12 deletions(-) diff --git a/libs/remote_storage/src/local_fs.rs b/libs/remote_storage/src/local_fs.rs index ca5fbd5de5..36fd2647c5 100644 --- a/libs/remote_storage/src/local_fs.rs +++ b/libs/remote_storage/src/local_fs.rs @@ -7,6 +7,7 @@ use std::{ borrow::Cow, future::Future, + io::ErrorKind, path::{Path, PathBuf}, pin::Pin, }; @@ -343,18 +344,14 @@ impl RemoteStorage for LocalFs { async fn delete(&self, path: &RemotePath) -> anyhow::Result<()> { let file_path = path.with_base(&self.storage_root); - if !file_path.exists() { + match fs::remove_file(&file_path).await { + Ok(()) => Ok(()), + // The file doesn't exist. This shouldn't yield an error to mirror S3's behaviour. // See https://docs.aws.amazon.com/AmazonS3/latest/API/API_DeleteObject.html // > If there isn't a null version, Amazon S3 does not remove any objects but will still respond that the command was successful. - return Ok(()); + Err(e) if e.kind() == ErrorKind::NotFound => Ok(()), + Err(e) => Err(anyhow::anyhow!(e)), } - - if !file_path.is_file() { - anyhow::bail!("{file_path:?} is not a file"); - } - Ok(fs::remove_file(file_path) - .await - .map_err(|e| anyhow::anyhow!(e))?) } async fn delete_objects<'a>(&self, paths: &'a [RemotePath]) -> anyhow::Result<()> { diff --git a/pageserver/src/tenant/remote_timeline_client/delete.rs b/pageserver/src/tenant/remote_timeline_client/delete.rs index 9f6732fbff..3f505d45ab 100644 --- a/pageserver/src/tenant/remote_timeline_client/delete.rs +++ b/pageserver/src/tenant/remote_timeline_client/delete.rs @@ -19,9 +19,10 @@ pub(super) async fn delete_layer<'a>( let path_to_delete = conf.remote_path(local_layer_path)?; - // XXX: If the deletion fails because the object already didn't exist, - // it would be good to just issue a warning but consider it success. - // https://github.com/neondatabase/neon/issues/2934 + // We don't want to print an error if the delete failed if the file has + // already been deleted. Thankfully, in this situation S3 already + // does not yield an error. While OS-provided local file system APIs do yield + // errors, we avoid them in the `LocalFs` wrapper. storage.delete(&path_to_delete).await.with_context(|| { format!("Failed to delete remote layer from storage at {path_to_delete:?}") }) From 87dd37a2f2da8add5c1e1e8b63aa7b78c5da930d Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Wed, 12 Jul 2023 16:58:40 +0300 Subject: [PATCH 12/58] pageserver: Align tenant, timeline id names in spans (#4687) Uses `(tenant|timeline)_id`. Not a statement about endorsing this naming style but it is better to be aligned. --- pageserver/src/disk_usage_eviction_task.rs | 2 +- pageserver/src/http/routes.rs | 22 +++++++++---------- pageserver/src/tenant.rs | 4 ++-- pageserver/src/tenant/mgr.rs | 6 ++--- .../src/tenant/remote_timeline_client.rs | 8 ++++--- pageserver/src/tenant/span.rs | 4 ++-- pageserver/src/tenant/timeline.rs | 8 +++---- pageserver/src/tenant/timeline/span.rs | 6 ++--- pageserver/src/tenant/timeline/uninit.rs | 2 +- 9 files changed, 30 insertions(+), 32 deletions(-) diff --git a/pageserver/src/disk_usage_eviction_task.rs b/pageserver/src/disk_usage_eviction_task.rs index 3cb89ab9e9..b2ca9ab0bb 100644 --- a/pageserver/src/disk_usage_eviction_task.rs +++ b/pageserver/src/disk_usage_eviction_task.rs @@ -305,7 +305,7 @@ pub async fn disk_usage_eviction_task_iteration_impl( let now = SystemTime::now(); for (i, (partition, candidate)) in candidates.iter().enumerate() { debug!( - "cand {}/{}: size={}, no_access_for={}us, parition={:?}, tenant={} timeline={} layer={}", + "cand {}/{}: size={}, no_access_for={}us, partition={:?}, {}/{}/{}", i + 1, candidates.len(), candidate.layer.file_size(), diff --git a/pageserver/src/http/routes.rs b/pageserver/src/http/routes.rs index 58dcbb2aac..f39db891e1 100644 --- a/pageserver/src/http/routes.rs +++ b/pageserver/src/http/routes.rs @@ -346,7 +346,7 @@ async fn timeline_create_handler( Err(tenant::CreateTimelineError::Other(err)) => Err(ApiError::InternalServerError(err)), } } - .instrument(info_span!("timeline_create", tenant = %tenant_id, timeline_id = %new_timeline_id, lsn=?request_data.ancestor_start_lsn, pg_version=?request_data.pg_version)) + .instrument(info_span!("timeline_create", %tenant_id, timeline_id = %new_timeline_id, lsn=?request_data.ancestor_start_lsn, pg_version=?request_data.pg_version)) .await } @@ -381,7 +381,7 @@ async fn timeline_list_handler( } Ok::, ApiError>(response_data) } - .instrument(info_span!("timeline_list", tenant = %tenant_id)) + .instrument(info_span!("timeline_list", %tenant_id)) .await?; json_response(StatusCode::OK, response_data) @@ -418,7 +418,7 @@ async fn timeline_detail_handler( Ok::<_, ApiError>(timeline_info) } - .instrument(info_span!("timeline_detail", tenant = %tenant_id, timeline = %timeline_id)) + .instrument(info_span!("timeline_detail", %tenant_id, %timeline_id)) .await?; json_response(StatusCode::OK, timeline_info) @@ -479,7 +479,7 @@ async fn tenant_attach_handler( remote_storage.clone(), &ctx, ) - .instrument(info_span!("tenant_attach", tenant = %tenant_id)) + .instrument(info_span!("tenant_attach", %tenant_id)) .await?; } else { return Err(ApiError::BadRequest(anyhow!( @@ -501,7 +501,7 @@ async fn timeline_delete_handler( let ctx = RequestContext::new(TaskKind::MgmtRequest, DownloadBehavior::Warn); mgr::delete_timeline(tenant_id, timeline_id, &ctx) - .instrument(info_span!("timeline_delete", tenant = %tenant_id, timeline = %timeline_id)) + .instrument(info_span!("timeline_delete", %tenant_id, %timeline_id)) .await?; // FIXME: needs to be an error for console to retry it. Ideally Accepted should be used and retried until 404. @@ -519,7 +519,7 @@ async fn tenant_detach_handler( let state = get_state(&request); let conf = state.conf; mgr::detach_tenant(conf, tenant_id, detach_ignored.unwrap_or(false)) - .instrument(info_span!("tenant_detach", tenant = %tenant_id)) + .instrument(info_span!("tenant_detach", %tenant_id)) .await?; json_response(StatusCode::OK, ()) @@ -542,7 +542,7 @@ async fn tenant_load_handler( state.remote_storage.clone(), &ctx, ) - .instrument(info_span!("load", tenant = %tenant_id)) + .instrument(info_span!("load", %tenant_id)) .await?; json_response(StatusCode::ACCEPTED, ()) @@ -558,7 +558,7 @@ async fn tenant_ignore_handler( let state = get_state(&request); let conf = state.conf; mgr::ignore_tenant(conf, tenant_id) - .instrument(info_span!("ignore_tenant", tenant = %tenant_id)) + .instrument(info_span!("ignore_tenant", %tenant_id)) .await?; json_response(StatusCode::OK, ()) @@ -611,7 +611,7 @@ async fn tenant_status( attachment_status: state.attachment_status(), }) } - .instrument(info_span!("tenant_status_handler", tenant = %tenant_id)) + .instrument(info_span!("tenant_status_handler", %tenant_id)) .await?; json_response(StatusCode::OK, tenant_info) @@ -850,7 +850,7 @@ async fn tenant_create_handler( state.remote_storage.clone(), &ctx, ) - .instrument(info_span!("tenant_create", tenant = ?target_tenant_id)) + .instrument(info_span!("tenant_create", tenant_id = %target_tenant_id)) .await?; // We created the tenant. Existing API semantics are that the tenant @@ -912,7 +912,7 @@ async fn update_tenant_config_handler( let state = get_state(&request); mgr::set_new_tenant_config(state.conf, tenant_conf, tenant_id) - .instrument(info_span!("tenant_config", tenant = ?tenant_id)) + .instrument(info_span!("tenant_config", %tenant_id)) .await?; json_response(StatusCode::OK, ()) diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index 5e207408cc..83096faa9c 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -560,7 +560,7 @@ impl Tenant { .map(move |res| { res.with_context(|| format!("download index part for timeline {timeline_id}")) }) - .instrument(info_span!("download_index_part", timeline=%timeline_id)), + .instrument(info_span!("download_index_part", %timeline_id)), ); } // Wait for all the download tasks to complete & collect results. @@ -1349,7 +1349,7 @@ impl Tenant { for (timeline_id, timeline) in &timelines_to_compact { timeline .compact(ctx) - .instrument(info_span!("compact_timeline", timeline = %timeline_id)) + .instrument(info_span!("compact_timeline", %timeline_id)) .await?; } diff --git a/pageserver/src/tenant/mgr.rs b/pageserver/src/tenant/mgr.rs index 8e31cc2ef1..2cc881ed5e 100644 --- a/pageserver/src/tenant/mgr.rs +++ b/pageserver/src/tenant/mgr.rs @@ -690,7 +690,7 @@ pub async fn immediate_gc( fail::fail_point!("immediate_gc_task_pre"); let result = tenant .gc_iteration(Some(timeline_id), gc_horizon, pitr, &ctx) - .instrument(info_span!("manual_gc", tenant = %tenant_id, timeline = %timeline_id)) + .instrument(info_span!("manual_gc", %tenant_id, %timeline_id)) .await; // FIXME: `gc_iteration` can return an error for multiple reasons; we should handle it // better once the types support it. @@ -740,9 +740,7 @@ pub async fn immediate_compact( async move { let result = timeline .compact(&ctx) - .instrument( - info_span!("manual_compact", tenant = %tenant_id, timeline = %timeline_id), - ) + .instrument(info_span!("manual_compact", %tenant_id, %timeline_id)) .await; match task_done.send(result) { diff --git a/pageserver/src/tenant/remote_timeline_client.rs b/pageserver/src/tenant/remote_timeline_client.rs index bc185b4f7a..d5468b43d0 100644 --- a/pageserver/src/tenant/remote_timeline_client.rs +++ b/pageserver/src/tenant/remote_timeline_client.rs @@ -933,11 +933,11 @@ impl RemoteTimelineClient { // Assign unique ID to this task upload_queue.task_counter += 1; - let task_id = upload_queue.task_counter; + let upload_task_id = upload_queue.task_counter; // Add it to the in-progress map let task = Arc::new(UploadTask { - task_id, + task_id: upload_task_id, op: next_op, retries: AtomicU32::new(0), }); @@ -947,6 +947,8 @@ impl RemoteTimelineClient { // Spawn task to perform the task let self_rc = Arc::clone(self); + let tenant_id = self.tenant_id; + let timeline_id = self.timeline_id; task_mgr::spawn( self.runtime.handle(), TaskKind::RemoteUploadTask, @@ -958,7 +960,7 @@ impl RemoteTimelineClient { self_rc.perform_upload_task(task).await; Ok(()) } - .instrument(info_span!(parent: None, "remote_upload", tenant = %self.tenant_id, timeline = %self.timeline_id, upload_task_id = %task_id)), + .instrument(info_span!(parent: None, "remote_upload", %tenant_id, %timeline_id, %upload_task_id)), ); // Loop back to process next task diff --git a/pageserver/src/tenant/span.rs b/pageserver/src/tenant/span.rs index 3728dd9dd8..a65ad6af47 100644 --- a/pageserver/src/tenant/span.rs +++ b/pageserver/src/tenant/span.rs @@ -5,8 +5,8 @@ use utils::tracing_span_assert::{check_fields_present, MultiNameExtractor}; pub(crate) fn debug_assert_current_span_has_tenant_id() {} #[cfg(debug_assertions)] -pub(crate) static TENANT_ID_EXTRACTOR: once_cell::sync::Lazy> = - once_cell::sync::Lazy::new(|| MultiNameExtractor::new("TenantId", ["tenant_id", "tenant"])); +pub(crate) static TENANT_ID_EXTRACTOR: once_cell::sync::Lazy> = + once_cell::sync::Lazy::new(|| MultiNameExtractor::new("TenantId", ["tenant_id"])); #[cfg(debug_assertions)] #[track_caller] diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index d790f0da1c..58a2adbb58 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -1051,7 +1051,7 @@ impl Timeline { } } - #[instrument(skip_all, fields(tenant = %self.tenant_id, timeline = %self.timeline_id))] + #[instrument(skip_all, fields(tenant_id = %self.tenant_id, timeline_id = %self.timeline_id))] pub async fn download_layer(&self, layer_file_name: &str) -> anyhow::Result> { let Some(layer) = self.find_layer(layer_file_name).await else { return Ok(None) }; let Some(remote_layer) = layer.downcast_remote_layer() else { return Ok(Some(false)) }; @@ -1539,7 +1539,7 @@ impl Timeline { *flush_loop_state = FlushLoopState::Exited; Ok(()) } - .instrument(info_span!(parent: None, "layer flush task", tenant = %self.tenant_id, timeline = %self.timeline_id)) + .instrument(info_span!(parent: None, "layer flush task", tenant_id = %self.tenant_id, timeline_id = %self.timeline_id)) ); } @@ -4104,7 +4104,7 @@ impl Timeline { new_gc_cutoff, ) .instrument( - info_span!("gc_timeline", timeline = %self.timeline_id, cutoff = %new_gc_cutoff), + info_span!("gc_timeline", timeline_id = %self.timeline_id, cutoff = %new_gc_cutoff), ) .await?; @@ -4590,7 +4590,7 @@ impl Timeline { }; Ok(()) } - .instrument(info_span!(parent: None, "download_all_remote_layers", tenant = %self.tenant_id, timeline = %self.timeline_id)) + .instrument(info_span!(parent: None, "download_all_remote_layers", tenant_id = %self.tenant_id, timeline_id = %self.timeline_id)) ); let initial_info = DownloadRemoteLayersTaskInfo { diff --git a/pageserver/src/tenant/timeline/span.rs b/pageserver/src/tenant/timeline/span.rs index 9ef0d5f92a..19a7fdb011 100644 --- a/pageserver/src/tenant/timeline/span.rs +++ b/pageserver/src/tenant/timeline/span.rs @@ -7,10 +7,8 @@ pub(crate) fn debug_assert_current_span_has_tenant_and_timeline_id() {} #[cfg(debug_assertions)] #[track_caller] pub(crate) fn debug_assert_current_span_has_tenant_and_timeline_id() { - static TIMELINE_ID_EXTRACTOR: once_cell::sync::Lazy> = - once_cell::sync::Lazy::new(|| { - MultiNameExtractor::new("TimelineId", ["timeline_id", "timeline"]) - }); + static TIMELINE_ID_EXTRACTOR: once_cell::sync::Lazy> = + once_cell::sync::Lazy::new(|| MultiNameExtractor::new("TimelineId", ["timeline_id"])); let fields: [&dyn Extractor; 2] = [ &*crate::tenant::span::TENANT_ID_EXTRACTOR, diff --git a/pageserver/src/tenant/timeline/uninit.rs b/pageserver/src/tenant/timeline/uninit.rs index 27d43a8b24..b8cc65f4b1 100644 --- a/pageserver/src/tenant/timeline/uninit.rs +++ b/pageserver/src/tenant/timeline/uninit.rs @@ -132,7 +132,7 @@ impl<'t> UninitializedTimeline<'t> { impl Drop for UninitializedTimeline<'_> { fn drop(&mut self) { if let Some((_, uninit_mark)) = self.raw_timeline.take() { - let _entered = info_span!("drop_uninitialized_timeline", tenant = %self.owning_tenant.tenant_id, timeline = %self.timeline_id).entered(); + let _entered = info_span!("drop_uninitialized_timeline", tenant_id = %self.owning_tenant.tenant_id, timeline_id = %self.timeline_id).entered(); error!("Timeline got dropped without initializing, cleaning its files"); cleanup_timeline_directory(uninit_mark); } From ed845b644b6dc2574b50ad223d72638f362d0a9f Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Wed, 12 Jul 2023 15:12:37 +0100 Subject: [PATCH 13/58] Prevent unintentional Postgres submodule update (#4692) ## Problem Postgres submodule can be changed unintentionally, and these changes are easy to miss during the review. Adding a check that should prevent this from happening, the check fails `build-neon` job with the following message: ``` Expected postgres-v14 rev to be at '1414141414141414141414141414141414141414', but it is at '1144aee1661c79eec65e784a8dad8bd450d9df79' Expected postgres-v15 rev to be at '1515151515151515151515151515151515151515', but it is at '1984832c740a7fa0e468bb720f40c525b652835d' Please update vendors/revisions.json if these changes are intentional. ``` This is an alternative approach to https://github.com/neondatabase/neon/pull/4603 ## Summary of changes - Add `vendor/revisions.json` file with expected revisions - Add built-time check (to `build-neon` job) that Postgres submodules match revisions from `vendor/revisions.json` - A couple of small improvements for logs from https://github.com/neondatabase/neon/pull/4603 - Fixed GitHub autocomment for no tests was run case --------- Co-authored-by: Joonas Koivunen --- .../actions/allure-report-generate/action.yml | 2 +- .github/workflows/build_and_test.yml | 21 +++++++++++ .../walreceiver/connection_manager.rs | 2 +- scripts/comment-test-report.js | 36 +++++++++---------- test_runner/regress/test_compatibility.py | 14 ++++---- vendor/revisions.json | 4 +++ 6 files changed, 51 insertions(+), 28 deletions(-) create mode 100644 vendor/revisions.json diff --git a/.github/actions/allure-report-generate/action.yml b/.github/actions/allure-report-generate/action.yml index 54b69d6d48..a027de9464 100644 --- a/.github/actions/allure-report-generate/action.yml +++ b/.github/actions/allure-report-generate/action.yml @@ -105,7 +105,7 @@ runs: # Get previously uploaded data for this run ZSTD_NBTHREADS=0 - S3_FILEPATHS=$(aws s3api list-objects-v2 --bucket ${BUCKET} --prefix ${RAW_PREFIX}/ | jq --raw-output '.Contents[].Key') + S3_FILEPATHS=$(aws s3api list-objects-v2 --bucket ${BUCKET} --prefix ${RAW_PREFIX}/ | jq --raw-output '.Contents[]?.Key') if [ -z "$S3_FILEPATHS" ]; then # There's no previously uploaded data for this $GITHUB_RUN_ID exit 0 diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index d026aa67d0..873f8570fc 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -174,6 +174,27 @@ jobs: submodules: true fetch-depth: 1 + - name: Check Postgres submodules revision + shell: bash -euo pipefail {0} + run: | + # This is a temporary solution to ensure that the Postgres submodules revision is correct (i.e. the updated intentionally). + # Eventually it will be replaced by a regression test https://github.com/neondatabase/neon/pull/4603 + + FAILED=false + for postgres in postgres-v14 postgres-v15; do + expected=$(cat vendor/revisions.json | jq --raw-output '."'"${postgres}"'"') + actual=$(git rev-parse "HEAD:vendor/${postgres}") + if [ "${expected}" != "${actual}" ]; then + echo >&2 "Expected ${postgres} rev to be at '${expected}', but it is at '${actual}'" + FAILED=true + fi + done + + if [ "${FAILED}" = "true" ]; then + echo >&2 "Please update vendors/revisions.json if these changes are intentional" + exit 1 + fi + - name: Set pg 14 revision for caching id: pg_v14_rev run: echo pg_rev=$(git rev-parse HEAD:vendor/postgres-v14) >> $GITHUB_OUTPUT diff --git a/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs b/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs index fa23ae765d..5c03c6106f 100644 --- a/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs +++ b/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs @@ -266,7 +266,7 @@ pub struct ConnectionManagerStatus { impl ConnectionManagerStatus { /// Generates a string, describing current connection status in a form, suitable for logging. pub fn to_human_readable_string(&self) -> String { - let mut resulting_string = "WalReceiver status".to_string(); + let mut resulting_string = String::new(); match &self.existing_connection { Some(connection) => { if connection.has_processed_wal { diff --git a/scripts/comment-test-report.js b/scripts/comment-test-report.js index dd60d42a37..b68df65c41 100755 --- a/scripts/comment-test-report.js +++ b/scripts/comment-test-report.js @@ -205,29 +205,25 @@ module.exports = async ({ github, context, fetch, report }) => { const {reportUrl, reportJsonUrl} = report - if (!reportUrl || !reportJsonUrl) { + if (reportUrl && reportJsonUrl) { + try { + const parsed = await parseReportJson({ reportJsonUrl, fetch }) + commentBody += await reportSummary({ ...parsed, reportUrl }) + } catch (error) { + commentBody += `### [full report](${reportUrl})\n___\n` + commentBody += `#### Failed to create a summary for the test run: \n` + commentBody += "```\n" + commentBody += `${error.stack}\n` + commentBody += "```\n" + commentBody += "\nTo reproduce and debug the error locally run:\n" + commentBody += "```\n" + commentBody += `scripts/comment-test-report.js ${reportJsonUrl}` + commentBody += "\n```\n" + } + } else { commentBody += `#### No tests were run or test report is not available\n` - commentBody += autoupdateNotice - return } - try { - const parsed = await parseReportJson({ reportJsonUrl, fetch }) - commentBody += await reportSummary({ ...parsed, reportUrl }) - } catch (error) { - commentBody += `### [full report](${reportUrl})\n___\n` - commentBody += `#### Failed to create a summary for the test run: \n` - commentBody += "```\n" - commentBody += `${error.stack}\n` - commentBody += "```\n" - commentBody += "\nTo reproduce and debug the error locally run:\n" - commentBody += "```\n" - commentBody += `scripts/comment-test-report.js ${reportJsonUrl}` - commentBody += "\n```\n" - } - - commentBody += autoupdateNotice - let createCommentFn, listCommentsFn, updateCommentFn, issueNumberOrSha if (isPullRequest) { createCommentFn = github.rest.issues.createComment diff --git a/test_runner/regress/test_compatibility.py b/test_runner/regress/test_compatibility.py index 00e916394b..a3d02c3f5a 100644 --- a/test_runner/regress/test_compatibility.py +++ b/test_runner/regress/test_compatibility.py @@ -73,9 +73,9 @@ def test_create_snapshot( ".*init_tenant_mgr: marking .* as locally complete, while it doesnt exist in remote index.*" ) - pg_bin.run(["pgbench", "--initialize", "--scale=10", endpoint.connstr()]) - pg_bin.run(["pgbench", "--time=60", "--progress=2", endpoint.connstr()]) - pg_bin.run( + pg_bin.run_capture(["pgbench", "--initialize", "--scale=10", endpoint.connstr()]) + pg_bin.run_capture(["pgbench", "--time=60", "--progress=2", endpoint.connstr()]) + pg_bin.run_capture( ["pg_dumpall", f"--dbname={endpoint.connstr()}", f"--file={test_output_dir / 'dump.sql'}"] ) @@ -405,7 +405,9 @@ def check_neon_works( request.addfinalizer(lambda: cli_current.endpoint_stop("main")) connstr = f"host=127.0.0.1 port={pg_port} user=cloud_admin dbname=postgres" - pg_bin.run(["pg_dumpall", f"--dbname={connstr}", f"--file={test_output_dir / 'dump.sql'}"]) + pg_bin.run_capture( + ["pg_dumpall", f"--dbname={connstr}", f"--file={test_output_dir / 'dump.sql'}"] + ) initial_dump_differs = dump_differs( repo_dir.parent / "dump.sql", test_output_dir / "dump.sql", @@ -425,7 +427,7 @@ def check_neon_works( shutil.rmtree(repo_dir / "local_fs_remote_storage") timeline_delete_wait_completed(pageserver_http, tenant_id, timeline_id) pageserver_http.timeline_create(pg_version, tenant_id, timeline_id) - pg_bin.run( + pg_bin.run_capture( ["pg_dumpall", f"--dbname={connstr}", f"--file={test_output_dir / 'dump-from-wal.sql'}"] ) # The assert itself deferred to the end of the test @@ -437,7 +439,7 @@ def check_neon_works( ) # Check that we can interract with the data - pg_bin.run(["pgbench", "--time=10", "--progress=2", connstr]) + pg_bin.run_capture(["pgbench", "--time=10", "--progress=2", connstr]) assert not dump_from_wal_differs, "dump from WAL differs" assert not initial_dump_differs, "initial dump differs" diff --git a/vendor/revisions.json b/vendor/revisions.json new file mode 100644 index 0000000000..c3adc2a575 --- /dev/null +++ b/vendor/revisions.json @@ -0,0 +1,4 @@ +{ + "postgres-v15": "1984832c740a7fa0e468bb720f40c525b652835d", + "postgres-v14": "1144aee1661c79eec65e784a8dad8bd450d9df79" +} From 664d32eb7fdc510f2c12c50ec3608b98a43185ad Mon Sep 17 00:00:00 2001 From: arpad-m Date: Wed, 12 Jul 2023 18:10:49 +0200 Subject: [PATCH 14/58] Don't propagate but log file not found error in layer uploading (#4694) This addresses the issue in #4526 by adding a test that reproduces the race condition that gave rise to the bug (or at least *a* race condition that gave rise to the same error message), and then implementing a fix that just prints a message to the log if a file could not been found for uploading. Even though the underlying race condition is not fixed yet, this will un-block the upload queue in that situation, greatly reducing the impact of such a (rare) race. Fixes #4526. --- pageserver/src/tenant.rs | 34 ++++--- .../src/tenant/remote_timeline_client.rs | 16 +--- .../tenant/remote_timeline_client/upload.rs | 23 ++++- pageserver/src/tenant/timeline.rs | 2 +- test_runner/regress/test_remote_storage.py | 89 +++++++++++++++++++ 5 files changed, 131 insertions(+), 33 deletions(-) diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index 83096faa9c..4c504527a0 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -84,6 +84,25 @@ use utils::{ lsn::{Lsn, RecordLsn}, }; +/// Declare a failpoint that can use the `pause` failpoint action. +/// We don't want to block the executor thread, hence, spawn_blocking + await. +macro_rules! pausable_failpoint { + ($name:literal) => { + if cfg!(feature = "testing") { + tokio::task::spawn_blocking({ + let current = tracing::Span::current(); + move || { + let _entered = current.entered(); + tracing::info!("at failpoint {}", $name); + fail::fail_point!($name); + } + }) + .await + .expect("spawn_blocking"); + } + }; +} + pub mod blob_io; pub mod block_io; pub mod disk_btree; @@ -1498,20 +1517,7 @@ impl Tenant { remote_client.delete_all().await.context("delete_all")? }; - // Have a failpoint that can use the `pause` failpoint action. - // We don't want to block the executor thread, hence, spawn_blocking + await. - if cfg!(feature = "testing") { - tokio::task::spawn_blocking({ - let current = tracing::Span::current(); - move || { - let _entered = current.entered(); - tracing::info!("at failpoint in_progress_delete"); - fail::fail_point!("in_progress_delete"); - } - }) - .await - .expect("spawn_blocking"); - } + pausable_failpoint!("in_progress_delete"); { // Remove the timeline from the map. diff --git a/pageserver/src/tenant/remote_timeline_client.rs b/pageserver/src/tenant/remote_timeline_client.rs index d5468b43d0..8c04794e92 100644 --- a/pageserver/src/tenant/remote_timeline_client.rs +++ b/pageserver/src/tenant/remote_timeline_client.rs @@ -748,20 +748,8 @@ impl RemoteTimelineClient { stopped.deleted_at = SetDeletedFlagProgress::NotRunning; }); - // Have a failpoint that can use the `pause` failpoint action. - // We don't want to block the executor thread, hence, spawn_blocking + await. - if cfg!(feature = "testing") { - tokio::task::spawn_blocking({ - let current = tracing::Span::current(); - move || { - let _entered = current.entered(); - tracing::info!("at failpoint persist_deleted_index_part"); - fail::fail_point!("persist_deleted_index_part"); - } - }) - .await - .expect("spawn_blocking"); - } + pausable_failpoint!("persist_deleted_index_part"); + upload::upload_index_part( self.conf, &self.storage_impl, diff --git a/pageserver/src/tenant/remote_timeline_client/upload.rs b/pageserver/src/tenant/remote_timeline_client/upload.rs index 098c661622..0178ef520c 100644 --- a/pageserver/src/tenant/remote_timeline_client/upload.rs +++ b/pageserver/src/tenant/remote_timeline_client/upload.rs @@ -2,7 +2,7 @@ use anyhow::{bail, Context}; use fail::fail_point; -use std::path::Path; +use std::{io::ErrorKind, path::Path}; use tokio::fs; use crate::{config::PageServerConf, tenant::remote_timeline_client::index::IndexPart}; @@ -11,6 +11,8 @@ use utils::id::{TenantId, TimelineId}; use super::index::LayerFileMetadata; +use tracing::info; + /// Serializes and uploads the given index part data to the remote storage. pub(super) async fn upload_index_part<'a>( conf: &'static PageServerConf, @@ -56,9 +58,22 @@ pub(super) async fn upload_timeline_layer<'a>( }); let storage_path = conf.remote_path(source_path)?; - let source_file = fs::File::open(&source_path) - .await - .with_context(|| format!("Failed to open a source file for layer {source_path:?}"))?; + let source_file_res = fs::File::open(&source_path).await; + let source_file = match source_file_res { + Ok(source_file) => source_file, + Err(e) if e.kind() == ErrorKind::NotFound => { + // In some situations we might run into the underlying file being deleted by + // e.g. compaction before the uploader gets to it. In that instance, we don't + // want to retry the error: a deleted file won't come back. In theory, the + // file might not have been written in the first place, which also indicates + // a bug. Still log the situation so that we can keep an eye on it. + // See https://github.com/neondatabase/neon/issues/4526 + info!(path = %source_path.display(), "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more."); + return Ok(()); + } + Err(e) => Err(e) + .with_context(|| format!("Failed to open a source file for layer {source_path:?}"))?, + }; let fs_size = source_file .metadata() diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index 58a2adbb58..d589f10570 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -2918,7 +2918,7 @@ impl Timeline { HashMap::from([(delta_path, metadata)]) }; - fail_point!("flush-frozen-before-sync"); + pausable_failpoint!("flush-frozen-before-sync"); // The new on-disk layers are now in the layer map. We can remove the // in-memory layer from the map now. We do not modify `LayerFileManager` because diff --git a/test_runner/regress/test_remote_storage.py b/test_runner/regress/test_remote_storage.py index 9a70266314..1b6e39ff31 100644 --- a/test_runner/regress/test_remote_storage.py +++ b/test_runner/regress/test_remote_storage.py @@ -777,6 +777,95 @@ def test_empty_branch_remote_storage_upload_on_restart( create_thread.join() +# Regression test for a race condition where files are compactified before the upload, +# resulting in the uploading complaining about the file not being found +# https://github.com/neondatabase/neon/issues/4526 +@pytest.mark.parametrize("remote_storage_kind", [RemoteStorageKind.LOCAL_FS]) +def test_compaction_delete_before_upload( + neon_env_builder: NeonEnvBuilder, + remote_storage_kind: RemoteStorageKind, +): + neon_env_builder.enable_remote_storage( + remote_storage_kind=remote_storage_kind, + test_name="test_compaction_delete_before_upload", + ) + + env = neon_env_builder.init_start() + + # create tenant with config that will determinstically allow + # compaction and disables gc + tenant_id, timeline_id = env.neon_cli.create_tenant( + conf={ + # Set a small compaction threshold + "compaction_threshold": "3", + # Disable GC + "gc_period": "0s", + # disable PITR + "pitr_interval": "0s", + } + ) + + client = env.pageserver.http_client() + + with env.endpoints.create_start("main", tenant_id=tenant_id) as endpoint: + # Build two tables with some data inside + endpoint.safe_psql("CREATE TABLE foo AS SELECT x FROM generate_series(1, 10000) g(x)") + wait_for_last_flush_lsn(env, endpoint, tenant_id, timeline_id) + + client.timeline_checkpoint(tenant_id, timeline_id) + + endpoint.safe_psql("CREATE TABLE bar AS SELECT x FROM generate_series(1, 10000) g(x)") + wait_for_last_flush_lsn(env, endpoint, tenant_id, timeline_id) + + # Now make the flushing hang and update one small piece of data + client.configure_failpoints(("flush-frozen-before-sync", "pause")) + + endpoint.safe_psql("UPDATE foo SET x = 0 WHERE x = 1") + + wait_for_last_flush_lsn(env, endpoint, tenant_id, timeline_id) + + q: queue.Queue[Optional[PageserverApiException]] = queue.Queue() + barrier = threading.Barrier(2) + + def checkpoint_in_background(): + barrier.wait() + try: + client.timeline_checkpoint(tenant_id, timeline_id) + q.put(None) + except PageserverApiException as e: + q.put(e) + + create_thread = threading.Thread(target=checkpoint_in_background) + create_thread.start() + + try: + barrier.wait() + + time.sleep(4) + client.timeline_compact(tenant_id, timeline_id) + + client.configure_failpoints(("flush-frozen-before-sync", "off")) + + conflict = q.get() + + assert conflict is None + finally: + create_thread.join() + + # Add a delay for the uploads to run into either the file not found or the + time.sleep(4) + + # Ensure that this actually terminates + wait_upload_queue_empty(client, tenant_id, timeline_id) + + # For now we are hitting this message. + # Maybe in the future the underlying race condition will be fixed, + # but until then, ensure that this message is hit instead. + assert env.pageserver.log_contains( + "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more." + ) + + def wait_upload_queue_empty( client: PageserverHttpClient, tenant_id: TenantId, timeline_id: TimelineId ): From 3a1be9b246439a5259d5c4d3586de113ccb23560 Mon Sep 17 00:00:00 2001 From: Arthur Petukhovsky Date: Wed, 12 Jul 2023 17:48:20 +0100 Subject: [PATCH 15/58] Broadcast before exiting sync safekeepers (#4700) Recently we started doing sync-safekeepers before exiting compute_ctl, expecting that it will make next sync faster by skipping recovery. But recovery is still running in some cases (https://github.com/neondatabase/neon/pull/4574#issuecomment-1629256166) because of the lagging truncateLsn. This PR should help with updating truncateLsn. --- pgxn/neon/walproposer.c | 12 ++++++++++++ 1 file changed, 12 insertions(+) diff --git a/pgxn/neon/walproposer.c b/pgxn/neon/walproposer.c index 8d82de6dc4..765966092d 100644 --- a/pgxn/neon/walproposer.c +++ b/pgxn/neon/walproposer.c @@ -2231,6 +2231,18 @@ HandleSafekeeperResponse(void) if (n_synced >= quorum) { /* All safekeepers synced! */ + + /* + * Send empty message to broadcast latest truncateLsn to all safekeepers. + * This helps to finish next sync-safekeepers eailier, by skipping recovery + * step. + * + * We don't need to wait for response because it doesn't affect correctness, + * and TCP should be able to deliver the message to safekeepers in case of + * network working properly. + */ + BroadcastAppendRequest(); + fprintf(stdout, "%X/%X\n", LSN_FORMAT_ARGS(propEpochStartLsn)); exit(0); } From 444d6e337f19bf2d4b5f3cd5a254f4debbd0f89b Mon Sep 17 00:00:00 2001 From: Stas Kelvich Date: Wed, 12 Jul 2023 20:58:55 +0300 Subject: [PATCH 16/58] add rfcs/022-user-mgmt.md (#3838) Co-authored-by: Vadim Kharitonov --- docs/rfcs/024-user-mgmt.md | 84 ++++++++++++++++++++++++++++++++++++++ 1 file changed, 84 insertions(+) create mode 100644 docs/rfcs/024-user-mgmt.md diff --git a/docs/rfcs/024-user-mgmt.md b/docs/rfcs/024-user-mgmt.md new file mode 100644 index 0000000000..7203357328 --- /dev/null +++ b/docs/rfcs/024-user-mgmt.md @@ -0,0 +1,84 @@ +# Postgres user and database management + +(This supersedes the previous proposal that looked too complicated and desynchronization-prone) + +We've accumulated a bunch of problems with our approach to role and database management, namely: + +1. we don't allow role and database creation from Postgres, and users are complaining about that +2. fine-grained role management is not possible both from Postgres and console + +Right now, we do store users and databases both in console and Postgres, and there are two main reasons for +that: + +* we want to be able to authenticate users in proxy against the console without Postgres' involvement. Otherwise, +malicious brute force attempts will wake up Postgres (expensive) and may exhaust the Postgres connections limit (deny of service). +* it is handy when we can render console UI without waking up compute (e.g., show database list) + +This RFC doesn't talk about giving root access to the database, which is blocked by a secure runtime setup. + +## Overview + +* Add Postgres extension that sends an HTTP request each time transaction that modifies users/databases is about to commit. +* Add user management API to internal console API. Also, the console should put a JWT token into the compute so that it can access management API. + +## Postgres behavior + +The default user role (@username) should have `CREATE ROLE`, `CREATE DB`, and `BYPASSRLS` privileges. We expose the Postgres port +to the open internet, so we need to check password strength. Now console generates strong passwords, so there is no risk of having dumb passwords. With user-provided passwords, such risks exist. + +Since we store passwords in the console we should also send unencrypted password when role is created/changed. Hence communication with the console must be encrypted. Postgres also supports creating roles using hashes, in that case, we will not be able to get a raw password. So I can see the following options here: + * roles created via SQL will *not* have raw passwords in the console + * roles created via SQL will have raw passwords in the console, except ones that were created using hashes + +I'm leaning towards the second option here as it is a bit more consistent one -- if raw password storage is enabled then we store passwords in all cases where we can store them. + +To send data about roles and databases from Postgres to the console we can create the following Postgres extension: + + * Intercept role/database changes in `ProcessUtility_hook`. Here we have access to the query statement with the raw password. The hook handler itself should not dial the console immediately and rather stash info in some hashmap for later use. + * When the transaction is about to commit we execute collected role modifications (all as one -- console should either accept all or reject all, and hence API shouldn't be REST-like). If the console request fails we can roll back the transaction. This way if the transaction is committed we know for sure that console has this information. We can use `XACT_EVENT_PRE_COMMIT` and `XACT_EVENT_PARALLEL_PRE_COMMIT` for that. + * Extension should be mindful of the fact that it is possible to create and delete roles within the transaction. + * We also need to track who is database owner, some coding around may be needed to get the current user when the database is created. + +## Console user management API + +The current public API has REST API for role management. We need to have some analog for the internal API (called mgmt API in the console code). But unlike public API here we want to have an atomic way to create several roles/databases (in cases when several roles were created in the same transaction). So something like that may work: + +``` +curl -X PATCH /api/v1/roles_and_databases -d ' +[ + {"op":"create", "type":"role", "name": "kurt", "password":"lYgT3BlbkFJ2vBZrqv"}, + {"op":"drop", "type":"role", "name": "trout"}, + {"op":"alter", "type":"role", "name": "kilgore", "password":"3BlbkFJ2vB"}, + {"op":"create", "type":"database", "name": "db2", "owner": "eliot"}, +] +' +``` + +Makes sense not to error out on duplicated create/delete operations (see failure modes) + +## Managing users from the console + +Now console puts a spec file with the list of databases/roles and delta operations in all the compute pods. `compute_ctl` then picks up that file and stubbornly executes deltas and checks data in the spec file is the same as in the Postgres. This way if the user creates a role in the UI we restart compute with a new spec file and during the start databases/roles are created. So if Postgres send an HTTP call each time role is created we need to break recursion in that case. We can do that based on application_name or some GUC or user (local == no HTTP hook). + +Generally, we have several options when we are creating users via console: + +1. restart compute with a new spec file, execute local SQL command; cut recursion in the extension +2. "push" spec files into running compute, execute local SQL command; cut recursion in the extension +3. "push" spec files into running compute, execute local SQL command; let extension create those roles in the console +4. avoid managing roles via spec files, send SQL commands to compute; let extension create those roles in the console + +The last option is the most straightforward one, but with the raw password storage opt-out, we will not have the password to establish an SQL connection. Also, we need a spec for provisioning purposes and to address potential desync (but that is quite unlikely). So I think the easiest approach would be: + +1. keep role management like it is now and cut the recursion in the extension when SQL is executed by compute_ctl +2. add "push" endpoint to the compute_ctl to avoid compute restart during the `apply_config` operation -- that can be done as a follow up to avoid increasing scope too much + +## Failure modes + +* during role creation via SQL role was created in the console but the connection was dropped before Postgres got acknowledgment or some error happened after acknowledgment (out of disk space, deadlock, etc): + + in that case, Postgres won't have a role that exists in the console. Compute restart will heal it (due to the spec file). Also if the console allows repeated creation/deletion user can repeat the transaction. + + +# Scalability + +On my laptop, I can create 4200 roles per second. That corresponds to 363 million roles per day. Since each role creation ends up in the console database we can add some limit to the number of roles (could be reasonably big to not run into it often -- like 1k or 10k). From 0626e0bfd3f01a9647c8e9babfbc7fbed5fe7c42 Mon Sep 17 00:00:00 2001 From: Conrad Ludgate Date: Thu, 13 Jul 2023 11:03:37 +0100 Subject: [PATCH 17/58] proxy: refactor some error handling and shutdowns (#4684) ## Problem It took me a while to understand the purpose of all the tasks spawned in the main functions. ## Summary of changes Utilising the type system and less macros, plus much more comments, document the shutdown procedure of each task in detail --- proxy/src/bin/pg_sni_router.rs | 22 ++++++++----- proxy/src/bin/proxy.rs | 57 ++++++++++++++++++++++------------ proxy/src/console/mgmt.rs | 4 +-- proxy/src/http/server.rs | 8 ++--- proxy/src/lib.rs | 11 +++---- proxy/src/metrics.rs | 4 +-- proxy/src/proxy.rs | 26 +++++++++------- 7 files changed, 80 insertions(+), 52 deletions(-) diff --git a/proxy/src/bin/pg_sni_router.rs b/proxy/src/bin/pg_sni_router.rs index a5f50cc7c1..849af47cfc 100644 --- a/proxy/src/bin/pg_sni_router.rs +++ b/proxy/src/bin/pg_sni_router.rs @@ -5,6 +5,7 @@ /// the outside. Similar to an ingress controller for HTTPS. use std::{net::SocketAddr, sync::Arc}; +use futures::future::Either; use tokio::net::TcpListener; use anyhow::{anyhow, bail, ensure, Context}; @@ -109,20 +110,25 @@ async fn main() -> anyhow::Result<()> { let cancellation_token = CancellationToken::new(); - let main = proxy::flatten_err(tokio::spawn(task_main( + let main = tokio::spawn(task_main( Arc::new(destination), tls_config, proxy_listener, cancellation_token.clone(), - ))); - let signals_task = proxy::flatten_err(tokio::spawn(proxy::handle_signals(cancellation_token))); + )); + let signals_task = tokio::spawn(proxy::handle_signals(cancellation_token)); - tokio::select! { - res = main => { res?; }, - res = signals_task => { res?; }, - } + // the signal task cant ever succeed. + // the main task can error, or can succeed on cancellation. + // we want to immediately exit on either of these cases + let signal = match futures::future::select(signals_task, main).await { + Either::Left((res, _)) => proxy::flatten_err(res)?, + Either::Right((res, _)) => return proxy::flatten_err(res), + }; - Ok(()) + // maintenance tasks return `Infallible` success values, this is an impossible value + // so this match statically ensures that there are no possibilities for that value + match signal {} } async fn task_main( diff --git a/proxy/src/bin/proxy.rs b/proxy/src/bin/proxy.rs index 28e6e25317..fc8bc39742 100644 --- a/proxy/src/bin/proxy.rs +++ b/proxy/src/bin/proxy.rs @@ -1,3 +1,4 @@ +use futures::future::Either; use proxy::auth; use proxy::console; use proxy::http; @@ -6,8 +7,10 @@ use proxy::metrics; use anyhow::bail; use clap::{self, Arg}; use proxy::config::{self, ProxyConfig}; +use std::pin::pin; use std::{borrow::Cow, net::SocketAddr}; use tokio::net::TcpListener; +use tokio::task::JoinSet; use tokio_util::sync::CancellationToken; use tracing::info; use tracing::warn; @@ -43,43 +46,59 @@ async fn main() -> anyhow::Result<()> { let proxy_listener = TcpListener::bind(proxy_address).await?; let cancellation_token = CancellationToken::new(); - let mut client_tasks = vec![tokio::spawn(proxy::proxy::task_main( + // client facing tasks. these will exit on error or on cancellation + // cancellation returns Ok(()) + let mut client_tasks = JoinSet::new(); + client_tasks.spawn(proxy::proxy::task_main( config, proxy_listener, cancellation_token.clone(), - ))]; + )); if let Some(wss_address) = args.get_one::("wss") { let wss_address: SocketAddr = wss_address.parse()?; info!("Starting wss on {wss_address}"); let wss_listener = TcpListener::bind(wss_address).await?; - client_tasks.push(tokio::spawn(http::websocket::task_main( + client_tasks.spawn(http::websocket::task_main( config, wss_listener, cancellation_token.clone(), - ))); + )); } - let mut tasks = vec![ - tokio::spawn(proxy::handle_signals(cancellation_token)), - tokio::spawn(http::server::task_main(http_listener)), - tokio::spawn(console::mgmt::task_main(mgmt_listener)), - ]; + // maintenance tasks. these never return unless there's an error + let mut maintenance_tasks = JoinSet::new(); + maintenance_tasks.spawn(proxy::handle_signals(cancellation_token)); + maintenance_tasks.spawn(http::server::task_main(http_listener)); + maintenance_tasks.spawn(console::mgmt::task_main(mgmt_listener)); if let Some(metrics_config) = &config.metric_collection { - tasks.push(tokio::spawn(metrics::task_main(metrics_config))); + maintenance_tasks.spawn(metrics::task_main(metrics_config)); } - let tasks = futures::future::try_join_all(tasks.into_iter().map(proxy::flatten_err)); - let client_tasks = - futures::future::try_join_all(client_tasks.into_iter().map(proxy::flatten_err)); - tokio::select! { - // We are only expecting an error from these forever tasks - res = tasks => { res?; }, - res = client_tasks => { res?; }, - } - Ok(()) + let maintenance = loop { + // get one complete task + match futures::future::select( + pin!(maintenance_tasks.join_next()), + pin!(client_tasks.join_next()), + ) + .await + { + // exit immediately on maintenance task completion + Either::Left((Some(res), _)) => break proxy::flatten_err(res)?, + // exit with error immediately if all maintenance tasks have ceased (should be caught by branch above) + Either::Left((None, _)) => bail!("no maintenance tasks running. invalid state"), + // exit immediately on client task error + Either::Right((Some(res), _)) => proxy::flatten_err(res)?, + // exit if all our client tasks have shutdown gracefully + Either::Right((None, _)) => return Ok(()), + } + }; + + // maintenance tasks return Infallible success values, this is an impossible value + // so this match statically ensures that there are no possibilities for that value + match maintenance {} } /// ProxyConfig is created at proxy startup, and lives forever. diff --git a/proxy/src/console/mgmt.rs b/proxy/src/console/mgmt.rs index 35d1ff59b7..f0e084b679 100644 --- a/proxy/src/console/mgmt.rs +++ b/proxy/src/console/mgmt.rs @@ -6,7 +6,7 @@ use anyhow::Context; use once_cell::sync::Lazy; use postgres_backend::{self, AuthType, PostgresBackend, PostgresBackendTCP, QueryError}; use pq_proto::{BeMessage, SINGLE_COL_ROWDESC}; -use std::future; +use std::{convert::Infallible, future}; use tokio::net::{TcpListener, TcpStream}; use tracing::{error, info, info_span, Instrument}; @@ -31,7 +31,7 @@ pub fn notify(psql_session_id: &str, msg: ComputeReady) -> Result<(), waiters::N /// Console management API listener task. /// It spawns console response handlers needed for the link auth. -pub async fn task_main(listener: TcpListener) -> anyhow::Result<()> { +pub async fn task_main(listener: TcpListener) -> anyhow::Result { scopeguard::defer! { info!("mgmt has shut down"); } diff --git a/proxy/src/http/server.rs b/proxy/src/http/server.rs index f35f4f9a62..6186ddde0d 100644 --- a/proxy/src/http/server.rs +++ b/proxy/src/http/server.rs @@ -1,6 +1,6 @@ -use anyhow::anyhow; +use anyhow::{anyhow, bail}; use hyper::{Body, Request, Response, StatusCode}; -use std::net::TcpListener; +use std::{convert::Infallible, net::TcpListener}; use tracing::info; use utils::http::{endpoint, error::ApiError, json::json_response, RouterBuilder, RouterService}; @@ -12,7 +12,7 @@ fn make_router() -> RouterBuilder { endpoint::make_router().get("/v1/status", status_handler) } -pub async fn task_main(http_listener: TcpListener) -> anyhow::Result<()> { +pub async fn task_main(http_listener: TcpListener) -> anyhow::Result { scopeguard::defer! { info!("http has shut down"); } @@ -23,5 +23,5 @@ pub async fn task_main(http_listener: TcpListener) -> anyhow::Result<()> { .serve(service().map_err(|e| anyhow!(e))?) .await?; - Ok(()) + bail!("hyper server without shutdown handling cannot shutdown successfully"); } diff --git a/proxy/src/lib.rs b/proxy/src/lib.rs index 148ee67d90..1e1e216bb7 100644 --- a/proxy/src/lib.rs +++ b/proxy/src/lib.rs @@ -1,5 +1,6 @@ +use std::convert::Infallible; + use anyhow::{bail, Context}; -use futures::{Future, FutureExt}; use tokio::task::JoinError; use tokio_util::sync::CancellationToken; use tracing::warn; @@ -23,7 +24,7 @@ pub mod url; pub mod waiters; /// Handle unix signals appropriately. -pub async fn handle_signals(token: CancellationToken) -> anyhow::Result<()> { +pub async fn handle_signals(token: CancellationToken) -> anyhow::Result { use tokio::signal::unix::{signal, SignalKind}; let mut hangup = signal(SignalKind::hangup())?; @@ -50,8 +51,6 @@ pub async fn handle_signals(token: CancellationToken) -> anyhow::Result<()> { } /// Flattens `Result>` into `Result`. -pub async fn flatten_err( - f: impl Future, JoinError>>, -) -> anyhow::Result<()> { - f.map(|r| r.context("join error").and_then(|x| x)).await +pub fn flatten_err(r: Result, JoinError>) -> anyhow::Result { + r.context("join error").and_then(|x| x) } diff --git a/proxy/src/metrics.rs b/proxy/src/metrics.rs index 00fd7f0405..c4be7e1f08 100644 --- a/proxy/src/metrics.rs +++ b/proxy/src/metrics.rs @@ -4,7 +4,7 @@ use crate::{config::MetricCollectionConfig, http}; use chrono::{DateTime, Utc}; use consumption_metrics::{idempotency_key, Event, EventChunk, EventType, CHUNK_SIZE}; use serde::Serialize; -use std::{collections::HashMap, time::Duration}; +use std::{collections::HashMap, convert::Infallible, time::Duration}; use tracing::{error, info, instrument, trace, warn}; const PROXY_IO_BYTES_PER_CLIENT: &str = "proxy_io_bytes_per_client"; @@ -26,7 +26,7 @@ pub struct Ids { pub branch_id: String, } -pub async fn task_main(config: &MetricCollectionConfig) -> anyhow::Result<()> { +pub async fn task_main(config: &MetricCollectionConfig) -> anyhow::Result { info!("metrics collector config: {config:?}"); scopeguard::defer! { info!("metrics collector has shut down"); diff --git a/proxy/src/proxy.rs b/proxy/src/proxy.rs index 12ca9c5187..2204fc62c6 100644 --- a/proxy/src/proxy.rs +++ b/proxy/src/proxy.rs @@ -162,7 +162,10 @@ pub async fn handle_ws_client( .map(|_| auth::ClientCredentials::parse(¶ms, hostname, common_names)) .transpose(); - async { result }.or_else(|e| stream.throw_error(e)).await? + match result { + Ok(creds) => creds, + Err(e) => stream.throw_error(e).await?, + } }; let client = Client::new(stream, creds, ¶ms, session_id, false); @@ -201,7 +204,10 @@ async fn handle_client( .map(|_| auth::ClientCredentials::parse(¶ms, sni, common_names)) .transpose(); - async { result }.or_else(|e| stream.throw_error(e)).await? + match result { + Ok(creds) => creds, + Err(e) => stream.throw_error(e).await?, + } }; let allow_self_signed_compute = config.allow_self_signed_compute; @@ -595,15 +601,13 @@ impl Client<'_, S> { application_name: params.get("application_name"), }; - let auth_result = async { - // `&mut stream` doesn't let us merge those 2 lines. - let res = creds - .authenticate(&extra, &mut stream, allow_cleartext) - .await; - - async { res }.or_else(|e| stream.throw_error(e)).await - } - .await?; + let auth_result = match creds + .authenticate(&extra, &mut stream, allow_cleartext) + .await + { + Ok(auth_result) => auth_result, + Err(e) => return stream.throw_error(e).await, + }; let AuthSuccess { reported_auth_ok, From db4d094afaea07eafdf0cacfa78e549f97c672f3 Mon Sep 17 00:00:00 2001 From: Conrad Ludgate Date: Thu, 13 Jul 2023 11:47:27 +0100 Subject: [PATCH 18/58] proxy: add more error cases to retry connect (#4707) ## Problem In the logs, I noticed we still weren't retrying in some cases. Seemed to be timeouts but we explicitly wanted to handle those ## Summary of changes Retry on io::ErrorKind::TimedOut errors. Handle IO errors in tokio_postgres::Error. --- proxy/src/http/conn_pool.rs | 19 ++++++---------- proxy/src/proxy.rs | 45 +++++++++++++++++++++++++++---------- 2 files changed, 40 insertions(+), 24 deletions(-) diff --git a/proxy/src/http/conn_pool.rs b/proxy/src/http/conn_pool.rs index fb53c663c8..49c94a830f 100644 --- a/proxy/src/http/conn_pool.rs +++ b/proxy/src/http/conn_pool.rs @@ -10,7 +10,10 @@ use crate::{auth, console}; use super::sql_over_http::MAX_RESPONSE_SIZE; -use crate::proxy::{invalidate_cache, retry_after, try_wake, NUM_RETRIES_WAKE_COMPUTE}; +use crate::proxy::{ + can_retry_tokio_postgres_error, invalidate_cache, retry_after, try_wake, + NUM_RETRIES_WAKE_COMPUTE, +}; use tracing::error; use tracing::info; @@ -272,19 +275,11 @@ async fn connect_to_compute( } fn can_retry_error(err: &tokio_postgres::Error, num_retries: u32) -> bool { - use tokio_postgres::error::SqlState; - match err.code() { + match err { // retry all errors at least once _ if num_retries == 0 => true, - // keep retrying connection errors - Some( - &SqlState::CONNECTION_FAILURE - | &SqlState::CONNECTION_EXCEPTION - | &SqlState::CONNECTION_DOES_NOT_EXIST - | &SqlState::SQLCLIENT_UNABLE_TO_ESTABLISH_SQLCONNECTION, - ) if num_retries < NUM_RETRIES_WAKE_COMPUTE => true, - // otherwise, don't retry - _ => false, + _ if num_retries >= NUM_RETRIES_WAKE_COMPUTE => false, + err => can_retry_tokio_postgres_error(err), } } diff --git a/proxy/src/proxy.rs b/proxy/src/proxy.rs index 2204fc62c6..8722109b80 100644 --- a/proxy/src/proxy.rs +++ b/proxy/src/proxy.rs @@ -20,7 +20,7 @@ use hyper::StatusCode; use metrics::{register_int_counter, register_int_counter_vec, IntCounter, IntCounterVec}; use once_cell::sync::Lazy; use pq_proto::{BeMessage as Be, FeStartupPacket, StartupMessageParams}; -use std::{ops::ControlFlow, sync::Arc}; +use std::{error::Error, ops::ControlFlow, sync::Arc}; use tokio::{ io::{AsyncRead, AsyncWrite, AsyncWriteExt}, time, @@ -445,24 +445,45 @@ pub async fn try_wake( } fn can_retry_error(err: &compute::ConnectionError, num_retries: u32) -> bool { - use std::io::ErrorKind; match err { // retry all errors at least once _ if num_retries == 0 => true, - // keep retrying connection errors - compute::ConnectionError::CouldNotConnect(io_err) - if num_retries < NUM_RETRIES_WAKE_COMPUTE => - { - matches!( - io_err.kind(), - ErrorKind::ConnectionRefused | ErrorKind::AddrNotAvailable - ) - } - // otherwise, don't retry + _ if num_retries >= NUM_RETRIES_WAKE_COMPUTE => false, + compute::ConnectionError::Postgres(err) => can_retry_tokio_postgres_error(err), + compute::ConnectionError::CouldNotConnect(err) => is_io_connection_err(err), _ => false, } } +pub fn can_retry_tokio_postgres_error(err: &tokio_postgres::Error) -> bool { + if let Some(io_err) = err.source().and_then(|x| x.downcast_ref()) { + is_io_connection_err(io_err) + } else if let Some(db_err) = err.source().and_then(|x| x.downcast_ref()) { + is_sql_connection_err(db_err) + } else { + false + } +} + +fn is_sql_connection_err(err: &tokio_postgres::error::DbError) -> bool { + use tokio_postgres::error::SqlState; + matches!( + err.code(), + &SqlState::CONNECTION_FAILURE + | &SqlState::CONNECTION_EXCEPTION + | &SqlState::CONNECTION_DOES_NOT_EXIST + | &SqlState::SQLCLIENT_UNABLE_TO_ESTABLISH_SQLCONNECTION, + ) +} + +fn is_io_connection_err(err: &std::io::Error) -> bool { + use std::io::ErrorKind; + matches!( + err.kind(), + ErrorKind::ConnectionRefused | ErrorKind::AddrNotAvailable | ErrorKind::TimedOut + ) +} + pub fn retry_after(num_retries: u32) -> time::Duration { match num_retries { 0 => time::Duration::ZERO, From ed938885ff845ab62e652df47c180d1c08ce8f37 Mon Sep 17 00:00:00 2001 From: Alexey Kondratov Date: Thu, 13 Jul 2023 13:18:35 +0200 Subject: [PATCH 19/58] [compute_ctl] Fix deletion of template databases (#4661) If database was created with `is_template true` Postgres doesn't allow dropping it right away and throws error ``` ERROR: cannot drop a template database ``` so we have to unset `is_template` first. Fixing it, I noticed that our `escape_literal` isn't exactly correct and following the same logic as in `quote_literal_internal`, we need to prepend string with `E`. Otherwise, it's not possible to filter `pg_database` using `escape_literal()` result if name contains `\`, for example. Also use `FORCE` to drop database even if there are active connections. We run this from `cloud_admin`, so it should have enough privileges. NB: there could be other db states, which prevent us from dropping the database. For example, if db is used by any active subscription or logical replication slot. TODO: deal with it once we allow logical replication. Proper fix should involve returning an error code to the control plane, so it could figure out that this is a non-retryable error, return it to the user and mark operation as permanently failed. Related to neondatabase/cloud#4258 --- compute_tools/src/compute.rs | 4 +-- compute_tools/src/config.rs | 16 +++-------- compute_tools/src/pg_helpers.rs | 25 +++++++++++----- compute_tools/src/spec.rs | 38 +++++++++++++++++++++++-- compute_tools/tests/pg_helpers_tests.rs | 8 ++++++ 5 files changed, 68 insertions(+), 23 deletions(-) diff --git a/compute_tools/src/compute.rs b/compute_tools/src/compute.rs index 38f3b53f65..b33f4f05dd 100644 --- a/compute_tools/src/compute.rs +++ b/compute_tools/src/compute.rs @@ -142,14 +142,14 @@ fn create_neon_superuser(spec: &ComputeSpec, client: &mut Client) -> Result<()> .cluster .roles .iter() - .map(|r| format!("'{}'", escape_literal(&r.name))) + .map(|r| escape_literal(&r.name)) .collect::>(); let dbs = spec .cluster .databases .iter() - .map(|db| format!("'{}'", escape_literal(&db.name))) + .map(|db| escape_literal(&db.name)) .collect::>(); let roles_decl = if roles.is_empty() { diff --git a/compute_tools/src/config.rs b/compute_tools/src/config.rs index 99346433d0..68b943eec8 100644 --- a/compute_tools/src/config.rs +++ b/compute_tools/src/config.rs @@ -47,30 +47,22 @@ pub fn write_postgres_conf(path: &Path, spec: &ComputeSpec) -> Result<()> { // Add options for connecting to storage writeln!(file, "# Neon storage settings")?; if let Some(s) = &spec.pageserver_connstring { - writeln!( - file, - "neon.pageserver_connstring='{}'", - escape_conf_value(s) - )?; + writeln!(file, "neon.pageserver_connstring={}", escape_conf_value(s))?; } if !spec.safekeeper_connstrings.is_empty() { writeln!( file, - "neon.safekeepers='{}'", + "neon.safekeepers={}", escape_conf_value(&spec.safekeeper_connstrings.join(",")) )?; } if let Some(s) = &spec.tenant_id { - writeln!( - file, - "neon.tenant_id='{}'", - escape_conf_value(&s.to_string()) - )?; + writeln!(file, "neon.tenant_id={}", escape_conf_value(&s.to_string()))?; } if let Some(s) = &spec.timeline_id { writeln!( file, - "neon.timeline_id='{}'", + "neon.timeline_id={}", escape_conf_value(&s.to_string()) )?; } diff --git a/compute_tools/src/pg_helpers.rs b/compute_tools/src/pg_helpers.rs index 6a78bffd1b..75550978d8 100644 --- a/compute_tools/src/pg_helpers.rs +++ b/compute_tools/src/pg_helpers.rs @@ -16,15 +16,26 @@ use compute_api::spec::{Database, GenericOption, GenericOptions, PgIdent, Role}; const POSTGRES_WAIT_TIMEOUT: Duration = Duration::from_millis(60 * 1000); // milliseconds -/// Escape a string for including it in a SQL literal +/// Escape a string for including it in a SQL literal. Wrapping the result +/// with `E'{}'` or `'{}'` is not required, as it returns a ready-to-use +/// SQL string literal, e.g. `'db'''` or `E'db\\'`. +/// See https://github.com/postgres/postgres/blob/da98d005cdbcd45af563d0c4ac86d0e9772cd15f/src/backend/utils/adt/quote.c#L47 +/// for the original implementation. pub fn escape_literal(s: &str) -> String { - s.replace('\'', "''").replace('\\', "\\\\") + let res = s.replace('\'', "''").replace('\\', "\\\\"); + + if res.contains('\\') { + format!("E'{}'", res) + } else { + format!("'{}'", res) + } } -/// Escape a string so that it can be used in postgresql.conf. -/// Same as escape_literal, currently. +/// Escape a string so that it can be used in postgresql.conf. Wrapping the result +/// with `'{}'` is not required, as it returns a ready-to-use config string. pub fn escape_conf_value(s: &str) -> String { - s.replace('\'', "''").replace('\\', "\\\\") + let res = s.replace('\'', "''").replace('\\', "\\\\"); + format!("'{}'", res) } trait GenericOptionExt { @@ -37,7 +48,7 @@ impl GenericOptionExt for GenericOption { fn to_pg_option(&self) -> String { if let Some(val) = &self.value { match self.vartype.as_ref() { - "string" => format!("{} '{}'", self.name, escape_literal(val)), + "string" => format!("{} {}", self.name, escape_literal(val)), _ => format!("{} {}", self.name, val), } } else { @@ -49,7 +60,7 @@ impl GenericOptionExt for GenericOption { fn to_pg_setting(&self) -> String { if let Some(val) = &self.value { match self.vartype.as_ref() { - "string" => format!("{} = '{}'", self.name, escape_conf_value(val)), + "string" => format!("{} = {}", self.name, escape_conf_value(val)), _ => format!("{} = {}", self.name, val), } } else { diff --git a/compute_tools/src/spec.rs b/compute_tools/src/spec.rs index 520696da00..575a5332a8 100644 --- a/compute_tools/src/spec.rs +++ b/compute_tools/src/spec.rs @@ -397,10 +397,44 @@ pub fn handle_databases(spec: &ComputeSpec, client: &mut Client) -> Result<()> { // We do not check either DB exists or not, // Postgres will take care of it for us "delete_db" => { - let query: String = format!("DROP DATABASE IF EXISTS {}", &op.name.pg_quote()); + // In Postgres we can't drop a database if it is a template. + // So we need to unset the template flag first, but it could + // be a retry, so we could've already dropped the database. + // Check that database exists first to make it idempotent. + let unset_template_query: String = format!( + " + DO $$ + BEGIN + IF EXISTS( + SELECT 1 + FROM pg_catalog.pg_database + WHERE datname = {} + ) + THEN + ALTER DATABASE {} is_template false; + END IF; + END + $$;", + escape_literal(&op.name), + &op.name.pg_quote() + ); + // Use FORCE to drop database even if there are active connections. + // We run this from `cloud_admin`, so it should have enough privileges. + // NB: there could be other db states, which prevent us from dropping + // the database. For example, if db is used by any active subscription + // or replication slot. + // TODO: deal with it once we allow logical replication. Proper fix should + // involve returning an error code to the control plane, so it could + // figure out that this is a non-retryable error, return it to the user + // and fail operation permanently. + let drop_db_query: String = format!( + "DROP DATABASE IF EXISTS {} WITH (FORCE)", + &op.name.pg_quote() + ); warn!("deleting database '{}'", &op.name); - client.execute(query.as_str(), &[])?; + client.execute(unset_template_query.as_str(), &[])?; + client.execute(drop_db_query.as_str(), &[])?; } "rename_db" => { let new_name = op.new_name.as_ref().unwrap(); diff --git a/compute_tools/tests/pg_helpers_tests.rs b/compute_tools/tests/pg_helpers_tests.rs index 265556d3b9..7d27d22a78 100644 --- a/compute_tools/tests/pg_helpers_tests.rs +++ b/compute_tools/tests/pg_helpers_tests.rs @@ -89,4 +89,12 @@ test.escaping = 'here''s a backslash \\ and a quote '' and a double-quote " hoor assert_eq!(none_generic_options.find("missed_value"), None); assert_eq!(none_generic_options.find("invalid_value"), None); } + + #[test] + fn test_escape_literal() { + assert_eq!(escape_literal("test"), "'test'"); + assert_eq!(escape_literal("test'"), "'test'''"); + assert_eq!(escape_literal("test\\'"), "E'test\\\\'''"); + assert_eq!(escape_literal("test\\'\\'"), "E'test\\\\''\\\\'''"); + } } From c76b74c50db50363556561a8e0e1602173f5a998 Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Thu, 13 Jul 2023 10:35:27 -0400 Subject: [PATCH 20/58] semantic layer map operations (#4618) ## Problem ref https://github.com/neondatabase/neon/issues/4373 ## Summary of changes A step towards immutable layer map. I decided to finish the refactor with this new approach and apply https://github.com/neondatabase/neon/pull/4455 on this patch later. In this PR, we moved all modifications of the layer map to one place with semantic operations like `initialize_local_layers`, `finish_compact_l0`, `finish_gc_timeline`, etc, which is now part of `LayerManager`. This makes it easier to build new features upon this PR: * For immutable storage state refactor, we can simply replace the layer map with `ArcSwap` and remove the `layers` lock. Moving towards it requires us to put all layer map changes in a single place as in https://github.com/neondatabase/neon/pull/4455. * For manifest, we can write to manifest in each of the semantic functions. --------- Signed-off-by: Alex Chi Z Co-authored-by: Christian Schwarz --- pageserver/src/tenant.rs | 2 +- pageserver/src/tenant/layer_map.rs | 2 +- pageserver/src/tenant/storage_layer.rs | 8 +- .../src/tenant/storage_layer/remote_layer.rs | 4 +- pageserver/src/tenant/timeline.rs | 387 ++++-------------- .../src/tenant/timeline/eviction_task.rs | 4 +- .../src/tenant/timeline/layer_manager.rs | 370 +++++++++++++++++ 7 files changed, 468 insertions(+), 309 deletions(-) create mode 100644 pageserver/src/tenant/timeline/layer_manager.rs diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index 4c504527a0..be88fd8676 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -429,7 +429,7 @@ impl Tenant { .layers .read() .await - .0 + .layer_map() .iter_historic_layers() .next() .is_some(), diff --git a/pageserver/src/tenant/layer_map.rs b/pageserver/src/tenant/layer_map.rs index 13fa7ccc7b..9dd3212a5b 100644 --- a/pageserver/src/tenant/layer_map.rs +++ b/pageserver/src/tenant/layer_map.rs @@ -659,7 +659,7 @@ mod tests { use crate::tenant::{ storage_layer::{AsLayerDesc, PersistentLayerDesc}, - timeline::LayerFileManager, + timeline::layer_manager::LayerFileManager, }; use super::*; diff --git a/pageserver/src/tenant/storage_layer.rs b/pageserver/src/tenant/storage_layer.rs index 72b2bfb1de..7996c00215 100644 --- a/pageserver/src/tenant/storage_layer.rs +++ b/pageserver/src/tenant/storage_layer.rs @@ -41,7 +41,7 @@ pub use inmemory_layer::InMemoryLayer; pub use layer_desc::{PersistentLayerDesc, PersistentLayerKey}; pub use remote_layer::RemoteLayer; -use super::layer_map::BatchedUpdates; +use super::timeline::layer_manager::LayerManager; pub fn range_overlaps(a: &Range, b: &Range) -> bool where @@ -170,7 +170,7 @@ impl LayerAccessStats { /// /// See [`record_residence_event`] for why you need to do this while holding the layer map lock. pub(crate) fn for_loading_layer( - layer_map_lock_held_witness: &BatchedUpdates<'_>, + layer_map_lock_held_witness: &LayerManager, status: LayerResidenceStatus, ) -> Self { let new = LayerAccessStats(Mutex::new(LayerAccessStatsLocked::default())); @@ -189,7 +189,7 @@ impl LayerAccessStats { /// See [`record_residence_event`] for why you need to do this while holding the layer map lock. pub(crate) fn clone_for_residence_change( &self, - layer_map_lock_held_witness: &BatchedUpdates<'_>, + layer_map_lock_held_witness: &LayerManager, new_status: LayerResidenceStatus, ) -> LayerAccessStats { let clone = { @@ -221,7 +221,7 @@ impl LayerAccessStats { /// pub(crate) fn record_residence_event( &self, - _layer_map_lock_held_witness: &BatchedUpdates<'_>, + _layer_map_lock_held_witness: &LayerManager, status: LayerResidenceStatus, reason: LayerResidenceEventReason, ) { diff --git a/pageserver/src/tenant/storage_layer/remote_layer.rs b/pageserver/src/tenant/storage_layer/remote_layer.rs index 54954fdb80..4ab11a6c3e 100644 --- a/pageserver/src/tenant/storage_layer/remote_layer.rs +++ b/pageserver/src/tenant/storage_layer/remote_layer.rs @@ -4,9 +4,9 @@ use crate::config::PageServerConf; use crate::context::RequestContext; use crate::repository::Key; -use crate::tenant::layer_map::BatchedUpdates; use crate::tenant::remote_timeline_client::index::LayerFileMetadata; use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState}; +use crate::tenant::timeline::layer_manager::LayerManager; use anyhow::{bail, Result}; use pageserver_api::models::HistoricLayerInfo; use std::ops::Range; @@ -224,7 +224,7 @@ impl RemoteLayer { /// Create a Layer struct representing this layer, after it has been downloaded. pub fn create_downloaded_layer( &self, - layer_map_lock_held_witness: &BatchedUpdates<'_>, + layer_map_lock_held_witness: &LayerManager, conf: &'static PageServerConf, file_size: u64, ) -> Arc { diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index d589f10570..3db1347c37 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -1,6 +1,5 @@ -//! - mod eviction_task; +pub mod layer_manager; mod logical_size; pub mod span; pub mod uninit; @@ -82,16 +81,15 @@ use crate::{is_temporary, task_mgr}; pub(super) use self::eviction_task::EvictionTaskTenantState; use self::eviction_task::EvictionTaskTimelineState; +use self::layer_manager::LayerManager; use self::logical_size::LogicalSize; use self::walreceiver::{WalReceiver, WalReceiverConf}; use super::config::TenantConf; -use super::layer_map::BatchedUpdates; use super::remote_timeline_client::index::IndexPart; use super::remote_timeline_client::RemoteTimelineClient; use super::storage_layer::{ AsLayerDesc, DeltaLayer, ImageLayer, Layer, LayerAccessStatsReset, PersistentLayerDesc, - PersistentLayerKey, }; #[derive(Debug, PartialEq, Eq, Clone, Copy)] @@ -125,78 +123,6 @@ impl PartialOrd for Hole { } } -pub struct LayerFileManager( - HashMap>, -); - -impl LayerFileManager { - fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc { - // The assumption for the `expect()` is that all code maintains the following invariant: - // A layer's descriptor is present in the LayerMap => the LayerFileManager contains a layer for the descriptor. - self.0 - .get(&desc.key()) - .with_context(|| format!("get layer from desc: {}", desc.filename())) - .expect("not found") - .clone() - } - - pub(crate) fn insert(&mut self, layer: Arc) { - let present = self.0.insert(layer.layer_desc().key(), layer.clone()); - if present.is_some() && cfg!(debug_assertions) { - panic!("overwriting a layer: {:?}", layer.layer_desc()) - } - } - - pub(crate) fn new() -> Self { - Self(HashMap::new()) - } - - pub(crate) fn remove(&mut self, layer: Arc) { - let present = self.0.remove(&layer.layer_desc().key()); - if present.is_none() && cfg!(debug_assertions) { - panic!( - "removing layer that is not present in layer mapping: {:?}", - layer.layer_desc() - ) - } - } - - pub(crate) fn replace_and_verify(&mut self, expected: Arc, new: Arc) -> Result<()> { - let key = expected.layer_desc().key(); - let other = new.layer_desc().key(); - - let expected_l0 = LayerMap::is_l0(expected.layer_desc()); - let new_l0 = LayerMap::is_l0(new.layer_desc()); - - fail::fail_point!("layermap-replace-notfound", |_| anyhow::bail!( - "layermap-replace-notfound" - )); - - anyhow::ensure!( - key == other, - "expected and new layer have different keys: {key:?} != {other:?}" - ); - - anyhow::ensure!( - expected_l0 == new_l0, - "one layer is l0 while the other is not: {expected_l0} != {new_l0}" - ); - - if let Some(layer) = self.0.get_mut(&expected.layer_desc().key()) { - anyhow::ensure!( - compare_arced_layers(&expected, layer), - "another layer was found instead of expected, expected={expected:?}, new={new:?}", - expected = Arc::as_ptr(&expected), - new = Arc::as_ptr(layer), - ); - *layer = new; - Ok(()) - } else { - anyhow::bail!("layer was not found"); - } - } -} - /// Temporary function for immutable storage state refactor, ensures we are dropping mutex guard instead of other things. /// Can be removed after all refactors are done. fn drop_rlock(rlock: tokio::sync::OwnedRwLockReadGuard) { @@ -236,7 +162,7 @@ pub struct Timeline { /// /// In the future, we'll be able to split up the tuple of LayerMap and `LayerFileManager`, /// so that e.g. on-demand-download/eviction, and layer spreading, can operate just on `LayerFileManager`. - pub(crate) layers: Arc>, + pub(crate) layers: Arc>, /// Set of key ranges which should be covered by image layers to /// allow GC to remove old layers. This set is created by GC and its cutoff LSN is also stored. @@ -587,7 +513,7 @@ impl Timeline { /// Hence, the result **does not represent local filesystem usage**. pub async fn layer_size_sum(&self) -> u64 { let guard = self.layers.read().await; - let (layer_map, _) = &*guard; + let layer_map = guard.layer_map(); let mut size = 0; for l in layer_map.iter_historic_layers() { size += l.file_size(); @@ -898,7 +824,7 @@ impl Timeline { let last_lsn = self.get_last_record_lsn(); let open_layer_size = { let guard = self.layers.read().await; - let (layers, _) = &*guard; + let layers = guard.layer_map(); let Some(open_layer) = layers.open_layer.as_ref() else { return Ok(()); }; @@ -1030,7 +956,7 @@ impl Timeline { pub async fn layer_map_info(&self, reset: LayerAccessStatsReset) -> LayerMapInfo { let guard = self.layers.read().await; - let (layer_map, mapping) = &*guard; + let layer_map = guard.layer_map(); let mut in_memory_layers = Vec::with_capacity(layer_map.frozen_layers.len() + 1); if let Some(open_layer) = &layer_map.open_layer { in_memory_layers.push(open_layer.info()); @@ -1041,7 +967,7 @@ impl Timeline { let mut historic_layers = Vec::new(); for historic_layer in layer_map.iter_historic_layers() { - let historic_layer = mapping.get_from_desc(&historic_layer); + let historic_layer = guard.get_from_desc(&historic_layer); historic_layers.push(historic_layer.info(reset)); } @@ -1152,27 +1078,18 @@ impl Timeline { // start the batch update let mut guard = self.layers.write().await; - let (layer_map, mapping) = &mut *guard; - let mut batch_updates = layer_map.batch_update(); - let mut results = Vec::with_capacity(layers_to_evict.len()); for l in layers_to_evict.iter() { let res = if cancel.is_cancelled() { None } else { - Some(self.evict_layer_batch_impl( - &layer_removal_guard, - l, - &mut batch_updates, - mapping, - )) + Some(self.evict_layer_batch_impl(&layer_removal_guard, l, &mut guard)) }; results.push(res); } // commit the updates & release locks - batch_updates.flush(); drop_wlock(guard); drop(layer_removal_guard); @@ -1184,8 +1101,7 @@ impl Timeline { &self, _layer_removal_cs: &tokio::sync::MutexGuard<'_, ()>, local_layer: &Arc, - batch_updates: &mut BatchedUpdates<'_>, - mapping: &mut LayerFileManager, + layer_mgr: &mut LayerManager, ) -> anyhow::Result { if local_layer.is_remote_layer() { // TODO(issue #3851): consider returning an err here instead of false, @@ -1221,7 +1137,7 @@ impl Timeline { &layer_metadata, local_layer .access_stats() - .clone_for_residence_change(batch_updates, LayerResidenceStatus::Evicted), + .clone_for_residence_change(layer_mgr, LayerResidenceStatus::Evicted), ), LayerFileName::Delta(delta_name) => RemoteLayer::new_delta( self.tenant_id, @@ -1230,13 +1146,13 @@ impl Timeline { &layer_metadata, local_layer .access_stats() - .clone_for_residence_change(batch_updates, LayerResidenceStatus::Evicted), + .clone_for_residence_change(layer_mgr, LayerResidenceStatus::Evicted), ), }); assert_eq!(local_layer.layer_desc(), new_remote_layer.layer_desc()); - let succeed = match mapping.replace_and_verify(local_layer.clone(), new_remote_layer) { + let succeed = match layer_mgr.replace_and_verify(local_layer.clone(), new_remote_layer) { Ok(()) => { if let Err(e) = local_layer.delete_resident_layer_file() { error!("failed to remove layer file on evict after replacement: {e:#?}"); @@ -1407,10 +1323,7 @@ impl Timeline { timeline_id, tenant_id, pg_version, - layers: Arc::new(tokio::sync::RwLock::new(( - LayerMap::default(), - LayerFileManager::new(), - ))), + layers: Arc::new(tokio::sync::RwLock::new(LayerManager::create())), wanted_image_layers: Mutex::new(None), walredo_mgr, @@ -1595,7 +1508,7 @@ impl Timeline { let mut layers = self.layers.try_write().expect( "in the context where we call this function, no other task has access to the object", ); - layers.0.next_open_layer_at = Some(Lsn(start_lsn.0)); + layers.initialize_empty(Lsn(start_lsn.0)); } /// @@ -1603,8 +1516,6 @@ impl Timeline { /// pub(super) async fn load_layer_map(&self, disk_consistent_lsn: Lsn) -> anyhow::Result<()> { let mut guard = self.layers.write().await; - let (layers, mapping) = &mut *guard; - let mut updates = layers.batch_update(); let mut num_layers = 0; let timer = self.metrics.load_layer_map_histo.start_timer(); @@ -1615,6 +1526,8 @@ impl Timeline { // total size of layer files in the current timeline directory let mut total_physical_size = 0; + let mut loaded_layers = Vec::>::new(); + for direntry in fs::read_dir(timeline_path)? { let direntry = direntry?; let direntry_path = direntry.path(); @@ -1641,12 +1554,12 @@ impl Timeline { self.tenant_id, &imgfilename, file_size, - LayerAccessStats::for_loading_layer(&updates, LayerResidenceStatus::Resident), + LayerAccessStats::for_loading_layer(&guard, LayerResidenceStatus::Resident), ); trace!("found layer {}", layer.path().display()); total_physical_size += file_size; - self.insert_historic_layer(Arc::new(layer), &mut updates, mapping); + loaded_layers.push(Arc::new(layer)); num_layers += 1; } else if let Some(deltafilename) = DeltaFileName::parse_str(&fname) { // Create a DeltaLayer struct for each delta file. @@ -1673,12 +1586,12 @@ impl Timeline { self.tenant_id, &deltafilename, file_size, - LayerAccessStats::for_loading_layer(&updates, LayerResidenceStatus::Resident), + LayerAccessStats::for_loading_layer(&guard, LayerResidenceStatus::Resident), ); trace!("found layer {}", layer.path().display()); total_physical_size += file_size; - self.insert_historic_layer(Arc::new(layer), &mut updates, mapping); + loaded_layers.push(Arc::new(layer)); num_layers += 1; } else if fname == METADATA_FILE_NAME || fname.ends_with(".old") { // ignore these @@ -1704,8 +1617,7 @@ impl Timeline { } } - updates.flush(); - layers.next_open_layer_at = Some(Lsn(disk_consistent_lsn.0) + 1); + guard.initialize_local_layers(loaded_layers, Lsn(disk_consistent_lsn.0) + 1); info!( "loaded layer map with {} layers at {}, total physical size: {}", @@ -1733,8 +1645,9 @@ impl Timeline { // We're holding a layer map lock for a while but this // method is only called during init so it's fine. let mut guard = self.layers.write().await; - let (layer_map, mapping) = &mut *guard; - let mut updates = layer_map.batch_update(); + + let mut corrupted_local_layers = Vec::new(); + let mut added_remote_layers = Vec::new(); for remote_layer_name in &index_part.timeline_layers { let local_layer = local_only_layers.remove(remote_layer_name); @@ -1778,7 +1691,7 @@ impl Timeline { anyhow::bail!("could not rename file {local_layer_path:?}: {err:?}"); } else { self.metrics.resident_physical_size_gauge.sub(local_size); - self.remove_historic_layer(local_layer, &mut updates, mapping); + corrupted_local_layers.push(local_layer); // fall-through to adding the remote layer } } else { @@ -1810,14 +1723,10 @@ impl Timeline { self.timeline_id, imgfilename, &remote_layer_metadata, - LayerAccessStats::for_loading_layer( - &updates, - LayerResidenceStatus::Evicted, - ), + LayerAccessStats::for_loading_layer(&guard, LayerResidenceStatus::Evicted), ); let remote_layer = Arc::new(remote_layer); - - self.insert_historic_layer(remote_layer, &mut updates, mapping); + added_remote_layers.push(remote_layer); } LayerFileName::Delta(deltafilename) => { // Create a RemoteLayer for the delta file. @@ -1838,18 +1747,14 @@ impl Timeline { self.timeline_id, deltafilename, &remote_layer_metadata, - LayerAccessStats::for_loading_layer( - &updates, - LayerResidenceStatus::Evicted, - ), + LayerAccessStats::for_loading_layer(&guard, LayerResidenceStatus::Evicted), ); let remote_layer = Arc::new(remote_layer); - self.insert_historic_layer(remote_layer, &mut updates, mapping); + added_remote_layers.push(remote_layer); } } } - - updates.flush(); + guard.initialize_remote_layers(corrupted_local_layers, added_remote_layers); Ok(local_only_layers) } @@ -1885,10 +1790,10 @@ impl Timeline { let local_layers = { let guard = self.layers.read().await; - let (layers, mapping) = &*guard; + let layers = guard.layer_map(); layers .iter_historic_layers() - .map(|l| (l.filename(), mapping.get_from_desc(&l))) + .map(|l| (l.filename(), guard.get_from_desc(&l))) .collect::>() }; @@ -2262,70 +2167,15 @@ impl Timeline { async fn find_layer(&self, layer_file_name: &str) -> Option> { let guard = self.layers.read().await; - let (layers, mapping) = &*guard; - for historic_layer in layers.iter_historic_layers() { + for historic_layer in guard.layer_map().iter_historic_layers() { let historic_layer_name = historic_layer.filename().file_name(); if layer_file_name == historic_layer_name { - return Some(mapping.get_from_desc(&historic_layer)); + return Some(guard.get_from_desc(&historic_layer)); } } None } - - /// Helper function to insert a layer from both layer map and layer file manager. Will be removed in the future - /// after we introduce `LayerMapManager`. - fn insert_historic_layer( - &self, - layer: Arc, - updates: &mut BatchedUpdates<'_>, - mapping: &mut LayerFileManager, - ) { - updates.insert_historic(layer.layer_desc().clone()); - mapping.insert(layer); - } - - /// Helper function to remove a layer from both layer map and layer file manager. Will be removed in the future - /// after we introduce `LayerMapManager`. - fn remove_historic_layer( - &self, - layer: Arc, - updates: &mut BatchedUpdates<'_>, - mapping: &mut LayerFileManager, - ) { - updates.remove_historic(layer.layer_desc().clone()); - mapping.remove(layer); - } - - /// Removes the layer from local FS (if present) and from memory. - /// Remote storage is not affected by this operation. - fn delete_historic_layer( - &self, - // we cannot remove layers otherwise, since gc and compaction will race - _layer_removal_cs: Arc>, - layer: Arc, - updates: &mut BatchedUpdates<'_>, - mapping: &mut LayerFileManager, - ) -> anyhow::Result<()> { - let layer = mapping.get_from_desc(&layer); - if !layer.is_remote_layer() { - layer.delete_resident_layer_file()?; - let layer_file_size = layer.file_size(); - self.metrics - .resident_physical_size_gauge - .sub(layer_file_size); - } - - // TODO Removing from the bottom of the layer map is expensive. - // Maybe instead discard all layer map historic versions that - // won't be needed for page reconstruction for this timeline, - // and mark what we can't delete yet as deleted from the layer - // map index without actually rebuilding the index. - updates.remove_historic(layer.layer_desc().clone()); - mapping.remove(layer); - - Ok(()) - } } type TraversalId = String; @@ -2500,7 +2350,7 @@ impl Timeline { 'layer_map_search: loop { let remote_layer = { let guard = timeline.layers.read().await; - let (layers, mapping) = &*guard; + let layers = guard.layer_map(); // Check the open and frozen in-memory layers first, in order from newest // to oldest. @@ -2562,7 +2412,7 @@ impl Timeline { } if let Some(SearchResult { lsn_floor, layer }) = layers.search(key, cont_lsn) { - let layer = mapping.get_from_desc(&layer); + let layer = guard.get_from_desc(&layer); // If it's a remote layer, download it and retry. if let Some(remote_layer) = super::storage_layer::downcast_remote_layer(&layer) @@ -2685,52 +2535,13 @@ impl Timeline { /// async fn get_layer_for_write(&self, lsn: Lsn) -> anyhow::Result> { let mut guard = self.layers.write().await; - let (layers, _) = &mut *guard; - - ensure!(lsn.is_aligned()); - - let last_record_lsn = self.get_last_record_lsn(); - ensure!( - lsn > last_record_lsn, - "cannot modify relation after advancing last_record_lsn (incoming_lsn={}, last_record_lsn={})\n{}", + let layer = guard.get_layer_for_write( lsn, - last_record_lsn, - std::backtrace::Backtrace::force_capture(), - ); - - // Do we have a layer open for writing already? - let layer; - if let Some(open_layer) = &layers.open_layer { - if open_layer.get_lsn_range().start > lsn { - bail!( - "unexpected open layer in the future: open layers starts at {}, write lsn {}", - open_layer.get_lsn_range().start, - lsn - ); - } - - layer = Arc::clone(open_layer); - } else { - // No writeable layer yet. Create one. - let start_lsn = layers - .next_open_layer_at - .context("No next open layer found")?; - - trace!( - "creating layer for write at {}/{} for record at {}", - self.timeline_id, - start_lsn, - lsn - ); - let new_layer = - InMemoryLayer::create(self.conf, self.timeline_id, self.tenant_id, start_lsn)?; - let layer_rc = Arc::new(new_layer); - - layers.open_layer = Some(Arc::clone(&layer_rc)); - layers.next_open_layer_at = None; - - layer = layer_rc; - } + self.get_last_record_lsn(), + self.conf, + self.timeline_id, + self.tenant_id, + )?; Ok(layer) } @@ -2763,21 +2574,7 @@ impl Timeline { Some(self.write_lock.lock().await) }; let mut guard = self.layers.write().await; - let (layers, _) = &mut *guard; - if let Some(open_layer) = &layers.open_layer { - let open_layer_rc = Arc::clone(open_layer); - // Does this layer need freezing? - let end_lsn = Lsn(self.get_last_record_lsn().0 + 1); - open_layer.freeze(end_lsn); - - // The layer is no longer open, update the layer map to reflect this. - // We will replace it with on-disk historics below. - layers.frozen_layers.push_back(open_layer_rc); - layers.open_layer = None; - layers.next_open_layer_at = Some(end_lsn); - self.last_freeze_at.store(end_lsn); - } - drop_wlock(guard); + guard.try_freeze_in_memory_layer(self.get_last_record_lsn(), &self.last_freeze_at); } /// Layer flusher task's main loop. @@ -2802,8 +2599,7 @@ impl Timeline { let result = loop { let layer_to_flush = { let guard = self.layers.read().await; - let (layers, _) = &*guard; - layers.frozen_layers.front().cloned() + guard.layer_map().frozen_layers.front().cloned() // drop 'layers' lock to allow concurrent reads and writes }; let Some(layer_to_flush) = layer_to_flush else { break Ok(()) }; @@ -2921,12 +2717,11 @@ impl Timeline { pausable_failpoint!("flush-frozen-before-sync"); // The new on-disk layers are now in the layer map. We can remove the - // in-memory layer from the map now. We do not modify `LayerFileManager` because - // it only contains persistent layers. The flushed layer is stored in + // in-memory layer from the map now. The flushed layer is stored in // the mapping in `create_delta_layer`. { - let mut layers = self.layers.write().await; - let l = layers.0.frozen_layers.pop_front(); + let mut guard = self.layers.write().await; + let l = guard.layer_map_mut().frozen_layers.pop_front(); // Only one thread may call this function at a time (for this // timeline). If two threads tried to flush the same frozen @@ -3065,15 +2860,12 @@ impl Timeline { // Add it to the layer map let l = Arc::new(new_delta); let mut guard = self.layers.write().await; - let (layers, mapping) = &mut *guard; - let mut batch_updates = layers.batch_update(); l.access_stats().record_residence_event( - &batch_updates, + &guard, LayerResidenceStatus::Resident, LayerResidenceEventReason::LayerCreate, ); - self.insert_historic_layer(l, &mut batch_updates, mapping); - batch_updates.flush(); + guard.track_new_l0_delta_layer(l); // update metrics self.metrics.resident_physical_size_gauge.add(sz); @@ -3122,7 +2914,7 @@ impl Timeline { let threshold = self.get_image_creation_threshold(); let guard = self.layers.read().await; - let (layers, _) = &*guard; + let layers = guard.layer_map(); let mut max_deltas = 0; { @@ -3301,11 +3093,9 @@ impl Timeline { let mut layer_paths_to_upload = HashMap::with_capacity(image_layers.len()); let mut guard = self.layers.write().await; - let (layers, mapping) = &mut *guard; - let mut updates = layers.batch_update(); let timeline_path = self.conf.timeline_path(&self.tenant_id, &self.timeline_id); - for l in image_layers { + for l in &image_layers { let path = l.filename(); let metadata = timeline_path .join(path.file_name()) @@ -3319,13 +3109,12 @@ impl Timeline { .add(metadata.len()); let l = Arc::new(l); l.access_stats().record_residence_event( - &updates, + &guard, LayerResidenceStatus::Resident, LayerResidenceEventReason::LayerCreate, ); - self.insert_historic_layer(l, &mut updates, mapping); } - updates.flush(); + guard.track_new_image_layers(image_layers); drop_wlock(guard); timer.stop_and_record(); @@ -3487,18 +3276,18 @@ impl Timeline { fn compact_level0_phase1( self: Arc, _layer_removal_cs: Arc>, - guard: tokio::sync::OwnedRwLockReadGuard<(LayerMap, LayerFileManager)>, + guard: tokio::sync::OwnedRwLockReadGuard, mut stats: CompactLevel0Phase1StatsBuilder, target_file_size: u64, ctx: &RequestContext, ) -> Result { stats.read_lock_held_spawn_blocking_startup_micros = stats.read_lock_acquisition_micros.till_now(); // set by caller - let (layers, mapping) = &*guard; + let layers = guard.layer_map(); let level0_deltas = layers.get_level0_deltas()?; let mut level0_deltas = level0_deltas .into_iter() - .map(|x| mapping.get_from_desc(&x)) + .map(|x| guard.get_from_desc(&x)) .collect_vec(); stats.level0_deltas_count = Some(level0_deltas.len()); // Only compact if enough layers have accumulated. @@ -3914,9 +3703,11 @@ impl Timeline { } let mut guard = self.layers.write().await; - let (layers, mapping) = &mut *guard; - let mut updates = layers.batch_update(); let mut new_layer_paths = HashMap::with_capacity(new_layers.len()); + + let mut insert_layers = Vec::new(); + let mut remove_layers = Vec::new(); + for l in new_layers { let new_delta_path = l.path(); @@ -3942,11 +3733,11 @@ impl Timeline { new_layer_paths.insert(new_delta_path, LayerFileMetadata::new(metadata.len())); let x: Arc = Arc::new(l); x.access_stats().record_residence_event( - &updates, + &guard, LayerResidenceStatus::Resident, LayerResidenceEventReason::LayerCreate, ); - self.insert_historic_layer(x, &mut updates, mapping); + insert_layers.push(x); } // Now that we have reshuffled the data to set of new delta layers, we can @@ -3954,12 +3745,16 @@ impl Timeline { let mut layer_names_to_delete = Vec::with_capacity(deltas_to_compact.len()); for l in deltas_to_compact { layer_names_to_delete.push(l.filename()); - // NB: the layer file identified by descriptor `l` is guaranteed to be present - // in the LayerFileManager because we kept holding `layer_removal_cs` the entire - // time, even though we dropped `Timeline::layers` inbetween. - self.delete_historic_layer(layer_removal_cs.clone(), l, &mut updates, mapping)?; + remove_layers.push(guard.get_from_desc(&l)); } - updates.flush(); + + guard.finish_compact_l0( + layer_removal_cs, + remove_layers, + insert_layers, + &self.metrics, + )?; + drop_wlock(guard); // Also schedule the deletions in remote storage @@ -4178,7 +3973,7 @@ impl Timeline { // // TODO holding a write lock is too agressive and avoidable let mut guard = self.layers.write().await; - let (layers, mapping) = &mut *guard; + let layers = guard.layer_map(); 'outer: for l in layers.iter_historic_layers() { result.layers_total += 1; @@ -4274,7 +4069,6 @@ impl Timeline { .unwrap() .replace((new_gc_cutoff, wanted_image_layers.to_keyspace())); - let mut updates = layers.batch_update(); if !layers_to_remove.is_empty() { // Persist the new GC cutoff value in the metadata file, before // we actually remove anything. @@ -4284,18 +4078,15 @@ impl Timeline { // (couldn't do this in the loop above, because you cannot modify a collection // while iterating it. BTreeMap::retain() would be another option) let mut layer_names_to_delete = Vec::with_capacity(layers_to_remove.len()); - { - for doomed_layer in layers_to_remove { - layer_names_to_delete.push(doomed_layer.filename()); - self.delete_historic_layer( - layer_removal_cs.clone(), - doomed_layer, - &mut updates, - mapping, - )?; // FIXME: schedule succeeded deletions before returning? - result.layers_removed += 1; - } + let gc_layers = layers_to_remove + .iter() + .map(|x| guard.get_from_desc(x)) + .collect(); + for doomed_layer in layers_to_remove { + layer_names_to_delete.push(doomed_layer.filename()); + result.layers_removed += 1; } + let apply = guard.finish_gc_timeline(layer_removal_cs, gc_layers, &self.metrics)?; if result.layers_removed != 0 { fail_point!("after-timeline-gc-removed-layers"); @@ -4304,8 +4095,9 @@ impl Timeline { if let Some(remote_client) = &self.remote_client { remote_client.schedule_layer_file_deletion(&layer_names_to_delete)?; } + + apply.flush(); } - updates.flush(); info!( "GC completed removing {} layers, cutoff {}", @@ -4477,13 +4269,11 @@ impl Timeline { // Download complete. Replace the RemoteLayer with the corresponding // Delta- or ImageLayer in the layer map. let mut guard = self_clone.layers.write().await; - let (layers, mapping) = &mut *guard; - let updates = layers.batch_update(); let new_layer = - remote_layer.create_downloaded_layer(&updates, self_clone.conf, *size); + remote_layer.create_downloaded_layer(&guard, self_clone.conf, *size); { let l: Arc = remote_layer.clone(); - let failure = match mapping.replace_and_verify(l, new_layer) { + let failure = match guard.replace_and_verify(l, new_layer) { Ok(()) => false, Err(e) => { // this is a precondition failure, the layer filename derived @@ -4511,7 +4301,6 @@ impl Timeline { .store(true, Relaxed); } } - updates.flush(); drop_wlock(guard); info!("on-demand download successful"); @@ -4612,10 +4401,10 @@ impl Timeline { let mut downloads = Vec::new(); { let guard = self.layers.read().await; - let (layers, mapping) = &*guard; + let layers = guard.layer_map(); layers .iter_historic_layers() - .map(|l| mapping.get_from_desc(&l)) + .map(|l| guard.get_from_desc(&l)) .filter_map(|l| l.downcast_remote_layer()) .map(|l| self.download_remote_layer(l)) .for_each(|dl| downloads.push(dl)) @@ -4717,7 +4506,7 @@ impl LocalLayerInfoForDiskUsageEviction { impl Timeline { pub(crate) async fn get_local_layers_for_disk_usage_eviction(&self) -> DiskUsageEvictionInfo { let guard = self.layers.read().await; - let (layers, mapping) = &*guard; + let layers = guard.layer_map(); let mut max_layer_size: Option = None; let mut resident_layers = Vec::new(); @@ -4726,7 +4515,7 @@ impl Timeline { let file_size = l.file_size(); max_layer_size = max_layer_size.map_or(Some(file_size), |m| Some(m.max(file_size))); - let l = mapping.get_from_desc(&l); + let l = guard.get_from_desc(&l); if l.is_remote_layer() { continue; diff --git a/pageserver/src/tenant/timeline/eviction_task.rs b/pageserver/src/tenant/timeline/eviction_task.rs index cd6a2d10cc..80146419df 100644 --- a/pageserver/src/tenant/timeline/eviction_task.rs +++ b/pageserver/src/tenant/timeline/eviction_task.rs @@ -198,10 +198,10 @@ impl Timeline { // So, we just need to deal with this. let candidates: Vec> = { let guard = self.layers.read().await; - let (layers, mapping) = &*guard; + let layers = guard.layer_map(); let mut candidates = Vec::new(); for hist_layer in layers.iter_historic_layers() { - let hist_layer = mapping.get_from_desc(&hist_layer); + let hist_layer = guard.get_from_desc(&hist_layer); if hist_layer.is_remote_layer() { continue; } diff --git a/pageserver/src/tenant/timeline/layer_manager.rs b/pageserver/src/tenant/timeline/layer_manager.rs new file mode 100644 index 0000000000..979155f8d2 --- /dev/null +++ b/pageserver/src/tenant/timeline/layer_manager.rs @@ -0,0 +1,370 @@ +use anyhow::{bail, ensure, Context, Result}; +use std::{collections::HashMap, sync::Arc}; +use tracing::trace; +use utils::{ + id::{TenantId, TimelineId}, + lsn::{AtomicLsn, Lsn}, +}; + +use crate::{ + config::PageServerConf, + metrics::TimelineMetrics, + tenant::{ + layer_map::{BatchedUpdates, LayerMap}, + storage_layer::{ + AsLayerDesc, DeltaLayer, ImageLayer, InMemoryLayer, Layer, PersistentLayer, + PersistentLayerDesc, PersistentLayerKey, RemoteLayer, + }, + timeline::compare_arced_layers, + }, +}; + +/// Provides semantic APIs to manipulate the layer map. +pub struct LayerManager { + layer_map: LayerMap, + layer_fmgr: LayerFileManager, +} + +/// After GC, the layer map changes will not be applied immediately. Users should manually apply the changes after +/// scheduling deletes in remote client. +pub struct ApplyGcResultGuard<'a>(BatchedUpdates<'a>); + +impl ApplyGcResultGuard<'_> { + pub fn flush(self) { + self.0.flush(); + } +} + +impl LayerManager { + pub fn create() -> Self { + Self { + layer_map: LayerMap::default(), + layer_fmgr: LayerFileManager::new(), + } + } + + pub fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc { + self.layer_fmgr.get_from_desc(desc) + } + + /// Get an immutable reference to the layer map. + /// + /// We expect users only to be able to get an immutable layer map. If users want to make modifications, + /// they should use the below semantic APIs. This design makes us step closer to immutable storage state. + pub fn layer_map(&self) -> &LayerMap { + &self.layer_map + } + + /// Get a mutable reference to the layer map. This function will be removed once `flush_frozen_layer` + /// gets a refactor. + pub fn layer_map_mut(&mut self) -> &mut LayerMap { + &mut self.layer_map + } + + /// Replace layers in the layer file manager, used in evictions and layer downloads. + pub fn replace_and_verify( + &mut self, + expected: Arc, + new: Arc, + ) -> Result<()> { + self.layer_fmgr.replace_and_verify(expected, new) + } + + /// Called from `load_layer_map`. Initialize the layer manager with: + /// 1. all on-disk layers + /// 2. next open layer (with disk disk_consistent_lsn LSN) + pub fn initialize_local_layers( + &mut self, + on_disk_layers: Vec>, + next_open_layer_at: Lsn, + ) { + let mut updates = self.layer_map.batch_update(); + for layer in on_disk_layers { + Self::insert_historic_layer(layer, &mut updates, &mut self.layer_fmgr); + } + updates.flush(); + self.layer_map.next_open_layer_at = Some(next_open_layer_at); + } + + /// Initialize when creating a new timeline, called in `init_empty_layer_map`. + pub fn initialize_empty(&mut self, next_open_layer_at: Lsn) { + self.layer_map.next_open_layer_at = Some(next_open_layer_at); + } + + pub fn initialize_remote_layers( + &mut self, + corrupted_local_layers: Vec>, + remote_layers: Vec>, + ) { + let mut updates = self.layer_map.batch_update(); + for layer in corrupted_local_layers { + Self::remove_historic_layer(layer, &mut updates, &mut self.layer_fmgr); + } + for layer in remote_layers { + Self::insert_historic_layer(layer, &mut updates, &mut self.layer_fmgr); + } + updates.flush(); + } + + /// Open a new writable layer to append data if there is no open layer, otherwise return the current open layer, + /// called within `get_layer_for_write`. + pub fn get_layer_for_write( + &mut self, + lsn: Lsn, + last_record_lsn: Lsn, + conf: &'static PageServerConf, + timeline_id: TimelineId, + tenant_id: TenantId, + ) -> Result> { + ensure!(lsn.is_aligned()); + + ensure!( + lsn > last_record_lsn, + "cannot modify relation after advancing last_record_lsn (incoming_lsn={}, last_record_lsn={})\n{}", + lsn, + last_record_lsn, + std::backtrace::Backtrace::force_capture(), + ); + + // Do we have a layer open for writing already? + let layer = if let Some(open_layer) = &self.layer_map.open_layer { + if open_layer.get_lsn_range().start > lsn { + bail!( + "unexpected open layer in the future: open layers starts at {}, write lsn {}", + open_layer.get_lsn_range().start, + lsn + ); + } + + Arc::clone(open_layer) + } else { + // No writeable layer yet. Create one. + let start_lsn = self + .layer_map + .next_open_layer_at + .context("No next open layer found")?; + + trace!( + "creating in-memory layer at {}/{} for record at {}", + timeline_id, + start_lsn, + lsn + ); + + let new_layer = InMemoryLayer::create(conf, timeline_id, tenant_id, start_lsn)?; + let layer = Arc::new(new_layer); + + self.layer_map.open_layer = Some(layer.clone()); + self.layer_map.next_open_layer_at = None; + + layer + }; + + Ok(layer) + } + + /// Called from `freeze_inmem_layer`, returns true if successfully frozen. + pub fn try_freeze_in_memory_layer( + &mut self, + Lsn(last_record_lsn): Lsn, + last_freeze_at: &AtomicLsn, + ) { + let end_lsn = Lsn(last_record_lsn + 1); + + if let Some(open_layer) = &self.layer_map.open_layer { + let open_layer_rc = Arc::clone(open_layer); + // Does this layer need freezing? + open_layer.freeze(end_lsn); + + // The layer is no longer open, update the layer map to reflect this. + // We will replace it with on-disk historics below. + self.layer_map.frozen_layers.push_back(open_layer_rc); + self.layer_map.open_layer = None; + self.layer_map.next_open_layer_at = Some(end_lsn); + last_freeze_at.store(end_lsn); + } + } + + /// Add image layers to the layer map, called from `create_image_layers`. + pub fn track_new_image_layers(&mut self, image_layers: Vec) { + let mut updates = self.layer_map.batch_update(); + for layer in image_layers { + Self::insert_historic_layer(Arc::new(layer), &mut updates, &mut self.layer_fmgr); + } + updates.flush(); + } + + /// Insert into the layer map when a new delta layer is created, called from `create_delta_layer`. + pub fn track_new_l0_delta_layer(&mut self, delta_layer: Arc) { + let mut updates = self.layer_map.batch_update(); + Self::insert_historic_layer(delta_layer, &mut updates, &mut self.layer_fmgr); + updates.flush(); + } + + /// Called when compaction is completed. + pub fn finish_compact_l0( + &mut self, + layer_removal_cs: Arc>, + compact_from: Vec>, + compact_to: Vec>, + metrics: &TimelineMetrics, + ) -> Result<()> { + let mut updates = self.layer_map.batch_update(); + for l in compact_to { + Self::insert_historic_layer(l, &mut updates, &mut self.layer_fmgr); + } + for l in compact_from { + // NB: the layer file identified by descriptor `l` is guaranteed to be present + // in the LayerFileManager because compaction kept holding `layer_removal_cs` the entire + // time, even though we dropped `Timeline::layers` inbetween. + Self::delete_historic_layer( + layer_removal_cs.clone(), + l, + &mut updates, + metrics, + &mut self.layer_fmgr, + )?; + } + updates.flush(); + Ok(()) + } + + /// Called when garbage collect the timeline. Returns a guard that will apply the updates to the layer map. + pub fn finish_gc_timeline( + &mut self, + layer_removal_cs: Arc>, + gc_layers: Vec>, + metrics: &TimelineMetrics, + ) -> Result { + let mut updates = self.layer_map.batch_update(); + for doomed_layer in gc_layers { + Self::delete_historic_layer( + layer_removal_cs.clone(), + doomed_layer, + &mut updates, + metrics, + &mut self.layer_fmgr, + )?; // FIXME: schedule succeeded deletions in timeline.rs `gc_timeline` instead of in batch? + } + Ok(ApplyGcResultGuard(updates)) + } + + /// Helper function to insert a layer into the layer map and file manager. + fn insert_historic_layer( + layer: Arc, + updates: &mut BatchedUpdates<'_>, + mapping: &mut LayerFileManager, + ) { + updates.insert_historic(layer.layer_desc().clone()); + mapping.insert(layer); + } + + /// Helper function to remove a layer into the layer map and file manager + fn remove_historic_layer( + layer: Arc, + updates: &mut BatchedUpdates<'_>, + mapping: &mut LayerFileManager, + ) { + updates.remove_historic(layer.layer_desc().clone()); + mapping.remove(layer); + } + + /// Removes the layer from local FS (if present) and from memory. + /// Remote storage is not affected by this operation. + fn delete_historic_layer( + // we cannot remove layers otherwise, since gc and compaction will race + _layer_removal_cs: Arc>, + layer: Arc, + updates: &mut BatchedUpdates<'_>, + metrics: &TimelineMetrics, + mapping: &mut LayerFileManager, + ) -> anyhow::Result<()> { + if !layer.is_remote_layer() { + layer.delete_resident_layer_file()?; + let layer_file_size = layer.file_size(); + metrics.resident_physical_size_gauge.sub(layer_file_size); + } + + // TODO Removing from the bottom of the layer map is expensive. + // Maybe instead discard all layer map historic versions that + // won't be needed for page reconstruction for this timeline, + // and mark what we can't delete yet as deleted from the layer + // map index without actually rebuilding the index. + updates.remove_historic(layer.layer_desc().clone()); + mapping.remove(layer); + + Ok(()) + } +} + +pub struct LayerFileManager( + HashMap>, +); + +impl LayerFileManager { + fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc { + // The assumption for the `expect()` is that all code maintains the following invariant: + // A layer's descriptor is present in the LayerMap => the LayerFileManager contains a layer for the descriptor. + self.0 + .get(&desc.key()) + .with_context(|| format!("get layer from desc: {}", desc.filename())) + .expect("not found") + .clone() + } + + pub(crate) fn insert(&mut self, layer: Arc) { + let present = self.0.insert(layer.layer_desc().key(), layer.clone()); + if present.is_some() && cfg!(debug_assertions) { + panic!("overwriting a layer: {:?}", layer.layer_desc()) + } + } + + pub(crate) fn new() -> Self { + Self(HashMap::new()) + } + + pub(crate) fn remove(&mut self, layer: Arc) { + let present = self.0.remove(&layer.layer_desc().key()); + if present.is_none() && cfg!(debug_assertions) { + panic!( + "removing layer that is not present in layer mapping: {:?}", + layer.layer_desc() + ) + } + } + + pub(crate) fn replace_and_verify(&mut self, expected: Arc, new: Arc) -> Result<()> { + let key = expected.layer_desc().key(); + let other = new.layer_desc().key(); + + let expected_l0 = LayerMap::is_l0(expected.layer_desc()); + let new_l0 = LayerMap::is_l0(new.layer_desc()); + + fail::fail_point!("layermap-replace-notfound", |_| anyhow::bail!( + "layermap-replace-notfound" + )); + + anyhow::ensure!( + key == other, + "expected and new layer have different keys: {key:?} != {other:?}" + ); + + anyhow::ensure!( + expected_l0 == new_l0, + "one layer is l0 while the other is not: {expected_l0} != {new_l0}" + ); + + if let Some(layer) = self.0.get_mut(&key) { + anyhow::ensure!( + compare_arced_layers(&expected, layer), + "another layer was found instead of expected, expected={expected:?}, new={new:?}", + expected = Arc::as_ptr(&expected), + new = Arc::as_ptr(layer), + ); + *layer = new; + Ok(()) + } else { + anyhow::bail!("layer was not found"); + } + } +} From cc82cd1b075ac9fd515c2bc9b481dfa1c1513cb1 Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Fri, 14 Jul 2023 17:45:25 +0300 Subject: [PATCH 21/58] spanchecks: Support testing without tracing (#4682) Tests cannot be ran without configuring tracing. Split from #4678. Does not nag about the span checks when there is no subscriber configured, because then the spans will have no links and nothing can be checked. Sadly the `SpanTrace::status()` cannot be used for this. `tracing` is always configured in regress testing (running with `pageserver` binary), which should be enough. Additionally cleans up the test code in span checks to be in the test code. Fixes a `#[should_panic]` test which was flaky before these changes, but the `#[should_panic]` hid the flakyness. Rationale for need: Unit tests might not be testing only the public or `feature="testing"` APIs which are only testable within `regress` tests so not all spans might be configured. --- libs/utils/src/tracing_span_assert.rs | 296 +++++++++++++++++++------ pageserver/src/tenant/span.rs | 7 +- pageserver/src/tenant/timeline/span.rs | 7 +- 3 files changed, 229 insertions(+), 81 deletions(-) diff --git a/libs/utils/src/tracing_span_assert.rs b/libs/utils/src/tracing_span_assert.rs index b9f7986442..02c3ea0361 100644 --- a/libs/utils/src/tracing_span_assert.rs +++ b/libs/utils/src/tracing_span_assert.rs @@ -1,8 +1,15 @@ //! Assert that the current [`tracing::Span`] has a given set of fields. //! +//! Can only produce meaningful positive results when tracing has been configured as in example. +//! Absence of `tracing_error::ErrorLayer` is not detected yet. +//! +//! `#[cfg(test)]` code will get a pass when using the `check_fields_present` macro in case tracing +//! is completly unconfigured. +//! //! # Usage //! -//! ``` +//! ```rust +//! # fn main() { //! use tracing_subscriber::prelude::*; //! let registry = tracing_subscriber::registry() //! .with(tracing_error::ErrorLayer::default()); @@ -20,23 +27,18 @@ //! //! use utils::tracing_span_assert::{check_fields_present, MultiNameExtractor}; //! let extractor = MultiNameExtractor::new("TestExtractor", ["test", "test_id"]); -//! match check_fields_present([&extractor]) { -//! Ok(()) => {}, -//! Err(missing) => { -//! panic!("Missing fields: {:?}", missing.into_iter().map(|f| f.name() ).collect::>()); -//! } +//! if let Err(missing) = check_fields_present!([&extractor]) { +//! // if you copypaste this to a custom assert method, remember to add #[track_caller] +//! // to get the "user" code location for the panic. +//! panic!("Missing fields: {missing:?}"); //! } +//! # } //! ``` //! //! Recommended reading: https://docs.rs/tracing-subscriber/0.3.16/tracing_subscriber/layer/index.html#per-layer-filtering //! -use std::{ - collections::HashSet, - fmt::{self}, - hash::{Hash, Hasher}, -}; - +#[derive(Debug)] pub enum ExtractionResult { Present, Absent, @@ -71,51 +73,105 @@ impl Extractor for MultiNameExtractor { } } -struct MemoryIdentity<'a>(&'a dyn Extractor); - -impl<'a> MemoryIdentity<'a> { - fn as_ptr(&self) -> *const () { - self.0 as *const _ as *const () - } -} -impl<'a> PartialEq for MemoryIdentity<'a> { - fn eq(&self, other: &Self) -> bool { - self.as_ptr() == other.as_ptr() - } -} -impl<'a> Eq for MemoryIdentity<'a> {} -impl<'a> Hash for MemoryIdentity<'a> { - fn hash(&self, state: &mut H) { - self.as_ptr().hash(state); - } -} -impl<'a> fmt::Debug for MemoryIdentity<'a> { - fn fmt(&self, f: &mut fmt::Formatter<'_>) -> std::fmt::Result { - write!(f, "{:p}: {}", self.as_ptr(), self.0.name()) - } -} - -/// The extractor names passed as keys to [`new`]. -pub fn check_fields_present( +/// Checks that the given extractors are satisfied with the current span hierarchy. +/// +/// This should not be called directly, but used through [`check_fields_present`] which allows +/// `Summary::Unconfigured` only when the calling crate is being `#[cfg(test)]` as a conservative default. +#[doc(hidden)] +pub fn check_fields_present0( must_be_present: [&dyn Extractor; L], -) -> Result<(), Vec<&dyn Extractor>> { - let mut missing: HashSet = - HashSet::from_iter(must_be_present.into_iter().map(|r| MemoryIdentity(r))); +) -> Result> { + let mut missing = must_be_present.into_iter().collect::>(); let trace = tracing_error::SpanTrace::capture(); trace.with_spans(|md, _formatted_fields| { - missing.retain(|extractor| match extractor.0.extract(md.fields()) { + // when trying to understand the inner workings of how does the matching work, note that + // this closure might be called zero times if the span is disabled. normally it is called + // once per span hierarchy level. + missing.retain(|extractor| match extractor.extract(md.fields()) { ExtractionResult::Present => false, ExtractionResult::Absent => true, }); - !missing.is_empty() // continue walking up until we've found all missing + + // continue walking up until we've found all missing + !missing.is_empty() }); if missing.is_empty() { - Ok(()) + Ok(Summary::FoundEverything) + } else if !tracing_subscriber_configured() { + Ok(Summary::Unconfigured) } else { - Err(missing.into_iter().map(|mi| mi.0).collect()) + // we can still hit here if a tracing subscriber has been configured but the ErrorLayer is + // missing, which can be annoying. for this case, we could probably use + // SpanTrace::status(). + // + // another way to end up here is with RUST_LOG=pageserver=off while configuring the + // logging, though I guess in that case the SpanTrace::status() == EMPTY would be valid. + // this case is covered by test `not_found_if_tracing_error_subscriber_has_wrong_filter`. + Err(missing) } } +/// Checks that the given extractors are satisfied with the current span hierarchy. +/// +/// The macro is the preferred way of checking if fields exist while passing checks if a test does +/// not have tracing configured. +/// +/// Why mangled name? Because #[macro_export] will expose it at utils::__check_fields_present. +/// However we can game a module namespaced macro for `use` purposes by re-exporting the +/// #[macro_export] exported name with an alias (below). +#[doc(hidden)] +#[macro_export] +macro_rules! __check_fields_present { + ($extractors:expr) => {{ + { + use $crate::tracing_span_assert::{check_fields_present0, Summary::*, Extractor}; + + match check_fields_present0($extractors) { + Ok(FoundEverything) => Ok(()), + Ok(Unconfigured) if cfg!(test) => { + // allow unconfigured in tests + Ok(()) + }, + Ok(Unconfigured) => { + panic!("utils::tracing_span_assert: outside of #[cfg(test)] expected tracing to be configured with tracing_error::ErrorLayer") + }, + Err(missing) => Err(missing) + } + } + }} +} + +pub use crate::__check_fields_present as check_fields_present; + +/// Explanation for why the check was deemed ok. +/// +/// Mainly useful for testing, or configuring per-crate behaviour as in with +/// [`check_fields_present`]. +#[derive(Debug)] +pub enum Summary { + /// All extractors were found. + /// + /// Should only happen when tracing is properly configured. + FoundEverything, + + /// Tracing has not been configured at all. This is ok for tests running without tracing set + /// up. + Unconfigured, +} + +fn tracing_subscriber_configured() -> bool { + let mut noop_configured = false; + tracing::dispatcher::get_default(|d| { + // it is possible that this closure will not be invoked, but the current implementation + // always invokes it + noop_configured = d + .downcast_ref::() + .is_some(); + }); + + !noop_configured +} + #[cfg(test)] mod tests { @@ -123,6 +179,36 @@ mod tests { use super::*; + use std::{ + collections::HashSet, + fmt::{self}, + hash::{Hash, Hasher}, + }; + + struct MemoryIdentity<'a>(&'a dyn Extractor); + + impl<'a> MemoryIdentity<'a> { + fn as_ptr(&self) -> *const () { + self.0 as *const _ as *const () + } + } + impl<'a> PartialEq for MemoryIdentity<'a> { + fn eq(&self, other: &Self) -> bool { + self.as_ptr() == other.as_ptr() + } + } + impl<'a> Eq for MemoryIdentity<'a> {} + impl<'a> Hash for MemoryIdentity<'a> { + fn hash(&self, state: &mut H) { + self.as_ptr().hash(state); + } + } + impl<'a> fmt::Debug for MemoryIdentity<'a> { + fn fmt(&self, f: &mut fmt::Formatter<'_>) -> std::fmt::Result { + write!(f, "{:p}: {}", self.as_ptr(), self.0.name()) + } + } + struct Setup { _current_thread_subscriber_guard: tracing::subscriber::DefaultGuard, tenant_extractor: MultiNameExtractor<2>, @@ -159,7 +245,8 @@ mod tests { let setup = setup_current_thread(); let span = tracing::info_span!("root", tenant_id = "tenant-1", timeline_id = "timeline-1"); let _guard = span.enter(); - check_fields_present([&setup.tenant_extractor, &setup.timeline_extractor]).unwrap(); + let res = check_fields_present0([&setup.tenant_extractor, &setup.timeline_extractor]); + assert!(matches!(res, Ok(Summary::FoundEverything)), "{res:?}"); } #[test] @@ -167,8 +254,8 @@ mod tests { let setup = setup_current_thread(); let span = tracing::info_span!("root", timeline_id = "timeline-1"); let _guard = span.enter(); - let missing = - check_fields_present([&setup.tenant_extractor, &setup.timeline_extractor]).unwrap_err(); + let missing = check_fields_present0([&setup.tenant_extractor, &setup.timeline_extractor]) + .unwrap_err(); assert_missing(missing, vec![&setup.tenant_extractor]); } @@ -185,7 +272,8 @@ mod tests { let span = tracing::info_span!("grandchild", timeline_id = "timeline-1"); let _guard = span.enter(); - check_fields_present([&setup.tenant_extractor, &setup.timeline_extractor]).unwrap(); + let res = check_fields_present0([&setup.tenant_extractor, &setup.timeline_extractor]); + assert!(matches!(res, Ok(Summary::FoundEverything)), "{res:?}"); } #[test] @@ -198,7 +286,7 @@ mod tests { let span = tracing::info_span!("child", timeline_id = "timeline-1"); let _guard = span.enter(); - let missing = check_fields_present([&setup.tenant_extractor]).unwrap_err(); + let missing = check_fields_present0([&setup.tenant_extractor]).unwrap_err(); assert_missing(missing, vec![&setup.tenant_extractor]); } @@ -207,7 +295,8 @@ mod tests { let setup = setup_current_thread(); let span = tracing::info_span!("root", tenant_id = "tenant-1", timeline_id = "timeline-1"); let _guard = span.enter(); - check_fields_present([&setup.tenant_extractor]).unwrap(); + let res = check_fields_present0([&setup.tenant_extractor]); + assert!(matches!(res, Ok(Summary::FoundEverything)), "{res:?}"); } #[test] @@ -223,7 +312,8 @@ mod tests { let span = tracing::info_span!("grandchild", timeline_id = "timeline-1"); let _guard = span.enter(); - check_fields_present([&setup.tenant_extractor]).unwrap(); + let res = check_fields_present0([&setup.tenant_extractor]); + assert!(matches!(res, Ok(Summary::FoundEverything)), "{res:?}"); } #[test] @@ -231,7 +321,7 @@ mod tests { let setup = setup_current_thread(); let span = tracing::info_span!("root", timeline_id = "timeline-1"); let _guard = span.enter(); - let missing = check_fields_present([&setup.tenant_extractor]).unwrap_err(); + let missing = check_fields_present0([&setup.tenant_extractor]).unwrap_err(); assert_missing(missing, vec![&setup.tenant_extractor]); } @@ -245,43 +335,107 @@ mod tests { let span = tracing::info_span!("child", timeline_id = "timeline-1"); let _guard = span.enter(); - let missing = check_fields_present([&setup.tenant_extractor]).unwrap_err(); + let missing = check_fields_present0([&setup.tenant_extractor]).unwrap_err(); assert_missing(missing, vec![&setup.tenant_extractor]); } #[test] - fn tracing_error_subscriber_not_set_up() { + fn tracing_error_subscriber_not_set_up_straight_line() { // no setup - let span = tracing::info_span!("foo", e = "some value"); let _guard = span.enter(); let extractor = MultiNameExtractor::new("E", ["e"]); - let missing = check_fields_present([&extractor]).unwrap_err(); - assert_missing(missing, vec![&extractor]); + let res = check_fields_present0([&extractor]); + assert!(matches!(res, Ok(Summary::Unconfigured)), "{res:?}"); + + // similarly for a not found key + let extractor = MultiNameExtractor::new("F", ["foobar"]); + let res = check_fields_present0([&extractor]); + assert!(matches!(res, Ok(Summary::Unconfigured)), "{res:?}"); } #[test] - #[should_panic] - fn panics_if_tracing_error_subscriber_has_wrong_filter() { + fn tracing_error_subscriber_not_set_up_with_instrument() { + // no setup + + // demo a case where span entering is used to establish a parent child connection, but + // when we re-enter the subspan SpanTrace::with_spans iterates over nothing. + let span = tracing::info_span!("foo", e = "some value"); + let _guard = span.enter(); + + let subspan = tracing::info_span!("bar", f = "foobar"); + drop(_guard); + + // normally this would work, but without any tracing-subscriber configured, both + // check_field_present find nothing + let _guard = subspan.enter(); + let extractors: [&dyn Extractor; 2] = [ + &MultiNameExtractor::new("E", ["e"]), + &MultiNameExtractor::new("F", ["f"]), + ]; + + let res = check_fields_present0(extractors); + assert!(matches!(res, Ok(Summary::Unconfigured)), "{res:?}"); + + // similarly for a not found key + let extractor = MultiNameExtractor::new("G", ["g"]); + let res = check_fields_present0([&extractor]); + assert!(matches!(res, Ok(Summary::Unconfigured)), "{res:?}"); + } + + #[test] + fn tracing_subscriber_configured() { + // this will fail if any utils::logging::init callers appear, but let's hope they do not + // appear. + assert!(!super::tracing_subscriber_configured()); + + let _g = setup_current_thread(); + + assert!(super::tracing_subscriber_configured()); + } + + #[test] + fn not_found_when_disabled_by_filter() { let r = tracing_subscriber::registry().with({ - tracing_error::ErrorLayer::default().with_filter( - tracing_subscriber::filter::dynamic_filter_fn(|md, _| { - if md.is_span() && *md.level() == tracing::Level::INFO { - return false; - } - true - }), - ) + tracing_error::ErrorLayer::default().with_filter(tracing_subscriber::filter::filter_fn( + |md| !(md.is_span() && *md.level() == tracing::Level::INFO), + )) }); let _guard = tracing::subscriber::set_default(r); + // this test is a rather tricky one, it has a number of possible outcomes depending on the + // execution order when executed with other tests even if no test sets the global default + // subscriber. + let span = tracing::info_span!("foo", e = "some value"); let _guard = span.enter(); - let extractor = MultiNameExtractor::new("E", ["e"]); - let missing = check_fields_present([&extractor]).unwrap_err(); - assert_missing(missing, vec![&extractor]); + let extractors: [&dyn Extractor; 1] = [&MultiNameExtractor::new("E", ["e"])]; + + if span.is_disabled() { + // the tests are running single threaded, or we got lucky and no other tests subscriber + // was got to register their per-CALLSITE::META interest between `set_default` and + // creation of the span, thus the filter got to apply and registered interest of Never, + // so the span was never created. + // + // as the span is disabled, no keys were recorded to it, leading check_fields_present0 + // to find an error. + + let missing = check_fields_present0(extractors).unwrap_err(); + assert_missing(missing, vec![extractors[0]]); + } else { + // when the span is enabled, it is because some other test is running at the same time, + // and that tests registry has filters which are interested in our above span. + // + // because the span is now enabled, all keys will be found for it. the + // tracing_error::SpanTrace does not consider layer filters during the span hierarchy + // walk (SpanTrace::with_spans), nor is the SpanTrace::status a reliable indicator in + // this test-induced issue. + + let res = check_fields_present0(extractors); + assert!(matches!(res, Ok(Summary::FoundEverything)), "{res:?}"); + } } } diff --git a/pageserver/src/tenant/span.rs b/pageserver/src/tenant/span.rs index a65ad6af47..04e92f4096 100644 --- a/pageserver/src/tenant/span.rs +++ b/pageserver/src/tenant/span.rs @@ -11,10 +11,7 @@ pub(crate) static TENANT_ID_EXTRACTOR: once_cell::sync::Lazy>() - ) + if let Err(missing) = check_fields_present!([&*TENANT_ID_EXTRACTOR]) { + panic!("missing extractors: {missing:?}") } } diff --git a/pageserver/src/tenant/timeline/span.rs b/pageserver/src/tenant/timeline/span.rs index 19a7fdb011..3b580c9d1b 100644 --- a/pageserver/src/tenant/timeline/span.rs +++ b/pageserver/src/tenant/timeline/span.rs @@ -14,10 +14,7 @@ pub(crate) fn debug_assert_current_span_has_tenant_and_timeline_id() { &*crate::tenant::span::TENANT_ID_EXTRACTOR, &*TIMELINE_ID_EXTRACTOR, ]; - if let Err(missing) = check_fields_present(fields) { - panic!( - "missing extractors: {:?}", - missing.into_iter().map(|e| e.name()).collect::>() - ) + if let Err(missing) = check_fields_present!(fields) { + panic!("missing extractors: {missing:?}") } } From 9a69b6cb941cb58a053b5f96f9150d8976e5dc5d Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Fri, 14 Jul 2023 18:59:16 +0300 Subject: [PATCH 22/58] Demote deletion warning, list files (#4688) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Handle test failures like: ``` AssertionError: assert not ['$ts WARN delete_timeline{tenant_id=X timeline_id=Y}: About to remove 1 files\n'] ``` Instead of logging: ``` WARN delete_timeline{tenant_id=X timeline_id=Y}: Found 1 files not bound to index_file.json, proceeding with their deletion WARN delete_timeline{tenant_id=X timeline_id=Y}: About to remove 1 files ``` For each one operation of timeline deletion, list all unref files with `info!`, and then continue to delete them with the added spice of logging the rare/never happening non-utf8 name with `warn!`. Rationale for `info!` instead of `warn!`: this is a normal operation; like we had mentioned in `test_import.py` -- basically whenever we delete a timeline which is not idle. Rationale for N * (`ìnfo!`|`warn!`): symmetry for the layer deletions; if we could ever need those, we could also need these for layer files which are not yet mentioned in `index_part.json`. --------- Co-authored-by: Christian Schwarz --- libs/remote_storage/src/lib.rs | 6 ++++++ pageserver/src/tenant/remote_timeline_client.rs | 14 ++++++++------ test_runner/regress/test_import.py | 6 ------ test_runner/regress/test_remote_storage.py | 3 --- 4 files changed, 14 insertions(+), 15 deletions(-) diff --git a/libs/remote_storage/src/lib.rs b/libs/remote_storage/src/lib.rs index 0e9c237e1e..90f9efa146 100644 --- a/libs/remote_storage/src/lib.rs +++ b/libs/remote_storage/src/lib.rs @@ -50,6 +50,12 @@ const REMOTE_STORAGE_PREFIX_SEPARATOR: char = '/'; #[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord, Hash)] pub struct RemotePath(PathBuf); +impl std::fmt::Display for RemotePath { + fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { + write!(f, "{}", self.0.display()) + } +} + impl RemotePath { pub fn new(relative_path: &Path) -> anyhow::Result { anyhow::ensure!( diff --git a/pageserver/src/tenant/remote_timeline_client.rs b/pageserver/src/tenant/remote_timeline_client.rs index 8c04794e92..0f5a585f3f 100644 --- a/pageserver/src/tenant/remote_timeline_client.rs +++ b/pageserver/src/tenant/remote_timeline_client.rs @@ -840,14 +840,16 @@ impl RemoteTimelineClient { let remaining: Vec = remaining .into_iter() .filter(|p| p.object_name() != Some(IndexPart::FILE_NAME)) + .inspect(|path| { + if let Some(name) = path.object_name() { + info!(%name, "deleting a file not referenced from index_part.json"); + } else { + warn!(%path, "deleting a nameless or non-utf8 object not referenced from index_part.json"); + } + }) .collect(); if !remaining.is_empty() { - warn!( - "Found {} files not bound to index_file.json, proceeding with their deletion", - remaining.len() - ); - warn!("About to remove {} files", remaining.len()); self.storage_impl.delete_objects(&remaining).await?; } @@ -856,7 +858,7 @@ impl RemoteTimelineClient { debug!("deleting index part"); self.storage_impl.delete(&index_file_path).await?; - info!(deletions_queued, "done deleting, including index_part.json"); + info!(prefix=%timeline_storage_path, referenced=deletions_queued, not_referenced=%remaining.len(), "done deleting in timeline prefix, including index_part.json"); Ok(()) } diff --git a/test_runner/regress/test_import.py b/test_runner/regress/test_import.py index 141c69b230..9248c42555 100644 --- a/test_runner/regress/test_import.py +++ b/test_runner/regress/test_import.py @@ -149,12 +149,6 @@ def test_import_from_vanilla(test_output_dir, pg_bin, vanilla_pg, neon_env_build ".*WARN.*ignored .* unexpected bytes after the tar archive.*" ) - # NOTE: delete can easily come before upload operations are completed - # https://github.com/neondatabase/neon/issues/4326 - env.pageserver.allowed_errors.append( - ".*files not bound to index_file.json, proceeding with their deletion.*" - ) - timeline_delete_wait_completed(client, tenant, timeline) # Importing correct backup works diff --git a/test_runner/regress/test_remote_storage.py b/test_runner/regress/test_remote_storage.py index 1b6e39ff31..13bc01f609 100644 --- a/test_runner/regress/test_remote_storage.py +++ b/test_runner/regress/test_remote_storage.py @@ -598,9 +598,6 @@ def test_timeline_deletion_with_files_stuck_in_upload_queue( ".* ERROR .*Error processing HTTP request: InternalServerError\\(timeline is Stopping" ) - env.pageserver.allowed_errors.append( - ".*files not bound to index_file.json, proceeding with their deletion.*" - ) timeline_delete_wait_completed(client, tenant_id, timeline_id) assert not timeline_path.exists() From 1309571f5dcb4f24701ca913ef8160205d6f6a39 Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Fri, 14 Jul 2023 12:11:01 -0400 Subject: [PATCH 23/58] proxy: switch to structopt for clap parsing (#4714) Using `#[clap]` for parsing cli opts, which is easier to maintain. --------- Signed-off-by: Alex Chi Z --- proxy/src/bin/proxy.rs | 219 ++++++++++++++++------------------------- 1 file changed, 84 insertions(+), 135 deletions(-) diff --git a/proxy/src/bin/proxy.rs b/proxy/src/bin/proxy.rs index fc8bc39742..6b46eaddfa 100644 --- a/proxy/src/bin/proxy.rs +++ b/proxy/src/bin/proxy.rs @@ -5,7 +5,6 @@ use proxy::http; use proxy::metrics; use anyhow::bail; -use clap::{self, Arg}; use proxy::config::{self, ProxyConfig}; use std::pin::pin; use std::{borrow::Cow, net::SocketAddr}; @@ -18,6 +17,70 @@ use utils::{project_git_version, sentry_init::init_sentry}; project_git_version!(GIT_VERSION); +use clap::{Parser, ValueEnum}; + +#[derive(Clone, Debug, ValueEnum)] +enum AuthBackend { + Console, + Postgres, + Link, +} + +/// Neon proxy/router +#[derive(Parser)] +#[command(version = GIT_VERSION, about)] +struct ProxyCliArgs { + /// listen for incoming client connections on ip:port + #[clap(short, long, default_value = "127.0.0.1:4432")] + proxy: String, + #[clap(value_enum, long, default_value_t = AuthBackend::Link)] + auth_backend: AuthBackend, + /// listen for management callback connection on ip:port + #[clap(short, long, default_value = "127.0.0.1:7000")] + mgmt: String, + /// listen for incoming http connections (metrics, etc) on ip:port + #[clap(long, default_value = "127.0.0.1:7001")] + http: String, + /// listen for incoming wss connections on ip:port + #[clap(long)] + wss: Option, + /// redirect unauthenticated users to the given uri in case of link auth + #[clap(short, long, default_value = "http://localhost:3000/psql_session/")] + uri: String, + /// cloud API endpoint for authenticating users + #[clap( + short, + long, + default_value = "http://localhost:3000/authenticate_proxy_request/" + )] + auth_endpoint: String, + /// path to TLS key for client postgres connections + /// + /// tls-key and tls-cert are for backwards compatibility, we can put all certs in one dir + #[clap(short = 'k', long, alias = "ssl-key")] + tls_key: Option, + /// path to TLS cert for client postgres connections + /// + /// tls-key and tls-cert are for backwards compatibility, we can put all certs in one dir + #[clap(short = 'c', long, alias = "ssl-cert")] + tls_cert: Option, + /// path to directory with TLS certificates for client postgres connections + #[clap(long)] + certs_dir: Option, + /// http endpoint to receive periodic metric updates + #[clap(long)] + metric_collection_endpoint: Option, + /// how often metrics should be sent to a collection endpoint + #[clap(long)] + metric_collection_interval: Option, + /// cache for `wake_compute` api method (use `size=0` to disable) + #[clap(long, default_value = config::CacheOptions::DEFAULT_OPTIONS_NODE_INFO)] + wake_compute_cache: String, + /// Allow self-signed certificates for compute nodes (for testing) + #[clap(long, default_value_t = false, value_parser = clap::builder::BoolishValueParser::new(), action = clap::ArgAction::Set)] + allow_self_signed_compute: bool, +} + #[tokio::main] async fn main() -> anyhow::Result<()> { let _logging_guard = proxy::logging::init().await?; @@ -27,21 +90,21 @@ async fn main() -> anyhow::Result<()> { info!("Version: {GIT_VERSION}"); ::metrics::set_build_info_metric(GIT_VERSION); - let args = cli().get_matches(); + let args = ProxyCliArgs::parse(); let config = build_config(&args)?; info!("Authentication backend: {}", config.auth_backend); // Check that we can bind to address before further initialization - let http_address: SocketAddr = args.get_one::("http").unwrap().parse()?; + let http_address: SocketAddr = args.http.parse()?; info!("Starting http on {http_address}"); let http_listener = TcpListener::bind(http_address).await?.into_std()?; - let mgmt_address: SocketAddr = args.get_one::("mgmt").unwrap().parse()?; + let mgmt_address: SocketAddr = args.mgmt.parse()?; info!("Starting mgmt on {mgmt_address}"); let mgmt_listener = TcpListener::bind(mgmt_address).await?; - let proxy_address: SocketAddr = args.get_one::("proxy").unwrap().parse()?; + let proxy_address: SocketAddr = args.proxy.parse()?; info!("Starting proxy on {proxy_address}"); let proxy_listener = TcpListener::bind(proxy_address).await?; let cancellation_token = CancellationToken::new(); @@ -55,7 +118,7 @@ async fn main() -> anyhow::Result<()> { cancellation_token.clone(), )); - if let Some(wss_address) = args.get_one::("wss") { + if let Some(wss_address) = args.wss { let wss_address: SocketAddr = wss_address.parse()?; info!("Starting wss on {wss_address}"); let wss_listener = TcpListener::bind(wss_address).await?; @@ -102,31 +165,24 @@ async fn main() -> anyhow::Result<()> { } /// ProxyConfig is created at proxy startup, and lives forever. -fn build_config(args: &clap::ArgMatches) -> anyhow::Result<&'static ProxyConfig> { - let tls_config = match ( - args.get_one::("tls-key"), - args.get_one::("tls-cert"), - ) { +fn build_config(args: &ProxyCliArgs) -> anyhow::Result<&'static ProxyConfig> { + let tls_config = match (&args.tls_key, &args.tls_cert) { (Some(key_path), Some(cert_path)) => Some(config::configure_tls( key_path, cert_path, - args.get_one::("certs-dir"), + args.certs_dir.as_ref(), )?), (None, None) => None, _ => bail!("either both or neither tls-key and tls-cert must be specified"), }; - let allow_self_signed_compute: bool = args - .get_one::("allow-self-signed-compute") - .unwrap() - .parse()?; - if allow_self_signed_compute { + if args.allow_self_signed_compute { warn!("allowing self-signed compute certificates"); } let metric_collection = match ( - args.get_one::("metric-collection-endpoint"), - args.get_one::("metric-collection-interval"), + &args.metric_collection_endpoint, + &args.metric_collection_interval, ) { (Some(endpoint), Some(interval)) => Some(config::MetricCollectionConfig { endpoint: endpoint.parse()?, @@ -139,145 +195,38 @@ fn build_config(args: &clap::ArgMatches) -> anyhow::Result<&'static ProxyConfig> ), }; - let auth_backend = match args.get_one::("auth-backend").unwrap().as_str() { - "console" => { - let config::CacheOptions { size, ttl } = args - .get_one::("wake-compute-cache") - .unwrap() - .parse()?; + let auth_backend = match &args.auth_backend { + AuthBackend::Console => { + let config::CacheOptions { size, ttl } = args.wake_compute_cache.parse()?; info!("Using NodeInfoCache (wake_compute) with size={size} ttl={ttl:?}"); let caches = Box::leak(Box::new(console::caches::ApiCaches { node_info: console::caches::NodeInfoCache::new("node_info_cache", size, ttl), })); - let url = args.get_one::("auth-endpoint").unwrap().parse()?; + let url = args.auth_endpoint.parse()?; let endpoint = http::Endpoint::new(url, http::new_client()); let api = console::provider::neon::Api::new(endpoint, caches); auth::BackendType::Console(Cow::Owned(api), ()) } - "postgres" => { - let url = args.get_one::("auth-endpoint").unwrap().parse()?; + AuthBackend::Postgres => { + let url = args.auth_endpoint.parse()?; let api = console::provider::mock::Api::new(url); auth::BackendType::Postgres(Cow::Owned(api), ()) } - "link" => { - let url = args.get_one::("uri").unwrap().parse()?; + AuthBackend::Link => { + let url = args.uri.parse()?; auth::BackendType::Link(Cow::Owned(url)) } - other => bail!("unsupported auth backend: {other}"), }; let config = Box::leak(Box::new(ProxyConfig { tls_config, auth_backend, metric_collection, - allow_self_signed_compute, + allow_self_signed_compute: args.allow_self_signed_compute, })); Ok(config) } - -fn cli() -> clap::Command { - clap::Command::new("Neon proxy/router") - .disable_help_flag(true) - .version(GIT_VERSION) - .arg( - Arg::new("proxy") - .short('p') - .long("proxy") - .help("listen for incoming client connections on ip:port") - .default_value("127.0.0.1:4432"), - ) - .arg( - Arg::new("auth-backend") - .long("auth-backend") - .value_parser(["console", "postgres", "link"]) - .default_value("link"), - ) - .arg( - Arg::new("mgmt") - .short('m') - .long("mgmt") - .help("listen for management callback connection on ip:port") - .default_value("127.0.0.1:7000"), - ) - .arg( - Arg::new("http") - .long("http") - .help("listen for incoming http connections (metrics, etc) on ip:port") - .default_value("127.0.0.1:7001"), - ) - .arg( - Arg::new("wss") - .long("wss") - .help("listen for incoming wss connections on ip:port"), - ) - .arg( - Arg::new("uri") - .short('u') - .long("uri") - .help("redirect unauthenticated users to the given uri in case of link auth") - .default_value("http://localhost:3000/psql_session/"), - ) - .arg( - Arg::new("auth-endpoint") - .short('a') - .long("auth-endpoint") - .help("cloud API endpoint for authenticating users") - .default_value("http://localhost:3000/authenticate_proxy_request/"), - ) - .arg( - Arg::new("tls-key") - .short('k') - .long("tls-key") - .alias("ssl-key") // backwards compatibility - .help("path to TLS key for client postgres connections"), - ) - .arg( - Arg::new("tls-cert") - .short('c') - .long("tls-cert") - .alias("ssl-cert") // backwards compatibility - .help("path to TLS cert for client postgres connections"), - ) - // tls-key and tls-cert are for backwards compatibility, we can put all certs in one dir - .arg( - Arg::new("certs-dir") - .long("certs-dir") - .help("path to directory with TLS certificates for client postgres connections"), - ) - .arg( - Arg::new("metric-collection-endpoint") - .long("metric-collection-endpoint") - .help("http endpoint to receive periodic metric updates"), - ) - .arg( - Arg::new("metric-collection-interval") - .long("metric-collection-interval") - .help("how often metrics should be sent to a collection endpoint"), - ) - .arg( - Arg::new("wake-compute-cache") - .long("wake-compute-cache") - .help("cache for `wake_compute` api method (use `size=0` to disable)") - .default_value(config::CacheOptions::DEFAULT_OPTIONS_NODE_INFO), - ) - .arg( - Arg::new("allow-self-signed-compute") - .long("allow-self-signed-compute") - .help("Allow self-signed certificates for compute nodes (for testing)") - .default_value("false"), - ) -} - -#[cfg(test)] -mod tests { - use super::*; - - #[test] - fn verify_cli() { - cli().debug_assert(); - } -} From e767ced8d078fd22c7e82b567e9707d11bee44c7 Mon Sep 17 00:00:00 2001 From: Vadim Kharitonov Date: Fri, 14 Jul 2023 18:34:01 +0200 Subject: [PATCH 24/58] Update rust to 1.71.0 (#4718) Co-authored-by: Joonas Koivunen --- libs/pq_proto/src/lib.rs | 18 +++++++++--------- libs/remote_storage/src/local_fs.rs | 5 +---- .../layer_map/historic_layer_coverage.rs | 3 +-- .../src/tenant/layer_map/layer_coverage.rs | 3 +-- rust-toolchain.toml | 2 +- 5 files changed, 13 insertions(+), 18 deletions(-) diff --git a/libs/pq_proto/src/lib.rs b/libs/pq_proto/src/lib.rs index 8e361b757c..5c5e8a9559 100644 --- a/libs/pq_proto/src/lib.rs +++ b/libs/pq_proto/src/lib.rs @@ -934,6 +934,15 @@ impl<'a> BeMessage<'a> { } } +fn terminate_code(code: &[u8; 5]) -> [u8; 6] { + let mut terminated = [0; 6]; + for (i, &elem) in code.iter().enumerate() { + terminated[i] = elem; + } + + terminated +} + #[cfg(test)] mod tests { use super::*; @@ -965,12 +974,3 @@ mod tests { assert_eq!(split_options(¶ms), ["foo bar", " \\", "baz ", "lol"]); } } - -fn terminate_code(code: &[u8; 5]) -> [u8; 6] { - let mut terminated = [0; 6]; - for (i, &elem) in code.iter().enumerate() { - terminated[i] = elem; - } - - terminated -} diff --git a/libs/remote_storage/src/local_fs.rs b/libs/remote_storage/src/local_fs.rs index 36fd2647c5..f1095ad8b8 100644 --- a/libs/remote_storage/src/local_fs.rs +++ b/libs/remote_storage/src/local_fs.rs @@ -151,10 +151,7 @@ impl RemoteStorage for LocalFs { let mut files = vec![]; let mut directory_queue = vec![full_path.clone()]; - while !directory_queue.is_empty() { - let cur_folder = directory_queue - .pop() - .expect("queue cannot be empty: we just checked"); + while let Some(cur_folder) = directory_queue.pop() { let mut entries = fs::read_dir(cur_folder.clone()).await?; while let Some(entry) = entries.next_entry().await? { let file_name: PathBuf = entry.file_name().into(); diff --git a/pageserver/src/tenant/layer_map/historic_layer_coverage.rs b/pageserver/src/tenant/layer_map/historic_layer_coverage.rs index 0f51597027..ff55fb7374 100644 --- a/pageserver/src/tenant/layer_map/historic_layer_coverage.rs +++ b/pageserver/src/tenant/layer_map/historic_layer_coverage.rs @@ -122,8 +122,7 @@ impl HistoricLayerCoverage { self.head = self .historic .iter() - .rev() - .next() + .next_back() .map(|(_, v)| v.clone()) .unwrap_or_default(); } diff --git a/pageserver/src/tenant/layer_map/layer_coverage.rs b/pageserver/src/tenant/layer_map/layer_coverage.rs index 47aace97a5..f940f8e3f7 100644 --- a/pageserver/src/tenant/layer_map/layer_coverage.rs +++ b/pageserver/src/tenant/layer_map/layer_coverage.rs @@ -113,8 +113,7 @@ impl LayerCoverage { pub fn query(&self, key: i128) -> Option { self.nodes .range(..=key) - .rev() - .next()? + .next_back()? .1 .as_ref() .map(|(_, v)| v.clone()) diff --git a/rust-toolchain.toml b/rust-toolchain.toml index 6abb435018..0ce368ff9d 100644 --- a/rust-toolchain.toml +++ b/rust-toolchain.toml @@ -1,5 +1,5 @@ [toolchain] -channel = "1.70.0" +channel = "1.71.0" profile = "default" # The default profile includes rustc, rust-std, cargo, rust-docs, rustfmt and clippy. # https://rust-lang.github.io/rustup/concepts/profiles.html From 982fce1e727211009e002db8675d4a3c73b21439 Mon Sep 17 00:00:00 2001 From: arpad-m Date: Sat, 15 Jul 2023 04:11:25 +0200 Subject: [PATCH 25/58] Fix rustdoc warnings and test cargo doc in CI (#4711) ## Problem `cargo +nightly doc` is giving a lot of warnings: broken links, naked URLs, etc. ## Summary of changes * update the `proc-macro2` dependency so that it can compile on latest Rust nightly, see https://github.com/dtolnay/proc-macro2/pull/391 and https://github.com/dtolnay/proc-macro2/issues/398 * allow the `private_intra_doc_links` lint, as linking to something that's private is always more useful than just mentioning it without a link: if the link breaks in the future, at least there is a warning due to that. Also, one might enable [`--document-private-items`](https://doc.rust-lang.org/cargo/commands/cargo-doc.html#documentation-options) in the future and make these links work in general. * fix all the remaining warnings given by `cargo +nightly doc` * make it possible to run `cargo doc` on stable Rust by updating `opentelemetry` and associated crates to version 0.19, pulling in a fix that previously broke `cargo doc` on stable: https://github.com/open-telemetry/opentelemetry-rust/pull/904 * Add `cargo doc` to CI to ensure that it won't get broken in the future. Fixes #2557 ## Future work * Potentially, it might make sense, for development purposes, to publish the generated rustdocs somewhere, like for example [how the rust compiler does it](https://doc.rust-lang.org/nightly/nightly-rustc/rustc_driver/index.html). I will file an issue for discussion. --- .cargo/config.toml | 5 ++ .github/workflows/build_and_test.yml | 5 ++ Cargo.lock | 58 +++++++------------ Cargo.toml | 10 ++-- compute_tools/src/pg_helpers.rs | 2 +- control_plane/src/background_process.rs | 2 +- control_plane/src/broker.rs | 3 +- control_plane/src/endpoint.rs | 4 +- control_plane/src/safekeeper.rs | 3 +- libs/metrics/src/metric_vec_duration.rs | 2 +- libs/pageserver_api/src/models.rs | 6 +- libs/pageserver_api/src/reltag.rs | 3 +- libs/postgres_ffi/src/relfile_utils.rs | 4 +- libs/pq_proto/src/framed.rs | 6 +- libs/remote_storage/src/lib.rs | 6 +- libs/tenant_size_model/src/calculation.rs | 2 +- libs/tracing-utils/src/http.rs | 2 +- libs/utils/src/http/json.rs | 2 +- libs/utils/src/lib.rs | 4 +- libs/utils/src/lock_file.rs | 9 +-- libs/utils/src/logging.rs | 2 +- libs/utils/src/seqwait.rs | 6 +- libs/utils/src/tracing_span_assert.rs | 2 +- pageserver/ctl/src/draw_timeline_dir.rs | 6 +- pageserver/src/config.rs | 6 +- pageserver/src/context.rs | 3 + pageserver/src/http/routes.rs | 2 +- pageserver/src/metrics.rs | 10 ++-- pageserver/src/pgdatadir_mapping.rs | 2 +- pageserver/src/task_mgr.rs | 13 +++-- pageserver/src/tenant.rs | 18 +++--- pageserver/src/tenant/disk_btree.rs | 2 +- pageserver/src/tenant/layer_map.rs | 4 +- .../layer_map/historic_layer_coverage.rs | 2 +- .../src/tenant/layer_map/layer_coverage.rs | 4 +- pageserver/src/tenant/manifest.rs | 2 +- pageserver/src/tenant/metadata.rs | 4 +- .../src/tenant/remote_timeline_client.rs | 8 ++- pageserver/src/tenant/size.rs | 4 +- pageserver/src/tenant/storage_layer.rs | 18 ++++-- .../src/tenant/storage_layer/delta_layer.rs | 8 ++- .../src/tenant/storage_layer/filename.rs | 5 +- .../src/tenant/storage_layer/image_layer.rs | 6 +- .../src/tenant/storage_layer/remote_layer.rs | 4 +- pageserver/src/tenant/timeline.rs | 32 ++++++---- .../walreceiver/connection_manager.rs | 2 +- proxy/src/cancellation.rs | 2 +- proxy/src/compute.rs | 2 +- proxy/src/config.rs | 2 +- proxy/src/console/provider.rs | 2 +- proxy/src/scram.rs | 2 +- safekeeper/src/control_file.rs | 5 +- safekeeper/src/timelines_global_map.rs | 2 +- safekeeper/src/wal_storage.rs | 6 +- test_runner/regress/test_tenant_detach.py | 2 +- 55 files changed, 200 insertions(+), 138 deletions(-) diff --git a/.cargo/config.toml b/.cargo/config.toml index 8fddaa2dd4..cc767a7f68 100644 --- a/.cargo/config.toml +++ b/.cargo/config.toml @@ -12,6 +12,11 @@ opt-level = 3 # Turn on a small amount of optimization in Development mode. opt-level = 1 +[build] +# This is only present for local builds, as it will be overridden +# by the RUSTDOCFLAGS env var in CI. +rustdocflags = ["-Arustdoc::private_intra_doc_links"] + [alias] build_testing = ["build", "--features", "testing"] neon = ["run", "--bin", "neon_local"] diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index 873f8570fc..fb19d54aaa 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -127,6 +127,11 @@ jobs: - name: Run cargo clippy (release) run: cargo hack --feature-powerset clippy --release $CLIPPY_COMMON_ARGS + - name: Check documentation generation + run: cargo doc --workspace --no-deps --document-private-items + env: + RUSTDOCFLAGS: "-Dwarnings -Arustdoc::private_intra_doc_links" + # Use `${{ !cancelled() }}` to run quck tests after the longer clippy run - name: Check formatting if: ${{ !cancelled() }} diff --git a/Cargo.lock b/Cargo.lock index 45f5acce7d..6bbb5dbfa2 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -2379,9 +2379,9 @@ dependencies = [ [[package]] name = "opentelemetry" -version = "0.18.0" +version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "69d6c3d7288a106c0a363e4b0e8d308058d56902adefb16f4936f417ffef086e" +checksum = "5f4b8347cc26099d3aeee044065ecc3ae11469796b4d65d065a23a584ed92a6f" dependencies = [ "opentelemetry_api", "opentelemetry_sdk", @@ -2389,9 +2389,9 @@ dependencies = [ [[package]] name = "opentelemetry-http" -version = "0.7.0" +version = "0.8.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1edc79add46364183ece1a4542592ca593e6421c60807232f5b8f7a31703825d" +checksum = "a819b71d6530c4297b49b3cae2939ab3a8cc1b9f382826a1bc29dd0ca3864906" dependencies = [ "async-trait", "bytes", @@ -2402,9 +2402,9 @@ dependencies = [ [[package]] name = "opentelemetry-otlp" -version = "0.11.0" +version = "0.12.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d1c928609d087790fc936a1067bdc310ae702bdf3b090c3f281b713622c8bbde" +checksum = "8af72d59a4484654ea8eb183fea5ae4eb6a41d7ac3e3bae5f4d2a282a3a7d3ca" dependencies = [ "async-trait", "futures", @@ -2420,48 +2420,47 @@ dependencies = [ [[package]] name = "opentelemetry-proto" -version = "0.1.0" +version = "0.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "d61a2f56df5574508dd86aaca016c917489e589ece4141df1b5e349af8d66c28" +checksum = "045f8eea8c0fa19f7d48e7bc3128a39c2e5c533d5c61298c548dfefc1064474c" dependencies = [ "futures", "futures-util", "opentelemetry", "prost", "tonic 0.8.3", - "tonic-build 0.8.4", ] [[package]] name = "opentelemetry-semantic-conventions" -version = "0.10.0" +version = "0.11.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "9b02e0230abb0ab6636d18e2ba8fa02903ea63772281340ccac18e0af3ec9eeb" +checksum = "24e33428e6bf08c6f7fcea4ddb8e358fab0fe48ab877a87c70c6ebe20f673ce5" dependencies = [ "opentelemetry", ] [[package]] name = "opentelemetry_api" -version = "0.18.0" +version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "c24f96e21e7acc813c7a8394ee94978929db2bcc46cf6b5014fc612bf7760c22" +checksum = "ed41783a5bf567688eb38372f2b7a8530f5a607a4b49d38dd7573236c23ca7e2" dependencies = [ "fnv", "futures-channel", "futures-util", "indexmap", - "js-sys", "once_cell", "pin-project-lite", "thiserror", + "urlencoding", ] [[package]] name = "opentelemetry_sdk" -version = "0.18.0" +version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "1ca41c4933371b61c2a2f214bf16931499af4ec90543604ec828f7a625c09113" +checksum = "8b3a2a91fdbfdd4d212c0dcc2ab540de2c2bcbbd90be17de7a7daf8822d010c1" dependencies = [ "async-trait", "crossbeam-channel", @@ -2937,9 +2936,9 @@ checksum = "dc375e1527247fe1a97d8b7156678dfe7c1af2fc075c9a4db3690ecd2a148068" [[package]] name = "proc-macro2" -version = "1.0.58" +version = "1.0.64" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "fa1fb82fc0c281dd9671101b66b771ebbe1eaf967b96ac8740dcba4b70005ca8" +checksum = "78803b62cbf1f46fde80d7c0e803111524b9877184cfe7c3033659490ac7a7da" dependencies = [ "unicode-ident", ] @@ -3328,9 +3327,9 @@ dependencies = [ [[package]] name = "reqwest-tracing" -version = "0.4.4" +version = "0.4.5" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "783e8130d2427ddd7897dd3f814d4a3aea31b05deb42a4fdf8c18258fe5aefd1" +checksum = "1b97ad83c2fc18113346b7158d79732242002427c30f620fa817c1f32901e0a8" dependencies = [ "anyhow", "async-trait", @@ -3998,7 +3997,7 @@ dependencies = [ "tokio", "tokio-stream", "tonic 0.9.2", - "tonic-build 0.9.2", + "tonic-build", "tracing", "utils", "workspace_hack", @@ -4516,19 +4515,6 @@ dependencies = [ "tracing", ] -[[package]] -name = "tonic-build" -version = "0.8.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "5bf5e9b9c0f7e0a7c027dcfaba7b2c60816c7049171f679d99ee2ff65d0de8c4" -dependencies = [ - "prettyplease 0.1.25", - "proc-macro2", - "prost-build", - "quote", - "syn 1.0.109", -] - [[package]] name = "tonic-build" version = "0.9.2" @@ -4652,9 +4638,9 @@ dependencies = [ [[package]] name = "tracing-opentelemetry" -version = "0.18.0" +version = "0.19.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "21ebb87a95ea13271332df069020513ab70bdb5637ca42d6e492dc3bbbad48de" +checksum = "00a39dcf9bfc1742fa4d6215253b33a6e474be78275884c216fc2a06267b3600" dependencies = [ "once_cell", "opentelemetry", diff --git a/Cargo.toml b/Cargo.toml index 6d35334deb..6ae31c13ac 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -84,9 +84,9 @@ notify = "5.0.0" num_cpus = "1.15" num-traits = "0.2.15" once_cell = "1.13" -opentelemetry = "0.18.0" -opentelemetry-otlp = { version = "0.11.0", default_features=false, features = ["http-proto", "trace", "http", "reqwest-client"] } -opentelemetry-semantic-conventions = "0.10.0" +opentelemetry = "0.19.0" +opentelemetry-otlp = { version = "0.12.0", default_features=false, features = ["http-proto", "trace", "http", "reqwest-client"] } +opentelemetry-semantic-conventions = "0.11.0" parking_lot = "0.12" pbkdf2 = "0.12.1" pin-project-lite = "0.2" @@ -95,7 +95,7 @@ prost = "0.11" rand = "0.8" regex = "1.4" reqwest = { version = "0.11", default-features = false, features = ["rustls-tls"] } -reqwest-tracing = { version = "0.4.0", features = ["opentelemetry_0_18"] } +reqwest-tracing = { version = "0.4.0", features = ["opentelemetry_0_19"] } reqwest-middleware = "0.2.0" reqwest-retry = "0.2.2" routerify = "3" @@ -130,7 +130,7 @@ toml_edit = "0.19" tonic = {version = "0.9", features = ["tls", "tls-roots"]} tracing = "0.1" tracing-error = "0.2.0" -tracing-opentelemetry = "0.18.0" +tracing-opentelemetry = "0.19.0" tracing-subscriber = { version = "0.3", default_features = false, features = ["smallvec", "fmt", "tracing-log", "std", "env-filter"] } url = "2.2" uuid = { version = "1.2", features = ["v4", "serde"] } diff --git a/compute_tools/src/pg_helpers.rs b/compute_tools/src/pg_helpers.rs index 75550978d8..b94a97a126 100644 --- a/compute_tools/src/pg_helpers.rs +++ b/compute_tools/src/pg_helpers.rs @@ -19,7 +19,7 @@ const POSTGRES_WAIT_TIMEOUT: Duration = Duration::from_millis(60 * 1000); // mil /// Escape a string for including it in a SQL literal. Wrapping the result /// with `E'{}'` or `'{}'` is not required, as it returns a ready-to-use /// SQL string literal, e.g. `'db'''` or `E'db\\'`. -/// See https://github.com/postgres/postgres/blob/da98d005cdbcd45af563d0c4ac86d0e9772cd15f/src/backend/utils/adt/quote.c#L47 +/// See /// for the original implementation. pub fn escape_literal(s: &str) -> String { let res = s.replace('\'', "''").replace('\\', "\\\\"); diff --git a/control_plane/src/background_process.rs b/control_plane/src/background_process.rs index 00af1a1d53..64664d65ff 100644 --- a/control_plane/src/background_process.rs +++ b/control_plane/src/background_process.rs @@ -10,7 +10,7 @@ //! (non-Neon binaries don't necessarily follow our pidfile conventions). //! The pid stored in the file is later used to stop the service. //! -//! See [`lock_file`] module for more info. +//! See the [`lock_file`](utils::lock_file) module for more info. use std::ffi::OsStr; use std::io::Write; diff --git a/control_plane/src/broker.rs b/control_plane/src/broker.rs index ad19dfa204..8d40c7afc1 100644 --- a/control_plane/src/broker.rs +++ b/control_plane/src/broker.rs @@ -2,8 +2,9 @@ //! //! In the local test environment, the data for each safekeeper is stored in //! +//! ```text //! .neon/safekeepers/ -//! +//! ``` use anyhow::Context; use std::path::PathBuf; diff --git a/control_plane/src/endpoint.rs b/control_plane/src/endpoint.rs index ab921d096f..ff373d7111 100644 --- a/control_plane/src/endpoint.rs +++ b/control_plane/src/endpoint.rs @@ -2,7 +2,9 @@ //! //! In the local test environment, the data for each endpoint is stored in //! +//! ```text //! .neon/endpoints/ +//! ``` //! //! Some basic information about the endpoint, like the tenant and timeline IDs, //! are stored in the `endpoint.json` file. The `endpoint.json` file is created @@ -22,7 +24,7 @@ //! //! Directory contents: //! -//! ```ignore +//! ```text //! .neon/endpoints/main/ //! compute.log - log output of `compute_ctl` and `postgres` //! endpoint.json - serialized `EndpointConf` struct diff --git a/control_plane/src/safekeeper.rs b/control_plane/src/safekeeper.rs index 9e053ff1f1..d5e0fb112f 100644 --- a/control_plane/src/safekeeper.rs +++ b/control_plane/src/safekeeper.rs @@ -2,8 +2,9 @@ //! //! In the local test environment, the data for each safekeeper is stored in //! +//! ```text //! .neon/safekeepers/ -//! +//! ``` use std::io::Write; use std::path::PathBuf; use std::process::Child; diff --git a/libs/metrics/src/metric_vec_duration.rs b/libs/metrics/src/metric_vec_duration.rs index 840f60f19b..e9a0a65570 100644 --- a/libs/metrics/src/metric_vec_duration.rs +++ b/libs/metrics/src/metric_vec_duration.rs @@ -1,4 +1,4 @@ -//! Helpers for observing duration on HistogramVec / CounterVec / GaugeVec / MetricVec. +//! Helpers for observing duration on `HistogramVec` / `CounterVec` / `GaugeVec` / `MetricVec`. use std::{future::Future, time::Instant}; diff --git a/libs/pageserver_api/src/models.rs b/libs/pageserver_api/src/models.rs index df5f5896a1..4c6529ffab 100644 --- a/libs/pageserver_api/src/models.rs +++ b/libs/pageserver_api/src/models.rs @@ -411,12 +411,16 @@ pub struct LayerResidenceEvent { pub reason: LayerResidenceEventReason, } -/// The reason for recording a given [`ResidenceEvent`]. +/// The reason for recording a given [`LayerResidenceEvent`]. #[derive(Debug, Clone, Copy, Serialize, Deserialize)] pub enum LayerResidenceEventReason { /// The layer map is being populated, e.g. during timeline load or attach. /// This includes [`RemoteLayer`] objects created in [`reconcile_with_remote`]. /// We need to record such events because there is no persistent storage for the events. + /// + // https://github.com/rust-lang/rust/issues/74481 + /// [`RemoteLayer`]: ../../tenant/storage_layer/struct.RemoteLayer.html + /// [`reconcile_with_remote`]: ../../tenant/struct.Timeline.html#method.reconcile_with_remote LayerLoad, /// We just created the layer (e.g., freeze_and_flush or compaction). /// Such layers are always [`LayerResidenceStatus::Resident`]. diff --git a/libs/pageserver_api/src/reltag.rs b/libs/pageserver_api/src/reltag.rs index 12693379f5..c98ad259bf 100644 --- a/libs/pageserver_api/src/reltag.rs +++ b/libs/pageserver_api/src/reltag.rs @@ -60,8 +60,9 @@ impl Ord for RelTag { /// Display RelTag in the same format that's used in most PostgreSQL debug messages: /// +/// ```text /// //[_fsm|_vm|_init] -/// +/// ``` impl fmt::Display for RelTag { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { if let Some(forkname) = forknumber_to_name(self.forknum) { diff --git a/libs/postgres_ffi/src/relfile_utils.rs b/libs/postgres_ffi/src/relfile_utils.rs index 1dc9f367ff..aa0e625b47 100644 --- a/libs/postgres_ffi/src/relfile_utils.rs +++ b/libs/postgres_ffi/src/relfile_utils.rs @@ -49,14 +49,16 @@ pub fn forknumber_to_name(forknum: u8) -> Option<&'static str> { } } -/// /// Parse a filename of a relation file. Returns (relfilenode, forknum, segno) tuple. /// /// Formats: +/// +/// ```text /// /// _ /// . /// _. +/// ``` /// /// See functions relpath() and _mdfd_segpath() in PostgreSQL sources. /// diff --git a/libs/pq_proto/src/framed.rs b/libs/pq_proto/src/framed.rs index 3cdca45009..c12898a05c 100644 --- a/libs/pq_proto/src/framed.rs +++ b/libs/pq_proto/src/framed.rs @@ -5,11 +5,11 @@ //! It is similar to what tokio_util::codec::Framed with appropriate codec //! provides, but `FramedReader` and `FramedWriter` read/write parts can be used //! separately without using split from futures::stream::StreamExt (which -//! allocates box[1] in polling internally). tokio::io::split is used for splitting +//! allocates a [Box] in polling internally). tokio::io::split is used for splitting //! instead. Plus we customize error messages more than a single type for all io //! calls. //! -//! [1] https://docs.rs/futures-util/0.3.26/src/futures_util/lock/bilock.rs.html#107 +//! [Box]: https://docs.rs/futures-util/0.3.26/src/futures_util/lock/bilock.rs.html#107 use bytes::{Buf, BytesMut}; use std::{ future::Future, @@ -117,7 +117,7 @@ impl Framed { impl Framed { /// Split into owned read and write parts. Beware of potential issues with /// using halves in different tasks on TLS stream: - /// https://github.com/tokio-rs/tls/issues/40 + /// pub fn split(self) -> (FramedReader, FramedWriter) { let (read_half, write_half) = tokio::io::split(self.stream); let reader = FramedReader { diff --git a/libs/remote_storage/src/lib.rs b/libs/remote_storage/src/lib.rs index 90f9efa146..92ef793a34 100644 --- a/libs/remote_storage/src/lib.rs +++ b/libs/remote_storage/src/lib.rs @@ -34,12 +34,12 @@ pub const DEFAULT_REMOTE_STORAGE_MAX_CONCURRENT_SYNCS: usize = 50; pub const DEFAULT_REMOTE_STORAGE_MAX_SYNC_ERRORS: u32 = 10; /// Currently, sync happens with AWS S3, that has two limits on requests per second: /// ~200 RPS for IAM services -/// https://docs.aws.amazon.com/AmazonRDS/latest/AuroraUserGuide/UsingWithRDS.IAMDBAuth.html +/// /// ~3500 PUT/COPY/POST/DELETE or 5500 GET/HEAD S3 requests -/// https://aws.amazon.com/premiumsupport/knowledge-center/s3-request-limit-avoid-throttling/ +/// pub const DEFAULT_REMOTE_STORAGE_S3_CONCURRENCY_LIMIT: usize = 100; /// No limits on the client side, which currenltly means 1000 for AWS S3. -/// https://docs.aws.amazon.com/AmazonS3/latest/API/API_ListObjectsV2.html#API_ListObjectsV2_RequestSyntax +/// pub const DEFAULT_MAX_KEYS_PER_LIST_RESPONSE: Option = None; const REMOTE_STORAGE_PREFIX_SEPARATOR: char = '/'; diff --git a/libs/tenant_size_model/src/calculation.rs b/libs/tenant_size_model/src/calculation.rs index 093b053675..f05997ee65 100644 --- a/libs/tenant_size_model/src/calculation.rs +++ b/libs/tenant_size_model/src/calculation.rs @@ -21,7 +21,7 @@ use crate::{SegmentMethod, SegmentSizeResult, SizeResult, StorageModel}; // 2. D+C+a+b // 3. D+A+B -/// [`Segment`] which has had it's size calculated. +/// `Segment` which has had its size calculated. #[derive(Clone, Debug)] struct SegmentSize { method: SegmentMethod, diff --git a/libs/tracing-utils/src/http.rs b/libs/tracing-utils/src/http.rs index 3f80f49de1..f5ab267ff3 100644 --- a/libs/tracing-utils/src/http.rs +++ b/libs/tracing-utils/src/http.rs @@ -33,7 +33,7 @@ pub enum OtelName<'a> { /// directly into HTTP servers. However, I couldn't find one for Hyper, /// so I had to write our own. OpenTelemetry website has a registry of /// instrumentation libraries at: -/// https://opentelemetry.io/registry/?language=rust&component=instrumentation +/// /// If a Hyper crate appears, consider switching to that. pub async fn tracing_handler( req: Request, diff --git a/libs/utils/src/http/json.rs b/libs/utils/src/http/json.rs index 9c153033cb..70e682cb76 100644 --- a/libs/utils/src/http/json.rs +++ b/libs/utils/src/http/json.rs @@ -14,7 +14,7 @@ pub async fn json_request Deserialize<'de>>( .map_err(ApiError::BadRequest) } -/// Will be removed as part of https://github.com/neondatabase/neon/issues/4282 +/// Will be removed as part of pub async fn json_request_or_empty_body Deserialize<'de>>( request: &mut Request, ) -> Result, ApiError> { diff --git a/libs/utils/src/lib.rs b/libs/utils/src/lib.rs index c3558443c3..3bcb092ba7 100644 --- a/libs/utils/src/lib.rs +++ b/libs/utils/src/lib.rs @@ -130,8 +130,8 @@ pub use failpoint_macro_helpers::failpoint_sleep_helper; /// Note that with git_version prefix is `git:` and in case of git version from env its `git-env:`. /// /// ############################################################################################# -/// TODO this macro is not the way the library is intended to be used, see https://github.com/neondatabase/neon/issues/1565 for details. -/// We use `cachepot` to reduce our current CI build times: https://github.com/neondatabase/cloud/pull/1033#issuecomment-1100935036 +/// TODO this macro is not the way the library is intended to be used, see for details. +/// We use `cachepot` to reduce our current CI build times: /// Yet, it seems to ignore the GIT_VERSION env variable, passed to Docker build, even with build.rs that contains /// `println!("cargo:rerun-if-env-changed=GIT_VERSION");` code for cachepot cache invalidation. /// The problem needs further investigation and regular `const` declaration instead of a macro. diff --git a/libs/utils/src/lock_file.rs b/libs/utils/src/lock_file.rs index adbf47eb7a..ca8295040c 100644 --- a/libs/utils/src/lock_file.rs +++ b/libs/utils/src/lock_file.rs @@ -1,9 +1,10 @@ //! A module to create and read lock files. //! //! File locking is done using [`fcntl::flock`] exclusive locks. -//! The only consumer of this module is currently [`pid_file`]. -//! See the module-level comment there for potential pitfalls -//! with lock files that are used to store PIDs (pidfiles). +//! The only consumer of this module is currently +//! [`pid_file`](crate::pid_file). See the module-level comment +//! there for potential pitfalls with lock files that are used +//! to store PIDs (pidfiles). use std::{ fs, @@ -81,7 +82,7 @@ pub fn create_exclusive(lock_file_path: &Path) -> anyhow::Result TracingPanicHookGuard { diff --git a/libs/utils/src/seqwait.rs b/libs/utils/src/seqwait.rs index 70cf4a1ce9..014887392e 100644 --- a/libs/utils/src/seqwait.rs +++ b/libs/utils/src/seqwait.rs @@ -23,9 +23,9 @@ pub enum SeqWaitError { /// Monotonically increasing value /// -/// It is handy to store some other fields under the same mutex in SeqWait +/// It is handy to store some other fields under the same mutex in `SeqWait` /// (e.g. store prev_record_lsn). So we allow SeqWait to be parametrized with -/// any type that can expose counter. is the type of exposed counter. +/// any type that can expose counter. `V` is the type of exposed counter. pub trait MonotonicCounter { /// Bump counter value and check that it goes forward /// N.B.: new_val is an actual new value, not a difference. @@ -90,7 +90,7 @@ impl Eq for Waiter {} /// [`wait_for`]: SeqWait::wait_for /// [`advance`]: SeqWait::advance /// -/// means Storage, is type of counter that this storage exposes. +/// `S` means Storage, `V` is type of counter that this storage exposes. /// pub struct SeqWait where diff --git a/libs/utils/src/tracing_span_assert.rs b/libs/utils/src/tracing_span_assert.rs index 02c3ea0361..926bfc3188 100644 --- a/libs/utils/src/tracing_span_assert.rs +++ b/libs/utils/src/tracing_span_assert.rs @@ -35,7 +35,7 @@ //! # } //! ``` //! -//! Recommended reading: https://docs.rs/tracing-subscriber/0.3.16/tracing_subscriber/layer/index.html#per-layer-filtering +//! Recommended reading: //! #[derive(Debug)] diff --git a/pageserver/ctl/src/draw_timeline_dir.rs b/pageserver/ctl/src/draw_timeline_dir.rs index 43e0c4422c..568078808f 100644 --- a/pageserver/ctl/src/draw_timeline_dir.rs +++ b/pageserver/ctl/src/draw_timeline_dir.rs @@ -7,10 +7,10 @@ //! - The y axis represents LSN, growing upwards. //! //! Coordinates in both axis are compressed for better readability. -//! (see https://medium.com/algorithms-digest/coordinate-compression-2fff95326fb) +//! (see ) //! //! Example use: -//! ``` +//! ```bash //! $ ls test_output/test_pgbench\[neon-45-684\]/repo/tenants/$TENANT/timelines/$TIMELINE | \ //! $ grep "__" | cargo run --release --bin pagectl draw-timeline-dir > out.svg //! $ firefox out.svg @@ -20,7 +20,7 @@ //! or from pageserver log files. //! //! TODO Consider shipping this as a grafana panel plugin: -//! https://grafana.com/tutorials/build-a-panel-plugin/ +//! use anyhow::Result; use pageserver::repository::Key; use std::cmp::Ordering; diff --git a/pageserver/src/config.rs b/pageserver/src/config.rs index f870c85355..4c6df469aa 100644 --- a/pageserver/src/config.rs +++ b/pageserver/src/config.rs @@ -171,11 +171,13 @@ pub struct PageServerConf { pub log_format: LogFormat, - /// Number of concurrent [`Tenant::gather_size_inputs`] allowed. + /// Number of concurrent [`Tenant::gather_size_inputs`](crate::tenant::Tenant::gather_size_inputs) allowed. pub concurrent_tenant_size_logical_size_queries: ConfigurableSemaphore, /// Limit of concurrent [`Tenant::gather_size_inputs`] issued by module `eviction_task`. /// The number of permits is the same as `concurrent_tenant_size_logical_size_queries`. /// See the comment in `eviction_task` for details. + /// + /// [`Tenant::gather_size_inputs`]: crate::tenant::Tenant::gather_size_inputs pub eviction_task_immitated_concurrent_logical_size_queries: ConfigurableSemaphore, // How often to collect metrics and send them to the metrics endpoint. @@ -993,6 +995,8 @@ impl ConfigurableSemaphore { /// Require a non-zero initial permits, because using permits == 0 is a crude way to disable a /// feature such as [`Tenant::gather_size_inputs`]. Otherwise any semaphore using future will /// behave like [`futures::future::pending`], just waiting until new permits are added. + /// + /// [`Tenant::gather_size_inputs`]: crate::tenant::Tenant::gather_size_inputs pub fn new(initial_permits: NonZeroUsize) -> Self { ConfigurableSemaphore { initial_permits, diff --git a/pageserver/src/context.rs b/pageserver/src/context.rs index f53b7736ab..a1a5c30ae9 100644 --- a/pageserver/src/context.rs +++ b/pageserver/src/context.rs @@ -179,6 +179,9 @@ impl RequestContext { /// a context and you are unwilling to change all callers to provide one. /// /// Before we add cancellation, we should get rid of this method. + /// + /// [`attached_child`]: Self::attached_child + /// [`detached_child`]: Self::detached_child pub fn todo_child(task_kind: TaskKind, download_behavior: DownloadBehavior) -> Self { Self::new(task_kind, download_behavior) } diff --git a/pageserver/src/http/routes.rs b/pageserver/src/http/routes.rs index f39db891e1..08fb917fb6 100644 --- a/pageserver/src/http/routes.rs +++ b/pageserver/src/http/routes.rs @@ -1143,7 +1143,7 @@ async fn disk_usage_eviction_run( let Some(storage) = state.remote_storage.clone() else { return Err(ApiError::InternalServerError(anyhow::anyhow!( "remote storage not configured, cannot run eviction iteration" - ))) + ))); }; let state = state.disk_usage_eviction_state.clone(); diff --git a/pageserver/src/metrics.rs b/pageserver/src/metrics.rs index 96d23e220f..dc0c1c03b7 100644 --- a/pageserver/src/metrics.rs +++ b/pageserver/src/metrics.rs @@ -385,7 +385,7 @@ pub static UNEXPECTED_ONDEMAND_DOWNLOADS: Lazy = Lazy::new(|| { .expect("failed to define a metric") }); -/// Each [`Timeline`]'s [`EVICTIONS_WITH_LOW_RESIDENCE_DURATION`] metric. +/// Each `Timeline`'s [`EVICTIONS_WITH_LOW_RESIDENCE_DURATION`] metric. #[derive(Debug)] pub struct EvictionsWithLowResidenceDuration { data_source: &'static str, @@ -818,7 +818,7 @@ pub static WAL_REDO_RECORD_COUNTER: Lazy = Lazy::new(|| { .unwrap() }); -/// Similar to [`prometheus::HistogramTimer`] but does not record on drop. +/// Similar to `prometheus::HistogramTimer` but does not record on drop. pub struct StorageTimeMetricsTimer { metrics: StorageTimeMetrics, start: Instant, @@ -876,7 +876,7 @@ impl StorageTimeMetrics { /// Starts timing a new operation. /// - /// Note: unlike [`prometheus::HistogramTimer`] the returned timer does not record on drop. + /// Note: unlike `prometheus::HistogramTimer` the returned timer does not record on drop. pub fn start_timer(&self) -> StorageTimeMetricsTimer { StorageTimeMetricsTimer::new(self.clone()) } @@ -1256,7 +1256,7 @@ impl RemoteTimelineClientMetrics { /// Update the metrics that change when a call to the remote timeline client instance starts. /// /// Drop the returned guard object once the operation is finished to updates corresponding metrics that track completions. - /// Or, use [`RemoteTimelineClientCallMetricGuard::will_decrement_manually`] and [`call_end`] if that + /// Or, use [`RemoteTimelineClientCallMetricGuard::will_decrement_manually`] and [`call_end`](Self::call_end) if that /// is more suitable. /// Never do both. pub(crate) fn call_begin( @@ -1289,7 +1289,7 @@ impl RemoteTimelineClientMetrics { /// Manually udpate the metrics that track completions, instead of using the guard object. /// Using the guard object is generally preferable. - /// See [`call_begin`] for more context. + /// See [`call_begin`](Self::call_begin) for more context. pub(crate) fn call_end( &self, file_kind: &RemoteOpFileKind, diff --git a/pageserver/src/pgdatadir_mapping.rs b/pageserver/src/pgdatadir_mapping.rs index a54cf9f91b..54b41f3e9d 100644 --- a/pageserver/src/pgdatadir_mapping.rs +++ b/pageserver/src/pgdatadir_mapping.rs @@ -1131,7 +1131,7 @@ impl<'a> DatadirModification<'a> { /// context, breaking the atomicity is OK. If the import is interrupted, the /// whole import fails and the timeline will be deleted anyway. /// (Or to be precise, it will be left behind for debugging purposes and - /// ignored, see https://github.com/neondatabase/neon/pull/1809) + /// ignored, see ) /// /// Note: A consequence of flushing the pending operations is that they /// won't be visible to subsequent operations until `commit`. The function diff --git a/pageserver/src/task_mgr.rs b/pageserver/src/task_mgr.rs index 13db38d956..9c6851bc71 100644 --- a/pageserver/src/task_mgr.rs +++ b/pageserver/src/task_mgr.rs @@ -205,7 +205,7 @@ pub enum TaskKind { /// /// Walreceiver uses its own abstraction called `TaskHandle` to represent the activity of establishing and handling a connection. /// That abstraction doesn't use `task_mgr`. - /// The [`WalReceiverManager`] task ensures that this `TaskHandle` task does not outlive the [`WalReceiverManager`] task. + /// The `WalReceiverManager` task ensures that this `TaskHandle` task does not outlive the `WalReceiverManager` task. /// For the `RequestContext` that we hand to the TaskHandle, we use the [`WalReceiverConnectionHandler`] task kind. /// /// Once the connection is established, the `TaskHandle` task creates a @@ -213,16 +213,21 @@ pub enum TaskKind { /// the `Connection` object. /// A `CancellationToken` created by the `TaskHandle` task ensures /// that the [`WalReceiverConnectionPoller`] task will cancel soon after as the `TaskHandle` is dropped. + /// + /// [`WalReceiverConnectionHandler`]: Self::WalReceiverConnectionHandler + /// [`WalReceiverConnectionPoller`]: Self::WalReceiverConnectionPoller WalReceiverManager, - /// The `TaskHandle` task that executes [`walreceiver_connection::handle_walreceiver_connection`]. + /// The `TaskHandle` task that executes `handle_walreceiver_connection`. /// Not a `task_mgr` task, but we use this `TaskKind` for its `RequestContext`. /// See the comment on [`WalReceiverManager`]. + /// + /// [`WalReceiverManager`]: Self::WalReceiverManager WalReceiverConnectionHandler, /// The task that polls the `tokio-postgres::Connection` object. - /// Spawned by task [`WalReceiverConnectionHandler`]. - /// See the comment on [`WalReceiverManager`]. + /// Spawned by task [`WalReceiverConnectionHandler`](Self::WalReceiverConnectionHandler). + /// See the comment on [`WalReceiverManager`](Self::WalReceiverManager). WalReceiverConnectionPoller, // Garbage collection worker. One per tenant diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index be88fd8676..142118bf6e 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -133,7 +133,7 @@ pub use timeline::{ // re-export this function so that page_cache.rs can use it. pub use crate::tenant::ephemeral_file::writeback as writeback_ephemeral_file; -// re-export for use in storage_sync.rs +// re-export for use in remote_timeline_client.rs pub use crate::tenant::metadata::save_metadata; // re-export for use in walreceiver @@ -1459,7 +1459,7 @@ impl Tenant { let layer_removal_guard = timeline.layer_removal_cs.lock().await; info!("got layer_removal_cs.lock(), deleting layer files"); - // NB: storage_sync upload tasks that reference these layers have been cancelled + // NB: remote_timeline_client upload tasks that reference these layers have been cancelled // by the caller. let local_timeline_directory = self @@ -4335,13 +4335,13 @@ mod tests { // assert freeze_and_flush exercised the initdb optimization { let state = tline.flush_loop_state.lock().unwrap(); - let - timeline::FlushLoopState::Running { - expect_initdb_optimization, - initdb_optimization_count, - } = *state else { - panic!("unexpected state: {:?}", *state); - }; + let timeline::FlushLoopState::Running { + expect_initdb_optimization, + initdb_optimization_count, + } = *state + else { + panic!("unexpected state: {:?}", *state); + }; assert!(expect_initdb_optimization); assert!(initdb_optimization_count > 0); } diff --git a/pageserver/src/tenant/disk_btree.rs b/pageserver/src/tenant/disk_btree.rs index 88dff32b76..734409a619 100644 --- a/pageserver/src/tenant/disk_btree.rs +++ b/pageserver/src/tenant/disk_btree.rs @@ -442,7 +442,7 @@ where writer: W, /// - /// stack[0] is the current root page, stack.last() is the leaf. + /// `stack[0]` is the current root page, `stack.last()` is the leaf. /// /// We maintain the length of the stack to be always greater than zero. /// Two exceptions are: diff --git a/pageserver/src/tenant/layer_map.rs b/pageserver/src/tenant/layer_map.rs index 9dd3212a5b..2908d3a83c 100644 --- a/pageserver/src/tenant/layer_map.rs +++ b/pageserver/src/tenant/layer_map.rs @@ -16,7 +16,7 @@ //! Other read methods are less critical but still impact performance of background tasks. //! //! This data structure relies on a persistent/immutable binary search tree. See the -//! following lecture for an introduction https://www.youtube.com/watch?v=WqCWghETNDc&t=581s +//! following lecture for an introduction //! Summary: A persistent/immutable BST (and persistent data structures in general) allows //! you to modify the tree in such a way that each modification creates a new "version" //! of the tree. When you modify it, you get a new version, but all previous versions are @@ -40,7 +40,7 @@ //! afterwards. We can add layers as long as they have larger LSNs than any previous layer in //! the map, but if we need to remove a layer, or insert anything with an older LSN, we need //! to throw away most of the persistent BST and build a new one, starting from the oldest -//! LSN. See `LayerMap::flush_updates()`. +//! LSN. See [`LayerMap::flush_updates()`]. //! mod historic_layer_coverage; diff --git a/pageserver/src/tenant/layer_map/historic_layer_coverage.rs b/pageserver/src/tenant/layer_map/historic_layer_coverage.rs index ff55fb7374..347490c1ba 100644 --- a/pageserver/src/tenant/layer_map/historic_layer_coverage.rs +++ b/pageserver/src/tenant/layer_map/historic_layer_coverage.rs @@ -411,7 +411,7 @@ fn test_persistent_overlapping() { /// still be more critical. /// /// See this for more on persistent and retroactive techniques: -/// https://www.youtube.com/watch?v=WqCWghETNDc&t=581s +/// pub struct BufferedHistoricLayerCoverage { /// A persistent layer map that we rebuild when we need to retroactively update historic_coverage: HistoricLayerCoverage, diff --git a/pageserver/src/tenant/layer_map/layer_coverage.rs b/pageserver/src/tenant/layer_map/layer_coverage.rs index f940f8e3f7..1d9101d3d1 100644 --- a/pageserver/src/tenant/layer_map/layer_coverage.rs +++ b/pageserver/src/tenant/layer_map/layer_coverage.rs @@ -2,7 +2,7 @@ use std::ops::Range; // NOTE the `im` crate has 20x more downloads and also has // persistent/immutable BTree. But it's bugged so rpds is a -// better choice https://github.com/neondatabase/neon/issues/3395 +// better choice use rpds::RedBlackTreeMapSync; /// Data structure that can efficiently: @@ -11,7 +11,7 @@ use rpds::RedBlackTreeMapSync; /// - insert layers in non-decreasing lsn.start order /// /// For a detailed explanation and justification of this approach, see: -/// https://neon.tech/blog/persistent-structures-in-neons-wal-indexing +/// /// /// NOTE The struct is parameterized over Value for easier /// testing, but in practice it's some sort of layer. diff --git a/pageserver/src/tenant/manifest.rs b/pageserver/src/tenant/manifest.rs index 745437dfbd..1d2835114f 100644 --- a/pageserver/src/tenant/manifest.rs +++ b/pageserver/src/tenant/manifest.rs @@ -24,7 +24,7 @@ //! Currently, this is not used in the system. Future refactors will ensure //! the storage state will be recorded in this file, and the system can be //! recovered from this file. This is tracked in -//! https://github.com/neondatabase/neon/issues/4418 +//! use std::io::{self, Read, Write}; diff --git a/pageserver/src/tenant/metadata.rs b/pageserver/src/tenant/metadata.rs index 0ce10c7bc8..d52bb66e76 100644 --- a/pageserver/src/tenant/metadata.rs +++ b/pageserver/src/tenant/metadata.rs @@ -1,10 +1,12 @@ //! Every image of a certain timeline from [`crate::tenant::Tenant`] //! has a metadata that needs to be stored persistently. //! -//! Later, the file gets is used in [`crate::remote_storage::storage_sync`] as a part of +//! Later, the file gets used in [`remote_timeline_client`] as a part of //! external storage import and export operations. //! //! The module contains all structs and related helper methods related to timeline metadata. +//! +//! [`remote_timeline_client`]: super::remote_timeline_client use std::fs::{File, OpenOptions}; use std::io::Write; diff --git a/pageserver/src/tenant/remote_timeline_client.rs b/pageserver/src/tenant/remote_timeline_client.rs index 0f5a585f3f..1355356712 100644 --- a/pageserver/src/tenant/remote_timeline_client.rs +++ b/pageserver/src/tenant/remote_timeline_client.rs @@ -135,7 +135,7 @@ //! - Initiate upload queue with that [`IndexPart`]. //! - Reschedule all lost operations by comparing the local filesystem state //! and remote state as per [`IndexPart`]. This is done in -//! [`Timeline::timeline_init_and_sync`] and [`Timeline::reconcile_with_remote`]. +//! [`Tenant::timeline_init_and_sync`] and [`Timeline::reconcile_with_remote`]. //! //! Note that if we crash during file deletion between the index update //! that removes the file from the list of files, and deleting the remote file, @@ -163,8 +163,8 @@ //! - download their remote [`IndexPart`]s //! - create `Timeline` struct and a `RemoteTimelineClient` //! - initialize the client's upload queue with its `IndexPart` -//! - create [`RemoteLayer`] instances for layers that are referenced by `IndexPart` -//! but not present locally +//! - create [`RemoteLayer`](super::storage_layer::RemoteLayer) instances +//! for layers that are referenced by `IndexPart` but not present locally //! - schedule uploads for layers that are only present locally. //! - if the remote `IndexPart`'s metadata was newer than the metadata in //! the local filesystem, write the remote metadata to the local filesystem @@ -198,6 +198,8 @@ //! in remote storage. //! But note that we don't test any of this right now. //! +//! [`Tenant::timeline_init_and_sync`]: super::Tenant::timeline_init_and_sync +//! [`Timeline::reconcile_with_remote`]: super::Timeline::reconcile_with_remote mod delete; mod download; diff --git a/pageserver/src/tenant/size.rs b/pageserver/src/tenant/size.rs index ffcbdc1f1d..e737d3f59c 100644 --- a/pageserver/src/tenant/size.rs +++ b/pageserver/src/tenant/size.rs @@ -110,11 +110,11 @@ pub struct TimelineInputs { /// /// Tenant size does not consider the latest state, but only the state until next_gc_cutoff, which /// is updated on-demand, during the start of this calculation and separate from the -/// [`Timeline::latest_gc_cutoff`]. +/// [`TimelineInputs::latest_gc_cutoff`]. /// /// For timelines in general: /// -/// ```ignore +/// ```text /// 0-----|---------|----|------------| · · · · · |·> lsn /// initdb_lsn branchpoints* next_gc_cutoff latest /// ``` diff --git a/pageserver/src/tenant/storage_layer.rs b/pageserver/src/tenant/storage_layer.rs index 7996c00215..e1ebe92c61 100644 --- a/pageserver/src/tenant/storage_layer.rs +++ b/pageserver/src/tenant/storage_layer.rs @@ -162,6 +162,9 @@ impl LayerAccessStats { /// The caller is responsible for recording a residence event /// using [`record_residence_event`] before calling `latest_activity`. /// If they don't, [`latest_activity`] will return `None`. + /// + /// [`record_residence_event`]: Self::record_residence_event + /// [`latest_activity`]: Self::latest_activity pub(crate) fn empty_will_record_residence_event_later() -> Self { LayerAccessStats(Mutex::default()) } @@ -169,6 +172,9 @@ impl LayerAccessStats { /// Create an empty stats object and record a [`LayerLoad`] event with the given residence status. /// /// See [`record_residence_event`] for why you need to do this while holding the layer map lock. + /// + /// [`LayerLoad`]: LayerResidenceEventReason::LayerLoad + /// [`record_residence_event`]: Self::record_residence_event pub(crate) fn for_loading_layer( layer_map_lock_held_witness: &LayerManager, status: LayerResidenceStatus, @@ -187,6 +193,8 @@ impl LayerAccessStats { /// The `new_status` is not recorded in `self`. /// /// See [`record_residence_event`] for why you need to do this while holding the layer map lock. + /// + /// [`record_residence_event`]: Self::record_residence_event pub(crate) fn clone_for_residence_change( &self, layer_map_lock_held_witness: &LayerManager, @@ -294,11 +302,13 @@ impl LayerAccessStats { /// implementation error. This function logs a rate-limited warning in that case. /// /// TODO: use type system to avoid the need for `fallback`. - /// The approach in https://github.com/neondatabase/neon/pull/3775 + /// The approach in /// could be used to enforce that a residence event is recorded /// before a layer is added to the layer map. We could also have /// a layer wrapper type that holds the LayerAccessStats, and ensure /// that that type can only be produced by inserting into the layer map. + /// + /// [`record_residence_event`]: Self::record_residence_event pub(crate) fn latest_activity(&self) -> Option { let locked = self.0.lock().unwrap(); let inner = &locked.for_eviction_policy; @@ -323,7 +333,7 @@ impl LayerAccessStats { } /// Supertrait of the [`Layer`] trait that captures the bare minimum interface -/// required by [`LayerMap`]. +/// required by [`LayerMap`](super::layer_map::LayerMap). /// /// All layers should implement a minimal `std::fmt::Debug` without tenant or /// timeline names, because those are known in the context of which the layers @@ -370,10 +380,10 @@ pub trait Layer: std::fmt::Debug + std::fmt::Display + Send + Sync { fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()>; } -/// Returned by [`Layer::iter`] +/// Returned by [`PersistentLayer::iter`] pub type LayerIter<'i> = Box> + 'i + Send>; -/// Returned by [`Layer::key_iter`] +/// Returned by [`PersistentLayer::key_iter`] pub type LayerKeyIter<'i> = Box + 'i + Send>; /// Get a layer descriptor from a layer. diff --git a/pageserver/src/tenant/storage_layer/delta_layer.rs b/pageserver/src/tenant/storage_layer/delta_layer.rs index aafab1dd8e..2eab2106a6 100644 --- a/pageserver/src/tenant/storage_layer/delta_layer.rs +++ b/pageserver/src/tenant/storage_layer/delta_layer.rs @@ -7,14 +7,18 @@ //! must be page images or WAL records with the 'will_init' flag set, so that //! they can be replayed without referring to an older page version. //! -//! The delta files are stored in timelines/ directory. Currently, +//! The delta files are stored in `timelines/` directory. Currently, //! there are no subdirectories, and each delta file is named like this: //! +//! ```text //! -__- +//! ``` //! //! For example: //! +//! ```text //! 000000067F000032BE0000400000000020B6-000000067F000032BE0000400000000030B6__000000578C6B29-0000000057A50051 +//! ``` //! //! Every delta file consists of three parts: "summary", "index", and //! "values". The summary is a fixed size header at the beginning of the file, @@ -800,7 +804,7 @@ impl DeltaLayerWriterInner { /// /// # Note /// -/// As described in https://github.com/neondatabase/neon/issues/2650, it's +/// As described in , it's /// possible for the writer to drop before `finish` is actually called. So this /// could lead to odd temporary files in the directory, exhausting file system. /// This structure wraps `DeltaLayerWriterInner` and also contains `Drop` diff --git a/pageserver/src/tenant/storage_layer/filename.rs b/pageserver/src/tenant/storage_layer/filename.rs index 073a0588e8..843bb1f631 100644 --- a/pageserver/src/tenant/storage_layer/filename.rs +++ b/pageserver/src/tenant/storage_layer/filename.rs @@ -57,8 +57,9 @@ impl Ord for DeltaFileName { /// Represents the filename of a DeltaLayer /// +/// ```text /// -__- -/// +/// ``` impl DeltaFileName { /// /// Parse a string as a delta file name. Returns None if the filename does not @@ -162,7 +163,9 @@ impl ImageFileName { /// /// Represents the filename of an ImageLayer /// +/// ```text /// -__ +/// ``` impl ImageFileName { /// /// Parse a string as an image file name. Returns None if the filename does not diff --git a/pageserver/src/tenant/storage_layer/image_layer.rs b/pageserver/src/tenant/storage_layer/image_layer.rs index e46a6d84f6..b8601af818 100644 --- a/pageserver/src/tenant/storage_layer/image_layer.rs +++ b/pageserver/src/tenant/storage_layer/image_layer.rs @@ -7,11 +7,15 @@ //! timelines/ directory. Currently, there are no //! subdirectories, and each image layer file is named like this: //! +//! ```text //! -__ +//! ``` //! //! For example: //! +//! ```text //! 000000067F000032BE0000400000000070B6-000000067F000032BE0000400000000080B6__00000000346BC568 +//! ``` //! //! Every image layer file consists of three parts: "summary", //! "index", and "values". The summary is a fixed size header at the @@ -660,7 +664,7 @@ impl ImageLayerWriterInner { /// /// # Note /// -/// As described in https://github.com/neondatabase/neon/issues/2650, it's +/// As described in , it's /// possible for the writer to drop before `finish` is actually called. So this /// could lead to odd temporary files in the directory, exhausting file system. /// This structure wraps `ImageLayerWriterInner` and also contains `Drop` diff --git a/pageserver/src/tenant/storage_layer/remote_layer.rs b/pageserver/src/tenant/storage_layer/remote_layer.rs index 4ab11a6c3e..d3c40d93bb 100644 --- a/pageserver/src/tenant/storage_layer/remote_layer.rs +++ b/pageserver/src/tenant/storage_layer/remote_layer.rs @@ -25,7 +25,7 @@ use super::{ }; /// RemoteLayer is a not yet downloaded [`ImageLayer`] or -/// [`crate::storage_layer::DeltaLayer`]. +/// [`DeltaLayer`](super::DeltaLayer). /// /// RemoteLayer might be downloaded on-demand during operations which are /// allowed download remote layers and during which, it gets replaced with a @@ -50,6 +50,8 @@ pub struct RemoteLayer { /// It is very unlikely to accumulate these in the Timeline's LayerMap, but having this avoids /// a possible fast loop between `Timeline::get_reconstruct_data` and /// `Timeline::download_remote_layer`, which also logs. + /// + /// [`ongoing_download`]: Self::ongoing_download pub(crate) download_replacement_failure: std::sync::atomic::AtomicBool, } diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index 3db1347c37..e568f459d7 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -183,7 +183,7 @@ pub struct Timeline { walredo_mgr: Arc, /// Remote storage client. - /// See [`storage_sync`] module comment for details. + /// See [`remote_timeline_client`](super::remote_timeline_client) module comment for details. pub remote_client: Option>, // What page versions do we hold in the repository? If we get a @@ -240,6 +240,8 @@ pub struct Timeline { /// This lock is acquired in [`Timeline::gc`], [`Timeline::compact`], /// and [`Tenant::delete_timeline`]. This is an `Arc` lock because we need an owned /// lock guard in functions that will be spawned to tokio I/O pool (which requires `'static`). + /// + /// [`Tenant::delete_timeline`]: super::Tenant::delete_timeline pub(super) layer_removal_cs: Arc>, // Needed to ensure that we can't create a branch at a point that was already garbage collected @@ -979,8 +981,12 @@ impl Timeline { #[instrument(skip_all, fields(tenant_id = %self.tenant_id, timeline_id = %self.timeline_id))] pub async fn download_layer(&self, layer_file_name: &str) -> anyhow::Result> { - let Some(layer) = self.find_layer(layer_file_name).await else { return Ok(None) }; - let Some(remote_layer) = layer.downcast_remote_layer() else { return Ok(Some(false)) }; + let Some(layer) = self.find_layer(layer_file_name).await else { + return Ok(None); + }; + let Some(remote_layer) = layer.downcast_remote_layer() else { + return Ok(Some(false)); + }; if self.remote_client.is_none() { return Ok(Some(false)); } @@ -989,10 +995,12 @@ impl Timeline { Ok(Some(true)) } - /// Like [`evict_layer_batch`], but for just one layer. + /// Like [`evict_layer_batch`](Self::evict_layer_batch), but for just one layer. /// Additional case `Ok(None)` covers the case where the layer could not be found by its `layer_file_name`. pub async fn evict_layer(&self, layer_file_name: &str) -> anyhow::Result> { - let Some(local_layer) = self.find_layer(layer_file_name).await else { return Ok(None) }; + let Some(local_layer) = self.find_layer(layer_file_name).await else { + return Ok(None); + }; let remote_client = self .remote_client .as_ref() @@ -1013,9 +1021,9 @@ impl Timeline { /// Evict a batch of layers. /// - /// GenericRemoteStorage reference is required as a witness[^witness_article] for "remote storage is configured." + /// GenericRemoteStorage reference is required as a (witness)[witness_article] for "remote storage is configured." /// - /// [^witness_article]: https://willcrichton.net/rust-api-type-patterns/witnesses.html + /// [witness_article]: https://willcrichton.net/rust-api-type-patterns/witnesses.html pub async fn evict_layers( &self, _: &GenericRemoteStorage, @@ -1769,7 +1777,7 @@ impl Timeline { /// 3. Schedule upload of local-only layer files (which will then also update the remote /// IndexPart to include the new layer files). /// - /// Refer to the `storage_sync` module comment for more context. + /// Refer to the [`remote_timeline_client`] module comment for more context. /// /// # TODO /// May be a bit cleaner to do things based on populated remote client, @@ -2602,7 +2610,9 @@ impl Timeline { guard.layer_map().frozen_layers.front().cloned() // drop 'layers' lock to allow concurrent reads and writes }; - let Some(layer_to_flush) = layer_to_flush else { break Ok(()) }; + let Some(layer_to_flush) = layer_to_flush else { + break Ok(()); + }; if let Err(err) = self.flush_frozen_layer(layer_to_flush, ctx).await { error!("could not flush frozen layer: {err:?}"); break Err(err); @@ -3273,6 +3283,8 @@ impl Timeline { /// This method takes the `_layer_removal_cs` guard to highlight it required downloads are /// returned as an error. If the `layer_removal_cs` boundary is changed not to be taken in the /// start of level0 files compaction, the on-demand download should be revisited as well. + /// + /// [`compact_inner`]: Self::compact_inner fn compact_level0_phase1( self: Arc, _layer_removal_cs: Arc>, @@ -3692,7 +3704,7 @@ impl Timeline { } // Before deleting any layers, we need to wait for their upload ops to finish. - // See storage_sync module level comment on consistency. + // See remote_timeline_client module level comment on consistency. // Do it here because we don't want to hold self.layers.write() while waiting. if let Some(remote_client) = &self.remote_client { debug!("waiting for upload ops to complete"); diff --git a/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs b/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs index 5c03c6106f..57c09a4487 100644 --- a/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs +++ b/pageserver/src/tenant/timeline/walreceiver/connection_manager.rs @@ -6,7 +6,7 @@ //! Current connection state is tracked too, to ensure it's not getting stale. //! //! After every connection or storage broker update fetched, the state gets updated correspondingly and rechecked for the new conneciton leader, -//! then a [re]connection happens, if necessary. +//! then a (re)connection happens, if necessary. //! Only WAL streaming task expects to be finished, other loops (storage broker, connection management) never exit unless cancelled explicitly via the dedicated channel. use std::{collections::HashMap, num::NonZeroU64, ops::ControlFlow, sync::Arc, time::Duration}; diff --git a/proxy/src/cancellation.rs b/proxy/src/cancellation.rs index c8c0727471..8d16f202e9 100644 --- a/proxy/src/cancellation.rs +++ b/proxy/src/cancellation.rs @@ -110,7 +110,7 @@ impl<'a> Session<'a> { impl Session<'_> { /// Store the cancel token for the given session. - /// This enables query cancellation in [`crate::proxy::handshake`]. + /// This enables query cancellation in `crate::proxy::prepare_client_connection`. pub fn enable_query_cancellation(self, cancel_closure: CancelClosure) -> CancelKeyData { info!("enabling query cancellation for this session"); self.cancel_map diff --git a/proxy/src/compute.rs b/proxy/src/compute.rs index 70b29679b9..ccf100397b 100644 --- a/proxy/src/compute.rs +++ b/proxy/src/compute.rs @@ -13,7 +13,7 @@ const COULD_NOT_CONNECT: &str = "Couldn't connect to compute node"; #[derive(Debug, Error)] pub enum ConnectionError { /// This error doesn't seem to reveal any secrets; for instance, - /// [`tokio_postgres::error::Kind`] doesn't contain ip addresses and such. + /// `tokio_postgres::error::Kind` doesn't contain ip addresses and such. #[error("{COULD_NOT_CONNECT}: {0}")] Postgres(#[from] tokio_postgres::Error), diff --git a/proxy/src/config.rs b/proxy/src/config.rs index 00f561fcf2..989027f03f 100644 --- a/proxy/src/config.rs +++ b/proxy/src/config.rs @@ -211,7 +211,7 @@ pub struct CacheOptions { } impl CacheOptions { - /// Default options for [`crate::auth::caches::NodeInfoCache`]. + /// Default options for [`crate::console::provider::NodeInfoCache`]. pub const DEFAULT_OPTIONS_NODE_INFO: &str = "size=4000,ttl=4m"; /// Parse cache options passed via cmdline. diff --git a/proxy/src/console/provider.rs b/proxy/src/console/provider.rs index 44e23e0adf..77b4330e44 100644 --- a/proxy/src/console/provider.rs +++ b/proxy/src/console/provider.rs @@ -197,7 +197,7 @@ pub trait Api { ) -> Result; } -/// Various caches for [`console`]. +/// Various caches for [`console`](super). pub struct ApiCaches { /// Cache for the `wake_compute` API method. pub node_info: NodeInfoCache, diff --git a/proxy/src/scram.rs b/proxy/src/scram.rs index 85854427ed..07822e8da5 100644 --- a/proxy/src/scram.rs +++ b/proxy/src/scram.rs @@ -12,7 +12,7 @@ mod messages; mod secret; mod signature; -#[cfg(test)] +#[cfg(any(test, doc))] mod password; pub use exchange::Exchange; diff --git a/safekeeper/src/control_file.rs b/safekeeper/src/control_file.rs index 653e938bb7..504c2d355d 100644 --- a/safekeeper/src/control_file.rs +++ b/safekeeper/src/control_file.rs @@ -163,8 +163,9 @@ impl Deref for FileStorage { #[async_trait::async_trait] impl Storage for FileStorage { - /// persists state durably to underlying storage - /// for description see https://lwn.net/Articles/457667/ + /// Persists state durably to the underlying storage. + /// + /// For a description, see . async fn persist(&mut self, s: &SafeKeeperState) -> Result<()> { let _timer = PERSIST_CONTROL_FILE_SECONDS.start_timer(); diff --git a/safekeeper/src/timelines_global_map.rs b/safekeeper/src/timelines_global_map.rs index f2d5df8744..eda5b9044e 100644 --- a/safekeeper/src/timelines_global_map.rs +++ b/safekeeper/src/timelines_global_map.rs @@ -1,4 +1,4 @@ -//! This module contains global (tenant_id, timeline_id) -> Arc mapping. +//! This module contains global `(tenant_id, timeline_id)` -> `Arc` mapping. //! All timelines should always be present in this map, this is done by loading them //! all from the disk on startup and keeping them in memory. diff --git a/safekeeper/src/wal_storage.rs b/safekeeper/src/wal_storage.rs index 61270a8d0b..d728312de4 100644 --- a/safekeeper/src/wal_storage.rs +++ b/safekeeper/src/wal_storage.rs @@ -106,13 +106,15 @@ pub struct PhysicalStorage { /// Imagine the following: /// - 000000010000000000000001 /// - it was fully written, but the last record is split between 2 segments - /// - after restart, find_end_of_wal() returned 0/1FFFFF0, which is in the end of this segment - /// - write_lsn, write_record_lsn and flush_record_lsn were initialized to 0/1FFFFF0 + /// - after restart, `find_end_of_wal()` returned 0/1FFFFF0, which is in the end of this segment + /// - `write_lsn`, `write_record_lsn` and `flush_record_lsn` were initialized to 0/1FFFFF0 /// - 000000010000000000000002.partial /// - it has only 1 byte written, which is not enough to make a full WAL record /// /// Partial segment 002 has no WAL records, and it will be removed by the next truncate_wal(). /// This flag will be set to true after the first truncate_wal() call. + /// + /// [`write_lsn`]: Self::write_lsn is_truncated_after_restart: bool, } diff --git a/test_runner/regress/test_tenant_detach.py b/test_runner/regress/test_tenant_detach.py index 2ded79954e..7d432def34 100644 --- a/test_runner/regress/test_tenant_detach.py +++ b/test_runner/regress/test_tenant_detach.py @@ -791,7 +791,7 @@ def test_ignore_while_attaching( pageserver_http.tenant_attach(tenant_id) # Run ignore on the task, thereby cancelling the attach. # XXX This should take priority over attach, i.e., it should cancel the attach task. - # But neither the failpoint, nor the proper storage_sync download functions, + # But neither the failpoint, nor the proper remote_timeline_client download functions, # are sensitive to task_mgr::shutdown. # This problem is tracked in https://github.com/neondatabase/neon/issues/2996 . # So, for now, effectively, this ignore here will block until attach task completes. From edccef45142023879b154a6c6d4227ec6c99b586 Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Sat, 15 Jul 2023 11:58:15 +0100 Subject: [PATCH 26/58] Make CI more friendly for external contributors (#4663) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit ## Problem CI doesn't work for external contributors (for PRs from forks), see #2222 for more information. I'm proposing the following: - External PR is created - PR is reviewed so that it doesn't contain any malicious code - Label `approved-for-ci-run` is added to that PR (by the reviewer) - A new workflow picks up this label and creates an internal branch from that PR (the branch name is `ci-run/pr-*`) - CI is run on the branch, but the results are also propagated to the PRs check - We can merge a PR itself if it's green; if not — repeat. ## Summary of changes - Create `approved-for-ci-run.yml` workflow which handles `approved-for-ci-run` label - Trigger `build_and_test.yml` and `neon_extra_builds.yml` workflows on `ci-run/pr-*` branches --- .github/workflows/approved-for-ci-run.yml | 55 +++++++++++++++++++++++ .github/workflows/build_and_test.yml | 1 + .github/workflows/neon_extra_builds.yml | 3 +- 3 files changed, 58 insertions(+), 1 deletion(-) create mode 100644 .github/workflows/approved-for-ci-run.yml diff --git a/.github/workflows/approved-for-ci-run.yml b/.github/workflows/approved-for-ci-run.yml new file mode 100644 index 0000000000..ac9e908c09 --- /dev/null +++ b/.github/workflows/approved-for-ci-run.yml @@ -0,0 +1,55 @@ +name: Handle `approved-for-ci-run` label +# This workflow helps to run CI pipeline for PRs made by external contributors (from forks). + +on: + pull_request: + types: + # Default types that triggers a workflow ([1]): + # - [1] https://docs.github.com/en/actions/using-workflows/events-that-trigger-workflows#pull_request + - opened + - synchronize + - reopened + # Types that we wand to handle in addition to keep labels tidy: + - closed + # Actual magic happens here: + - labeled + +env: + GH_TOKEN: ${{ secrets.GITHUB_TOKEN }} + PR_NUMBER: ${{ github.event.pull_request.number }} + +jobs: + remove-label: + # Remove `approved-for-ci-run` label if the workflow is triggered by changes in a PR. + # The PR should be reviewed and labelled manually again. + + runs-on: [ ubuntu-latest ] + + if: | + contains(fromJSON('["opened", "synchronize", "reopened", "closed"]'), github.event.action) && + contains(github.event.pull_request.labels.*.name, 'approved-for-ci-run') + + steps: + - run: gh pr --repo "${GITHUB_REPOSITORY}" edit "${PR_NUMBER}" --remove-label "approved-for-ci-run" + + create-branch: + # Create a local branch for an `approved-for-ci-run` labelled PR to run CI pipeline in it. + + runs-on: [ ubuntu-latest ] + + if: | + github.event.action == 'labeled' && + contains(github.event.pull_request.labels.*.name, 'approved-for-ci-run') + + steps: + - run: gh pr --repo "${GITHUB_REPOSITORY}" edit "${PR_NUMBER}" --remove-label "approved-for-ci-run" + + - uses: actions/checkout@v3 + with: + ref: main + + - run: gh pr checkout "${PR_NUMBER}" + + - run: git checkout -b "ci-run/pr-${PR_NUMBER}" + + - run: git push --force origin "ci-run/pr-${PR_NUMBER}" diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index fb19d54aaa..f024db9d94 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -5,6 +5,7 @@ on: branches: - main - release + - ci-run/pr-* pull_request: defaults: diff --git a/.github/workflows/neon_extra_builds.yml b/.github/workflows/neon_extra_builds.yml index 1196881541..a21ddb0414 100644 --- a/.github/workflows/neon_extra_builds.yml +++ b/.github/workflows/neon_extra_builds.yml @@ -3,7 +3,8 @@ name: Check neon with extra platform builds on: push: branches: - - main + - main + - ci-run/pr-* pull_request: defaults: From 53470ad12ae8fadf66b532fcf3c0755077ec2e0a Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Sat, 15 Jul 2023 14:36:13 +0300 Subject: [PATCH 27/58] Bump cryptography from 41.0.0 to 41.0.2 (#4724) --- poetry.lock | 154 +++++++++------------------------------------------- 1 file changed, 27 insertions(+), 127 deletions(-) diff --git a/poetry.lock b/poetry.lock index aa76ac6dbd..aadbb7c33f 100644 --- a/poetry.lock +++ b/poetry.lock @@ -1,10 +1,9 @@ -# This file is automatically @generated by Poetry and should not be changed by hand. +# This file is automatically @generated by Poetry 1.5.1 and should not be changed by hand. [[package]] name = "aiohttp" version = "3.7.4" description = "Async http client/server framework (asyncio)" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -62,7 +61,6 @@ speedups = ["aiodns", "brotlipy", "cchardet"] name = "aiopg" version = "1.3.4" description = "Postgres integration with asyncio." -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -81,7 +79,6 @@ sa = ["sqlalchemy[postgresql-psycopg2binary] (>=1.3,<1.5)"] name = "allure-pytest" version = "2.13.2" description = "Allure pytest integration" -category = "main" optional = false python-versions = "*" files = [ @@ -97,7 +94,6 @@ pytest = ">=4.5.0" name = "allure-python-commons" version = "2.13.2" description = "Common module for integrate allure with python-based frameworks" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -113,7 +109,6 @@ pluggy = ">=0.4.0" name = "async-timeout" version = "3.0.1" description = "Timeout context manager for asyncio programs" -category = "main" optional = false python-versions = ">=3.5.3" files = [ @@ -125,7 +120,6 @@ files = [ name = "asyncpg" version = "0.27.0" description = "An asyncio PostgreSQL driver" -category = "main" optional = false python-versions = ">=3.7.0" files = [ @@ -176,7 +170,6 @@ test = ["flake8 (>=5.0.4,<5.1.0)", "uvloop (>=0.15.3)"] name = "attrs" version = "21.4.0" description = "Classes Without Boilerplate" -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" files = [ @@ -194,7 +187,6 @@ tests-no-zope = ["cloudpickle", "coverage[toml] (>=5.0.2)", "hypothesis", "mypy" name = "aws-sam-translator" version = "1.48.0" description = "AWS SAM Translator is a library that transform SAM templates into AWS CloudFormation templates" -category = "main" optional = false python-versions = ">=3.7, <=4.0, !=4.0" files = [ @@ -204,7 +196,7 @@ files = [ ] [package.dependencies] -boto3 = ">=1.19.5,<2.0.0" +boto3 = ">=1.19.5,<2.dev0" jsonschema = ">=3.2,<4.0" [package.extras] @@ -214,7 +206,6 @@ dev = ["black (==20.8b1)", "boto3 (>=1.23,<2)", "click (>=7.1,<8.0)", "coverage name = "aws-xray-sdk" version = "2.10.0" description = "The AWS X-Ray SDK for Python (the SDK) enables Python developers to record and emit information from within their applications to the AWS X-Ray service." -category = "main" optional = false python-versions = "*" files = [ @@ -230,7 +221,6 @@ wrapt = "*" name = "backoff" version = "2.2.1" description = "Function decoration for backoff and retry" -category = "main" optional = false python-versions = ">=3.7,<4.0" files = [ @@ -242,7 +232,6 @@ files = [ name = "black" version = "23.3.0" description = "The uncompromising code formatter." -category = "dev" optional = false python-versions = ">=3.7" files = [ @@ -292,7 +281,6 @@ uvloop = ["uvloop (>=0.15.2)"] name = "boto3" version = "1.26.16" description = "The AWS SDK for Python" -category = "main" optional = false python-versions = ">= 3.7" files = [ @@ -312,7 +300,6 @@ crt = ["botocore[crt] (>=1.21.0,<2.0a0)"] name = "boto3-stubs" version = "1.26.16" description = "Type annotations for boto3 1.26.16 generated with mypy-boto3-builder 7.11.11" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -657,7 +644,6 @@ xray = ["mypy-boto3-xray (>=1.26.0,<1.27.0)"] name = "botocore" version = "1.29.16" description = "Low-level, data-driven core of boto 3." -category = "main" optional = false python-versions = ">= 3.7" files = [ @@ -677,7 +663,6 @@ crt = ["awscrt (==0.14.0)"] name = "botocore-stubs" version = "1.27.38" description = "Type annotations for botocore 1.27.38 generated with mypy-boto3-builder 7.10.1" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -692,7 +677,6 @@ typing-extensions = ">=4.1.0" name = "certifi" version = "2022.12.7" description = "Python package for providing Mozilla's CA Bundle." -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -704,7 +688,6 @@ files = [ name = "cffi" version = "1.15.1" description = "Foreign Function Interface for Python calling C code." -category = "main" optional = false python-versions = "*" files = [ @@ -781,7 +764,6 @@ pycparser = "*" name = "cfn-lint" version = "0.61.3" description = "Checks CloudFormation templates for practices and behaviour that could potentially be improved" -category = "main" optional = false python-versions = ">=3.6, <=4.0, !=4.0" files = [ @@ -803,7 +785,6 @@ sarif-om = ">=1.0.4,<1.1.0" name = "chardet" version = "3.0.4" description = "Universal encoding detector for Python 2 and 3" -category = "main" optional = false python-versions = "*" files = [ @@ -815,7 +796,6 @@ files = [ name = "charset-normalizer" version = "2.1.0" description = "The Real First Universal Charset Detector. Open, modern and actively maintained alternative to Chardet." -category = "main" optional = false python-versions = ">=3.6.0" files = [ @@ -830,7 +810,6 @@ unicode-backport = ["unicodedata2"] name = "click" version = "8.1.3" description = "Composable command line interface toolkit" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -845,7 +824,6 @@ colorama = {version = "*", markers = "platform_system == \"Windows\""} name = "colorama" version = "0.4.5" description = "Cross-platform colored terminal text." -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" files = [ @@ -855,31 +833,34 @@ files = [ [[package]] name = "cryptography" -version = "41.0.0" +version = "41.0.2" description = "cryptography is a package which provides cryptographic recipes and primitives to Python developers." -category = "main" optional = false python-versions = ">=3.7" files = [ - {file = "cryptography-41.0.0-cp37-abi3-macosx_10_12_universal2.whl", hash = "sha256:3c5ef25d060c80d6d9f7f9892e1d41bb1c79b78ce74805b8cb4aa373cb7d5ec8"}, - {file = "cryptography-41.0.0-cp37-abi3-macosx_10_12_x86_64.whl", hash = "sha256:8362565b3835ceacf4dc8f3b56471a2289cf51ac80946f9087e66dc283a810e0"}, - {file = "cryptography-41.0.0-cp37-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3680248309d340fda9611498a5319b0193a8dbdb73586a1acf8109d06f25b92d"}, - {file = "cryptography-41.0.0-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:84a165379cb9d411d58ed739e4af3396e544eac190805a54ba2e0322feb55c46"}, - {file = "cryptography-41.0.0-cp37-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:4ab14d567f7bbe7f1cdff1c53d5324ed4d3fc8bd17c481b395db224fb405c237"}, - {file = "cryptography-41.0.0-cp37-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:9f65e842cb02550fac96536edb1d17f24c0a338fd84eaf582be25926e993dde4"}, - {file = "cryptography-41.0.0-cp37-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:b7f2f5c525a642cecad24ee8670443ba27ac1fab81bba4cc24c7b6b41f2d0c75"}, - {file = "cryptography-41.0.0-cp37-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:7d92f0248d38faa411d17f4107fc0bce0c42cae0b0ba5415505df72d751bf62d"}, - {file = "cryptography-41.0.0-cp37-abi3-win32.whl", hash = "sha256:34d405ea69a8b34566ba3dfb0521379b210ea5d560fafedf9f800a9a94a41928"}, - {file = "cryptography-41.0.0-cp37-abi3-win_amd64.whl", hash = "sha256:344c6de9f8bda3c425b3a41b319522ba3208551b70c2ae00099c205f0d9fd3be"}, - {file = "cryptography-41.0.0-pp38-pypy38_pp73-macosx_10_12_x86_64.whl", hash = "sha256:88ff107f211ea696455ea8d911389f6d2b276aabf3231bf72c8853d22db755c5"}, - {file = "cryptography-41.0.0-pp38-pypy38_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:b846d59a8d5a9ba87e2c3d757ca019fa576793e8758174d3868aecb88d6fc8eb"}, - {file = "cryptography-41.0.0-pp38-pypy38_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:f5d0bf9b252f30a31664b6f64432b4730bb7038339bd18b1fafe129cfc2be9be"}, - {file = "cryptography-41.0.0-pp38-pypy38_pp73-win_amd64.whl", hash = "sha256:5c1f7293c31ebc72163a9a0df246f890d65f66b4a40d9ec80081969ba8c78cc9"}, - {file = "cryptography-41.0.0-pp39-pypy39_pp73-macosx_10_12_x86_64.whl", hash = "sha256:bf8fc66012ca857d62f6a347007e166ed59c0bc150cefa49f28376ebe7d992a2"}, - {file = "cryptography-41.0.0-pp39-pypy39_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:a4fc68d1c5b951cfb72dfd54702afdbbf0fb7acdc9b7dc4301bbf2225a27714d"}, - {file = "cryptography-41.0.0-pp39-pypy39_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:14754bcdae909d66ff24b7b5f166d69340ccc6cb15731670435efd5719294895"}, - {file = "cryptography-41.0.0-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:0ddaee209d1cf1f180f1efa338a68c4621154de0afaef92b89486f5f96047c55"}, - {file = "cryptography-41.0.0.tar.gz", hash = "sha256:6b71f64beeea341c9b4f963b48ee3b62d62d57ba93eb120e1196b31dc1025e78"}, + {file = "cryptography-41.0.2-cp37-abi3-macosx_10_12_universal2.whl", hash = "sha256:01f1d9e537f9a15b037d5d9ee442b8c22e3ae11ce65ea1f3316a41c78756b711"}, + {file = "cryptography-41.0.2-cp37-abi3-macosx_10_12_x86_64.whl", hash = "sha256:079347de771f9282fbfe0e0236c716686950c19dee1b76240ab09ce1624d76d7"}, + {file = "cryptography-41.0.2-cp37-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:439c3cc4c0d42fa999b83ded80a9a1fb54d53c58d6e59234cfe97f241e6c781d"}, + {file = "cryptography-41.0.2-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f14ad275364c8b4e525d018f6716537ae7b6d369c094805cae45300847e0894f"}, + {file = "cryptography-41.0.2-cp37-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:84609ade00a6ec59a89729e87a503c6e36af98ddcd566d5f3be52e29ba993182"}, + {file = "cryptography-41.0.2-cp37-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:49c3222bb8f8e800aead2e376cbef687bc9e3cb9b58b29a261210456a7783d83"}, + {file = "cryptography-41.0.2-cp37-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:d73f419a56d74fef257955f51b18d046f3506270a5fd2ac5febbfa259d6c0fa5"}, + {file = "cryptography-41.0.2-cp37-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:2a034bf7d9ca894720f2ec1d8b7b5832d7e363571828037f9e0c4f18c1b58a58"}, + {file = "cryptography-41.0.2-cp37-abi3-win32.whl", hash = "sha256:d124682c7a23c9764e54ca9ab5b308b14b18eba02722b8659fb238546de83a76"}, + {file = "cryptography-41.0.2-cp37-abi3-win_amd64.whl", hash = "sha256:9c3fe6534d59d071ee82081ca3d71eed3210f76ebd0361798c74abc2bcf347d4"}, + {file = "cryptography-41.0.2-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:a719399b99377b218dac6cf547b6ec54e6ef20207b6165126a280b0ce97e0d2a"}, + {file = "cryptography-41.0.2-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:182be4171f9332b6741ee818ec27daff9fb00349f706629f5cbf417bd50e66fd"}, + {file = "cryptography-41.0.2-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:7a9a3bced53b7f09da251685224d6a260c3cb291768f54954e28f03ef14e3766"}, + {file = "cryptography-41.0.2-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:f0dc40e6f7aa37af01aba07277d3d64d5a03dc66d682097541ec4da03cc140ee"}, + {file = "cryptography-41.0.2-pp38-pypy38_pp73-macosx_10_12_x86_64.whl", hash = "sha256:674b669d5daa64206c38e507808aae49904c988fa0a71c935e7006a3e1e83831"}, + {file = "cryptography-41.0.2-pp38-pypy38_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:7af244b012711a26196450d34f483357e42aeddb04128885d95a69bd8b14b69b"}, + {file = "cryptography-41.0.2-pp38-pypy38_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:9b6d717393dbae53d4e52684ef4f022444fc1cce3c48c38cb74fca29e1f08eaa"}, + {file = "cryptography-41.0.2-pp38-pypy38_pp73-win_amd64.whl", hash = "sha256:192255f539d7a89f2102d07d7375b1e0a81f7478925b3bc2e0549ebf739dae0e"}, + {file = "cryptography-41.0.2-pp39-pypy39_pp73-macosx_10_12_x86_64.whl", hash = "sha256:f772610fe364372de33d76edcd313636a25684edb94cee53fd790195f5989d14"}, + {file = "cryptography-41.0.2-pp39-pypy39_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:b332cba64d99a70c1e0836902720887fb4529ea49ea7f5462cf6640e095e11d2"}, + {file = "cryptography-41.0.2-pp39-pypy39_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:9a6673c1828db6270b76b22cc696f40cde9043eb90373da5c2f8f2158957f42f"}, + {file = "cryptography-41.0.2-pp39-pypy39_pp73-win_amd64.whl", hash = "sha256:342f3767e25876751e14f8459ad85e77e660537ca0a066e10e75df9c9e9099f0"}, + {file = "cryptography-41.0.2.tar.gz", hash = "sha256:7d230bf856164de164ecb615ccc14c7fc6de6906ddd5b491f3af90d3514c925c"}, ] [package.dependencies] @@ -899,7 +880,6 @@ test-randomorder = ["pytest-randomly"] name = "docker" version = "4.2.2" description = "A Python library for the Docker Engine API." -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" files = [ @@ -921,7 +901,6 @@ tls = ["cryptography (>=1.3.4)", "idna (>=2.0.0)", "pyOpenSSL (>=17.5.0)"] name = "ecdsa" version = "0.18.0" description = "ECDSA cryptographic signature library (pure python)" -category = "main" optional = false python-versions = ">=2.6, !=3.0.*, !=3.1.*, !=3.2.*" files = [ @@ -940,7 +919,6 @@ gmpy2 = ["gmpy2"] name = "exceptiongroup" version = "1.1.1" description = "Backport of PEP 654 (exception groups)" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -955,7 +933,6 @@ test = ["pytest (>=6)"] name = "execnet" version = "1.9.0" description = "execnet: rapid multi-Python deployment" -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" files = [ @@ -970,7 +947,6 @@ testing = ["pre-commit"] name = "flask" version = "2.2.5" description = "A simple framework for building complex web applications." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -993,7 +969,6 @@ dotenv = ["python-dotenv"] name = "flask-cors" version = "3.0.10" description = "A Flask extension adding a decorator for CORS support" -category = "main" optional = false python-versions = "*" files = [ @@ -1009,7 +984,6 @@ Six = "*" name = "graphql-core" version = "3.2.1" description = "GraphQL implementation for Python, a port of GraphQL.js, the JavaScript reference implementation for GraphQL." -category = "main" optional = false python-versions = ">=3.6,<4" files = [ @@ -1021,7 +995,6 @@ files = [ name = "idna" version = "3.3" description = "Internationalized Domain Names in Applications (IDNA)" -category = "main" optional = false python-versions = ">=3.5" files = [ @@ -1033,7 +1006,6 @@ files = [ name = "importlib-metadata" version = "4.12.0" description = "Read metadata from Python packages" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1053,7 +1025,6 @@ testing = ["flufl.flake8", "importlib-resources (>=1.3)", "packaging", "pyfakefs name = "iniconfig" version = "1.1.1" description = "iniconfig: brain-dead simple config-ini parsing" -category = "main" optional = false python-versions = "*" files = [ @@ -1065,7 +1036,6 @@ files = [ name = "itsdangerous" version = "2.1.2" description = "Safely pass data to untrusted environments and back." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1077,7 +1047,6 @@ files = [ name = "jinja2" version = "3.1.2" description = "A very fast and expressive template engine." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1095,7 +1064,6 @@ i18n = ["Babel (>=2.7)"] name = "jmespath" version = "1.0.1" description = "JSON Matching Expressions" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1107,7 +1075,6 @@ files = [ name = "jschema-to-python" version = "1.2.3" description = "Generate source code for Python classes from a JSON schema." -category = "main" optional = false python-versions = ">= 2.7" files = [ @@ -1124,7 +1091,6 @@ pbr = "*" name = "jsondiff" version = "2.0.0" description = "Diff JSON and JSON-like structures in Python" -category = "main" optional = false python-versions = "*" files = [ @@ -1136,7 +1102,6 @@ files = [ name = "jsonpatch" version = "1.32" description = "Apply JSON-Patches (RFC 6902)" -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*" files = [ @@ -1151,7 +1116,6 @@ jsonpointer = ">=1.9" name = "jsonpickle" version = "2.2.0" description = "Python library for serializing any arbitrary object graph into JSON" -category = "main" optional = false python-versions = ">=2.7" files = [ @@ -1168,7 +1132,6 @@ testing-libs = ["simplejson", "ujson", "yajl"] name = "jsonpointer" version = "2.3" description = "Identify specific nodes in a JSON document (RFC 6901)" -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" files = [ @@ -1180,7 +1143,6 @@ files = [ name = "jsonschema" version = "3.2.0" description = "An implementation of JSON Schema validation for Python" -category = "main" optional = false python-versions = "*" files = [ @@ -1202,7 +1164,6 @@ format-nongpl = ["idna", "jsonpointer (>1.13)", "rfc3339-validator", "rfc3986-va name = "junit-xml" version = "1.9" description = "Creates JUnit XML test result documents that can be read by tools such as Jenkins" -category = "main" optional = false python-versions = "*" files = [ @@ -1217,7 +1178,6 @@ six = "*" name = "markupsafe" version = "2.1.1" description = "Safely add untrusted strings to HTML/XML markup." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1267,7 +1227,6 @@ files = [ name = "moto" version = "4.1.2" description = "" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1328,7 +1287,6 @@ xray = ["aws-xray-sdk (>=0.93,!=0.96)", "setuptools"] name = "multidict" version = "6.0.4" description = "multidict implementation" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1412,7 +1370,6 @@ files = [ name = "mypy" version = "1.3.0" description = "Optional static typing for Python" -category = "dev" optional = false python-versions = ">=3.7" files = [ @@ -1459,7 +1416,6 @@ reports = ["lxml"] name = "mypy-boto3-s3" version = "1.26.0.post1" description = "Type annotations for boto3.S3 1.26.0 service generated with mypy-boto3-builder 7.11.10" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1474,7 +1430,6 @@ typing-extensions = ">=4.1.0" name = "mypy-extensions" version = "1.0.0" description = "Type system extensions for programs checked with the mypy type checker." -category = "dev" optional = false python-versions = ">=3.5" files = [ @@ -1486,7 +1441,6 @@ files = [ name = "networkx" version = "2.8.5" description = "Python package for creating and manipulating graphs and networks" -category = "main" optional = false python-versions = ">=3.8" files = [ @@ -1505,7 +1459,6 @@ test = ["codecov (>=2.1)", "pytest (>=7.1)", "pytest-cov (>=3.0)"] name = "openapi-schema-validator" version = "0.2.3" description = "OpenAPI schema validation for Python" -category = "main" optional = false python-versions = ">=3.7.0,<4.0.0" files = [ @@ -1525,7 +1478,6 @@ strict-rfc3339 = ["strict-rfc3339"] name = "openapi-spec-validator" version = "0.4.0" description = "OpenAPI 2.0 (aka Swagger) and OpenAPI 3.0 spec validator" -category = "main" optional = false python-versions = ">=3.7.0,<4.0.0" files = [ @@ -1546,7 +1498,6 @@ requests = ["requests"] name = "packaging" version = "23.0" description = "Core utilities for Python packages" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1558,7 +1509,6 @@ files = [ name = "pathspec" version = "0.9.0" description = "Utility library for gitignore style pattern matching of file paths." -category = "dev" optional = false python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,>=2.7" files = [ @@ -1570,7 +1520,6 @@ files = [ name = "pbr" version = "5.9.0" description = "Python Build Reasonableness" -category = "main" optional = false python-versions = ">=2.6" files = [ @@ -1582,7 +1531,6 @@ files = [ name = "platformdirs" version = "2.5.2" description = "A small Python module for determining appropriate platform-specific dirs, e.g. a \"user data dir\"." -category = "dev" optional = false python-versions = ">=3.7" files = [ @@ -1598,7 +1546,6 @@ test = ["appdirs (==1.4.4)", "pytest (>=6)", "pytest-cov (>=2.7)", "pytest-mock name = "pluggy" version = "1.0.0" description = "plugin and hook calling mechanisms for python" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -1614,7 +1561,6 @@ testing = ["pytest", "pytest-benchmark"] name = "prometheus-client" version = "0.14.1" description = "Python client for the Prometheus monitoring system." -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -1629,7 +1575,6 @@ twisted = ["twisted"] name = "psutil" version = "5.9.4" description = "Cross-platform lib for process and system monitoring in Python." -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" files = [ @@ -1656,7 +1601,6 @@ test = ["enum34", "ipaddress", "mock", "pywin32", "wmi"] name = "psycopg2-binary" version = "2.9.6" description = "psycopg2 - Python-PostgreSQL Database Adapter" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -1728,7 +1672,6 @@ files = [ name = "pyasn1" version = "0.4.8" description = "ASN.1 types and codecs" -category = "main" optional = false python-versions = "*" files = [ @@ -1740,7 +1683,6 @@ files = [ name = "pycparser" version = "2.21" description = "C parser in Python" -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*" files = [ @@ -1752,7 +1694,6 @@ files = [ name = "pyjwt" version = "2.4.0" description = "JSON Web Token implementation in Python" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -1773,7 +1714,6 @@ tests = ["coverage[toml] (==5.0.4)", "pytest (>=6.0.0,<7.0.0)"] name = "pyparsing" version = "3.0.9" description = "pyparsing module - Classes and methods to define and execute parsing grammars" -category = "main" optional = false python-versions = ">=3.6.8" files = [ @@ -1788,7 +1728,6 @@ diagrams = ["jinja2", "railroad-diagrams"] name = "pypiwin32" version = "223" description = "" -category = "main" optional = false python-versions = "*" files = [ @@ -1803,7 +1742,6 @@ pywin32 = ">=223" name = "pyrsistent" version = "0.18.1" description = "Persistent/Functional/Immutable data structures" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1834,7 +1772,6 @@ files = [ name = "pytest" version = "7.3.1" description = "pytest: simple powerful testing with Python" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1857,7 +1794,6 @@ testing = ["argcomplete", "attrs (>=19.2.0)", "hypothesis (>=3.56)", "mock", "no name = "pytest-asyncio" version = "0.21.0" description = "Pytest support for asyncio" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1876,7 +1812,6 @@ testing = ["coverage (>=6.2)", "flaky (>=3.5.0)", "hypothesis (>=5.7.1)", "mypy name = "pytest-httpserver" version = "1.0.8" description = "pytest-httpserver is a httpserver for pytest" -category = "main" optional = false python-versions = ">=3.8,<4.0" files = [ @@ -1891,7 +1826,6 @@ Werkzeug = ">=2.0.0" name = "pytest-lazy-fixture" version = "0.6.3" description = "It helps to use fixtures in pytest.mark.parametrize" -category = "main" optional = false python-versions = "*" files = [ @@ -1906,7 +1840,6 @@ pytest = ">=3.2.5" name = "pytest-order" version = "1.1.0" description = "pytest plugin to run your tests in a specific order" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -1924,7 +1857,6 @@ pytest = [ name = "pytest-rerunfailures" version = "11.1.2" description = "pytest plugin to re-run tests to eliminate flaky failures" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1940,7 +1872,6 @@ pytest = ">=5.3" name = "pytest-timeout" version = "2.1.0" description = "pytest plugin to abort hanging tests" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -1955,7 +1886,6 @@ pytest = ">=5.0.0" name = "pytest-xdist" version = "3.3.1" description = "pytest xdist plugin for distributed testing, most importantly across multiple CPUs" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -1976,7 +1906,6 @@ testing = ["filelock"] name = "python-dateutil" version = "2.8.2" description = "Extensions to the standard Python datetime module" -category = "main" optional = false python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,>=2.7" files = [ @@ -1991,7 +1920,6 @@ six = ">=1.5" name = "python-jose" version = "3.3.0" description = "JOSE implementation in Python" -category = "main" optional = false python-versions = "*" files = [ @@ -2014,7 +1942,6 @@ pycryptodome = ["pyasn1", "pycryptodome (>=3.3.1,<4.0.0)"] name = "pywin32" version = "301" description = "Python for Window Extensions" -category = "main" optional = false python-versions = "*" files = [ @@ -2034,7 +1961,6 @@ files = [ name = "pyyaml" version = "6.0" description = "YAML parser and emitter for Python" -category = "main" optional = false python-versions = ">=3.6" files = [ @@ -2084,7 +2010,6 @@ files = [ name = "requests" version = "2.31.0" description = "Python HTTP for Humans." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2106,7 +2031,6 @@ use-chardet-on-py3 = ["chardet (>=3.0.2,<6)"] name = "responses" version = "0.21.0" description = "A utility library for mocking out the `requests` Python library." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2125,7 +2049,6 @@ tests = ["coverage (>=6.0.0)", "flake8", "mypy", "pytest (>=7.0.0)", "pytest-asy name = "rsa" version = "4.9" description = "Pure-Python RSA implementation" -category = "main" optional = false python-versions = ">=3.6,<4" files = [ @@ -2140,7 +2063,6 @@ pyasn1 = ">=0.1.3" name = "ruff" version = "0.0.269" description = "An extremely fast Python linter, written in Rust." -category = "dev" optional = false python-versions = ">=3.7" files = [ @@ -2167,7 +2089,6 @@ files = [ name = "s3transfer" version = "0.6.0" description = "An Amazon S3 Transfer Manager" -category = "main" optional = false python-versions = ">= 3.7" files = [ @@ -2185,7 +2106,6 @@ crt = ["botocore[crt] (>=1.20.29,<2.0a.0)"] name = "sarif-om" version = "1.0.4" description = "Classes implementing the SARIF 2.1.0 object model." -category = "main" optional = false python-versions = ">= 2.7" files = [ @@ -2201,7 +2121,6 @@ pbr = "*" name = "setuptools" version = "65.5.1" description = "Easily download, build, install, upgrade, and uninstall Python packages" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2218,7 +2137,6 @@ testing-integration = ["build[virtualenv]", "filelock (>=3.4.0)", "jaraco.envs ( name = "six" version = "1.16.0" description = "Python 2 and 3 compatibility utilities" -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*" files = [ @@ -2230,7 +2148,6 @@ files = [ name = "sshpubkeys" version = "3.3.1" description = "SSH public key parser" -category = "main" optional = false python-versions = ">=3" files = [ @@ -2249,7 +2166,6 @@ dev = ["twine", "wheel", "yapf"] name = "toml" version = "0.10.2" description = "Python Library for Tom's Obvious, Minimal Language" -category = "main" optional = false python-versions = ">=2.6, !=3.0.*, !=3.1.*, !=3.2.*" files = [ @@ -2261,7 +2177,6 @@ files = [ name = "tomli" version = "2.0.1" description = "A lil' TOML parser" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2273,7 +2188,6 @@ files = [ name = "types-psutil" version = "5.9.5.12" description = "Typing stubs for psutil" -category = "main" optional = false python-versions = "*" files = [ @@ -2285,7 +2199,6 @@ files = [ name = "types-psycopg2" version = "2.9.21.10" description = "Typing stubs for psycopg2" -category = "main" optional = false python-versions = "*" files = [ @@ -2297,7 +2210,6 @@ files = [ name = "types-pytest-lazy-fixture" version = "0.6.3.3" description = "Typing stubs for pytest-lazy-fixture" -category = "main" optional = false python-versions = "*" files = [ @@ -2309,7 +2221,6 @@ files = [ name = "types-requests" version = "2.31.0.0" description = "Typing stubs for requests" -category = "main" optional = false python-versions = "*" files = [ @@ -2324,7 +2235,6 @@ types-urllib3 = "*" name = "types-s3transfer" version = "0.6.0.post3" description = "Type annotations and code completion for s3transfer" -category = "main" optional = false python-versions = ">=3.7,<4.0" files = [ @@ -2336,7 +2246,6 @@ files = [ name = "types-toml" version = "0.10.8.6" description = "Typing stubs for toml" -category = "main" optional = false python-versions = "*" files = [ @@ -2348,7 +2257,6 @@ files = [ name = "types-urllib3" version = "1.26.17" description = "Typing stubs for urllib3" -category = "main" optional = false python-versions = "*" files = [ @@ -2360,7 +2268,6 @@ files = [ name = "typing-extensions" version = "4.6.1" description = "Backported and Experimental Type Hints for Python 3.7+" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2372,7 +2279,6 @@ files = [ name = "urllib3" version = "1.26.11" description = "HTTP library with thread-safe connection pooling, file post, and more." -category = "main" optional = false python-versions = ">=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*, !=3.5.*, <4" files = [ @@ -2389,7 +2295,6 @@ socks = ["PySocks (>=1.5.6,!=1.5.7,<2.0)"] name = "websocket-client" version = "1.3.3" description = "WebSocket client for Python with low level API options" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2406,7 +2311,6 @@ test = ["websockets"] name = "werkzeug" version = "2.2.3" description = "The comprehensive WSGI web application library." -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2424,7 +2328,6 @@ watchdog = ["watchdog"] name = "wrapt" version = "1.14.1" description = "Module for decorators, wrappers and monkey patching." -category = "main" optional = false python-versions = "!=3.0.*,!=3.1.*,!=3.2.*,!=3.3.*,!=3.4.*,>=2.7" files = [ @@ -2498,7 +2401,6 @@ files = [ name = "xmltodict" version = "0.13.0" description = "Makes working with XML feel like you are working with JSON" -category = "main" optional = false python-versions = ">=3.4" files = [ @@ -2510,7 +2412,6 @@ files = [ name = "yarl" version = "1.8.2" description = "Yet another URL library" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2598,7 +2499,6 @@ multidict = ">=4.0" name = "zipp" version = "3.8.1" description = "Backport of pathlib-compatible object wrapper for zip files" -category = "main" optional = false python-versions = ">=3.7" files = [ @@ -2613,4 +2513,4 @@ testing = ["func-timeout", "jaraco.itertools", "pytest (>=6)", "pytest-black (>= [metadata] lock-version = "2.0" python-versions = "^3.9" -content-hash = "c6c217033f50430c31b0979b74db222e6bab2301abd8b9f0cce5a9d5bccc578f" +content-hash = "fe771b153ef7e308d6d04421d0eb3f97d00780882277d2b4fc1f296054d8db79" From 2eae0a1fe58a0b5ed871a6004014307f3ea42469 Mon Sep 17 00:00:00 2001 From: Em Sharnoff Date: Sat, 15 Jul 2023 15:38:15 -0700 Subject: [PATCH 28/58] Update vm-builder v0.12.1 -> v0.13.1 (#4728) This should only affect the version of the vm-informant used. The only change to the vm-informant from v0.12.1 to v0.13.1 was: * https://github.com/neondatabase/autoscaling/pull/407 Just a typo fix; worth getting in anyways. --- .github/workflows/build_and_test.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index f024db9d94..daa0a0da98 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -794,7 +794,7 @@ jobs: run: shell: sh -eu {0} env: - VM_BUILDER_VERSION: v0.12.1 + VM_BUILDER_VERSION: v0.13.1 steps: - name: Checkout From 48936d44f8cc991f2888f580ad7894887b701a75 Mon Sep 17 00:00:00 2001 From: Vadim Kharitonov Date: Sun, 16 Jul 2023 12:40:59 +0200 Subject: [PATCH 29/58] Update postgres version (#4727) --- vendor/postgres-v14 | 2 +- vendor/postgres-v15 | 2 +- vendor/revisions.json | 4 ++-- 3 files changed, 4 insertions(+), 4 deletions(-) diff --git a/vendor/postgres-v14 b/vendor/postgres-v14 index 1144aee166..12c5dc8281 160000 --- a/vendor/postgres-v14 +++ b/vendor/postgres-v14 @@ -1 +1 @@ -Subproject commit 1144aee1661c79eec65e784a8dad8bd450d9df79 +Subproject commit 12c5dc8281d20b5bd636e1097eea80a7bc609591 diff --git a/vendor/postgres-v15 b/vendor/postgres-v15 index 1984832c74..44e3f7221c 160000 --- a/vendor/postgres-v15 +++ b/vendor/postgres-v15 @@ -1 +1 @@ -Subproject commit 1984832c740a7fa0e468bb720f40c525b652835d +Subproject commit 44e3f7221cafa6ad55dd0d9c62a980dd79e66089 diff --git a/vendor/revisions.json b/vendor/revisions.json index c3adc2a575..981629b7b8 100644 --- a/vendor/revisions.json +++ b/vendor/revisions.json @@ -1,4 +1,4 @@ { - "postgres-v15": "1984832c740a7fa0e468bb720f40c525b652835d", - "postgres-v14": "1144aee1661c79eec65e784a8dad8bd450d9df79" + "postgres-v15": "44e3f7221cafa6ad55dd0d9c62a980dd79e66089", + "postgres-v14": "12c5dc8281d20b5bd636e1097eea80a7bc609591" } From 35e73759f56a906a99f9a9cf11ea36d1e7462d21 Mon Sep 17 00:00:00 2001 From: arpad-m Date: Mon, 17 Jul 2023 12:49:58 +0200 Subject: [PATCH 30/58] Reword comment and add comment on race condition (#4725) The race condition that caused #4526 is still not fixed, so point it out in a comment. Also, reword a comment in upload.rs. Follow-up of #4694 --- .../src/tenant/remote_timeline_client/upload.rs | 11 +++++------ pageserver/src/tenant/timeline.rs | 6 ++++++ 2 files changed, 11 insertions(+), 6 deletions(-) diff --git a/pageserver/src/tenant/remote_timeline_client/upload.rs b/pageserver/src/tenant/remote_timeline_client/upload.rs index 0178ef520c..a805e9bd60 100644 --- a/pageserver/src/tenant/remote_timeline_client/upload.rs +++ b/pageserver/src/tenant/remote_timeline_client/upload.rs @@ -62,12 +62,11 @@ pub(super) async fn upload_timeline_layer<'a>( let source_file = match source_file_res { Ok(source_file) => source_file, Err(e) if e.kind() == ErrorKind::NotFound => { - // In some situations we might run into the underlying file being deleted by - // e.g. compaction before the uploader gets to it. In that instance, we don't - // want to retry the error: a deleted file won't come back. In theory, the - // file might not have been written in the first place, which also indicates - // a bug. Still log the situation so that we can keep an eye on it. - // See https://github.com/neondatabase/neon/issues/4526 + // If we encounter this arm, it wasn't intended, but it's also not + // a big problem, if it's because the file was deleted before an + // upload. However, a nonexistent file can also be indicative of + // something worse, like when a file is scheduled for upload before + // it has been written to disk yet. info!(path = %source_path.display(), "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more."); return Ok(()); } diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index e568f459d7..ded65c732a 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -2724,6 +2724,12 @@ impl Timeline { HashMap::from([(delta_path, metadata)]) }; + // FIXME: between create_delta_layer and the scheduling of the upload in `update_metadata_file`, + // a compaction can delete the file and then it won't be available for uploads any more. + // We still schedule the upload, resulting in an error, but ideally we'd somehow avoid this + // race situation. + // See https://github.com/neondatabase/neon/issues/4526 + pausable_failpoint!("flush-frozen-before-sync"); // The new on-disk layers are now in the layer map. We can remove the From 966213f429f2cddcb0907ae74c4a970beeef46e8 Mon Sep 17 00:00:00 2001 From: Christian Schwarz Date: Mon, 17 Jul 2023 13:46:13 +0200 Subject: [PATCH 31/58] basebackup query metric: use same buckets as control plane (#4732) The `CRITICAL_OPS_BUCKETS` is not useful for getting an accurate picture of basebackup latency because all the observations that negatively affect our SLI fall into one bucket, i.e., 100ms-1s. Use the same buckets as control plane instead. --- pageserver/src/metrics.rs | 13 ++++++++++++- 1 file changed, 12 insertions(+), 1 deletion(-) diff --git a/pageserver/src/metrics.rs b/pageserver/src/metrics.rs index dc0c1c03b7..ee8dfba69a 100644 --- a/pageserver/src/metrics.rs +++ b/pageserver/src/metrics.rs @@ -541,6 +541,17 @@ pub static SMGR_QUERY_TIME: Lazy = Lazy::new(|| { .expect("failed to define a metric") }); +// keep in sync with control plane Go code so that we can validate +// compute's basebackup_ms metric with our perspective in the context of SLI/SLO. +static COMPUTE_STARTUP_BUCKETS: Lazy<[f64; 28]> = Lazy::new(|| { + // Go code uses milliseconds. Variable is called `computeStartupBuckets` + [ + 5, 10, 20, 30, 50, 70, 100, 120, 150, 200, 250, 300, 350, 400, 450, 500, 600, 800, 1000, + 1500, 2000, 2500, 3000, 5000, 10000, 20000, 40000, 60000, + ] + .map(|ms| (ms as f64) / 1000.0) +}); + pub struct BasebackupQueryTime(HistogramVec); pub static BASEBACKUP_QUERY_TIME: Lazy = Lazy::new(|| { BasebackupQueryTime({ @@ -548,7 +559,7 @@ pub static BASEBACKUP_QUERY_TIME: Lazy = Lazy::new(|| { "pageserver_basebackup_query_seconds", "Histogram of basebackup queries durations, by result type", &["result"], - CRITICAL_OP_BUCKETS.into(), + COMPUTE_STARTUP_BUCKETS.to_vec(), ) .expect("failed to define a metric") }) From 1aad8918e1dc4f916248258a28cc18782448f3fe Mon Sep 17 00:00:00 2001 From: bojanserafimov Date: Mon, 17 Jul 2023 09:21:42 -0400 Subject: [PATCH 32/58] Document recommended ccls setup (#4723) --- docs/tools.md | 22 ++++++++++++++++++++++ 1 file changed, 22 insertions(+) create mode 100644 docs/tools.md diff --git a/docs/tools.md b/docs/tools.md new file mode 100644 index 0000000000..1adef2be61 --- /dev/null +++ b/docs/tools.md @@ -0,0 +1,22 @@ +# Useful development tools + +This readme contains some hints on how to set up some optional development tools. + +## ccls + +[ccls](https://github.com/MaskRay/ccls) is a c/c++ language server. It requires some setup +to work well. There are different ways to do it but here's what works for me: +1. Make a common parent directory for all your common neon projects. (for example, `~/src/neondatabase/`) +2. Go to `vendor/postgres-v15` +3. Run `make clean && ./configure` +4. Install [bear](https://github.com/rizsotto/Bear), and run `bear -- make -j4` +5. Copy the generated `compile_commands.json` to `~/src/neondatabase` (or equivalent) +6. Run `touch ~/src/neondatabase/.ccls-root` this will make the `compile_commands.json` file discoverable in all subdirectories + +With this setup you will get decent lsp mileage inside the postgres repo, and also any postgres extensions that you put in `~/src/neondatabase/`, like `pg_embedding`, or inside `~/src/neondatabase/neon/pgxn` as well. + +Some additional tips for various IDEs: + +### Emacs + +To improve performance: `(setq lsp-lens-enable nil)` From 1066bca5e3bd0aa446f385f700e0be0cdf55d3ab Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Mon, 17 Jul 2023 10:26:29 -0400 Subject: [PATCH 33/58] compaction: allow duplicated layers and skip in replacement (#4696) ## Problem Compactions might generate files of exactly the same name as before compaction due to our naming of layer files. This could have already caused some mess in the system, and is known to cause some issues like https://github.com/neondatabase/neon/issues/4088. Therefore, we now consider duplicated layers in the post-compaction process to avoid violating the layer map duplicate checks. related previous works: close https://github.com/neondatabase/neon/pull/4094 error reported in: https://github.com/neondatabase/neon/issues/4690, https://github.com/neondatabase/neon/issues/4088 ## Summary of changes If a file already exists in the layer map before the compaction, do not modify the layer map and do not delete the file. The file on disk at that time should be the new one overwritten by the compaction process. This PR also adds a test case with a fail point that produces exactly the same set of files. This bypassing behavior is safe because the produced layer files have the same content / are the same representation of the original file. An alternative might be directly removing the duplicate check in the layer map, but I feel it would be good if we can prevent that in the first place. --------- Signed-off-by: Alex Chi Z Co-authored-by: Konstantin Knizhnik Co-authored-by: Heikki Linnakangas Co-authored-by: Joonas Koivunen --- pageserver/src/tenant/storage_layer.rs | 4 ++ .../src/tenant/storage_layer/delta_layer.rs | 5 ++ pageserver/src/tenant/timeline.rs | 70 ++++++++++++++++--- .../src/tenant/timeline/layer_manager.rs | 8 +++ test_runner/regress/test_duplicate_layers.py | 36 ++++++++++ 5 files changed, 113 insertions(+), 10 deletions(-) create mode 100644 test_runner/regress/test_duplicate_layers.py diff --git a/pageserver/src/tenant/storage_layer.rs b/pageserver/src/tenant/storage_layer.rs index e1ebe92c61..c6d1a0052a 100644 --- a/pageserver/src/tenant/storage_layer.rs +++ b/pageserver/src/tenant/storage_layer.rs @@ -442,6 +442,10 @@ pub trait PersistentLayer: Layer + AsLayerDesc { None } + fn downcast_delta_layer(self: Arc) -> Option> { + None + } + fn is_remote_layer(&self) -> bool { false } diff --git a/pageserver/src/tenant/storage_layer/delta_layer.rs b/pageserver/src/tenant/storage_layer/delta_layer.rs index 2eab2106a6..83a22f9f13 100644 --- a/pageserver/src/tenant/storage_layer/delta_layer.rs +++ b/pageserver/src/tenant/storage_layer/delta_layer.rs @@ -51,6 +51,7 @@ use std::io::{Seek, SeekFrom}; use std::ops::Range; use std::os::unix::fs::FileExt; use std::path::{Path, PathBuf}; +use std::sync::Arc; use tracing::*; use utils::{ @@ -414,6 +415,10 @@ impl AsLayerDesc for DeltaLayer { } impl PersistentLayer for DeltaLayer { + fn downcast_delta_layer(self: Arc) -> Option> { + Some(self) + } + fn local_path(&self) -> Option { Some(self.path()) } diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index ded65c732a..58144d9050 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -24,7 +24,7 @@ use tracing::*; use utils::id::TenantTimelineId; use std::cmp::{max, min, Ordering}; -use std::collections::{BinaryHeap, HashMap}; +use std::collections::{BinaryHeap, HashMap, HashSet}; use std::fs; use std::ops::{Deref, Range}; use std::path::{Path, PathBuf}; @@ -3140,7 +3140,7 @@ impl Timeline { #[derive(Default)] struct CompactLevel0Phase1Result { - new_layers: Vec, + new_layers: Vec>, deltas_to_compact: Vec>, } @@ -3318,6 +3318,37 @@ impl Timeline { return Ok(CompactLevel0Phase1Result::default()); } + // This failpoint is used together with `test_duplicate_layers` integration test. + // It returns the compaction result exactly the same layers as input to compaction. + // We want to ensure that this will not cause any problem when updating the layer map + // after the compaction is finished. + // + // Currently, there are two rare edge cases that will cause duplicated layers being + // inserted. + // 1. The compaction job is inturrupted / did not finish successfully. Assume we have file 1, 2, 3, 4, which + // is compacted to 5, but the page server is shut down, next time we start page server we will get a layer + // map containing 1, 2, 3, 4, and 5, whereas 5 has the same content as 4. If we trigger L0 compation at this + // point again, it is likely that we will get a file 6 which has the same content and the key range as 5, + // and this causes an overwrite. This is acceptable because the content is the same, and we should do a + // layer replace instead of the normal remove / upload process. + // 2. The input workload pattern creates exactly n files that are sorted, non-overlapping and is of target file + // size length. Compaction will likely create the same set of n files afterwards. + // + // This failpoint is a superset of both of the cases. + fail_point!("compact-level0-phase1-return-same", |_| { + println!("compact-level0-phase1-return-same"); // so that we can check if we hit the failpoint + Ok(CompactLevel0Phase1Result { + new_layers: level0_deltas + .iter() + .map(|x| x.clone().downcast_delta_layer().unwrap()) + .collect(), + deltas_to_compact: level0_deltas + .iter() + .map(|x| x.layer_desc().clone().into()) + .collect(), + }) + }); + // Gather the files to compact in this iteration. // // Start with the oldest Level 0 delta file, and collect any other @@ -3576,7 +3607,9 @@ impl Timeline { || contains_hole { // ... if so, flush previous layer and prepare to write new one - new_layers.push(writer.take().unwrap().finish(prev_key.unwrap().next())?); + new_layers.push(Arc::new( + writer.take().unwrap().finish(prev_key.unwrap().next())?, + )); writer = None; if contains_hole { @@ -3614,7 +3647,7 @@ impl Timeline { prev_key = Some(key); } if let Some(writer) = writer { - new_layers.push(writer.finish(prev_key.unwrap().next())?); + new_layers.push(Arc::new(writer.finish(prev_key.unwrap().next())?)); } // Sync layers @@ -3723,6 +3756,11 @@ impl Timeline { let mut guard = self.layers.write().await; let mut new_layer_paths = HashMap::with_capacity(new_layers.len()); + // In some rare cases, we may generate a file with exactly the same key range / LSN as before the compaction. + // We should move to numbering the layer files instead of naming them using key range / LSN some day. But for + // now, we just skip the file to avoid unintentional modification to files on the disk and in the layer map. + let mut duplicated_layers = HashSet::new(); + let mut insert_layers = Vec::new(); let mut remove_layers = Vec::new(); @@ -3749,21 +3787,33 @@ impl Timeline { .add(metadata.len()); new_layer_paths.insert(new_delta_path, LayerFileMetadata::new(metadata.len())); - let x: Arc = Arc::new(l); - x.access_stats().record_residence_event( + l.access_stats().record_residence_event( &guard, LayerResidenceStatus::Resident, LayerResidenceEventReason::LayerCreate, ); - insert_layers.push(x); + let l = l as Arc; + if guard.contains(&l) { + duplicated_layers.insert(l.layer_desc().key()); + } else { + if LayerMap::is_l0(l.layer_desc()) { + return Err(CompactionError::Other(anyhow!("compaction generates a L0 layer file as output, which will cause infinite compaction."))); + } + insert_layers.push(l); + } } // Now that we have reshuffled the data to set of new delta layers, we can // delete the old ones let mut layer_names_to_delete = Vec::with_capacity(deltas_to_compact.len()); - for l in deltas_to_compact { - layer_names_to_delete.push(l.filename()); - remove_layers.push(guard.get_from_desc(&l)); + for ldesc in deltas_to_compact { + if duplicated_layers.contains(&ldesc.key()) { + // skip duplicated layers, they will not be removed; we have already overwritten them + // with new layers in the compaction phase 1. + continue; + } + layer_names_to_delete.push(ldesc.filename()); + remove_layers.push(guard.get_from_desc(&ldesc)); } guard.finish_compact_l0( diff --git a/pageserver/src/tenant/timeline/layer_manager.rs b/pageserver/src/tenant/timeline/layer_manager.rs index 979155f8d2..77f5f38314 100644 --- a/pageserver/src/tenant/timeline/layer_manager.rs +++ b/pageserver/src/tenant/timeline/layer_manager.rs @@ -295,6 +295,10 @@ impl LayerManager { Ok(()) } + + pub(crate) fn contains(&self, layer: &Arc) -> bool { + self.layer_fmgr.contains(layer) + } } pub struct LayerFileManager( @@ -319,6 +323,10 @@ impl LayerFileManager { } } + pub(crate) fn contains(&self, layer: &Arc) -> bool { + self.0.contains_key(&layer.layer_desc().key()) + } + pub(crate) fn new() -> Self { Self(HashMap::new()) } diff --git a/test_runner/regress/test_duplicate_layers.py b/test_runner/regress/test_duplicate_layers.py new file mode 100644 index 0000000000..c1832a2063 --- /dev/null +++ b/test_runner/regress/test_duplicate_layers.py @@ -0,0 +1,36 @@ +import time + +import pytest +from fixtures.neon_fixtures import NeonEnvBuilder, PgBin + + +# Test duplicate layer detection +# +# This test sets fail point at the end of first compaction phase: +# after flushing new L1 layers but before deletion of L0 layers +# it should cause generation of duplicate L1 layer by compaction after restart. +@pytest.mark.timeout(600) +def test_duplicate_layers(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin): + env = neon_env_builder.init_start() + pageserver_http = env.pageserver.http_client() + + # Use aggressive compaction and checkpoint settings + tenant_id, _ = env.neon_cli.create_tenant( + conf={ + "checkpoint_distance": f"{1024 ** 2}", + "compaction_target_size": f"{1024 ** 2}", + "compaction_period": "5 s", + "compaction_threshold": "3", + } + ) + + pageserver_http.configure_failpoints(("compact-level0-phase1-return-same", "return")) + + endpoint = env.endpoints.create_start("main", tenant_id=tenant_id) + connstr = endpoint.connstr(options="-csynchronous_commit=off") + pg_bin.run_capture(["pgbench", "-i", "-s1", connstr]) + + time.sleep(10) # let compaction to be performed + assert env.pageserver.log_contains("compact-level0-phase1-return-same") + + pg_bin.run_capture(["pgbench", "-P1", "-N", "-c5", "-T500", "-Mprepared", connstr]) From 7c85c7ea9170afc48360bc69d8bec266e52c34b4 Mon Sep 17 00:00:00 2001 From: Conrad Ludgate Date: Mon, 17 Jul 2023 15:53:01 +0100 Subject: [PATCH 34/58] proxy: merge connect compute (#4713) ## Problem Half of #4699. TCP/WS have one implementation of `connect_to_compute`, HTTP has another implementation of `connect_to_compute`. Having both is annoying to deal with. ## Summary of changes Creates a set of traits `ConnectMechanism` and `ShouldError` that allows the `connect_to_compute` to be generic over raw TCP stream or tokio_postgres based connections. I'm not super happy with this. I think it would be nice to remove tokio_postgres entirely but that will need a lot more thought to be put into it. I have also slightly refactored the caching to use fewer references. Instead using ownership to ensure the state of retrying is encoded in the type system. --- proxy/src/cache.rs | 13 +- proxy/src/compute.rs | 13 +- proxy/src/console/provider.rs | 4 +- proxy/src/console/provider/mock.rs | 4 +- proxy/src/console/provider/neon.rs | 4 +- proxy/src/http/conn_pool.rs | 98 ++++------- proxy/src/proxy.rs | 255 ++++++++++++++++++----------- 7 files changed, 215 insertions(+), 176 deletions(-) diff --git a/proxy/src/cache.rs b/proxy/src/cache.rs index 4e16cc39ec..a9d6793bbd 100644 --- a/proxy/src/cache.rs +++ b/proxy/src/cache.rs @@ -262,24 +262,21 @@ pub mod timed_lru { token: Option<(C, C::LookupInfo)>, /// The value itself. - pub value: C::Value, + value: C::Value, } impl Cached { /// Place any entry into this wrapper; invalidation will be a no-op. - /// Unfortunately, rust doesn't let us implement [`From`] or [`Into`]. - pub fn new_uncached(value: impl Into) -> Self { - Self { - token: None, - value: value.into(), - } + pub fn new_uncached(value: C::Value) -> Self { + Self { token: None, value } } /// Drop this entry from a cache if it's still there. - pub fn invalidate(&self) { + pub fn invalidate(self) -> C::Value { if let Some((cache, info)) = &self.token { cache.invalidate(info); } + self.value } /// Tell if this entry is actually cached. diff --git a/proxy/src/compute.rs b/proxy/src/compute.rs index ccf100397b..b1cf2a8559 100644 --- a/proxy/src/compute.rs +++ b/proxy/src/compute.rs @@ -1,4 +1,9 @@ -use crate::{auth::parse_endpoint_param, cancellation::CancelClosure, error::UserFacingError}; +use crate::{ + auth::parse_endpoint_param, + cancellation::CancelClosure, + console::errors::WakeComputeError, + error::{io_error, UserFacingError}, +}; use futures::{FutureExt, TryFutureExt}; use itertools::Itertools; use pq_proto::StartupMessageParams; @@ -24,6 +29,12 @@ pub enum ConnectionError { TlsError(#[from] native_tls::Error), } +impl From for ConnectionError { + fn from(value: WakeComputeError) -> Self { + io_error(value).into() + } +} + impl UserFacingError for ConnectionError { fn to_string_client(&self) -> String { use ConnectionError::*; diff --git a/proxy/src/console/provider.rs b/proxy/src/console/provider.rs index 77b4330e44..3eaed1b82b 100644 --- a/proxy/src/console/provider.rs +++ b/proxy/src/console/provider.rs @@ -186,14 +186,14 @@ pub trait Api { async fn get_auth_info( &self, extra: &ConsoleReqExtra<'_>, - creds: &ClientCredentials<'_>, + creds: &ClientCredentials, ) -> Result, errors::GetAuthInfoError>; /// Wake up the compute node and return the corresponding connection info. async fn wake_compute( &self, extra: &ConsoleReqExtra<'_>, - creds: &ClientCredentials<'_>, + creds: &ClientCredentials, ) -> Result; } diff --git a/proxy/src/console/provider/mock.rs b/proxy/src/console/provider/mock.rs index 3b42c73a34..282567269d 100644 --- a/proxy/src/console/provider/mock.rs +++ b/proxy/src/console/provider/mock.rs @@ -106,7 +106,7 @@ impl super::Api for Api { async fn get_auth_info( &self, _extra: &ConsoleReqExtra<'_>, - creds: &ClientCredentials<'_>, + creds: &ClientCredentials, ) -> Result, GetAuthInfoError> { self.do_get_auth_info(creds).await } @@ -115,7 +115,7 @@ impl super::Api for Api { async fn wake_compute( &self, _extra: &ConsoleReqExtra<'_>, - _creds: &ClientCredentials<'_>, + _creds: &ClientCredentials, ) -> Result { self.do_wake_compute() .map_ok(CachedNodeInfo::new_uncached) diff --git a/proxy/src/console/provider/neon.rs b/proxy/src/console/provider/neon.rs index a8e855b2c8..22e766b5f1 100644 --- a/proxy/src/console/provider/neon.rs +++ b/proxy/src/console/provider/neon.rs @@ -123,7 +123,7 @@ impl super::Api for Api { async fn get_auth_info( &self, extra: &ConsoleReqExtra<'_>, - creds: &ClientCredentials<'_>, + creds: &ClientCredentials, ) -> Result, GetAuthInfoError> { self.do_get_auth_info(extra, creds).await } @@ -132,7 +132,7 @@ impl super::Api for Api { async fn wake_compute( &self, extra: &ConsoleReqExtra<'_>, - creds: &ClientCredentials<'_>, + creds: &ClientCredentials, ) -> Result { let key = creds.project().expect("impossible"); diff --git a/proxy/src/http/conn_pool.rs b/proxy/src/http/conn_pool.rs index 49c94a830f..703632a511 100644 --- a/proxy/src/http/conn_pool.rs +++ b/proxy/src/http/conn_pool.rs @@ -1,19 +1,17 @@ +use anyhow::Context; +use async_trait::async_trait; use parking_lot::Mutex; use pq_proto::StartupMessageParams; use std::fmt; -use std::ops::ControlFlow; use std::{collections::HashMap, sync::Arc}; use tokio::time; -use crate::config; use crate::{auth, console}; +use crate::{compute, config}; use super::sql_over_http::MAX_RESPONSE_SIZE; -use crate::proxy::{ - can_retry_tokio_postgres_error, invalidate_cache, retry_after, try_wake, - NUM_RETRIES_WAKE_COMPUTE, -}; +use crate::proxy::ConnectMechanism; use tracing::error; use tracing::info; @@ -187,6 +185,27 @@ impl GlobalConnPool { } } +struct TokioMechanism<'a> { + conn_info: &'a ConnInfo, +} + +#[async_trait] +impl ConnectMechanism for TokioMechanism<'_> { + type Connection = tokio_postgres::Client; + type ConnectError = tokio_postgres::Error; + type Error = anyhow::Error; + + async fn connect_once( + &self, + node_info: &console::CachedNodeInfo, + timeout: time::Duration, + ) -> Result { + connect_to_compute_once(node_info, self.conn_info, timeout).await + } + + fn update_connect_config(&self, _config: &mut compute::ConnCfg) {} +} + // Wake up the destination if needed. Code here is a bit involved because // we reuse the code from the usual proxy and we need to prepare few structures // that this code expects. @@ -220,72 +239,18 @@ async fn connect_to_compute( application_name: Some(APP_NAME), }; - let node_info = &mut creds.wake_compute(&extra).await?.expect("msg"); + let node_info = creds + .wake_compute(&extra) + .await? + .context("missing cache entry from wake_compute")?; - let mut num_retries = 0; - let mut wait_duration = time::Duration::ZERO; - let mut should_wake_with_error = None; - loop { - if !wait_duration.is_zero() { - time::sleep(wait_duration).await; - } - - // try wake the compute node if we have determined it's sensible to do so - if let Some(err) = should_wake_with_error.take() { - match try_wake(node_info, &extra, &creds).await { - // we can't wake up the compute node - Ok(None) => return Err(err), - // there was an error communicating with the control plane - Err(e) => return Err(e.into()), - // failed to wake up but we can continue to retry - Ok(Some(ControlFlow::Continue(()))) => { - wait_duration = retry_after(num_retries); - should_wake_with_error = Some(err); - - num_retries += 1; - info!(num_retries, "retrying wake compute"); - continue; - } - // successfully woke up a compute node and can break the wakeup loop - Ok(Some(ControlFlow::Break(()))) => {} - } - } - - match connect_to_compute_once(node_info, conn_info).await { - Ok(res) => return Ok(res), - Err(e) => { - error!(error = ?e, "could not connect to compute node"); - if !can_retry_error(&e, num_retries) { - return Err(e.into()); - } - wait_duration = retry_after(num_retries); - - // after the first connect failure, - // we should invalidate the cache and wake up a new compute node - if num_retries == 0 { - invalidate_cache(node_info); - should_wake_with_error = Some(e.into()); - } - } - } - - num_retries += 1; - info!(num_retries, "retrying connect"); - } -} - -fn can_retry_error(err: &tokio_postgres::Error, num_retries: u32) -> bool { - match err { - // retry all errors at least once - _ if num_retries == 0 => true, - _ if num_retries >= NUM_RETRIES_WAKE_COMPUTE => false, - err => can_retry_tokio_postgres_error(err), - } + crate::proxy::connect_to_compute(&TokioMechanism { conn_info }, node_info, &extra, &creds).await } async fn connect_to_compute_once( node_info: &console::CachedNodeInfo, conn_info: &ConnInfo, + timeout: time::Duration, ) -> Result { let mut config = (*node_info.config).clone(); @@ -294,6 +259,7 @@ async fn connect_to_compute_once( .password(&conn_info.password) .dbname(&conn_info.dbname) .max_backend_message_size(MAX_RESPONSE_SIZE) + .connect_timeout(timeout) .connect(tokio_postgres::NoTls) .await?; diff --git a/proxy/src/proxy.rs b/proxy/src/proxy.rs index 8722109b80..d4a3f2641e 100644 --- a/proxy/src/proxy.rs +++ b/proxy/src/proxy.rs @@ -11,16 +11,16 @@ use crate::{ errors::{ApiError, WakeComputeError}, messages::MetricsAuxInfo, }, - error::io_error, stream::{PqStream, Stream}, }; use anyhow::{bail, Context}; +use async_trait::async_trait; use futures::TryFutureExt; use hyper::StatusCode; use metrics::{register_int_counter, register_int_counter_vec, IntCounter, IntCounterVec}; use once_cell::sync::Lazy; use pq_proto::{BeMessage as Be, FeStartupPacket, StartupMessageParams}; -use std::{error::Error, ops::ControlFlow, sync::Arc}; +use std::{error::Error, io, ops::ControlFlow, sync::Arc}; use tokio::{ io::{AsyncRead, AsyncWrite, AsyncWriteExt}, time, @@ -31,7 +31,7 @@ use utils::measured_stream::MeasuredStream; /// Number of times we should retry the `/proxy_wake_compute` http request. /// Retry duration is BASE_RETRY_WAIT_DURATION * 1.5^n -pub const NUM_RETRIES_WAKE_COMPUTE: u32 = 10; +const NUM_RETRIES_WAKE_COMPUTE: u32 = 10; const BASE_RETRY_WAIT_DURATION: time::Duration = time::Duration::from_millis(100); const ERR_INSECURE_CONNECTION: &str = "connection is insecure (try using `sslmode=require`)"; @@ -303,18 +303,18 @@ async fn handshake( /// (e.g. the compute node's address might've changed at the wrong time). /// Invalidate the cache entry (if any) to prevent subsequent errors. #[tracing::instrument(name = "invalidate_cache", skip_all)] -pub fn invalidate_cache(node_info: &console::CachedNodeInfo) { +pub fn invalidate_cache(node_info: console::CachedNodeInfo) -> compute::ConnCfg { let is_cached = node_info.cached(); if is_cached { warn!("invalidating stalled compute node info cache entry"); - node_info.invalidate(); } - let label = match is_cached { true => "compute_cached", false => "compute_uncached", }; NUM_CONNECTION_FAILURES.with_label_values(&[label]).inc(); + + node_info.invalidate().config } /// Try to connect to the compute node once. @@ -331,47 +331,68 @@ async fn connect_to_compute_once( .await } +enum ConnectionState { + Cached(console::CachedNodeInfo), + Invalid(compute::ConnCfg, E), +} + +#[async_trait] +pub trait ConnectMechanism { + type Connection; + type ConnectError; + type Error: From; + async fn connect_once( + &self, + node_info: &console::CachedNodeInfo, + timeout: time::Duration, + ) -> Result; + + fn update_connect_config(&self, conf: &mut compute::ConnCfg); +} + +pub struct TcpMechanism<'a> { + /// KV-dictionary with PostgreSQL connection params. + pub params: &'a StartupMessageParams, +} + +#[async_trait] +impl ConnectMechanism for TcpMechanism<'_> { + type Connection = PostgresConnection; + type ConnectError = compute::ConnectionError; + type Error = compute::ConnectionError; + + async fn connect_once( + &self, + node_info: &console::CachedNodeInfo, + timeout: time::Duration, + ) -> Result { + connect_to_compute_once(node_info, timeout).await + } + + fn update_connect_config(&self, config: &mut compute::ConnCfg) { + config.set_startup_params(self.params); + } +} + /// Try to connect to the compute node, retrying if necessary. /// This function might update `node_info`, so we take it by `&mut`. #[tracing::instrument(skip_all)] -async fn connect_to_compute( - node_info: &mut console::CachedNodeInfo, - params: &StartupMessageParams, +pub async fn connect_to_compute( + mechanism: &M, + mut node_info: console::CachedNodeInfo, extra: &console::ConsoleReqExtra<'_>, creds: &auth::BackendType<'_, auth::ClientCredentials<'_>>, -) -> Result { +) -> Result +where + M::ConnectError: ShouldRetry + std::fmt::Debug, + M::Error: From, +{ + mechanism.update_connect_config(&mut node_info.config); + let mut num_retries = 0; - let mut wait_duration = time::Duration::ZERO; - let mut should_wake_with_error = None; + let mut state = ConnectionState::::Cached(node_info); + loop { - // Apply startup params to the (possibly, cached) compute node info. - node_info.config.set_startup_params(params); - - if !wait_duration.is_zero() { - time::sleep(wait_duration).await; - } - - // try wake the compute node if we have determined it's sensible to do so - if let Some(err) = should_wake_with_error.take() { - match try_wake(node_info, extra, creds).await { - // we can't wake up the compute node - Ok(None) => return Err(err), - // there was an error communicating with the control plane - Err(e) => return Err(io_error(e).into()), - // failed to wake up but we can continue to retry - Ok(Some(ControlFlow::Continue(()))) => { - wait_duration = retry_after(num_retries); - should_wake_with_error = Some(err); - - num_retries += 1; - info!(num_retries, "retrying wake compute"); - continue; - } - // successfully woke up a compute node and can break the wakeup loop - Ok(Some(ControlFlow::Break(()))) => {} - } - } - // Set a shorter timeout for the initial connection attempt. // // In case we try to connect to an outdated address that is no longer valid, the @@ -391,29 +412,56 @@ async fn connect_to_compute( time::Duration::from_secs(10) }; - // do this again to ensure we have username? - node_info.config.set_startup_params(params); + match state { + ConnectionState::Invalid(config, err) => { + match try_wake(&config, extra, creds).await { + // we can't wake up the compute node + Ok(None) => return Err(err.into()), + // there was an error communicating with the control plane + Err(e) => return Err(e.into()), + // failed to wake up but we can continue to retry + Ok(Some(ControlFlow::Continue(()))) => { + state = ConnectionState::Invalid(config, err); + let wait_duration = retry_after(num_retries); + num_retries += 1; - match connect_to_compute_once(node_info, timeout).await { - Ok(res) => return Ok(res), - Err(e) => { - error!(error = ?e, "could not connect to compute node"); - if !can_retry_error(&e, num_retries) { - return Err(e); + info!(num_retries, "retrying wake compute"); + time::sleep(wait_duration).await; + continue; + } + // successfully woke up a compute node and can break the wakeup loop + Ok(Some(ControlFlow::Break(mut node_info))) => { + mechanism.update_connect_config(&mut node_info.config); + state = ConnectionState::Cached(node_info) + } } - wait_duration = retry_after(num_retries); + } + ConnectionState::Cached(node_info) => { + match mechanism.connect_once(&node_info, timeout).await { + Ok(res) => return Ok(res), + Err(e) => { + error!(error = ?e, "could not connect to compute node"); + if !e.should_retry(num_retries) { + return Err(e.into()); + } - // after the first connect failure, - // we should invalidate the cache and wake up a new compute node - if num_retries == 0 { - invalidate_cache(node_info); - should_wake_with_error = Some(e); + // after the first connect failure, + // we should invalidate the cache and wake up a new compute node + if num_retries == 0 { + state = ConnectionState::Invalid(invalidate_cache(node_info), e); + } else { + state = ConnectionState::Cached(node_info); + } + + let wait_duration = retry_after(num_retries); + num_retries += 1; + + info!(num_retries, "retrying wake compute"); + time::sleep(wait_duration).await; + } } } } - - num_retries += 1; - info!(num_retries, "retrying connect"); } } @@ -421,11 +469,11 @@ async fn connect_to_compute( /// * Returns Ok(Some(true)) if there was an error waking but retries are acceptable /// * Returns Ok(Some(false)) if the wakeup succeeded /// * Returns Ok(None) or Err(e) if there was an error -pub async fn try_wake( - node_info: &mut console::CachedNodeInfo, +async fn try_wake( + config: &compute::ConnCfg, extra: &console::ConsoleReqExtra<'_>, creds: &auth::BackendType<'_, auth::ClientCredentials<'_>>, -) -> Result>, WakeComputeError> { +) -> Result>, WakeComputeError> { info!("compute node's state has likely changed; requesting a wake-up"); match creds.wake_compute(extra).await { // retry wake if the compute was in an invalid state @@ -435,53 +483,69 @@ pub async fn try_wake( })) => Ok(Some(ControlFlow::Continue(()))), // Update `node_info` and try again. Ok(Some(mut new)) => { - new.config.reuse_password(&node_info.config); - *node_info = new; - Ok(Some(ControlFlow::Break(()))) + new.config.reuse_password(config); + Ok(Some(ControlFlow::Break(new))) } Err(e) => Err(e), Ok(None) => Ok(None), } } -fn can_retry_error(err: &compute::ConnectionError, num_retries: u32) -> bool { - match err { - // retry all errors at least once - _ if num_retries == 0 => true, - _ if num_retries >= NUM_RETRIES_WAKE_COMPUTE => false, - compute::ConnectionError::Postgres(err) => can_retry_tokio_postgres_error(err), - compute::ConnectionError::CouldNotConnect(err) => is_io_connection_err(err), - _ => false, +pub trait ShouldRetry { + fn could_retry(&self) -> bool; + fn should_retry(&self, num_retries: u32) -> bool { + match self { + // retry all errors at least once + _ if num_retries == 0 => true, + _ if num_retries >= NUM_RETRIES_WAKE_COMPUTE => false, + err => err.could_retry(), + } } } -pub fn can_retry_tokio_postgres_error(err: &tokio_postgres::Error) -> bool { - if let Some(io_err) = err.source().and_then(|x| x.downcast_ref()) { - is_io_connection_err(io_err) - } else if let Some(db_err) = err.source().and_then(|x| x.downcast_ref()) { - is_sql_connection_err(db_err) - } else { - false +impl ShouldRetry for io::Error { + fn could_retry(&self) -> bool { + use std::io::ErrorKind; + matches!( + self.kind(), + ErrorKind::ConnectionRefused | ErrorKind::AddrNotAvailable | ErrorKind::TimedOut + ) } } -fn is_sql_connection_err(err: &tokio_postgres::error::DbError) -> bool { - use tokio_postgres::error::SqlState; - matches!( - err.code(), - &SqlState::CONNECTION_FAILURE - | &SqlState::CONNECTION_EXCEPTION - | &SqlState::CONNECTION_DOES_NOT_EXIST - | &SqlState::SQLCLIENT_UNABLE_TO_ESTABLISH_SQLCONNECTION, - ) +impl ShouldRetry for tokio_postgres::error::DbError { + fn could_retry(&self) -> bool { + use tokio_postgres::error::SqlState; + matches!( + self.code(), + &SqlState::CONNECTION_FAILURE + | &SqlState::CONNECTION_EXCEPTION + | &SqlState::CONNECTION_DOES_NOT_EXIST + | &SqlState::SQLCLIENT_UNABLE_TO_ESTABLISH_SQLCONNECTION, + ) + } } -fn is_io_connection_err(err: &std::io::Error) -> bool { - use std::io::ErrorKind; - matches!( - err.kind(), - ErrorKind::ConnectionRefused | ErrorKind::AddrNotAvailable | ErrorKind::TimedOut - ) +impl ShouldRetry for tokio_postgres::Error { + fn could_retry(&self) -> bool { + if let Some(io_err) = self.source().and_then(|x| x.downcast_ref()) { + io::Error::could_retry(io_err) + } else if let Some(db_err) = self.source().and_then(|x| x.downcast_ref()) { + tokio_postgres::error::DbError::could_retry(db_err) + } else { + false + } + } +} + +impl ShouldRetry for compute::ConnectionError { + fn could_retry(&self) -> bool { + match self { + compute::ConnectionError::Postgres(err) => err.could_retry(), + compute::ConnectionError::CouldNotConnect(err) => err.could_retry(), + _ => false, + } + } } pub fn retry_after(num_retries: u32) -> time::Duration { @@ -637,7 +701,8 @@ impl Client<'_, S> { node_info.allow_self_signed_compute = allow_self_signed_compute; - let mut node = connect_to_compute(&mut node_info, params, &extra, &creds) + let aux = node_info.aux.clone(); + let mut node = connect_to_compute(&TcpMechanism { params }, node_info, &extra, &creds) .or_else(|e| stream.throw_error(e)) .await?; @@ -648,6 +713,6 @@ impl Client<'_, S> { // immediately after opening the connection. let (stream, read_buf) = stream.into_inner(); node.stream.write_all(&read_buf).await?; - proxy_pass(stream, node.stream, &node_info.aux).await + proxy_pass(stream, node.stream, &aux).await } } From be271e3edf33af783413f9949e2417d95a519b91 Mon Sep 17 00:00:00 2001 From: Kirill Bulatov Date: Mon, 17 Jul 2023 19:18:33 +0300 Subject: [PATCH 35/58] Use upstream version of tokio-tar (#4722) tokio-tar 0.3.1 got released, including all changes from the fork currently used, switch over to that one. --- Cargo.lock | 20 +++++++++++++++----- Cargo.toml | 2 +- pageserver/src/basebackup.rs | 6 ------ 3 files changed, 16 insertions(+), 12 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 6bbb5dbfa2..b5f6b3b328 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -4098,7 +4098,7 @@ checksum = "4b55807c0344e1e6c04d7c965f5289c39a8d94ae23ed5c0b57aabac549f871c6" dependencies = [ "filetime", "libc", - "xattr", + "xattr 0.2.3", ] [[package]] @@ -4379,16 +4379,17 @@ dependencies = [ [[package]] name = "tokio-tar" -version = "0.3.0" -source = "git+https://github.com/neondatabase/tokio-tar.git?rev=404df61437de0feef49ba2ccdbdd94eb8ad6e142#404df61437de0feef49ba2ccdbdd94eb8ad6e142" +version = "0.3.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "9d5714c010ca3e5c27114c1cdeb9d14641ace49874aa5626d7149e47aedace75" dependencies = [ "filetime", "futures-core", "libc", - "redox_syscall 0.2.16", + "redox_syscall 0.3.5", "tokio", "tokio-stream", - "xattr", + "xattr 1.0.0", ] [[package]] @@ -5362,6 +5363,15 @@ dependencies = [ "libc", ] +[[package]] +name = "xattr" +version = "1.0.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ea263437ca03c1522846a4ddafbca2542d0ad5ed9b784909d4b27b76f62bc34a" +dependencies = [ + "libc", +] + [[package]] name = "xmlparser" version = "0.13.5" diff --git a/Cargo.toml b/Cargo.toml index 6ae31c13ac..01e2fe7cf9 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -124,6 +124,7 @@ tokio-io-timeout = "1.2.0" tokio-postgres-rustls = "0.9.0" tokio-rustls = "0.23" tokio-stream = "0.1" +tokio-tar = "0.3" tokio-util = { version = "0.7", features = ["io"] } toml = "0.7" toml_edit = "0.19" @@ -148,7 +149,6 @@ postgres-native-tls = { git = "https://github.com/neondatabase/rust-postgres.git postgres-protocol = { git = "https://github.com/neondatabase/rust-postgres.git", rev="1aaedab101b23f7612042850d8f2036810fa7c7f" } postgres-types = { git = "https://github.com/neondatabase/rust-postgres.git", rev="1aaedab101b23f7612042850d8f2036810fa7c7f" } tokio-postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="1aaedab101b23f7612042850d8f2036810fa7c7f" } -tokio-tar = { git = "https://github.com/neondatabase/tokio-tar.git", rev="404df61437de0feef49ba2ccdbdd94eb8ad6e142" } ## Other git libraries heapless = { default-features=false, features=[], git = "https://github.com/japaric/heapless.git", rev = "644653bf3b831c6bb4963be2de24804acf5e5001" } # upstream release pending diff --git a/pageserver/src/basebackup.rs b/pageserver/src/basebackup.rs index c666fc785c..d2dc759835 100644 --- a/pageserver/src/basebackup.rs +++ b/pageserver/src/basebackup.rs @@ -19,12 +19,6 @@ use tokio::io; use tokio::io::AsyncWrite; use tracing::*; -/// NB: This relies on a modified version of tokio_tar that does *not* write the -/// end-of-archive marker (1024 zero bytes), when the Builder struct is dropped -/// without explicitly calling 'finish' or 'into_inner'! -/// -/// See https://github.com/neondatabase/tokio-tar/pull/1 -/// use tokio_tar::{Builder, EntryType, Header}; use crate::context::RequestContext; From 149dd36b6b6302fe96a749199c338d3c3312c2fd Mon Sep 17 00:00:00 2001 From: bojanserafimov Date: Mon, 17 Jul 2023 14:47:08 -0400 Subject: [PATCH 36/58] Update pg: add startup logs (#4736) --- vendor/postgres-v15 | 2 +- vendor/revisions.json | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/vendor/postgres-v15 b/vendor/postgres-v15 index 44e3f7221c..e3fbfc4d14 160000 --- a/vendor/postgres-v15 +++ b/vendor/postgres-v15 @@ -1 +1 @@ -Subproject commit 44e3f7221cafa6ad55dd0d9c62a980dd79e66089 +Subproject commit e3fbfc4d143b2d3c3c1813ce747f8af35aa9405e diff --git a/vendor/revisions.json b/vendor/revisions.json index 981629b7b8..18da5900a8 100644 --- a/vendor/revisions.json +++ b/vendor/revisions.json @@ -1,4 +1,4 @@ { - "postgres-v15": "44e3f7221cafa6ad55dd0d9c62a980dd79e66089", + "postgres-v15": "e3fbfc4d143b2d3c3c1813ce747f8af35aa9405e", "postgres-v14": "12c5dc8281d20b5bd636e1097eea80a7bc609591" } From 196943c78f15a35d89b19bc1ec52d4c38b836b47 Mon Sep 17 00:00:00 2001 From: George MacKerron Date: Mon, 17 Jul 2023 20:01:25 +0100 Subject: [PATCH 37/58] CORS preflight OPTIONS support for /sql (http fetch) endpoint (#4706) ## Problem HTTP fetch can't be used from browsers because proxy doesn't support [CORS 'preflight' `OPTIONS` requests](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS#preflighted_requests). ## Summary of changes Added a simple `OPTIONS` endpoint for `/sql`. --- proxy/src/http/websocket.rs | 12 ++++++++++++ 1 file changed, 12 insertions(+) diff --git a/proxy/src/http/websocket.rs b/proxy/src/http/websocket.rs index 83ba034e57..ebbf3e728e 100644 --- a/proxy/src/http/websocket.rs +++ b/proxy/src/http/websocket.rs @@ -221,6 +221,18 @@ async fn ws_handler( ); r }) + } else if request.uri().path() == "/sql" && request.method() == Method::OPTIONS { + Response::builder() + .header("Allow", "OPTIONS, POST") + .header("Access-Control-Allow-Origin", "*") + .header( + "Access-Control-Allow-Headers", + "Neon-Connection-String, Neon-Raw-Text-Output, Neon-Array-Mode, Neon-Pool-Opt-In", + ) + .header("Access-Control-Max-Age", "86400" /* 24 hours */) + .status(StatusCode::OK) // 204 is also valid, but see: https://developer.mozilla.org/en-US/docs/Web/HTTP/Methods/OPTIONS#status_code + .body(Body::empty()) + .map_err(|e| ApiError::BadRequest(e.into())) } else { json_response(StatusCode::BAD_REQUEST, "query is not supported") } From e074ccf1700ea4d71abfc57c381de43354dd036a Mon Sep 17 00:00:00 2001 From: Conrad Ludgate Date: Mon, 17 Jul 2023 20:05:26 +0100 Subject: [PATCH 38/58] reduce proxy timeouts (#4708) ## Problem 10 retries * 10 second timeouts makes for a very long retry window. ## Summary of changes Adds a 2s timeout to sql_over_http connections, and also reduces the 10s timeout in TCP. --- proxy/src/proxy.rs | 26 ++++---------------------- 1 file changed, 4 insertions(+), 22 deletions(-) diff --git a/proxy/src/proxy.rs b/proxy/src/proxy.rs index d4a3f2641e..a43192c11e 100644 --- a/proxy/src/proxy.rs +++ b/proxy/src/proxy.rs @@ -31,7 +31,8 @@ use utils::measured_stream::MeasuredStream; /// Number of times we should retry the `/proxy_wake_compute` http request. /// Retry duration is BASE_RETRY_WAIT_DURATION * 1.5^n -const NUM_RETRIES_WAKE_COMPUTE: u32 = 10; +const NUM_RETRIES_CONNECT: u32 = 10; +const CONNECT_TIMEOUT: time::Duration = time::Duration::from_secs(2); const BASE_RETRY_WAIT_DURATION: time::Duration = time::Duration::from_millis(100); const ERR_INSECURE_CONNECTION: &str = "connection is insecure (try using `sslmode=require`)"; @@ -393,25 +394,6 @@ where let mut state = ConnectionState::::Cached(node_info); loop { - // Set a shorter timeout for the initial connection attempt. - // - // In case we try to connect to an outdated address that is no longer valid, the - // default behavior of Kubernetes is to drop the packets, causing us to wait for - // the entire timeout period. We want to fail fast in such cases. - // - // A specific case to consider is when we have cached compute node information - // with a 4-minute TTL (Time To Live), but the user has executed a `/suspend` API - // call, resulting in the nonexistence of the compute node. - // - // We only use caching in case of scram proxy backed by the console, so reduce - // the timeout only in that case. - let is_scram_proxy = matches!(creds, auth::BackendType::Console(_, _)); - let timeout = if is_scram_proxy && num_retries == 0 { - time::Duration::from_secs(2) - } else { - time::Duration::from_secs(10) - }; - match state { ConnectionState::Invalid(config, err) => { match try_wake(&config, extra, creds).await { @@ -437,7 +419,7 @@ where } } ConnectionState::Cached(node_info) => { - match mechanism.connect_once(&node_info, timeout).await { + match mechanism.connect_once(&node_info, CONNECT_TIMEOUT).await { Ok(res) => return Ok(res), Err(e) => { error!(error = ?e, "could not connect to compute node"); @@ -497,7 +479,7 @@ pub trait ShouldRetry { match self { // retry all errors at least once _ if num_retries == 0 => true, - _ if num_retries >= NUM_RETRIES_WAKE_COMPUTE => false, + _ if num_retries >= NUM_RETRIES_CONNECT => false, err => err.could_retry(), } } From 4580f5085a3eb821a1d1eff688ed8d8a1ceb80ea Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Mon, 17 Jul 2023 20:09:45 +0100 Subject: [PATCH 39/58] test_runner: run benchmarks in parallel (#4683) ## Problem Benchmarks run takes about an hour on main branch (in a single job), which delays pipeline results. And it takes another hour if we want to restart the job due to some failures. ## Summary of changes - Use `pytest-split` plugin to run benchmarks on separate CI runners in 4 parallel jobs - Add `scripts/benchmark_durations.py` for getting benchmark durations from the database to help `pytest-split` schedule tests more evenly. It uses p99 for the last 10 days' results (durations). The current distribution could be better; each worker's durations vary from 9m to 35m, but this could be improved in consequent PRs. --- .../actions/run-python-test-set/action.yml | 8 + .github/workflows/build_and_test.yml | 6 +- poetry.lock | 16 +- pyproject.toml | 1 + scripts/benchmark_durations.py | 177 ++++++++++++++++++ 5 files changed, 204 insertions(+), 4 deletions(-) create mode 100755 scripts/benchmark_durations.py diff --git a/.github/actions/run-python-test-set/action.yml b/.github/actions/run-python-test-set/action.yml index dec1f47e47..ceb6f4aa90 100644 --- a/.github/actions/run-python-test-set/action.yml +++ b/.github/actions/run-python-test-set/action.yml @@ -150,6 +150,14 @@ runs: EXTRA_PARAMS="--flaky-tests-json $TEST_OUTPUT/flaky.json $EXTRA_PARAMS" fi + # We use pytest-split plugin to run benchmarks in parallel on different CI runners + if [ "${TEST_SELECTION}" = "test_runner/performance" ] && [ "${{ inputs.build_type }}" != "remote" ]; then + mkdir -p $TEST_OUTPUT + poetry run ./scripts/benchmark_durations.py "${TEST_RESULT_CONNSTR}" --days 10 --output "$TEST_OUTPUT/benchmark_durations.json" + + EXTRA_PARAMS="--durations-path $TEST_OUTPUT/benchmark_durations.json $EXTRA_PARAMS" + fi + if [[ "${{ inputs.build_type }}" == "debug" ]]; then cov_prefix=(scripts/coverage "--profraw-prefix=$GITHUB_JOB" --dir=/tmp/coverage run) elif [[ "${{ inputs.build_type }}" == "release" ]]; then diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index daa0a0da98..5f3e4f1145 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -396,13 +396,11 @@ jobs: strategy: fail-fast: false matrix: + pytest_split_group: [ 1, 2, 3, 4 ] build_type: [ release ] steps: - name: Checkout uses: actions/checkout@v3 - with: - submodules: true - fetch-depth: 1 - name: Pytest benchmarks uses: ./.github/actions/run-python-test-set @@ -411,9 +409,11 @@ jobs: test_selection: performance run_in_parallel: false save_perf_report: ${{ github.ref_name == 'main' }} + extra_params: --splits ${{ strategy.job-total }} --group ${{ matrix.pytest_split_group }} env: VIP_VAP_ACCESS_TOKEN: "${{ secrets.VIP_VAP_ACCESS_TOKEN }}" PERF_TEST_RESULT_CONNSTR: "${{ secrets.PERF_TEST_RESULT_CONNSTR }}" + TEST_RESULT_CONNSTR: "${{ secrets.REGRESS_TEST_RESULT_CONNSTR }}" # XXX: no coverage data handling here, since benchmarks are run on release builds, # while coverage is currently collected for the debug ones diff --git a/poetry.lock b/poetry.lock index aadbb7c33f..b22a6a5bc9 100644 --- a/poetry.lock +++ b/poetry.lock @@ -1868,6 +1868,20 @@ files = [ packaging = ">=17.1" pytest = ">=5.3" +[[package]] +name = "pytest-split" +version = "0.8.1" +description = "Pytest plugin which splits the test suite to equally sized sub suites based on test execution time." +optional = false +python-versions = ">=3.7.1,<4.0" +files = [ + {file = "pytest_split-0.8.1-py3-none-any.whl", hash = "sha256:74b110ea091bd147cc1c5f9665a59506e5cedfa66f96a89fb03e4ab447c2c168"}, + {file = "pytest_split-0.8.1.tar.gz", hash = "sha256:2d88bd3dc528689a7a3f58fc12ea165c3aa62e90795e420dfad920afe5612d6d"}, +] + +[package.dependencies] +pytest = ">=5,<8" + [[package]] name = "pytest-timeout" version = "2.1.0" @@ -2513,4 +2527,4 @@ testing = ["func-timeout", "jaraco.itertools", "pytest (>=6)", "pytest-black (>= [metadata] lock-version = "2.0" python-versions = "^3.9" -content-hash = "fe771b153ef7e308d6d04421d0eb3f97d00780882277d2b4fc1f296054d8db79" +content-hash = "e16a65d8fdff4e2173610e552e0e7306e301de2c640ae6082ef6cc5755f566d2" diff --git a/pyproject.toml b/pyproject.toml index ac4e8fa2dd..f02c350587 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -36,6 +36,7 @@ pytest-httpserver = "^1.0.8" aiohttp = "3.7.4" pytest-rerunfailures = "^11.1.2" types-pytest-lazy-fixture = "^0.6.3.3" +pytest-split = "^0.8.1" [tool.poetry.group.dev.dependencies] black = "^23.3.0" diff --git a/scripts/benchmark_durations.py b/scripts/benchmark_durations.py new file mode 100755 index 0000000000..37f8470038 --- /dev/null +++ b/scripts/benchmark_durations.py @@ -0,0 +1,177 @@ +#! /usr/bin/env python3 + +import argparse +import json +import logging +from typing import Dict + +import psycopg2 +import psycopg2.extras + +""" +The script fetches the durations of benchmarks from the database and stores it in a file compatible with pytest-split plugin. +""" + + +BENCHMARKS_DURATION_QUERY = """ + SELECT + DISTINCT parent_suite, suite, test, + PERCENTILE_DISC(%s) WITHIN GROUP (ORDER BY duration_ms) as percentile_ms + FROM + ( + SELECT + jsonb_array_elements(data -> 'children') ->> 'name' as parent_suite, + jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') ->> 'name' as suite, + jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'name' as test, + jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'status' as status, + to_timestamp((jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'time' -> 'start')::bigint / 1000)::date as timestamp, + (jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'time' -> 'duration')::int as duration_ms + FROM + regress_test_results + WHERE + reference = 'refs/heads/main' + ) data + WHERE + timestamp > CURRENT_DATE - INTERVAL '%s' day + AND parent_suite = 'test_runner.performance' + AND status = 'passed' + GROUP BY + parent_suite, suite, test + ; +""" + +# For out benchmarks the default distibution for 4 worked produces pretty uneven chunks, +# the total duration varies from 8 to 40 minutes. +# We use some pre-collected durations as a fallback to have a better distribution. +FALLBACK_DURATION = { + "test_runner/performance/test_branch_creation.py::test_branch_creation_heavy_write[20]": 57.0, + "test_runner/performance/test_branch_creation.py::test_branch_creation_many_relations": 28.0, + "test_runner/performance/test_branch_creation.py::test_branch_creation_many[1024]": 71.0, + "test_runner/performance/test_branching.py::test_compare_child_and_root_pgbench_perf": 27.0, + "test_runner/performance/test_branching.py::test_compare_child_and_root_read_perf": 11.0, + "test_runner/performance/test_branching.py::test_compare_child_and_root_write_perf": 30.0, + "test_runner/performance/test_bulk_insert.py::test_bulk_insert[neon]": 40.0, + "test_runner/performance/test_bulk_insert.py::test_bulk_insert[vanilla]": 5.0, + "test_runner/performance/test_bulk_tenant_create.py::test_bulk_tenant_create[1]": 3.0, + "test_runner/performance/test_bulk_tenant_create.py::test_bulk_tenant_create[5]": 10.0, + "test_runner/performance/test_bulk_tenant_create.py::test_bulk_tenant_create[10]": 19.0, + "test_runner/performance/test_bulk_update.py::test_bulk_update[10]": 66.0, + "test_runner/performance/test_bulk_update.py::test_bulk_update[50]": 30.0, + "test_runner/performance/test_bulk_update.py::test_bulk_update[100]": 60.0, + "test_runner/performance/test_compaction.py::test_compaction": 77.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_ro_with_pgbench_select_only[neon-5-10-100]": 11.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_ro_with_pgbench_select_only[vanilla-5-10-100]": 16.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_rw_with_pgbench_default[neon-5-10-100]": 11.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_rw_with_pgbench_default[vanilla-5-10-100]": 18.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wal_with_pgbench_default[neon-5-10-100]": 11.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wal_with_pgbench_default[vanilla-5-10-100]": 16.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wo_with_heavy_write[neon-10-1]": 11.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wo_with_heavy_write[neon-10-10]": 11.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wo_with_heavy_write[vanilla-10-1]": 10.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wo_with_heavy_write[vanilla-10-10]": 10.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wo_with_pgbench_simple_update[neon-5-10-100]": 11.0, + "test_runner/performance/test_compare_pg_stats.py::test_compare_pg_stats_wo_with_pgbench_simple_update[vanilla-5-10-100]": 16.0, + "test_runner/performance/test_copy.py::test_copy[neon]": 12.0, + "test_runner/performance/test_copy.py::test_copy[vanilla]": 10.0, + "test_runner/performance/test_gc_feedback.py::test_gc_feedback": 284.0, + "test_runner/performance/test_gist_build.py::test_gist_buffering_build[neon]": 11.0, + "test_runner/performance/test_gist_build.py::test_gist_buffering_build[vanilla]": 7.0, + "test_runner/performance/test_latency.py::test_measure_read_latency_heavy_write_workload[neon-1]": 85.0, + "test_runner/performance/test_latency.py::test_measure_read_latency_heavy_write_workload[vanilla-1]": 29.0, + "test_runner/performance/test_layer_map.py::test_layer_map": 44.0, + "test_runner/performance/test_parallel_copy_to.py::test_parallel_copy_different_tables[neon]": 16.0, + "test_runner/performance/test_parallel_copy_to.py::test_parallel_copy_different_tables[vanilla]": 67.0, + "test_runner/performance/test_parallel_copy_to.py::test_parallel_copy_same_table[neon]": 67.0, + "test_runner/performance/test_parallel_copy_to.py::test_parallel_copy_same_table[vanilla]": 80.0, + "test_runner/performance/test_perf_pgbench.py::test_pgbench[neon-45-10]": 102.0, + "test_runner/performance/test_perf_pgbench.py::test_pgbench[vanilla-45-10]": 99.0, + "test_runner/performance/test_random_writes.py::test_random_writes[neon]": 9.0, + "test_runner/performance/test_random_writes.py::test_random_writes[vanilla]": 2.0, + "test_runner/performance/test_seqscans.py::test_seqscans[neon-100000-100-0]": 4.0, + "test_runner/performance/test_seqscans.py::test_seqscans[neon-10000000-1-0]": 80.0, + "test_runner/performance/test_seqscans.py::test_seqscans[neon-10000000-1-4]": 68.0, + "test_runner/performance/test_seqscans.py::test_seqscans[vanilla-100000-100-0]": 0.0, + "test_runner/performance/test_seqscans.py::test_seqscans[vanilla-10000000-1-0]": 11.0, + "test_runner/performance/test_seqscans.py::test_seqscans[vanilla-10000000-1-4]": 10.0, + "test_runner/performance/test_startup.py::test_startup_simple": 2.0, + "test_runner/performance/test_startup.py::test_startup": 539.0, + "test_runner/performance/test_wal_backpressure.py::test_heavy_write_workload[neon_off-10-5-5]": 375.0, + "test_runner/performance/test_wal_backpressure.py::test_heavy_write_workload[neon_on-10-5-5]": 370.0, + "test_runner/performance/test_wal_backpressure.py::test_heavy_write_workload[vanilla-10-5-5]": 94.0, + "test_runner/performance/test_wal_backpressure.py::test_pgbench_intensive_init_workload[neon_off-1000]": 164.0, + "test_runner/performance/test_wal_backpressure.py::test_pgbench_intensive_init_workload[neon_on-1000]": 274.0, + "test_runner/performance/test_wal_backpressure.py::test_pgbench_intensive_init_workload[vanilla-1000]": 949.0, + "test_runner/performance/test_wal_backpressure.py::test_pgbench_simple_update_workload[neon_off-45-100]": 142.0, + "test_runner/performance/test_wal_backpressure.py::test_pgbench_simple_update_workload[neon_on-45-100]": 151.0, + "test_runner/performance/test_wal_backpressure.py::test_pgbench_simple_update_workload[vanilla-45-100]": 182.0, + "test_runner/performance/test_write_amplification.py::test_write_amplification[neon]": 13.0, + "test_runner/performance/test_write_amplification.py::test_write_amplification[vanilla]": 16.0, +} + + +def main(args: argparse.Namespace): + connstr = args.connstr + interval_days = args.days + output = args.output + percentile = args.percentile + + res: Dict[str, float] = {} + + try: + logging.info("connecting to the database...") + with psycopg2.connect(connstr, connect_timeout=30) as conn: + with conn.cursor(cursor_factory=psycopg2.extras.DictCursor) as cur: + logging.info("fetching benchmarks...") + cur.execute(BENCHMARKS_DURATION_QUERY, (percentile, interval_days)) + rows = cur.fetchall() + except psycopg2.OperationalError as exc: + logging.error("cannot fetch benchmarks duration from the DB due to an error", exc) + rows = [] + res = FALLBACK_DURATION + + for row in rows: + pytest_name = f"{row['parent_suite'].replace('.', '/')}/{row['suite']}.py::{row['test']}" + duration = row["percentile_ms"] / 1000 + logging.info(f"\t{pytest_name}: {duration}") + res[pytest_name] = duration + + logging.info(f"saving results to {output.name}") + json.dump(res, output, indent=2) + + +if __name__ == "__main__": + parser = argparse.ArgumentParser( + description="Get of benchmarks duration for the last days" + ) + parser.add_argument( + "--output", + type=argparse.FileType("w"), + default=".test_durations", + help="path to output json file (default: .test_durations)", + ) + parser.add_argument( + "--percentile", + type=float, + default="0.99", + help="percentile (default: 0.99)", + ) + parser.add_argument( + "--days", + required=False, + default=10, + type=int, + help="how many days to look back for (default: 10)", + ) + parser.add_argument( + "connstr", + help="connection string to the test results database", + ) + args = parser.parse_args() + + level = logging.INFO + logging.basicConfig( + format="%(message)s", + level=level, + ) + + main(args) From 2e8a3afab1f634d9c64fe45971897cea42068cbf Mon Sep 17 00:00:00 2001 From: Conrad Ludgate Date: Mon, 17 Jul 2023 22:20:23 +0100 Subject: [PATCH 40/58] proxy: merge handle_client (#4740) ## Problem Second half of #4699. we were maintaining 2 implementations of handle_client. ## Summary of changes Merge the handle_client code, but abstract some of the details. ## Checklist before requesting a review - [X] I have performed a self-review of my code. - [ ] If it is a core feature, I have added thorough tests. - [ ] Do we need to implement analytics? if so did you add the relevant metrics to the dashboard? - [ ] If this PR requires public announcement, mark it with /release-notes label and add several sentences in this section. ## Checklist before merging - [ ] Do not forget to reformat commit message to not include the above checklist --- proxy/src/http/websocket.rs | 9 ++-- proxy/src/proxy.rs | 100 +++++++++++++++++------------------- 2 files changed, 52 insertions(+), 57 deletions(-) diff --git a/proxy/src/http/websocket.rs b/proxy/src/http/websocket.rs index ebbf3e728e..5b7a87bc11 100644 --- a/proxy/src/http/websocket.rs +++ b/proxy/src/http/websocket.rs @@ -1,5 +1,8 @@ use crate::{ - cancellation::CancelMap, config::ProxyConfig, error::io_error, proxy::handle_ws_client, + cancellation::CancelMap, + config::ProxyConfig, + error::io_error, + proxy::{handle_client, ClientMode}, }; use bytes::{Buf, Bytes}; use futures::{Sink, Stream, StreamExt}; @@ -150,12 +153,12 @@ async fn serve_websocket( hostname: Option, ) -> anyhow::Result<()> { let websocket = websocket.await?; - handle_ws_client( + handle_client( config, cancel_map, session_id, WebSocketRw::new(websocket), - hostname, + ClientMode::Websockets { hostname }, ) .await?; Ok(()) diff --git a/proxy/src/proxy.rs b/proxy/src/proxy.rs index a43192c11e..d317d382a7 100644 --- a/proxy/src/proxy.rs +++ b/proxy/src/proxy.rs @@ -104,7 +104,8 @@ pub async fn task_main( .set_nodelay(true) .context("failed to set socket option")?; - handle_client(config, &cancel_map, session_id, socket).await + handle_client(config, &cancel_map, session_id, socket, ClientMode::Tcp) + .await } .unwrap_or_else(move |e| { // Acknowledge that the task has finished with an error. @@ -129,14 +130,50 @@ pub async fn task_main( Ok(()) } -// TODO(tech debt): unite this with its twin below. +pub enum ClientMode { + Tcp, + Websockets { hostname: Option }, +} + +/// Abstracts the logic of handling TCP vs WS clients +impl ClientMode { + fn allow_cleartext(&self) -> bool { + match self { + ClientMode::Tcp => false, + ClientMode::Websockets { .. } => true, + } + } + + fn allow_self_signed_compute(&self, config: &ProxyConfig) -> bool { + match self { + ClientMode::Tcp => config.allow_self_signed_compute, + ClientMode::Websockets { .. } => false, + } + } + + fn hostname<'a, S>(&'a self, s: &'a Stream) -> Option<&'a str> { + match self { + ClientMode::Tcp => s.sni_hostname(), + ClientMode::Websockets { hostname } => hostname.as_deref(), + } + } + + fn handshake_tls<'a>(&self, tls: Option<&'a TlsConfig>) -> Option<&'a TlsConfig> { + match self { + ClientMode::Tcp => tls, + // TLS is None here if using websockets, because the connection is already encrypted. + ClientMode::Websockets { .. } => None, + } + } +} + #[tracing::instrument(fields(session_id = ?session_id), skip_all)] -pub async fn handle_ws_client( +pub async fn handle_client( config: &'static ProxyConfig, cancel_map: &CancelMap, session_id: uuid::Uuid, - stream: impl AsyncRead + AsyncWrite + Unpin, - hostname: Option, + stream: S, + mode: ClientMode, ) -> anyhow::Result<()> { // The `closed` counter will increase when this future is destroyed. NUM_CONNECTIONS_ACCEPTED_COUNTER.inc(); @@ -145,10 +182,8 @@ pub async fn handle_ws_client( } let tls = config.tls_config.as_ref(); - let hostname = hostname.as_deref(); - // TLS is None here, because the connection is already encrypted. - let do_handshake = handshake(stream, None, cancel_map); + let do_handshake = handshake(stream, mode.handshake_tls(tls), cancel_map); let (mut stream, params) = match do_handshake.await? { Some(x) => x, None => return Ok(()), // it's a cancellation request @@ -156,6 +191,7 @@ pub async fn handle_ws_client( // Extract credentials which we're going to use for auth. let creds = { + let hostname = mode.hostname(stream.get_ref()); let common_names = tls.and_then(|tls| tls.common_names.clone()); let result = config .auth_backend @@ -169,59 +205,15 @@ pub async fn handle_ws_client( } }; - let client = Client::new(stream, creds, ¶ms, session_id, false); - cancel_map - .with_session(|session| client.connect_to_db(session, true)) - .await -} - -#[tracing::instrument(fields(session_id = ?session_id), skip_all)] -async fn handle_client( - config: &'static ProxyConfig, - cancel_map: &CancelMap, - session_id: uuid::Uuid, - stream: impl AsyncRead + AsyncWrite + Unpin, -) -> anyhow::Result<()> { - // The `closed` counter will increase when this future is destroyed. - NUM_CONNECTIONS_ACCEPTED_COUNTER.inc(); - scopeguard::defer! { - NUM_CONNECTIONS_CLOSED_COUNTER.inc(); - } - - let tls = config.tls_config.as_ref(); - let do_handshake = handshake(stream, tls, cancel_map); - let (mut stream, params) = match do_handshake.await? { - Some(x) => x, - None => return Ok(()), // it's a cancellation request - }; - - // Extract credentials which we're going to use for auth. - let creds = { - let sni = stream.get_ref().sni_hostname(); - let common_names = tls.and_then(|tls| tls.common_names.clone()); - let result = config - .auth_backend - .as_ref() - .map(|_| auth::ClientCredentials::parse(¶ms, sni, common_names)) - .transpose(); - - match result { - Ok(creds) => creds, - Err(e) => stream.throw_error(e).await?, - } - }; - - let allow_self_signed_compute = config.allow_self_signed_compute; - let client = Client::new( stream, creds, ¶ms, session_id, - allow_self_signed_compute, + mode.allow_self_signed_compute(config), ); cancel_map - .with_session(|session| client.connect_to_db(session, false)) + .with_session(|session| client.connect_to_db(session, mode.allow_cleartext())) .await } From 762a8a7bb5abcebae1863bc940ec2732b904fdd5 Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Tue, 18 Jul 2023 12:56:40 +0300 Subject: [PATCH 41/58] python: more linting (#4734) Ruff has "B" class of lints, including B018 which will nag on useless expressions, related to #4719. Enable such lints and fix the existing issues. Most notably: - https://beta.ruff.rs/docs/rules/mutable-argument-default/ - https://beta.ruff.rs/docs/rules/assert-false/ --------- Co-authored-by: Alexander Bayandin --- pyproject.toml | 2 ++ scripts/export_import_between_pageservers.py | 5 ++- test_runner/fixtures/benchmark_fixture.py | 6 ++-- test_runner/fixtures/neon_fixtures.py | 31 ++++++++----------- test_runner/fixtures/pageserver/http.py | 3 +- test_runner/fixtures/utils.py | 2 +- test_runner/performance/test_gc_feedback.py | 2 +- test_runner/performance/test_hot_table.py | 2 +- test_runner/performance/test_layer_map.py | 2 +- .../performance/test_parallel_copy_to.py | 2 +- test_runner/performance/test_random_writes.py | 4 +-- test_runner/performance/test_seqscans.py | 2 +- .../python/asyncpg/asyncpg_example.py | 2 +- .../python/pg8000/pg8000_example.py | 2 +- test_runner/regress/test_auth.py | 3 +- test_runner/regress/test_backpressure.py | 18 +++++------ test_runner/regress/test_broken_timeline.py | 2 +- test_runner/regress/test_build_info_metric.py | 2 +- test_runner/regress/test_gc_aggressive.py | 2 +- test_runner/regress/test_gc_cutoff.py | 4 ++- test_runner/regress/test_import.py | 4 +-- .../regress/test_layer_writers_fail.py | 3 +- test_runner/regress/test_multixact.py | 2 +- test_runner/regress/test_old_request_lsn.py | 4 +-- ...test_pageserver_restarts_under_workload.py | 2 +- test_runner/regress/test_parallel_copy.py | 2 +- test_runner/regress/test_proxy.py | 8 +++-- test_runner/regress/test_read_validation.py | 6 ++-- test_runner/regress/test_setup.py | 4 +-- test_runner/regress/test_tenant_detach.py | 2 +- test_runner/regress/test_tenant_relocation.py | 2 +- .../test_tenants_with_remote_storage.py | 2 +- test_runner/regress/test_timeline_delete.py | 10 +++--- test_runner/regress/test_timeline_size.py | 8 ++--- test_runner/regress/test_truncate.py | 2 +- test_runner/regress/test_wal_acceptor.py | 7 +++-- .../regress/test_wal_acceptor_async.py | 4 +-- 37 files changed, 87 insertions(+), 83 deletions(-) diff --git a/pyproject.toml b/pyproject.toml index f02c350587..726e04ea4e 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -79,6 +79,7 @@ module = [ ignore_missing_imports = true [tool.ruff] +target-version = "py39" extend-exclude = ["vendor/"] ignore = ["E501"] select = [ @@ -86,4 +87,5 @@ select = [ "F", # Pyflakes "I", # isort "W", # pycodestyle + "B", # bugbear ] diff --git a/scripts/export_import_between_pageservers.py b/scripts/export_import_between_pageservers.py index d95878b341..fca645078a 100755 --- a/scripts/export_import_between_pageservers.py +++ b/scripts/export_import_between_pageservers.py @@ -214,8 +214,7 @@ class VanillaPostgres(PgProtocol): assert not self.running self.running = True - if log_path is None: - log_path = os.path.join(self.pgdatadir, "pg.log") + log_path = log_path or os.path.join(self.pgdatadir, "pg.log") self.pg_bin.run_capture( ["pg_ctl", "-w", "-D", str(self.pgdatadir), "-l", log_path, "start"] @@ -396,7 +395,7 @@ def reconstruct_paths(log_dir, pg_bin, base_tar, port: int): query = "select relname, pg_relation_filepath(oid) from pg_class" result = vanilla_pg.safe_psql(query, user="cloud_admin", dbname=database) - for relname, filepath in result: + for _relname, filepath in result: if filepath is not None: if database == "template0copy": # Add all template0copy paths to template0 diff --git a/test_runner/fixtures/benchmark_fixture.py b/test_runner/fixtures/benchmark_fixture.py index 99682caf80..297f2c6da7 100644 --- a/test_runner/fixtures/benchmark_fixture.py +++ b/test_runner/fixtures/benchmark_fixture.py @@ -5,7 +5,6 @@ import json import os import re import timeit -import warnings from contextlib import contextmanager from datetime import datetime from pathlib import Path @@ -18,6 +17,7 @@ from _pytest.config import Config from _pytest.config.argparsing import Parser from _pytest.terminal import TerminalReporter +from fixtures.log_helper import log from fixtures.neon_fixtures import NeonPageserver from fixtures.types import TenantId, TimelineId @@ -385,7 +385,7 @@ class NeonBenchmarker: path = f"{repo_dir}/tenants/{tenant_id}/timelines/{timeline_id}" totalbytes = 0 - for root, dirs, files in os.walk(path): + for root, _dirs, files in os.walk(path): for name in files: totalbytes += os.path.getsize(os.path.join(root, name)) @@ -492,7 +492,7 @@ def pytest_terminal_summary( return if not result: - warnings.warn("no results to store (no passed test suites)") + log.warning("no results to store (no passed test suites)") return get_out_path(Path(out_dir), revision=revision).write_text( diff --git a/test_runner/fixtures/neon_fixtures.py b/test_runner/fixtures/neon_fixtures.py index d3d7d7f04e..9e43a2bfdb 100644 --- a/test_runner/fixtures/neon_fixtures.py +++ b/test_runner/fixtures/neon_fixtures.py @@ -213,7 +213,7 @@ def worker_base_port(worker_seq_no: int) -> int: def get_dir_size(path: str) -> int: """Return size in bytes.""" totalbytes = 0 - for root, dirs, files in os.walk(path): + for root, _dirs, files in os.walk(path): for name in files: totalbytes += os.path.getsize(os.path.join(root, name)) @@ -1231,7 +1231,7 @@ class AbstractNeonCli(abc.ABC): stderr: {res.stderr} """ log.info(msg) - raise Exception(msg) from subprocess.CalledProcessError( + raise RuntimeError(msg) from subprocess.CalledProcessError( res.returncode, res.args, res.stdout, res.stderr ) return res @@ -1255,10 +1255,8 @@ class NeonCli(AbstractNeonCli): """ Creates a new tenant, returns its id and its initial timeline's id. """ - if tenant_id is None: - tenant_id = TenantId.generate() - if timeline_id is None: - timeline_id = TimelineId.generate() + tenant_id = tenant_id or TenantId.generate() + timeline_id = timeline_id or TimelineId.generate() args = [ "tenant", @@ -1885,8 +1883,7 @@ class VanillaPostgres(PgProtocol): assert not self.running self.running = True - if log_path is None: - log_path = os.path.join(self.pgdatadir, "pg.log") + log_path = log_path or os.path.join(self.pgdatadir, "pg.log") self.pg_bin.run_capture( ["pg_ctl", "-w", "-D", str(self.pgdatadir), "-l", log_path, "start"] @@ -2346,8 +2343,7 @@ class Endpoint(PgProtocol): if not config_lines: config_lines = [] - if endpoint_id is None: - endpoint_id = self.env.generate_endpoint_id() + endpoint_id = endpoint_id or self.env.generate_endpoint_id() self.endpoint_id = endpoint_id self.branch_name = branch_name @@ -2363,8 +2359,7 @@ class Endpoint(PgProtocol): path = Path("endpoints") / self.endpoint_id / "pgdata" self.pgdata_dir = os.path.join(self.env.repo_dir, path) - if config_lines is None: - config_lines = [] + config_lines = config_lines or [] # set small 'max_replication_write_lag' to enable backpressure # and make tests more stable. @@ -2560,8 +2555,7 @@ class EndpointFactory: http_port=self.env.port_distributor.get_port(), ) - if endpoint_id is None: - endpoint_id = self.env.generate_endpoint_id() + endpoint_id = endpoint_id or self.env.generate_endpoint_id() self.num_instances += 1 self.endpoints.append(ep) @@ -2641,7 +2635,7 @@ class Safekeeper: if elapsed > 3: raise RuntimeError( f"timed out waiting {elapsed:.0f}s for wal acceptor start: {e}" - ) + ) from e time.sleep(0.5) else: break # success @@ -2721,7 +2715,8 @@ class SafekeeperHttpClient(requests.Session): def check_status(self): self.get(f"http://localhost:{self.port}/v1/status").raise_for_status() - def debug_dump(self, params: Dict[str, str] = {}) -> Dict[str, Any]: + def debug_dump(self, params: Optional[Dict[str, str]] = None) -> Dict[str, Any]: + params = params or {} res = self.get(f"http://localhost:{self.port}/v1/debug_dump", params=params) res.raise_for_status() res_json = res.json() @@ -2861,7 +2856,7 @@ class NeonBroker: if elapsed > 5: raise RuntimeError( f"timed out waiting {elapsed:.0f}s for storage_broker start: {e}" - ) + ) from e time.sleep(0.5) else: break # success @@ -2977,7 +2972,7 @@ def should_skip_file(filename: str) -> bool: # def list_files_to_compare(pgdata_dir: Path) -> List[str]: pgdata_files = [] - for root, _file, filenames in os.walk(pgdata_dir): + for root, _dirs, filenames in os.walk(pgdata_dir): for filename in filenames: rel_dir = os.path.relpath(root, pgdata_dir) # Skip some dirs and files we don't want to compare diff --git a/test_runner/fixtures/pageserver/http.py b/test_runner/fixtures/pageserver/http.py index 824d11cb17..8c053c8073 100644 --- a/test_runner/fixtures/pageserver/http.py +++ b/test_runner/fixtures/pageserver/http.py @@ -193,8 +193,7 @@ class PageserverHttpClient(requests.Session): body = "null" else: # null-config is prohibited by the API - if config is None: - config = {} + config = config or {} body = json.dumps({"config": config}) res = self.post( f"http://localhost:{self.port}/v1/tenant/{tenant_id}/attach", diff --git a/test_runner/fixtures/utils.py b/test_runner/fixtures/utils.py index 30acd3f637..2c8b4f4303 100644 --- a/test_runner/fixtures/utils.py +++ b/test_runner/fixtures/utils.py @@ -95,7 +95,7 @@ def query_scalar(cur: cursor, query: str) -> Any: def get_dir_size(path: str) -> int: """Return size in bytes.""" totalbytes = 0 - for root, dirs, files in os.walk(path): + for root, _dirs, files in os.walk(path): for name in files: try: totalbytes += os.path.getsize(os.path.join(root, name)) diff --git a/test_runner/performance/test_gc_feedback.py b/test_runner/performance/test_gc_feedback.py index f93b560d8e..cf9e4808fc 100644 --- a/test_runner/performance/test_gc_feedback.py +++ b/test_runner/performance/test_gc_feedback.py @@ -47,7 +47,7 @@ def test_gc_feedback(neon_env_builder: NeonEnvBuilder, zenbenchmark: NeonBenchma # without modifying the earlier parts of the table. for step in range(n_steps): cur.execute(f"INSERT INTO t (step) SELECT {step} FROM generate_series(1, {step_size})") - for i in range(n_update_iters): + for _ in range(n_update_iters): cur.execute(f"UPDATE t set count=count+1 where step = {step}") cur.execute("vacuum t") diff --git a/test_runner/performance/test_hot_table.py b/test_runner/performance/test_hot_table.py index a133aca8ce..5fcffc8afb 100644 --- a/test_runner/performance/test_hot_table.py +++ b/test_runner/performance/test_hot_table.py @@ -33,6 +33,6 @@ def test_hot_table(env: PgCompare): # Read the table with env.record_duration("read"): - for i in range(num_reads): + for _ in range(num_reads): cur.execute("select * from t;") cur.fetchall() diff --git a/test_runner/performance/test_layer_map.py b/test_runner/performance/test_layer_map.py index 18308e1077..6bd0d85fa2 100644 --- a/test_runner/performance/test_layer_map.py +++ b/test_runner/performance/test_layer_map.py @@ -28,7 +28,7 @@ def test_layer_map(neon_env_builder: NeonEnvBuilder, zenbenchmark): endpoint = env.endpoints.create_start("test_layer_map", tenant_id=tenant) cur = endpoint.connect().cursor() cur.execute("create table t(x integer)") - for i in range(n_iters): + for _ in range(n_iters): cur.execute(f"insert into t values (generate_series(1,{n_records}))") time.sleep(1) diff --git a/test_runner/performance/test_parallel_copy_to.py b/test_runner/performance/test_parallel_copy_to.py index 746c1b73dd..9a0b7723ac 100644 --- a/test_runner/performance/test_parallel_copy_to.py +++ b/test_runner/performance/test_parallel_copy_to.py @@ -6,7 +6,7 @@ from fixtures.neon_fixtures import PgProtocol async def repeat_bytes(buf, repetitions: int): - for i in range(repetitions): + for _ in range(repetitions): yield buf diff --git a/test_runner/performance/test_random_writes.py b/test_runner/performance/test_random_writes.py index df766d52da..c1a59ebb31 100644 --- a/test_runner/performance/test_random_writes.py +++ b/test_runner/performance/test_random_writes.py @@ -77,8 +77,8 @@ def test_random_writes(neon_with_baseline: PgCompare): # Update random keys with env.record_duration("run"): - for it in range(n_iterations): - for i in range(n_writes): + for _ in range(n_iterations): + for _ in range(n_writes): key = random.randint(1, n_rows) cur.execute(f"update Big set count=count+1 where pk={key}") env.flush() diff --git a/test_runner/performance/test_seqscans.py b/test_runner/performance/test_seqscans.py index 409b30a909..67d4f3ae9b 100644 --- a/test_runner/performance/test_seqscans.py +++ b/test_runner/performance/test_seqscans.py @@ -61,5 +61,5 @@ def test_seqscans(env: PgCompare, scale: int, rows: int, iters: int, workers: in cur.execute(f"set max_parallel_workers_per_gather = {workers}") with env.record_duration("run"): - for i in range(iters): + for _ in range(iters): cur.execute("select count(*) from t;") diff --git a/test_runner/pg_clients/python/asyncpg/asyncpg_example.py b/test_runner/pg_clients/python/asyncpg/asyncpg_example.py index 4d9dfb09c1..de86fe482d 100755 --- a/test_runner/pg_clients/python/asyncpg/asyncpg_example.py +++ b/test_runner/pg_clients/python/asyncpg/asyncpg_example.py @@ -19,7 +19,7 @@ async def run(**kwargs) -> asyncpg.Record: if __name__ == "__main__": kwargs = { - k.lstrip("NEON_").lower(): v + k.removeprefix("NEON_").lower(): v for k in ("NEON_HOST", "NEON_DATABASE", "NEON_USER", "NEON_PASSWORD") if (v := os.environ.get(k, None)) is not None } diff --git a/test_runner/pg_clients/python/pg8000/pg8000_example.py b/test_runner/pg_clients/python/pg8000/pg8000_example.py index b1d77af5bb..840ed97c97 100755 --- a/test_runner/pg_clients/python/pg8000/pg8000_example.py +++ b/test_runner/pg_clients/python/pg8000/pg8000_example.py @@ -6,7 +6,7 @@ import pg8000.dbapi if __name__ == "__main__": kwargs = { - k.lstrip("NEON_").lower(): v + k.removeprefix("NEON_").lower(): v for k in ("NEON_HOST", "NEON_DATABASE", "NEON_USER", "NEON_PASSWORD") if (v := os.environ.get(k, None)) is not None } diff --git a/test_runner/regress/test_auth.py b/test_runner/regress/test_auth.py index fb79748832..76b75c1caf 100644 --- a/test_runner/regress/test_auth.py +++ b/test_runner/regress/test_auth.py @@ -1,5 +1,6 @@ from contextlib import closing +import psycopg2 import pytest from fixtures.neon_fixtures import NeonEnvBuilder, PgProtocol from fixtures.pageserver.http import PageserverApiException @@ -106,7 +107,7 @@ def test_auth_failures(neon_env_builder: NeonEnvBuilder, auth_enabled: bool): if expect_success: op() else: - with pytest.raises(Exception): + with pytest.raises(psycopg2.Error): op() def check_pageserver(expect_success: bool, **conn_kwargs): diff --git a/test_runner/regress/test_backpressure.py b/test_runner/regress/test_backpressure.py index 352e149171..b14974279e 100644 --- a/test_runner/regress/test_backpressure.py +++ b/test_runner/regress/test_backpressure.py @@ -141,13 +141,13 @@ def test_backpressure_received_lsn_lag(neon_env_builder: NeonEnvBuilder): log.info("stopping check thread") check_stop_event.set() check_thread.join() - assert ( - False - ), f"Exception {e} while inserting rows, but WAL lag is within configured threshold. That means backpressure is not tuned properly" + raise AssertionError( + f"Exception {e} while inserting rows, but WAL lag is within configured threshold. That means backpressure is not tuned properly" + ) from e else: - assert ( - False - ), f"Exception {e} while inserting rows and WAL lag overflowed configured threshold. That means backpressure doesn't work." + raise AssertionError( + f"Exception {e} while inserting rows and WAL lag overflowed configured threshold. That means backpressure doesn't work." + ) from e log.info(f"inserted {rows_inserted} rows") @@ -157,9 +157,9 @@ def test_backpressure_received_lsn_lag(neon_env_builder: NeonEnvBuilder): check_thread.join() log.info("check thread stopped") else: - assert ( - False - ), "WAL lag overflowed configured threshold. That means backpressure doesn't work." + raise AssertionError( + "WAL lag overflowed configured threshold. That means backpressure doesn't work." + ) # TODO test_backpressure_disk_consistent_lsn_lag. Play with pageserver's checkpoint settings diff --git a/test_runner/regress/test_broken_timeline.py b/test_runner/regress/test_broken_timeline.py index 0fb3b4f262..57e9413aa3 100644 --- a/test_runner/regress/test_broken_timeline.py +++ b/test_runner/regress/test_broken_timeline.py @@ -26,7 +26,7 @@ def test_broken_timeline(neon_env_builder: NeonEnvBuilder): tenant_timelines: List[Tuple[TenantId, TimelineId, Endpoint]] = [] - for n in range(4): + for _ in range(4): tenant_id, timeline_id = env.neon_cli.create_tenant() endpoint = env.endpoints.create_start("main", tenant_id=tenant_id) diff --git a/test_runner/regress/test_build_info_metric.py b/test_runner/regress/test_build_info_metric.py index c622d562fd..4e53928d14 100644 --- a/test_runner/regress/test_build_info_metric.py +++ b/test_runner/regress/test_build_info_metric.py @@ -12,7 +12,7 @@ def test_build_info_metric(neon_env_builder: NeonEnvBuilder, link_proxy: NeonPro parsed_metrics["safekeeper"] = parse_metrics(env.safekeepers[0].http_client().get_metrics_str()) parsed_metrics["proxy"] = parse_metrics(link_proxy.get_metrics()) - for component, metrics in parsed_metrics.items(): + for _component, metrics in parsed_metrics.items(): sample = metrics.query_one("libmetrics_build_info") assert "revision" in sample.labels diff --git a/test_runner/regress/test_gc_aggressive.py b/test_runner/regress/test_gc_aggressive.py index d38be057d3..18f506cfce 100644 --- a/test_runner/regress/test_gc_aggressive.py +++ b/test_runner/regress/test_gc_aggressive.py @@ -54,7 +54,7 @@ async def gc(env: NeonEnv, timeline: TimelineId): # At the same time, run UPDATEs and GC async def update_and_gc(env: NeonEnv, endpoint: Endpoint, timeline: TimelineId): workers = [] - for worker_id in range(num_connections): + for _ in range(num_connections): workers.append(asyncio.create_task(update_table(endpoint))) workers.append(asyncio.create_task(gc(env, timeline))) diff --git a/test_runner/regress/test_gc_cutoff.py b/test_runner/regress/test_gc_cutoff.py index 79453c1bdc..6e2a0622f1 100644 --- a/test_runner/regress/test_gc_cutoff.py +++ b/test_runner/regress/test_gc_cutoff.py @@ -1,3 +1,5 @@ +import subprocess + import pytest from fixtures.neon_fixtures import NeonEnvBuilder, PgBin @@ -38,7 +40,7 @@ def test_gc_cutoff(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin): pageserver_http.configure_failpoints(("after-timeline-gc-removed-layers", "exit")) for _ in range(5): - with pytest.raises(Exception): + with pytest.raises(subprocess.SubprocessError): pg_bin.run_capture(["pgbench", "-P1", "-N", "-c5", "-T500", "-Mprepared", connstr]) env.pageserver.stop() env.pageserver.start() diff --git a/test_runner/regress/test_import.py b/test_runner/regress/test_import.py index 9248c42555..d35366b467 100644 --- a/test_runner/regress/test_import.py +++ b/test_runner/regress/test_import.py @@ -135,11 +135,11 @@ def test_import_from_vanilla(test_output_dir, pg_bin, vanilla_pg, neon_env_build # Importing empty file fails empty_file = os.path.join(test_output_dir, "empty_file") with open(empty_file, "w") as _: - with pytest.raises(Exception): + with pytest.raises(RuntimeError): import_tar(empty_file, empty_file) # Importing corrupt backup fails - with pytest.raises(Exception): + with pytest.raises(RuntimeError): import_tar(corrupt_base_tar, wal_tar) # A tar with trailing garbage is currently accepted. It prints a warnings diff --git a/test_runner/regress/test_layer_writers_fail.py b/test_runner/regress/test_layer_writers_fail.py index d2d85a43e0..5ffc12b5b3 100644 --- a/test_runner/regress/test_layer_writers_fail.py +++ b/test_runner/regress/test_layer_writers_fail.py @@ -1,5 +1,6 @@ import pytest from fixtures.neon_fixtures import NeonEnv, NeonPageserver +from fixtures.pageserver.http import PageserverApiException @pytest.mark.skip("See https://github.com/neondatabase/neon/issues/2703") @@ -77,7 +78,7 @@ def test_delta_layer_writer_fail_before_finish(neon_simple_env: NeonEnv): pageserver_http.configure_failpoints(("delta-layer-writer-fail-before-finish", "return")) # Note: we cannot test whether the exception is exactly 'delta-layer-writer-fail-before-finish' # since our code does it in loop, we cannot get this exact error for our request. - with pytest.raises(Exception): + with pytest.raises(PageserverApiException): pageserver_http.timeline_checkpoint(tenant_id, timeline_id) new_temp_layer_files = list( diff --git a/test_runner/regress/test_multixact.py b/test_runner/regress/test_multixact.py index fe50969a0a..78635576f1 100644 --- a/test_runner/regress/test_multixact.py +++ b/test_runner/regress/test_multixact.py @@ -30,7 +30,7 @@ def test_multixact(neon_simple_env: NeonEnv, test_output_dir): # Lock entries using parallel connections in a round-robin fashion. nclients = 20 connections = [] - for i in range(nclients): + for _ in range(nclients): # Do not turn on autocommit. We want to hold the key-share locks. conn = endpoint.connect(autocommit=False) connections.append(conn) diff --git a/test_runner/regress/test_old_request_lsn.py b/test_runner/regress/test_old_request_lsn.py index 814b9f3de0..9b0bab5125 100644 --- a/test_runner/regress/test_old_request_lsn.py +++ b/test_runner/regress/test_old_request_lsn.py @@ -58,12 +58,12 @@ def test_old_request_lsn(neon_env_builder: NeonEnvBuilder): # Make a lot of updates on a single row, generating a lot of WAL. Trigger # garbage collections so that the page server will remove old page versions. - for i in range(10): + for _ in range(10): pageserver_http.timeline_checkpoint(env.initial_tenant, timeline) gc_result = pageserver_http.timeline_gc(env.initial_tenant, timeline, 0) print_gc_result(gc_result) - for j in range(100): + for _ in range(100): cur.execute("UPDATE foo SET val = val + 1 WHERE id = 1;") # All (or at least most of) the updates should've been on the same page, so diff --git a/test_runner/regress/test_pageserver_restarts_under_workload.py b/test_runner/regress/test_pageserver_restarts_under_workload.py index fc93dcffbb..65569f3bac 100644 --- a/test_runner/regress/test_pageserver_restarts_under_workload.py +++ b/test_runner/regress/test_pageserver_restarts_under_workload.py @@ -25,7 +25,7 @@ def test_pageserver_restarts_under_worload(neon_simple_env: NeonEnv, pg_bin: PgB thread = threading.Thread(target=run_pgbench, args=(endpoint.connstr(),), daemon=True) thread.start() - for i in range(n_restarts): + for _ in range(n_restarts): # Stop the pageserver gracefully and restart it. time.sleep(1) env.pageserver.stop() diff --git a/test_runner/regress/test_parallel_copy.py b/test_runner/regress/test_parallel_copy.py index 577bbc21bf..6f74d50b92 100644 --- a/test_runner/regress/test_parallel_copy.py +++ b/test_runner/regress/test_parallel_copy.py @@ -6,7 +6,7 @@ from fixtures.neon_fixtures import Endpoint, NeonEnv async def repeat_bytes(buf, repetitions: int): - for i in range(repetitions): + for _ in range(repetitions): yield buf diff --git a/test_runner/regress/test_proxy.py b/test_runner/regress/test_proxy.py index 24c5b42b5a..1f6dcd39e9 100644 --- a/test_runner/regress/test_proxy.py +++ b/test_runner/regress/test_proxy.py @@ -1,6 +1,6 @@ import json import subprocess -from typing import Any, List +from typing import Any, List, Optional import psycopg2 import pytest @@ -179,7 +179,8 @@ def test_close_on_connections_exit(static_proxy: NeonProxy): def test_sql_over_http(static_proxy: NeonProxy): static_proxy.safe_psql("create role http with login password 'http' superuser") - def q(sql: str, params: List[Any] = []) -> Any: + def q(sql: str, params: Optional[List[Any]] = None) -> Any: + params = params or [] connstr = f"postgresql://http:http@{static_proxy.domain}:{static_proxy.proxy_port}/postgres" response = requests.post( f"https://{static_proxy.domain}:{static_proxy.external_http_port}/sql", @@ -229,7 +230,8 @@ def test_sql_over_http(static_proxy: NeonProxy): def test_sql_over_http_output_options(static_proxy: NeonProxy): static_proxy.safe_psql("create role http2 with login password 'http2' superuser") - def q(sql: str, raw_text: bool, array_mode: bool, params: List[Any] = []) -> Any: + def q(sql: str, raw_text: bool, array_mode: bool, params: Optional[List[Any]] = None) -> Any: + params = params or [] connstr = ( f"postgresql://http2:http2@{static_proxy.domain}:{static_proxy.proxy_port}/postgres" ) diff --git a/test_runner/regress/test_read_validation.py b/test_runner/regress/test_read_validation.py index 47a06359bb..d695410efc 100644 --- a/test_runner/regress/test_read_validation.py +++ b/test_runner/regress/test_read_validation.py @@ -133,7 +133,7 @@ def test_read_validation(neon_simple_env: NeonEnv): log.info("Validation page inspect won't allow reading pages of dropped relations") try: c.execute("select * from page_header(get_raw_page('foo', 'main', 0));") - assert False, "query should have failed" + raise AssertionError("query should have failed") except UndefinedTable as e: log.info("Caught an expected failure: {}".format(e)) @@ -157,7 +157,7 @@ def test_read_validation_neg(neon_simple_env: NeonEnv): c.execute( "select lsn, lower, upper from page_header(get_raw_page_at_lsn('Unknown', 'main', 0, '0/0'))" ) - assert False, "query should have failed" + raise AssertionError("query should have failed") except UndefinedTable as e: log.info("Caught an expected failure: {}".format(e)) @@ -169,7 +169,7 @@ def test_read_validation_neg(neon_simple_env: NeonEnv): c.execute( "select lsn, lower, upper from page_header(get_raw_page_at_lsn('foo', 'main', 0, '0/0'))" ) - assert False, "query should have failed" + raise AssertionError("query should have failed") except IoError as e: log.info("Caught an expected failure: {}".format(e)) diff --git a/test_runner/regress/test_setup.py b/test_runner/regress/test_setup.py index 3d1471621b..02710fc807 100644 --- a/test_runner/regress/test_setup.py +++ b/test_runner/regress/test_setup.py @@ -8,10 +8,10 @@ from fixtures.neon_fixtures import NeonEnvBuilder def test_fixture_restart(neon_env_builder: NeonEnvBuilder): env = neon_env_builder.init_start() - for i in range(3): + for _ in range(3): env.pageserver.stop() env.pageserver.start() - for i in range(3): + for _ in range(3): env.safekeepers[0].stop() env.safekeepers[0].start() diff --git a/test_runner/regress/test_tenant_detach.py b/test_runner/regress/test_tenant_detach.py index 7d432def34..6803f6dbb1 100644 --- a/test_runner/regress/test_tenant_detach.py +++ b/test_runner/regress/test_tenant_detach.py @@ -167,7 +167,7 @@ async def reattach_while_busy( env: NeonEnv, endpoint: Endpoint, pageserver_http: PageserverHttpClient, tenant_id: TenantId ): workers = [] - for worker_id in range(num_connections): + for _ in range(num_connections): pg_conn = await endpoint.connect_async() workers.append(asyncio.create_task(update_table(pg_conn))) diff --git a/test_runner/regress/test_tenant_relocation.py b/test_runner/regress/test_tenant_relocation.py index 9043c29060..2805d56c98 100644 --- a/test_runner/regress/test_tenant_relocation.py +++ b/test_runner/regress/test_tenant_relocation.py @@ -80,7 +80,7 @@ def new_pageserver_service( except Exception as e: log.error(e) pageserver_process.kill() - raise Exception(f"Failed to start pageserver as {cmd}, reason: {e}") + raise Exception(f"Failed to start pageserver as {cmd}, reason: {e}") from e log.info("new pageserver started") try: diff --git a/test_runner/regress/test_tenants_with_remote_storage.py b/test_runner/regress/test_tenants_with_remote_storage.py index 98f9e94276..498563325b 100644 --- a/test_runner/regress/test_tenants_with_remote_storage.py +++ b/test_runner/regress/test_tenants_with_remote_storage.py @@ -94,7 +94,7 @@ def test_tenants_many(neon_env_builder: NeonEnvBuilder, remote_storage_kind: Rem # Wait for the remote storage uploads to finish pageserver_http = env.pageserver.http_client() - for tenant, endpoint in tenants_endpoints: + for _tenant, endpoint in tenants_endpoints: res = endpoint.safe_psql_many( ["SHOW neon.tenant_id", "SHOW neon.timeline_id", "SELECT pg_current_wal_flush_lsn()"] ) diff --git a/test_runner/regress/test_timeline_delete.py b/test_runner/regress/test_timeline_delete.py index 7c3424cf32..a4c5bf626a 100644 --- a/test_runner/regress/test_timeline_delete.py +++ b/test_runner/regress/test_timeline_delete.py @@ -144,7 +144,7 @@ def test_delete_timeline_post_rm_failure( ps_http.configure_failpoints((failpoint_name, "return")) ps_http.timeline_delete(env.initial_tenant, env.initial_timeline) - timeline_info = wait_until_timeline_state( + wait_until_timeline_state( pageserver_http=ps_http, tenant_id=env.initial_tenant, timeline_id=env.initial_timeline, @@ -152,7 +152,8 @@ def test_delete_timeline_post_rm_failure( iterations=2, # effectively try immediately and retry once in one second ) - timeline_info["state"]["Broken"]["reason"] == "failpoint: timeline-delete-after-rm" + # FIXME: #4719 + # timeline_info["state"]["Broken"]["reason"] == "failpoint: timeline-delete-after-rm" at_failpoint_log_message = f".*{env.initial_timeline}.*at failpoint {failpoint_name}.*" env.pageserver.allowed_errors.append(at_failpoint_log_message) @@ -326,7 +327,7 @@ def test_timeline_delete_fail_before_local_delete(neon_env_builder: NeonEnvBuild ) ps_http.timeline_delete(env.initial_tenant, leaf_timeline_id) - timeline_info = wait_until_timeline_state( + wait_until_timeline_state( pageserver_http=ps_http, tenant_id=env.initial_tenant, timeline_id=leaf_timeline_id, @@ -334,7 +335,8 @@ def test_timeline_delete_fail_before_local_delete(neon_env_builder: NeonEnvBuild iterations=2, # effectively try immediately and retry once in one second ) - timeline_info["state"]["Broken"]["reason"] == "failpoint: timeline-delete-after-rm" + # FIXME: #4719 + # timeline_info["state"]["Broken"]["reason"] == "failpoint: timeline-delete-after-rm" assert leaf_timeline_path.exists(), "the failpoint didn't work" diff --git a/test_runner/regress/test_timeline_size.py b/test_runner/regress/test_timeline_size.py index 6338f4ca77..cb993c93d2 100644 --- a/test_runner/regress/test_timeline_size.py +++ b/test_runner/regress/test_timeline_size.py @@ -189,7 +189,7 @@ def test_timeline_size_quota(neon_env_builder: NeonEnvBuilder): # If we get here, the timeline size limit failed log.error("Query unexpectedly succeeded") - assert False + raise AssertionError() except psycopg2.errors.DiskFull as err: log.info(f"Query expectedly failed with: {err}") @@ -284,9 +284,9 @@ def test_timeline_initial_logical_size_calculation_cancellation( # give it some time to settle in the state where it waits for size computation task time.sleep(5) if not delete_timeline_success.empty(): - assert ( - False - ), f"test is broken, the {deletion_method} should be stuck waiting for size computation task, got result {delete_timeline_success.get()}" + raise AssertionError( + f"test is broken, the {deletion_method} should be stuck waiting for size computation task, got result {delete_timeline_success.get()}" + ) log.info( "resume the size calculation. The failpoint checks that the timeline directory still exists." diff --git a/test_runner/regress/test_truncate.py b/test_runner/regress/test_truncate.py index b1ddd93a40..52f125ce0b 100644 --- a/test_runner/regress/test_truncate.py +++ b/test_runner/regress/test_truncate.py @@ -32,7 +32,7 @@ def test_truncate(neon_env_builder: NeonEnvBuilder, zenbenchmark): cur.execute("create table t1(x integer)") cur.execute(f"insert into t1 values (generate_series(1,{n_records}))") cur.execute("vacuum t1") - for i in range(n_iter): + for _ in range(n_iter): cur.execute(f"delete from t1 where x>{n_records//2}") cur.execute("vacuum t1") time.sleep(1) # let pageserver a chance to create image layers diff --git a/test_runner/regress/test_wal_acceptor.py b/test_runner/regress/test_wal_acceptor.py index 5828d4306c..f3a6d09398 100644 --- a/test_runner/regress/test_wal_acceptor.py +++ b/test_runner/regress/test_wal_acceptor.py @@ -46,8 +46,9 @@ def wait_lsn_force_checkpoint( timeline_id: TimelineId, endpoint: Endpoint, ps: NeonPageserver, - pageserver_conn_options={}, + pageserver_conn_options=None, ): + pageserver_conn_options = pageserver_conn_options or {} lsn = Lsn(endpoint.safe_psql("SELECT pg_current_wal_flush_lsn()")[0][0]) log.info(f"pg_current_wal_flush_lsn is {lsn}, waiting for it on pageserver") @@ -944,7 +945,7 @@ class SafekeeperEnv: except Exception as e: log.error(e) safekeeper_process.kill() - raise Exception(f"Failed to start safekepeer as {cmd}, reason: {e}") + raise Exception(f"Failed to start safekepeer as {cmd}, reason: {e}") from e def get_safekeeper_connstrs(self): assert self.safekeepers is not None, "safekeepers are not initialized" @@ -1137,7 +1138,7 @@ def test_wal_deleted_after_broadcast(neon_env_builder: NeonEnvBuilder): collect_stats(endpoint, cur) # generate WAL to simulate normal workload - for i in range(5): + for _ in range(5): generate_wal(cur) collect_stats(endpoint, cur) diff --git a/test_runner/regress/test_wal_acceptor_async.py b/test_runner/regress/test_wal_acceptor_async.py index ce33975a0e..bb8ee8f52c 100644 --- a/test_runner/regress/test_wal_acceptor_async.py +++ b/test_runner/regress/test_wal_acceptor_async.py @@ -392,7 +392,7 @@ async def run_concurrent_computes( break await asyncio.sleep(0.1) else: - assert False, "Timed out while waiting for another query by computes[0]" + raise AssertionError("Timed out while waiting for another query by computes[0]") computes[0].stopped = True await asyncio.gather(background_tasks[0]) @@ -545,7 +545,7 @@ async def run_wal_lagging(env: NeonEnv, endpoint: Endpoint, test_output_dir: Pat # invalid, to make them unavailable to the endpoint. We use # ports 10, 11 and 12 to simulate unavailable safekeepers. config = toml.load(test_output_dir / "repo" / "config") - for i, (sk, active) in enumerate(zip(env.safekeepers, active_sk)): + for i, (_sk, active) in enumerate(zip(env.safekeepers, active_sk)): if active: config["safekeepers"][i]["pg_port"] = env.safekeepers[i].port.pg else: From b4d36f572df0802da16dba902e678164277076d1 Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Tue, 18 Jul 2023 13:50:44 +0100 Subject: [PATCH 42/58] Use sharded-slab from crates (#4729) ## Problem We use a patched version of `sharded-slab` with increased MAX_THREADS [1]. It is not required anymore because safekeepers are async now. A valid comment from the original PR tho [1]: > Note that patch can affect other rust services, not only the safekeeper binary. - [1] https://github.com/neondatabase/neon/pull/4122 ## Summary of changes - Remove patch for `sharded-slab` --- Cargo.lock | 3 ++- Cargo.toml | 5 ----- 2 files changed, 2 insertions(+), 6 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index b5f6b3b328..3c862241a4 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -3854,7 +3854,8 @@ dependencies = [ [[package]] name = "sharded-slab" version = "0.1.4" -source = "git+https://github.com/neondatabase/sharded-slab.git?rev=98d16753ab01c61f0a028de44167307a00efea00#98d16753ab01c61f0a028de44167307a00efea00" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "900fba806f70c630b0a382d0d825e17a0f19fcd059a2ade1ff237bcddf446b31" dependencies = [ "lazy_static", ] diff --git a/Cargo.toml b/Cargo.toml index 01e2fe7cf9..44d49d95e8 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -185,11 +185,6 @@ tonic-build = "0.9" # TODO: we should probably fork `tokio-postgres-rustls` instead. tokio-postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="1aaedab101b23f7612042850d8f2036810fa7c7f" } -# Changes the MAX_THREADS limit from 4096 to 32768. -# This is a temporary workaround for using tracing from many threads in safekeepers code, -# until async safekeepers patch is merged to the main. -sharded-slab = { git = "https://github.com/neondatabase/sharded-slab.git", rev="98d16753ab01c61f0a028de44167307a00efea00" } - ################# Binary contents sections [profile.release] From 1e7db5458f90246ff2088727c261e8f8ad97143e Mon Sep 17 00:00:00 2001 From: Arseny Sher Date: Mon, 17 Jul 2023 12:18:04 +0300 Subject: [PATCH 43/58] Add one more WAL service port allowing only tenant scoped auth tokens. It will make it easier to limit access at network level, with e.g. k8s network policies. ref https://github.com/neondatabase/neon/issues/4730 --- libs/utils/src/auth.rs | 2 +- safekeeper/src/bin/safekeeper.rs | 46 +++++++++++++++++++++++++++++--- safekeeper/src/handler.rs | 20 +++++++++++++- safekeeper/src/lib.rs | 2 ++ safekeeper/src/wal_service.rs | 14 +++++++--- 5 files changed, 75 insertions(+), 9 deletions(-) diff --git a/libs/utils/src/auth.rs b/libs/utils/src/auth.rs index 0fb45e01c6..716984b64e 100644 --- a/libs/utils/src/auth.rs +++ b/libs/utils/src/auth.rs @@ -16,7 +16,7 @@ use crate::id::TenantId; /// Algorithm to use. We require EdDSA. const STORAGE_TOKEN_ALGORITHM: Algorithm = Algorithm::EdDSA; -#[derive(Debug, Serialize, Deserialize, Clone, PartialEq)] +#[derive(Debug, Serialize, Deserialize, Clone, Copy, PartialEq)] #[serde(rename_all = "lowercase")] pub enum Scope { // Provides access to all data for a specific tenant (specified in `struct Claims` below) diff --git a/safekeeper/src/bin/safekeeper.rs b/safekeeper/src/bin/safekeeper.rs index 0625538bf3..abede2e44d 100644 --- a/safekeeper/src/bin/safekeeper.rs +++ b/safekeeper/src/bin/safekeeper.rs @@ -37,7 +37,7 @@ use safekeeper::{http, WAL_REMOVER_RUNTIME}; use safekeeper::{remove_wal, WAL_BACKUP_RUNTIME}; use safekeeper::{wal_backup, HTTP_RUNTIME}; use storage_broker::DEFAULT_ENDPOINT; -use utils::auth::JwtAuth; +use utils::auth::{JwtAuth, Scope}; use utils::{ id::NodeId, logging::{self, LogFormat}, @@ -72,6 +72,10 @@ struct Args { /// Listen endpoint for receiving/sending WAL in the form host:port. #[arg(short, long, default_value = DEFAULT_PG_LISTEN_ADDR)] listen_pg: String, + /// Listen endpoint for receiving/sending WAL in the form host:port allowing + /// only tenant scoped auth tokens. Pointless if auth is disabled. + #[arg(long, default_value = None, verbatim_doc_comment)] + listen_pg_tenant_only: Option, /// Listen http endpoint for management and metrics in the form host:port. #[arg(long, default_value = DEFAULT_HTTP_LISTEN_ADDR)] listen_http: String, @@ -94,7 +98,7 @@ struct Args { broker_keepalive_interval: Duration, /// Peer safekeeper is considered dead after not receiving heartbeats from /// it during this period passed as a human readable duration. - #[arg(long, value_parser= humantime::parse_duration, default_value = DEFAULT_HEARTBEAT_TIMEOUT)] + #[arg(long, value_parser= humantime::parse_duration, default_value = DEFAULT_HEARTBEAT_TIMEOUT, verbatim_doc_comment)] heartbeat_timeout: Duration, /// Remote storage configuration for WAL backup (offloading to s3) as TOML /// inline table, e.g. @@ -179,6 +183,7 @@ async fn main() -> anyhow::Result<()> { workdir, my_id: id, listen_pg_addr: args.listen_pg, + listen_pg_addr_tenant_only: args.listen_pg_tenant_only, listen_http_addr: args.listen_http, availability_zone: args.availability_zone, no_sync: args.no_sync, @@ -222,6 +227,21 @@ async fn start_safekeeper(conf: SafeKeeperConf) -> Result<()> { e })?; + let pg_listener_tenant_only = + if let Some(listen_pg_addr_tenant_only) = &conf.listen_pg_addr_tenant_only { + info!( + "starting safekeeper tenant scoped WAL service on {}", + listen_pg_addr_tenant_only + ); + let listener = tcp_listener::bind(listen_pg_addr_tenant_only.clone()).map_err(|e| { + error!("failed to bind to address {}: {}", conf.listen_pg_addr, e); + e + })?; + Some(listener) + } else { + None + }; + info!( "starting safekeeper HTTP service on {}", conf.listen_http_addr @@ -253,14 +273,34 @@ async fn start_safekeeper(conf: SafeKeeperConf) -> Result<()> { let current_thread_rt = conf .current_thread_runtime .then(|| Handle::try_current().expect("no runtime in main")); + let wal_service_handle = current_thread_rt .as_ref() .unwrap_or_else(|| WAL_SERVICE_RUNTIME.handle()) - .spawn(wal_service::task_main(conf_, pg_listener)) + .spawn(wal_service::task_main( + conf_, + pg_listener, + Some(Scope::SafekeeperData), + )) // wrap with task name for error reporting .map(|res| ("WAL service main".to_owned(), res)); tasks_handles.push(Box::pin(wal_service_handle)); + if let Some(pg_listener_tenant_only) = pg_listener_tenant_only { + let conf_ = conf.clone(); + let wal_service_handle = current_thread_rt + .as_ref() + .unwrap_or_else(|| WAL_SERVICE_RUNTIME.handle()) + .spawn(wal_service::task_main( + conf_, + pg_listener_tenant_only, + Some(Scope::Tenant), + )) + // wrap with task name for error reporting + .map(|res| ("WAL service tenant only main".to_owned(), res)); + tasks_handles.push(Box::pin(wal_service_handle)); + } + let conf_ = conf.clone(); let http_handle = current_thread_rt .as_ref() diff --git a/safekeeper/src/handler.rs b/safekeeper/src/handler.rs index 1367d5eebb..5fe9db9628 100644 --- a/safekeeper/src/handler.rs +++ b/safekeeper/src/handler.rs @@ -34,6 +34,8 @@ pub struct SafekeeperPostgresHandler { pub ttid: TenantTimelineId, /// Unique connection id is logged in spans for observability. pub conn_id: ConnectionId, + /// Auth scope allowed on the connections. None if auth is not configured. + allowed_auth_scope: Option, claims: Option, io_metrics: Option, } @@ -147,6 +149,16 @@ impl postgres_backend::Handler .unwrap() .decode(str::from_utf8(jwt_response).context("jwt response is not UTF-8")?)?; + let scope = self + .allowed_auth_scope + .expect("auth is enabled but scope is not configured"); + // The handler might be configured to allow only tenant scope tokens. + if matches!(scope, Scope::Tenant) && !matches!(data.claims.scope, Scope::Tenant) { + return Err(QueryError::Other(anyhow::anyhow!( + "passed JWT token is for full access, but only tenant scope is allowed" + ))); + } + if matches!(data.claims.scope, Scope::Tenant) && data.claims.tenant_id.is_none() { return Err(QueryError::Other(anyhow::anyhow!( "jwt token scope is Tenant, but tenant id is missing" @@ -215,7 +227,12 @@ impl postgres_backend::Handler } impl SafekeeperPostgresHandler { - pub fn new(conf: SafeKeeperConf, conn_id: u32, io_metrics: Option) -> Self { + pub fn new( + conf: SafeKeeperConf, + conn_id: u32, + io_metrics: Option, + allowed_auth_scope: Option, + ) -> Self { SafekeeperPostgresHandler { conf, appname: None, @@ -224,6 +241,7 @@ impl SafekeeperPostgresHandler { ttid: TenantTimelineId::empty(), conn_id, claims: None, + allowed_auth_scope, io_metrics, } } diff --git a/safekeeper/src/lib.rs b/safekeeper/src/lib.rs index b8e1101369..1a1c0add67 100644 --- a/safekeeper/src/lib.rs +++ b/safekeeper/src/lib.rs @@ -53,6 +53,7 @@ pub struct SafeKeeperConf { pub workdir: PathBuf, pub my_id: NodeId, pub listen_pg_addr: String, + pub listen_pg_addr_tenant_only: Option, pub listen_http_addr: String, pub availability_zone: Option, pub no_sync: bool, @@ -85,6 +86,7 @@ impl SafeKeeperConf { workdir: PathBuf::from("./"), no_sync: false, listen_pg_addr: defaults::DEFAULT_PG_LISTEN_ADDR.to_string(), + listen_pg_addr_tenant_only: None, listen_http_addr: defaults::DEFAULT_HTTP_LISTEN_ADDR.to_string(), availability_zone: None, remote_storage: None, diff --git a/safekeeper/src/wal_service.rs b/safekeeper/src/wal_service.rs index 406132b2b0..43e870e621 100644 --- a/safekeeper/src/wal_service.rs +++ b/safekeeper/src/wal_service.rs @@ -8,7 +8,7 @@ use std::{future, time::Duration}; use tokio::net::TcpStream; use tokio_io_timeout::TimeoutReader; use tracing::*; -use utils::measured_stream::MeasuredStream; +use utils::{auth::Scope, measured_stream::MeasuredStream}; use crate::handler::SafekeeperPostgresHandler; use crate::metrics::TrafficMetrics; @@ -19,6 +19,7 @@ use postgres_backend::{AuthType, PostgresBackend}; pub async fn task_main( conf: SafeKeeperConf, pg_listener: std::net::TcpListener, + allowed_auth_scope: Option, ) -> anyhow::Result<()> { // Tokio's from_std won't do this for us, per its comment. pg_listener.set_nonblocking(true)?; @@ -33,7 +34,7 @@ pub async fn task_main( let conn_id = issue_connection_id(&mut connection_count); tokio::spawn(async move { - if let Err(err) = handle_socket(socket, conf, conn_id) + if let Err(err) = handle_socket(socket, conf, conn_id, allowed_auth_scope) .instrument(info_span!("", cid = %conn_id)) .await { @@ -49,6 +50,7 @@ async fn handle_socket( socket: TcpStream, conf: SafeKeeperConf, conn_id: ConnectionId, + allowed_auth_scope: Option, ) -> Result<(), QueryError> { socket.set_nodelay(true)?; let peer_addr = socket.peer_addr()?; @@ -84,8 +86,12 @@ async fn handle_socket( None => AuthType::Trust, Some(_) => AuthType::NeonJWT, }; - let mut conn_handler = - SafekeeperPostgresHandler::new(conf, conn_id, Some(traffic_metrics.clone())); + let mut conn_handler = SafekeeperPostgresHandler::new( + conf, + conn_id, + Some(traffic_metrics.clone()), + allowed_auth_scope, + ); let pgbackend = PostgresBackend::new_from_io(socket, peer_addr, auth_type, None)?; // libpq protocol between safekeeper and walproposer / pageserver // We don't use shutdown. From 921bb86909dcebc2138fcd9769244ae21dfd6f3a Mon Sep 17 00:00:00 2001 From: Arseny Sher Date: Mon, 17 Jul 2023 19:58:05 +0300 Subject: [PATCH 44/58] Use safekeeper tenant only port in all tests and actually test it. Compute now uses special safekeeper WAL service port allowing auth tokens with only tenant scope. Adds understanding of this port to neon_local and fixtures, as well as test of both ports behaviour with different tokens. ref https://github.com/neondatabase/neon/issues/4730 --- control_plane/src/endpoint.rs | 6 +-- control_plane/src/local_env.rs | 10 +++++ control_plane/src/safekeeper.rs | 50 ++++++++++++++---------- test_runner/fixtures/neon_fixtures.py | 4 ++ test_runner/regress/test_wal_acceptor.py | 37 ++++++++++++++++++ 5 files changed, 84 insertions(+), 23 deletions(-) diff --git a/control_plane/src/endpoint.rs b/control_plane/src/endpoint.rs index ff373d7111..6df6e47f29 100644 --- a/control_plane/src/endpoint.rs +++ b/control_plane/src/endpoint.rs @@ -289,7 +289,7 @@ impl Endpoint { .env .safekeepers .iter() - .map(|sk| format!("localhost:{}", sk.pg_port)) + .map(|sk| format!("localhost:{}", sk.get_compute_port())) .collect::>() .join(","); conf.append("neon.safekeepers", &safekeepers); @@ -318,7 +318,7 @@ impl Endpoint { .env .safekeepers .iter() - .map(|x| x.pg_port.to_string()) + .map(|x| x.get_compute_port().to_string()) .collect::>() .join(","); let sk_hosts = vec!["localhost"; self.env.safekeepers.len()].join(","); @@ -463,7 +463,7 @@ impl Endpoint { .iter() .find(|node| node.id == sk_id) .ok_or_else(|| anyhow!("safekeeper {sk_id} does not exist"))?; - safekeeper_connstrings.push(format!("127.0.0.1:{}", sk.pg_port)); + safekeeper_connstrings.push(format!("127.0.0.1:{}", sk.get_compute_port())); } } diff --git a/control_plane/src/local_env.rs b/control_plane/src/local_env.rs index 208eb9e7ec..9e42c2e333 100644 --- a/control_plane/src/local_env.rs +++ b/control_plane/src/local_env.rs @@ -137,6 +137,7 @@ impl Default for PageServerConf { pub struct SafekeeperConf { pub id: NodeId, pub pg_port: u16, + pub pg_tenant_only_port: Option, pub http_port: u16, pub sync: bool, pub remote_storage: Option, @@ -149,6 +150,7 @@ impl Default for SafekeeperConf { Self { id: NodeId(0), pg_port: 0, + pg_tenant_only_port: None, http_port: 0, sync: true, remote_storage: None, @@ -158,6 +160,14 @@ impl Default for SafekeeperConf { } } +impl SafekeeperConf { + /// Compute is served by port on which only tenant scoped tokens allowed, if + /// it is configured. + pub fn get_compute_port(&self) -> u16 { + self.pg_tenant_only_port.unwrap_or(self.pg_port) + } +} + impl LocalEnv { pub fn pg_distrib_dir_raw(&self) -> PathBuf { self.pg_distrib_dir.clone() diff --git a/control_plane/src/safekeeper.rs b/control_plane/src/safekeeper.rs index d5e0fb112f..be0192d137 100644 --- a/control_plane/src/safekeeper.rs +++ b/control_plane/src/safekeeper.rs @@ -120,45 +120,55 @@ impl SafekeeperNode { let availability_zone = format!("sk-{}", id_string); let mut args = vec![ - "-D", - datadir.to_str().with_context(|| { - format!("Datadir path {datadir:?} cannot be represented as a unicode string") - })?, - "--id", - &id_string, - "--listen-pg", - &listen_pg, - "--listen-http", - &listen_http, - "--availability-zone", - &availability_zone, + "-D".to_owned(), + datadir + .to_str() + .with_context(|| { + format!("Datadir path {datadir:?} cannot be represented as a unicode string") + })? + .to_owned(), + "--id".to_owned(), + id_string, + "--listen-pg".to_owned(), + listen_pg, + "--listen-http".to_owned(), + listen_http, + "--availability-zone".to_owned(), + availability_zone, ]; + if let Some(pg_tenant_only_port) = self.conf.pg_tenant_only_port { + let listen_pg_tenant_only = format!("127.0.0.1:{}", pg_tenant_only_port); + args.extend(["--listen-pg-tenant-only".to_owned(), listen_pg_tenant_only]); + } if !self.conf.sync { - args.push("--no-sync"); + args.push("--no-sync".to_owned()); } let broker_endpoint = format!("{}", self.env.broker.client_url()); - args.extend(["--broker-endpoint", &broker_endpoint]); + args.extend(["--broker-endpoint".to_owned(), broker_endpoint]); let mut backup_threads = String::new(); if let Some(threads) = self.conf.backup_threads { backup_threads = threads.to_string(); - args.extend(["--backup-threads", &backup_threads]); + args.extend(["--backup-threads".to_owned(), backup_threads]); } else { drop(backup_threads); } if let Some(ref remote_storage) = self.conf.remote_storage { - args.extend(["--remote-storage", remote_storage]); + args.extend(["--remote-storage".to_owned(), remote_storage.clone()]); } let key_path = self.env.base_data_dir.join("auth_public_key.pem"); if self.conf.auth_enabled { args.extend([ - "--auth-validation-public-key-path", - key_path.to_str().with_context(|| { - format!("Key path {key_path:?} cannot be represented as a unicode string") - })?, + "--auth-validation-public-key-path".to_owned(), + key_path + .to_str() + .with_context(|| { + format!("Key path {key_path:?} cannot be represented as a unicode string") + })? + .to_owned(), ]); } diff --git a/test_runner/fixtures/neon_fixtures.py b/test_runner/fixtures/neon_fixtures.py index 9e43a2bfdb..eafc061ab9 100644 --- a/test_runner/fixtures/neon_fixtures.py +++ b/test_runner/fixtures/neon_fixtures.py @@ -459,6 +459,7 @@ class AuthKeys: def generate_safekeeper_token(self) -> str: return self.generate_token(scope="safekeeperdata") + # generate token giving access to only one tenant def generate_tenant_token(self, tenant_id: TenantId) -> str: return self.generate_token(scope="tenant", tenant_id=str(tenant_id)) @@ -965,6 +966,7 @@ class NeonEnv: for i in range(1, config.num_safekeepers + 1): port = SafekeeperPort( pg=self.port_distributor.get_port(), + pg_tenant_only=self.port_distributor.get_port(), http=self.port_distributor.get_port(), ) id = config.safekeepers_id_start + i # assign ids sequentially @@ -973,6 +975,7 @@ class NeonEnv: [[safekeepers]] id = {id} pg_port = {port.pg} + pg_tenant_only_port = {port.pg_tenant_only} http_port = {port.http} sync = {'true' if config.safekeepers_enable_fsync else 'false'}""" ) @@ -2608,6 +2611,7 @@ class EndpointFactory: @dataclass class SafekeeperPort: pg: int + pg_tenant_only: int http: int diff --git a/test_runner/regress/test_wal_acceptor.py b/test_runner/regress/test_wal_acceptor.py index f3a6d09398..24b32ad7e7 100644 --- a/test_runner/regress/test_wal_acceptor.py +++ b/test_runner/regress/test_wal_acceptor.py @@ -13,6 +13,7 @@ from functools import partial from pathlib import Path from typing import Any, List, Optional +import psycopg2 import pytest from fixtures.log_helper import log from fixtures.neon_fixtures import ( @@ -866,6 +867,41 @@ def test_timeline_status(neon_env_builder: NeonEnvBuilder, auth_enabled: bool): assert debug_dump_1["config"]["id"] == env.safekeepers[0].id +# Test auth on WAL service (postgres protocol) ports. +def test_sk_auth(neon_env_builder: NeonEnvBuilder): + neon_env_builder.auth_enabled = True + env = neon_env_builder.init_start() + + env.neon_cli.create_branch("test_sk_auth") + endpoint = env.endpoints.create_start("test_sk_auth") + + sk = env.safekeepers[0] + + # learn neon timeline from compute + tenant_id = TenantId(endpoint.safe_psql("show neon.tenant_id")[0][0]) + timeline_id = TimelineId(endpoint.safe_psql("show neon.timeline_id")[0][0]) + + tenant_token = env.auth_keys.generate_tenant_token(tenant_id) + full_token = env.auth_keys.generate_safekeeper_token() + + conn_opts = { + "host": "127.0.0.1", + "options": f"-c timeline_id={timeline_id} tenant_id={tenant_id}", + } + connector = PgProtocol(**conn_opts) + # no password, should fail + with pytest.raises(psycopg2.OperationalError): + connector.safe_psql("IDENTIFY_SYSTEM", port=sk.port.pg) + # giving password, should be ok with either token on main pg port + connector.safe_psql("IDENTIFY_SYSTEM", port=sk.port.pg, password=tenant_token) + connector.safe_psql("IDENTIFY_SYSTEM", port=sk.port.pg, password=full_token) + # on tenant only port tenant only token should work + connector.safe_psql("IDENTIFY_SYSTEM", port=sk.port.pg_tenant_only, password=tenant_token) + # but full token should fail + with pytest.raises(psycopg2.OperationalError): + connector.safe_psql("IDENTIFY_SYSTEM", port=sk.port.pg_tenant_only, password=full_token) + + class SafekeeperEnv: def __init__( self, @@ -912,6 +948,7 @@ class SafekeeperEnv: def start_safekeeper(self, i): port = SafekeeperPort( pg=self.port_distributor.get_port(), + pg_tenant_only=self.port_distributor.get_port(), http=self.port_distributor.get_port(), ) From d4a5fd52588a130997db5bd5baf6cf5fa998acfd Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Wed, 19 Jul 2023 15:44:14 +0100 Subject: [PATCH 45/58] Disable extension uploading to S3 (#4751) ## Problem We're going to reset S3 buckets for extensions (https://github.com/neondatabase/aws/pull/413), and as soon as we're going to change the format we store extensions on S3. Let's stop uploading extensions in the old format. ## Summary of changes - Disable `aws s3 cp` step for extensions --- .github/workflows/build_and_test.yml | 2 ++ 1 file changed, 2 insertions(+) diff --git a/.github/workflows/build_and_test.yml b/.github/workflows/build_and_test.yml index 5f3e4f1145..18dfc458b5 100644 --- a/.github/workflows/build_and_test.yml +++ b/.github/workflows/build_and_test.yml @@ -1007,6 +1007,8 @@ jobs: done - name: Upload postgres-extensions to S3 + # TODO: Reenable step after switching to the new extensions format (tar-gzipped + index.json) + if: false run: | for BUCKET in $(echo ${S3_BUCKETS}); do aws s3 cp --recursive --only-show-errors ./extensions-to-upload s3://${BUCKET}/${{ needs.tag.outputs.build-tag }}/${{ matrix.version }} From f09e82270e3258508c6d6cc191486c56ee926216 Mon Sep 17 00:00:00 2001 From: Daniel <10074684+danieltprice@users.noreply.github.com> Date: Wed, 19 Jul 2023 15:08:25 -0300 Subject: [PATCH 46/58] Update comment for hnsw extension (#4755) Updated the description that appears for hnsw when you query extensions: ``` neondb=> SELECT * FROM pg_available_extensions WHERE name = 'hnsw'; name | default_version | installed_version | comment ----------------------+-----------------+-------------------+-------------------------------------------------- hnsw | 0.1.0 | | ** Deprecated ** Please use pg_embedding instead (1 row) ``` --------- Co-authored-by: Alexander Bayandin --- pgxn/hnsw/hnsw.control | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/pgxn/hnsw/hnsw.control b/pgxn/hnsw/hnsw.control index 8b75c350a8..24510f6766 100644 --- a/pgxn/hnsw/hnsw.control +++ b/pgxn/hnsw/hnsw.control @@ -1,4 +1,4 @@ -comment = 'hnsw index' +comment = '** Deprecated ** Please use pg_embedding instead' default_version = '0.1.0' module_pathname = '$libdir/hnsw' relocatable = true From e1061879aac8eb979a7292cb3a46c02d7f2e07ca Mon Sep 17 00:00:00 2001 From: bojanserafimov Date: Wed, 19 Jul 2023 23:46:16 -0400 Subject: [PATCH 47/58] Improve startup python test (#4757) --- test_runner/performance/test_startup.py | 12 +++++++++++- 1 file changed, 11 insertions(+), 1 deletion(-) diff --git a/test_runner/performance/test_startup.py b/test_runner/performance/test_startup.py index d897df1bcb..875be3b7b0 100644 --- a/test_runner/performance/test_startup.py +++ b/test_runner/performance/test_startup.py @@ -43,7 +43,17 @@ def test_startup_simple(neon_env_builder: NeonEnvBuilder, zenbenchmark: NeonBenc if endpoint: endpoint.start() else: - endpoint = env.endpoints.create_start("test_startup") + endpoint = env.endpoints.create_start( + "test_startup", + # Shared buffers need to be allocated during startup, so they + # impact startup time. This is the default value we use for + # 1CPU pods (maybe different for VMs). + # + # TODO extensions also contribute to shared memory allocation, + # and this test doesn't include all default extensions we + # load. + config_lines=["shared_buffers=262144"], + ) endpoint.safe_psql("select 1;") # Get metrics From 9e871318a0bfb530877247724d6fe2c62b857269 Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Thu, 20 Jul 2023 13:14:13 +0300 Subject: [PATCH 48/58] Wait detaches or ignores on pageserver shutdown (#4678) Adds in a barrier for the duration of the `Tenant::shutdown`. `pageserver_shutdown` will join this await, `detach`es and `ignore`s will not. Fixes #4429. --------- Co-authored-by: Christian Schwarz --- libs/pageserver_api/src/models.rs | 18 ++- libs/utils/src/completion.rs | 16 +++ libs/utils/src/tracing_span_assert.rs | 4 +- pageserver/Cargo.toml | 1 + pageserver/src/tenant.rs | 43 +++--- pageserver/src/tenant/mgr.rs | 198 +++++++++++++++++++++++--- workspace_hack/Cargo.toml | 2 +- 7 files changed, 242 insertions(+), 40 deletions(-) diff --git a/libs/pageserver_api/src/models.rs b/libs/pageserver_api/src/models.rs index 4c6529ffab..2f4c21326e 100644 --- a/libs/pageserver_api/src/models.rs +++ b/libs/pageserver_api/src/models.rs @@ -9,6 +9,7 @@ use serde::{Deserialize, Serialize}; use serde_with::{serde_as, DisplayFromStr}; use strum_macros; use utils::{ + completion, history_buffer::HistoryBufferWithDropCounter, id::{NodeId, TenantId, TimelineId}, lsn::Lsn, @@ -76,7 +77,12 @@ pub enum TenantState { /// system is being shut down. /// /// Transitions out of this state are possible through `set_broken()`. - Stopping, + Stopping { + // Because of https://github.com/serde-rs/serde/issues/2105 this has to be a named field, + // otherwise it will not be skipped during deserialization + #[serde(skip)] + progress: completion::Barrier, + }, /// The tenant is recognized by the pageserver, but can no longer be used for /// any operations. /// @@ -118,7 +124,7 @@ impl TenantState { // Why is Stopping a Maybe case? Because, during pageserver shutdown, // we set the Stopping state irrespective of whether the tenant // has finished attaching or not. - Self::Stopping => Maybe, + Self::Stopping { .. } => Maybe, } } @@ -928,7 +934,13 @@ mod tests { "Activating", ), (line!(), TenantState::Active, "Active"), - (line!(), TenantState::Stopping, "Stopping"), + ( + line!(), + TenantState::Stopping { + progress: utils::completion::Barrier::default(), + }, + "Stopping", + ), ( line!(), TenantState::Broken { diff --git a/libs/utils/src/completion.rs b/libs/utils/src/completion.rs index 2cdaee548e..e2e84dd0ee 100644 --- a/libs/utils/src/completion.rs +++ b/libs/utils/src/completion.rs @@ -12,6 +12,13 @@ pub struct Completion(mpsc::Sender<()>); #[derive(Clone)] pub struct Barrier(Arc>>); +impl Default for Barrier { + fn default() -> Self { + let (_, rx) = channel(); + rx + } +} + impl Barrier { pub async fn wait(self) { self.0.lock().await.recv().await; @@ -24,6 +31,15 @@ impl Barrier { } } +impl PartialEq for Barrier { + fn eq(&self, other: &Self) -> bool { + // we don't use dyn so this is good + Arc::ptr_eq(&self.0, &other.0) + } +} + +impl Eq for Barrier {} + /// Create new Guard and Barrier pair. pub fn channel() -> (Completion, Barrier) { let (tx, rx) = mpsc::channel::<()>(1); diff --git a/libs/utils/src/tracing_span_assert.rs b/libs/utils/src/tracing_span_assert.rs index 926bfc3188..db17f7d8cd 100644 --- a/libs/utils/src/tracing_span_assert.rs +++ b/libs/utils/src/tracing_span_assert.rs @@ -164,9 +164,7 @@ fn tracing_subscriber_configured() -> bool { tracing::dispatcher::get_default(|d| { // it is possible that this closure will not be invoked, but the current implementation // always invokes it - noop_configured = d - .downcast_ref::() - .is_some(); + noop_configured = d.is::(); }); !noop_configured diff --git a/pageserver/Cargo.toml b/pageserver/Cargo.toml index 9381ed0bfa..27e90ea97d 100644 --- a/pageserver/Cargo.toml +++ b/pageserver/Cargo.toml @@ -82,6 +82,7 @@ strum_macros.workspace = true criterion.workspace = true hex-literal.workspace = true tempfile.workspace = true +tokio = { workspace = true, features = ["process", "sync", "fs", "rt", "io-util", "time", "test-util"] } [[bench]] name = "bench_layer_map" diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index 142118bf6e..379db0720f 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -281,7 +281,7 @@ pub enum DeleteTimelineError { } pub enum SetStoppingError { - AlreadyStopping, + AlreadyStopping(completion::Barrier), Broken, } @@ -318,10 +318,6 @@ impl std::fmt::Display for WaitToBecomeActiveError { } } -pub(crate) enum ShutdownError { - AlreadyStopping, -} - struct DeletionGuard(OwnedMutexGuard); impl DeletionGuard { @@ -1721,7 +1717,7 @@ impl Tenant { self.state.send_modify(|current_state| { use pageserver_api::models::ActivatingFrom; match &*current_state { - TenantState::Activating(_) | TenantState::Active | TenantState::Broken { .. } | TenantState::Stopping => { + TenantState::Activating(_) | TenantState::Active | TenantState::Broken { .. } | TenantState::Stopping { .. } => { panic!("caller is responsible for calling activate() only on Loading / Attaching tenants, got {state:?}", state = current_state); } TenantState::Loading => { @@ -1785,7 +1781,16 @@ impl Tenant { /// - detach + ignore (freeze_and_flush == false) /// /// This will attempt to shutdown even if tenant is broken. - pub(crate) async fn shutdown(&self, freeze_and_flush: bool) -> Result<(), ShutdownError> { + /// + /// `shutdown_progress` is a [`completion::Barrier`] for the shutdown initiated by this call. + /// If the tenant is already shutting down, we return a clone of the first shutdown call's + /// `Barrier` as an `Err`. This not-first caller can use the returned barrier to join with + /// the ongoing shutdown. + async fn shutdown( + &self, + shutdown_progress: completion::Barrier, + freeze_and_flush: bool, + ) -> Result<(), completion::Barrier> { span::debug_assert_current_span_has_tenant_id(); // Set tenant (and its timlines) to Stoppping state. // @@ -1804,12 +1809,16 @@ impl Tenant { // But the tenant background loops are joined-on in our caller. // It's mesed up. // we just ignore the failure to stop - match self.set_stopping().await { + + match self.set_stopping(shutdown_progress).await { Ok(()) => {} Err(SetStoppingError::Broken) => { // assume that this is acceptable } - Err(SetStoppingError::AlreadyStopping) => return Err(ShutdownError::AlreadyStopping), + Err(SetStoppingError::AlreadyStopping(other)) => { + // give caller the option to wait for this this shutdown + return Err(other); + } }; if freeze_and_flush { @@ -1841,7 +1850,7 @@ impl Tenant { /// This function waits for the tenant to become active if it isn't already, before transitioning it into Stopping state. /// /// This function is not cancel-safe! - async fn set_stopping(&self) -> Result<(), SetStoppingError> { + async fn set_stopping(&self, progress: completion::Barrier) -> Result<(), SetStoppingError> { let mut rx = self.state.subscribe(); // cannot stop before we're done activating, so wait out until we're done activating @@ -1853,7 +1862,7 @@ impl Tenant { ); false } - TenantState::Active | TenantState::Broken { .. } | TenantState::Stopping {} => true, + TenantState::Active | TenantState::Broken { .. } | TenantState::Stopping { .. } => true, }) .await .expect("cannot drop self.state while on a &self method"); @@ -1868,7 +1877,7 @@ impl Tenant { // FIXME: due to time-of-check vs time-of-use issues, it can happen that new timelines // are created after the transition to Stopping. That's harmless, as the Timelines // won't be accessible to anyone afterwards, because the Tenant is in Stopping state. - *current_state = TenantState::Stopping; + *current_state = TenantState::Stopping { progress }; // Continue stopping outside the closure. We need to grab timelines.lock() // and we plan to turn it into a tokio::sync::Mutex in a future patch. true @@ -1880,9 +1889,9 @@ impl Tenant { err = Some(SetStoppingError::Broken); false } - TenantState::Stopping => { + TenantState::Stopping { progress } => { info!("Tenant is already in Stopping state"); - err = Some(SetStoppingError::AlreadyStopping); + err = Some(SetStoppingError::AlreadyStopping(progress.clone())); false } }); @@ -1926,7 +1935,7 @@ impl Tenant { ); false } - TenantState::Active | TenantState::Broken { .. } | TenantState::Stopping {} => true, + TenantState::Active | TenantState::Broken { .. } | TenantState::Stopping { .. } => true, }) .await .expect("cannot drop self.state while on a &self method"); @@ -1949,7 +1958,7 @@ impl Tenant { warn!("Tenant is already in Broken state"); } // This is the only "expected" path, any other path is a bug. - TenantState::Stopping => { + TenantState::Stopping { .. } => { warn!( "Marking Stopping tenant as Broken state, reason: {}", reason @@ -1982,7 +1991,7 @@ impl Tenant { TenantState::Active { .. } => { return Ok(()); } - TenantState::Broken { .. } | TenantState::Stopping => { + TenantState::Broken { .. } | TenantState::Stopping { .. } => { // There's no chance the tenant can transition back into ::Active return Err(WaitToBecomeActiveError::WillNotBecomeActive { tenant_id: self.tenant_id, diff --git a/pageserver/src/tenant/mgr.rs b/pageserver/src/tenant/mgr.rs index 2cc881ed5e..4b97871f35 100644 --- a/pageserver/src/tenant/mgr.rs +++ b/pageserver/src/tenant/mgr.rs @@ -233,11 +233,17 @@ pub fn schedule_local_tenant_processing( /// That could be easily misinterpreted by control plane, the consumer of the /// management API. For example, it could attach the tenant on a different pageserver. /// We would then be in split-brain once this pageserver restarts. -#[instrument] +#[instrument(skip_all)] pub async fn shutdown_all_tenants() { + shutdown_all_tenants0(&TENANTS).await +} + +async fn shutdown_all_tenants0(tenants: &tokio::sync::RwLock) { + use utils::completion; + // Prevent new tenants from being created. let tenants_to_shut_down = { - let mut m = TENANTS.write().await; + let mut m = tenants.write().await; match &mut *m { TenantsMap::Initializing => { *m = TenantsMap::ShuttingDown(HashMap::default()); @@ -262,14 +268,41 @@ pub async fn shutdown_all_tenants() { for (tenant_id, tenant) in tenants_to_shut_down { join_set.spawn( async move { - let freeze_and_flush = true; + // ordering shouldn't matter for this, either we store true right away or never + let ordering = std::sync::atomic::Ordering::Relaxed; + let joined_other = std::sync::atomic::AtomicBool::new(false); - match tenant.shutdown(freeze_and_flush).await { - Ok(()) => debug!("tenant successfully stopped"), - Err(super::ShutdownError::AlreadyStopping) => { - warn!("tenant was already shutting down") + let mut shutdown = std::pin::pin!(async { + let freeze_and_flush = true; + + let res = { + let (_guard, shutdown_progress) = completion::channel(); + tenant.shutdown(shutdown_progress, freeze_and_flush).await + }; + + if let Err(other_progress) = res { + // join the another shutdown in progress + joined_other.store(true, ordering); + other_progress.wait().await; } - } + }); + + // in practice we might not have a lot time to go, since systemd is going to + // SIGKILL us at 10s, but we can try. delete tenant might take a while, so put out + // a warning. + let warning = std::time::Duration::from_secs(5); + let mut warning = std::pin::pin!(tokio::time::sleep(warning)); + + tokio::select! { + _ = &mut shutdown => {}, + _ = &mut warning => { + let joined_other = joined_other.load(ordering); + warn!(%joined_other, "waiting for the shutdown to complete"); + shutdown.await; + } + }; + + debug!("tenant successfully stopped"); } .instrument(info_span!("shutdown", %tenant_id)), ); @@ -413,6 +446,15 @@ pub async fn detach_tenant( conf: &'static PageServerConf, tenant_id: TenantId, detach_ignored: bool, +) -> Result<(), TenantStateError> { + detach_tenant0(conf, &TENANTS, tenant_id, detach_ignored).await +} + +async fn detach_tenant0( + conf: &'static PageServerConf, + tenants: &tokio::sync::RwLock, + tenant_id: TenantId, + detach_ignored: bool, ) -> Result<(), TenantStateError> { let local_files_cleanup_operation = |tenant_id_to_clean| async move { let local_tenant_directory = conf.tenant_path(&tenant_id_to_clean); @@ -425,7 +467,8 @@ pub async fn detach_tenant( }; let removal_result = - remove_tenant_from_memory(tenant_id, local_files_cleanup_operation(tenant_id)).await; + remove_tenant_from_memory(tenants, tenant_id, local_files_cleanup_operation(tenant_id)) + .await; // Ignored tenants are not present in memory and will bail the removal from memory operation. // Before returning the error, check for ignored tenant removal case — we only need to clean its local files then. @@ -472,7 +515,15 @@ pub async fn ignore_tenant( conf: &'static PageServerConf, tenant_id: TenantId, ) -> Result<(), TenantStateError> { - remove_tenant_from_memory(tenant_id, async { + ignore_tenant0(conf, &TENANTS, tenant_id).await +} + +async fn ignore_tenant0( + conf: &'static PageServerConf, + tenants: &tokio::sync::RwLock, + tenant_id: TenantId, +) -> Result<(), TenantStateError> { + remove_tenant_from_memory(tenants, tenant_id, async { let ignore_mark_file = conf.tenant_ignore_mark_file_path(&tenant_id); fs::File::create(&ignore_mark_file) .await @@ -597,18 +648,21 @@ where /// If the cleanup fails, tenant will stay in memory in [`TenantState::Broken`] state, and another removal /// operation would be needed to remove it. async fn remove_tenant_from_memory( + tenants: &tokio::sync::RwLock, tenant_id: TenantId, tenant_cleanup: F, ) -> Result where F: std::future::Future>, { + use utils::completion; + // It's important to keep the tenant in memory after the final cleanup, to avoid cleanup races. // The exclusive lock here ensures we don't miss the tenant state updates before trying another removal. // tenant-wde cleanup operations may take some time (removing the entire tenant directory), we want to // avoid holding the lock for the entire process. let tenant = { - TENANTS + tenants .write() .await .get(&tenant_id) @@ -616,14 +670,20 @@ where .ok_or(TenantStateError::NotFound(tenant_id))? }; + // allow pageserver shutdown to await for our completion + let (_guard, progress) = completion::channel(); + + // whenever we remove a tenant from memory, we don't want to flush and wait for upload let freeze_and_flush = false; // shutdown is sure to transition tenant to stopping, and wait for all tasks to complete, so // that we can continue safely to cleanup. - match tenant.shutdown(freeze_and_flush).await { + match tenant.shutdown(progress, freeze_and_flush).await { Ok(()) => {} - Err(super::ShutdownError::AlreadyStopping) => { - return Err(TenantStateError::IsStopping(tenant_id)) + Err(_other) => { + // if pageserver shutdown or other detach/ignore is already ongoing, we don't want to + // wait for it but return an error right away because these are distinct requests. + return Err(TenantStateError::IsStopping(tenant_id)); } } @@ -632,14 +692,14 @@ where .with_context(|| format!("Failed to run cleanup for tenant {tenant_id}")) { Ok(hook_value) => { - let mut tenants_accessor = TENANTS.write().await; + let mut tenants_accessor = tenants.write().await; if tenants_accessor.remove(&tenant_id).is_none() { warn!("Tenant {tenant_id} got removed from memory before operation finished"); } Ok(hook_value) } Err(e) => { - let tenants_accessor = TENANTS.read().await; + let tenants_accessor = tenants.read().await; match tenants_accessor.get(&tenant_id) { Some(tenant) => { tenant.set_broken(e.to_string()).await; @@ -756,3 +816,109 @@ pub async fn immediate_compact( Ok(wait_task_done) } + +#[cfg(test)] +mod tests { + use std::collections::HashMap; + use std::sync::Arc; + use tracing::{info_span, Instrument}; + + use super::{super::harness::TenantHarness, TenantsMap}; + + #[tokio::test(start_paused = true)] + async fn shutdown_joins_remove_tenant_from_memory() { + // the test is a bit ugly with the lockstep together with spawned tasks. the aim is to make + // sure `shutdown_all_tenants0` per-tenant processing joins in any active + // remove_tenant_from_memory calls, which is enforced by making the operation last until + // we've ran `shutdown_all_tenants0` for a long time. + + let (t, _ctx) = TenantHarness::create("shutdown_joins_detach") + .unwrap() + .load() + .await; + + // harness loads it to active, which is forced and nothing is running on the tenant + + let id = t.tenant_id(); + + // tenant harness configures the logging and we cannot escape it + let _e = info_span!("testing", tenant_id = %id).entered(); + + let tenants = HashMap::from([(id, t.clone())]); + let tenants = Arc::new(tokio::sync::RwLock::new(TenantsMap::Open(tenants))); + + let (until_cleanup_completed, can_complete_cleanup) = utils::completion::channel(); + let (until_cleanup_started, cleanup_started) = utils::completion::channel(); + + // start a "detaching operation", which will take a while, until can_complete_cleanup + let cleanup_task = { + let jh = tokio::spawn({ + let tenants = tenants.clone(); + async move { + let cleanup = async move { + drop(until_cleanup_started); + can_complete_cleanup.wait().await; + anyhow::Ok(()) + }; + super::remove_tenant_from_memory(&tenants, id, cleanup).await + } + .instrument(info_span!("foobar", tenant_id = %id)) + }); + + // now the long cleanup should be in place, with the stopping state + cleanup_started.wait().await; + jh + }; + + let mut cleanup_progress = std::pin::pin!(t + .shutdown(utils::completion::Barrier::default(), false) + .await + .unwrap_err() + .wait()); + + let mut shutdown_task = { + let (until_shutdown_started, shutdown_started) = utils::completion::channel(); + + let shutdown_task = tokio::spawn(async move { + drop(until_shutdown_started); + super::shutdown_all_tenants0(&tenants).await; + }); + + shutdown_started.wait().await; + shutdown_task + }; + + // if the joining in is removed from shutdown_all_tenants0, the shutdown_task should always + // get to complete within timeout and fail the test. it is expected to continue awaiting + // until completion or SIGKILL during normal shutdown. + // + // the timeout is long to cover anything that shutdown_task could be doing, but it is + // handled instantly because we use tokio's time pausing in this test. 100s is much more than + // what we get from systemd on shutdown (10s). + let long_time = std::time::Duration::from_secs(100); + tokio::select! { + _ = &mut shutdown_task => unreachable!("shutdown must continue, until_cleanup_completed is not dropped"), + _ = &mut cleanup_progress => unreachable!("cleanup progress must continue, until_cleanup_completed is not dropped"), + _ = tokio::time::sleep(long_time) => {}, + } + + // allow the remove_tenant_from_memory and thus eventually the shutdown to continue + drop(until_cleanup_completed); + + let (je, ()) = tokio::join!(shutdown_task, cleanup_progress); + je.expect("Tenant::shutdown shutdown not have panicked"); + cleanup_task + .await + .expect("no panicking") + .expect("remove_tenant_from_memory failed"); + + futures::future::poll_immediate( + t.shutdown(utils::completion::Barrier::default(), false) + .await + .unwrap_err() + .wait(), + ) + .await + .expect("the stopping progress must still be complete"); + } +} diff --git a/workspace_hack/Cargo.toml b/workspace_hack/Cargo.toml index 63a65d3889..3f47ef062f 100644 --- a/workspace_hack/Cargo.toml +++ b/workspace_hack/Cargo.toml @@ -46,7 +46,7 @@ scopeguard = { version = "1" } serde = { version = "1", features = ["alloc", "derive"] } serde_json = { version = "1", features = ["raw_value"] } socket2 = { version = "0.4", default-features = false, features = ["all"] } -tokio = { version = "1", features = ["fs", "io-std", "io-util", "macros", "net", "process", "rt-multi-thread", "signal", "sync", "time"] } +tokio = { version = "1", features = ["fs", "io-std", "io-util", "macros", "net", "process", "rt-multi-thread", "signal", "test-util"] } tokio-rustls = { version = "0.23" } tokio-util = { version = "0.7", features = ["codec", "io"] } toml_datetime = { version = "0.6", default-features = false, features = ["serde"] } From 27c73c87409ebe8aa9045c197f0c61ee5050a730 Mon Sep 17 00:00:00 2001 From: Alexander Bayandin Date: Thu, 20 Jul 2023 12:32:57 +0100 Subject: [PATCH 49/58] Bump pg_embedding extension (#4758) ``` % git log --pretty=oneline 2465f831ea1f8d49c1d74f8959adb7fc277d70cd..eeb3ba7c3a60c95b2604dd543c64b2f1bb4a3703 eeb3ba7c3a60c95b2604dd543c64b2f1bb4a3703 (HEAD -> main, origin/main) Fixc in-mmeory index rebuild after TRUNCATE 1d7cfcfe3d58e2cf4566900437c609725448d14b Correctly handle truncate forin-0memory HNSW index 8fd2a4a191f67858498d876ec378b58e76b5874a :Fix empty index search issue 30e9ef4064cff40c60ff2f78afeac6c296722757 Fix extensiomn name in makefile 23bb5d504aa21b1663719739f6eedfdcb139d948 Fix getting memory size at Mac OS/X 39193a38d6ad8badd2a8d1dce2dd999e1b86885d Update a comment for the extension bf3b0d62a7df56a5e4db9d9e62dc535794c425bc Merge branch 'main' of https://github.com/neondatabase/pg_embedding c2142d514280e14322d1026f0c811876ccf7a91f Update README.md 53b641880f786d2b69a75941c49e569018e8e97e Create LICENSE 093aaa36d5af183831bf370c97b563c12d15f23a Update README.md 91f0bb84d14cb26fd8b452bf9e1ecea026ac5cbc Update README.md 7f7efa38015f24ee9a09beca3009b8d0497a40b4 Update README.md 71defdd4143ecf35489d93289f6cdfa2545fbd36 Merge pull request #4 from neondatabase/danieltprice-patch-1 e06c228b99c6b7c47ebce3bb7c97dbd494088b0a Update README.md d7e52b576b47d9023743b124bdd0360a9fc98f59 Update README.md 70ab399c861330b50a9aff9ab9edc7044942a65b Merge pull request #5 from neondatabase/oom_error_reporting 0aee1d937997198fa2d2b2ed7a0886d1075fa790 Fix OOM error reporting and support vectprization for ARM 18d80079ce60b2aa81d58cefdf42fc09d2621fc1 Update README.md ``` --- Dockerfile.compute-node | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/Dockerfile.compute-node b/Dockerfile.compute-node index 1b5db2af81..495ef25526 100644 --- a/Dockerfile.compute-node +++ b/Dockerfile.compute-node @@ -535,10 +535,10 @@ FROM build-deps AS pg-embedding-pg-build COPY --from=pg-build /usr/local/pgsql/ /usr/local/pgsql/ ENV PATH "/usr/local/pgsql/bin/:$PATH" -# 2465f831ea1f8d49c1d74f8959adb7fc277d70cd made on 05/07/2023 +# eeb3ba7c3a60c95b2604dd543c64b2f1bb4a3703 made on 15/07/2023 # There is no release tag yet -RUN wget https://github.com/neondatabase/pg_embedding/archive/2465f831ea1f8d49c1d74f8959adb7fc277d70cd.tar.gz -O pg_embedding.tar.gz && \ - echo "047af2b1f664a1e6e37867bd4eeaf5934fa27d6ba3d6c4461efa388ddf7cd1d5 pg_embedding.tar.gz" | sha256sum --check && \ +RUN wget https://github.com/neondatabase/pg_embedding/archive/eeb3ba7c3a60c95b2604dd543c64b2f1bb4a3703.tar.gz -O pg_embedding.tar.gz && \ + echo "030846df723652f99a8689ce63b66fa0c23477a7fd723533ab8a6b28ab70730f pg_embedding.tar.gz" | sha256sum --check && \ mkdir pg_embedding-src && cd pg_embedding-src && tar xvzf ../pg_embedding.tar.gz --strip-components=1 -C . && \ make -j $(getconf _NPROCESSORS_ONLN) && \ make -j $(getconf _NPROCESSORS_ONLN) install && \ From d98cb399787f76d61985b58648c56c050d82f206 Mon Sep 17 00:00:00 2001 From: arpad-m Date: Thu, 20 Jul 2023 16:19:38 +0200 Subject: [PATCH 50/58] pageserver: use tokio::time::timeout where possible (#4756) Removes a bunch of cases which used `tokio::select` to emulate the `tokio::time::timeout` function. I've done an additional review on the cancellation safety of these futures, all of them seem to be cancellation safe (not that `select!` allows non-cancellation-safe futures, but as we touch them, such a review makes sense). Furthermore, I correct a few mentions of a non-existent `tokio::timeout!` macro in the docs to the `tokio::time::timeout` function. --- docs/pageserver-thread-mgmt.md | 10 +++---- pageserver/src/bin/pageserver.rs | 6 ++-- pageserver/src/disk_usage_eviction_task.rs | 10 +++---- pageserver/src/task_mgr.rs | 18 +++++------ pageserver/src/tenant/tasks.rs | 30 +++++++++---------- .../src/tenant/timeline/eviction_task.rs | 10 +++---- 6 files changed, 40 insertions(+), 44 deletions(-) diff --git a/docs/pageserver-thread-mgmt.md b/docs/pageserver-thread-mgmt.md index b911933528..c911d2c53d 100644 --- a/docs/pageserver-thread-mgmt.md +++ b/docs/pageserver-thread-mgmt.md @@ -30,8 +30,8 @@ or similar, to wake up on shutdown. In async Rust, futures can be "cancelled" at any await point, by dropping the Future. For example, `tokio::select!` returns as soon as -one of the Futures returns, and drops the others. `tokio::timeout!` is -another example. In the Rust ecosystem, some functions are +one of the Futures returns, and drops the others. `tokio::time::timeout` +is another example. In the Rust ecosystem, some functions are cancellation-safe, meaning they can be safely dropped without side-effects, while others are not. See documentation of `tokio::select!` for examples. @@ -42,9 +42,9 @@ function that you call cannot be assumed to be async cancellation-safe, and must be polled to completion. The downside of non-cancellation safe code is that you have to be very -careful when using `tokio::select!`, `tokio::timeout!`, and other such -functions that can cause a Future to be dropped. They can only be used -with functions that are explicitly documented to be cancellation-safe, +careful when using `tokio::select!`, `tokio::time::timeout`, and other +such functions that can cause a Future to be dropped. They can only be +used with functions that are explicitly documented to be cancellation-safe, or you need to spawn a separate task to shield from the cancellation. At the entry points to the code, we also take care to poll futures to diff --git a/pageserver/src/bin/pageserver.rs b/pageserver/src/bin/pageserver.rs index b01ace63e4..b247fdf0ab 100644 --- a/pageserver/src/bin/pageserver.rs +++ b/pageserver/src/bin/pageserver.rs @@ -396,8 +396,8 @@ fn start_pageserver( let guard = scopeguard::guard_on_success((), |_| tracing::info!("Cancelled before initial logical sizes completed")); - let init_sizes_done = tokio::select! { - _ = &mut init_sizes_done => { + let init_sizes_done = match tokio::time::timeout(timeout, &mut init_sizes_done).await { + Ok(_) => { let now = std::time::Instant::now(); tracing::info!( from_init_done_millis = (now - init_done).as_millis(), @@ -406,7 +406,7 @@ fn start_pageserver( ); None } - _ = tokio::time::sleep(timeout) => { + Err(_) => { tracing::info!( timeout_millis = timeout.as_millis(), "Initial logical size timeout elapsed; starting background jobs" diff --git a/pageserver/src/disk_usage_eviction_task.rs b/pageserver/src/disk_usage_eviction_task.rs index b2ca9ab0bb..37c52c5423 100644 --- a/pageserver/src/disk_usage_eviction_task.rs +++ b/pageserver/src/disk_usage_eviction_task.rs @@ -166,11 +166,11 @@ async fn disk_usage_eviction_task( .await; let sleep_until = start + task_config.period; - tokio::select! { - _ = tokio::time::sleep_until(sleep_until) => {}, - _ = cancel.cancelled() => { - break - } + if tokio::time::timeout_at(sleep_until, cancel.cancelled()) + .await + .is_ok() + { + break; } } } diff --git a/pageserver/src/task_mgr.rs b/pageserver/src/task_mgr.rs index 9c6851bc71..f3a4ce6db7 100644 --- a/pageserver/src/task_mgr.rs +++ b/pageserver/src/task_mgr.rs @@ -511,17 +511,13 @@ pub async fn shutdown_tasks( warn!(name = task.name, tenant_id = ?tenant_id, timeline_id = ?timeline_id, kind = ?task_kind, "stopping left-over"); } } - let join_handle = tokio::select! { - biased; - _ = &mut join_handle => { None }, - _ = tokio::time::sleep(std::time::Duration::from_secs(1)) => { - // allow some time to elapse before logging to cut down the number of log - // lines. - info!("waiting for {} to shut down", task.name); - Some(join_handle) - } - }; - if let Some(join_handle) = join_handle { + if tokio::time::timeout(std::time::Duration::from_secs(1), &mut join_handle) + .await + .is_err() + { + // allow some time to elapse before logging to cut down the number of log + // lines. + info!("waiting for {} to shut down", task.name); // we never handled this return value, but: // - we don't deschedule which would lead to is_cancelled // - panics are already logged (is_panicked) diff --git a/pageserver/src/tenant/tasks.rs b/pageserver/src/tenant/tasks.rs index 360818b5a7..622ae371a4 100644 --- a/pageserver/src/tenant/tasks.rs +++ b/pageserver/src/tenant/tasks.rs @@ -122,12 +122,12 @@ async fn compaction_loop(tenant: Arc, cancel: CancellationToken) { warn_when_period_overrun(started_at.elapsed(), period, "compaction"); // Sleep - tokio::select! { - _ = cancel.cancelled() => { - info!("received cancellation request during idling"); - break; - }, - _ = tokio::time::sleep(sleep_duration) => {}, + if tokio::time::timeout(sleep_duration, cancel.cancelled()) + .await + .is_ok() + { + info!("received cancellation request during idling"); + break; } } } @@ -196,12 +196,12 @@ async fn gc_loop(tenant: Arc, cancel: CancellationToken) { warn_when_period_overrun(started_at.elapsed(), period, "gc"); // Sleep - tokio::select! { - _ = cancel.cancelled() => { - info!("received cancellation request during idling"); - break; - }, - _ = tokio::time::sleep(sleep_duration) => {}, + if tokio::time::timeout(sleep_duration, cancel.cancelled()) + .await + .is_ok() + { + info!("received cancellation request during idling"); + break; } } } @@ -263,9 +263,9 @@ pub(crate) async fn random_init_delay( rng.gen_range(Duration::ZERO..=period) }; - tokio::select! { - _ = cancel.cancelled() => Err(Cancelled), - _ = tokio::time::sleep(d) => Ok(()), + match tokio::time::timeout(d, cancel.cancelled()).await { + Ok(_) => Err(Cancelled), + Err(_) => Ok(()), } } diff --git a/pageserver/src/tenant/timeline/eviction_task.rs b/pageserver/src/tenant/timeline/eviction_task.rs index 80146419df..a5f570d942 100644 --- a/pageserver/src/tenant/timeline/eviction_task.rs +++ b/pageserver/src/tenant/timeline/eviction_task.rs @@ -100,11 +100,11 @@ impl Timeline { match cf { ControlFlow::Break(()) => break, ControlFlow::Continue(sleep_until) => { - tokio::select! { - _ = cancel.cancelled() => { - break; - } - _ = tokio::time::sleep_until(sleep_until) => { } + if tokio::time::timeout_at(sleep_until, cancel.cancelled()) + .await + .is_ok() + { + break; } } } From 8d27a9c54e16967103c3aeeb261933718ec5f9b1 Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Thu, 20 Jul 2023 17:45:10 +0300 Subject: [PATCH 51/58] Less verbose eviction failures (#4737) As seen in staging logs with some massive compactions (create_image_layer), in addition to racing with compaction or gc or even between two invocations to `evict_layer_batch`. Cc: #4745 Fixes: #3851 (organic tech debt reduction) Solution is not to log the Not Found in such cases; it is perfectly natural to happen. Route to this is quite long, but implemented two cases of "race between two eviction processes" which are like our disk usage based eviction and eviction_task, both have the separate "lets figure out what to evict" and "lets evict" phases. --- libs/utils/src/error.rs | 111 +++++++ libs/utils/src/lib.rs | 3 + pageserver/src/disk_usage_eviction_task.rs | 25 +- pageserver/src/tenant.rs | 20 +- pageserver/src/tenant/timeline.rs | 304 ++++++++++++++---- .../src/tenant/timeline/eviction_task.rs | 23 +- 6 files changed, 406 insertions(+), 80 deletions(-) create mode 100644 libs/utils/src/error.rs diff --git a/libs/utils/src/error.rs b/libs/utils/src/error.rs new file mode 100644 index 0000000000..7ce203e918 --- /dev/null +++ b/libs/utils/src/error.rs @@ -0,0 +1,111 @@ +/// Create a reporter for an error that outputs similar to [`anyhow::Error`] with Display with alternative setting. +/// +/// It can be used with `anyhow::Error` as well. +/// +/// Why would one use this instead of converting to `anyhow::Error` on the spot? Because +/// anyhow::Error would also capture a stacktrace on the spot, which you would later discard after +/// formatting. +/// +/// ## Usage +/// +/// ```rust +/// #[derive(Debug, thiserror::Error)] +/// enum MyCoolError { +/// #[error("should never happen")] +/// Bad(#[source] std::io::Error), +/// } +/// +/// # fn failing_call() -> Result<(), MyCoolError> { Err(MyCoolError::Bad(std::io::ErrorKind::PermissionDenied.into())) } +/// +/// # fn main() { +/// use utils::error::report_compact_sources; +/// +/// if let Err(e) = failing_call() { +/// let e = report_compact_sources(&e); +/// assert_eq!(format!("{e}"), "should never happen: permission denied"); +/// } +/// # } +/// ``` +/// +/// ## TODO +/// +/// When we are able to describe return position impl trait in traits, this should of course be an +/// extension trait. Until then avoid boxing with this more ackward interface. +pub fn report_compact_sources(e: &E) -> impl std::fmt::Display + '_ { + struct AnyhowDisplayAlternateAlike<'a, E>(&'a E); + + impl std::fmt::Display for AnyhowDisplayAlternateAlike<'_, E> { + fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { + write!(f, "{}", self.0)?; + + // why is E a generic parameter here? hope that rustc will see through a default + // Error::source implementation and leave the following out if there cannot be any + // sources: + Sources(self.0.source()).try_for_each(|src| write!(f, ": {}", src)) + } + } + + struct Sources<'a>(Option<&'a (dyn std::error::Error + 'static)>); + + impl<'a> Iterator for Sources<'a> { + type Item = &'a (dyn std::error::Error + 'static); + + fn next(&mut self) -> Option { + let rem = self.0; + + let next = self.0.and_then(|x| x.source()); + self.0 = next; + rem + } + } + + AnyhowDisplayAlternateAlike(e) +} + +#[cfg(test)] +mod tests { + use super::report_compact_sources; + + #[test] + fn report_compact_sources_examples() { + use std::fmt::Write; + + #[derive(Debug, thiserror::Error)] + enum EvictionError { + #[error("cannot evict a remote layer")] + CannotEvictRemoteLayer, + #[error("stat failed")] + StatFailed(#[source] std::io::Error), + #[error("layer was no longer part of LayerMap")] + LayerNotFound(#[source] anyhow::Error), + } + + let examples = [ + ( + line!(), + EvictionError::CannotEvictRemoteLayer, + "cannot evict a remote layer", + ), + ( + line!(), + EvictionError::StatFailed(std::io::ErrorKind::PermissionDenied.into()), + "stat failed: permission denied", + ), + ( + line!(), + EvictionError::LayerNotFound(anyhow::anyhow!("foobar")), + "layer was no longer part of LayerMap: foobar", + ), + ]; + + let mut s = String::new(); + + for (line, example, expected) in examples { + s.clear(); + + write!(s, "{}", report_compact_sources(&example)).expect("string grows"); + + assert_eq!(s, expected, "example on line {line}"); + } + } +} diff --git a/libs/utils/src/lib.rs b/libs/utils/src/lib.rs index 3bcb092ba7..b591cc611a 100644 --- a/libs/utils/src/lib.rs +++ b/libs/utils/src/lib.rs @@ -63,6 +63,9 @@ pub mod rate_limit; /// Simple once-barrier and a guard which keeps barrier awaiting. pub mod completion; +/// Reporting utilities +pub mod error; + mod failpoint_macro_helpers { /// use with fail::cfg("$name", "return(2000)") diff --git a/pageserver/src/disk_usage_eviction_task.rs b/pageserver/src/disk_usage_eviction_task.rs index 37c52c5423..042d4c6d06 100644 --- a/pageserver/src/disk_usage_eviction_task.rs +++ b/pageserver/src/disk_usage_eviction_task.rs @@ -60,7 +60,7 @@ use utils::serde_percent::Percent; use crate::{ config::PageServerConf, task_mgr::{self, TaskKind, BACKGROUND_RUNTIME}, - tenant::{self, storage_layer::PersistentLayer, Timeline}, + tenant::{self, storage_layer::PersistentLayer, timeline::EvictionError, Timeline}, }; #[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)] @@ -390,13 +390,22 @@ pub async fn disk_usage_eviction_task_iteration_impl( assert_eq!(results.len(), batch.len()); for (result, layer) in results.into_iter().zip(batch.iter()) { match result { - Some(Ok(true)) => { + Some(Ok(())) => { usage_assumed.add_available_bytes(layer.file_size()); } - Some(Ok(false)) => { - // this is: - // - Replacement::{NotFound, Unexpected} - // - it cannot be is_remote_layer, filtered already + Some(Err(EvictionError::CannotEvictRemoteLayer)) => { + unreachable!("get_local_layers_for_disk_usage_eviction finds only local layers") + } + Some(Err(EvictionError::FileNotFound)) => { + evictions_failed.file_sizes += layer.file_size(); + evictions_failed.count += 1; + } + Some(Err( + e @ EvictionError::LayerNotFound(_) + | e @ EvictionError::StatFailed(_), + )) => { + let e = utils::error::report_compact_sources(&e); + warn!(%layer, "failed to evict layer: {e}"); evictions_failed.file_sizes += layer.file_size(); evictions_failed.count += 1; } @@ -404,10 +413,6 @@ pub async fn disk_usage_eviction_task_iteration_impl( assert!(cancel.is_cancelled()); return; } - Some(Err(e)) => { - // we really shouldn't be getting this, precondition failure - error!("failed to evict layer: {:#}", e); - } } } } diff --git a/pageserver/src/tenant.rs b/pageserver/src/tenant.rs index 379db0720f..44f1a6cd65 100644 --- a/pageserver/src/tenant.rs +++ b/pageserver/src/tenant.rs @@ -121,7 +121,7 @@ pub mod mgr; pub mod tasks; pub mod upload_queue; -mod timeline; +pub(crate) mod timeline; pub mod size; @@ -1168,7 +1168,7 @@ impl Tenant { ) } - /// Helper for unit tests to create an emtpy timeline. + /// Helper for unit tests to create an empty timeline. /// /// The timeline is has state value `Active` but its background loops are not running. // This makes the various functions which anyhow::ensure! for Active state work in tests. @@ -3359,14 +3359,18 @@ pub mod harness { pub async fn load(&self) -> (Arc, RequestContext) { let ctx = RequestContext::new(TaskKind::UnitTest, DownloadBehavior::Error); ( - self.try_load(&ctx) + self.try_load(&ctx, None) .await .expect("failed to load test tenant"), ctx, ) } - pub async fn try_load(&self, ctx: &RequestContext) -> anyhow::Result> { + pub async fn try_load( + &self, + ctx: &RequestContext, + remote_storage: Option, + ) -> anyhow::Result> { let walredo_mgr = Arc::new(TestRedoManager); let tenant = Arc::new(Tenant::new( @@ -3375,7 +3379,7 @@ pub mod harness { TenantConfOpt::from(self.tenant_conf), walredo_mgr, self.tenant_id, - None, + remote_storage, )); tenant .load(None, ctx) @@ -3913,7 +3917,11 @@ mod tests { metadata_bytes[8] ^= 1; std::fs::write(metadata_path, metadata_bytes)?; - let err = harness.try_load(&ctx).await.err().expect("should fail"); + let err = harness + .try_load(&ctx, None) + .await + .err() + .expect("should fail"); // get all the stack with all .context, not tonly the last one let message = format!("{err:#}"); let expected = "Failed to parse metadata bytes from path"; diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index 58144d9050..887deeedf0 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -1011,11 +1011,11 @@ impl Timeline { .evict_layer_batch(remote_client, &[local_layer], cancel) .await?; assert_eq!(results.len(), 1); - let result: Option> = results.into_iter().next().unwrap(); + let result: Option> = results.into_iter().next().unwrap(); match result { None => anyhow::bail!("task_mgr shutdown requested"), - Some(Ok(b)) => Ok(Some(b)), - Some(Err(e)) => Err(e), + Some(Ok(())) => Ok(Some(true)), + Some(Err(e)) => Err(anyhow::Error::new(e)), } } @@ -1024,12 +1024,12 @@ impl Timeline { /// GenericRemoteStorage reference is required as a (witness)[witness_article] for "remote storage is configured." /// /// [witness_article]: https://willcrichton.net/rust-api-type-patterns/witnesses.html - pub async fn evict_layers( + pub(crate) async fn evict_layers( &self, _: &GenericRemoteStorage, layers_to_evict: &[Arc], cancel: CancellationToken, - ) -> anyhow::Result>>> { + ) -> anyhow::Result>>> { let remote_client = self.remote_client.clone().expect( "GenericRemoteStorage is configured, so timeline must have RemoteTimelineClient", ); @@ -1064,7 +1064,7 @@ impl Timeline { remote_client: &Arc, layers_to_evict: &[Arc], cancel: CancellationToken, - ) -> anyhow::Result>>> { + ) -> anyhow::Result>>> { // ensure that the layers have finished uploading // (don't hold the layer_removal_cs while we do it, we're not removing anything yet) remote_client @@ -1110,11 +1110,9 @@ impl Timeline { _layer_removal_cs: &tokio::sync::MutexGuard<'_, ()>, local_layer: &Arc, layer_mgr: &mut LayerManager, - ) -> anyhow::Result { + ) -> Result<(), EvictionError> { if local_layer.is_remote_layer() { - // TODO(issue #3851): consider returning an err here instead of false, - // which is the same out the match later - return Ok(false); + return Err(EvictionError::CannotEvictRemoteLayer); } let layer_file_size = local_layer.file_size(); @@ -1123,13 +1121,22 @@ impl Timeline { .local_path() .expect("local layer should have a local path") .metadata() - .context("get local layer file stat")? + // when the eviction fails because we have already deleted the layer in compaction for + // example, a NotFound error bubbles up from here. + .map_err(|e| { + if e.kind() == std::io::ErrorKind::NotFound { + EvictionError::FileNotFound + } else { + EvictionError::StatFailed(e) + } + })? .modified() - .context("get mtime of layer file")?; + .map_err(EvictionError::StatFailed)?; + let local_layer_residence_duration = match SystemTime::now().duration_since(local_layer_mtime) { Err(e) => { - warn!("layer mtime is in the future: {}", e); + warn!(layer = %local_layer, "layer mtime is in the future: {}", e); None } Ok(delta) => Some(delta), @@ -1160,54 +1167,65 @@ impl Timeline { assert_eq!(local_layer.layer_desc(), new_remote_layer.layer_desc()); - let succeed = match layer_mgr.replace_and_verify(local_layer.clone(), new_remote_layer) { - Ok(()) => { - if let Err(e) = local_layer.delete_resident_layer_file() { - error!("failed to remove layer file on evict after replacement: {e:#?}"); - } - // Always decrement the physical size gauge, even if we failed to delete the file. - // Rationale: we already replaced the layer with a remote layer in the layer map, - // and any subsequent download_remote_layer will - // 1. overwrite the file on disk and - // 2. add the downloaded size to the resident size gauge. - // - // If there is no re-download, and we restart the pageserver, then load_layer_map - // will treat the file as a local layer again, count it towards resident size, - // and it'll be like the layer removal never happened. - // The bump in resident size is perhaps unexpected but overall a robust behavior. - self.metrics - .resident_physical_size_gauge - .sub(layer_file_size); + layer_mgr + .replace_and_verify(local_layer.clone(), new_remote_layer) + .map_err(EvictionError::LayerNotFound)?; - self.metrics.evictions.inc(); + if let Err(e) = local_layer.delete_resident_layer_file() { + // this should never happen, because of layer_removal_cs usage and above stat + // access for mtime + error!("failed to remove layer file on evict after replacement: {e:#?}"); + } + // Always decrement the physical size gauge, even if we failed to delete the file. + // Rationale: we already replaced the layer with a remote layer in the layer map, + // and any subsequent download_remote_layer will + // 1. overwrite the file on disk and + // 2. add the downloaded size to the resident size gauge. + // + // If there is no re-download, and we restart the pageserver, then load_layer_map + // will treat the file as a local layer again, count it towards resident size, + // and it'll be like the layer removal never happened. + // The bump in resident size is perhaps unexpected but overall a robust behavior. + self.metrics + .resident_physical_size_gauge + .sub(layer_file_size); - if let Some(delta) = local_layer_residence_duration { - self.metrics - .evictions_with_low_residence_duration - .read() - .unwrap() - .observe(delta); - info!(layer=%local_layer, residence_millis=delta.as_millis(), "evicted layer after known residence period"); - } else { - info!(layer=%local_layer, "evicted layer after unknown residence period"); - } + self.metrics.evictions.inc(); - true - } - Err(err) => { - if cfg!(debug_assertions) { - panic!("failed to replace: {err}, evicted: {local_layer:?}"); - } else { - error!(evicted=?local_layer, "failed to replace: {err}"); - } - false - } - }; + if let Some(delta) = local_layer_residence_duration { + self.metrics + .evictions_with_low_residence_duration + .read() + .unwrap() + .observe(delta); + info!(layer=%local_layer, residence_millis=delta.as_millis(), "evicted layer after known residence period"); + } else { + info!(layer=%local_layer, "evicted layer after unknown residence period"); + } - Ok(succeed) + Ok(()) } } +#[derive(Debug, thiserror::Error)] +pub(crate) enum EvictionError { + #[error("cannot evict a remote layer")] + CannotEvictRemoteLayer, + /// Most likely the to-be evicted layer has been deleted by compaction or gc which use the same + /// locks, so they got to execute before the eviction. + #[error("file backing the layer has been removed already")] + FileNotFound, + #[error("stat failed")] + StatFailed(#[source] std::io::Error), + /// In practice, this can be a number of things, but lets assume it means only this. + /// + /// This case includes situations such as the Layer was evicted and redownloaded in between, + /// because the file existed before an replacement attempt was made but now the Layers are + /// different objects in memory. + #[error("layer was no longer part of LayerMap")] + LayerNotFound(#[source] anyhow::Error), +} + /// Number of times we will compute partition within a checkpoint distance. const REPARTITION_FREQ_IN_CHECKPOINT_DISTANCE: u64 = 10; @@ -4572,6 +4590,7 @@ impl LocalLayerInfoForDiskUsageEviction { } impl Timeline { + /// Returns non-remote layers for eviction. pub(crate) async fn get_local_layers_for_disk_usage_eviction(&self) -> DiskUsageEvictionInfo { let guard = self.layers.read().await; let layers = guard.layer_map(); @@ -4741,3 +4760,180 @@ pub fn compare_arced_layers(left: &Arc, right: &Arc) -> bool { left == right } + +#[cfg(test)] +mod tests { + use std::sync::Arc; + + use utils::{id::TimelineId, lsn::Lsn}; + + use crate::tenant::{harness::TenantHarness, storage_layer::PersistentLayer}; + + use super::{EvictionError, Timeline}; + + #[tokio::test] + async fn two_layer_eviction_attempts_at_the_same_time() { + let harness = + TenantHarness::create("two_layer_eviction_attempts_at_the_same_time").unwrap(); + + let remote_storage = { + // this is never used for anything, because of how the create_test_timeline works, but + // it is with us in spirit and a Some. + use remote_storage::{GenericRemoteStorage, RemoteStorageConfig, RemoteStorageKind}; + let path = harness.conf.workdir.join("localfs"); + std::fs::create_dir_all(&path).unwrap(); + let config = RemoteStorageConfig { + max_concurrent_syncs: std::num::NonZeroUsize::new(2_000_000).unwrap(), + max_sync_errors: std::num::NonZeroU32::new(3_000_000).unwrap(), + storage: RemoteStorageKind::LocalFs(path), + }; + GenericRemoteStorage::from_config(&config).unwrap() + }; + + let ctx = any_context(); + let tenant = harness.try_load(&ctx, Some(remote_storage)).await.unwrap(); + let timeline = tenant + .create_test_timeline(TimelineId::generate(), Lsn(0x10), 14, &ctx) + .await + .unwrap(); + + let rc = timeline + .remote_client + .clone() + .expect("just configured this"); + + let layer = find_some_layer(&timeline).await; + + let cancel = tokio_util::sync::CancellationToken::new(); + let batch = [layer]; + + let first = { + let cancel = cancel.clone(); + async { + timeline + .evict_layer_batch(&rc, &batch, cancel) + .await + .unwrap() + } + }; + let second = async { + timeline + .evict_layer_batch(&rc, &batch, cancel) + .await + .unwrap() + }; + + let (first, second) = tokio::join!(first, second); + + let (first, second) = (only_one(first), only_one(second)); + + match (first, second) { + (Ok(()), Err(EvictionError::FileNotFound)) + | (Err(EvictionError::FileNotFound), Ok(())) => { + // one of the evictions gets to do it, + // other one gets FileNotFound. all is good. + } + other => unreachable!("unexpected {:?}", other), + } + } + + #[tokio::test] + async fn layer_eviction_aba_fails() { + let harness = + TenantHarness::create("two_layer_eviction_attempts_at_the_same_time").unwrap(); + + let remote_storage = { + // this is never used for anything, because of how the create_test_timeline works, but + // it is with us in spirit and a Some. + use remote_storage::{GenericRemoteStorage, RemoteStorageConfig, RemoteStorageKind}; + let path = harness.conf.workdir.join("localfs"); + std::fs::create_dir_all(&path).unwrap(); + let config = RemoteStorageConfig { + max_concurrent_syncs: std::num::NonZeroUsize::new(2_000_000).unwrap(), + max_sync_errors: std::num::NonZeroU32::new(3_000_000).unwrap(), + storage: RemoteStorageKind::LocalFs(path), + }; + GenericRemoteStorage::from_config(&config).unwrap() + }; + + let ctx = any_context(); + let tenant = harness.try_load(&ctx, Some(remote_storage)).await.unwrap(); + let timeline = tenant + .create_test_timeline(TimelineId::generate(), Lsn(0x10), 14, &ctx) + .await + .unwrap(); + + let _e = tracing::info_span!("foobar", tenant_id = %tenant.tenant_id, timeline_id = %timeline.timeline_id).entered(); + + let rc = timeline.remote_client.clone().unwrap(); + + // TenantHarness allows uploads to happen given GenericRemoteStorage is configured + let layer = find_some_layer(&timeline).await; + + let cancel = tokio_util::sync::CancellationToken::new(); + let batch = [layer]; + + let first = { + let cancel = cancel.clone(); + async { + timeline + .evict_layer_batch(&rc, &batch, cancel) + .await + .unwrap() + } + }; + + // lets imagine this is stuck somehow, still referencing the original `Arc` + let second = { + let cancel = cancel.clone(); + async { + timeline + .evict_layer_batch(&rc, &batch, cancel) + .await + .unwrap() + } + }; + + // while it's stuck, we evict and end up redownloading it + only_one(first.await).expect("eviction succeeded"); + + let layer = find_some_layer(&timeline).await; + let layer = layer.downcast_remote_layer().unwrap(); + timeline.download_remote_layer(layer).await.unwrap(); + + let res = only_one(second.await); + + assert!( + matches!(res, Err(EvictionError::LayerNotFound(_))), + "{res:?}" + ); + + // no more specific asserting, outside of preconds this is the only valid replacement + // failure + } + + fn any_context() -> crate::context::RequestContext { + use crate::context::*; + use crate::task_mgr::*; + RequestContext::new(TaskKind::UnitTest, DownloadBehavior::Error) + } + + fn only_one(mut input: Vec>) -> T { + assert_eq!(1, input.len()); + input + .pop() + .expect("length just checked") + .expect("no cancellation") + } + + async fn find_some_layer(timeline: &Timeline) -> Arc { + let layers = timeline.layers.read().await; + let desc = layers + .layer_map() + .iter_historic_layers() + .next() + .expect("must find one layer to evict"); + + layers.get_from_desc(&desc) + } +} diff --git a/pageserver/src/tenant/timeline/eviction_task.rs b/pageserver/src/tenant/timeline/eviction_task.rs index a5f570d942..5485cc42b4 100644 --- a/pageserver/src/tenant/timeline/eviction_task.rs +++ b/pageserver/src/tenant/timeline/eviction_task.rs @@ -30,6 +30,7 @@ use crate::{ tenant::{ config::{EvictionPolicy, EvictionPolicyLayerAccessThreshold}, storage_layer::PersistentLayer, + timeline::EvictionError, LogicalSizeCalculationCause, Tenant, }, }; @@ -270,20 +271,22 @@ impl Timeline { None => { stats.skipped_for_shutdown += 1; } - Some(Ok(true)) => { - debug!("evicted layer {l:?}"); + Some(Ok(())) => { stats.evicted += 1; } - Some(Ok(false)) => { - debug!("layer is not evictable: {l:?}"); + Some(Err(EvictionError::CannotEvictRemoteLayer)) => { stats.not_evictable += 1; } - Some(Err(e)) => { - // This variant is the case where an unexpected error happened during eviction. - // Expected errors that result in non-eviction are `Some(Ok(false))`. - // So, dump Debug here to gather as much info as possible in this rare case. - warn!("failed to evict layer {l:?}: {e:?}"); - stats.errors += 1; + Some(Err(EvictionError::FileNotFound)) => { + // compaction/gc removed the file while we were waiting on layer_removal_cs + stats.not_evictable += 1; + } + Some(Err( + e @ EvictionError::LayerNotFound(_) | e @ EvictionError::StatFailed(_), + )) => { + let e = utils::error::report_compact_sources(&e); + warn!(layer = %l, "failed to evict layer: {e}"); + stats.not_evictable += 1; } } } From 89746a48c63715753fe8f68e471c9bdfb9516d24 Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Thu, 20 Jul 2023 19:55:40 +0300 Subject: [PATCH 52/58] chore: fix copypaste caused flakyness (#4763) I introduced a copypaste error leading to flaky [test failure][report] in #4737. Solution is to use correct/unique test name. I also looked into providing a proper fn name via macro but ... Yeah, it's probably not a great idea. [report]: https://github.com/neondatabase/neon/actions/runs/5612473297/job/15206293430#step:15:197 --- pageserver/src/tenant/timeline.rs | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index 887deeedf0..e5fedeb73e 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -4839,8 +4839,7 @@ mod tests { #[tokio::test] async fn layer_eviction_aba_fails() { - let harness = - TenantHarness::create("two_layer_eviction_attempts_at_the_same_time").unwrap(); + let harness = TenantHarness::create("layer_eviction_aba_fails").unwrap(); let remote_storage = { // this is never used for anything, because of how the create_test_timeline works, but From 3fc3666df73f3d148973831762bf87508a92d3e3 Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Thu, 20 Jul 2023 13:39:19 -0400 Subject: [PATCH 53/58] make flush frozen layer an atomic operation (#4720) ## Problem close https://github.com/neondatabase/neon/issues/4712 ## Summary of changes Previously, when flushing frozen layers, it was split into two operations: add delta layer to disk + remove frozen layer from memory. This would cause a short period of time where we will have the same data both in frozen and delta layer. In this PR, we merge them into one atomic operation in layer map manager, therefore simplifying the code. Note that if we decide to create image layers for L0 flush, it will still be split into two operations on layer map. --------- Signed-off-by: Alex Chi Z Co-authored-by: Joonas Koivunen --- pageserver/src/tenant/timeline.rs | 83 ++++++++++--------- .../src/tenant/timeline/layer_manager.rs | 19 ++++- test_runner/regress/test_ancestor_branch.py | 2 +- test_runner/regress/test_recovery.py | 4 +- test_runner/regress/test_remote_storage.py | 4 +- 5 files changed, 64 insertions(+), 48 deletions(-) diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index e5fedeb73e..c6ceae500b 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -2703,7 +2703,7 @@ impl Timeline { // files instead. This is possible as long as *all* the data imported into the // repository have the same LSN. let lsn_range = frozen_layer.get_lsn_range(); - let layer_paths_to_upload = + let (layer_paths_to_upload, delta_layer_to_add) = if lsn_range.start == self.initdb_lsn && lsn_range.end == Lsn(self.initdb_lsn.0 + 1) { #[cfg(test)] match &mut *self.flush_loop_state.lock().unwrap() { @@ -2722,8 +2722,12 @@ impl Timeline { let (partitioning, _lsn) = self .repartition(self.initdb_lsn, self.get_compaction_target_size(), ctx) .await?; - self.create_image_layers(&partitioning, self.initdb_lsn, true, ctx) - .await? + // For image layers, we add them immediately into the layer map. + ( + self.create_image_layers(&partitioning, self.initdb_lsn, true, ctx) + .await?, + None, + ) } else { #[cfg(test)] match &mut *self.flush_loop_state.lock().unwrap() { @@ -2737,35 +2741,50 @@ impl Timeline { assert!(!*expect_initdb_optimization, "expected initdb optimization"); } } - // normal case, write out a L0 delta layer file. - let (delta_path, metadata) = self.create_delta_layer(&frozen_layer).await?; - HashMap::from([(delta_path, metadata)]) + // Normal case, write out a L0 delta layer file. + // `create_delta_layer` will not modify the layer map. + // We will remove frozen layer and add delta layer in one atomic operation later. + let layer = self.create_delta_layer(&frozen_layer).await?; + ( + HashMap::from([(layer.filename(), LayerFileMetadata::new(layer.file_size()))]), + Some(layer), + ) }; - // FIXME: between create_delta_layer and the scheduling of the upload in `update_metadata_file`, - // a compaction can delete the file and then it won't be available for uploads any more. - // We still schedule the upload, resulting in an error, but ideally we'd somehow avoid this - // race situation. - // See https://github.com/neondatabase/neon/issues/4526 - - pausable_failpoint!("flush-frozen-before-sync"); - // The new on-disk layers are now in the layer map. We can remove the // in-memory layer from the map now. The flushed layer is stored in // the mapping in `create_delta_layer`. { let mut guard = self.layers.write().await; - let l = guard.layer_map_mut().frozen_layers.pop_front(); - // Only one thread may call this function at a time (for this - // timeline). If two threads tried to flush the same frozen - // layer to disk at the same time, that would not work. - assert!(compare_arced_layers(&l.unwrap(), &frozen_layer)); + if let Some(ref l) = delta_layer_to_add { + // TODO: move access stats, metrics update, etc. into layer manager. + l.access_stats().record_residence_event( + &guard, + LayerResidenceStatus::Resident, + LayerResidenceEventReason::LayerCreate, + ); + // update metrics + let sz = l.file_size(); + self.metrics.resident_physical_size_gauge.add(sz); + self.metrics.num_persistent_files_created.inc_by(1); + self.metrics.persistent_bytes_written.inc_by(sz); + } + + guard.finish_flush_l0_layer(delta_layer_to_add, &frozen_layer); // release lock on 'layers' } - fail_point!("checkpoint-after-sync"); + // FIXME: between create_delta_layer and the scheduling of the upload in `update_metadata_file`, + // a compaction can delete the file and then it won't be available for uploads any more. + // We still schedule the upload, resulting in an error, but ideally we'd somehow avoid this + // race situation. + // See https://github.com/neondatabase/neon/issues/4526 + pausable_failpoint!("flush-frozen-pausable"); + + // This failpoint is used by another test case `test_pageserver_recovery`. + fail_point!("flush-frozen-exit"); // Update the metadata file, with new 'disk_consistent_lsn' // @@ -2847,11 +2866,12 @@ impl Timeline { Ok(()) } - // Write out the given frozen in-memory layer as a new L0 delta file + // Write out the given frozen in-memory layer as a new L0 delta file. This L0 file will not be tracked + // in layer map immediately. The caller is responsible to put it into the layer map. async fn create_delta_layer( self: &Arc, frozen_layer: &Arc, - ) -> anyhow::Result<(LayerFileName, LayerFileMetadata)> { + ) -> anyhow::Result { let span = tracing::info_span!("blocking"); let new_delta: DeltaLayer = tokio::task::spawn_blocking({ let _g = span.entered(); @@ -2888,25 +2908,8 @@ impl Timeline { }) .await .context("spawn_blocking")??; - let new_delta_name = new_delta.filename(); - let sz = new_delta.desc.file_size; - // Add it to the layer map - let l = Arc::new(new_delta); - let mut guard = self.layers.write().await; - l.access_stats().record_residence_event( - &guard, - LayerResidenceStatus::Resident, - LayerResidenceEventReason::LayerCreate, - ); - guard.track_new_l0_delta_layer(l); - - // update metrics - self.metrics.resident_physical_size_gauge.add(sz); - self.metrics.num_persistent_files_created.inc_by(1); - self.metrics.persistent_bytes_written.inc_by(sz); - - Ok((new_delta_name, LayerFileMetadata::new(sz))) + Ok(new_delta) } async fn repartition( diff --git a/pageserver/src/tenant/timeline/layer_manager.rs b/pageserver/src/tenant/timeline/layer_manager.rs index 77f5f38314..f6f0d533d1 100644 --- a/pageserver/src/tenant/timeline/layer_manager.rs +++ b/pageserver/src/tenant/timeline/layer_manager.rs @@ -194,10 +194,23 @@ impl LayerManager { updates.flush(); } - /// Insert into the layer map when a new delta layer is created, called from `create_delta_layer`. - pub fn track_new_l0_delta_layer(&mut self, delta_layer: Arc) { + /// Flush a frozen layer and add the written delta layer to the layer map. + pub fn finish_flush_l0_layer( + &mut self, + delta_layer: Option, + frozen_layer_for_check: &Arc, + ) { + let l = self.layer_map.frozen_layers.pop_front(); let mut updates = self.layer_map.batch_update(); - Self::insert_historic_layer(delta_layer, &mut updates, &mut self.layer_fmgr); + + // Only one thread may call this function at a time (for this + // timeline). If two threads tried to flush the same frozen + // layer to disk at the same time, that would not work. + assert!(compare_arced_layers(&l.unwrap(), frozen_layer_for_check)); + + if let Some(delta_layer) = delta_layer { + Self::insert_historic_layer(Arc::new(delta_layer), &mut updates, &mut self.layer_fmgr); + } updates.flush(); } diff --git a/test_runner/regress/test_ancestor_branch.py b/test_runner/regress/test_ancestor_branch.py index e8c1a2f34c..0e390ba9e5 100644 --- a/test_runner/regress/test_ancestor_branch.py +++ b/test_runner/regress/test_ancestor_branch.py @@ -20,7 +20,7 @@ def test_ancestor_branch(neon_env_builder: NeonEnvBuilder): } ) - pageserver_http.configure_failpoints(("flush-frozen-before-sync", "sleep(10000)")) + pageserver_http.configure_failpoints(("flush-frozen-pausable", "sleep(10000)")) endpoint_branch0 = env.endpoints.create_start("main", tenant_id=tenant) branch0_cur = endpoint_branch0.connect().cursor() diff --git a/test_runner/regress/test_recovery.py b/test_runner/regress/test_recovery.py index 76e97a35a4..552825cf08 100644 --- a/test_runner/regress/test_recovery.py +++ b/test_runner/regress/test_recovery.py @@ -38,8 +38,8 @@ def test_pageserver_recovery(neon_env_builder: NeonEnvBuilder): # Configure failpoints pageserver_http.configure_failpoints( [ - ("flush-frozen-before-sync", "sleep(2000)"), - ("checkpoint-after-sync", "exit"), + ("flush-frozen-pausable", "sleep(2000)"), + ("flush-frozen-exit", "exit"), ] ) diff --git a/test_runner/regress/test_remote_storage.py b/test_runner/regress/test_remote_storage.py index 13bc01f609..f1575ae4d3 100644 --- a/test_runner/regress/test_remote_storage.py +++ b/test_runner/regress/test_remote_storage.py @@ -815,7 +815,7 @@ def test_compaction_delete_before_upload( wait_for_last_flush_lsn(env, endpoint, tenant_id, timeline_id) # Now make the flushing hang and update one small piece of data - client.configure_failpoints(("flush-frozen-before-sync", "pause")) + client.configure_failpoints(("flush-frozen-pausable", "pause")) endpoint.safe_psql("UPDATE foo SET x = 0 WHERE x = 1") @@ -841,7 +841,7 @@ def test_compaction_delete_before_upload( time.sleep(4) client.timeline_compact(tenant_id, timeline_id) - client.configure_failpoints(("flush-frozen-before-sync", "off")) + client.configure_failpoints(("flush-frozen-pausable", "off")) conflict = q.get() From 8d0f4a785742405a8ca34de01933981d100ee5bf Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Thu, 20 Jul 2023 22:33:50 +0300 Subject: [PATCH 54/58] Bump aiohttp from 3.7.4 to 3.8.5 (#4762) --- poetry.lock | 240 +++++++++++++++++++++++++++++++++++++------------ pyproject.toml | 2 +- 2 files changed, 183 insertions(+), 59 deletions(-) diff --git a/poetry.lock b/poetry.lock index b22a6a5bc9..a8ea410734 100644 --- a/poetry.lock +++ b/poetry.lock @@ -2,60 +2,111 @@ [[package]] name = "aiohttp" -version = "3.7.4" +version = "3.8.5" description = "Async http client/server framework (asyncio)" optional = false python-versions = ">=3.6" files = [ - {file = "aiohttp-3.7.4-cp36-cp36m-macosx_10_14_x86_64.whl", hash = "sha256:6c8200abc9dc5f27203986100579fc19ccad7a832c07d2bc151ce4ff17190076"}, - {file = "aiohttp-3.7.4-cp36-cp36m-manylinux1_i686.whl", hash = "sha256:dd7936f2a6daa861143e376b3a1fb56e9b802f4980923594edd9ca5670974895"}, - {file = "aiohttp-3.7.4-cp36-cp36m-manylinux2014_aarch64.whl", hash = "sha256:bc3d14bf71a3fb94e5acf5bbf67331ab335467129af6416a437bd6024e4f743d"}, - {file = "aiohttp-3.7.4-cp36-cp36m-manylinux2014_i686.whl", hash = "sha256:8ec1a38074f68d66ccb467ed9a673a726bb397142c273f90d4ba954666e87d54"}, - {file = "aiohttp-3.7.4-cp36-cp36m-manylinux2014_ppc64le.whl", hash = "sha256:b84ad94868e1e6a5e30d30ec419956042815dfaea1b1df1cef623e4564c374d9"}, - {file = "aiohttp-3.7.4-cp36-cp36m-manylinux2014_s390x.whl", hash = "sha256:d5d102e945ecca93bcd9801a7bb2fa703e37ad188a2f81b1e65e4abe4b51b00c"}, - {file = "aiohttp-3.7.4-cp36-cp36m-manylinux2014_x86_64.whl", hash = "sha256:c2a80fd9a8d7e41b4e38ea9fe149deed0d6aaede255c497e66b8213274d6d61b"}, - {file = "aiohttp-3.7.4-cp36-cp36m-win32.whl", hash = "sha256:481d4b96969fbfdcc3ff35eea5305d8565a8300410d3d269ccac69e7256b1329"}, - {file = "aiohttp-3.7.4-cp36-cp36m-win_amd64.whl", hash = "sha256:16d0683ef8a6d803207f02b899c928223eb219111bd52420ef3d7a8aa76227b6"}, - {file = "aiohttp-3.7.4-cp37-cp37m-macosx_10_14_x86_64.whl", hash = "sha256:eab51036cac2da8a50d7ff0ea30be47750547c9aa1aa2cf1a1b710a1827e7dbe"}, - {file = "aiohttp-3.7.4-cp37-cp37m-manylinux1_i686.whl", hash = "sha256:feb24ff1226beeb056e247cf2e24bba5232519efb5645121c4aea5b6ad74c1f2"}, - {file = "aiohttp-3.7.4-cp37-cp37m-manylinux2014_aarch64.whl", hash = "sha256:119feb2bd551e58d83d1b38bfa4cb921af8ddedec9fad7183132db334c3133e0"}, - {file = "aiohttp-3.7.4-cp37-cp37m-manylinux2014_i686.whl", hash = "sha256:6ca56bdfaf825f4439e9e3673775e1032d8b6ea63b8953d3812c71bd6a8b81de"}, - {file = "aiohttp-3.7.4-cp37-cp37m-manylinux2014_ppc64le.whl", hash = "sha256:5563ad7fde451b1986d42b9bb9140e2599ecf4f8e42241f6da0d3d624b776f40"}, - {file = "aiohttp-3.7.4-cp37-cp37m-manylinux2014_s390x.whl", hash = "sha256:62bc216eafac3204877241569209d9ba6226185aa6d561c19159f2e1cbb6abfb"}, - {file = "aiohttp-3.7.4-cp37-cp37m-manylinux2014_x86_64.whl", hash = "sha256:f4496d8d04da2e98cc9133e238ccebf6a13ef39a93da2e87146c8c8ac9768242"}, - {file = "aiohttp-3.7.4-cp37-cp37m-win32.whl", hash = "sha256:2ffea7904e70350da429568113ae422c88d2234ae776519549513c8f217f58a9"}, - {file = "aiohttp-3.7.4-cp37-cp37m-win_amd64.whl", hash = "sha256:5e91e927003d1ed9283dee9abcb989334fc8e72cf89ebe94dc3e07e3ff0b11e9"}, - {file = "aiohttp-3.7.4-cp38-cp38-macosx_10_14_x86_64.whl", hash = "sha256:4c1bdbfdd231a20eee3e56bd0ac1cd88c4ff41b64ab679ed65b75c9c74b6c5c2"}, - {file = "aiohttp-3.7.4-cp38-cp38-manylinux1_i686.whl", hash = "sha256:71680321a8a7176a58dfbc230789790639db78dad61a6e120b39f314f43f1907"}, - {file = "aiohttp-3.7.4-cp38-cp38-manylinux2014_aarch64.whl", hash = "sha256:7dbd087ff2f4046b9b37ba28ed73f15fd0bc9f4fdc8ef6781913da7f808d9536"}, - {file = "aiohttp-3.7.4-cp38-cp38-manylinux2014_i686.whl", hash = "sha256:dee68ec462ff10c1d836c0ea2642116aba6151c6880b688e56b4c0246770f297"}, - {file = "aiohttp-3.7.4-cp38-cp38-manylinux2014_ppc64le.whl", hash = "sha256:99c5a5bf7135607959441b7d720d96c8e5c46a1f96e9d6d4c9498be8d5f24212"}, - {file = "aiohttp-3.7.4-cp38-cp38-manylinux2014_s390x.whl", hash = "sha256:5dde6d24bacac480be03f4f864e9a67faac5032e28841b00533cd168ab39cad9"}, - {file = "aiohttp-3.7.4-cp38-cp38-manylinux2014_x86_64.whl", hash = "sha256:418597633b5cd9639e514b1d748f358832c08cd5d9ef0870026535bd5eaefdd0"}, - {file = "aiohttp-3.7.4-cp38-cp38-win32.whl", hash = "sha256:e76e78863a4eaec3aee5722d85d04dcbd9844bc6cd3bfa6aa880ff46ad16bfcb"}, - {file = "aiohttp-3.7.4-cp38-cp38-win_amd64.whl", hash = "sha256:950b7ef08b2afdab2488ee2edaff92a03ca500a48f1e1aaa5900e73d6cf992bc"}, - {file = "aiohttp-3.7.4-cp39-cp39-macosx_10_14_x86_64.whl", hash = "sha256:2eb3efe243e0f4ecbb654b08444ae6ffab37ac0ef8f69d3a2ffb958905379daf"}, - {file = "aiohttp-3.7.4-cp39-cp39-manylinux1_i686.whl", hash = "sha256:822bd4fd21abaa7b28d65fc9871ecabaddc42767884a626317ef5b75c20e8a2d"}, - {file = "aiohttp-3.7.4-cp39-cp39-manylinux2014_aarch64.whl", hash = "sha256:58c62152c4c8731a3152e7e650b29ace18304d086cb5552d317a54ff2749d32a"}, - {file = "aiohttp-3.7.4-cp39-cp39-manylinux2014_i686.whl", hash = "sha256:7c7820099e8b3171e54e7eedc33e9450afe7cd08172632d32128bd527f8cb77d"}, - {file = "aiohttp-3.7.4-cp39-cp39-manylinux2014_ppc64le.whl", hash = "sha256:5b50e0b9460100fe05d7472264d1975f21ac007b35dcd6fd50279b72925a27f4"}, - {file = "aiohttp-3.7.4-cp39-cp39-manylinux2014_s390x.whl", hash = "sha256:c44d3c82a933c6cbc21039326767e778eface44fca55c65719921c4b9661a3f7"}, - {file = "aiohttp-3.7.4-cp39-cp39-manylinux2014_x86_64.whl", hash = "sha256:cc31e906be1cc121ee201adbdf844522ea3349600dd0a40366611ca18cd40e81"}, - {file = "aiohttp-3.7.4-cp39-cp39-win32.whl", hash = "sha256:fbd3b5e18d34683decc00d9a360179ac1e7a320a5fee10ab8053ffd6deab76e0"}, - {file = "aiohttp-3.7.4-cp39-cp39-win_amd64.whl", hash = "sha256:40bd1b101b71a18a528ffce812cc14ff77d4a2a1272dfb8b11b200967489ef3e"}, - {file = "aiohttp-3.7.4.tar.gz", hash = "sha256:5d84ecc73141d0a0d61ece0742bb7ff5751b0657dab8405f899d3ceb104cc7de"}, + {file = "aiohttp-3.8.5-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:a94159871304770da4dd371f4291b20cac04e8c94f11bdea1c3478e557fbe0d8"}, + {file = "aiohttp-3.8.5-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:13bf85afc99ce6f9ee3567b04501f18f9f8dbbb2ea11ed1a2e079670403a7c84"}, + {file = "aiohttp-3.8.5-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:2ce2ac5708501afc4847221a521f7e4b245abf5178cf5ddae9d5b3856ddb2f3a"}, + {file = "aiohttp-3.8.5-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:96943e5dcc37a6529d18766597c491798b7eb7a61d48878611298afc1fca946c"}, + {file = "aiohttp-3.8.5-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:2ad5c3c4590bb3cc28b4382f031f3783f25ec223557124c68754a2231d989e2b"}, + {file = "aiohttp-3.8.5-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0c413c633d0512df4dc7fd2373ec06cc6a815b7b6d6c2f208ada7e9e93a5061d"}, + {file = "aiohttp-3.8.5-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:df72ac063b97837a80d80dec8d54c241af059cc9bb42c4de68bd5b61ceb37caa"}, + {file = "aiohttp-3.8.5-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c48c5c0271149cfe467c0ff8eb941279fd6e3f65c9a388c984e0e6cf57538e14"}, + {file = "aiohttp-3.8.5-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:368a42363c4d70ab52c2c6420a57f190ed3dfaca6a1b19afda8165ee16416a82"}, + {file = "aiohttp-3.8.5-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:7607ec3ce4993464368505888af5beb446845a014bc676d349efec0e05085905"}, + {file = "aiohttp-3.8.5-cp310-cp310-musllinux_1_1_ppc64le.whl", hash = "sha256:0d21c684808288a98914e5aaf2a7c6a3179d4df11d249799c32d1808e79503b5"}, + {file = "aiohttp-3.8.5-cp310-cp310-musllinux_1_1_s390x.whl", hash = "sha256:312fcfbacc7880a8da0ae8b6abc6cc7d752e9caa0051a53d217a650b25e9a691"}, + {file = "aiohttp-3.8.5-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:ad093e823df03bb3fd37e7dec9d4670c34f9e24aeace76808fc20a507cace825"}, + {file = "aiohttp-3.8.5-cp310-cp310-win32.whl", hash = "sha256:33279701c04351a2914e1100b62b2a7fdb9a25995c4a104259f9a5ead7ed4802"}, + {file = "aiohttp-3.8.5-cp310-cp310-win_amd64.whl", hash = "sha256:6e4a280e4b975a2e7745573e3fc9c9ba0d1194a3738ce1cbaa80626cc9b4f4df"}, + {file = "aiohttp-3.8.5-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:ae871a964e1987a943d83d6709d20ec6103ca1eaf52f7e0d36ee1b5bebb8b9b9"}, + {file = "aiohttp-3.8.5-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:461908b2578955045efde733719d62f2b649c404189a09a632d245b445c9c975"}, + {file = "aiohttp-3.8.5-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:72a860c215e26192379f57cae5ab12b168b75db8271f111019509a1196dfc780"}, + {file = "aiohttp-3.8.5-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cc14be025665dba6202b6a71cfcdb53210cc498e50068bc088076624471f8bb9"}, + {file = "aiohttp-3.8.5-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:8af740fc2711ad85f1a5c034a435782fbd5b5f8314c9a3ef071424a8158d7f6b"}, + {file = "aiohttp-3.8.5-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:841cd8233cbd2111a0ef0a522ce016357c5e3aff8a8ce92bcfa14cef890d698f"}, + {file = "aiohttp-3.8.5-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5ed1c46fb119f1b59304b5ec89f834f07124cd23ae5b74288e364477641060ff"}, + {file = "aiohttp-3.8.5-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:84f8ae3e09a34f35c18fa57f015cc394bd1389bce02503fb30c394d04ee6b938"}, + {file = "aiohttp-3.8.5-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:62360cb771707cb70a6fd114b9871d20d7dd2163a0feafe43fd115cfe4fe845e"}, + {file = "aiohttp-3.8.5-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:23fb25a9f0a1ca1f24c0a371523546366bb642397c94ab45ad3aedf2941cec6a"}, + {file = "aiohttp-3.8.5-cp311-cp311-musllinux_1_1_ppc64le.whl", hash = "sha256:b0ba0d15164eae3d878260d4c4df859bbdc6466e9e6689c344a13334f988bb53"}, + {file = "aiohttp-3.8.5-cp311-cp311-musllinux_1_1_s390x.whl", hash = "sha256:5d20003b635fc6ae3f96d7260281dfaf1894fc3aa24d1888a9b2628e97c241e5"}, + {file = "aiohttp-3.8.5-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:0175d745d9e85c40dcc51c8f88c74bfbaef9e7afeeeb9d03c37977270303064c"}, + {file = "aiohttp-3.8.5-cp311-cp311-win32.whl", hash = "sha256:2e1b1e51b0774408f091d268648e3d57f7260c1682e7d3a63cb00d22d71bb945"}, + {file = "aiohttp-3.8.5-cp311-cp311-win_amd64.whl", hash = "sha256:043d2299f6dfdc92f0ac5e995dfc56668e1587cea7f9aa9d8a78a1b6554e5755"}, + {file = "aiohttp-3.8.5-cp36-cp36m-macosx_10_9_x86_64.whl", hash = "sha256:cae533195e8122584ec87531d6df000ad07737eaa3c81209e85c928854d2195c"}, + {file = "aiohttp-3.8.5-cp36-cp36m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4f21e83f355643c345177a5d1d8079f9f28b5133bcd154193b799d380331d5d3"}, + {file = "aiohttp-3.8.5-cp36-cp36m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:a7a75ef35f2df54ad55dbf4b73fe1da96f370e51b10c91f08b19603c64004acc"}, + {file = "aiohttp-3.8.5-cp36-cp36m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:2e2e9839e14dd5308ee773c97115f1e0a1cb1d75cbeeee9f33824fa5144c7634"}, + {file = "aiohttp-3.8.5-cp36-cp36m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c44e65da1de4403d0576473e2344828ef9c4c6244d65cf4b75549bb46d40b8dd"}, + {file = "aiohttp-3.8.5-cp36-cp36m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:78d847e4cde6ecc19125ccbc9bfac4a7ab37c234dd88fbb3c5c524e8e14da543"}, + {file = "aiohttp-3.8.5-cp36-cp36m-musllinux_1_1_aarch64.whl", hash = "sha256:c7a815258e5895d8900aec4454f38dca9aed71085f227537208057853f9d13f2"}, + {file = "aiohttp-3.8.5-cp36-cp36m-musllinux_1_1_i686.whl", hash = "sha256:8b929b9bd7cd7c3939f8bcfffa92fae7480bd1aa425279d51a89327d600c704d"}, + {file = "aiohttp-3.8.5-cp36-cp36m-musllinux_1_1_ppc64le.whl", hash = "sha256:5db3a5b833764280ed7618393832e0853e40f3d3e9aa128ac0ba0f8278d08649"}, + {file = "aiohttp-3.8.5-cp36-cp36m-musllinux_1_1_s390x.whl", hash = "sha256:a0215ce6041d501f3155dc219712bc41252d0ab76474615b9700d63d4d9292af"}, + {file = "aiohttp-3.8.5-cp36-cp36m-musllinux_1_1_x86_64.whl", hash = "sha256:fd1ed388ea7fbed22c4968dd64bab0198de60750a25fe8c0c9d4bef5abe13824"}, + {file = "aiohttp-3.8.5-cp36-cp36m-win32.whl", hash = "sha256:6e6783bcc45f397fdebc118d772103d751b54cddf5b60fbcc958382d7dd64f3e"}, + {file = "aiohttp-3.8.5-cp36-cp36m-win_amd64.whl", hash = "sha256:b5411d82cddd212644cf9360879eb5080f0d5f7d809d03262c50dad02f01421a"}, + {file = "aiohttp-3.8.5-cp37-cp37m-macosx_10_9_x86_64.whl", hash = "sha256:01d4c0c874aa4ddfb8098e85d10b5e875a70adc63db91f1ae65a4b04d3344cda"}, + {file = "aiohttp-3.8.5-cp37-cp37m-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e5980a746d547a6ba173fd5ee85ce9077e72d118758db05d229044b469d9029a"}, + {file = "aiohttp-3.8.5-cp37-cp37m-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:2a482e6da906d5e6e653be079b29bc173a48e381600161c9932d89dfae5942ef"}, + {file = "aiohttp-3.8.5-cp37-cp37m-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:80bd372b8d0715c66c974cf57fe363621a02f359f1ec81cba97366948c7fc873"}, + {file = "aiohttp-3.8.5-cp37-cp37m-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c1161b345c0a444ebcf46bf0a740ba5dcf50612fd3d0528883fdc0eff578006a"}, + {file = "aiohttp-3.8.5-cp37-cp37m-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:cd56db019015b6acfaaf92e1ac40eb8434847d9bf88b4be4efe5bfd260aee692"}, + {file = "aiohttp-3.8.5-cp37-cp37m-musllinux_1_1_aarch64.whl", hash = "sha256:153c2549f6c004d2754cc60603d4668899c9895b8a89397444a9c4efa282aaf4"}, + {file = "aiohttp-3.8.5-cp37-cp37m-musllinux_1_1_i686.whl", hash = "sha256:4a01951fabc4ce26ab791da5f3f24dca6d9a6f24121746eb19756416ff2d881b"}, + {file = "aiohttp-3.8.5-cp37-cp37m-musllinux_1_1_ppc64le.whl", hash = "sha256:bfb9162dcf01f615462b995a516ba03e769de0789de1cadc0f916265c257e5d8"}, + {file = "aiohttp-3.8.5-cp37-cp37m-musllinux_1_1_s390x.whl", hash = "sha256:7dde0009408969a43b04c16cbbe252c4f5ef4574ac226bc8815cd7342d2028b6"}, + {file = "aiohttp-3.8.5-cp37-cp37m-musllinux_1_1_x86_64.whl", hash = "sha256:4149d34c32f9638f38f544b3977a4c24052042affa895352d3636fa8bffd030a"}, + {file = "aiohttp-3.8.5-cp37-cp37m-win32.whl", hash = "sha256:68c5a82c8779bdfc6367c967a4a1b2aa52cd3595388bf5961a62158ee8a59e22"}, + {file = "aiohttp-3.8.5-cp37-cp37m-win_amd64.whl", hash = "sha256:2cf57fb50be5f52bda004b8893e63b48530ed9f0d6c96c84620dc92fe3cd9b9d"}, + {file = "aiohttp-3.8.5-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:eca4bf3734c541dc4f374ad6010a68ff6c6748f00451707f39857f429ca36ced"}, + {file = "aiohttp-3.8.5-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:1274477e4c71ce8cfe6c1ec2f806d57c015ebf84d83373676036e256bc55d690"}, + {file = "aiohttp-3.8.5-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:28c543e54710d6158fc6f439296c7865b29e0b616629767e685a7185fab4a6b9"}, + {file = "aiohttp-3.8.5-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:910bec0c49637d213f5d9877105d26e0c4a4de2f8b1b29405ff37e9fc0ad52b8"}, + {file = "aiohttp-3.8.5-cp38-cp38-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5443910d662db951b2e58eb70b0fbe6b6e2ae613477129a5805d0b66c54b6cb7"}, + {file = "aiohttp-3.8.5-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:2e460be6978fc24e3df83193dc0cc4de46c9909ed92dd47d349a452ef49325b7"}, + {file = "aiohttp-3.8.5-cp38-cp38-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fb1558def481d84f03b45888473fc5a1f35747b5f334ef4e7a571bc0dfcb11f8"}, + {file = "aiohttp-3.8.5-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:34dd0c107799dcbbf7d48b53be761a013c0adf5571bf50c4ecad5643fe9cfcd0"}, + {file = "aiohttp-3.8.5-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:aa1990247f02a54185dc0dff92a6904521172a22664c863a03ff64c42f9b5410"}, + {file = "aiohttp-3.8.5-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:0e584a10f204a617d71d359fe383406305a4b595b333721fa50b867b4a0a1548"}, + {file = "aiohttp-3.8.5-cp38-cp38-musllinux_1_1_ppc64le.whl", hash = "sha256:a3cf433f127efa43fee6b90ea4c6edf6c4a17109d1d037d1a52abec84d8f2e42"}, + {file = "aiohttp-3.8.5-cp38-cp38-musllinux_1_1_s390x.whl", hash = "sha256:c11f5b099adafb18e65c2c997d57108b5bbeaa9eeee64a84302c0978b1ec948b"}, + {file = "aiohttp-3.8.5-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:84de26ddf621d7ac4c975dbea4c945860e08cccde492269db4e1538a6a6f3c35"}, + {file = "aiohttp-3.8.5-cp38-cp38-win32.whl", hash = "sha256:ab88bafedc57dd0aab55fa728ea10c1911f7e4d8b43e1d838a1739f33712921c"}, + {file = "aiohttp-3.8.5-cp38-cp38-win_amd64.whl", hash = "sha256:5798a9aad1879f626589f3df0f8b79b3608a92e9beab10e5fda02c8a2c60db2e"}, + {file = "aiohttp-3.8.5-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:a6ce61195c6a19c785df04e71a4537e29eaa2c50fe745b732aa937c0c77169f3"}, + {file = "aiohttp-3.8.5-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:773dd01706d4db536335fcfae6ea2440a70ceb03dd3e7378f3e815b03c97ab51"}, + {file = "aiohttp-3.8.5-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f83a552443a526ea38d064588613aca983d0ee0038801bc93c0c916428310c28"}, + {file = "aiohttp-3.8.5-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1f7372f7341fcc16f57b2caded43e81ddd18df53320b6f9f042acad41f8e049a"}, + {file = "aiohttp-3.8.5-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ea353162f249c8097ea63c2169dd1aa55de1e8fecbe63412a9bc50816e87b761"}, + {file = "aiohttp-3.8.5-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:e5d47ae48db0b2dcf70bc8a3bc72b3de86e2a590fc299fdbbb15af320d2659de"}, + {file = "aiohttp-3.8.5-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d827176898a2b0b09694fbd1088c7a31836d1a505c243811c87ae53a3f6273c1"}, + {file = "aiohttp-3.8.5-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3562b06567c06439d8b447037bb655ef69786c590b1de86c7ab81efe1c9c15d8"}, + {file = "aiohttp-3.8.5-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:4e874cbf8caf8959d2adf572a78bba17cb0e9d7e51bb83d86a3697b686a0ab4d"}, + {file = "aiohttp-3.8.5-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:6809a00deaf3810e38c628e9a33271892f815b853605a936e2e9e5129762356c"}, + {file = "aiohttp-3.8.5-cp39-cp39-musllinux_1_1_ppc64le.whl", hash = "sha256:33776e945d89b29251b33a7e7d006ce86447b2cfd66db5e5ded4e5cd0340585c"}, + {file = "aiohttp-3.8.5-cp39-cp39-musllinux_1_1_s390x.whl", hash = "sha256:eaeed7abfb5d64c539e2db173f63631455f1196c37d9d8d873fc316470dfbacd"}, + {file = "aiohttp-3.8.5-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:e91d635961bec2d8f19dfeb41a539eb94bd073f075ca6dae6c8dc0ee89ad6f91"}, + {file = "aiohttp-3.8.5-cp39-cp39-win32.whl", hash = "sha256:00ad4b6f185ec67f3e6562e8a1d2b69660be43070bd0ef6fcec5211154c7df67"}, + {file = "aiohttp-3.8.5-cp39-cp39-win_amd64.whl", hash = "sha256:c0a9034379a37ae42dea7ac1e048352d96286626251862e448933c0f59cbd79c"}, + {file = "aiohttp-3.8.5.tar.gz", hash = "sha256:b9552ec52cc147dbf1944ac7ac98af7602e51ea2dcd076ed194ca3c0d1c7d0bc"}, ] [package.dependencies] -async-timeout = ">=3.0,<4.0" +aiosignal = ">=1.1.2" +async-timeout = ">=4.0.0a3,<5.0" attrs = ">=17.3.0" -chardet = ">=2.0,<4.0" +charset-normalizer = ">=2.0,<4.0" +frozenlist = ">=1.1.1" multidict = ">=4.5,<7.0" -typing-extensions = ">=3.6.5" yarl = ">=1.0,<2.0" [package.extras] -speedups = ["aiodns", "brotlipy", "cchardet"] +speedups = ["Brotli", "aiodns", "cchardet"] [[package]] name = "aiopg" @@ -75,6 +126,20 @@ psycopg2-binary = ">=2.8.4" [package.extras] sa = ["sqlalchemy[postgresql-psycopg2binary] (>=1.3,<1.5)"] +[[package]] +name = "aiosignal" +version = "1.3.1" +description = "aiosignal: a list of registered asynchronous callbacks" +optional = false +python-versions = ">=3.7" +files = [ + {file = "aiosignal-1.3.1-py3-none-any.whl", hash = "sha256:f8376fb07dd1e86a584e4fcdec80b36b7f81aac666ebc724e2c090300dd83b17"}, + {file = "aiosignal-1.3.1.tar.gz", hash = "sha256:54cd96e15e1649b75d6c87526a6ff0b6c1b0dd3459f43d9ca11d48c339b68cfc"}, +] + +[package.dependencies] +frozenlist = ">=1.1.0" + [[package]] name = "allure-pytest" version = "2.13.2" @@ -107,13 +172,13 @@ pluggy = ">=0.4.0" [[package]] name = "async-timeout" -version = "3.0.1" +version = "4.0.2" description = "Timeout context manager for asyncio programs" optional = false -python-versions = ">=3.5.3" +python-versions = ">=3.6" files = [ - {file = "async-timeout-3.0.1.tar.gz", hash = "sha256:0c3c816a028d47f659d6ff5c745cb2acf1f966da1fe5c19c77a70282b25f4c5f"}, - {file = "async_timeout-3.0.1-py3-none-any.whl", hash = "sha256:4291ca197d287d274d0b6cb5d6f8f8f82d434ed288f962539ff18cc9012f9ea3"}, + {file = "async-timeout-4.0.2.tar.gz", hash = "sha256:2163e1640ddb52b7a8c80d0a67a08587e5d245cc9c553a74a847056bc2976b15"}, + {file = "async_timeout-4.0.2-py3-none-any.whl", hash = "sha256:8ca1e4fcf50d07413d66d1a5e416e42cfdf5851c981d679a09851a6853383b3c"}, ] [[package]] @@ -781,17 +846,6 @@ networkx = ">=2.4,<3.0" pyyaml = ">5.4" sarif-om = ">=1.0.4,<1.1.0" -[[package]] -name = "chardet" -version = "3.0.4" -description = "Universal encoding detector for Python 2 and 3" -optional = false -python-versions = "*" -files = [ - {file = "chardet-3.0.4-py2.py3-none-any.whl", hash = "sha256:fc323ffcaeaed0e0a02bf4d117757b98aed530d9ed4531e3e15460124c106691"}, - {file = "chardet-3.0.4.tar.gz", hash = "sha256:84ab92ed1c4d4f16916e05906b6b75a6c0fb5db821cc65e70cbd64a3e2a5eaae"}, -] - [[package]] name = "charset-normalizer" version = "2.1.0" @@ -980,6 +1034,76 @@ files = [ Flask = ">=0.9" Six = "*" +[[package]] +name = "frozenlist" +version = "1.4.0" +description = "A list-like structure which implements collections.abc.MutableSequence" +optional = false +python-versions = ">=3.8" +files = [ + {file = "frozenlist-1.4.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:764226ceef3125e53ea2cb275000e309c0aa5464d43bd72abd661e27fffc26ab"}, + {file = "frozenlist-1.4.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:d6484756b12f40003c6128bfcc3fa9f0d49a687e171186c2d85ec82e3758c559"}, + {file = "frozenlist-1.4.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:9ac08e601308e41eb533f232dbf6b7e4cea762f9f84f6357136eed926c15d12c"}, + {file = "frozenlist-1.4.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d081f13b095d74b67d550de04df1c756831f3b83dc9881c38985834387487f1b"}, + {file = "frozenlist-1.4.0-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:71932b597f9895f011f47f17d6428252fc728ba2ae6024e13c3398a087c2cdea"}, + {file = "frozenlist-1.4.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:981b9ab5a0a3178ff413bca62526bb784249421c24ad7381e39d67981be2c326"}, + {file = "frozenlist-1.4.0-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e41f3de4df3e80de75845d3e743b3f1c4c8613c3997a912dbf0229fc61a8b963"}, + {file = "frozenlist-1.4.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6918d49b1f90821e93069682c06ffde41829c346c66b721e65a5c62b4bab0300"}, + {file = "frozenlist-1.4.0-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:0e5c8764c7829343d919cc2dfc587a8db01c4f70a4ebbc49abde5d4b158b007b"}, + {file = "frozenlist-1.4.0-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:8d0edd6b1c7fb94922bf569c9b092ee187a83f03fb1a63076e7774b60f9481a8"}, + {file = "frozenlist-1.4.0-cp310-cp310-musllinux_1_1_ppc64le.whl", hash = "sha256:e29cda763f752553fa14c68fb2195150bfab22b352572cb36c43c47bedba70eb"}, + {file = "frozenlist-1.4.0-cp310-cp310-musllinux_1_1_s390x.whl", hash = "sha256:0c7c1b47859ee2cac3846fde1c1dc0f15da6cec5a0e5c72d101e0f83dcb67ff9"}, + {file = "frozenlist-1.4.0-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:901289d524fdd571be1c7be054f48b1f88ce8dddcbdf1ec698b27d4b8b9e5d62"}, + {file = "frozenlist-1.4.0-cp310-cp310-win32.whl", hash = "sha256:1a0848b52815006ea6596c395f87449f693dc419061cc21e970f139d466dc0a0"}, + {file = "frozenlist-1.4.0-cp310-cp310-win_amd64.whl", hash = "sha256:b206646d176a007466358aa21d85cd8600a415c67c9bd15403336c331a10d956"}, + {file = "frozenlist-1.4.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:de343e75f40e972bae1ef6090267f8260c1446a1695e77096db6cfa25e759a95"}, + {file = "frozenlist-1.4.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:ad2a9eb6d9839ae241701d0918f54c51365a51407fd80f6b8289e2dfca977cc3"}, + {file = "frozenlist-1.4.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:bd7bd3b3830247580de99c99ea2a01416dfc3c34471ca1298bccabf86d0ff4dc"}, + {file = "frozenlist-1.4.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:bdf1847068c362f16b353163391210269e4f0569a3c166bc6a9f74ccbfc7e839"}, + {file = "frozenlist-1.4.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:38461d02d66de17455072c9ba981d35f1d2a73024bee7790ac2f9e361ef1cd0c"}, + {file = "frozenlist-1.4.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d5a32087d720c608f42caed0ef36d2b3ea61a9d09ee59a5142d6070da9041b8f"}, + {file = "frozenlist-1.4.0-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:dd65632acaf0d47608190a71bfe46b209719bf2beb59507db08ccdbe712f969b"}, + {file = "frozenlist-1.4.0-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:261b9f5d17cac914531331ff1b1d452125bf5daa05faf73b71d935485b0c510b"}, + {file = "frozenlist-1.4.0-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:b89ac9768b82205936771f8d2eb3ce88503b1556324c9f903e7156669f521472"}, + {file = "frozenlist-1.4.0-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:008eb8b31b3ea6896da16c38c1b136cb9fec9e249e77f6211d479db79a4eaf01"}, + {file = "frozenlist-1.4.0-cp311-cp311-musllinux_1_1_ppc64le.whl", hash = "sha256:e74b0506fa5aa5598ac6a975a12aa8928cbb58e1f5ac8360792ef15de1aa848f"}, + {file = "frozenlist-1.4.0-cp311-cp311-musllinux_1_1_s390x.whl", hash = "sha256:490132667476f6781b4c9458298b0c1cddf237488abd228b0b3650e5ecba7467"}, + {file = "frozenlist-1.4.0-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:76d4711f6f6d08551a7e9ef28c722f4a50dd0fc204c56b4bcd95c6cc05ce6fbb"}, + {file = "frozenlist-1.4.0-cp311-cp311-win32.whl", hash = "sha256:a02eb8ab2b8f200179b5f62b59757685ae9987996ae549ccf30f983f40602431"}, + {file = "frozenlist-1.4.0-cp311-cp311-win_amd64.whl", hash = "sha256:515e1abc578dd3b275d6a5114030b1330ba044ffba03f94091842852f806f1c1"}, + {file = "frozenlist-1.4.0-cp38-cp38-macosx_10_9_universal2.whl", hash = "sha256:f0ed05f5079c708fe74bf9027e95125334b6978bf07fd5ab923e9e55e5fbb9d3"}, + {file = "frozenlist-1.4.0-cp38-cp38-macosx_10_9_x86_64.whl", hash = "sha256:ca265542ca427bf97aed183c1676e2a9c66942e822b14dc6e5f42e038f92a503"}, + {file = "frozenlist-1.4.0-cp38-cp38-macosx_11_0_arm64.whl", hash = "sha256:491e014f5c43656da08958808588cc6c016847b4360e327a62cb308c791bd2d9"}, + {file = "frozenlist-1.4.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:17ae5cd0f333f94f2e03aaf140bb762c64783935cc764ff9c82dff626089bebf"}, + {file = "frozenlist-1.4.0-cp38-cp38-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:1e78fb68cf9c1a6aa4a9a12e960a5c9dfbdb89b3695197aa7064705662515de2"}, + {file = "frozenlist-1.4.0-cp38-cp38-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d5655a942f5f5d2c9ed93d72148226d75369b4f6952680211972a33e59b1dfdc"}, + {file = "frozenlist-1.4.0-cp38-cp38-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c11b0746f5d946fecf750428a95f3e9ebe792c1ee3b1e96eeba145dc631a9672"}, + {file = "frozenlist-1.4.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e66d2a64d44d50d2543405fb183a21f76b3b5fd16f130f5c99187c3fb4e64919"}, + {file = "frozenlist-1.4.0-cp38-cp38-musllinux_1_1_aarch64.whl", hash = "sha256:88f7bc0fcca81f985f78dd0fa68d2c75abf8272b1f5c323ea4a01a4d7a614efc"}, + {file = "frozenlist-1.4.0-cp38-cp38-musllinux_1_1_i686.whl", hash = "sha256:5833593c25ac59ede40ed4de6d67eb42928cca97f26feea219f21d0ed0959b79"}, + {file = "frozenlist-1.4.0-cp38-cp38-musllinux_1_1_ppc64le.whl", hash = "sha256:fec520865f42e5c7f050c2a79038897b1c7d1595e907a9e08e3353293ffc948e"}, + {file = "frozenlist-1.4.0-cp38-cp38-musllinux_1_1_s390x.whl", hash = "sha256:b826d97e4276750beca7c8f0f1a4938892697a6bcd8ec8217b3312dad6982781"}, + {file = "frozenlist-1.4.0-cp38-cp38-musllinux_1_1_x86_64.whl", hash = "sha256:ceb6ec0a10c65540421e20ebd29083c50e6d1143278746a4ef6bcf6153171eb8"}, + {file = "frozenlist-1.4.0-cp38-cp38-win32.whl", hash = "sha256:2b8bcf994563466db019fab287ff390fffbfdb4f905fc77bc1c1d604b1c689cc"}, + {file = "frozenlist-1.4.0-cp38-cp38-win_amd64.whl", hash = "sha256:a6c8097e01886188e5be3e6b14e94ab365f384736aa1fca6a0b9e35bd4a30bc7"}, + {file = "frozenlist-1.4.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:6c38721585f285203e4b4132a352eb3daa19121a035f3182e08e437cface44bf"}, + {file = "frozenlist-1.4.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:a0c6da9aee33ff0b1a451e867da0c1f47408112b3391dd43133838339e410963"}, + {file = "frozenlist-1.4.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:93ea75c050c5bb3d98016b4ba2497851eadf0ac154d88a67d7a6816206f6fa7f"}, + {file = "frozenlist-1.4.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:f61e2dc5ad442c52b4887f1fdc112f97caeff4d9e6ebe78879364ac59f1663e1"}, + {file = "frozenlist-1.4.0-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:aa384489fefeb62321b238e64c07ef48398fe80f9e1e6afeff22e140e0850eef"}, + {file = "frozenlist-1.4.0-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:10ff5faaa22786315ef57097a279b833ecab1a0bfb07d604c9cbb1c4cdc2ed87"}, + {file = "frozenlist-1.4.0-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:007df07a6e3eb3e33e9a1fe6a9db7af152bbd8a185f9aaa6ece10a3529e3e1c6"}, + {file = "frozenlist-1.4.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7f4f399d28478d1f604c2ff9119907af9726aed73680e5ed1ca634d377abb087"}, + {file = "frozenlist-1.4.0-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:c5374b80521d3d3f2ec5572e05adc94601985cc526fb276d0c8574a6d749f1b3"}, + {file = "frozenlist-1.4.0-cp39-cp39-musllinux_1_1_i686.whl", hash = "sha256:ce31ae3e19f3c902de379cf1323d90c649425b86de7bbdf82871b8a2a0615f3d"}, + {file = "frozenlist-1.4.0-cp39-cp39-musllinux_1_1_ppc64le.whl", hash = "sha256:7211ef110a9194b6042449431e08c4d80c0481e5891e58d429df5899690511c2"}, + {file = "frozenlist-1.4.0-cp39-cp39-musllinux_1_1_s390x.whl", hash = "sha256:556de4430ce324c836789fa4560ca62d1591d2538b8ceb0b4f68fb7b2384a27a"}, + {file = "frozenlist-1.4.0-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:7645a8e814a3ee34a89c4a372011dcd817964ce8cb273c8ed6119d706e9613e3"}, + {file = "frozenlist-1.4.0-cp39-cp39-win32.whl", hash = "sha256:19488c57c12d4e8095a922f328df3f179c820c212940a498623ed39160bc3c2f"}, + {file = "frozenlist-1.4.0-cp39-cp39-win_amd64.whl", hash = "sha256:6221d84d463fb110bdd7619b69cb43878a11d51cbb9394ae3105d082d5199167"}, + {file = "frozenlist-1.4.0.tar.gz", hash = "sha256:09163bdf0b2907454042edb19f887c6d33806adc71fbd54afc14908bfdc22251"}, +] + [[package]] name = "graphql-core" version = "3.2.1" @@ -2527,4 +2651,4 @@ testing = ["func-timeout", "jaraco.itertools", "pytest (>=6)", "pytest-black (>= [metadata] lock-version = "2.0" python-versions = "^3.9" -content-hash = "e16a65d8fdff4e2173610e552e0e7306e301de2c640ae6082ef6cc5755f566d2" +content-hash = "c40f62277e788011920f4edb6f7392046ee440f792a104c903097415def9a916" diff --git a/pyproject.toml b/pyproject.toml index 726e04ea4e..2ff8f6982d 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -33,7 +33,7 @@ psutil = "^5.9.4" types-psutil = "^5.9.5.12" types-toml = "^0.10.8.6" pytest-httpserver = "^1.0.8" -aiohttp = "3.7.4" +aiohttp = "3.8.5" pytest-rerunfailures = "^11.1.2" types-pytest-lazy-fixture = "^0.6.3.3" pytest-split = "^0.8.1" From 1685593f386adf57e697a21ad41700d284aeb81b Mon Sep 17 00:00:00 2001 From: Alex Chi Z Date: Fri, 21 Jul 2023 10:15:44 -0400 Subject: [PATCH 55/58] stable merge and sort in compaction (#4573) Per discussion at https://github.com/neondatabase/neon/pull/4537#discussion_r1242086217, it looks like a better idea to use `<` instead of `<=` for all these comparisons. --------- Signed-off-by: Alex Chi Z --- pageserver/src/tenant/timeline.rs | 14 +++----------- 1 file changed, 3 insertions(+), 11 deletions(-) diff --git a/pageserver/src/tenant/timeline.rs b/pageserver/src/tenant/timeline.rs index c6ceae500b..616d184393 100644 --- a/pageserver/src/tenant/timeline.rs +++ b/pageserver/src/tenant/timeline.rs @@ -3452,7 +3452,7 @@ impl Timeline { let mut prev: Option = None; for (next_key, _next_lsn, _size) in itertools::process_results( deltas_to_compact.iter().map(|l| l.key_iter(ctx)), - |iter_iter| iter_iter.kmerge_by(|a, b| a.0 <= b.0), + |iter_iter| iter_iter.kmerge_by(|a, b| a.0 < b.0), )? { if let Some(prev_key) = prev { // just first fast filter @@ -3492,11 +3492,7 @@ impl Timeline { iter_iter.kmerge_by(|a, b| { if let Ok((a_key, a_lsn, _)) = a { if let Ok((b_key, b_lsn, _)) = b { - match a_key.cmp(b_key) { - Ordering::Less => true, - Ordering::Equal => a_lsn <= b_lsn, - Ordering::Greater => false, - } + (a_key, a_lsn) < (b_key, b_lsn) } else { false } @@ -3514,11 +3510,7 @@ impl Timeline { iter_iter.kmerge_by(|a, b| { let (a_key, a_lsn, _) = a; let (b_key, b_lsn, _) = b; - match a_key.cmp(b_key) { - Ordering::Less => true, - Ordering::Equal => a_lsn <= b_lsn, - Ordering::Greater => false, - } + (a_key, a_lsn) < (b_key, b_lsn) }) }, )?; From 25d2f4b669076a266775ea4e73c578eee2d63049 Mon Sep 17 00:00:00 2001 From: Joonas Koivunen Date: Fri, 21 Jul 2023 18:10:55 +0300 Subject: [PATCH 56/58] metrics: chunked responses (#4768) Metrics can get really large in the order of hundreds of megabytes, which we used to buffer completly (after a few rounds of growing the buffer). --- Cargo.lock | 1 + libs/metrics/src/lib.rs | 1 + libs/utils/Cargo.toml | 4 + libs/utils/src/http/endpoint.rs | 137 +++++++++++++++++++++++++++++--- 4 files changed, 131 insertions(+), 12 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 3c862241a4..b9ca53064f 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -4867,6 +4867,7 @@ dependencies = [ "tempfile", "thiserror", "tokio", + "tokio-stream", "tracing", "tracing-error", "tracing-subscriber", diff --git a/libs/metrics/src/lib.rs b/libs/metrics/src/lib.rs index f24488b19d..b4026d93e1 100644 --- a/libs/metrics/src/lib.rs +++ b/libs/metrics/src/lib.rs @@ -6,6 +6,7 @@ use once_cell::sync::Lazy; use prometheus::core::{AtomicU64, Collector, GenericGauge, GenericGaugeVec}; pub use prometheus::opts; pub use prometheus::register; +pub use prometheus::Error; pub use prometheus::{core, default_registry, proto}; pub use prometheus::{exponential_buckets, linear_buckets}; pub use prometheus::{register_counter_vec, Counter, CounterVec}; diff --git a/libs/utils/Cargo.toml b/libs/utils/Cargo.toml index e7c8323c1d..f01131540e 100644 --- a/libs/utils/Cargo.toml +++ b/libs/utils/Cargo.toml @@ -42,6 +42,10 @@ workspace_hack.workspace = true const_format.workspace = true +# to use tokio channels as streams, this is faster to compile than async_stream +# why is it only here? no other crate should use it, streams are rarely needed. +tokio-stream = { version = "0.1.14" } + [dev-dependencies] byteorder.workspace = true bytes.workspace = true diff --git a/libs/utils/src/http/endpoint.rs b/libs/utils/src/http/endpoint.rs index 33241dbdf7..f3f5e95d0b 100644 --- a/libs/utils/src/http/endpoint.rs +++ b/libs/utils/src/http/endpoint.rs @@ -9,7 +9,6 @@ use metrics::{register_int_counter, Encoder, IntCounter, TextEncoder}; use once_cell::sync::Lazy; use routerify::ext::RequestExt; use routerify::{Middleware, RequestInfo, Router, RouterBuilder}; -use tokio::task::JoinError; use tracing::{self, debug, info, info_span, warn, Instrument}; use std::future::Future; @@ -148,26 +147,140 @@ impl Drop for RequestCancelled { } async fn prometheus_metrics_handler(_req: Request) -> Result, ApiError> { + use bytes::{Bytes, BytesMut}; + use std::io::Write as _; + use tokio::sync::mpsc; + use tokio_stream::wrappers::ReceiverStream; + SERVE_METRICS_COUNT.inc(); - let mut buffer = vec![]; - let encoder = TextEncoder::new(); + /// An [`std::io::Write`] implementation on top of a channel sending [`bytes::Bytes`] chunks. + struct ChannelWriter { + buffer: BytesMut, + tx: mpsc::Sender>, + written: usize, + } - let metrics = tokio::task::spawn_blocking(move || { - // Currently we take a lot of mutexes while collecting metrics, so it's - // better to spawn a blocking task to avoid blocking the event loop. - metrics::gather() - }) - .await - .map_err(|e: JoinError| ApiError::InternalServerError(e.into()))?; - encoder.encode(&metrics, &mut buffer).unwrap(); + impl ChannelWriter { + fn new(buf_len: usize, tx: mpsc::Sender>) -> Self { + assert_ne!(buf_len, 0); + ChannelWriter { + // split about half off the buffer from the start, because we flush depending on + // capacity. first flush will come sooner than without this, but now resizes will + // have better chance of picking up the "other" half. not guaranteed of course. + buffer: BytesMut::with_capacity(buf_len).split_off(buf_len / 2), + tx, + written: 0, + } + } + + fn flush0(&mut self) -> std::io::Result { + let n = self.buffer.len(); + if n == 0 { + return Ok(0); + } + + tracing::trace!(n, "flushing"); + let ready = self.buffer.split().freeze(); + + // not ideal to call from blocking code to block_on, but we are sure that this + // operation does not spawn_blocking other tasks + let res: Result<(), ()> = tokio::runtime::Handle::current().block_on(async { + self.tx.send(Ok(ready)).await.map_err(|_| ())?; + + // throttle sending to allow reuse of our buffer in `write`. + self.tx.reserve().await.map_err(|_| ())?; + + // now the response task has picked up the buffer and hopefully started + // sending it to the client. + Ok(()) + }); + if res.is_err() { + return Err(std::io::ErrorKind::BrokenPipe.into()); + } + self.written += n; + Ok(n) + } + + fn flushed_bytes(&self) -> usize { + self.written + } + } + + impl std::io::Write for ChannelWriter { + fn write(&mut self, mut buf: &[u8]) -> std::io::Result { + let remaining = self.buffer.capacity() - self.buffer.len(); + + let out_of_space = remaining < buf.len(); + + let original_len = buf.len(); + + if out_of_space { + let can_still_fit = buf.len() - remaining; + self.buffer.extend_from_slice(&buf[..can_still_fit]); + buf = &buf[can_still_fit..]; + self.flush0()?; + } + + // assume that this will often under normal operation just move the pointer back to the + // beginning of allocation, because previous split off parts are already sent and + // dropped. + self.buffer.extend_from_slice(buf); + Ok(original_len) + } + + fn flush(&mut self) -> std::io::Result<()> { + self.flush0().map(|_| ()) + } + } + + let started_at = std::time::Instant::now(); + + let (tx, rx) = mpsc::channel(1); + + let body = Body::wrap_stream(ReceiverStream::new(rx)); + + let mut writer = ChannelWriter::new(128 * 1024, tx); + + let encoder = TextEncoder::new(); let response = Response::builder() .status(200) .header(CONTENT_TYPE, encoder.format_type()) - .body(Body::from(buffer)) + .body(body) .unwrap(); + let span = info_span!("blocking"); + tokio::task::spawn_blocking(move || { + let _span = span.entered(); + let metrics = metrics::gather(); + let res = encoder + .encode(&metrics, &mut writer) + .and_then(|_| writer.flush().map_err(|e| e.into())); + + match res { + Ok(()) => { + tracing::info!( + bytes = writer.flushed_bytes(), + elapsed_ms = started_at.elapsed().as_millis(), + "responded /metrics" + ); + } + Err(e) => { + tracing::warn!("failed to write out /metrics response: {e:#}"); + // semantics of this error are quite... unclear. we want to error the stream out to + // abort the response to somehow notify the client that we failed. + // + // though, most likely the reason for failure is that the receiver is already gone. + drop( + writer + .tx + .blocking_send(Err(std::io::ErrorKind::BrokenPipe.into())), + ); + } + } + }); + Ok(response) } From 457e3a3ebc35b35c589532164395b1d98a4fd2a4 Mon Sep 17 00:00:00 2001 From: Konstantin Knizhnik Date: Fri, 21 Jul 2023 21:20:53 +0300 Subject: [PATCH 57/58] Mx offset bug (#4775) Fix mx_offset_to_flags_offset() function Fixes issue #4774 Postgres `MXOffsetToFlagsOffset` was not correctly converted to Rust because cast to u16 is done before division by modulo. It is possible only if divider is power of two. Add a small rust unit test to check that the function produces same results as the PostgreSQL macro, and extend the existing python test to cover this bug. Co-authored-by: Konstantin Knizhnik Co-authored-by: Heikki Linnakangas --- libs/postgres_ffi/src/nonrelfile_utils.rs | 44 +++++++++++++++++++++-- test_runner/regress/test_multixact.py | 21 ++++++++--- 2 files changed, 57 insertions(+), 8 deletions(-) diff --git a/libs/postgres_ffi/src/nonrelfile_utils.rs b/libs/postgres_ffi/src/nonrelfile_utils.rs index 5acf90be70..e3e7133b94 100644 --- a/libs/postgres_ffi/src/nonrelfile_utils.rs +++ b/libs/postgres_ffi/src/nonrelfile_utils.rs @@ -57,9 +57,9 @@ pub fn slru_may_delete_clogsegment(segpage: u32, cutoff_page: u32) -> bool { // Multixact utils pub fn mx_offset_to_flags_offset(xid: MultiXactId) -> usize { - ((xid / pg_constants::MULTIXACT_MEMBERS_PER_MEMBERGROUP as u32) as u16 - % pg_constants::MULTIXACT_MEMBERGROUPS_PER_PAGE - * pg_constants::MULTIXACT_MEMBERGROUP_SIZE) as usize + ((xid / pg_constants::MULTIXACT_MEMBERS_PER_MEMBERGROUP as u32) + % pg_constants::MULTIXACT_MEMBERGROUPS_PER_PAGE as u32 + * pg_constants::MULTIXACT_MEMBERGROUP_SIZE as u32) as usize } pub fn mx_offset_to_flags_bitshift(xid: MultiXactId) -> u16 { @@ -81,3 +81,41 @@ fn mx_offset_to_member_page(xid: u32) -> u32 { pub fn mx_offset_to_member_segment(xid: u32) -> i32 { (mx_offset_to_member_page(xid) / pg_constants::SLRU_PAGES_PER_SEGMENT) as i32 } + +#[cfg(test)] +mod tests { + use super::*; + + #[test] + fn test_multixid_calc() { + // Check that the mx_offset_* functions produce the same values as the + // corresponding PostgreSQL C macros (MXOffsetTo*). These test values + // were generated by calling the PostgreSQL macros with a little C + // program. + assert_eq!(mx_offset_to_member_segment(0), 0); + assert_eq!(mx_offset_to_member_page(0), 0); + assert_eq!(mx_offset_to_flags_offset(0), 0); + assert_eq!(mx_offset_to_flags_bitshift(0), 0); + assert_eq!(mx_offset_to_member_offset(0), 4); + assert_eq!(mx_offset_to_member_segment(1), 0); + assert_eq!(mx_offset_to_member_page(1), 0); + assert_eq!(mx_offset_to_flags_offset(1), 0); + assert_eq!(mx_offset_to_flags_bitshift(1), 8); + assert_eq!(mx_offset_to_member_offset(1), 8); + assert_eq!(mx_offset_to_member_segment(123456789), 2358); + assert_eq!(mx_offset_to_member_page(123456789), 75462); + assert_eq!(mx_offset_to_flags_offset(123456789), 4780); + assert_eq!(mx_offset_to_flags_bitshift(123456789), 8); + assert_eq!(mx_offset_to_member_offset(123456789), 4788); + assert_eq!(mx_offset_to_member_segment(u32::MAX - 1), 82040); + assert_eq!(mx_offset_to_member_page(u32::MAX - 1), 2625285); + assert_eq!(mx_offset_to_flags_offset(u32::MAX - 1), 5160); + assert_eq!(mx_offset_to_flags_bitshift(u32::MAX - 1), 16); + assert_eq!(mx_offset_to_member_offset(u32::MAX - 1), 5172); + assert_eq!(mx_offset_to_member_segment(u32::MAX), 82040); + assert_eq!(mx_offset_to_member_page(u32::MAX), 2625285); + assert_eq!(mx_offset_to_flags_offset(u32::MAX), 5160); + assert_eq!(mx_offset_to_flags_bitshift(u32::MAX), 24); + assert_eq!(mx_offset_to_member_offset(u32::MAX), 5176); + } +} diff --git a/test_runner/regress/test_multixact.py b/test_runner/regress/test_multixact.py index 78635576f1..9db463dc4a 100644 --- a/test_runner/regress/test_multixact.py +++ b/test_runner/regress/test_multixact.py @@ -8,6 +8,10 @@ from fixtures.utils import query_scalar # Now this test is very minimalistic - # it only checks next_multixact_id field in restored pg_control, # since we don't have functions to check multixact internals. +# We do check that the datadir contents exported from the +# pageserver match what the running PostgreSQL produced. This +# is enough to verify that the WAL records are handled correctly +# in the pageserver. # def test_multixact(neon_simple_env: NeonEnv, test_output_dir): env = neon_simple_env @@ -18,8 +22,8 @@ def test_multixact(neon_simple_env: NeonEnv, test_output_dir): cur = endpoint.connect().cursor() cur.execute( """ - CREATE TABLE t1(i int primary key); - INSERT INTO t1 select * from generate_series(1, 100); + CREATE TABLE t1(i int primary key, n_updated int); + INSERT INTO t1 select g, 0 from generate_series(1, 50) g; """ ) @@ -29,6 +33,7 @@ def test_multixact(neon_simple_env: NeonEnv, test_output_dir): # Lock entries using parallel connections in a round-robin fashion. nclients = 20 + update_every = 97 connections = [] for _ in range(nclients): # Do not turn on autocommit. We want to hold the key-share locks. @@ -36,14 +41,20 @@ def test_multixact(neon_simple_env: NeonEnv, test_output_dir): connections.append(conn) # On each iteration, we commit the previous transaction on a connection, - # and issue antoher select. Each SELECT generates a new multixact that + # and issue another select. Each SELECT generates a new multixact that # includes the new XID, and the XIDs of all the other parallel transactions. # This generates enough traffic on both multixact offsets and members SLRUs # to cross page boundaries. - for i in range(5000): + for i in range(20000): conn = connections[i % nclients] conn.commit() - conn.cursor().execute("select * from t1 for key share") + + # Perform some non-key UPDATEs too, to exercise different multixact + # member statuses. + if i % update_every == 0: + conn.cursor().execute(f"update t1 set n_updated = n_updated + 1 where i = {i % 50}") + else: + conn.cursor().execute("select * from t1 for key share") # We have multixacts now. We can close the connections. for c in connections: From 7feb0d1a80227c6992e488fdbda9b78769741f25 Mon Sep 17 00:00:00 2001 From: Alek Westover Date: Fri, 21 Jul 2023 15:17:16 -0400 Subject: [PATCH 58/58] `unwrap` instead of passing `anyhow::Error` on failure to spawn a thread (#4779) --- compute_tools/src/bin/compute_ctl.rs | 5 ++--- compute_tools/src/configurator.rs | 8 ++++---- compute_tools/src/monitor.rs | 8 ++++---- 3 files changed, 10 insertions(+), 11 deletions(-) diff --git a/compute_tools/src/bin/compute_ctl.rs b/compute_tools/src/bin/compute_ctl.rs index 68f6bf3844..4953e5f331 100644 --- a/compute_tools/src/bin/compute_ctl.rs +++ b/compute_tools/src/bin/compute_ctl.rs @@ -223,9 +223,8 @@ fn main() -> Result<()> { drop(state); // Launch remaining service threads - let _monitor_handle = launch_monitor(&compute).expect("cannot launch compute monitor thread"); - let _configurator_handle = - launch_configurator(&compute).expect("cannot launch configurator thread"); + let _monitor_handle = launch_monitor(&compute); + let _configurator_handle = launch_configurator(&compute); // Start Postgres let mut delay_exit = false; diff --git a/compute_tools/src/configurator.rs b/compute_tools/src/configurator.rs index 13550e0176..274a221ac7 100644 --- a/compute_tools/src/configurator.rs +++ b/compute_tools/src/configurator.rs @@ -1,7 +1,6 @@ use std::sync::Arc; use std::thread; -use anyhow::Result; use tracing::{error, info, instrument}; use compute_api::responses::ComputeStatus; @@ -42,13 +41,14 @@ fn configurator_main_loop(compute: &Arc) { } } -pub fn launch_configurator(compute: &Arc) -> Result> { +pub fn launch_configurator(compute: &Arc) -> thread::JoinHandle<()> { let compute = Arc::clone(compute); - Ok(thread::Builder::new() + thread::Builder::new() .name("compute-configurator".into()) .spawn(move || { configurator_main_loop(&compute); info!("configurator thread is exited"); - })?) + }) + .expect("cannot launch configurator thread") } diff --git a/compute_tools/src/monitor.rs b/compute_tools/src/monitor.rs index d2e7b698dd..1085a27902 100644 --- a/compute_tools/src/monitor.rs +++ b/compute_tools/src/monitor.rs @@ -1,7 +1,6 @@ use std::sync::Arc; use std::{thread, time}; -use anyhow::Result; use chrono::{DateTime, Utc}; use postgres::{Client, NoTls}; use tracing::{debug, info}; @@ -105,10 +104,11 @@ fn watch_compute_activity(compute: &ComputeNode) { } /// Launch a separate compute monitor thread and return its `JoinHandle`. -pub fn launch_monitor(state: &Arc) -> Result> { +pub fn launch_monitor(state: &Arc) -> thread::JoinHandle<()> { let state = Arc::clone(state); - Ok(thread::Builder::new() + thread::Builder::new() .name("compute-monitor".into()) - .spawn(move || watch_compute_activity(&state))?) + .spawn(move || watch_compute_activity(&state)) + .expect("cannot launch compute monitor thread") }