mirror of
https://github.com/neondatabase/neon.git
synced 2026-01-25 22:30:38 +00:00
Compare commits
8 Commits
initdb_wal
...
lfc_fixes2
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
773a8836cc | ||
|
|
da34a9ed89 | ||
|
|
e4b74e375c | ||
|
|
c3d1e26361 | ||
|
|
665eff5e08 | ||
|
|
7aeec2bc9d | ||
|
|
bc3a5d571f | ||
|
|
2324e5a3d3 |
2
.github/actionlint.yml
vendored
2
.github/actionlint.yml
vendored
@@ -5,6 +5,4 @@ self-hosted-runner:
|
||||
- small
|
||||
- us-east-2
|
||||
config-variables:
|
||||
- REMOTE_STORAGE_AZURE_CONTAINER
|
||||
- REMOTE_STORAGE_AZURE_REGION
|
||||
- SLACK_UPCOMING_RELEASE_CHANNEL_ID
|
||||
|
||||
@@ -203,10 +203,6 @@ runs:
|
||||
COMMIT_SHA: ${{ github.event.pull_request.head.sha || github.sha }}
|
||||
BASE_S3_URL: ${{ steps.generate-report.outputs.base-s3-url }}
|
||||
run: |
|
||||
if [ ! -d "${WORKDIR}/report/data/test-cases" ]; then
|
||||
exit 0
|
||||
fi
|
||||
|
||||
export DATABASE_URL=${REGRESS_TEST_RESULT_CONNSTR_NEW}
|
||||
|
||||
./scripts/pysync
|
||||
|
||||
19
.github/workflows/build_and_test.yml
vendored
19
.github/workflows/build_and_test.yml
vendored
@@ -320,9 +320,6 @@ jobs:
|
||||
- name: Build neon extensions
|
||||
run: mold -run make neon-pg-ext -j$(nproc)
|
||||
|
||||
- name: Build walproposer-lib
|
||||
run: mold -run make walproposer-lib -j$(nproc)
|
||||
|
||||
- name: Run cargo build
|
||||
run: |
|
||||
${cov_prefix} mold -run cargo build $CARGO_FLAGS $CARGO_FEATURES --bins --tests
|
||||
@@ -338,16 +335,6 @@ jobs:
|
||||
# Avoid `$CARGO_FEATURES` since there's no `testing` feature in the e2e tests now
|
||||
${cov_prefix} cargo test $CARGO_FLAGS --package remote_storage --test test_real_s3
|
||||
|
||||
# Run separate tests for real Azure Blob Storage
|
||||
# XXX: replace region with `eu-central-1`-like region
|
||||
export ENABLE_REAL_AZURE_REMOTE_STORAGE=y
|
||||
export AZURE_STORAGE_ACCOUNT="${{ secrets.AZURE_STORAGE_ACCOUNT_DEV }}"
|
||||
export AZURE_STORAGE_ACCESS_KEY="${{ secrets.AZURE_STORAGE_ACCESS_KEY_DEV }}"
|
||||
export REMOTE_STORAGE_AZURE_CONTAINER="${{ vars.REMOTE_STORAGE_AZURE_CONTAINER }}"
|
||||
export REMOTE_STORAGE_AZURE_REGION="${{ vars.REMOTE_STORAGE_AZURE_REGION }}"
|
||||
# Avoid `$CARGO_FEATURES` since there's no `testing` feature in the e2e tests now
|
||||
${cov_prefix} cargo test $CARGO_FLAGS --package remote_storage --test test_real_azure
|
||||
|
||||
- name: Install rust binaries
|
||||
run: |
|
||||
# Install target binaries
|
||||
@@ -433,7 +420,7 @@ jobs:
|
||||
rerun_flaky: true
|
||||
pg_version: ${{ matrix.pg_version }}
|
||||
env:
|
||||
TEST_RESULT_CONNSTR: ${{ secrets.REGRESS_TEST_RESULT_CONNSTR_NEW }}
|
||||
TEST_RESULT_CONNSTR: ${{ secrets.REGRESS_TEST_RESULT_CONNSTR }}
|
||||
CHECK_ONDISK_DATA_COMPATIBILITY: nonempty
|
||||
|
||||
- name: Merge and upload coverage data
|
||||
@@ -468,7 +455,7 @@ jobs:
|
||||
env:
|
||||
VIP_VAP_ACCESS_TOKEN: "${{ secrets.VIP_VAP_ACCESS_TOKEN }}"
|
||||
PERF_TEST_RESULT_CONNSTR: "${{ secrets.PERF_TEST_RESULT_CONNSTR }}"
|
||||
TEST_RESULT_CONNSTR: "${{ secrets.REGRESS_TEST_RESULT_CONNSTR_NEW }}"
|
||||
TEST_RESULT_CONNSTR: "${{ secrets.REGRESS_TEST_RESULT_CONNSTR }}"
|
||||
# XXX: no coverage data handling here, since benchmarks are run on release builds,
|
||||
# while coverage is currently collected for the debug ones
|
||||
|
||||
@@ -847,7 +834,7 @@ jobs:
|
||||
run:
|
||||
shell: sh -eu {0}
|
||||
env:
|
||||
VM_BUILDER_VERSION: v0.18.5
|
||||
VM_BUILDER_VERSION: v0.17.12
|
||||
|
||||
steps:
|
||||
- name: Checkout
|
||||
|
||||
18
.github/workflows/neon_extra_builds.yml
vendored
18
.github/workflows/neon_extra_builds.yml
vendored
@@ -32,7 +32,7 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v4
|
||||
uses: actions/checkout@v3
|
||||
with:
|
||||
submodules: true
|
||||
fetch-depth: 1
|
||||
@@ -90,21 +90,18 @@ jobs:
|
||||
|
||||
- name: Build postgres v14
|
||||
if: steps.cache_pg_14.outputs.cache-hit != 'true'
|
||||
run: make postgres-v14 -j$(sysctl -n hw.ncpu)
|
||||
run: make postgres-v14 -j$(nproc)
|
||||
|
||||
- name: Build postgres v15
|
||||
if: steps.cache_pg_15.outputs.cache-hit != 'true'
|
||||
run: make postgres-v15 -j$(sysctl -n hw.ncpu)
|
||||
run: make postgres-v15 -j$(nproc)
|
||||
|
||||
- name: Build postgres v16
|
||||
if: steps.cache_pg_16.outputs.cache-hit != 'true'
|
||||
run: make postgres-v16 -j$(sysctl -n hw.ncpu)
|
||||
run: make postgres-v16 -j$(nproc)
|
||||
|
||||
- name: Build neon extensions
|
||||
run: make neon-pg-ext -j$(sysctl -n hw.ncpu)
|
||||
|
||||
- name: Build walproposer-lib
|
||||
run: make walproposer-lib -j$(sysctl -n hw.ncpu)
|
||||
run: make neon-pg-ext -j$(nproc)
|
||||
|
||||
- name: Run cargo build
|
||||
run: cargo build --all --release
|
||||
@@ -129,7 +126,7 @@ jobs:
|
||||
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v4
|
||||
uses: actions/checkout@v3
|
||||
with:
|
||||
submodules: true
|
||||
fetch-depth: 1
|
||||
@@ -138,9 +135,6 @@ jobs:
|
||||
- name: Get postgres headers
|
||||
run: make postgres-headers -j$(nproc)
|
||||
|
||||
- name: Build walproposer-lib
|
||||
run: make walproposer-lib -j$(nproc)
|
||||
|
||||
- name: Produce the build stats
|
||||
run: cargo build --all --release --timings
|
||||
|
||||
|
||||
2
.github/workflows/release.yml
vendored
2
.github/workflows/release.yml
vendored
@@ -2,7 +2,7 @@ name: Create Release Branch
|
||||
|
||||
on:
|
||||
schedule:
|
||||
- cron: '0 7 * * 5'
|
||||
- cron: '0 7 * * 2'
|
||||
workflow_dispatch:
|
||||
|
||||
jobs:
|
||||
|
||||
1038
Cargo.lock
generated
1038
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
19
Cargo.toml
19
Cargo.toml
@@ -26,7 +26,6 @@ members = [
|
||||
"libs/tracing-utils",
|
||||
"libs/postgres_ffi/wal_craft",
|
||||
"libs/vm_monitor",
|
||||
"libs/walproposer",
|
||||
]
|
||||
|
||||
[workspace.package]
|
||||
@@ -37,10 +36,6 @@ license = "Apache-2.0"
|
||||
[workspace.dependencies]
|
||||
anyhow = { version = "1.0", features = ["backtrace"] }
|
||||
async-compression = { version = "0.4.0", features = ["tokio", "gzip"] }
|
||||
azure_core = "0.16"
|
||||
azure_identity = "0.16"
|
||||
azure_storage = "0.16"
|
||||
azure_storage_blobs = "0.16"
|
||||
flate2 = "1.0.26"
|
||||
async-stream = "0.3"
|
||||
async-trait = "0.1"
|
||||
@@ -81,7 +76,6 @@ hex = "0.4"
|
||||
hex-literal = "0.4"
|
||||
hmac = "0.12.1"
|
||||
hostname = "0.3.1"
|
||||
http-types = "2"
|
||||
humantime = "2.1"
|
||||
humantime-serde = "1.1.1"
|
||||
hyper = "0.14"
|
||||
@@ -161,11 +155,11 @@ env_logger = "0.10"
|
||||
log = "0.4"
|
||||
|
||||
## Libraries from neondatabase/ git forks, ideally with changes to be upstreamed
|
||||
postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="7434d9388965a17a6d113e5dfc0e65666a03b4c2" }
|
||||
postgres-native-tls = { git = "https://github.com/neondatabase/rust-postgres.git", rev="7434d9388965a17a6d113e5dfc0e65666a03b4c2" }
|
||||
postgres-protocol = { git = "https://github.com/neondatabase/rust-postgres.git", rev="7434d9388965a17a6d113e5dfc0e65666a03b4c2" }
|
||||
postgres-types = { git = "https://github.com/neondatabase/rust-postgres.git", rev="7434d9388965a17a6d113e5dfc0e65666a03b4c2" }
|
||||
tokio-postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="7434d9388965a17a6d113e5dfc0e65666a03b4c2" }
|
||||
postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="9011f7110db12b5e15afaf98f8ac834501d50ddc" }
|
||||
postgres-native-tls = { git = "https://github.com/neondatabase/rust-postgres.git", rev="9011f7110db12b5e15afaf98f8ac834501d50ddc" }
|
||||
postgres-protocol = { git = "https://github.com/neondatabase/rust-postgres.git", rev="9011f7110db12b5e15afaf98f8ac834501d50ddc" }
|
||||
postgres-types = { git = "https://github.com/neondatabase/rust-postgres.git", rev="9011f7110db12b5e15afaf98f8ac834501d50ddc" }
|
||||
tokio-postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="9011f7110db12b5e15afaf98f8ac834501d50ddc" }
|
||||
|
||||
## Other git libraries
|
||||
heapless = { default-features=false, features=[], git = "https://github.com/japaric/heapless.git", rev = "644653bf3b831c6bb4963be2de24804acf5e5001" } # upstream release pending
|
||||
@@ -186,7 +180,6 @@ tenant_size_model = { version = "0.1", path = "./libs/tenant_size_model/" }
|
||||
tracing-utils = { version = "0.1", path = "./libs/tracing-utils/" }
|
||||
utils = { version = "0.1", path = "./libs/utils/" }
|
||||
vm_monitor = { version = "0.1", path = "./libs/vm_monitor/" }
|
||||
walproposer = { version = "0.1", path = "./libs/walproposer/" }
|
||||
|
||||
## Common library dependency
|
||||
workspace_hack = { version = "0.1", path = "./workspace_hack/" }
|
||||
@@ -202,7 +195,7 @@ tonic-build = "0.9"
|
||||
|
||||
# This is only needed for proxy's tests.
|
||||
# TODO: we should probably fork `tokio-postgres-rustls` instead.
|
||||
tokio-postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="7434d9388965a17a6d113e5dfc0e65666a03b4c2" }
|
||||
tokio-postgres = { git = "https://github.com/neondatabase/rust-postgres.git", rev="9011f7110db12b5e15afaf98f8ac834501d50ddc" }
|
||||
|
||||
################# Binary contents sections
|
||||
|
||||
|
||||
@@ -224,8 +224,8 @@ RUN wget https://github.com/df7cb/postgresql-unit/archive/refs/tags/7.7.tar.gz -
|
||||
FROM build-deps AS vector-pg-build
|
||||
COPY --from=pg-build /usr/local/pgsql/ /usr/local/pgsql/
|
||||
|
||||
RUN wget https://github.com/pgvector/pgvector/archive/refs/tags/v0.5.1.tar.gz -O pgvector.tar.gz && \
|
||||
echo "cc7a8e034a96e30a819911ac79d32f6bc47bdd1aa2de4d7d4904e26b83209dc8 pgvector.tar.gz" | sha256sum --check && \
|
||||
RUN wget https://github.com/pgvector/pgvector/archive/refs/tags/v0.5.0.tar.gz -O pgvector.tar.gz && \
|
||||
echo "d8aa3504b215467ca528525a6de12c3f85f9891b091ce0e5864dd8a9b757f77b pgvector.tar.gz" | sha256sum --check && \
|
||||
mkdir pgvector-src && cd pgvector-src && tar xvzf ../pgvector.tar.gz --strip-components=1 -C . && \
|
||||
make -j $(getconf _NPROCESSORS_ONLN) PG_CONFIG=/usr/local/pgsql/bin/pg_config && \
|
||||
make -j $(getconf _NPROCESSORS_ONLN) install PG_CONFIG=/usr/local/pgsql/bin/pg_config && \
|
||||
@@ -368,8 +368,8 @@ RUN wget https://github.com/citusdata/postgresql-hll/archive/refs/tags/v2.18.tar
|
||||
FROM build-deps AS plpgsql-check-pg-build
|
||||
COPY --from=pg-build /usr/local/pgsql/ /usr/local/pgsql/
|
||||
|
||||
RUN wget https://github.com/okbob/plpgsql_check/archive/refs/tags/v2.5.3.tar.gz -O plpgsql_check.tar.gz && \
|
||||
echo "6631ec3e7fb3769eaaf56e3dfedb829aa761abf163d13dba354b4c218508e1c0 plpgsql_check.tar.gz" | sha256sum --check && \
|
||||
RUN wget https://github.com/okbob/plpgsql_check/archive/refs/tags/v2.4.0.tar.gz -O plpgsql_check.tar.gz && \
|
||||
echo "9ba58387a279b35a3bfa39ee611e5684e6cddb2ba046ddb2c5190b3bd2ca254a plpgsql_check.tar.gz" | sha256sum --check && \
|
||||
mkdir plpgsql_check-src && cd plpgsql_check-src && tar xvzf ../plpgsql_check.tar.gz --strip-components=1 -C . && \
|
||||
make -j $(getconf _NPROCESSORS_ONLN) PG_CONFIG=/usr/local/pgsql/bin/pg_config USE_PGXS=1 && \
|
||||
make -j $(getconf _NPROCESSORS_ONLN) install PG_CONFIG=/usr/local/pgsql/bin/pg_config USE_PGXS=1 && \
|
||||
|
||||
38
Makefile
38
Makefile
@@ -62,7 +62,7 @@ all: neon postgres neon-pg-ext
|
||||
#
|
||||
# The 'postgres_ffi' depends on the Postgres headers.
|
||||
.PHONY: neon
|
||||
neon: postgres-headers walproposer-lib
|
||||
neon: postgres-headers
|
||||
+@echo "Compiling Neon"
|
||||
$(CARGO_CMD_PREFIX) cargo build $(CARGO_BUILD_FLAGS)
|
||||
|
||||
@@ -168,42 +168,6 @@ neon-pg-ext-clean-%:
|
||||
-C $(POSTGRES_INSTALL_DIR)/build/neon-utils-$* \
|
||||
-f $(ROOT_PROJECT_DIR)/pgxn/neon_utils/Makefile clean
|
||||
|
||||
# Build walproposer as a static library. walproposer source code is located
|
||||
# in the pgxn/neon directory.
|
||||
#
|
||||
# We also need to include libpgport.a and libpgcommon.a, because walproposer
|
||||
# uses some functions from those libraries.
|
||||
#
|
||||
# Some object files are removed from libpgport.a and libpgcommon.a because
|
||||
# they depend on openssl and other libraries that are not included in our
|
||||
# Rust build.
|
||||
.PHONY: walproposer-lib
|
||||
walproposer-lib: neon-pg-ext-v16
|
||||
+@echo "Compiling walproposer-lib"
|
||||
mkdir -p $(POSTGRES_INSTALL_DIR)/build/walproposer-lib
|
||||
$(MAKE) PG_CONFIG=$(POSTGRES_INSTALL_DIR)/v16/bin/pg_config CFLAGS='$(PG_CFLAGS) $(COPT)' \
|
||||
-C $(POSTGRES_INSTALL_DIR)/build/walproposer-lib \
|
||||
-f $(ROOT_PROJECT_DIR)/pgxn/neon/Makefile walproposer-lib
|
||||
cp $(POSTGRES_INSTALL_DIR)/v16/lib/libpgport.a $(POSTGRES_INSTALL_DIR)/build/walproposer-lib
|
||||
cp $(POSTGRES_INSTALL_DIR)/v16/lib/libpgcommon.a $(POSTGRES_INSTALL_DIR)/build/walproposer-lib
|
||||
ifeq ($(UNAME_S),Linux)
|
||||
$(AR) d $(POSTGRES_INSTALL_DIR)/build/walproposer-lib/libpgport.a \
|
||||
pg_strong_random.o
|
||||
$(AR) d $(POSTGRES_INSTALL_DIR)/build/walproposer-lib/libpgcommon.a \
|
||||
pg_crc32c.o \
|
||||
hmac_openssl.o \
|
||||
cryptohash_openssl.o \
|
||||
scram-common.o \
|
||||
md5_common.o \
|
||||
checksum_helper.o
|
||||
endif
|
||||
|
||||
.PHONY: walproposer-lib-clean
|
||||
walproposer-lib-clean:
|
||||
$(MAKE) PG_CONFIG=$(POSTGRES_INSTALL_DIR)/v16/bin/pg_config \
|
||||
-C $(POSTGRES_INSTALL_DIR)/build/walproposer-lib \
|
||||
-f $(ROOT_PROJECT_DIR)/pgxn/neon/Makefile clean
|
||||
|
||||
.PHONY: neon-pg-ext
|
||||
neon-pg-ext: \
|
||||
neon-pg-ext-v14 \
|
||||
|
||||
4
NOTICE
4
NOTICE
@@ -1,5 +1,5 @@
|
||||
Neon
|
||||
Copyright 2022 Neon Inc.
|
||||
|
||||
The PostgreSQL submodules in vendor/ are licensed under the PostgreSQL license.
|
||||
See vendor/postgres-vX/COPYRIGHT for details.
|
||||
The PostgreSQL submodules in vendor/postgres-v14 and vendor/postgres-v15 are licensed under the
|
||||
PostgreSQL license. See vendor/postgres-v14/COPYRIGHT and vendor/postgres-v15/COPYRIGHT.
|
||||
|
||||
@@ -156,7 +156,6 @@ fn main() -> Result<()> {
|
||||
let path = Path::new(sp);
|
||||
let file = File::open(path)?;
|
||||
spec = Some(serde_json::from_reader(file)?);
|
||||
live_config_allowed = true;
|
||||
} else if let Some(id) = compute_id {
|
||||
if let Some(cp_base) = control_plane_uri {
|
||||
live_config_allowed = true;
|
||||
@@ -278,26 +277,32 @@ fn main() -> Result<()> {
|
||||
if #[cfg(target_os = "linux")] {
|
||||
use std::env;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
let vm_monitor_addr = matches
|
||||
.get_one::<String>("vm-monitor-addr")
|
||||
.expect("--vm-monitor-addr should always be set because it has a default arg");
|
||||
use tracing::warn;
|
||||
let vm_monitor_addr = matches.get_one::<String>("vm-monitor-addr");
|
||||
let file_cache_connstr = matches.get_one::<String>("filecache-connstr");
|
||||
let cgroup = matches.get_one::<String>("cgroup");
|
||||
let file_cache_on_disk = matches.get_flag("file-cache-on-disk");
|
||||
|
||||
// Only make a runtime if we need to.
|
||||
// Note: it seems like you can make a runtime in an inner scope and
|
||||
// if you start a task in it it won't be dropped. However, make it
|
||||
// in the outermost scope just to be safe.
|
||||
let rt = if env::var_os("AUTOSCALING").is_some() {
|
||||
Some(
|
||||
let rt = match (env::var_os("AUTOSCALING"), vm_monitor_addr) {
|
||||
(None, None) => None,
|
||||
(None, Some(_)) => {
|
||||
warn!("--vm-monitor-addr option set but AUTOSCALING env var not present");
|
||||
None
|
||||
}
|
||||
(Some(_), None) => {
|
||||
panic!("AUTOSCALING env var present but --vm-monitor-addr option not set")
|
||||
}
|
||||
(Some(_), Some(_)) => Some(
|
||||
tokio::runtime::Builder::new_multi_thread()
|
||||
.worker_threads(4)
|
||||
.enable_all()
|
||||
.build()
|
||||
.expect("failed to create tokio runtime for monitor")
|
||||
)
|
||||
} else {
|
||||
None
|
||||
.expect("failed to create tokio runtime for monitor"),
|
||||
),
|
||||
};
|
||||
|
||||
// This token is used internally by the monitor to clean up all threads
|
||||
@@ -308,7 +313,8 @@ fn main() -> Result<()> {
|
||||
Box::leak(Box::new(vm_monitor::Args {
|
||||
cgroup: cgroup.cloned(),
|
||||
pgconnstr: file_cache_connstr.cloned(),
|
||||
addr: vm_monitor_addr.clone(),
|
||||
addr: vm_monitor_addr.cloned().unwrap(),
|
||||
file_cache_on_disk,
|
||||
})),
|
||||
token.clone(),
|
||||
))
|
||||
@@ -480,8 +486,6 @@ fn cli() -> clap::Command {
|
||||
.value_name("FILECACHE_CONNSTR"),
|
||||
)
|
||||
.arg(
|
||||
// DEPRECATED, NO LONGER DOES ANYTHING.
|
||||
// See https://github.com/neondatabase/cloud/issues/7516
|
||||
Arg::new("file-cache-on-disk")
|
||||
.long("file-cache-on-disk")
|
||||
.action(clap::ArgAction::SetTrue),
|
||||
|
||||
@@ -252,7 +252,7 @@ fn create_neon_superuser(spec: &ComputeSpec, client: &mut Client) -> Result<()>
|
||||
IF NOT EXISTS (
|
||||
SELECT FROM pg_catalog.pg_roles WHERE rolname = 'neon_superuser')
|
||||
THEN
|
||||
CREATE ROLE neon_superuser CREATEDB CREATEROLE NOLOGIN REPLICATION IN ROLE pg_read_all_data, pg_write_all_data;
|
||||
CREATE ROLE neon_superuser CREATEDB CREATEROLE NOLOGIN IN ROLE pg_read_all_data, pg_write_all_data;
|
||||
IF array_length(roles, 1) IS NOT NULL THEN
|
||||
EXECUTE format('GRANT neon_superuser TO %s',
|
||||
array_to_string(ARRAY(SELECT quote_ident(x) FROM unnest(roles) as x), ', '));
|
||||
@@ -692,11 +692,10 @@ impl ComputeNode {
|
||||
// Proceed with post-startup configuration. Note, that order of operations is important.
|
||||
let spec = &compute_state.pspec.as_ref().expect("spec must be set").spec;
|
||||
create_neon_superuser(spec, &mut client)?;
|
||||
cleanup_instance(&mut client)?;
|
||||
handle_roles(spec, &mut client)?;
|
||||
handle_databases(spec, &mut client)?;
|
||||
handle_role_deletions(spec, self.connstr.as_str(), &mut client)?;
|
||||
handle_grants(spec, &mut client, self.connstr.as_str())?;
|
||||
handle_grants(spec, self.connstr.as_str())?;
|
||||
handle_extensions(spec, &mut client)?;
|
||||
create_availability_check_data(&mut client)?;
|
||||
|
||||
@@ -732,11 +731,10 @@ impl ComputeNode {
|
||||
// Disable DDL forwarding because control plane already knows about these roles/databases.
|
||||
if spec.mode == ComputeMode::Primary {
|
||||
client.simple_query("SET neon.forward_ddl = false")?;
|
||||
cleanup_instance(&mut client)?;
|
||||
handle_roles(&spec, &mut client)?;
|
||||
handle_databases(&spec, &mut client)?;
|
||||
handle_role_deletions(&spec, self.connstr.as_str(), &mut client)?;
|
||||
handle_grants(&spec, &mut client, self.connstr.as_str())?;
|
||||
handle_grants(&spec, self.connstr.as_str())?;
|
||||
handle_extensions(&spec, &mut client)?;
|
||||
}
|
||||
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
use std::collections::HashMap;
|
||||
use std::fmt::Write;
|
||||
use std::fs;
|
||||
use std::fs::File;
|
||||
@@ -193,16 +192,11 @@ impl Escaping for PgIdent {
|
||||
/// Build a list of existing Postgres roles
|
||||
pub fn get_existing_roles(xact: &mut Transaction<'_>) -> Result<Vec<Role>> {
|
||||
let postgres_roles = xact
|
||||
.query(
|
||||
"SELECT rolname, rolpassword, rolreplication, rolbypassrls FROM pg_catalog.pg_authid",
|
||||
&[],
|
||||
)?
|
||||
.query("SELECT rolname, rolpassword FROM pg_catalog.pg_authid", &[])?
|
||||
.iter()
|
||||
.map(|row| Role {
|
||||
name: row.get("rolname"),
|
||||
encrypted_password: row.get("rolpassword"),
|
||||
replication: Some(row.get("rolreplication")),
|
||||
bypassrls: Some(row.get("rolbypassrls")),
|
||||
options: None,
|
||||
})
|
||||
.collect();
|
||||
@@ -211,37 +205,22 @@ pub fn get_existing_roles(xact: &mut Transaction<'_>) -> Result<Vec<Role>> {
|
||||
}
|
||||
|
||||
/// Build a list of existing Postgres databases
|
||||
pub fn get_existing_dbs(client: &mut Client) -> Result<HashMap<String, Database>> {
|
||||
// `pg_database.datconnlimit = -2` means that the database is in the
|
||||
// invalid state. See:
|
||||
// https://github.com/postgres/postgres/commit/a4b4cc1d60f7e8ccfcc8ff8cb80c28ee411ad9a9
|
||||
let postgres_dbs: Vec<Database> = client
|
||||
pub fn get_existing_dbs(client: &mut Client) -> Result<Vec<Database>> {
|
||||
let postgres_dbs = client
|
||||
.query(
|
||||
"SELECT
|
||||
datname AS name,
|
||||
datdba::regrole::text AS owner,
|
||||
NOT datallowconn AS restrict_conn,
|
||||
datconnlimit = - 2 AS invalid
|
||||
FROM
|
||||
pg_catalog.pg_database;",
|
||||
"SELECT datname, datdba::regrole::text as owner
|
||||
FROM pg_catalog.pg_database;",
|
||||
&[],
|
||||
)?
|
||||
.iter()
|
||||
.map(|row| Database {
|
||||
name: row.get("name"),
|
||||
name: row.get("datname"),
|
||||
owner: row.get("owner"),
|
||||
restrict_conn: row.get("restrict_conn"),
|
||||
invalid: row.get("invalid"),
|
||||
options: None,
|
||||
})
|
||||
.collect();
|
||||
|
||||
let dbs_map = postgres_dbs
|
||||
.iter()
|
||||
.map(|db| (db.name.clone(), db.clone()))
|
||||
.collect::<HashMap<_, _>>();
|
||||
|
||||
Ok(dbs_map)
|
||||
Ok(postgres_dbs)
|
||||
}
|
||||
|
||||
/// Wait for Postgres to become ready to accept connections. It's ready to
|
||||
|
||||
@@ -13,7 +13,7 @@ use crate::params::PG_HBA_ALL_MD5;
|
||||
use crate::pg_helpers::*;
|
||||
|
||||
use compute_api::responses::{ControlPlaneComputeStatus, ControlPlaneSpecResponse};
|
||||
use compute_api::spec::{ComputeSpec, PgIdent, Role};
|
||||
use compute_api::spec::{ComputeSpec, Database, PgIdent, Role};
|
||||
|
||||
// Do control plane request and return response if any. In case of error it
|
||||
// returns a bool flag indicating whether it makes sense to retry the request
|
||||
@@ -24,7 +24,7 @@ fn do_control_plane_request(
|
||||
) -> Result<ControlPlaneSpecResponse, (bool, String)> {
|
||||
let resp = reqwest::blocking::Client::new()
|
||||
.get(uri)
|
||||
.header("Authorization", format!("Bearer {}", jwt))
|
||||
.header("Authorization", jwt)
|
||||
.send()
|
||||
.map_err(|e| {
|
||||
(
|
||||
@@ -161,38 +161,6 @@ pub fn add_standby_signal(pgdata_path: &Path) -> Result<()> {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Compute could be unexpectedly shut down, for example, during the
|
||||
/// database dropping. This leaves the database in the invalid state,
|
||||
/// which prevents new db creation with the same name. This function
|
||||
/// will clean it up before proceeding with catalog updates. All
|
||||
/// possible future cleanup operations may go here too.
|
||||
#[instrument(skip_all)]
|
||||
pub fn cleanup_instance(client: &mut Client) -> Result<()> {
|
||||
let existing_dbs = get_existing_dbs(client)?;
|
||||
|
||||
for (_, db) in existing_dbs {
|
||||
if db.invalid {
|
||||
// After recent commit in Postgres, interrupted DROP DATABASE
|
||||
// leaves the database in the invalid state. According to the
|
||||
// commit message, the only option for user is to drop it again.
|
||||
// See:
|
||||
// https://github.com/postgres/postgres/commit/a4b4cc1d60f7e8ccfcc8ff8cb80c28ee411ad9a9
|
||||
//
|
||||
// Postgres Neon extension is done the way, that db is de-registered
|
||||
// in the control plane metadata only after it is dropped. So there is
|
||||
// a chance that it still thinks that db should exist. This means
|
||||
// that it will be re-created by `handle_databases()`. Yet, it's fine
|
||||
// as user can just repeat drop (in vanilla Postgres they would need
|
||||
// to do the same, btw).
|
||||
let query = format!("DROP DATABASE IF EXISTS {}", db.name.pg_quote());
|
||||
info!("dropping invalid database {}", db.name);
|
||||
client.execute(query.as_str(), &[])?;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Given a cluster spec json and open transaction it handles roles creation,
|
||||
/// deletion and update.
|
||||
#[instrument(skip_all)]
|
||||
@@ -265,8 +233,6 @@ pub fn handle_roles(spec: &ComputeSpec, client: &mut Client) -> Result<()> {
|
||||
let action = if let Some(r) = pg_role {
|
||||
if (r.encrypted_password.is_none() && role.encrypted_password.is_some())
|
||||
|| (r.encrypted_password.is_some() && role.encrypted_password.is_none())
|
||||
|| !r.bypassrls.unwrap_or(false)
|
||||
|| !r.replication.unwrap_or(false)
|
||||
{
|
||||
RoleAction::Update
|
||||
} else if let Some(pg_pwd) = &r.encrypted_password {
|
||||
@@ -298,14 +264,13 @@ pub fn handle_roles(spec: &ComputeSpec, client: &mut Client) -> Result<()> {
|
||||
match action {
|
||||
RoleAction::None => {}
|
||||
RoleAction::Update => {
|
||||
let mut query: String =
|
||||
format!("ALTER ROLE {} BYPASSRLS REPLICATION", name.pg_quote());
|
||||
let mut query: String = format!("ALTER ROLE {} ", name.pg_quote());
|
||||
query.push_str(&role.to_pg_options());
|
||||
xact.execute(query.as_str(), &[])?;
|
||||
}
|
||||
RoleAction::Create => {
|
||||
let mut query: String = format!(
|
||||
"CREATE ROLE {} CREATEROLE CREATEDB BYPASSRLS REPLICATION IN ROLE neon_superuser",
|
||||
"CREATE ROLE {} CREATEROLE CREATEDB BYPASSRLS IN ROLE neon_superuser",
|
||||
name.pg_quote()
|
||||
);
|
||||
info!("role create query: '{}'", &query);
|
||||
@@ -414,13 +379,13 @@ fn reassign_owned_objects(spec: &ComputeSpec, connstr: &str, role_name: &PgIdent
|
||||
/// which together provide us idempotency.
|
||||
#[instrument(skip_all)]
|
||||
pub fn handle_databases(spec: &ComputeSpec, client: &mut Client) -> Result<()> {
|
||||
let existing_dbs = get_existing_dbs(client)?;
|
||||
let existing_dbs: Vec<Database> = get_existing_dbs(client)?;
|
||||
|
||||
// Print a list of existing Postgres databases (only in debug mode)
|
||||
if span_enabled!(Level::INFO) {
|
||||
info!("postgres databases:");
|
||||
for (dbname, db) in &existing_dbs {
|
||||
info!(" {}:{}", dbname, db.owner);
|
||||
for r in &existing_dbs {
|
||||
info!(" {}:{}", r.name, r.owner);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -474,7 +439,8 @@ pub fn handle_databases(spec: &ComputeSpec, client: &mut Client) -> Result<()> {
|
||||
"rename_db" => {
|
||||
let new_name = op.new_name.as_ref().unwrap();
|
||||
|
||||
if existing_dbs.get(&op.name).is_some() {
|
||||
// XXX: with a limited number of roles it is fine, but consider making it a HashMap
|
||||
if existing_dbs.iter().any(|r| r.name == op.name) {
|
||||
let query: String = format!(
|
||||
"ALTER DATABASE {} RENAME TO {}",
|
||||
op.name.pg_quote(),
|
||||
@@ -491,12 +457,14 @@ pub fn handle_databases(spec: &ComputeSpec, client: &mut Client) -> Result<()> {
|
||||
}
|
||||
|
||||
// Refresh Postgres databases info to handle possible renames
|
||||
let existing_dbs = get_existing_dbs(client)?;
|
||||
let existing_dbs: Vec<Database> = get_existing_dbs(client)?;
|
||||
|
||||
info!("cluster spec databases:");
|
||||
for db in &spec.cluster.databases {
|
||||
let name = &db.name;
|
||||
let pg_db = existing_dbs.get(name);
|
||||
|
||||
// XXX: with a limited number of databases it is fine, but consider making it a HashMap
|
||||
let pg_db = existing_dbs.iter().find(|r| r.name == *name);
|
||||
|
||||
enum DatabaseAction {
|
||||
None,
|
||||
@@ -562,32 +530,13 @@ pub fn handle_databases(spec: &ComputeSpec, client: &mut Client) -> Result<()> {
|
||||
/// Grant CREATE ON DATABASE to the database owner and do some other alters and grants
|
||||
/// to allow users creating trusted extensions and re-creating `public` schema, for example.
|
||||
#[instrument(skip_all)]
|
||||
pub fn handle_grants(spec: &ComputeSpec, client: &mut Client, connstr: &str) -> Result<()> {
|
||||
info!("modifying database permissions");
|
||||
let existing_dbs = get_existing_dbs(client)?;
|
||||
pub fn handle_grants(spec: &ComputeSpec, connstr: &str) -> Result<()> {
|
||||
info!("cluster spec grants:");
|
||||
|
||||
// Do some per-database access adjustments. We'd better do this at db creation time,
|
||||
// but CREATE DATABASE isn't transactional. So we cannot create db + do some grants
|
||||
// atomically.
|
||||
for db in &spec.cluster.databases {
|
||||
match existing_dbs.get(&db.name) {
|
||||
Some(pg_db) => {
|
||||
if pg_db.restrict_conn || pg_db.invalid {
|
||||
info!(
|
||||
"skipping grants for db {} (invalid: {}, connections not allowed: {})",
|
||||
db.name, pg_db.invalid, pg_db.restrict_conn
|
||||
);
|
||||
continue;
|
||||
}
|
||||
}
|
||||
None => {
|
||||
bail!(
|
||||
"database {} doesn't exist in Postgres after handle_databases()",
|
||||
db.name
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
let mut conf = Config::from_str(connstr)?;
|
||||
conf.dbname(&db.name);
|
||||
|
||||
@@ -626,11 +575,6 @@ pub fn handle_grants(spec: &ComputeSpec, client: &mut Client, connstr: &str) ->
|
||||
|
||||
// Explicitly grant CREATE ON SCHEMA PUBLIC to the web_access user.
|
||||
// This is needed because since postgres 15 this privilege is removed by default.
|
||||
// TODO: web_access isn't created for almost 1 year. It could be that we have
|
||||
// active users of 1 year old projects, but hopefully not, so check it and
|
||||
// remove this code if possible. The worst thing that could happen is that
|
||||
// user won't be able to use public schema in NEW databases created in the
|
||||
// very OLD project.
|
||||
let grant_query = "DO $$\n\
|
||||
BEGIN\n\
|
||||
IF EXISTS(\n\
|
||||
|
||||
@@ -28,7 +28,7 @@ mod pg_helpers_tests {
|
||||
assert_eq!(
|
||||
spec.cluster.settings.as_pg_settings(),
|
||||
r#"fsync = off
|
||||
wal_level = logical
|
||||
wal_level = replica
|
||||
hot_standby = on
|
||||
neon.safekeepers = '127.0.0.1:6502,127.0.0.1:6503,127.0.0.1:6501'
|
||||
wal_log_hints = on
|
||||
|
||||
@@ -19,7 +19,7 @@ const COMMAND: &str = "attachment_service";
|
||||
pub struct AttachHookRequest {
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
pub tenant_id: TenantId,
|
||||
pub node_id: Option<NodeId>,
|
||||
pub pageserver_id: Option<NodeId>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
@@ -85,7 +85,7 @@ impl AttachmentService {
|
||||
.control_plane_api
|
||||
.clone()
|
||||
.unwrap()
|
||||
.join("attach-hook")
|
||||
.join("attach_hook")
|
||||
.unwrap();
|
||||
let client = reqwest::blocking::ClientBuilder::new()
|
||||
.build()
|
||||
@@ -93,7 +93,7 @@ impl AttachmentService {
|
||||
|
||||
let request = AttachHookRequest {
|
||||
tenant_id,
|
||||
node_id: Some(pageserver_id),
|
||||
pageserver_id: Some(pageserver_id),
|
||||
};
|
||||
|
||||
let response = client.post(url).json(&request).send()?;
|
||||
|
||||
@@ -86,7 +86,7 @@ where
|
||||
.stdout(process_log_file)
|
||||
.stderr(same_file_for_stderr)
|
||||
.args(args);
|
||||
let filled_cmd = fill_remote_storage_secrets_vars(fill_rust_env_vars(background_command));
|
||||
let filled_cmd = fill_aws_secrets_vars(fill_rust_env_vars(background_command));
|
||||
filled_cmd.envs(envs);
|
||||
|
||||
let pid_file_to_check = match initial_pid_file {
|
||||
@@ -238,13 +238,11 @@ fn fill_rust_env_vars(cmd: &mut Command) -> &mut Command {
|
||||
filled_cmd
|
||||
}
|
||||
|
||||
fn fill_remote_storage_secrets_vars(mut cmd: &mut Command) -> &mut Command {
|
||||
fn fill_aws_secrets_vars(mut cmd: &mut Command) -> &mut Command {
|
||||
for env_key in [
|
||||
"AWS_ACCESS_KEY_ID",
|
||||
"AWS_SECRET_ACCESS_KEY",
|
||||
"AWS_SESSION_TOKEN",
|
||||
"AZURE_STORAGE_ACCOUNT",
|
||||
"AZURE_STORAGE_ACCESS_KEY",
|
||||
] {
|
||||
if let Ok(value) = std::env::var(env_key) {
|
||||
cmd = cmd.env(env_key, value);
|
||||
|
||||
@@ -12,9 +12,7 @@ use hyper::{Body, Request, Response};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::{collections::HashMap, sync::Arc};
|
||||
use utils::http::endpoint::request_span;
|
||||
use utils::logging::{self, LogFormat};
|
||||
use utils::signals::{ShutdownSignals, Signal};
|
||||
|
||||
use utils::{
|
||||
http::{
|
||||
@@ -172,7 +170,7 @@ async fn handle_re_attach(mut req: Request<Body>) -> Result<Response<Body>, ApiE
|
||||
state.generation += 1;
|
||||
response.tenants.push(ReAttachResponseTenant {
|
||||
id: *t,
|
||||
gen: state.generation,
|
||||
generation: state.generation,
|
||||
});
|
||||
}
|
||||
}
|
||||
@@ -218,31 +216,14 @@ async fn handle_attach_hook(mut req: Request<Body>) -> Result<Response<Body>, Ap
|
||||
.tenants
|
||||
.entry(attach_req.tenant_id)
|
||||
.or_insert_with(|| TenantState {
|
||||
pageserver: attach_req.node_id,
|
||||
pageserver: attach_req.pageserver_id,
|
||||
generation: 0,
|
||||
});
|
||||
|
||||
if let Some(attaching_pageserver) = attach_req.node_id.as_ref() {
|
||||
if attach_req.pageserver_id.is_some() {
|
||||
tenant_state.generation += 1;
|
||||
tracing::info!(
|
||||
tenant_id = %attach_req.tenant_id,
|
||||
ps_id = %attaching_pageserver,
|
||||
generation = %tenant_state.generation,
|
||||
"issuing",
|
||||
);
|
||||
} else if let Some(ps_id) = tenant_state.pageserver {
|
||||
tracing::info!(
|
||||
tenant_id = %attach_req.tenant_id,
|
||||
%ps_id,
|
||||
generation = %tenant_state.generation,
|
||||
"dropping",
|
||||
);
|
||||
} else {
|
||||
tracing::info!(
|
||||
tenant_id = %attach_req.tenant_id,
|
||||
"no-op: tenant already has no pageserver");
|
||||
}
|
||||
tenant_state.pageserver = attach_req.node_id;
|
||||
tenant_state.pageserver = attach_req.pageserver_id;
|
||||
let generation = tenant_state.generation;
|
||||
|
||||
locked.save().await.map_err(ApiError::InternalServerError)?;
|
||||
@@ -250,7 +231,7 @@ async fn handle_attach_hook(mut req: Request<Body>) -> Result<Response<Body>, Ap
|
||||
json_response(
|
||||
StatusCode::OK,
|
||||
AttachHookResponse {
|
||||
gen: attach_req.node_id.map(|_| generation),
|
||||
gen: attach_req.pageserver_id.map(|_| generation),
|
||||
},
|
||||
)
|
||||
}
|
||||
@@ -258,9 +239,9 @@ async fn handle_attach_hook(mut req: Request<Body>) -> Result<Response<Body>, Ap
|
||||
fn make_router(persistent_state: PersistentState) -> RouterBuilder<hyper::Body, ApiError> {
|
||||
endpoint::make_router()
|
||||
.data(Arc::new(State::new(persistent_state)))
|
||||
.post("/re-attach", |r| request_span(r, handle_re_attach))
|
||||
.post("/validate", |r| request_span(r, handle_validate))
|
||||
.post("/attach-hook", |r| request_span(r, handle_attach_hook))
|
||||
.post("/re-attach", handle_re_attach)
|
||||
.post("/validate", handle_validate)
|
||||
.post("/attach_hook", handle_attach_hook)
|
||||
}
|
||||
|
||||
#[tokio::main]
|
||||
@@ -287,16 +268,7 @@ async fn main() -> anyhow::Result<()> {
|
||||
let server = hyper::Server::from_tcp(http_listener)?.serve(service);
|
||||
|
||||
tracing::info!("Serving on {0}", args.listen);
|
||||
|
||||
tokio::task::spawn(server);
|
||||
|
||||
ShutdownSignals::handle(|signal| match signal {
|
||||
Signal::Interrupt | Signal::Terminate | Signal::Quit => {
|
||||
tracing::info!("Got {}. Terminating", signal.name());
|
||||
// We're just a test helper: no graceful shutdown.
|
||||
std::process::exit(0);
|
||||
}
|
||||
})?;
|
||||
server.await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -116,7 +116,6 @@ fn main() -> Result<()> {
|
||||
"attachment_service" => handle_attachment_service(sub_args, &env),
|
||||
"safekeeper" => handle_safekeeper(sub_args, &env),
|
||||
"endpoint" => handle_endpoint(sub_args, &env),
|
||||
"mappings" => handle_mappings(sub_args, &mut env),
|
||||
"pg" => bail!("'pg' subcommand has been renamed to 'endpoint'"),
|
||||
_ => bail!("unexpected subcommand {sub_name}"),
|
||||
};
|
||||
@@ -798,24 +797,6 @@ fn handle_endpoint(ep_match: &ArgMatches, env: &local_env::LocalEnv) -> Result<(
|
||||
ep.start(&auth_token, safekeepers, remote_ext_config)?;
|
||||
}
|
||||
}
|
||||
"reconfigure" => {
|
||||
let endpoint_id = sub_args
|
||||
.get_one::<String>("endpoint_id")
|
||||
.ok_or_else(|| anyhow!("No endpoint ID provided to reconfigure"))?;
|
||||
let endpoint = cplane
|
||||
.endpoints
|
||||
.get(endpoint_id.as_str())
|
||||
.with_context(|| format!("postgres endpoint {endpoint_id} is not found"))?;
|
||||
let pageserver_id =
|
||||
if let Some(id_str) = sub_args.get_one::<String>("endpoint-pageserver-id") {
|
||||
Some(NodeId(
|
||||
id_str.parse().context("while parsing pageserver id")?,
|
||||
))
|
||||
} else {
|
||||
None
|
||||
};
|
||||
endpoint.reconfigure(pageserver_id)?;
|
||||
}
|
||||
"stop" => {
|
||||
let endpoint_id = sub_args
|
||||
.get_one::<String>("endpoint_id")
|
||||
@@ -835,38 +816,6 @@ fn handle_endpoint(ep_match: &ArgMatches, env: &local_env::LocalEnv) -> Result<(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_mappings(sub_match: &ArgMatches, env: &mut local_env::LocalEnv) -> Result<()> {
|
||||
let (sub_name, sub_args) = match sub_match.subcommand() {
|
||||
Some(ep_subcommand_data) => ep_subcommand_data,
|
||||
None => bail!("no mappings subcommand provided"),
|
||||
};
|
||||
|
||||
match sub_name {
|
||||
"map" => {
|
||||
let branch_name = sub_args
|
||||
.get_one::<String>("branch-name")
|
||||
.expect("branch-name argument missing");
|
||||
|
||||
let tenant_id = sub_args
|
||||
.get_one::<String>("tenant-id")
|
||||
.map(|x| TenantId::from_str(x))
|
||||
.expect("tenant-id argument missing")
|
||||
.expect("malformed tenant-id arg");
|
||||
|
||||
let timeline_id = sub_args
|
||||
.get_one::<String>("timeline-id")
|
||||
.map(|x| TimelineId::from_str(x))
|
||||
.expect("timeline-id argument missing")
|
||||
.expect("malformed timeline-id arg");
|
||||
|
||||
env.register_branch_mapping(branch_name.to_owned(), tenant_id, timeline_id)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
other => unimplemented!("mappings subcommand {other}"),
|
||||
}
|
||||
}
|
||||
|
||||
fn handle_pageserver(sub_match: &ArgMatches, env: &local_env::LocalEnv) -> Result<()> {
|
||||
fn get_pageserver(env: &local_env::LocalEnv, args: &ArgMatches) -> Result<PageServerNode> {
|
||||
let node_id = if let Some(id_str) = args.get_one::<String>("pageserver-id") {
|
||||
@@ -1135,7 +1084,6 @@ fn cli() -> Command {
|
||||
// --id, when using a pageserver command
|
||||
let pageserver_id_arg = Arg::new("pageserver-id")
|
||||
.long("id")
|
||||
.global(true)
|
||||
.help("pageserver id")
|
||||
.required(false);
|
||||
// --pageserver-id when using a non-pageserver command
|
||||
@@ -1306,20 +1254,17 @@ fn cli() -> Command {
|
||||
Command::new("pageserver")
|
||||
.arg_required_else_help(true)
|
||||
.about("Manage pageserver")
|
||||
.arg(pageserver_id_arg)
|
||||
.subcommand(Command::new("status"))
|
||||
.subcommand(Command::new("start")
|
||||
.about("Start local pageserver")
|
||||
.arg(pageserver_config_args.clone())
|
||||
)
|
||||
.subcommand(Command::new("stop")
|
||||
.about("Stop local pageserver")
|
||||
.arg(stop_mode_arg.clone())
|
||||
)
|
||||
.subcommand(Command::new("restart")
|
||||
.about("Restart local pageserver")
|
||||
.arg(pageserver_config_args.clone())
|
||||
)
|
||||
.arg(pageserver_id_arg.clone())
|
||||
.subcommand(Command::new("start").about("Start local pageserver")
|
||||
.arg(pageserver_id_arg.clone())
|
||||
.arg(pageserver_config_args.clone()))
|
||||
.subcommand(Command::new("stop").about("Stop local pageserver")
|
||||
.arg(pageserver_id_arg.clone())
|
||||
.arg(stop_mode_arg.clone()))
|
||||
.subcommand(Command::new("restart").about("Restart local pageserver")
|
||||
.arg(pageserver_id_arg.clone())
|
||||
.arg(pageserver_config_args.clone()))
|
||||
)
|
||||
.subcommand(
|
||||
Command::new("attachment_service")
|
||||
@@ -1376,8 +1321,8 @@ fn cli() -> Command {
|
||||
.about("Start postgres.\n If the endpoint doesn't exist yet, it is created.")
|
||||
.arg(endpoint_id_arg.clone())
|
||||
.arg(tenant_id_arg.clone())
|
||||
.arg(branch_name_arg.clone())
|
||||
.arg(timeline_id_arg.clone())
|
||||
.arg(branch_name_arg)
|
||||
.arg(timeline_id_arg)
|
||||
.arg(lsn_arg)
|
||||
.arg(pg_port_arg)
|
||||
.arg(http_port_arg)
|
||||
@@ -1387,16 +1332,10 @@ fn cli() -> Command {
|
||||
.arg(safekeepers_arg)
|
||||
.arg(remote_ext_config_args)
|
||||
)
|
||||
.subcommand(Command::new("reconfigure")
|
||||
.about("Reconfigure the endpoint")
|
||||
.arg(endpoint_pageserver_id_arg)
|
||||
.arg(endpoint_id_arg.clone())
|
||||
.arg(tenant_id_arg.clone())
|
||||
)
|
||||
.subcommand(
|
||||
Command::new("stop")
|
||||
.arg(endpoint_id_arg)
|
||||
.arg(tenant_id_arg.clone())
|
||||
.arg(tenant_id_arg)
|
||||
.arg(
|
||||
Arg::new("destroy")
|
||||
.help("Also delete data directory (now optional, should be default in future)")
|
||||
@@ -1407,18 +1346,6 @@ fn cli() -> Command {
|
||||
)
|
||||
|
||||
)
|
||||
.subcommand(
|
||||
Command::new("mappings")
|
||||
.arg_required_else_help(true)
|
||||
.about("Manage neon_local branch name mappings")
|
||||
.subcommand(
|
||||
Command::new("map")
|
||||
.about("Create new mapping which cannot exist already")
|
||||
.arg(branch_name_arg.clone())
|
||||
.arg(tenant_id_arg.clone())
|
||||
.arg(timeline_id_arg.clone())
|
||||
)
|
||||
)
|
||||
// Obsolete old name for 'endpoint'. We now just print an error if it's used.
|
||||
.subcommand(
|
||||
Command::new("pg")
|
||||
|
||||
@@ -253,7 +253,7 @@ impl Endpoint {
|
||||
conf.append("shared_buffers", "1MB");
|
||||
conf.append("fsync", "off");
|
||||
conf.append("max_connections", "100");
|
||||
conf.append("wal_level", "logical");
|
||||
conf.append("wal_level", "replica");
|
||||
// wal_sender_timeout is the maximum time to wait for WAL replication.
|
||||
// It also defines how often the walreciever will send a feedback message to the wal sender.
|
||||
conf.append("wal_sender_timeout", "5s");
|
||||
@@ -414,32 +414,16 @@ impl Endpoint {
|
||||
);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn wait_for_compute_ctl_to_exit(&self) -> Result<()> {
|
||||
// Also wait for the compute_ctl process to die. It might have some cleanup
|
||||
// work to do after postgres stops, like syncing safekeepers, etc.
|
||||
//
|
||||
// TODO use background_process::stop_process instead
|
||||
let pidfile_path = self.endpoint_path().join("compute_ctl.pid");
|
||||
let pid: u32 = std::fs::read_to_string(pidfile_path)?.parse()?;
|
||||
let pid = nix::unistd::Pid::from_raw(pid as i32);
|
||||
crate::background_process::wait_until_stopped("compute_ctl", pid)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn read_postgresql_conf(&self) -> Result<String> {
|
||||
// Slurp the endpoints/<endpoint id>/postgresql.conf file into
|
||||
// memory. We will include it in the spec file that we pass to
|
||||
// `compute_ctl`, and `compute_ctl` will write it to the postgresql.conf
|
||||
// in the data directory.
|
||||
let postgresql_conf_path = self.endpoint_path().join("postgresql.conf");
|
||||
match std::fs::read(&postgresql_conf_path) {
|
||||
Ok(content) => Ok(String::from_utf8(content)?),
|
||||
Err(e) if e.kind() == std::io::ErrorKind::NotFound => Ok("".to_string()),
|
||||
Err(e) => Err(anyhow::Error::new(e).context(format!(
|
||||
"failed to read config file in {}",
|
||||
postgresql_conf_path.to_str().unwrap()
|
||||
))),
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn start(
|
||||
@@ -452,7 +436,21 @@ impl Endpoint {
|
||||
anyhow::bail!("The endpoint is already running");
|
||||
}
|
||||
|
||||
let postgresql_conf = self.read_postgresql_conf()?;
|
||||
// Slurp the endpoints/<endpoint id>/postgresql.conf file into
|
||||
// memory. We will include it in the spec file that we pass to
|
||||
// `compute_ctl`, and `compute_ctl` will write it to the postgresql.conf
|
||||
// in the data directory.
|
||||
let postgresql_conf_path = self.endpoint_path().join("postgresql.conf");
|
||||
let postgresql_conf = match std::fs::read(&postgresql_conf_path) {
|
||||
Ok(content) => String::from_utf8(content)?,
|
||||
Err(e) if e.kind() == std::io::ErrorKind::NotFound => "".to_string(),
|
||||
Err(e) => {
|
||||
return Err(anyhow::Error::new(e).context(format!(
|
||||
"failed to read config file in {}",
|
||||
postgresql_conf_path.to_str().unwrap()
|
||||
)))
|
||||
}
|
||||
};
|
||||
|
||||
// We always start the compute node from scratch, so if the Postgres
|
||||
// data dir exists from a previous launch, remove it first.
|
||||
@@ -623,61 +621,6 @@ impl Endpoint {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn reconfigure(&self, pageserver_id: Option<NodeId>) -> Result<()> {
|
||||
let mut spec: ComputeSpec = {
|
||||
let spec_path = self.endpoint_path().join("spec.json");
|
||||
let file = std::fs::File::open(spec_path)?;
|
||||
serde_json::from_reader(file)?
|
||||
};
|
||||
|
||||
let postgresql_conf = self.read_postgresql_conf()?;
|
||||
spec.cluster.postgresql_conf = Some(postgresql_conf);
|
||||
|
||||
if let Some(pageserver_id) = pageserver_id {
|
||||
let endpoint_config_path = self.endpoint_path().join("endpoint.json");
|
||||
let mut endpoint_conf: EndpointConf = {
|
||||
let file = std::fs::File::open(&endpoint_config_path)?;
|
||||
serde_json::from_reader(file)?
|
||||
};
|
||||
endpoint_conf.pageserver_id = pageserver_id;
|
||||
std::fs::write(
|
||||
endpoint_config_path,
|
||||
serde_json::to_string_pretty(&endpoint_conf)?,
|
||||
)?;
|
||||
|
||||
let pageserver =
|
||||
PageServerNode::from_env(&self.env, self.env.get_pageserver_conf(pageserver_id)?);
|
||||
let ps_http_conf = &pageserver.pg_connection_config;
|
||||
let (host, port) = (ps_http_conf.host(), ps_http_conf.port());
|
||||
spec.pageserver_connstring = Some(format!("postgresql://no_user@{host}:{port}"));
|
||||
}
|
||||
|
||||
let client = reqwest::blocking::Client::new();
|
||||
let response = client
|
||||
.post(format!(
|
||||
"http://{}:{}/configure",
|
||||
self.http_address.ip(),
|
||||
self.http_address.port()
|
||||
))
|
||||
.body(format!(
|
||||
"{{\"spec\":{}}}",
|
||||
serde_json::to_string_pretty(&spec)?
|
||||
))
|
||||
.send()?;
|
||||
|
||||
let status = response.status();
|
||||
if !(status.is_client_error() || status.is_server_error()) {
|
||||
Ok(())
|
||||
} else {
|
||||
let url = response.url().to_owned();
|
||||
let msg = match response.text() {
|
||||
Ok(err_body) => format!("Error: {}", err_body),
|
||||
Err(_) => format!("Http error ({}) at {}.", status.as_u16(), url),
|
||||
};
|
||||
Err(anyhow::anyhow!(msg))
|
||||
}
|
||||
}
|
||||
|
||||
pub fn stop(&self, destroy: bool) -> Result<()> {
|
||||
// If we are going to destroy data directory,
|
||||
// use immediate shutdown mode, otherwise,
|
||||
@@ -686,25 +629,15 @@ impl Endpoint {
|
||||
// Postgres is always started from scratch, so stop
|
||||
// without destroy only used for testing and debugging.
|
||||
//
|
||||
self.pg_ctl(
|
||||
if destroy {
|
||||
&["-m", "immediate", "stop"]
|
||||
} else {
|
||||
&["stop"]
|
||||
},
|
||||
&None,
|
||||
)?;
|
||||
|
||||
// Also wait for the compute_ctl process to die. It might have some cleanup
|
||||
// work to do after postgres stops, like syncing safekeepers, etc.
|
||||
//
|
||||
self.wait_for_compute_ctl_to_exit()?;
|
||||
if destroy {
|
||||
self.pg_ctl(&["-m", "immediate", "stop"], &None)?;
|
||||
println!(
|
||||
"Destroying postgres data directory '{}'",
|
||||
self.pgdata().to_str().unwrap()
|
||||
);
|
||||
std::fs::remove_dir_all(self.endpoint_path())?;
|
||||
} else {
|
||||
self.pg_ctl(&["stop"], &None)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -25,7 +25,7 @@
|
||||
},
|
||||
{
|
||||
"name": "wal_level",
|
||||
"value": "logical",
|
||||
"value": "replica",
|
||||
"vartype": "enum"
|
||||
},
|
||||
{
|
||||
|
||||
@@ -188,60 +188,11 @@ that.
|
||||
|
||||
## Error message style
|
||||
|
||||
### PostgreSQL extensions
|
||||
|
||||
PostgreSQL has a style guide for writing error messages:
|
||||
|
||||
https://www.postgresql.org/docs/current/error-style-guide.html
|
||||
|
||||
Follow that guide when writing error messages in the PostgreSQL
|
||||
extensions.
|
||||
|
||||
### Neon Rust code
|
||||
|
||||
#### Anyhow Context
|
||||
|
||||
When adding anyhow `context()`, use form `present-tense-verb+action`.
|
||||
|
||||
Example:
|
||||
- Bad: `file.metadata().context("could not get file metadata")?;`
|
||||
- Good: `file.metadata().context("get file metadata")?;`
|
||||
|
||||
#### Logging Errors
|
||||
|
||||
When logging any error `e`, use `could not {e:#}` or `failed to {e:#}`.
|
||||
|
||||
If `e` is an `anyhow` error and you want to log the backtrace that it contains,
|
||||
use `{e:?}` instead of `{e:#}`.
|
||||
|
||||
#### Rationale
|
||||
|
||||
The `{:#}` ("alternate Display") of an `anyhow` error chain is concatenation fo the contexts, using `: `.
|
||||
|
||||
For example, the following Rust code will result in output
|
||||
```
|
||||
ERROR failed to list users: load users from server: parse response: invalid json
|
||||
```
|
||||
|
||||
This is more concise / less noisy than what happens if you do `.context("could not ...")?` at each level, i.e.:
|
||||
|
||||
```
|
||||
ERROR could not list users: could not load users from server: could not parse response: invalid json
|
||||
```
|
||||
|
||||
|
||||
```rust
|
||||
fn main() {
|
||||
match list_users().context("list users") else {
|
||||
Ok(_) => ...,
|
||||
Err(e) => tracing::error!("failed to {e:#}"),
|
||||
}
|
||||
}
|
||||
fn list_users() {
|
||||
http_get_users().context("load users from server")?;
|
||||
}
|
||||
fn http_get_users() {
|
||||
let response = client....?;
|
||||
response.parse().context("parse response")?; // fails with serde error "invalid json"
|
||||
}
|
||||
```
|
||||
extension. We don't follow it strictly in the pageserver and
|
||||
safekeeper, but the advice in the PostgreSQL style guide is generally
|
||||
good, and you can't go wrong by following it.
|
||||
|
||||
@@ -96,16 +96,6 @@ prefix_in_bucket = '/test_prefix/'
|
||||
|
||||
`AWS_SECRET_ACCESS_KEY` and `AWS_ACCESS_KEY_ID` env variables can be used to specify the S3 credentials if needed.
|
||||
|
||||
or
|
||||
|
||||
```toml
|
||||
[remote_storage]
|
||||
container_name = 'some-container-name'
|
||||
container_region = 'us-east'
|
||||
prefix_in_container = '/test-prefix/'
|
||||
```
|
||||
|
||||
`AZURE_STORAGE_ACCOUNT` and `AZURE_STORAGE_ACCESS_KEY` env variables can be used to specify the azure credentials if needed.
|
||||
|
||||
## Repository background tasks
|
||||
|
||||
|
||||
@@ -1,108 +0,0 @@
|
||||
# Updating Postgres
|
||||
|
||||
## Minor Versions
|
||||
|
||||
When upgrading to a new minor version of Postgres, please follow these steps:
|
||||
|
||||
_Example: 15.4 is the new minor version to upgrade to from 15.3._
|
||||
|
||||
1. Clone the Neon Postgres repository if you have not done so already.
|
||||
|
||||
```shell
|
||||
git clone git@github.com:neondatabase/postgres.git
|
||||
```
|
||||
|
||||
1. Add the Postgres upstream remote.
|
||||
|
||||
```shell
|
||||
git remote add upstream https://git.postgresql.org/git/postgresql.git
|
||||
```
|
||||
|
||||
1. Create a new branch based on the stable branch you are updating.
|
||||
|
||||
```shell
|
||||
git checkout -b my-branch REL_15_STABLE_neon
|
||||
```
|
||||
|
||||
1. Tag the last commit on the stable branch you are updating.
|
||||
|
||||
```shell
|
||||
git tag REL_15_3_neon
|
||||
```
|
||||
|
||||
1. Push the new tag to the Neon Postgres repository.
|
||||
|
||||
```shell
|
||||
git push origin REL_15_3_neon
|
||||
```
|
||||
|
||||
1. Find the release tags you're looking for. They are of the form `REL_X_Y`.
|
||||
|
||||
1. Rebase the branch you created on the tag and resolve any conflicts.
|
||||
|
||||
```shell
|
||||
git fetch upstream REL_15_4
|
||||
git rebase REL_15_4
|
||||
```
|
||||
|
||||
1. Run the Postgres test suite to make sure our commits have not affected
|
||||
Postgres in a negative way.
|
||||
|
||||
```shell
|
||||
make check
|
||||
# OR
|
||||
meson test -C builddir
|
||||
```
|
||||
|
||||
1. Push your branch to the Neon Postgres repository.
|
||||
|
||||
```shell
|
||||
git push origin my-branch
|
||||
```
|
||||
|
||||
1. Clone the Neon repository if you have not done so already.
|
||||
|
||||
```shell
|
||||
git clone git@github.com:neondatabase/neon.git
|
||||
```
|
||||
|
||||
1. Create a new branch.
|
||||
|
||||
1. Change the `revisions.json` file to point at the HEAD of your Postgres
|
||||
branch.
|
||||
|
||||
1. Update the Git submodule.
|
||||
|
||||
```shell
|
||||
git submodule set-branch --branch my-branch vendor/postgres-v15
|
||||
git submodule update --remote vendor/postgres-v15
|
||||
```
|
||||
|
||||
1. Run the Neon test suite to make sure that Neon is still good to go on this
|
||||
minor Postgres release.
|
||||
|
||||
```shell
|
||||
./scripts/poetry -k pg15
|
||||
```
|
||||
|
||||
1. Commit your changes.
|
||||
|
||||
1. Create a pull request, and wait for CI to go green.
|
||||
|
||||
1. Force push the rebased Postgres branches into the Neon Postgres repository.
|
||||
|
||||
```shell
|
||||
git push --force origin my-branch:REL_15_STABLE_neon
|
||||
```
|
||||
|
||||
It may require disabling various branch protections.
|
||||
|
||||
1. Update your Neon PR to point at the branches.
|
||||
|
||||
```shell
|
||||
git submodule set-branch --branch REL_15_STABLE_neon vendor/postgres-v15
|
||||
git commit --amend --no-edit
|
||||
git push --force origin
|
||||
```
|
||||
|
||||
1. Merge the pull request after getting approval(s) and CI completion.
|
||||
@@ -190,8 +190,6 @@ pub struct DeltaOp {
|
||||
pub struct Role {
|
||||
pub name: PgIdent,
|
||||
pub encrypted_password: Option<String>,
|
||||
pub replication: Option<bool>,
|
||||
pub bypassrls: Option<bool>,
|
||||
pub options: GenericOptions,
|
||||
}
|
||||
|
||||
@@ -202,12 +200,6 @@ pub struct Database {
|
||||
pub name: PgIdent,
|
||||
pub owner: PgIdent,
|
||||
pub options: GenericOptions,
|
||||
// These are derived flags, not present in the spec file.
|
||||
// They are never set by the control plane.
|
||||
#[serde(skip_deserializing, default)]
|
||||
pub restrict_conn: bool,
|
||||
#[serde(skip_deserializing, default)]
|
||||
pub invalid: bool,
|
||||
}
|
||||
|
||||
/// Common type representing both SQL statement params with or without value,
|
||||
|
||||
@@ -76,7 +76,7 @@
|
||||
},
|
||||
{
|
||||
"name": "wal_level",
|
||||
"value": "logical",
|
||||
"value": "replica",
|
||||
"vartype": "enum"
|
||||
},
|
||||
{
|
||||
|
||||
@@ -89,14 +89,14 @@ pub const DISK_WRITE_SECONDS_BUCKETS: &[f64] = &[
|
||||
0.000_050, 0.000_100, 0.000_500, 0.001, 0.003, 0.005, 0.01, 0.05, 0.1, 0.3, 0.5,
|
||||
];
|
||||
|
||||
pub fn set_build_info_metric(revision: &str, build_tag: &str) {
|
||||
pub fn set_build_info_metric(revision: &str) {
|
||||
let metric = register_int_gauge_vec!(
|
||||
"libmetrics_build_info",
|
||||
"Build/version information",
|
||||
&["revision", "build_tag"]
|
||||
&["revision"]
|
||||
)
|
||||
.expect("Failed to register build info metric");
|
||||
metric.with_label_values(&[revision, build_tag]).set(1);
|
||||
metric.with_label_values(&[revision]).set(1);
|
||||
}
|
||||
|
||||
// Records I/O stats in a "cross-platform" way.
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
use std::io::{Read, Result, Write};
|
||||
|
||||
/// A wrapper for an object implementing [Read]
|
||||
/// A wrapper for an object implementing [Read](std::io::Read)
|
||||
/// which allows a closure to observe the amount of bytes read.
|
||||
/// This is useful in conjunction with metrics (e.g. [IntCounter](crate::IntCounter)).
|
||||
///
|
||||
@@ -51,17 +51,17 @@ impl<'a, T> CountedReader<'a, T> {
|
||||
}
|
||||
}
|
||||
|
||||
/// Get an immutable reference to the underlying [Read] implementor
|
||||
/// Get an immutable reference to the underlying [Read](std::io::Read) implementor
|
||||
pub fn inner(&self) -> &T {
|
||||
&self.reader
|
||||
}
|
||||
|
||||
/// Get a mutable reference to the underlying [Read] implementor
|
||||
/// Get a mutable reference to the underlying [Read](std::io::Read) implementor
|
||||
pub fn inner_mut(&mut self) -> &mut T {
|
||||
&mut self.reader
|
||||
}
|
||||
|
||||
/// Consume the wrapper and return the underlying [Read] implementor
|
||||
/// Consume the wrapper and return the underlying [Read](std::io::Read) implementor
|
||||
pub fn into_inner(self) -> T {
|
||||
self.reader
|
||||
}
|
||||
@@ -75,7 +75,7 @@ impl<T: Read> Read for CountedReader<'_, T> {
|
||||
}
|
||||
}
|
||||
|
||||
/// A wrapper for an object implementing [Write]
|
||||
/// A wrapper for an object implementing [Write](std::io::Write)
|
||||
/// which allows a closure to observe the amount of bytes written.
|
||||
/// This is useful in conjunction with metrics (e.g. [IntCounter](crate::IntCounter)).
|
||||
///
|
||||
@@ -122,17 +122,17 @@ impl<'a, T> CountedWriter<'a, T> {
|
||||
}
|
||||
}
|
||||
|
||||
/// Get an immutable reference to the underlying [Write] implementor
|
||||
/// Get an immutable reference to the underlying [Write](std::io::Write) implementor
|
||||
pub fn inner(&self) -> &T {
|
||||
&self.writer
|
||||
}
|
||||
|
||||
/// Get a mutable reference to the underlying [Write] implementor
|
||||
/// Get a mutable reference to the underlying [Write](std::io::Write) implementor
|
||||
pub fn inner_mut(&mut self) -> &mut T {
|
||||
&mut self.writer
|
||||
}
|
||||
|
||||
/// Consume the wrapper and return the underlying [Write] implementor
|
||||
/// Consume the wrapper and return the underlying [Write](std::io::Write) implementor
|
||||
pub fn into_inner(self) -> T {
|
||||
self.writer
|
||||
}
|
||||
|
||||
@@ -17,7 +17,7 @@ pub struct ReAttachRequest {
|
||||
pub struct ReAttachResponseTenant {
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
pub id: TenantId,
|
||||
pub gen: u32,
|
||||
pub generation: u32,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
|
||||
@@ -110,6 +110,7 @@ impl TenantState {
|
||||
// So, return `Maybe` while Attaching, making Console wait for the attach task to finish.
|
||||
Self::Attaching | Self::Activating(ActivatingFrom::Attaching) => Maybe,
|
||||
// tenant mgr startup distinguishes attaching from loading via marker file.
|
||||
// If it's loading, there is no attach marker file, i.e., attach had finished in the past.
|
||||
Self::Loading | Self::Activating(ActivatingFrom::Loading) => Attached,
|
||||
// We only reach Active after successful load / attach.
|
||||
// So, call atttachment status Attached.
|
||||
|
||||
@@ -22,9 +22,9 @@ use postgres_ffi::Oid;
|
||||
/// [See more related comments here](https:///github.com/postgres/postgres/blob/99c5852e20a0987eca1c38ba0c09329d4076b6a0/src/include/storage/relfilenode.h#L57).
|
||||
///
|
||||
// FIXME: should move 'forknum' as last field to keep this consistent with Postgres.
|
||||
// Then we could replace the custom Ord and PartialOrd implementations below with
|
||||
// deriving them. This will require changes in walredoproc.c.
|
||||
#[derive(Debug, PartialEq, Eq, Hash, Clone, Copy, Serialize)]
|
||||
// Then we could replace the custo Ord and PartialOrd implementations below with
|
||||
// deriving them.
|
||||
#[derive(Debug, PartialEq, Eq, Hash, Clone, Copy, Serialize, Deserialize)]
|
||||
pub struct RelTag {
|
||||
pub forknum: u8,
|
||||
pub spcnode: Oid,
|
||||
@@ -40,9 +40,21 @@ impl PartialOrd for RelTag {
|
||||
|
||||
impl Ord for RelTag {
|
||||
fn cmp(&self, other: &Self) -> Ordering {
|
||||
// Custom ordering where we put forknum to the end of the list
|
||||
let other_tup = (other.spcnode, other.dbnode, other.relnode, other.forknum);
|
||||
(self.spcnode, self.dbnode, self.relnode, self.forknum).cmp(&other_tup)
|
||||
let mut cmp = self.spcnode.cmp(&other.spcnode);
|
||||
if cmp != Ordering::Equal {
|
||||
return cmp;
|
||||
}
|
||||
cmp = self.dbnode.cmp(&other.dbnode);
|
||||
if cmp != Ordering::Equal {
|
||||
return cmp;
|
||||
}
|
||||
cmp = self.relnode.cmp(&other.relnode);
|
||||
if cmp != Ordering::Equal {
|
||||
return cmp;
|
||||
}
|
||||
cmp = self.forknum.cmp(&other.forknum);
|
||||
|
||||
cmp
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -19,8 +19,8 @@ use tracing::{debug, error, info, trace};
|
||||
|
||||
use pq_proto::framed::{ConnectionError, Framed, FramedReader, FramedWriter};
|
||||
use pq_proto::{
|
||||
BeMessage, FeMessage, FeStartupPacket, ProtocolError, SQLSTATE_ADMIN_SHUTDOWN,
|
||||
SQLSTATE_INTERNAL_ERROR, SQLSTATE_SUCCESSFUL_COMPLETION,
|
||||
BeMessage, FeMessage, FeStartupPacket, ProtocolError, SQLSTATE_INTERNAL_ERROR,
|
||||
SQLSTATE_SUCCESSFUL_COMPLETION,
|
||||
};
|
||||
|
||||
/// An error, occurred during query processing:
|
||||
@@ -30,9 +30,6 @@ pub enum QueryError {
|
||||
/// The connection was lost while processing the query.
|
||||
#[error(transparent)]
|
||||
Disconnected(#[from] ConnectionError),
|
||||
/// We were instructed to shutdown while processing the query
|
||||
#[error("Shutting down")]
|
||||
Shutdown,
|
||||
/// Some other error
|
||||
#[error(transparent)]
|
||||
Other(#[from] anyhow::Error),
|
||||
@@ -47,8 +44,7 @@ impl From<io::Error> for QueryError {
|
||||
impl QueryError {
|
||||
pub fn pg_error_code(&self) -> &'static [u8; 5] {
|
||||
match self {
|
||||
Self::Disconnected(_) => b"08006", // connection failure
|
||||
Self::Shutdown => SQLSTATE_ADMIN_SHUTDOWN,
|
||||
Self::Disconnected(_) => b"08006", // connection failure
|
||||
Self::Other(_) => SQLSTATE_INTERNAL_ERROR, // internal error
|
||||
}
|
||||
}
|
||||
@@ -242,7 +238,6 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> MaybeWriteOnly<IO> {
|
||||
}
|
||||
}
|
||||
|
||||
/// Cancellation safe as long as the underlying IO is cancellation safe.
|
||||
async fn shutdown(&mut self) -> io::Result<()> {
|
||||
match self {
|
||||
MaybeWriteOnly::Full(framed) => framed.shutdown().await,
|
||||
@@ -394,37 +389,14 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> PostgresBackend<IO> {
|
||||
shutdown_watcher: F,
|
||||
) -> Result<(), QueryError>
|
||||
where
|
||||
F: Fn() -> S + Clone,
|
||||
F: Fn() -> S,
|
||||
S: Future,
|
||||
{
|
||||
let ret = self
|
||||
.run_message_loop(handler, shutdown_watcher.clone())
|
||||
.await;
|
||||
|
||||
tokio::select! {
|
||||
_ = shutdown_watcher() => {
|
||||
// do nothing; we most likely got already stopped by shutdown and will log it next.
|
||||
}
|
||||
_ = self.framed.shutdown() => {
|
||||
// socket might be already closed, e.g. if previously received error,
|
||||
// so ignore result.
|
||||
},
|
||||
}
|
||||
|
||||
match ret {
|
||||
Ok(()) => Ok(()),
|
||||
Err(QueryError::Shutdown) => {
|
||||
info!("Stopped due to shutdown");
|
||||
Ok(())
|
||||
}
|
||||
Err(QueryError::Disconnected(e)) => {
|
||||
info!("Disconnected ({e:#})");
|
||||
// Disconnection is not an error: we just use it that way internally to drop
|
||||
// out of loops.
|
||||
Ok(())
|
||||
}
|
||||
e => e,
|
||||
}
|
||||
let ret = self.run_message_loop(handler, shutdown_watcher).await;
|
||||
// socket might be already closed, e.g. if previously received error,
|
||||
// so ignore result.
|
||||
self.framed.shutdown().await.ok();
|
||||
ret
|
||||
}
|
||||
|
||||
async fn run_message_loop<F, S>(
|
||||
@@ -444,11 +416,15 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> PostgresBackend<IO> {
|
||||
_ = shutdown_watcher() => {
|
||||
// We were requested to shut down.
|
||||
tracing::info!("shutdown request received during handshake");
|
||||
return Err(QueryError::Shutdown)
|
||||
return Ok(())
|
||||
},
|
||||
|
||||
handshake_r = self.handshake(handler) => {
|
||||
handshake_r?;
|
||||
result = self.handshake(handler) => {
|
||||
// Handshake complete.
|
||||
result?;
|
||||
if self.state == ProtoState::Closed {
|
||||
return Ok(()); // EOF during handshake
|
||||
}
|
||||
}
|
||||
);
|
||||
|
||||
@@ -459,34 +435,17 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> PostgresBackend<IO> {
|
||||
_ = shutdown_watcher() => {
|
||||
// We were requested to shut down.
|
||||
tracing::info!("shutdown request received in run_message_loop");
|
||||
return Err(QueryError::Shutdown)
|
||||
Ok(None)
|
||||
},
|
||||
msg = self.read_message() => { msg },
|
||||
)? {
|
||||
trace!("got message {:?}", msg);
|
||||
|
||||
let result = self.process_message(handler, msg, &mut query_string).await;
|
||||
tokio::select!(
|
||||
biased;
|
||||
_ = shutdown_watcher() => {
|
||||
// We were requested to shut down.
|
||||
tracing::info!("shutdown request received during response flush");
|
||||
|
||||
// If we exited process_message with a shutdown error, there may be
|
||||
// some valid response content on in our transmit buffer: permit sending
|
||||
// this within a short timeout. This is a best effort thing so we don't
|
||||
// care about the result.
|
||||
tokio::time::timeout(std::time::Duration::from_millis(500), self.flush()).await.ok();
|
||||
|
||||
return Err(QueryError::Shutdown)
|
||||
},
|
||||
flush_r = self.flush() => {
|
||||
flush_r?;
|
||||
}
|
||||
);
|
||||
|
||||
self.flush().await?;
|
||||
match result? {
|
||||
ProcessMsgResult::Continue => {
|
||||
self.flush().await?;
|
||||
continue;
|
||||
}
|
||||
ProcessMsgResult::Break => break,
|
||||
@@ -591,9 +550,7 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> PostgresBackend<IO> {
|
||||
self.peer_addr
|
||||
);
|
||||
self.state = ProtoState::Closed;
|
||||
return Err(QueryError::Disconnected(ConnectionError::Protocol(
|
||||
ProtocolError::Protocol("EOF during handshake".to_string()),
|
||||
)));
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -632,9 +589,7 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> PostgresBackend<IO> {
|
||||
self.peer_addr
|
||||
);
|
||||
self.state = ProtoState::Closed;
|
||||
return Err(QueryError::Disconnected(ConnectionError::Protocol(
|
||||
ProtocolError::Protocol("EOF during auth".to_string()),
|
||||
)));
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -958,7 +913,6 @@ impl<'a, IO: AsyncRead + AsyncWrite + Unpin> AsyncWrite for CopyDataWriter<'a, I
|
||||
pub fn short_error(e: &QueryError) -> String {
|
||||
match e {
|
||||
QueryError::Disconnected(connection_error) => connection_error.to_string(),
|
||||
QueryError::Shutdown => "shutdown".to_string(),
|
||||
QueryError::Other(e) => format!("{e:#}"),
|
||||
}
|
||||
}
|
||||
@@ -975,9 +929,6 @@ fn log_query_error(query: &str, e: &QueryError) {
|
||||
QueryError::Disconnected(other_connection_error) => {
|
||||
error!("query handler for '{query}' failed with connection error: {other_connection_error:?}")
|
||||
}
|
||||
QueryError::Shutdown => {
|
||||
info!("query handler for '{query}' cancelled during tenant shutdown")
|
||||
}
|
||||
QueryError::Other(e) => {
|
||||
error!("query handler for '{query}' failed: {e:?}");
|
||||
}
|
||||
|
||||
@@ -131,7 +131,6 @@ pub const MAX_SEND_SIZE: usize = XLOG_BLCKSZ * 16;
|
||||
|
||||
// Export some version independent functions that are used outside of this mod
|
||||
pub use v14::xlog_utils::encode_logical_message;
|
||||
pub use v14::xlog_utils::from_pg_timestamp;
|
||||
pub use v14::xlog_utils::get_current_timestamp;
|
||||
pub use v14::xlog_utils::to_pg_timestamp;
|
||||
pub use v14::xlog_utils::XLogFileName;
|
||||
|
||||
@@ -220,10 +220,6 @@ pub const XLOG_CHECKPOINT_ONLINE: u8 = 0x10;
|
||||
pub const XLP_FIRST_IS_CONTRECORD: u16 = 0x0001;
|
||||
pub const XLP_LONG_HEADER: u16 = 0x0002;
|
||||
|
||||
/* From replication/slot.h */
|
||||
pub const REPL_SLOT_ON_DISK_OFFSETOF_RESTART_LSN: usize = 4*4 /* offset of `slotdata` in ReplicationSlotOnDisk */
|
||||
+ 64 /* NameData */ + 4*4;
|
||||
|
||||
/* From fsm_internals.h */
|
||||
const FSM_NODES_PER_PAGE: usize = BLCKSZ as usize - SIZEOF_PAGE_HEADER_DATA - 4;
|
||||
const FSM_NON_LEAF_NODES_PER_PAGE: usize = BLCKSZ as usize / 2 - 1;
|
||||
|
||||
@@ -136,42 +136,21 @@ pub fn get_current_timestamp() -> TimestampTz {
|
||||
to_pg_timestamp(SystemTime::now())
|
||||
}
|
||||
|
||||
// Module to reduce the scope of the constants
|
||||
mod timestamp_conversions {
|
||||
use std::time::Duration;
|
||||
|
||||
use super::*;
|
||||
|
||||
const UNIX_EPOCH_JDATE: u64 = 2440588; // == date2j(1970, 1, 1)
|
||||
const POSTGRES_EPOCH_JDATE: u64 = 2451545; // == date2j(2000, 1, 1)
|
||||
pub fn to_pg_timestamp(time: SystemTime) -> TimestampTz {
|
||||
const UNIX_EPOCH_JDATE: u64 = 2440588; /* == date2j(1970, 1, 1) */
|
||||
const POSTGRES_EPOCH_JDATE: u64 = 2451545; /* == date2j(2000, 1, 1) */
|
||||
const SECS_PER_DAY: u64 = 86400;
|
||||
const USECS_PER_SEC: u64 = 1000000;
|
||||
const SECS_DIFF_UNIX_TO_POSTGRES_EPOCH: u64 =
|
||||
(POSTGRES_EPOCH_JDATE - UNIX_EPOCH_JDATE) * SECS_PER_DAY;
|
||||
|
||||
pub fn to_pg_timestamp(time: SystemTime) -> TimestampTz {
|
||||
match time.duration_since(SystemTime::UNIX_EPOCH) {
|
||||
Ok(n) => {
|
||||
((n.as_secs() - SECS_DIFF_UNIX_TO_POSTGRES_EPOCH) * USECS_PER_SEC
|
||||
+ n.subsec_micros() as u64) as i64
|
||||
}
|
||||
Err(_) => panic!("SystemTime before UNIX EPOCH!"),
|
||||
match time.duration_since(SystemTime::UNIX_EPOCH) {
|
||||
Ok(n) => {
|
||||
((n.as_secs() - ((POSTGRES_EPOCH_JDATE - UNIX_EPOCH_JDATE) * SECS_PER_DAY))
|
||||
* USECS_PER_SEC
|
||||
+ n.subsec_micros() as u64) as i64
|
||||
}
|
||||
}
|
||||
|
||||
pub fn from_pg_timestamp(time: TimestampTz) -> SystemTime {
|
||||
let time: u64 = time
|
||||
.try_into()
|
||||
.expect("timestamp before millenium (postgres epoch)");
|
||||
let since_unix_epoch = time + SECS_DIFF_UNIX_TO_POSTGRES_EPOCH * USECS_PER_SEC;
|
||||
SystemTime::UNIX_EPOCH
|
||||
.checked_add(Duration::from_micros(since_unix_epoch))
|
||||
.expect("SystemTime overflow")
|
||||
Err(_) => panic!("SystemTime before UNIX EPOCH!"),
|
||||
}
|
||||
}
|
||||
|
||||
pub use timestamp_conversions::{from_pg_timestamp, to_pg_timestamp};
|
||||
|
||||
// Returns (aligned) end_lsn of the last record in data_dir with WAL segments.
|
||||
// start_lsn must point to some previously known record boundary (beginning of
|
||||
// the next record). If no valid record after is found, start_lsn is returned
|
||||
@@ -502,24 +481,4 @@ pub fn encode_logical_message(prefix: &str, message: &str) -> Vec<u8> {
|
||||
wal
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
|
||||
#[test]
|
||||
fn test_ts_conversion() {
|
||||
let now = SystemTime::now();
|
||||
let round_trip = from_pg_timestamp(to_pg_timestamp(now));
|
||||
|
||||
let now_since = now.duration_since(SystemTime::UNIX_EPOCH).unwrap();
|
||||
let round_trip_since = round_trip.duration_since(SystemTime::UNIX_EPOCH).unwrap();
|
||||
assert_eq!(now_since.as_micros(), round_trip_since.as_micros());
|
||||
|
||||
let now_pg = get_current_timestamp();
|
||||
let round_trip_pg = to_pg_timestamp(from_pg_timestamp(now_pg));
|
||||
|
||||
assert_eq!(now_pg, round_trip_pg);
|
||||
}
|
||||
|
||||
// If you need to craft WAL and write tests for this module, put it at wal_craft crate.
|
||||
}
|
||||
// If you need to craft WAL and write tests for this module, put it at wal_craft crate.
|
||||
|
||||
@@ -14,7 +14,6 @@ macro_rules! xlog_utils_test {
|
||||
($version:ident) => {
|
||||
#[path = "."]
|
||||
mod $version {
|
||||
#[allow(unused_imports)]
|
||||
pub use postgres_ffi::$version::wal_craft_test_export::*;
|
||||
#[allow(clippy::duplicate_mod)]
|
||||
#[cfg(test)]
|
||||
|
||||
@@ -214,24 +214,27 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
/// Cancellation safe as long as the AsyncWrite is cancellation safe.
|
||||
async fn flush<S: AsyncWrite + Unpin>(
|
||||
stream: &mut S,
|
||||
write_buf: &mut BytesMut,
|
||||
) -> Result<(), io::Error> {
|
||||
while write_buf.has_remaining() {
|
||||
let bytes_written = stream.write_buf(write_buf).await?;
|
||||
let bytes_written = stream.write(write_buf.chunk()).await?;
|
||||
if bytes_written == 0 {
|
||||
return Err(io::Error::new(
|
||||
ErrorKind::WriteZero,
|
||||
"failed to write message",
|
||||
));
|
||||
}
|
||||
// The advanced part will be garbage collected, likely during shifting
|
||||
// data left on next attempt to write to buffer when free space is not
|
||||
// enough.
|
||||
write_buf.advance(bytes_written);
|
||||
}
|
||||
write_buf.clear();
|
||||
stream.flush().await
|
||||
}
|
||||
|
||||
/// Cancellation safe as long as the AsyncWrite is cancellation safe.
|
||||
async fn shutdown<S: AsyncWrite + Unpin>(
|
||||
stream: &mut S,
|
||||
write_buf: &mut BytesMut,
|
||||
|
||||
@@ -670,7 +670,6 @@ pub fn read_cstr(buf: &mut Bytes) -> Result<Bytes, ProtocolError> {
|
||||
}
|
||||
|
||||
pub const SQLSTATE_INTERNAL_ERROR: &[u8; 5] = b"XX000";
|
||||
pub const SQLSTATE_ADMIN_SHUTDOWN: &[u8; 5] = b"57P01";
|
||||
pub const SQLSTATE_SUCCESSFUL_COMPLETION: &[u8; 5] = b"00000";
|
||||
|
||||
impl<'a> BeMessage<'a> {
|
||||
|
||||
@@ -13,7 +13,6 @@ aws-types.workspace = true
|
||||
aws-config.workspace = true
|
||||
aws-sdk-s3.workspace = true
|
||||
aws-credential-types.workspace = true
|
||||
bytes.workspace = true
|
||||
camino.workspace = true
|
||||
hyper = { workspace = true, features = ["stream"] }
|
||||
serde.workspace = true
|
||||
@@ -27,13 +26,6 @@ metrics.workspace = true
|
||||
utils.workspace = true
|
||||
pin-project-lite.workspace = true
|
||||
workspace_hack.workspace = true
|
||||
azure_core.workspace = true
|
||||
azure_identity.workspace = true
|
||||
azure_storage.workspace = true
|
||||
azure_storage_blobs.workspace = true
|
||||
futures-util.workspace = true
|
||||
http-types.workspace = true
|
||||
itertools.workspace = true
|
||||
|
||||
[dev-dependencies]
|
||||
camino-tempfile.workspace = true
|
||||
|
||||
@@ -1,337 +0,0 @@
|
||||
//! Azure Blob Storage wrapper
|
||||
|
||||
use std::env;
|
||||
use std::num::NonZeroU32;
|
||||
use std::sync::Arc;
|
||||
use std::{borrow::Cow, collections::HashMap, io::Cursor};
|
||||
|
||||
use super::REMOTE_STORAGE_PREFIX_SEPARATOR;
|
||||
use anyhow::Result;
|
||||
use azure_core::request_options::{MaxResults, Metadata, Range};
|
||||
use azure_core::Header;
|
||||
use azure_identity::DefaultAzureCredential;
|
||||
use azure_storage::StorageCredentials;
|
||||
use azure_storage_blobs::prelude::ClientBuilder;
|
||||
use azure_storage_blobs::{
|
||||
blob::operations::GetBlobBuilder,
|
||||
prelude::{BlobClient, ContainerClient},
|
||||
};
|
||||
use futures_util::StreamExt;
|
||||
use http_types::StatusCode;
|
||||
use tokio::io::AsyncRead;
|
||||
use tracing::debug;
|
||||
|
||||
use crate::s3_bucket::RequestKind;
|
||||
use crate::{
|
||||
AzureConfig, ConcurrencyLimiter, Download, DownloadError, Listing, ListingMode, RemotePath,
|
||||
RemoteStorage, StorageMetadata,
|
||||
};
|
||||
|
||||
pub struct AzureBlobStorage {
|
||||
client: ContainerClient,
|
||||
prefix_in_container: Option<String>,
|
||||
max_keys_per_list_response: Option<NonZeroU32>,
|
||||
concurrency_limiter: ConcurrencyLimiter,
|
||||
}
|
||||
|
||||
impl AzureBlobStorage {
|
||||
pub fn new(azure_config: &AzureConfig) -> Result<Self> {
|
||||
debug!(
|
||||
"Creating azure remote storage for azure container {}",
|
||||
azure_config.container_name
|
||||
);
|
||||
|
||||
let account = env::var("AZURE_STORAGE_ACCOUNT").expect("missing AZURE_STORAGE_ACCOUNT");
|
||||
|
||||
// If the `AZURE_STORAGE_ACCESS_KEY` env var has an access key, use that,
|
||||
// otherwise try the token based credentials.
|
||||
let credentials = if let Ok(access_key) = env::var("AZURE_STORAGE_ACCESS_KEY") {
|
||||
StorageCredentials::access_key(account.clone(), access_key)
|
||||
} else {
|
||||
let token_credential = DefaultAzureCredential::default();
|
||||
StorageCredentials::token_credential(Arc::new(token_credential))
|
||||
};
|
||||
|
||||
let builder = ClientBuilder::new(account, credentials);
|
||||
|
||||
let client = builder.container_client(azure_config.container_name.to_owned());
|
||||
|
||||
let max_keys_per_list_response =
|
||||
if let Some(limit) = azure_config.max_keys_per_list_response {
|
||||
Some(
|
||||
NonZeroU32::new(limit as u32)
|
||||
.ok_or_else(|| anyhow::anyhow!("max_keys_per_list_response can't be 0"))?,
|
||||
)
|
||||
} else {
|
||||
None
|
||||
};
|
||||
|
||||
Ok(AzureBlobStorage {
|
||||
client,
|
||||
prefix_in_container: azure_config.prefix_in_container.to_owned(),
|
||||
max_keys_per_list_response,
|
||||
concurrency_limiter: ConcurrencyLimiter::new(azure_config.concurrency_limit.get()),
|
||||
})
|
||||
}
|
||||
|
||||
pub fn relative_path_to_name(&self, path: &RemotePath) -> String {
|
||||
assert_eq!(std::path::MAIN_SEPARATOR, REMOTE_STORAGE_PREFIX_SEPARATOR);
|
||||
let path_string = path
|
||||
.get_path()
|
||||
.as_str()
|
||||
.trim_end_matches(REMOTE_STORAGE_PREFIX_SEPARATOR);
|
||||
match &self.prefix_in_container {
|
||||
Some(prefix) => {
|
||||
if prefix.ends_with(REMOTE_STORAGE_PREFIX_SEPARATOR) {
|
||||
prefix.clone() + path_string
|
||||
} else {
|
||||
format!("{prefix}{REMOTE_STORAGE_PREFIX_SEPARATOR}{path_string}")
|
||||
}
|
||||
}
|
||||
None => path_string.to_string(),
|
||||
}
|
||||
}
|
||||
|
||||
fn name_to_relative_path(&self, key: &str) -> RemotePath {
|
||||
let relative_path =
|
||||
match key.strip_prefix(self.prefix_in_container.as_deref().unwrap_or_default()) {
|
||||
Some(stripped) => stripped,
|
||||
// we rely on Azure to return properly prefixed paths
|
||||
// for requests with a certain prefix
|
||||
None => panic!(
|
||||
"Key {key} does not start with container prefix {:?}",
|
||||
self.prefix_in_container
|
||||
),
|
||||
};
|
||||
RemotePath(
|
||||
relative_path
|
||||
.split(REMOTE_STORAGE_PREFIX_SEPARATOR)
|
||||
.collect(),
|
||||
)
|
||||
}
|
||||
|
||||
async fn download_for_builder(
|
||||
&self,
|
||||
metadata: StorageMetadata,
|
||||
builder: GetBlobBuilder,
|
||||
) -> Result<Download, DownloadError> {
|
||||
let mut response = builder.into_stream();
|
||||
|
||||
// TODO give proper streaming response instead of buffering into RAM
|
||||
// https://github.com/neondatabase/neon/issues/5563
|
||||
let mut buf = Vec::new();
|
||||
while let Some(part) = response.next().await {
|
||||
let part = part.map_err(to_download_error)?;
|
||||
let data = part
|
||||
.data
|
||||
.collect()
|
||||
.await
|
||||
.map_err(|e| DownloadError::Other(e.into()))?;
|
||||
buf.extend_from_slice(&data.slice(..));
|
||||
}
|
||||
Ok(Download {
|
||||
download_stream: Box::pin(Cursor::new(buf)),
|
||||
metadata: Some(metadata),
|
||||
})
|
||||
}
|
||||
// TODO get rid of this function once we have metadata included in the response
|
||||
// https://github.com/Azure/azure-sdk-for-rust/issues/1439
|
||||
async fn get_metadata(
|
||||
&self,
|
||||
blob_client: &BlobClient,
|
||||
) -> Result<StorageMetadata, DownloadError> {
|
||||
let builder = blob_client.get_metadata();
|
||||
|
||||
let response = builder.into_future().await.map_err(to_download_error)?;
|
||||
let mut map = HashMap::new();
|
||||
|
||||
for md in response.metadata.iter() {
|
||||
map.insert(
|
||||
md.name().as_str().to_string(),
|
||||
md.value().as_str().to_string(),
|
||||
);
|
||||
}
|
||||
Ok(StorageMetadata(map))
|
||||
}
|
||||
|
||||
async fn permit(&self, kind: RequestKind) -> tokio::sync::SemaphorePermit<'_> {
|
||||
self.concurrency_limiter
|
||||
.acquire(kind)
|
||||
.await
|
||||
.expect("semaphore is never closed")
|
||||
}
|
||||
}
|
||||
|
||||
fn to_azure_metadata(metadata: StorageMetadata) -> Metadata {
|
||||
let mut res = Metadata::new();
|
||||
for (k, v) in metadata.0.into_iter() {
|
||||
res.insert(k, v);
|
||||
}
|
||||
res
|
||||
}
|
||||
|
||||
fn to_download_error(error: azure_core::Error) -> DownloadError {
|
||||
if let Some(http_err) = error.as_http_error() {
|
||||
match http_err.status() {
|
||||
StatusCode::NotFound => DownloadError::NotFound,
|
||||
StatusCode::BadRequest => DownloadError::BadInput(anyhow::Error::new(error)),
|
||||
_ => DownloadError::Other(anyhow::Error::new(error)),
|
||||
}
|
||||
} else {
|
||||
DownloadError::Other(error.into())
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl RemoteStorage for AzureBlobStorage {
|
||||
async fn list(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
mode: ListingMode,
|
||||
) -> anyhow::Result<Listing, DownloadError> {
|
||||
// get the passed prefix or if it is not set use prefix_in_bucket value
|
||||
let list_prefix = prefix
|
||||
.map(|p| self.relative_path_to_name(p))
|
||||
.or_else(|| self.prefix_in_container.clone())
|
||||
.map(|mut p| {
|
||||
// required to end with a separator
|
||||
// otherwise request will return only the entry of a prefix
|
||||
if matches!(mode, ListingMode::WithDelimiter)
|
||||
&& !p.ends_with(REMOTE_STORAGE_PREFIX_SEPARATOR)
|
||||
{
|
||||
p.push(REMOTE_STORAGE_PREFIX_SEPARATOR);
|
||||
}
|
||||
p
|
||||
});
|
||||
|
||||
let mut builder = self.client.list_blobs();
|
||||
|
||||
if let ListingMode::WithDelimiter = mode {
|
||||
builder = builder.delimiter(REMOTE_STORAGE_PREFIX_SEPARATOR.to_string());
|
||||
}
|
||||
|
||||
if let Some(prefix) = list_prefix {
|
||||
builder = builder.prefix(Cow::from(prefix.to_owned()));
|
||||
}
|
||||
|
||||
if let Some(limit) = self.max_keys_per_list_response {
|
||||
builder = builder.max_results(MaxResults::new(limit));
|
||||
}
|
||||
|
||||
let mut response = builder.into_stream();
|
||||
let mut res = Listing::default();
|
||||
while let Some(l) = response.next().await {
|
||||
let entry = l.map_err(to_download_error)?;
|
||||
let prefix_iter = entry
|
||||
.blobs
|
||||
.prefixes()
|
||||
.map(|prefix| self.name_to_relative_path(&prefix.name));
|
||||
res.prefixes.extend(prefix_iter);
|
||||
|
||||
let blob_iter = entry
|
||||
.blobs
|
||||
.blobs()
|
||||
.map(|k| self.name_to_relative_path(&k.name));
|
||||
res.keys.extend(blob_iter);
|
||||
}
|
||||
Ok(res)
|
||||
}
|
||||
async fn upload(
|
||||
&self,
|
||||
mut from: impl AsyncRead + Unpin + Send + Sync + 'static,
|
||||
data_size_bytes: usize,
|
||||
to: &RemotePath,
|
||||
metadata: Option<StorageMetadata>,
|
||||
) -> anyhow::Result<()> {
|
||||
let _permit = self.permit(RequestKind::Put).await;
|
||||
let blob_client = self.client.blob_client(self.relative_path_to_name(to));
|
||||
|
||||
// TODO FIX THIS UGLY HACK and don't buffer the entire object
|
||||
// into RAM here, but use the streaming interface. For that,
|
||||
// we'd have to change the interface though...
|
||||
// https://github.com/neondatabase/neon/issues/5563
|
||||
let mut buf = Vec::with_capacity(data_size_bytes);
|
||||
tokio::io::copy(&mut from, &mut buf).await?;
|
||||
let body = azure_core::Body::Bytes(buf.into());
|
||||
|
||||
let mut builder = blob_client.put_block_blob(body);
|
||||
|
||||
if let Some(metadata) = metadata {
|
||||
builder = builder.metadata(to_azure_metadata(metadata));
|
||||
}
|
||||
|
||||
let _response = builder.into_future().await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn download(&self, from: &RemotePath) -> Result<Download, DownloadError> {
|
||||
let _permit = self.permit(RequestKind::Get).await;
|
||||
let blob_client = self.client.blob_client(self.relative_path_to_name(from));
|
||||
|
||||
let metadata = self.get_metadata(&blob_client).await?;
|
||||
|
||||
let builder = blob_client.get();
|
||||
|
||||
self.download_for_builder(metadata, builder).await
|
||||
}
|
||||
|
||||
async fn download_byte_range(
|
||||
&self,
|
||||
from: &RemotePath,
|
||||
start_inclusive: u64,
|
||||
end_exclusive: Option<u64>,
|
||||
) -> Result<Download, DownloadError> {
|
||||
let _permit = self.permit(RequestKind::Get).await;
|
||||
let blob_client = self.client.blob_client(self.relative_path_to_name(from));
|
||||
|
||||
let metadata = self.get_metadata(&blob_client).await?;
|
||||
|
||||
let mut builder = blob_client.get();
|
||||
|
||||
if let Some(end_exclusive) = end_exclusive {
|
||||
builder = builder.range(Range::new(start_inclusive, end_exclusive));
|
||||
} else {
|
||||
// Open ranges are not supported by the SDK so we work around
|
||||
// by setting the upper limit extremely high (but high enough
|
||||
// to still be representable by signed 64 bit integers).
|
||||
// TODO remove workaround once the SDK adds open range support
|
||||
// https://github.com/Azure/azure-sdk-for-rust/issues/1438
|
||||
let end_exclusive = u64::MAX / 4;
|
||||
builder = builder.range(Range::new(start_inclusive, end_exclusive));
|
||||
}
|
||||
|
||||
self.download_for_builder(metadata, builder).await
|
||||
}
|
||||
|
||||
async fn delete(&self, path: &RemotePath) -> anyhow::Result<()> {
|
||||
let _permit = self.permit(RequestKind::Delete).await;
|
||||
let blob_client = self.client.blob_client(self.relative_path_to_name(path));
|
||||
|
||||
let builder = blob_client.delete();
|
||||
|
||||
match builder.into_future().await {
|
||||
Ok(_response) => Ok(()),
|
||||
Err(e) => {
|
||||
if let Some(http_err) = e.as_http_error() {
|
||||
if http_err.status() == StatusCode::NotFound {
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
Err(anyhow::Error::new(e))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async fn delete_objects<'a>(&self, paths: &'a [RemotePath]) -> anyhow::Result<()> {
|
||||
// Permit is already obtained by inner delete function
|
||||
|
||||
// TODO batch requests are also not supported by the SDK
|
||||
// https://github.com/Azure/azure-sdk-for-rust/issues/1068
|
||||
// https://github.com/Azure/azure-sdk-for-rust/issues/1249
|
||||
for path in paths {
|
||||
self.delete(path).await?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
@@ -4,10 +4,7 @@
|
||||
//! [`RemoteStorage`] trait a CRUD-like generic abstraction to use for adapting external storages with a few implementations:
|
||||
//! * [`local_fs`] allows to use local file system as an external storage
|
||||
//! * [`s3_bucket`] uses AWS S3 bucket as an external storage
|
||||
//! * [`azure_blob`] allows to use Azure Blob storage as an external storage
|
||||
//!
|
||||
|
||||
mod azure_blob;
|
||||
mod local_fs;
|
||||
mod s3_bucket;
|
||||
mod simulate_failures;
|
||||
@@ -24,15 +21,11 @@ use anyhow::{bail, Context};
|
||||
use camino::{Utf8Path, Utf8PathBuf};
|
||||
|
||||
use serde::{Deserialize, Serialize};
|
||||
use tokio::{io, sync::Semaphore};
|
||||
use tokio::io;
|
||||
use toml_edit::Item;
|
||||
use tracing::info;
|
||||
|
||||
pub use self::{
|
||||
azure_blob::AzureBlobStorage, local_fs::LocalFs, s3_bucket::S3Bucket,
|
||||
simulate_failures::UnreliableWrapper,
|
||||
};
|
||||
use s3_bucket::RequestKind;
|
||||
pub use self::{local_fs::LocalFs, s3_bucket::S3Bucket, simulate_failures::UnreliableWrapper};
|
||||
|
||||
/// How many different timelines can be processed simultaneously when synchronizing layers with the remote storage.
|
||||
/// During regular work, pageserver produces one layer file per timeline checkpoint, with bursts of concurrency
|
||||
@@ -46,11 +39,6 @@ pub const DEFAULT_REMOTE_STORAGE_MAX_SYNC_ERRORS: u32 = 10;
|
||||
/// ~3500 PUT/COPY/POST/DELETE or 5500 GET/HEAD S3 requests
|
||||
/// <https://aws.amazon.com/premiumsupport/knowledge-center/s3-request-limit-avoid-throttling/>
|
||||
pub const DEFAULT_REMOTE_STORAGE_S3_CONCURRENCY_LIMIT: usize = 100;
|
||||
/// We set this a little bit low as we currently buffer the entire file into RAM
|
||||
///
|
||||
/// Here, a limit of max 20k concurrent connections was noted.
|
||||
/// <https://learn.microsoft.com/en-us/answers/questions/1301863/is-there-any-limitation-to-concurrent-connections>
|
||||
pub const DEFAULT_REMOTE_STORAGE_AZURE_CONCURRENCY_LIMIT: usize = 30;
|
||||
/// No limits on the client side, which currenltly means 1000 for AWS S3.
|
||||
/// <https://docs.aws.amazon.com/AmazonS3/latest/API/API_ListObjectsV2.html#API_ListObjectsV2_RequestSyntax>
|
||||
pub const DEFAULT_MAX_KEYS_PER_LIST_RESPONSE: Option<i32> = None;
|
||||
@@ -129,22 +117,6 @@ impl RemotePath {
|
||||
}
|
||||
}
|
||||
|
||||
/// We don't need callers to be able to pass arbitrary delimiters: just control
|
||||
/// whether listings will use a '/' separator or not.
|
||||
///
|
||||
/// The WithDelimiter mode will populate `prefixes` and `keys` in the result. The
|
||||
/// NoDelimiter mode will only populate `keys`.
|
||||
pub enum ListingMode {
|
||||
WithDelimiter,
|
||||
NoDelimiter,
|
||||
}
|
||||
|
||||
#[derive(Default)]
|
||||
pub struct Listing {
|
||||
pub prefixes: Vec<RemotePath>,
|
||||
pub keys: Vec<RemotePath>,
|
||||
}
|
||||
|
||||
/// Storage (potentially remote) API to manage its state.
|
||||
/// This storage tries to be unaware of any layered repository context,
|
||||
/// providing basic CRUD operations for storage files.
|
||||
@@ -157,13 +129,8 @@ pub trait RemoteStorage: Send + Sync + 'static {
|
||||
async fn list_prefixes(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
) -> Result<Vec<RemotePath>, DownloadError> {
|
||||
let result = self
|
||||
.list(prefix, ListingMode::WithDelimiter)
|
||||
.await?
|
||||
.prefixes;
|
||||
Ok(result)
|
||||
}
|
||||
) -> Result<Vec<RemotePath>, DownloadError>;
|
||||
|
||||
/// Lists all files in directory "recursively"
|
||||
/// (not really recursively, because AWS has a flat namespace)
|
||||
/// Note: This is subtely different than list_prefixes,
|
||||
@@ -175,16 +142,7 @@ pub trait RemoteStorage: Send + Sync + 'static {
|
||||
/// whereas,
|
||||
/// list_prefixes("foo/bar/") = ["cat", "dog"]
|
||||
/// See `test_real_s3.rs` for more details.
|
||||
async fn list_files(&self, prefix: Option<&RemotePath>) -> anyhow::Result<Vec<RemotePath>> {
|
||||
let result = self.list(prefix, ListingMode::NoDelimiter).await?.keys;
|
||||
Ok(result)
|
||||
}
|
||||
|
||||
async fn list(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
_mode: ListingMode,
|
||||
) -> anyhow::Result<Listing, DownloadError>;
|
||||
async fn list_files(&self, folder: Option<&RemotePath>) -> anyhow::Result<Vec<RemotePath>>;
|
||||
|
||||
/// Streams the local file contents into remote into the remote storage entry.
|
||||
async fn upload(
|
||||
@@ -235,9 +193,6 @@ pub enum DownloadError {
|
||||
BadInput(anyhow::Error),
|
||||
/// The file was not found in the remote storage.
|
||||
NotFound,
|
||||
/// A cancellation token aborted the download, typically during
|
||||
/// tenant detach or process shutdown.
|
||||
Cancelled,
|
||||
/// The file was found in the remote storage, but the download failed.
|
||||
Other(anyhow::Error),
|
||||
}
|
||||
@@ -248,7 +203,6 @@ impl std::fmt::Display for DownloadError {
|
||||
DownloadError::BadInput(e) => {
|
||||
write!(f, "Failed to download a remote file due to user input: {e}")
|
||||
}
|
||||
DownloadError::Cancelled => write!(f, "Cancelled, shutting down"),
|
||||
DownloadError::NotFound => write!(f, "No file found for the remote object id given"),
|
||||
DownloadError::Other(e) => write!(f, "Failed to download a remote file: {e:?}"),
|
||||
}
|
||||
@@ -263,24 +217,10 @@ impl std::error::Error for DownloadError {}
|
||||
pub enum GenericRemoteStorage {
|
||||
LocalFs(LocalFs),
|
||||
AwsS3(Arc<S3Bucket>),
|
||||
AzureBlob(Arc<AzureBlobStorage>),
|
||||
Unreliable(Arc<UnreliableWrapper>),
|
||||
}
|
||||
|
||||
impl GenericRemoteStorage {
|
||||
pub async fn list(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
mode: ListingMode,
|
||||
) -> anyhow::Result<Listing, DownloadError> {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.list(prefix, mode).await,
|
||||
Self::AwsS3(s) => s.list(prefix, mode).await,
|
||||
Self::AzureBlob(s) => s.list(prefix, mode).await,
|
||||
Self::Unreliable(s) => s.list(prefix, mode).await,
|
||||
}
|
||||
}
|
||||
|
||||
// A function for listing all the files in a "directory"
|
||||
// Example:
|
||||
// list_files("foo/bar") = ["foo/bar/a.txt", "foo/bar/b.txt"]
|
||||
@@ -288,7 +228,6 @@ impl GenericRemoteStorage {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.list_files(folder).await,
|
||||
Self::AwsS3(s) => s.list_files(folder).await,
|
||||
Self::AzureBlob(s) => s.list_files(folder).await,
|
||||
Self::Unreliable(s) => s.list_files(folder).await,
|
||||
}
|
||||
}
|
||||
@@ -303,7 +242,6 @@ impl GenericRemoteStorage {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.list_prefixes(prefix).await,
|
||||
Self::AwsS3(s) => s.list_prefixes(prefix).await,
|
||||
Self::AzureBlob(s) => s.list_prefixes(prefix).await,
|
||||
Self::Unreliable(s) => s.list_prefixes(prefix).await,
|
||||
}
|
||||
}
|
||||
@@ -318,7 +256,6 @@ impl GenericRemoteStorage {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.upload(from, data_size_bytes, to, metadata).await,
|
||||
Self::AwsS3(s) => s.upload(from, data_size_bytes, to, metadata).await,
|
||||
Self::AzureBlob(s) => s.upload(from, data_size_bytes, to, metadata).await,
|
||||
Self::Unreliable(s) => s.upload(from, data_size_bytes, to, metadata).await,
|
||||
}
|
||||
}
|
||||
@@ -327,7 +264,6 @@ impl GenericRemoteStorage {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.download(from).await,
|
||||
Self::AwsS3(s) => s.download(from).await,
|
||||
Self::AzureBlob(s) => s.download(from).await,
|
||||
Self::Unreliable(s) => s.download(from).await,
|
||||
}
|
||||
}
|
||||
@@ -347,10 +283,6 @@ impl GenericRemoteStorage {
|
||||
s.download_byte_range(from, start_inclusive, end_exclusive)
|
||||
.await
|
||||
}
|
||||
Self::AzureBlob(s) => {
|
||||
s.download_byte_range(from, start_inclusive, end_exclusive)
|
||||
.await
|
||||
}
|
||||
Self::Unreliable(s) => {
|
||||
s.download_byte_range(from, start_inclusive, end_exclusive)
|
||||
.await
|
||||
@@ -362,7 +294,6 @@ impl GenericRemoteStorage {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.delete(path).await,
|
||||
Self::AwsS3(s) => s.delete(path).await,
|
||||
Self::AzureBlob(s) => s.delete(path).await,
|
||||
Self::Unreliable(s) => s.delete(path).await,
|
||||
}
|
||||
}
|
||||
@@ -371,7 +302,6 @@ impl GenericRemoteStorage {
|
||||
match self {
|
||||
Self::LocalFs(s) => s.delete_objects(paths).await,
|
||||
Self::AwsS3(s) => s.delete_objects(paths).await,
|
||||
Self::AzureBlob(s) => s.delete_objects(paths).await,
|
||||
Self::Unreliable(s) => s.delete_objects(paths).await,
|
||||
}
|
||||
}
|
||||
@@ -389,11 +319,6 @@ impl GenericRemoteStorage {
|
||||
s3_config.bucket_name, s3_config.bucket_region, s3_config.prefix_in_bucket, s3_config.endpoint);
|
||||
Self::AwsS3(Arc::new(S3Bucket::new(s3_config)?))
|
||||
}
|
||||
RemoteStorageKind::AzureContainer(azure_config) => {
|
||||
info!("Using azure container '{}' in region '{}' as a remote storage, prefix in container: '{:?}'",
|
||||
azure_config.container_name, azure_config.container_region, azure_config.prefix_in_container);
|
||||
Self::AzureBlob(Arc::new(AzureBlobStorage::new(azure_config)?))
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
@@ -458,9 +383,6 @@ pub enum RemoteStorageKind {
|
||||
/// AWS S3 based storage, storing all files in the S3 bucket
|
||||
/// specified by the config
|
||||
AwsS3(S3Config),
|
||||
/// Azure Blob based storage, storing all files in the container
|
||||
/// specified by the config
|
||||
AzureContainer(AzureConfig),
|
||||
}
|
||||
|
||||
/// AWS S3 bucket coordinates and access credentials to manage the bucket contents (read and write).
|
||||
@@ -500,45 +422,11 @@ impl Debug for S3Config {
|
||||
}
|
||||
}
|
||||
|
||||
/// Azure bucket coordinates and access credentials to manage the bucket contents (read and write).
|
||||
#[derive(Clone, PartialEq, Eq)]
|
||||
pub struct AzureConfig {
|
||||
/// Name of the container to connect to.
|
||||
pub container_name: String,
|
||||
/// The region where the bucket is located at.
|
||||
pub container_region: String,
|
||||
/// A "subfolder" in the container, to use the same container separately by multiple remote storage users at once.
|
||||
pub prefix_in_container: Option<String>,
|
||||
/// Azure has various limits on its API calls, we need not to exceed those.
|
||||
/// See [`DEFAULT_REMOTE_STORAGE_AZURE_CONCURRENCY_LIMIT`] for more details.
|
||||
pub concurrency_limit: NonZeroUsize,
|
||||
pub max_keys_per_list_response: Option<i32>,
|
||||
}
|
||||
|
||||
impl Debug for AzureConfig {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.debug_struct("AzureConfig")
|
||||
.field("bucket_name", &self.container_name)
|
||||
.field("bucket_region", &self.container_region)
|
||||
.field("prefix_in_bucket", &self.prefix_in_container)
|
||||
.field("concurrency_limit", &self.concurrency_limit)
|
||||
.field(
|
||||
"max_keys_per_list_response",
|
||||
&self.max_keys_per_list_response,
|
||||
)
|
||||
.finish()
|
||||
}
|
||||
}
|
||||
|
||||
impl RemoteStorageConfig {
|
||||
pub fn from_toml(toml: &toml_edit::Item) -> anyhow::Result<Option<RemoteStorageConfig>> {
|
||||
let local_path = toml.get("local_path");
|
||||
let bucket_name = toml.get("bucket_name");
|
||||
let bucket_region = toml.get("bucket_region");
|
||||
let container_name = toml.get("container_name");
|
||||
let container_region = toml.get("container_region");
|
||||
|
||||
let use_azure = container_name.is_some() && container_region.is_some();
|
||||
|
||||
let max_concurrent_syncs = NonZeroUsize::new(
|
||||
parse_optional_integer("max_concurrent_syncs", toml)?
|
||||
@@ -552,13 +440,9 @@ impl RemoteStorageConfig {
|
||||
)
|
||||
.context("Failed to parse 'max_sync_errors' as a positive integer")?;
|
||||
|
||||
let default_concurrency_limit = if use_azure {
|
||||
DEFAULT_REMOTE_STORAGE_AZURE_CONCURRENCY_LIMIT
|
||||
} else {
|
||||
DEFAULT_REMOTE_STORAGE_S3_CONCURRENCY_LIMIT
|
||||
};
|
||||
let concurrency_limit = NonZeroUsize::new(
|
||||
parse_optional_integer("concurrency_limit", toml)?.unwrap_or(default_concurrency_limit),
|
||||
parse_optional_integer("concurrency_limit", toml)?
|
||||
.unwrap_or(DEFAULT_REMOTE_STORAGE_S3_CONCURRENCY_LIMIT),
|
||||
)
|
||||
.context("Failed to parse 'concurrency_limit' as a positive integer")?;
|
||||
|
||||
@@ -567,70 +451,33 @@ impl RemoteStorageConfig {
|
||||
.context("Failed to parse 'max_keys_per_list_response' as a positive integer")?
|
||||
.or(DEFAULT_MAX_KEYS_PER_LIST_RESPONSE);
|
||||
|
||||
let endpoint = toml
|
||||
.get("endpoint")
|
||||
.map(|endpoint| parse_toml_string("endpoint", endpoint))
|
||||
.transpose()?;
|
||||
|
||||
let storage = match (
|
||||
local_path,
|
||||
bucket_name,
|
||||
bucket_region,
|
||||
container_name,
|
||||
container_region,
|
||||
) {
|
||||
let storage = match (local_path, bucket_name, bucket_region) {
|
||||
// no 'local_path' nor 'bucket_name' options are provided, consider this remote storage disabled
|
||||
(None, None, None, None, None) => return Ok(None),
|
||||
(_, Some(_), None, ..) => {
|
||||
(None, None, None) => return Ok(None),
|
||||
(_, Some(_), None) => {
|
||||
bail!("'bucket_region' option is mandatory if 'bucket_name' is given ")
|
||||
}
|
||||
(_, None, Some(_), ..) => {
|
||||
(_, None, Some(_)) => {
|
||||
bail!("'bucket_name' option is mandatory if 'bucket_region' is given ")
|
||||
}
|
||||
(None, Some(bucket_name), Some(bucket_region), ..) => {
|
||||
RemoteStorageKind::AwsS3(S3Config {
|
||||
bucket_name: parse_toml_string("bucket_name", bucket_name)?,
|
||||
bucket_region: parse_toml_string("bucket_region", bucket_region)?,
|
||||
prefix_in_bucket: toml
|
||||
.get("prefix_in_bucket")
|
||||
.map(|prefix_in_bucket| {
|
||||
parse_toml_string("prefix_in_bucket", prefix_in_bucket)
|
||||
})
|
||||
.transpose()?,
|
||||
endpoint,
|
||||
concurrency_limit,
|
||||
max_keys_per_list_response,
|
||||
})
|
||||
}
|
||||
(_, _, _, Some(_), None) => {
|
||||
bail!("'container_name' option is mandatory if 'container_region' is given ")
|
||||
}
|
||||
(_, _, _, None, Some(_)) => {
|
||||
bail!("'container_name' option is mandatory if 'container_region' is given ")
|
||||
}
|
||||
(None, None, None, Some(container_name), Some(container_region)) => {
|
||||
RemoteStorageKind::AzureContainer(AzureConfig {
|
||||
container_name: parse_toml_string("container_name", container_name)?,
|
||||
container_region: parse_toml_string("container_region", container_region)?,
|
||||
prefix_in_container: toml
|
||||
.get("prefix_in_container")
|
||||
.map(|prefix_in_container| {
|
||||
parse_toml_string("prefix_in_container", prefix_in_container)
|
||||
})
|
||||
.transpose()?,
|
||||
concurrency_limit,
|
||||
max_keys_per_list_response,
|
||||
})
|
||||
}
|
||||
(Some(local_path), None, None, None, None) => RemoteStorageKind::LocalFs(
|
||||
Utf8PathBuf::from(parse_toml_string("local_path", local_path)?),
|
||||
),
|
||||
(Some(_), Some(_), ..) => {
|
||||
bail!("'local_path' and 'bucket_name' are mutually exclusive")
|
||||
}
|
||||
(Some(_), _, _, Some(_), Some(_)) => {
|
||||
bail!("local_path and 'container_name' are mutually exclusive")
|
||||
}
|
||||
(None, Some(bucket_name), Some(bucket_region)) => RemoteStorageKind::AwsS3(S3Config {
|
||||
bucket_name: parse_toml_string("bucket_name", bucket_name)?,
|
||||
bucket_region: parse_toml_string("bucket_region", bucket_region)?,
|
||||
prefix_in_bucket: toml
|
||||
.get("prefix_in_bucket")
|
||||
.map(|prefix_in_bucket| parse_toml_string("prefix_in_bucket", prefix_in_bucket))
|
||||
.transpose()?,
|
||||
endpoint: toml
|
||||
.get("endpoint")
|
||||
.map(|endpoint| parse_toml_string("endpoint", endpoint))
|
||||
.transpose()?,
|
||||
concurrency_limit,
|
||||
max_keys_per_list_response,
|
||||
}),
|
||||
(Some(local_path), None, None) => RemoteStorageKind::LocalFs(Utf8PathBuf::from(
|
||||
parse_toml_string("local_path", local_path)?,
|
||||
)),
|
||||
(Some(_), Some(_), _) => bail!("local_path and bucket_name are mutually exclusive"),
|
||||
};
|
||||
|
||||
Ok(Some(RemoteStorageConfig {
|
||||
@@ -666,46 +513,6 @@ fn parse_toml_string(name: &str, item: &Item) -> anyhow::Result<String> {
|
||||
Ok(s.to_string())
|
||||
}
|
||||
|
||||
struct ConcurrencyLimiter {
|
||||
// Every request to S3 can be throttled or cancelled, if a certain number of requests per second is exceeded.
|
||||
// Same goes to IAM, which is queried before every S3 request, if enabled. IAM has even lower RPS threshold.
|
||||
// The helps to ensure we don't exceed the thresholds.
|
||||
write: Arc<Semaphore>,
|
||||
read: Arc<Semaphore>,
|
||||
}
|
||||
|
||||
impl ConcurrencyLimiter {
|
||||
fn for_kind(&self, kind: RequestKind) -> &Arc<Semaphore> {
|
||||
match kind {
|
||||
RequestKind::Get => &self.read,
|
||||
RequestKind::Put => &self.write,
|
||||
RequestKind::List => &self.read,
|
||||
RequestKind::Delete => &self.write,
|
||||
}
|
||||
}
|
||||
|
||||
async fn acquire(
|
||||
&self,
|
||||
kind: RequestKind,
|
||||
) -> Result<tokio::sync::SemaphorePermit<'_>, tokio::sync::AcquireError> {
|
||||
self.for_kind(kind).acquire().await
|
||||
}
|
||||
|
||||
async fn acquire_owned(
|
||||
&self,
|
||||
kind: RequestKind,
|
||||
) -> Result<tokio::sync::OwnedSemaphorePermit, tokio::sync::AcquireError> {
|
||||
Arc::clone(self.for_kind(kind)).acquire_owned().await
|
||||
}
|
||||
|
||||
fn new(limit: usize) -> ConcurrencyLimiter {
|
||||
Self {
|
||||
read: Arc::new(Semaphore::new(limit)),
|
||||
write: Arc::new(Semaphore::new(limit)),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
|
||||
@@ -15,7 +15,7 @@ use tokio::{
|
||||
use tracing::*;
|
||||
use utils::{crashsafe::path_with_suffix_extension, fs_ext::is_directory_empty};
|
||||
|
||||
use crate::{Download, DownloadError, Listing, ListingMode, RemotePath};
|
||||
use crate::{Download, DownloadError, RemotePath};
|
||||
|
||||
use super::{RemoteStorage, StorageMetadata};
|
||||
|
||||
@@ -75,7 +75,7 @@ impl LocalFs {
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
async fn list_all(&self) -> anyhow::Result<Vec<RemotePath>> {
|
||||
async fn list(&self) -> anyhow::Result<Vec<RemotePath>> {
|
||||
Ok(get_all_files(&self.storage_root, true)
|
||||
.await?
|
||||
.into_iter()
|
||||
@@ -89,10 +89,52 @@ impl LocalFs {
|
||||
})
|
||||
.collect())
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl RemoteStorage for LocalFs {
|
||||
async fn list_prefixes(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
) -> Result<Vec<RemotePath>, DownloadError> {
|
||||
let path = match prefix {
|
||||
Some(prefix) => Cow::Owned(prefix.with_base(&self.storage_root)),
|
||||
None => Cow::Borrowed(&self.storage_root),
|
||||
};
|
||||
|
||||
let prefixes_to_filter = get_all_files(path.as_ref(), false)
|
||||
.await
|
||||
.map_err(DownloadError::Other)?;
|
||||
|
||||
let mut prefixes = Vec::with_capacity(prefixes_to_filter.len());
|
||||
|
||||
// filter out empty directories to mirror s3 behavior.
|
||||
for prefix in prefixes_to_filter {
|
||||
if prefix.is_dir()
|
||||
&& is_directory_empty(&prefix)
|
||||
.await
|
||||
.map_err(DownloadError::Other)?
|
||||
{
|
||||
continue;
|
||||
}
|
||||
|
||||
prefixes.push(
|
||||
prefix
|
||||
.strip_prefix(&self.storage_root)
|
||||
.context("Failed to strip prefix")
|
||||
.and_then(RemotePath::new)
|
||||
.expect(
|
||||
"We list files for storage root, hence should be able to remote the prefix",
|
||||
),
|
||||
)
|
||||
}
|
||||
|
||||
Ok(prefixes)
|
||||
}
|
||||
|
||||
// recursively lists all files in a directory,
|
||||
// mirroring the `list_files` for `s3_bucket`
|
||||
async fn list_recursive(&self, folder: Option<&RemotePath>) -> anyhow::Result<Vec<RemotePath>> {
|
||||
async fn list_files(&self, folder: Option<&RemotePath>) -> anyhow::Result<Vec<RemotePath>> {
|
||||
let full_path = match folder {
|
||||
Some(folder) => folder.with_base(&self.storage_root),
|
||||
None => self.storage_root.clone(),
|
||||
@@ -144,70 +186,6 @@ impl LocalFs {
|
||||
|
||||
Ok(files)
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl RemoteStorage for LocalFs {
|
||||
async fn list(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
mode: ListingMode,
|
||||
) -> Result<Listing, DownloadError> {
|
||||
let mut result = Listing::default();
|
||||
|
||||
if let ListingMode::NoDelimiter = mode {
|
||||
let keys = self
|
||||
.list_recursive(prefix)
|
||||
.await
|
||||
.map_err(DownloadError::Other)?;
|
||||
|
||||
result.keys = keys
|
||||
.into_iter()
|
||||
.filter(|k| {
|
||||
let path = k.with_base(&self.storage_root);
|
||||
!path.is_dir()
|
||||
})
|
||||
.collect();
|
||||
|
||||
return Ok(result);
|
||||
}
|
||||
|
||||
let path = match prefix {
|
||||
Some(prefix) => Cow::Owned(prefix.with_base(&self.storage_root)),
|
||||
None => Cow::Borrowed(&self.storage_root),
|
||||
};
|
||||
|
||||
let prefixes_to_filter = get_all_files(path.as_ref(), false)
|
||||
.await
|
||||
.map_err(DownloadError::Other)?;
|
||||
|
||||
// filter out empty directories to mirror s3 behavior.
|
||||
for prefix in prefixes_to_filter {
|
||||
if prefix.is_dir()
|
||||
&& is_directory_empty(&prefix)
|
||||
.await
|
||||
.map_err(DownloadError::Other)?
|
||||
{
|
||||
continue;
|
||||
}
|
||||
|
||||
let stripped = prefix
|
||||
.strip_prefix(&self.storage_root)
|
||||
.context("Failed to strip prefix")
|
||||
.and_then(RemotePath::new)
|
||||
.expect(
|
||||
"We list files for storage root, hence should be able to remote the prefix",
|
||||
);
|
||||
|
||||
if prefix.is_dir() {
|
||||
result.prefixes.push(stripped);
|
||||
} else {
|
||||
result.keys.push(stripped);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(result)
|
||||
}
|
||||
|
||||
async fn upload(
|
||||
&self,
|
||||
@@ -501,7 +479,7 @@ mod fs_tests {
|
||||
|
||||
let target_path_1 = upload_dummy_file(&storage, "upload_1", None).await?;
|
||||
assert_eq!(
|
||||
storage.list_all().await?,
|
||||
storage.list().await?,
|
||||
vec![target_path_1.clone()],
|
||||
"Should list a single file after first upload"
|
||||
);
|
||||
@@ -689,7 +667,7 @@ mod fs_tests {
|
||||
let upload_target = upload_dummy_file(&storage, upload_name, None).await?;
|
||||
|
||||
storage.delete(&upload_target).await?;
|
||||
assert!(storage.list_all().await?.is_empty());
|
||||
assert!(storage.list().await?.is_empty());
|
||||
|
||||
storage
|
||||
.delete(&upload_target)
|
||||
@@ -747,43 +725,6 @@ mod fs_tests {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn list() -> anyhow::Result<()> {
|
||||
// No delimiter: should recursively list everything
|
||||
let storage = create_storage()?;
|
||||
let child = upload_dummy_file(&storage, "grandparent/parent/child", None).await?;
|
||||
let uncle = upload_dummy_file(&storage, "grandparent/uncle", None).await?;
|
||||
|
||||
let listing = storage.list(None, ListingMode::NoDelimiter).await?;
|
||||
assert!(listing.prefixes.is_empty());
|
||||
assert_eq!(listing.keys, [uncle.clone(), child.clone()].to_vec());
|
||||
|
||||
// Delimiter: should only go one deep
|
||||
let listing = storage.list(None, ListingMode::WithDelimiter).await?;
|
||||
|
||||
assert_eq!(
|
||||
listing.prefixes,
|
||||
[RemotePath::from_string("timelines").unwrap()].to_vec()
|
||||
);
|
||||
assert!(listing.keys.is_empty());
|
||||
|
||||
// Delimiter & prefix
|
||||
let listing = storage
|
||||
.list(
|
||||
Some(&RemotePath::from_string("timelines/some_timeline/grandparent").unwrap()),
|
||||
ListingMode::WithDelimiter,
|
||||
)
|
||||
.await?;
|
||||
assert_eq!(
|
||||
listing.prefixes,
|
||||
[RemotePath::from_string("timelines/some_timeline/grandparent/parent").unwrap()]
|
||||
.to_vec()
|
||||
);
|
||||
assert_eq!(listing.keys, [uncle.clone()].to_vec());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn upload_dummy_file(
|
||||
storage: &LocalFs,
|
||||
name: &str,
|
||||
@@ -836,7 +777,7 @@ mod fs_tests {
|
||||
}
|
||||
|
||||
async fn list_files_sorted(storage: &LocalFs) -> anyhow::Result<Vec<RemotePath>> {
|
||||
let mut files = storage.list_all().await?;
|
||||
let mut files = storage.list().await?;
|
||||
files.sort_by(|a, b| a.0.cmp(&b.0));
|
||||
Ok(files)
|
||||
}
|
||||
|
||||
@@ -4,7 +4,7 @@
|
||||
//! allowing multiple api users to independently work with the same S3 bucket, if
|
||||
//! their bucket prefixes are both specified and different.
|
||||
|
||||
use std::borrow::Cow;
|
||||
use std::sync::Arc;
|
||||
|
||||
use anyhow::Context;
|
||||
use aws_config::{
|
||||
@@ -24,20 +24,22 @@ use aws_sdk_s3::{
|
||||
use aws_smithy_http::body::SdkBody;
|
||||
use hyper::Body;
|
||||
use scopeguard::ScopeGuard;
|
||||
use tokio::io::{self, AsyncRead};
|
||||
use tokio::{
|
||||
io::{self, AsyncRead},
|
||||
sync::Semaphore,
|
||||
};
|
||||
use tokio_util::io::ReaderStream;
|
||||
use tracing::debug;
|
||||
|
||||
use super::StorageMetadata;
|
||||
use crate::{
|
||||
ConcurrencyLimiter, Download, DownloadError, Listing, ListingMode, RemotePath, RemoteStorage,
|
||||
S3Config, MAX_KEYS_PER_DELETE, REMOTE_STORAGE_PREFIX_SEPARATOR,
|
||||
Download, DownloadError, RemotePath, RemoteStorage, S3Config, MAX_KEYS_PER_DELETE,
|
||||
REMOTE_STORAGE_PREFIX_SEPARATOR,
|
||||
};
|
||||
|
||||
pub(super) mod metrics;
|
||||
|
||||
use self::metrics::AttemptOutcome;
|
||||
pub(super) use self::metrics::RequestKind;
|
||||
use self::metrics::{AttemptOutcome, RequestKind};
|
||||
|
||||
/// AWS S3 storage.
|
||||
pub struct S3Bucket {
|
||||
@@ -48,6 +50,46 @@ pub struct S3Bucket {
|
||||
concurrency_limiter: ConcurrencyLimiter,
|
||||
}
|
||||
|
||||
struct ConcurrencyLimiter {
|
||||
// Every request to S3 can be throttled or cancelled, if a certain number of requests per second is exceeded.
|
||||
// Same goes to IAM, which is queried before every S3 request, if enabled. IAM has even lower RPS threshold.
|
||||
// The helps to ensure we don't exceed the thresholds.
|
||||
write: Arc<Semaphore>,
|
||||
read: Arc<Semaphore>,
|
||||
}
|
||||
|
||||
impl ConcurrencyLimiter {
|
||||
fn for_kind(&self, kind: RequestKind) -> &Arc<Semaphore> {
|
||||
match kind {
|
||||
RequestKind::Get => &self.read,
|
||||
RequestKind::Put => &self.write,
|
||||
RequestKind::List => &self.read,
|
||||
RequestKind::Delete => &self.write,
|
||||
}
|
||||
}
|
||||
|
||||
async fn acquire(
|
||||
&self,
|
||||
kind: RequestKind,
|
||||
) -> Result<tokio::sync::SemaphorePermit<'_>, tokio::sync::AcquireError> {
|
||||
self.for_kind(kind).acquire().await
|
||||
}
|
||||
|
||||
async fn acquire_owned(
|
||||
&self,
|
||||
kind: RequestKind,
|
||||
) -> Result<tokio::sync::OwnedSemaphorePermit, tokio::sync::AcquireError> {
|
||||
Arc::clone(self.for_kind(kind)).acquire_owned().await
|
||||
}
|
||||
|
||||
fn new(limit: usize) -> ConcurrencyLimiter {
|
||||
Self {
|
||||
read: Arc::new(Semaphore::new(limit)),
|
||||
write: Arc::new(Semaphore::new(limit)),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Default)]
|
||||
struct GetObjectRequest {
|
||||
bucket: String,
|
||||
@@ -299,13 +341,13 @@ impl<S: AsyncRead> AsyncRead for TimedDownload<S> {
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl RemoteStorage for S3Bucket {
|
||||
async fn list(
|
||||
/// See the doc for `RemoteStorage::list_prefixes`
|
||||
/// Note: it wont include empty "directories"
|
||||
async fn list_prefixes(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
mode: ListingMode,
|
||||
) -> Result<Listing, DownloadError> {
|
||||
) -> Result<Vec<RemotePath>, DownloadError> {
|
||||
let kind = RequestKind::List;
|
||||
let mut result = Listing::default();
|
||||
|
||||
// get the passed prefix or if it is not set use prefix_in_bucket value
|
||||
let list_prefix = prefix
|
||||
@@ -314,33 +356,28 @@ impl RemoteStorage for S3Bucket {
|
||||
.map(|mut p| {
|
||||
// required to end with a separator
|
||||
// otherwise request will return only the entry of a prefix
|
||||
if matches!(mode, ListingMode::WithDelimiter)
|
||||
&& !p.ends_with(REMOTE_STORAGE_PREFIX_SEPARATOR)
|
||||
{
|
||||
if !p.ends_with(REMOTE_STORAGE_PREFIX_SEPARATOR) {
|
||||
p.push(REMOTE_STORAGE_PREFIX_SEPARATOR);
|
||||
}
|
||||
p
|
||||
});
|
||||
|
||||
let mut document_keys = Vec::new();
|
||||
|
||||
let mut continuation_token = None;
|
||||
|
||||
loop {
|
||||
let _guard = self.permit(kind).await;
|
||||
let started_at = start_measuring_requests(kind);
|
||||
|
||||
let mut request = self
|
||||
let fetch_response = self
|
||||
.client
|
||||
.list_objects_v2()
|
||||
.bucket(self.bucket_name.clone())
|
||||
.set_prefix(list_prefix.clone())
|
||||
.set_continuation_token(continuation_token)
|
||||
.set_max_keys(self.max_keys_per_list_response);
|
||||
|
||||
if let ListingMode::WithDelimiter = mode {
|
||||
request = request.delimiter(REMOTE_STORAGE_PREFIX_SEPARATOR.to_string());
|
||||
}
|
||||
|
||||
let response = request
|
||||
.delimiter(REMOTE_STORAGE_PREFIX_SEPARATOR.to_string())
|
||||
.set_max_keys(self.max_keys_per_list_response)
|
||||
.send()
|
||||
.await
|
||||
.context("Failed to list S3 prefixes")
|
||||
@@ -350,35 +387,71 @@ impl RemoteStorage for S3Bucket {
|
||||
|
||||
metrics::BUCKET_METRICS
|
||||
.req_seconds
|
||||
.observe_elapsed(kind, &response, started_at);
|
||||
.observe_elapsed(kind, &fetch_response, started_at);
|
||||
|
||||
let response = response?;
|
||||
let fetch_response = fetch_response?;
|
||||
|
||||
let keys = response.contents().unwrap_or_default();
|
||||
let empty = Vec::new();
|
||||
let prefixes = response.common_prefixes.as_ref().unwrap_or(&empty);
|
||||
|
||||
tracing::info!("list: {} prefixes, {} keys", prefixes.len(), keys.len());
|
||||
|
||||
for object in keys {
|
||||
let object_path = object.key().expect("response does not contain a key");
|
||||
let remote_path = self.s3_object_to_relative_path(object_path);
|
||||
result.keys.push(remote_path);
|
||||
}
|
||||
|
||||
result.prefixes.extend(
|
||||
prefixes
|
||||
.iter()
|
||||
document_keys.extend(
|
||||
fetch_response
|
||||
.common_prefixes
|
||||
.unwrap_or_default()
|
||||
.into_iter()
|
||||
.filter_map(|o| Some(self.s3_object_to_relative_path(o.prefix()?))),
|
||||
);
|
||||
|
||||
continuation_token = match response.next_continuation_token {
|
||||
continuation_token = match fetch_response.next_continuation_token {
|
||||
Some(new_token) => Some(new_token),
|
||||
None => break,
|
||||
};
|
||||
}
|
||||
|
||||
Ok(result)
|
||||
Ok(document_keys)
|
||||
}
|
||||
|
||||
/// See the doc for `RemoteStorage::list_files`
|
||||
async fn list_files(&self, folder: Option<&RemotePath>) -> anyhow::Result<Vec<RemotePath>> {
|
||||
let kind = RequestKind::List;
|
||||
|
||||
let folder_name = folder
|
||||
.map(|p| self.relative_path_to_s3_object(p))
|
||||
.or_else(|| self.prefix_in_bucket.clone());
|
||||
|
||||
// AWS may need to break the response into several parts
|
||||
let mut continuation_token = None;
|
||||
let mut all_files = vec![];
|
||||
loop {
|
||||
let _guard = self.permit(kind).await;
|
||||
let started_at = start_measuring_requests(kind);
|
||||
|
||||
let response = self
|
||||
.client
|
||||
.list_objects_v2()
|
||||
.bucket(self.bucket_name.clone())
|
||||
.set_prefix(folder_name.clone())
|
||||
.set_continuation_token(continuation_token)
|
||||
.set_max_keys(self.max_keys_per_list_response)
|
||||
.send()
|
||||
.await
|
||||
.context("Failed to list files in S3 bucket");
|
||||
|
||||
let started_at = ScopeGuard::into_inner(started_at);
|
||||
metrics::BUCKET_METRICS
|
||||
.req_seconds
|
||||
.observe_elapsed(kind, &response, started_at);
|
||||
|
||||
let response = response?;
|
||||
|
||||
for object in response.contents().unwrap_or_default() {
|
||||
let object_path = object.key().expect("response does not contain a key");
|
||||
let remote_path = self.s3_object_to_relative_path(object_path);
|
||||
all_files.push(remote_path);
|
||||
}
|
||||
match response.next_continuation_token {
|
||||
Some(new_token) => continuation_token = Some(new_token),
|
||||
None => break,
|
||||
}
|
||||
}
|
||||
Ok(all_files)
|
||||
}
|
||||
|
||||
async fn upload(
|
||||
@@ -483,20 +556,6 @@ impl RemoteStorage for S3Bucket {
|
||||
.deleted_objects_total
|
||||
.inc_by(chunk.len() as u64);
|
||||
if let Some(errors) = resp.errors {
|
||||
// Log a bounded number of the errors within the response:
|
||||
// these requests can carry 1000 keys so logging each one
|
||||
// would be too verbose, especially as errors may lead us
|
||||
// to retry repeatedly.
|
||||
const LOG_UP_TO_N_ERRORS: usize = 10;
|
||||
for e in errors.iter().take(LOG_UP_TO_N_ERRORS) {
|
||||
tracing::warn!(
|
||||
"DeleteObjects key {} failed: {}: {}",
|
||||
e.key.as_ref().map(Cow::from).unwrap_or("".into()),
|
||||
e.code.as_ref().map(Cow::from).unwrap_or("".into()),
|
||||
e.message.as_ref().map(Cow::from).unwrap_or("".into())
|
||||
);
|
||||
}
|
||||
|
||||
return Err(anyhow::format_err!(
|
||||
"Failed to delete {} objects",
|
||||
errors.len()
|
||||
|
||||
@@ -6,7 +6,7 @@ use once_cell::sync::Lazy;
|
||||
pub(super) static BUCKET_METRICS: Lazy<BucketMetrics> = Lazy::new(Default::default);
|
||||
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
pub(crate) enum RequestKind {
|
||||
pub(super) enum RequestKind {
|
||||
Get = 0,
|
||||
Put = 1,
|
||||
Delete = 2,
|
||||
|
||||
@@ -5,9 +5,7 @@ use std::collections::hash_map::Entry;
|
||||
use std::collections::HashMap;
|
||||
use std::sync::Mutex;
|
||||
|
||||
use crate::{
|
||||
Download, DownloadError, Listing, ListingMode, RemotePath, RemoteStorage, StorageMetadata,
|
||||
};
|
||||
use crate::{Download, DownloadError, RemotePath, RemoteStorage, StorageMetadata};
|
||||
|
||||
pub struct UnreliableWrapper {
|
||||
inner: crate::GenericRemoteStorage,
|
||||
@@ -97,15 +95,6 @@ impl RemoteStorage for UnreliableWrapper {
|
||||
self.inner.list_files(folder).await
|
||||
}
|
||||
|
||||
async fn list(
|
||||
&self,
|
||||
prefix: Option<&RemotePath>,
|
||||
mode: ListingMode,
|
||||
) -> Result<Listing, DownloadError> {
|
||||
self.attempt(RemoteOp::ListPrefixes(prefix.cloned()))?;
|
||||
self.inner.list(prefix, mode).await
|
||||
}
|
||||
|
||||
async fn upload(
|
||||
&self,
|
||||
data: impl tokio::io::AsyncRead + Unpin + Send + Sync + 'static,
|
||||
|
||||
@@ -1,625 +0,0 @@
|
||||
use std::collections::HashSet;
|
||||
use std::env;
|
||||
use std::num::{NonZeroU32, NonZeroUsize};
|
||||
use std::ops::ControlFlow;
|
||||
use std::path::PathBuf;
|
||||
use std::sync::Arc;
|
||||
use std::time::UNIX_EPOCH;
|
||||
|
||||
use anyhow::Context;
|
||||
use camino::Utf8Path;
|
||||
use once_cell::sync::OnceCell;
|
||||
use remote_storage::{
|
||||
AzureConfig, Download, GenericRemoteStorage, RemotePath, RemoteStorageConfig, RemoteStorageKind,
|
||||
};
|
||||
use test_context::{test_context, AsyncTestContext};
|
||||
use tokio::task::JoinSet;
|
||||
use tracing::{debug, error, info};
|
||||
|
||||
static LOGGING_DONE: OnceCell<()> = OnceCell::new();
|
||||
|
||||
const ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME: &str = "ENABLE_REAL_AZURE_REMOTE_STORAGE";
|
||||
|
||||
const BASE_PREFIX: &str = "test";
|
||||
|
||||
/// Tests that the Azure client can list all prefixes, even if the response comes paginated and requires multiple HTTP queries.
|
||||
/// Uses real Azure and requires [`ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME`] and related Azure cred env vars specified.
|
||||
/// See the client creation in [`create_azure_client`] for details on the required env vars.
|
||||
/// If real Azure tests are disabled, the test passes, skipping any real test run: currently, there's no way to mark the test ignored in runtime with the
|
||||
/// deafult test framework, see https://github.com/rust-lang/rust/issues/68007 for details.
|
||||
///
|
||||
/// First, the test creates a set of Azure blobs with keys `/${random_prefix_part}/${base_prefix_str}/sub_prefix_${i}/blob_${i}` in [`upload_azure_data`]
|
||||
/// where
|
||||
/// * `random_prefix_part` is set for the entire Azure client during the Azure client creation in [`create_azure_client`], to avoid multiple test runs interference
|
||||
/// * `base_prefix_str` is a common prefix to use in the client requests: we would want to ensure that the client is able to list nested prefixes inside the bucket
|
||||
///
|
||||
/// Then, verifies that the client does return correct prefixes when queried:
|
||||
/// * with no prefix, it lists everything after its `${random_prefix_part}/` — that should be `${base_prefix_str}` value only
|
||||
/// * with `${base_prefix_str}/` prefix, it lists every `sub_prefix_${i}`
|
||||
///
|
||||
/// With the real Azure enabled and `#[cfg(test)]` Rust configuration used, the Azure client test adds a `max-keys` param to limit the response keys.
|
||||
/// This way, we are able to test the pagination implicitly, by ensuring all results are returned from the remote storage and avoid uploading too many blobs to Azure.
|
||||
///
|
||||
/// Lastly, the test attempts to clean up and remove all uploaded Azure files.
|
||||
/// If any errors appear during the clean up, they get logged, but the test is not failed or stopped until clean up is finished.
|
||||
#[test_context(MaybeEnabledAzureWithTestBlobs)]
|
||||
#[tokio::test]
|
||||
async fn azure_pagination_should_work(
|
||||
ctx: &mut MaybeEnabledAzureWithTestBlobs,
|
||||
) -> anyhow::Result<()> {
|
||||
let ctx = match ctx {
|
||||
MaybeEnabledAzureWithTestBlobs::Enabled(ctx) => ctx,
|
||||
MaybeEnabledAzureWithTestBlobs::Disabled => return Ok(()),
|
||||
MaybeEnabledAzureWithTestBlobs::UploadsFailed(e, _) => {
|
||||
anyhow::bail!("Azure init failed: {e:?}")
|
||||
}
|
||||
};
|
||||
|
||||
let test_client = Arc::clone(&ctx.enabled.client);
|
||||
let expected_remote_prefixes = ctx.remote_prefixes.clone();
|
||||
|
||||
let base_prefix = RemotePath::new(Utf8Path::new(ctx.enabled.base_prefix))
|
||||
.context("common_prefix construction")?;
|
||||
let root_remote_prefixes = test_client
|
||||
.list_prefixes(None)
|
||||
.await
|
||||
.context("client list root prefixes failure")?
|
||||
.into_iter()
|
||||
.collect::<HashSet<_>>();
|
||||
assert_eq!(
|
||||
root_remote_prefixes, HashSet::from([base_prefix.clone()]),
|
||||
"remote storage root prefixes list mismatches with the uploads. Returned prefixes: {root_remote_prefixes:?}"
|
||||
);
|
||||
|
||||
let nested_remote_prefixes = test_client
|
||||
.list_prefixes(Some(&base_prefix))
|
||||
.await
|
||||
.context("client list nested prefixes failure")?
|
||||
.into_iter()
|
||||
.collect::<HashSet<_>>();
|
||||
let remote_only_prefixes = nested_remote_prefixes
|
||||
.difference(&expected_remote_prefixes)
|
||||
.collect::<HashSet<_>>();
|
||||
let missing_uploaded_prefixes = expected_remote_prefixes
|
||||
.difference(&nested_remote_prefixes)
|
||||
.collect::<HashSet<_>>();
|
||||
assert_eq!(
|
||||
remote_only_prefixes.len() + missing_uploaded_prefixes.len(), 0,
|
||||
"remote storage nested prefixes list mismatches with the uploads. Remote only prefixes: {remote_only_prefixes:?}, missing uploaded prefixes: {missing_uploaded_prefixes:?}",
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Tests that Azure client can list all files in a folder, even if the response comes paginated and requirees multiple Azure queries.
|
||||
/// Uses real Azure and requires [`ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME`] and related Azure cred env vars specified. Test will skip real code and pass if env vars not set.
|
||||
/// See `Azure_pagination_should_work` for more information.
|
||||
///
|
||||
/// First, create a set of Azure objects with keys `random_prefix/folder{j}/blob_{i}.txt` in [`upload_azure_data`]
|
||||
/// Then performs the following queries:
|
||||
/// 1. `list_files(None)`. This should return all files `random_prefix/folder{j}/blob_{i}.txt`
|
||||
/// 2. `list_files("folder1")`. This should return all files `random_prefix/folder1/blob_{i}.txt`
|
||||
#[test_context(MaybeEnabledAzureWithSimpleTestBlobs)]
|
||||
#[tokio::test]
|
||||
async fn azure_list_files_works(
|
||||
ctx: &mut MaybeEnabledAzureWithSimpleTestBlobs,
|
||||
) -> anyhow::Result<()> {
|
||||
let ctx = match ctx {
|
||||
MaybeEnabledAzureWithSimpleTestBlobs::Enabled(ctx) => ctx,
|
||||
MaybeEnabledAzureWithSimpleTestBlobs::Disabled => return Ok(()),
|
||||
MaybeEnabledAzureWithSimpleTestBlobs::UploadsFailed(e, _) => {
|
||||
anyhow::bail!("Azure init failed: {e:?}")
|
||||
}
|
||||
};
|
||||
let test_client = Arc::clone(&ctx.enabled.client);
|
||||
let base_prefix =
|
||||
RemotePath::new(Utf8Path::new("folder1")).context("common_prefix construction")?;
|
||||
let root_files = test_client
|
||||
.list_files(None)
|
||||
.await
|
||||
.context("client list root files failure")?
|
||||
.into_iter()
|
||||
.collect::<HashSet<_>>();
|
||||
assert_eq!(
|
||||
root_files,
|
||||
ctx.remote_blobs.clone(),
|
||||
"remote storage list_files on root mismatches with the uploads."
|
||||
);
|
||||
let nested_remote_files = test_client
|
||||
.list_files(Some(&base_prefix))
|
||||
.await
|
||||
.context("client list nested files failure")?
|
||||
.into_iter()
|
||||
.collect::<HashSet<_>>();
|
||||
let trim_remote_blobs: HashSet<_> = ctx
|
||||
.remote_blobs
|
||||
.iter()
|
||||
.map(|x| x.get_path())
|
||||
.filter(|x| x.starts_with("folder1"))
|
||||
.map(|x| RemotePath::new(x).expect("must be valid path"))
|
||||
.collect();
|
||||
assert_eq!(
|
||||
nested_remote_files, trim_remote_blobs,
|
||||
"remote storage list_files on subdirrectory mismatches with the uploads."
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test_context(MaybeEnabledAzure)]
|
||||
#[tokio::test]
|
||||
async fn azure_delete_non_exising_works(ctx: &mut MaybeEnabledAzure) -> anyhow::Result<()> {
|
||||
let ctx = match ctx {
|
||||
MaybeEnabledAzure::Enabled(ctx) => ctx,
|
||||
MaybeEnabledAzure::Disabled => return Ok(()),
|
||||
};
|
||||
|
||||
let path = RemotePath::new(Utf8Path::new(
|
||||
format!("{}/for_sure_there_is_nothing_there_really", ctx.base_prefix).as_str(),
|
||||
))
|
||||
.with_context(|| "RemotePath conversion")?;
|
||||
|
||||
ctx.client.delete(&path).await.expect("should succeed");
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test_context(MaybeEnabledAzure)]
|
||||
#[tokio::test]
|
||||
async fn azure_delete_objects_works(ctx: &mut MaybeEnabledAzure) -> anyhow::Result<()> {
|
||||
let ctx = match ctx {
|
||||
MaybeEnabledAzure::Enabled(ctx) => ctx,
|
||||
MaybeEnabledAzure::Disabled => return Ok(()),
|
||||
};
|
||||
|
||||
let path1 = RemotePath::new(Utf8Path::new(format!("{}/path1", ctx.base_prefix).as_str()))
|
||||
.with_context(|| "RemotePath conversion")?;
|
||||
|
||||
let path2 = RemotePath::new(Utf8Path::new(format!("{}/path2", ctx.base_prefix).as_str()))
|
||||
.with_context(|| "RemotePath conversion")?;
|
||||
|
||||
let path3 = RemotePath::new(Utf8Path::new(format!("{}/path3", ctx.base_prefix).as_str()))
|
||||
.with_context(|| "RemotePath conversion")?;
|
||||
|
||||
let data1 = "remote blob data1".as_bytes();
|
||||
let data1_len = data1.len();
|
||||
let data2 = "remote blob data2".as_bytes();
|
||||
let data2_len = data2.len();
|
||||
let data3 = "remote blob data3".as_bytes();
|
||||
let data3_len = data3.len();
|
||||
ctx.client
|
||||
.upload(std::io::Cursor::new(data1), data1_len, &path1, None)
|
||||
.await?;
|
||||
|
||||
ctx.client
|
||||
.upload(std::io::Cursor::new(data2), data2_len, &path2, None)
|
||||
.await?;
|
||||
|
||||
ctx.client
|
||||
.upload(std::io::Cursor::new(data3), data3_len, &path3, None)
|
||||
.await?;
|
||||
|
||||
ctx.client.delete_objects(&[path1, path2]).await?;
|
||||
|
||||
let prefixes = ctx.client.list_prefixes(None).await?;
|
||||
|
||||
assert_eq!(prefixes.len(), 1);
|
||||
|
||||
ctx.client.delete_objects(&[path3]).await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test_context(MaybeEnabledAzure)]
|
||||
#[tokio::test]
|
||||
async fn azure_upload_download_works(ctx: &mut MaybeEnabledAzure) -> anyhow::Result<()> {
|
||||
let MaybeEnabledAzure::Enabled(ctx) = ctx else {
|
||||
return Ok(());
|
||||
};
|
||||
|
||||
let path = RemotePath::new(Utf8Path::new(format!("{}/file", ctx.base_prefix).as_str()))
|
||||
.with_context(|| "RemotePath conversion")?;
|
||||
|
||||
let data = "remote blob data here".as_bytes();
|
||||
let data_len = data.len() as u64;
|
||||
|
||||
ctx.client
|
||||
.upload(std::io::Cursor::new(data), data.len(), &path, None)
|
||||
.await?;
|
||||
|
||||
async fn download_and_compare(mut dl: Download) -> anyhow::Result<Vec<u8>> {
|
||||
let mut buf = Vec::new();
|
||||
tokio::io::copy(&mut dl.download_stream, &mut buf).await?;
|
||||
Ok(buf)
|
||||
}
|
||||
// Normal download request
|
||||
let dl = ctx.client.download(&path).await?;
|
||||
let buf = download_and_compare(dl).await?;
|
||||
assert_eq!(buf, data);
|
||||
|
||||
// Full range (end specified)
|
||||
let dl = ctx
|
||||
.client
|
||||
.download_byte_range(&path, 0, Some(data_len))
|
||||
.await?;
|
||||
let buf = download_and_compare(dl).await?;
|
||||
assert_eq!(buf, data);
|
||||
|
||||
// partial range (end specified)
|
||||
let dl = ctx.client.download_byte_range(&path, 4, Some(10)).await?;
|
||||
let buf = download_and_compare(dl).await?;
|
||||
assert_eq!(buf, data[4..10]);
|
||||
|
||||
// partial range (end beyond real end)
|
||||
let dl = ctx
|
||||
.client
|
||||
.download_byte_range(&path, 8, Some(data_len * 100))
|
||||
.await?;
|
||||
let buf = download_and_compare(dl).await?;
|
||||
assert_eq!(buf, data[8..]);
|
||||
|
||||
// Partial range (end unspecified)
|
||||
let dl = ctx.client.download_byte_range(&path, 4, None).await?;
|
||||
let buf = download_and_compare(dl).await?;
|
||||
assert_eq!(buf, data[4..]);
|
||||
|
||||
// Full range (end unspecified)
|
||||
let dl = ctx.client.download_byte_range(&path, 0, None).await?;
|
||||
let buf = download_and_compare(dl).await?;
|
||||
assert_eq!(buf, data);
|
||||
|
||||
debug!("Cleanup: deleting file at path {path:?}");
|
||||
ctx.client
|
||||
.delete(&path)
|
||||
.await
|
||||
.with_context(|| format!("{path:?} removal"))?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn ensure_logging_ready() {
|
||||
LOGGING_DONE.get_or_init(|| {
|
||||
utils::logging::init(
|
||||
utils::logging::LogFormat::Test,
|
||||
utils::logging::TracingErrorLayerEnablement::Disabled,
|
||||
)
|
||||
.expect("logging init failed");
|
||||
});
|
||||
}
|
||||
|
||||
struct EnabledAzure {
|
||||
client: Arc<GenericRemoteStorage>,
|
||||
base_prefix: &'static str,
|
||||
}
|
||||
|
||||
impl EnabledAzure {
|
||||
async fn setup(max_keys_in_list_response: Option<i32>) -> Self {
|
||||
let client = create_azure_client(max_keys_in_list_response)
|
||||
.context("Azure client creation")
|
||||
.expect("Azure client creation failed");
|
||||
|
||||
EnabledAzure {
|
||||
client,
|
||||
base_prefix: BASE_PREFIX,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
enum MaybeEnabledAzure {
|
||||
Enabled(EnabledAzure),
|
||||
Disabled,
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl AsyncTestContext for MaybeEnabledAzure {
|
||||
async fn setup() -> Self {
|
||||
ensure_logging_ready();
|
||||
|
||||
if env::var(ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME).is_err() {
|
||||
info!(
|
||||
"`{}` env variable is not set, skipping the test",
|
||||
ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME
|
||||
);
|
||||
return Self::Disabled;
|
||||
}
|
||||
|
||||
Self::Enabled(EnabledAzure::setup(None).await)
|
||||
}
|
||||
}
|
||||
|
||||
enum MaybeEnabledAzureWithTestBlobs {
|
||||
Enabled(AzureWithTestBlobs),
|
||||
Disabled,
|
||||
UploadsFailed(anyhow::Error, AzureWithTestBlobs),
|
||||
}
|
||||
|
||||
struct AzureWithTestBlobs {
|
||||
enabled: EnabledAzure,
|
||||
remote_prefixes: HashSet<RemotePath>,
|
||||
remote_blobs: HashSet<RemotePath>,
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl AsyncTestContext for MaybeEnabledAzureWithTestBlobs {
|
||||
async fn setup() -> Self {
|
||||
ensure_logging_ready();
|
||||
if env::var(ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME).is_err() {
|
||||
info!(
|
||||
"`{}` env variable is not set, skipping the test",
|
||||
ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME
|
||||
);
|
||||
return Self::Disabled;
|
||||
}
|
||||
|
||||
let max_keys_in_list_response = 10;
|
||||
let upload_tasks_count = 1 + (2 * usize::try_from(max_keys_in_list_response).unwrap());
|
||||
|
||||
let enabled = EnabledAzure::setup(Some(max_keys_in_list_response)).await;
|
||||
|
||||
match upload_azure_data(&enabled.client, enabled.base_prefix, upload_tasks_count).await {
|
||||
ControlFlow::Continue(uploads) => {
|
||||
info!("Remote objects created successfully");
|
||||
|
||||
Self::Enabled(AzureWithTestBlobs {
|
||||
enabled,
|
||||
remote_prefixes: uploads.prefixes,
|
||||
remote_blobs: uploads.blobs,
|
||||
})
|
||||
}
|
||||
ControlFlow::Break(uploads) => Self::UploadsFailed(
|
||||
anyhow::anyhow!("One or multiple blobs failed to upload to Azure"),
|
||||
AzureWithTestBlobs {
|
||||
enabled,
|
||||
remote_prefixes: uploads.prefixes,
|
||||
remote_blobs: uploads.blobs,
|
||||
},
|
||||
),
|
||||
}
|
||||
}
|
||||
|
||||
async fn teardown(self) {
|
||||
match self {
|
||||
Self::Disabled => {}
|
||||
Self::Enabled(ctx) | Self::UploadsFailed(_, ctx) => {
|
||||
cleanup(&ctx.enabled.client, ctx.remote_blobs).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// NOTE: the setups for the list_prefixes test and the list_files test are very similar
|
||||
// However, they are not idential. The list_prefixes function is concerned with listing prefixes,
|
||||
// whereas the list_files function is concerned with listing files.
|
||||
// See `RemoteStorage::list_files` documentation for more details
|
||||
enum MaybeEnabledAzureWithSimpleTestBlobs {
|
||||
Enabled(AzureWithSimpleTestBlobs),
|
||||
Disabled,
|
||||
UploadsFailed(anyhow::Error, AzureWithSimpleTestBlobs),
|
||||
}
|
||||
struct AzureWithSimpleTestBlobs {
|
||||
enabled: EnabledAzure,
|
||||
remote_blobs: HashSet<RemotePath>,
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl AsyncTestContext for MaybeEnabledAzureWithSimpleTestBlobs {
|
||||
async fn setup() -> Self {
|
||||
ensure_logging_ready();
|
||||
if env::var(ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME).is_err() {
|
||||
info!(
|
||||
"`{}` env variable is not set, skipping the test",
|
||||
ENABLE_REAL_AZURE_REMOTE_STORAGE_ENV_VAR_NAME
|
||||
);
|
||||
return Self::Disabled;
|
||||
}
|
||||
|
||||
let max_keys_in_list_response = 10;
|
||||
let upload_tasks_count = 1 + (2 * usize::try_from(max_keys_in_list_response).unwrap());
|
||||
|
||||
let enabled = EnabledAzure::setup(Some(max_keys_in_list_response)).await;
|
||||
|
||||
match upload_simple_azure_data(&enabled.client, upload_tasks_count).await {
|
||||
ControlFlow::Continue(uploads) => {
|
||||
info!("Remote objects created successfully");
|
||||
|
||||
Self::Enabled(AzureWithSimpleTestBlobs {
|
||||
enabled,
|
||||
remote_blobs: uploads,
|
||||
})
|
||||
}
|
||||
ControlFlow::Break(uploads) => Self::UploadsFailed(
|
||||
anyhow::anyhow!("One or multiple blobs failed to upload to Azure"),
|
||||
AzureWithSimpleTestBlobs {
|
||||
enabled,
|
||||
remote_blobs: uploads,
|
||||
},
|
||||
),
|
||||
}
|
||||
}
|
||||
|
||||
async fn teardown(self) {
|
||||
match self {
|
||||
Self::Disabled => {}
|
||||
Self::Enabled(ctx) | Self::UploadsFailed(_, ctx) => {
|
||||
cleanup(&ctx.enabled.client, ctx.remote_blobs).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn create_azure_client(
|
||||
max_keys_per_list_response: Option<i32>,
|
||||
) -> anyhow::Result<Arc<GenericRemoteStorage>> {
|
||||
use rand::Rng;
|
||||
|
||||
let remote_storage_azure_container = env::var("REMOTE_STORAGE_AZURE_CONTAINER").context(
|
||||
"`REMOTE_STORAGE_AZURE_CONTAINER` env var is not set, but real Azure tests are enabled",
|
||||
)?;
|
||||
let remote_storage_azure_region = env::var("REMOTE_STORAGE_AZURE_REGION").context(
|
||||
"`REMOTE_STORAGE_AZURE_REGION` env var is not set, but real Azure tests are enabled",
|
||||
)?;
|
||||
|
||||
// due to how time works, we've had test runners use the same nanos as bucket prefixes.
|
||||
// millis is just a debugging aid for easier finding the prefix later.
|
||||
let millis = std::time::SystemTime::now()
|
||||
.duration_since(UNIX_EPOCH)
|
||||
.context("random Azure test prefix part calculation")?
|
||||
.as_millis();
|
||||
|
||||
// because nanos can be the same for two threads so can millis, add randomness
|
||||
let random = rand::thread_rng().gen::<u32>();
|
||||
|
||||
let remote_storage_config = RemoteStorageConfig {
|
||||
max_concurrent_syncs: NonZeroUsize::new(100).unwrap(),
|
||||
max_sync_errors: NonZeroU32::new(5).unwrap(),
|
||||
storage: RemoteStorageKind::AzureContainer(AzureConfig {
|
||||
container_name: remote_storage_azure_container,
|
||||
container_region: remote_storage_azure_region,
|
||||
prefix_in_container: Some(format!("test_{millis}_{random:08x}/")),
|
||||
concurrency_limit: NonZeroUsize::new(100).unwrap(),
|
||||
max_keys_per_list_response,
|
||||
}),
|
||||
};
|
||||
Ok(Arc::new(
|
||||
GenericRemoteStorage::from_config(&remote_storage_config).context("remote storage init")?,
|
||||
))
|
||||
}
|
||||
|
||||
struct Uploads {
|
||||
prefixes: HashSet<RemotePath>,
|
||||
blobs: HashSet<RemotePath>,
|
||||
}
|
||||
|
||||
async fn upload_azure_data(
|
||||
client: &Arc<GenericRemoteStorage>,
|
||||
base_prefix_str: &'static str,
|
||||
upload_tasks_count: usize,
|
||||
) -> ControlFlow<Uploads, Uploads> {
|
||||
info!("Creating {upload_tasks_count} Azure files");
|
||||
let mut upload_tasks = JoinSet::new();
|
||||
for i in 1..upload_tasks_count + 1 {
|
||||
let task_client = Arc::clone(client);
|
||||
upload_tasks.spawn(async move {
|
||||
let prefix = format!("{base_prefix_str}/sub_prefix_{i}/");
|
||||
let blob_prefix = RemotePath::new(Utf8Path::new(&prefix))
|
||||
.with_context(|| format!("{prefix:?} to RemotePath conversion"))?;
|
||||
let blob_path = blob_prefix.join(Utf8Path::new(&format!("blob_{i}")));
|
||||
debug!("Creating remote item {i} at path {blob_path:?}");
|
||||
|
||||
let data = format!("remote blob data {i}").into_bytes();
|
||||
let data_len = data.len();
|
||||
task_client
|
||||
.upload(std::io::Cursor::new(data), data_len, &blob_path, None)
|
||||
.await?;
|
||||
|
||||
Ok::<_, anyhow::Error>((blob_prefix, blob_path))
|
||||
});
|
||||
}
|
||||
|
||||
let mut upload_tasks_failed = false;
|
||||
let mut uploaded_prefixes = HashSet::with_capacity(upload_tasks_count);
|
||||
let mut uploaded_blobs = HashSet::with_capacity(upload_tasks_count);
|
||||
while let Some(task_run_result) = upload_tasks.join_next().await {
|
||||
match task_run_result
|
||||
.context("task join failed")
|
||||
.and_then(|task_result| task_result.context("upload task failed"))
|
||||
{
|
||||
Ok((upload_prefix, upload_path)) => {
|
||||
uploaded_prefixes.insert(upload_prefix);
|
||||
uploaded_blobs.insert(upload_path);
|
||||
}
|
||||
Err(e) => {
|
||||
error!("Upload task failed: {e:?}");
|
||||
upload_tasks_failed = true;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let uploads = Uploads {
|
||||
prefixes: uploaded_prefixes,
|
||||
blobs: uploaded_blobs,
|
||||
};
|
||||
if upload_tasks_failed {
|
||||
ControlFlow::Break(uploads)
|
||||
} else {
|
||||
ControlFlow::Continue(uploads)
|
||||
}
|
||||
}
|
||||
|
||||
async fn cleanup(client: &Arc<GenericRemoteStorage>, objects_to_delete: HashSet<RemotePath>) {
|
||||
info!(
|
||||
"Removing {} objects from the remote storage during cleanup",
|
||||
objects_to_delete.len()
|
||||
);
|
||||
let mut delete_tasks = JoinSet::new();
|
||||
for object_to_delete in objects_to_delete {
|
||||
let task_client = Arc::clone(client);
|
||||
delete_tasks.spawn(async move {
|
||||
debug!("Deleting remote item at path {object_to_delete:?}");
|
||||
task_client
|
||||
.delete(&object_to_delete)
|
||||
.await
|
||||
.with_context(|| format!("{object_to_delete:?} removal"))
|
||||
});
|
||||
}
|
||||
|
||||
while let Some(task_run_result) = delete_tasks.join_next().await {
|
||||
match task_run_result {
|
||||
Ok(task_result) => match task_result {
|
||||
Ok(()) => {}
|
||||
Err(e) => error!("Delete task failed: {e:?}"),
|
||||
},
|
||||
Err(join_err) => error!("Delete task did not finish correctly: {join_err}"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Uploads files `folder{j}/blob{i}.txt`. See test description for more details.
|
||||
async fn upload_simple_azure_data(
|
||||
client: &Arc<GenericRemoteStorage>,
|
||||
upload_tasks_count: usize,
|
||||
) -> ControlFlow<HashSet<RemotePath>, HashSet<RemotePath>> {
|
||||
info!("Creating {upload_tasks_count} Azure files");
|
||||
let mut upload_tasks = JoinSet::new();
|
||||
for i in 1..upload_tasks_count + 1 {
|
||||
let task_client = Arc::clone(client);
|
||||
upload_tasks.spawn(async move {
|
||||
let blob_path = PathBuf::from(format!("folder{}/blob_{}.txt", i / 7, i));
|
||||
let blob_path = RemotePath::new(
|
||||
Utf8Path::from_path(blob_path.as_path()).expect("must be valid blob path"),
|
||||
)
|
||||
.with_context(|| format!("{blob_path:?} to RemotePath conversion"))?;
|
||||
debug!("Creating remote item {i} at path {blob_path:?}");
|
||||
|
||||
let data = format!("remote blob data {i}").into_bytes();
|
||||
let data_len = data.len();
|
||||
task_client
|
||||
.upload(std::io::Cursor::new(data), data_len, &blob_path, None)
|
||||
.await?;
|
||||
|
||||
Ok::<_, anyhow::Error>(blob_path)
|
||||
});
|
||||
}
|
||||
|
||||
let mut upload_tasks_failed = false;
|
||||
let mut uploaded_blobs = HashSet::with_capacity(upload_tasks_count);
|
||||
while let Some(task_run_result) = upload_tasks.join_next().await {
|
||||
match task_run_result
|
||||
.context("task join failed")
|
||||
.and_then(|task_result| task_result.context("upload task failed"))
|
||||
{
|
||||
Ok(upload_path) => {
|
||||
uploaded_blobs.insert(upload_path);
|
||||
}
|
||||
Err(e) => {
|
||||
error!("Upload task failed: {e:?}");
|
||||
upload_tasks_failed = true;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if upload_tasks_failed {
|
||||
ControlFlow::Break(uploaded_blobs)
|
||||
} else {
|
||||
ControlFlow::Continue(uploaded_blobs)
|
||||
}
|
||||
}
|
||||
@@ -119,7 +119,6 @@ pub fn api_error_handler(api_error: ApiError) -> Response<Body> {
|
||||
|
||||
match api_error {
|
||||
ApiError::ResourceUnavailable(_) => info!("Error processing HTTP request: {api_error:#}"),
|
||||
ApiError::NotFound(_) => info!("Error processing HTTP request: {api_error:#}"),
|
||||
ApiError::InternalServerError(_) => error!("Error processing HTTP request: {api_error:?}"),
|
||||
_ => error!("Error processing HTTP request: {api_error:#}"),
|
||||
}
|
||||
|
||||
@@ -73,8 +73,6 @@ pub mod completion;
|
||||
/// Reporting utilities
|
||||
pub mod error;
|
||||
|
||||
pub mod sync;
|
||||
|
||||
/// This is a shortcut to embed git sha into binaries and avoid copying the same build script to all packages
|
||||
///
|
||||
/// we have several cases:
|
||||
@@ -130,21 +128,6 @@ macro_rules! project_git_version {
|
||||
};
|
||||
}
|
||||
|
||||
/// This is a shortcut to embed build tag into binaries and avoid copying the same build script to all packages
|
||||
#[macro_export]
|
||||
macro_rules! project_build_tag {
|
||||
($const_identifier:ident) => {
|
||||
const $const_identifier: &::core::primitive::str = {
|
||||
const __ARG: &[&::core::primitive::str; 2] = &match ::core::option_env!("BUILD_TAG") {
|
||||
::core::option::Option::Some(x) => ["build_tag-env:", x],
|
||||
::core::option::Option::None => ["build_tag:", ""],
|
||||
};
|
||||
|
||||
$crate::__const_format::concatcp!(__ARG[0], __ARG[1])
|
||||
};
|
||||
};
|
||||
}
|
||||
|
||||
/// Re-export for `project_git_version` macro
|
||||
#[doc(hidden)]
|
||||
pub use const_format as __const_format;
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
pub mod heavier_once_cell;
|
||||
@@ -1,383 +0,0 @@
|
||||
use std::sync::{
|
||||
atomic::{AtomicUsize, Ordering},
|
||||
Arc, Mutex, MutexGuard,
|
||||
};
|
||||
use tokio::sync::Semaphore;
|
||||
|
||||
/// Custom design like [`tokio::sync::OnceCell`] but using [`OwnedSemaphorePermit`] instead of
|
||||
/// `SemaphorePermit`, allowing use of `take` which does not require holding an outer mutex guard
|
||||
/// for the duration of initialization.
|
||||
///
|
||||
/// Has no unsafe, builds upon [`tokio::sync::Semaphore`] and [`std::sync::Mutex`].
|
||||
///
|
||||
/// [`OwnedSemaphorePermit`]: tokio::sync::OwnedSemaphorePermit
|
||||
pub struct OnceCell<T> {
|
||||
inner: Mutex<Inner<T>>,
|
||||
initializers: AtomicUsize,
|
||||
}
|
||||
|
||||
impl<T> Default for OnceCell<T> {
|
||||
/// Create new uninitialized [`OnceCell`].
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
inner: Default::default(),
|
||||
initializers: AtomicUsize::new(0),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Semaphore is the current state:
|
||||
/// - open semaphore means the value is `None`, not yet initialized
|
||||
/// - closed semaphore means the value has been initialized
|
||||
#[derive(Debug)]
|
||||
struct Inner<T> {
|
||||
init_semaphore: Arc<Semaphore>,
|
||||
value: Option<T>,
|
||||
}
|
||||
|
||||
impl<T> Default for Inner<T> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
init_semaphore: Arc::new(Semaphore::new(1)),
|
||||
value: None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> OnceCell<T> {
|
||||
/// Creates an already initialized `OnceCell` with the given value.
|
||||
pub fn new(value: T) -> Self {
|
||||
let sem = Semaphore::new(1);
|
||||
sem.close();
|
||||
Self {
|
||||
inner: Mutex::new(Inner {
|
||||
init_semaphore: Arc::new(sem),
|
||||
value: Some(value),
|
||||
}),
|
||||
initializers: AtomicUsize::new(0),
|
||||
}
|
||||
}
|
||||
|
||||
/// Returns a guard to an existing initialized value, or uniquely initializes the value before
|
||||
/// returning the guard.
|
||||
///
|
||||
/// Initializing might wait on any existing [`Guard::take_and_deinit`] deinitialization.
|
||||
///
|
||||
/// Initialization is panic-safe and cancellation-safe.
|
||||
pub async fn get_or_init<F, Fut, E>(&self, factory: F) -> Result<Guard<'_, T>, E>
|
||||
where
|
||||
F: FnOnce(InitPermit) -> Fut,
|
||||
Fut: std::future::Future<Output = Result<(T, InitPermit), E>>,
|
||||
{
|
||||
let sem = {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
if guard.value.is_some() {
|
||||
return Ok(Guard(guard));
|
||||
}
|
||||
guard.init_semaphore.clone()
|
||||
};
|
||||
|
||||
let permit = {
|
||||
// increment the count for the duration of queued
|
||||
let _guard = CountWaitingInitializers::start(self);
|
||||
sem.acquire_owned().await
|
||||
};
|
||||
|
||||
match permit {
|
||||
Ok(permit) => {
|
||||
let permit = InitPermit(permit);
|
||||
let (value, _permit) = factory(permit).await?;
|
||||
|
||||
let guard = self.inner.lock().unwrap();
|
||||
|
||||
Ok(Self::set0(value, guard))
|
||||
}
|
||||
Err(_closed) => {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
assert!(
|
||||
guard.value.is_some(),
|
||||
"semaphore got closed, must be initialized"
|
||||
);
|
||||
return Ok(Guard(guard));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Assuming a permit is held after previous call to [`Guard::take_and_deinit`], it can be used
|
||||
/// to complete initializing the inner value.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// If the inner has already been initialized.
|
||||
pub fn set(&self, value: T, _permit: InitPermit) -> Guard<'_, T> {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
|
||||
// cannot assert that this permit is for self.inner.semaphore, but we can assert it cannot
|
||||
// give more permits right now.
|
||||
if guard.init_semaphore.try_acquire().is_ok() {
|
||||
drop(guard);
|
||||
panic!("permit is of wrong origin");
|
||||
}
|
||||
|
||||
Self::set0(value, guard)
|
||||
}
|
||||
|
||||
fn set0(value: T, mut guard: std::sync::MutexGuard<'_, Inner<T>>) -> Guard<'_, T> {
|
||||
if guard.value.is_some() {
|
||||
drop(guard);
|
||||
unreachable!("we won permit, must not be initialized");
|
||||
}
|
||||
guard.value = Some(value);
|
||||
guard.init_semaphore.close();
|
||||
Guard(guard)
|
||||
}
|
||||
|
||||
/// Returns a guard to an existing initialized value, if any.
|
||||
pub fn get(&self) -> Option<Guard<'_, T>> {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
if guard.value.is_some() {
|
||||
Some(Guard(guard))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
/// Return the number of [`Self::get_or_init`] calls waiting for initialization to complete.
|
||||
pub fn initializer_count(&self) -> usize {
|
||||
self.initializers.load(Ordering::Relaxed)
|
||||
}
|
||||
}
|
||||
|
||||
/// DropGuard counter for queued tasks waiting to initialize, mainly accessible for the
|
||||
/// initializing task for example at the end of initialization.
|
||||
struct CountWaitingInitializers<'a, T>(&'a OnceCell<T>);
|
||||
|
||||
impl<'a, T> CountWaitingInitializers<'a, T> {
|
||||
fn start(target: &'a OnceCell<T>) -> Self {
|
||||
target.initializers.fetch_add(1, Ordering::Relaxed);
|
||||
CountWaitingInitializers(target)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, T> Drop for CountWaitingInitializers<'a, T> {
|
||||
fn drop(&mut self) {
|
||||
self.0.initializers.fetch_sub(1, Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
|
||||
/// Uninteresting guard object to allow short-lived access to inspect or clone the held,
|
||||
/// initialized value.
|
||||
#[derive(Debug)]
|
||||
pub struct Guard<'a, T>(MutexGuard<'a, Inner<T>>);
|
||||
|
||||
impl<T> std::ops::Deref for Guard<'_, T> {
|
||||
type Target = T;
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
self.0
|
||||
.value
|
||||
.as_ref()
|
||||
.expect("guard is not created unless value has been initialized")
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> std::ops::DerefMut for Guard<'_, T> {
|
||||
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||
self.0
|
||||
.value
|
||||
.as_mut()
|
||||
.expect("guard is not created unless value has been initialized")
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, T> Guard<'a, T> {
|
||||
/// Take the current value, and a new permit for it's deinitialization.
|
||||
///
|
||||
/// The permit will be on a semaphore part of the new internal value, and any following
|
||||
/// [`OnceCell::get_or_init`] will wait on it to complete.
|
||||
pub fn take_and_deinit(&mut self) -> (T, InitPermit) {
|
||||
let mut swapped = Inner::default();
|
||||
let permit = swapped
|
||||
.init_semaphore
|
||||
.clone()
|
||||
.try_acquire_owned()
|
||||
.expect("we just created this");
|
||||
std::mem::swap(&mut *self.0, &mut swapped);
|
||||
swapped
|
||||
.value
|
||||
.map(|v| (v, InitPermit(permit)))
|
||||
.expect("guard is not created unless value has been initialized")
|
||||
}
|
||||
}
|
||||
|
||||
/// Type held by OnceCell (de)initializing task.
|
||||
pub struct InitPermit(tokio::sync::OwnedSemaphorePermit);
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use std::{
|
||||
convert::Infallible,
|
||||
sync::atomic::{AtomicUsize, Ordering},
|
||||
time::Duration,
|
||||
};
|
||||
|
||||
#[tokio::test]
|
||||
async fn many_initializers() {
|
||||
#[derive(Default, Debug)]
|
||||
struct Counters {
|
||||
factory_got_to_run: AtomicUsize,
|
||||
future_polled: AtomicUsize,
|
||||
winners: AtomicUsize,
|
||||
}
|
||||
|
||||
let initializers = 100;
|
||||
|
||||
let cell = Arc::new(OnceCell::default());
|
||||
let counters = Arc::new(Counters::default());
|
||||
let barrier = Arc::new(tokio::sync::Barrier::new(initializers + 1));
|
||||
|
||||
let mut js = tokio::task::JoinSet::new();
|
||||
for i in 0..initializers {
|
||||
js.spawn({
|
||||
let cell = cell.clone();
|
||||
let counters = counters.clone();
|
||||
let barrier = barrier.clone();
|
||||
|
||||
async move {
|
||||
barrier.wait().await;
|
||||
let won = {
|
||||
let g = cell
|
||||
.get_or_init(|permit| {
|
||||
counters.factory_got_to_run.fetch_add(1, Ordering::Relaxed);
|
||||
async {
|
||||
counters.future_polled.fetch_add(1, Ordering::Relaxed);
|
||||
Ok::<_, Infallible>((i, permit))
|
||||
}
|
||||
})
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
*g == i
|
||||
};
|
||||
|
||||
if won {
|
||||
counters.winners.fetch_add(1, Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
barrier.wait().await;
|
||||
|
||||
while let Some(next) = js.join_next().await {
|
||||
next.expect("no panics expected");
|
||||
}
|
||||
|
||||
let mut counters = Arc::try_unwrap(counters).unwrap();
|
||||
|
||||
assert_eq!(*counters.factory_got_to_run.get_mut(), 1);
|
||||
assert_eq!(*counters.future_polled.get_mut(), 1);
|
||||
assert_eq!(*counters.winners.get_mut(), 1);
|
||||
}
|
||||
|
||||
#[tokio::test(start_paused = true)]
|
||||
async fn reinit_waits_for_deinit() {
|
||||
// with the tokio::time paused, we will "sleep" for 1s while holding the reinitialization
|
||||
let sleep_for = Duration::from_secs(1);
|
||||
let initial = 42;
|
||||
let reinit = 1;
|
||||
let cell = Arc::new(OnceCell::new(initial));
|
||||
|
||||
let deinitialization_started = Arc::new(tokio::sync::Barrier::new(2));
|
||||
|
||||
let jh = tokio::spawn({
|
||||
let cell = cell.clone();
|
||||
let deinitialization_started = deinitialization_started.clone();
|
||||
async move {
|
||||
let (answer, _permit) = cell.get().expect("initialized to value").take_and_deinit();
|
||||
assert_eq!(answer, initial);
|
||||
|
||||
deinitialization_started.wait().await;
|
||||
tokio::time::sleep(sleep_for).await;
|
||||
}
|
||||
});
|
||||
|
||||
deinitialization_started.wait().await;
|
||||
|
||||
let started_at = tokio::time::Instant::now();
|
||||
cell.get_or_init(|permit| async { Ok::<_, Infallible>((reinit, permit)) })
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
let elapsed = started_at.elapsed();
|
||||
assert!(
|
||||
elapsed >= sleep_for,
|
||||
"initialization should had taken at least the time time slept with permit"
|
||||
);
|
||||
|
||||
jh.await.unwrap();
|
||||
|
||||
assert_eq!(*cell.get().unwrap(), reinit);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn reinit_with_deinit_permit() {
|
||||
let cell = Arc::new(OnceCell::new(42));
|
||||
|
||||
let (mol, permit) = cell.get().unwrap().take_and_deinit();
|
||||
cell.set(5, permit);
|
||||
assert_eq!(*cell.get().unwrap(), 5);
|
||||
|
||||
let (five, permit) = cell.get().unwrap().take_and_deinit();
|
||||
assert_eq!(5, five);
|
||||
cell.set(mol, permit);
|
||||
assert_eq!(*cell.get().unwrap(), 42);
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn initialization_attemptable_until_ok() {
|
||||
let cell = OnceCell::default();
|
||||
|
||||
for _ in 0..10 {
|
||||
cell.get_or_init(|_permit| async { Err("whatever error") })
|
||||
.await
|
||||
.unwrap_err();
|
||||
}
|
||||
|
||||
let g = cell
|
||||
.get_or_init(|permit| async { Ok::<_, Infallible>(("finally success", permit)) })
|
||||
.await
|
||||
.unwrap();
|
||||
assert_eq!(*g, "finally success");
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn initialization_is_cancellation_safe() {
|
||||
let cell = OnceCell::default();
|
||||
|
||||
let barrier = tokio::sync::Barrier::new(2);
|
||||
|
||||
let initializer = cell.get_or_init(|permit| async {
|
||||
barrier.wait().await;
|
||||
futures::future::pending::<()>().await;
|
||||
|
||||
Ok::<_, Infallible>(("never reached", permit))
|
||||
});
|
||||
|
||||
tokio::select! {
|
||||
_ = initializer => { unreachable!("cannot complete; stuck in pending().await") },
|
||||
_ = barrier.wait() => {}
|
||||
};
|
||||
|
||||
// now initializer is dropped
|
||||
|
||||
assert!(cell.get().is_none());
|
||||
|
||||
let g = cell
|
||||
.get_or_init(|permit| async { Ok::<_, Infallible>(("now initialized", permit)) })
|
||||
.await
|
||||
.unwrap();
|
||||
assert_eq!(*g, "now initialized");
|
||||
}
|
||||
}
|
||||
@@ -27,8 +27,8 @@ and old one if it exists.
|
||||
* the filecache: a struct that allows communication with the Postgres file cache.
|
||||
On startup, we connect to the filecache and hold on to the connection for the
|
||||
entire monitor lifetime.
|
||||
* the cgroup watcher: the `CgroupWatcher` polls the `neon-postgres` cgroup's memory
|
||||
usage and sends rolling aggregates to the runner.
|
||||
* the cgroup watcher: the `CgroupWatcher` manages the `neon-postgres` cgroup by
|
||||
listening for `memory.high` events and setting its `memory.{high,max}` values.
|
||||
* the runner: the runner marries the filecache and cgroup watcher together,
|
||||
communicating with the agent throught the `Dispatcher`, and then calling filecache
|
||||
and cgroup watcher functions as needed to upscale and downscale
|
||||
|
||||
@@ -1,38 +1,161 @@
|
||||
use std::fmt::{self, Debug, Formatter};
|
||||
use std::time::{Duration, Instant};
|
||||
|
||||
use anyhow::{anyhow, Context};
|
||||
use cgroups_rs::{
|
||||
hierarchies::{self, is_cgroup2_unified_mode},
|
||||
memory::MemController,
|
||||
Subsystem,
|
||||
use std::{
|
||||
fmt::{Debug, Display},
|
||||
fs,
|
||||
pin::pin,
|
||||
sync::atomic::{AtomicU64, Ordering},
|
||||
};
|
||||
use tokio::sync::watch;
|
||||
|
||||
use anyhow::{anyhow, bail, Context};
|
||||
use cgroups_rs::{
|
||||
freezer::FreezerController,
|
||||
hierarchies::{self, is_cgroup2_unified_mode, UNIFIED_MOUNTPOINT},
|
||||
memory::MemController,
|
||||
MaxValue,
|
||||
Subsystem::{Freezer, Mem},
|
||||
};
|
||||
use inotify::{EventStream, Inotify, WatchMask};
|
||||
use tokio::sync::mpsc::{self, error::TryRecvError};
|
||||
use tokio::time::{Duration, Instant};
|
||||
use tokio_stream::{Stream, StreamExt};
|
||||
use tracing::{info, warn};
|
||||
|
||||
use crate::protocol::Resources;
|
||||
use crate::MiB;
|
||||
|
||||
/// Monotonically increasing counter of the number of memory.high events
|
||||
/// the cgroup has experienced.
|
||||
///
|
||||
/// We use this to determine if a modification to the `memory.events` file actually
|
||||
/// changed the `high` field. If not, we don't care about the change. When we
|
||||
/// read the file, we check the `high` field in the file against `MEMORY_EVENT_COUNT`
|
||||
/// to see if it changed since last time.
|
||||
pub static MEMORY_EVENT_COUNT: AtomicU64 = AtomicU64::new(0);
|
||||
|
||||
/// Monotonically increasing counter that gives each cgroup event a unique id.
|
||||
///
|
||||
/// This allows us to answer questions like "did this upscale arrive before this
|
||||
/// memory.high?". This static is also used by the `Sequenced` type to "tag" values
|
||||
/// with a sequence number. As such, prefer to used the `Sequenced` type rather
|
||||
/// than this static directly.
|
||||
static EVENT_SEQUENCE_NUMBER: AtomicU64 = AtomicU64::new(0);
|
||||
|
||||
/// A memory event type reported in memory.events.
|
||||
#[derive(Debug, Eq, PartialEq, Copy, Clone)]
|
||||
pub enum MemoryEvent {
|
||||
Low,
|
||||
High,
|
||||
Max,
|
||||
Oom,
|
||||
OomKill,
|
||||
OomGroupKill,
|
||||
}
|
||||
|
||||
impl MemoryEvent {
|
||||
fn as_str(&self) -> &str {
|
||||
match self {
|
||||
MemoryEvent::Low => "low",
|
||||
MemoryEvent::High => "high",
|
||||
MemoryEvent::Max => "max",
|
||||
MemoryEvent::Oom => "oom",
|
||||
MemoryEvent::OomKill => "oom_kill",
|
||||
MemoryEvent::OomGroupKill => "oom_group_kill",
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl Display for MemoryEvent {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.write_str(self.as_str())
|
||||
}
|
||||
}
|
||||
|
||||
/// Configuration for a `CgroupWatcher`
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct Config {
|
||||
/// Interval at which we should be fetching memory statistics
|
||||
memory_poll_interval: Duration,
|
||||
// The target difference between the total memory reserved for the cgroup
|
||||
// and the value of the cgroup's memory.high.
|
||||
//
|
||||
// In other words, memory.high + oom_buffer_bytes will equal the total memory that the cgroup may
|
||||
// use (equal to system memory, minus whatever's taken out for the file cache).
|
||||
oom_buffer_bytes: u64,
|
||||
|
||||
/// The number of samples used in constructing aggregated memory statistics
|
||||
memory_history_len: usize,
|
||||
/// The number of most recent samples that will be periodically logged.
|
||||
///
|
||||
/// Each sample is logged exactly once. Increasing this value means that recent samples will be
|
||||
/// logged less frequently, and vice versa.
|
||||
///
|
||||
/// For simplicity, this value must be greater than or equal to `memory_history_len`.
|
||||
memory_history_log_interval: usize,
|
||||
// The amount of memory, in bytes, below a proposed new value for
|
||||
// memory.high that the cgroup's memory usage must be for us to downscale
|
||||
//
|
||||
// In other words, we can downscale only when:
|
||||
//
|
||||
// memory.current + memory_high_buffer_bytes < (proposed) memory.high
|
||||
//
|
||||
// TODO: there's some minor issues with this approach -- in particular, that we might have
|
||||
// memory in use by the kernel's page cache that we're actually ok with getting rid of.
|
||||
pub(crate) memory_high_buffer_bytes: u64,
|
||||
|
||||
// The maximum duration, in milliseconds, that we're allowed to pause
|
||||
// the cgroup for while waiting for the autoscaler-agent to upscale us
|
||||
max_upscale_wait: Duration,
|
||||
|
||||
// The required minimum time, in milliseconds, that we must wait before re-freezing
|
||||
// the cgroup while waiting for the autoscaler-agent to upscale us.
|
||||
do_not_freeze_more_often_than: Duration,
|
||||
|
||||
// The amount of memory, in bytes, that we should periodically increase memory.high
|
||||
// by while waiting for the autoscaler-agent to upscale us.
|
||||
//
|
||||
// This exists to avoid the excessive throttling that happens when a cgroup is above its
|
||||
// memory.high for too long. See more here:
|
||||
// https://github.com/neondatabase/autoscaling/issues/44#issuecomment-1522487217
|
||||
memory_high_increase_by_bytes: u64,
|
||||
|
||||
// The period, in milliseconds, at which we should repeatedly increase the value
|
||||
// of the cgroup's memory.high while we're waiting on upscaling and memory.high
|
||||
// is still being hit.
|
||||
//
|
||||
// Technically speaking, this actually serves as a rate limit to moderate responding to
|
||||
// memory.high events, but these are roughly equivalent if the process is still allocating
|
||||
// memory.
|
||||
memory_high_increase_every: Duration,
|
||||
}
|
||||
|
||||
impl Config {
|
||||
/// Calculate the new value for the cgroups memory.high based on system memory
|
||||
pub fn calculate_memory_high_value(&self, total_system_mem: u64) -> u64 {
|
||||
total_system_mem.saturating_sub(self.oom_buffer_bytes)
|
||||
}
|
||||
}
|
||||
|
||||
impl Default for Config {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
memory_poll_interval: Duration::from_millis(100),
|
||||
memory_history_len: 5, // use 500ms of history for decision-making
|
||||
memory_history_log_interval: 20, // but only log every ~2s (otherwise it's spammy)
|
||||
oom_buffer_bytes: 100 * MiB,
|
||||
memory_high_buffer_bytes: 100 * MiB,
|
||||
// while waiting for upscale, don't freeze for more than 20ms every 1s
|
||||
max_upscale_wait: Duration::from_millis(20),
|
||||
do_not_freeze_more_often_than: Duration::from_millis(1000),
|
||||
// while waiting for upscale, increase memory.high by 10MiB every 25ms
|
||||
memory_high_increase_by_bytes: 10 * MiB,
|
||||
memory_high_increase_every: Duration::from_millis(25),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Used to represent data that is associated with a certain point in time, such
|
||||
/// as an upscale request or memory.high event.
|
||||
///
|
||||
/// Internally, creating a `Sequenced` uses a static atomic counter to obtain
|
||||
/// a unique sequence number. Sequence numbers are monotonically increasing,
|
||||
/// allowing us to answer questions like "did this upscale happen after this
|
||||
/// memory.high event?" by comparing the sequence numbers of the two events.
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct Sequenced<T> {
|
||||
seqnum: u64,
|
||||
data: T,
|
||||
}
|
||||
|
||||
impl<T> Sequenced<T> {
|
||||
pub fn new(data: T) -> Self {
|
||||
Self {
|
||||
seqnum: EVENT_SEQUENCE_NUMBER.fetch_add(1, Ordering::AcqRel),
|
||||
data,
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -47,14 +170,74 @@ impl Default for Config {
|
||||
pub struct CgroupWatcher {
|
||||
pub config: Config,
|
||||
|
||||
/// The sequence number of the last upscale.
|
||||
///
|
||||
/// If we receive a memory.high event that has a _lower_ sequence number than
|
||||
/// `last_upscale_seqnum`, then we know it occured before the upscale, and we
|
||||
/// can safely ignore it.
|
||||
///
|
||||
/// Note: Like the `events` field, this doesn't _need_ interior mutability but we
|
||||
/// use it anyways so that methods take `&self`, not `&mut self`.
|
||||
last_upscale_seqnum: AtomicU64,
|
||||
|
||||
/// A channel on which we send messages to request upscale from the dispatcher.
|
||||
upscale_requester: mpsc::Sender<()>,
|
||||
|
||||
/// The actual cgroup we are watching and managing.
|
||||
cgroup: cgroups_rs::Cgroup,
|
||||
}
|
||||
|
||||
/// Read memory.events for the desired event type.
|
||||
///
|
||||
/// `path` specifies the path to the desired `memory.events` file.
|
||||
/// For more info, see the `memory.events` section of the [kernel docs]
|
||||
/// <https://docs.kernel.org/admin-guide/cgroup-v2.html#memory-interface-files>
|
||||
fn get_event_count(path: &str, event: MemoryEvent) -> anyhow::Result<u64> {
|
||||
let contents = fs::read_to_string(path)
|
||||
.with_context(|| format!("failed to read memory.events from {path}"))?;
|
||||
|
||||
// Then contents of the file look like:
|
||||
// low 42
|
||||
// high 101
|
||||
// ...
|
||||
contents
|
||||
.lines()
|
||||
.filter_map(|s| s.split_once(' '))
|
||||
.find(|(e, _)| *e == event.as_str())
|
||||
.ok_or_else(|| anyhow!("failed to find entry for memory.{event} events in {path}"))
|
||||
.and_then(|(_, count)| {
|
||||
count
|
||||
.parse::<u64>()
|
||||
.with_context(|| format!("failed to parse memory.{event} as u64"))
|
||||
})
|
||||
}
|
||||
|
||||
/// Create an event stream that produces events whenever the file at the provided
|
||||
/// path is modified.
|
||||
fn create_file_watcher(path: &str) -> anyhow::Result<EventStream<[u8; 1024]>> {
|
||||
info!("creating file watcher for {path}");
|
||||
let inotify = Inotify::init().context("failed to initialize file watcher")?;
|
||||
inotify
|
||||
.watches()
|
||||
.add(path, WatchMask::MODIFY)
|
||||
.with_context(|| format!("failed to start watching {path}"))?;
|
||||
inotify
|
||||
// The inotify docs use [0u8; 1024] so we'll just copy them. We only need
|
||||
// to store one event at a time - if the event gets written over, that's
|
||||
// ok. We still see that there is an event. For more information, see:
|
||||
// https://man7.org/linux/man-pages/man7/inotify.7.html
|
||||
.into_event_stream([0u8; 1024])
|
||||
.context("failed to start inotify event stream")
|
||||
}
|
||||
|
||||
impl CgroupWatcher {
|
||||
/// Create a new `CgroupWatcher`.
|
||||
#[tracing::instrument(skip_all, fields(%name))]
|
||||
pub fn new(name: String) -> anyhow::Result<Self> {
|
||||
pub fn new(
|
||||
name: String,
|
||||
// A channel on which to send upscale requests
|
||||
upscale_requester: mpsc::Sender<()>,
|
||||
) -> anyhow::Result<(Self, impl Stream<Item = Sequenced<u64>>)> {
|
||||
// TODO: clarify exactly why we need v2
|
||||
// Make sure cgroups v2 (aka unified) are supported
|
||||
if !is_cgroup2_unified_mode() {
|
||||
@@ -62,203 +245,410 @@ impl CgroupWatcher {
|
||||
}
|
||||
let cgroup = cgroups_rs::Cgroup::load(hierarchies::auto(), &name);
|
||||
|
||||
Ok(Self {
|
||||
cgroup,
|
||||
config: Default::default(),
|
||||
})
|
||||
// Start monitoring the cgroup for memory events. In general, for
|
||||
// cgroups v2 (aka unified), metrics are reported in files like
|
||||
// > `/sys/fs/cgroup/{name}/{metric}`
|
||||
// We are looking for `memory.high` events, which are stored in the
|
||||
// file `memory.events`. For more info, see the `memory.events` section
|
||||
// of https://docs.kernel.org/admin-guide/cgroup-v2.html#memory-interface-files
|
||||
let path = format!("{}/{}/memory.events", UNIFIED_MOUNTPOINT, &name);
|
||||
let memory_events = create_file_watcher(&path)
|
||||
.with_context(|| format!("failed to create event watcher for {path}"))?
|
||||
// This would be nice with with .inspect_err followed by .ok
|
||||
.filter_map(move |_| match get_event_count(&path, MemoryEvent::High) {
|
||||
Ok(high) => Some(high),
|
||||
Err(error) => {
|
||||
// TODO: Might want to just panic here
|
||||
warn!(?error, "failed to read high events count from {}", &path);
|
||||
None
|
||||
}
|
||||
})
|
||||
// Only report the event if the memory.high count increased
|
||||
.filter_map(|high| {
|
||||
if MEMORY_EVENT_COUNT.fetch_max(high, Ordering::AcqRel) < high {
|
||||
Some(high)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
})
|
||||
.map(Sequenced::new);
|
||||
|
||||
let initial_count = get_event_count(
|
||||
&format!("{}/{}/memory.events", UNIFIED_MOUNTPOINT, &name),
|
||||
MemoryEvent::High,
|
||||
)?;
|
||||
|
||||
info!(initial_count, "initial memory.high event count");
|
||||
|
||||
// Hard update `MEMORY_EVENT_COUNT` since there could have been processes
|
||||
// running in the cgroup before that caused it to be non-zero.
|
||||
MEMORY_EVENT_COUNT.fetch_max(initial_count, Ordering::AcqRel);
|
||||
|
||||
Ok((
|
||||
Self {
|
||||
cgroup,
|
||||
upscale_requester,
|
||||
last_upscale_seqnum: AtomicU64::new(0),
|
||||
config: Default::default(),
|
||||
},
|
||||
memory_events,
|
||||
))
|
||||
}
|
||||
|
||||
/// The entrypoint for the `CgroupWatcher`.
|
||||
#[tracing::instrument(skip_all)]
|
||||
pub async fn watch(
|
||||
pub async fn watch<E>(
|
||||
&self,
|
||||
updates: watch::Sender<(Instant, MemoryHistory)>,
|
||||
) -> anyhow::Result<()> {
|
||||
// this requirement makes the code a bit easier to work with; see the config for more.
|
||||
assert!(self.config.memory_history_len <= self.config.memory_history_log_interval);
|
||||
// These are ~dependency injected~ (fancy, I know) because this function
|
||||
// should never return.
|
||||
// -> therefore: when we tokio::spawn it, we don't await the JoinHandle.
|
||||
// -> therefore: if we want to stick it in an Arc so many threads can access
|
||||
// it, methods can never take mutable access.
|
||||
// - note: we use the Arc strategy so that a) we can call this function
|
||||
// right here and b) the runner can call the set/get_memory methods
|
||||
// -> since calling recv() on a tokio::sync::mpsc::Receiver takes &mut self,
|
||||
// we just pass them in here instead of holding them in fields, as that
|
||||
// would require this method to take &mut self.
|
||||
mut upscales: mpsc::Receiver<Sequenced<Resources>>,
|
||||
events: E,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
E: Stream<Item = Sequenced<u64>>,
|
||||
{
|
||||
let mut wait_to_freeze = pin!(tokio::time::sleep(Duration::ZERO));
|
||||
let mut last_memory_high_increase_at: Option<Instant> = None;
|
||||
let mut events = pin!(events);
|
||||
|
||||
let mut ticker = tokio::time::interval(self.config.memory_poll_interval);
|
||||
ticker.set_missed_tick_behavior(tokio::time::MissedTickBehavior::Skip);
|
||||
// ticker.reset_immediately(); // FIXME: enable this once updating to tokio >= 1.30.0
|
||||
// Are we waiting to be upscaled? Could be true if we request upscale due
|
||||
// to a memory.high event and it does not arrive in time.
|
||||
let mut waiting_on_upscale = false;
|
||||
|
||||
let mem_controller = self.memory()?;
|
||||
loop {
|
||||
tokio::select! {
|
||||
upscale = upscales.recv() => {
|
||||
let Sequenced { seqnum, data } = upscale
|
||||
.context("failed to listen on upscale notification channel")?;
|
||||
waiting_on_upscale = false;
|
||||
last_memory_high_increase_at = None;
|
||||
self.last_upscale_seqnum.store(seqnum, Ordering::Release);
|
||||
info!(cpu = data.cpu, mem_bytes = data.mem, "received upscale");
|
||||
}
|
||||
event = events.next() => {
|
||||
let Some(Sequenced { seqnum, .. }) = event else {
|
||||
bail!("failed to listen for memory.high events")
|
||||
};
|
||||
// The memory.high came before our last upscale, so we consider
|
||||
// it resolved
|
||||
if self.last_upscale_seqnum.fetch_max(seqnum, Ordering::AcqRel) > seqnum {
|
||||
info!(
|
||||
"received memory.high event, but it came before our last upscale -> ignoring it"
|
||||
);
|
||||
continue;
|
||||
}
|
||||
|
||||
// buffer for samples that will be logged. once full, it remains so.
|
||||
let history_log_len = self.config.memory_history_log_interval;
|
||||
let mut history_log_buf = vec![MemoryStatus::zeroed(); history_log_len];
|
||||
// The memory.high came after our latest upscale. We don't
|
||||
// want to do anything yet, so peek the next event in hopes
|
||||
// that it's an upscale.
|
||||
if let Some(upscale_num) = self
|
||||
.upscaled(&mut upscales)
|
||||
.context("failed to check if we were upscaled")?
|
||||
{
|
||||
if upscale_num > seqnum {
|
||||
info!(
|
||||
"received memory.high event, but it came before our last upscale -> ignoring it"
|
||||
);
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
for t in 0_u64.. {
|
||||
ticker.tick().await;
|
||||
// If it's been long enough since we last froze, freeze the
|
||||
// cgroup and request upscale
|
||||
if wait_to_freeze.is_elapsed() {
|
||||
info!("received memory.high event -> requesting upscale");
|
||||
waiting_on_upscale = self
|
||||
.handle_memory_high_event(&mut upscales)
|
||||
.await
|
||||
.context("failed to handle upscale")?;
|
||||
wait_to_freeze
|
||||
.as_mut()
|
||||
.reset(Instant::now() + self.config.do_not_freeze_more_often_than);
|
||||
continue;
|
||||
}
|
||||
|
||||
let now = Instant::now();
|
||||
let mem = Self::memory_usage(mem_controller);
|
||||
// Ok, we can't freeze, just request upscale
|
||||
if !waiting_on_upscale {
|
||||
info!("received memory.high event, but too soon to refreeze -> requesting upscale");
|
||||
|
||||
let i = t as usize % history_log_len;
|
||||
history_log_buf[i] = mem;
|
||||
// Make check to make sure we haven't been upscaled in the
|
||||
// meantine (can happen if the agent independently decides
|
||||
// to upscale us again)
|
||||
if self
|
||||
.upscaled(&mut upscales)
|
||||
.context("failed to check if we were upscaled")?
|
||||
.is_some()
|
||||
{
|
||||
info!("no need to request upscaling because we got upscaled");
|
||||
continue;
|
||||
}
|
||||
self.upscale_requester
|
||||
.send(())
|
||||
.await
|
||||
.context("failed to request upscale")?;
|
||||
waiting_on_upscale = true;
|
||||
continue;
|
||||
}
|
||||
|
||||
// We're taking *at most* memory_history_len values; we may be bounded by the total
|
||||
// number of samples that have come in so far.
|
||||
let samples_count = (t + 1).min(self.config.memory_history_len as u64) as usize;
|
||||
// NB: in `ring_buf_recent_values_iter`, `i` is *inclusive*, which matches the fact
|
||||
// that we just inserted a value there, so the end of the iterator will *include* the
|
||||
// value at i, rather than stopping just short of it.
|
||||
let samples = ring_buf_recent_values_iter(&history_log_buf, i, samples_count);
|
||||
// Shoot, we can't freeze or and we're still waiting on upscale,
|
||||
// increase memory.high to reduce throttling
|
||||
let can_increase_memory_high = match last_memory_high_increase_at {
|
||||
None => true,
|
||||
Some(t) => t.elapsed() > self.config.memory_high_increase_every,
|
||||
};
|
||||
if can_increase_memory_high {
|
||||
info!(
|
||||
"received memory.high event, \
|
||||
but too soon to refreeze and already requested upscale \
|
||||
-> increasing memory.high"
|
||||
);
|
||||
|
||||
let summary = MemoryHistory {
|
||||
avg_non_reclaimable: samples.map(|h| h.non_reclaimable).sum::<u64>()
|
||||
/ samples_count as u64,
|
||||
samples_count,
|
||||
samples_span: self.config.memory_poll_interval * (samples_count - 1) as u32,
|
||||
// Make check to make sure we haven't been upscaled in the
|
||||
// meantine (can happen if the agent independently decides
|
||||
// to upscale us again)
|
||||
if self
|
||||
.upscaled(&mut upscales)
|
||||
.context("failed to check if we were upscaled")?
|
||||
.is_some()
|
||||
{
|
||||
info!("no need to increase memory.high because got upscaled");
|
||||
continue;
|
||||
}
|
||||
|
||||
// Request upscale anyways (the agent will handle deduplicating
|
||||
// requests)
|
||||
self.upscale_requester
|
||||
.send(())
|
||||
.await
|
||||
.context("failed to request upscale")?;
|
||||
|
||||
let memory_high =
|
||||
self.get_memory_high_bytes().context("failed to get memory.high")?;
|
||||
let new_high = memory_high + self.config.memory_high_increase_by_bytes;
|
||||
info!(
|
||||
current_high_bytes = memory_high,
|
||||
new_high_bytes = new_high,
|
||||
"updating memory.high"
|
||||
);
|
||||
self.set_memory_high_bytes(new_high)
|
||||
.context("failed to set memory.high")?;
|
||||
last_memory_high_increase_at = Some(Instant::now());
|
||||
continue;
|
||||
}
|
||||
|
||||
info!("received memory.high event, but can't do anything");
|
||||
}
|
||||
};
|
||||
|
||||
// Log the current history if it's time to do so. Because `history_log_buf` has length
|
||||
// equal to the logging interval, we can just log the entire buffer every time we set
|
||||
// the last entry, which also means that for this log line, we can ignore that it's a
|
||||
// ring buffer (because all the entries are in order of increasing time).
|
||||
if i == history_log_len - 1 {
|
||||
info!(
|
||||
history = ?MemoryStatus::debug_slice(&history_log_buf),
|
||||
summary = ?summary,
|
||||
"Recent cgroup memory statistics history"
|
||||
);
|
||||
}
|
||||
|
||||
updates
|
||||
.send((now, summary))
|
||||
.context("failed to send MemoryHistory")?;
|
||||
}
|
||||
}
|
||||
|
||||
unreachable!()
|
||||
/// Handle a `memory.high`, returning whether we are still waiting on upscale
|
||||
/// by the time the function returns.
|
||||
///
|
||||
/// The general plan for handling a `memory.high` event is as follows:
|
||||
/// 1. Freeze the cgroup
|
||||
/// 2. Start a timer for `self.config.max_upscale_wait`
|
||||
/// 3. Request upscale
|
||||
/// 4. After the timer elapses or we receive upscale, thaw the cgroup.
|
||||
/// 5. Return whether or not we are still waiting for upscale. If we are,
|
||||
/// we'll increase the cgroups memory.high to avoid getting oom killed
|
||||
#[tracing::instrument(skip_all)]
|
||||
async fn handle_memory_high_event(
|
||||
&self,
|
||||
upscales: &mut mpsc::Receiver<Sequenced<Resources>>,
|
||||
) -> anyhow::Result<bool> {
|
||||
// Immediately freeze the cgroup before doing anything else.
|
||||
info!("received memory.high event -> freezing cgroup");
|
||||
self.freeze().context("failed to freeze cgroup")?;
|
||||
|
||||
// We'll use this for logging durations
|
||||
let start_time = Instant::now();
|
||||
|
||||
// Await the upscale until we have to unfreeze
|
||||
let timed =
|
||||
tokio::time::timeout(self.config.max_upscale_wait, self.await_upscale(upscales));
|
||||
|
||||
// Request the upscale
|
||||
info!(
|
||||
wait = ?self.config.max_upscale_wait,
|
||||
"sending request for immediate upscaling",
|
||||
);
|
||||
self.upscale_requester
|
||||
.send(())
|
||||
.await
|
||||
.context("failed to request upscale")?;
|
||||
|
||||
let waiting_on_upscale = match timed.await {
|
||||
Ok(Ok(())) => {
|
||||
info!(elapsed = ?start_time.elapsed(), "received upscale in time");
|
||||
false
|
||||
}
|
||||
// **important**: unfreeze the cgroup before ?-reporting the error
|
||||
Ok(Err(e)) => {
|
||||
info!("error waiting for upscale -> thawing cgroup");
|
||||
self.thaw()
|
||||
.context("failed to thaw cgroup after errored waiting for upscale")?;
|
||||
Err(e.context("failed to await upscale"))?
|
||||
}
|
||||
Err(_) => {
|
||||
info!(elapsed = ?self.config.max_upscale_wait, "timed out waiting for upscale");
|
||||
true
|
||||
}
|
||||
};
|
||||
|
||||
info!("thawing cgroup");
|
||||
self.thaw().context("failed to thaw cgroup")?;
|
||||
|
||||
Ok(waiting_on_upscale)
|
||||
}
|
||||
|
||||
/// Checks whether we were just upscaled, returning the upscale's sequence
|
||||
/// number if so.
|
||||
#[tracing::instrument(skip_all)]
|
||||
fn upscaled(
|
||||
&self,
|
||||
upscales: &mut mpsc::Receiver<Sequenced<Resources>>,
|
||||
) -> anyhow::Result<Option<u64>> {
|
||||
let Sequenced { seqnum, data } = match upscales.try_recv() {
|
||||
Ok(upscale) => upscale,
|
||||
Err(TryRecvError::Empty) => return Ok(None),
|
||||
Err(TryRecvError::Disconnected) => {
|
||||
bail!("upscale notification channel was disconnected")
|
||||
}
|
||||
};
|
||||
|
||||
// Make sure to update the last upscale sequence number
|
||||
self.last_upscale_seqnum.store(seqnum, Ordering::Release);
|
||||
info!(cpu = data.cpu, mem_bytes = data.mem, "received upscale");
|
||||
Ok(Some(seqnum))
|
||||
}
|
||||
|
||||
/// Await an upscale event, discarding any `memory.high` events received in
|
||||
/// the process.
|
||||
///
|
||||
/// This is used in `handle_memory_high_event`, where we need to listen
|
||||
/// for upscales in particular so we know if we can thaw the cgroup early.
|
||||
#[tracing::instrument(skip_all)]
|
||||
async fn await_upscale(
|
||||
&self,
|
||||
upscales: &mut mpsc::Receiver<Sequenced<Resources>>,
|
||||
) -> anyhow::Result<()> {
|
||||
let Sequenced { seqnum, .. } = upscales
|
||||
.recv()
|
||||
.await
|
||||
.context("error listening for upscales")?;
|
||||
|
||||
self.last_upscale_seqnum.store(seqnum, Ordering::Release);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Get the cgroup's name.
|
||||
pub fn path(&self) -> &str {
|
||||
self.cgroup.path()
|
||||
}
|
||||
}
|
||||
|
||||
// Methods for manipulating the actual cgroup
|
||||
impl CgroupWatcher {
|
||||
/// Get a handle on the freezer subsystem.
|
||||
fn freezer(&self) -> anyhow::Result<&FreezerController> {
|
||||
if let Some(Freezer(freezer)) = self
|
||||
.cgroup
|
||||
.subsystems()
|
||||
.iter()
|
||||
.find(|sub| matches!(sub, Freezer(_)))
|
||||
{
|
||||
Ok(freezer)
|
||||
} else {
|
||||
anyhow::bail!("could not find freezer subsystem")
|
||||
}
|
||||
}
|
||||
|
||||
/// Attempt to freeze the cgroup.
|
||||
pub fn freeze(&self) -> anyhow::Result<()> {
|
||||
self.freezer()
|
||||
.context("failed to get freezer subsystem")?
|
||||
.freeze()
|
||||
.context("failed to freeze")
|
||||
}
|
||||
|
||||
/// Attempt to thaw the cgroup.
|
||||
pub fn thaw(&self) -> anyhow::Result<()> {
|
||||
self.freezer()
|
||||
.context("failed to get freezer subsystem")?
|
||||
.thaw()
|
||||
.context("failed to thaw")
|
||||
}
|
||||
|
||||
/// Get a handle on the memory subsystem.
|
||||
///
|
||||
/// Note: this method does not require `self.memory_update_lock` because
|
||||
/// getting a handle to the subsystem does not access any of the files we
|
||||
/// care about, such as memory.high and memory.events
|
||||
fn memory(&self) -> anyhow::Result<&MemController> {
|
||||
self.cgroup
|
||||
if let Some(Mem(memory)) = self
|
||||
.cgroup
|
||||
.subsystems()
|
||||
.iter()
|
||||
.find_map(|sub| match sub {
|
||||
Subsystem::Mem(c) => Some(c),
|
||||
_ => None,
|
||||
.find(|sub| matches!(sub, Mem(_)))
|
||||
{
|
||||
Ok(memory)
|
||||
} else {
|
||||
anyhow::bail!("could not find memory subsystem")
|
||||
}
|
||||
}
|
||||
|
||||
/// Get cgroup current memory usage.
|
||||
pub fn current_memory_usage(&self) -> anyhow::Result<u64> {
|
||||
Ok(self
|
||||
.memory()
|
||||
.context("failed to get memory subsystem")?
|
||||
.memory_stat()
|
||||
.usage_in_bytes)
|
||||
}
|
||||
|
||||
/// Set cgroup memory.high threshold.
|
||||
pub fn set_memory_high_bytes(&self, bytes: u64) -> anyhow::Result<()> {
|
||||
self.set_memory_high_internal(MaxValue::Value(u64::min(bytes, i64::MAX as u64) as i64))
|
||||
}
|
||||
|
||||
/// Set the cgroup's memory.high to 'max', disabling it.
|
||||
pub fn unset_memory_high(&self) -> anyhow::Result<()> {
|
||||
self.set_memory_high_internal(MaxValue::Max)
|
||||
}
|
||||
|
||||
fn set_memory_high_internal(&self, value: MaxValue) -> anyhow::Result<()> {
|
||||
self.memory()
|
||||
.context("failed to get memory subsystem")?
|
||||
.set_mem(cgroups_rs::memory::SetMemory {
|
||||
low: None,
|
||||
high: Some(value),
|
||||
min: None,
|
||||
max: None,
|
||||
})
|
||||
.ok_or_else(|| anyhow!("could not find memory subsystem"))
|
||||
.map_err(anyhow::Error::from)
|
||||
}
|
||||
|
||||
/// Given a handle on the memory subsystem, returns the current memory information
|
||||
fn memory_usage(mem_controller: &MemController) -> MemoryStatus {
|
||||
let stat = mem_controller.memory_stat().stat;
|
||||
MemoryStatus {
|
||||
non_reclaimable: stat.active_anon + stat.inactive_anon,
|
||||
/// Get memory.high threshold.
|
||||
pub fn get_memory_high_bytes(&self) -> anyhow::Result<u64> {
|
||||
let high = self
|
||||
.memory()
|
||||
.context("failed to get memory subsystem while getting memory statistics")?
|
||||
.get_mem()
|
||||
.map(|mem| mem.high)
|
||||
.context("failed to get memory statistics from subsystem")?;
|
||||
match high {
|
||||
Some(MaxValue::Max) => Ok(i64::MAX as u64),
|
||||
Some(MaxValue::Value(high)) => Ok(high as u64),
|
||||
None => anyhow::bail!("failed to read memory.high from memory subsystem"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Helper function for `CgroupWatcher::watch`
|
||||
fn ring_buf_recent_values_iter<T>(
|
||||
buf: &[T],
|
||||
last_value_idx: usize,
|
||||
count: usize,
|
||||
) -> impl '_ + Iterator<Item = &T> {
|
||||
// Assertion carried over from `CgroupWatcher::watch`, to make the logic in this function
|
||||
// easier (we only have to add `buf.len()` once, rather than a dynamic number of times).
|
||||
assert!(count <= buf.len());
|
||||
|
||||
buf.iter()
|
||||
// 'cycle' because the values could wrap around
|
||||
.cycle()
|
||||
// with 'cycle', this skip is more like 'offset', and functionally this is
|
||||
// offsettting by 'last_value_idx - count (mod buf.len())', but we have to be
|
||||
// careful to avoid underflow, so we pre-add buf.len().
|
||||
// The '+ 1' is because `last_value_idx` is inclusive, rather than exclusive.
|
||||
.skip((buf.len() + last_value_idx + 1 - count) % buf.len())
|
||||
.take(count)
|
||||
}
|
||||
|
||||
/// Summary of recent memory usage
|
||||
#[derive(Debug, Copy, Clone)]
|
||||
pub struct MemoryHistory {
|
||||
/// Rolling average of non-reclaimable memory usage samples over the last `history_period`
|
||||
pub avg_non_reclaimable: u64,
|
||||
|
||||
/// The number of samples used to construct this summary
|
||||
pub samples_count: usize,
|
||||
/// Total timespan between the first and last sample used for this summary
|
||||
pub samples_span: Duration,
|
||||
}
|
||||
|
||||
#[derive(Debug, Copy, Clone)]
|
||||
pub struct MemoryStatus {
|
||||
non_reclaimable: u64,
|
||||
}
|
||||
|
||||
impl MemoryStatus {
|
||||
fn zeroed() -> Self {
|
||||
MemoryStatus { non_reclaimable: 0 }
|
||||
}
|
||||
|
||||
fn debug_slice(slice: &[Self]) -> impl '_ + Debug {
|
||||
struct DS<'a>(&'a [MemoryStatus]);
|
||||
|
||||
impl<'a> Debug for DS<'a> {
|
||||
fn fmt(&self, f: &mut Formatter) -> fmt::Result {
|
||||
f.debug_struct("[MemoryStatus]")
|
||||
.field(
|
||||
"non_reclaimable[..]",
|
||||
&Fields(self.0, |stat: &MemoryStatus| {
|
||||
BytesToGB(stat.non_reclaimable)
|
||||
}),
|
||||
)
|
||||
.finish()
|
||||
}
|
||||
}
|
||||
|
||||
struct Fields<'a, F>(&'a [MemoryStatus], F);
|
||||
|
||||
impl<'a, F: Fn(&MemoryStatus) -> T, T: Debug> Debug for Fields<'a, F> {
|
||||
fn fmt(&self, f: &mut Formatter) -> fmt::Result {
|
||||
f.debug_list().entries(self.0.iter().map(&self.1)).finish()
|
||||
}
|
||||
}
|
||||
|
||||
struct BytesToGB(u64);
|
||||
|
||||
impl Debug for BytesToGB {
|
||||
fn fmt(&self, f: &mut Formatter) -> fmt::Result {
|
||||
f.write_fmt(format_args!(
|
||||
"{:.3}Gi",
|
||||
self.0 as f64 / (1_u64 << 30) as f64
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
DS(slice)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
#[test]
|
||||
fn ring_buf_iter() {
|
||||
let buf = vec![0_i32, 1, 2, 3, 4, 5, 6, 7, 8, 9];
|
||||
|
||||
let values = |offset, count| {
|
||||
super::ring_buf_recent_values_iter(&buf, offset, count)
|
||||
.copied()
|
||||
.collect::<Vec<i32>>()
|
||||
};
|
||||
|
||||
// Boundary conditions: start, end, and entire thing:
|
||||
assert_eq!(values(0, 1), [0]);
|
||||
assert_eq!(values(3, 4), [0, 1, 2, 3]);
|
||||
assert_eq!(values(9, 4), [6, 7, 8, 9]);
|
||||
assert_eq!(values(9, 10), [0, 1, 2, 3, 4, 5, 6, 7, 8, 9]);
|
||||
|
||||
// "normal" operation: no wraparound
|
||||
assert_eq!(values(7, 4), [4, 5, 6, 7]);
|
||||
|
||||
// wraparound:
|
||||
assert_eq!(values(0, 4), [7, 8, 9, 0]);
|
||||
assert_eq!(values(1, 4), [8, 9, 0, 1]);
|
||||
assert_eq!(values(2, 4), [9, 0, 1, 2]);
|
||||
assert_eq!(values(2, 10), [3, 4, 5, 6, 7, 8, 9, 0, 1, 2]);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -12,10 +12,12 @@ use futures::{
|
||||
stream::{SplitSink, SplitStream},
|
||||
SinkExt, StreamExt,
|
||||
};
|
||||
use tokio::sync::mpsc;
|
||||
use tracing::info;
|
||||
|
||||
use crate::cgroup::Sequenced;
|
||||
use crate::protocol::{
|
||||
OutboundMsg, ProtocolRange, ProtocolResponse, ProtocolVersion, PROTOCOL_MAX_VERSION,
|
||||
OutboundMsg, ProtocolRange, ProtocolResponse, ProtocolVersion, Resources, PROTOCOL_MAX_VERSION,
|
||||
PROTOCOL_MIN_VERSION,
|
||||
};
|
||||
|
||||
@@ -34,6 +36,13 @@ pub struct Dispatcher {
|
||||
/// We send messages to the agent through `sink`
|
||||
sink: SplitSink<WebSocket, Message>,
|
||||
|
||||
/// Used to notify the cgroup when we are upscaled.
|
||||
pub(crate) notify_upscale_events: mpsc::Sender<Sequenced<Resources>>,
|
||||
|
||||
/// When the cgroup requests upscale it will send on this channel. In response
|
||||
/// we send an `UpscaleRequst` to the agent.
|
||||
pub(crate) request_upscale_events: mpsc::Receiver<()>,
|
||||
|
||||
/// The protocol version we have agreed to use with the agent. This is negotiated
|
||||
/// during the creation of the dispatcher, and should be the highest shared protocol
|
||||
/// version.
|
||||
@@ -52,7 +61,11 @@ impl Dispatcher {
|
||||
/// 1. Wait for the agent to sent the range of protocols it supports.
|
||||
/// 2. Send a protocol version that works for us as well, or an error if there
|
||||
/// is no compatible version.
|
||||
pub async fn new(stream: WebSocket) -> anyhow::Result<Self> {
|
||||
pub async fn new(
|
||||
stream: WebSocket,
|
||||
notify_upscale_events: mpsc::Sender<Sequenced<Resources>>,
|
||||
request_upscale_events: mpsc::Receiver<()>,
|
||||
) -> anyhow::Result<Self> {
|
||||
let (mut sink, mut source) = stream.split();
|
||||
|
||||
// Figure out the highest protocol version we both support
|
||||
@@ -106,10 +119,22 @@ impl Dispatcher {
|
||||
Ok(Self {
|
||||
sink,
|
||||
source,
|
||||
notify_upscale_events,
|
||||
request_upscale_events,
|
||||
proto_version: highest_shared_version,
|
||||
})
|
||||
}
|
||||
|
||||
/// Notify the cgroup manager that we have received upscale and wait for
|
||||
/// the acknowledgement.
|
||||
#[tracing::instrument(skip_all, fields(?resources))]
|
||||
pub async fn notify_upscale(&self, resources: Sequenced<Resources>) -> anyhow::Result<()> {
|
||||
self.notify_upscale_events
|
||||
.send(resources)
|
||||
.await
|
||||
.context("failed to send resources and oneshot sender across channel")
|
||||
}
|
||||
|
||||
/// Send a message to the agent.
|
||||
///
|
||||
/// Although this function is small, it has one major benefit: it is the only
|
||||
|
||||
@@ -21,6 +21,11 @@ pub struct FileCacheState {
|
||||
|
||||
#[derive(Debug)]
|
||||
pub struct FileCacheConfig {
|
||||
/// Whether the file cache is *actually* stored in memory (e.g. by writing to
|
||||
/// a tmpfs or shmem file). If true, the size of the file cache will be counted against the
|
||||
/// memory available for the cgroup.
|
||||
pub(crate) in_memory: bool,
|
||||
|
||||
/// The size of the file cache, in terms of the size of the resource it consumes
|
||||
/// (currently: only memory)
|
||||
///
|
||||
@@ -54,9 +59,22 @@ pub struct FileCacheConfig {
|
||||
spread_factor: f64,
|
||||
}
|
||||
|
||||
impl Default for FileCacheConfig {
|
||||
fn default() -> Self {
|
||||
impl FileCacheConfig {
|
||||
pub fn default_in_memory() -> Self {
|
||||
Self {
|
||||
in_memory: true,
|
||||
// 75 %
|
||||
resource_multiplier: 0.75,
|
||||
// 640 MiB; (512 + 128)
|
||||
min_remaining_after_cache: NonZeroU64::new(640 * MiB).unwrap(),
|
||||
// ensure any increase in file cache size is split 90-10 with 10% to other memory
|
||||
spread_factor: 0.1,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn default_on_disk() -> Self {
|
||||
Self {
|
||||
in_memory: false,
|
||||
resource_multiplier: 0.75,
|
||||
// 256 MiB - lower than when in memory because overcommitting is safe; if we don't have
|
||||
// memory, the kernel will just evict from its page cache, rather than e.g. killing
|
||||
@@ -65,9 +83,7 @@ impl Default for FileCacheConfig {
|
||||
spread_factor: 0.1,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl FileCacheConfig {
|
||||
/// Make sure fields of the config are consistent.
|
||||
pub fn validate(&self) -> anyhow::Result<()> {
|
||||
// Single field validity
|
||||
|
||||
@@ -39,6 +39,16 @@ pub struct Args {
|
||||
#[arg(short, long)]
|
||||
pub pgconnstr: Option<String>,
|
||||
|
||||
/// Flag to signal that the Postgres file cache is on disk (i.e. not in memory aside from the
|
||||
/// kernel's page cache), and therefore should not count against available memory.
|
||||
//
|
||||
// NB: Ideally this flag would directly refer to whether the file cache is in memory (rather
|
||||
// than a roundabout way, via whether it's on disk), but in order to be backwards compatible
|
||||
// during the switch away from an in-memory file cache, we had to default to the previous
|
||||
// behavior.
|
||||
#[arg(long)]
|
||||
pub file_cache_on_disk: bool,
|
||||
|
||||
/// The address we should listen on for connection requests. For the
|
||||
/// agent, this is 0.0.0.0:10301. For the informant, this is 127.0.0.1:10369.
|
||||
#[arg(short, long)]
|
||||
|
||||
@@ -5,16 +5,18 @@
|
||||
//! all functionality.
|
||||
|
||||
use std::fmt::Debug;
|
||||
use std::sync::Arc;
|
||||
use std::time::{Duration, Instant};
|
||||
|
||||
use anyhow::{bail, Context};
|
||||
use axum::extract::ws::{Message, WebSocket};
|
||||
use futures::StreamExt;
|
||||
use tokio::sync::{broadcast, watch};
|
||||
use tokio::sync::broadcast;
|
||||
use tokio::sync::mpsc;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::{error, info, warn};
|
||||
|
||||
use crate::cgroup::{self, CgroupWatcher};
|
||||
use crate::cgroup::{CgroupWatcher, Sequenced};
|
||||
use crate::dispatcher::Dispatcher;
|
||||
use crate::filecache::{FileCacheConfig, FileCacheState};
|
||||
use crate::protocol::{InboundMsg, InboundMsgKind, OutboundMsg, OutboundMsgKind, Resources};
|
||||
@@ -26,7 +28,7 @@ use crate::{bytes_to_mebibytes, get_total_system_memory, spawn_with_cancel, Args
|
||||
pub struct Runner {
|
||||
config: Config,
|
||||
filecache: Option<FileCacheState>,
|
||||
cgroup: Option<CgroupState>,
|
||||
cgroup: Option<Arc<CgroupWatcher>>,
|
||||
dispatcher: Dispatcher,
|
||||
|
||||
/// We "mint" new message ids by incrementing this counter and taking the value.
|
||||
@@ -43,14 +45,6 @@ pub struct Runner {
|
||||
kill: broadcast::Receiver<()>,
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
struct CgroupState {
|
||||
watcher: watch::Receiver<(Instant, cgroup::MemoryHistory)>,
|
||||
/// If [`cgroup::MemoryHistory::avg_non_reclaimable`] exceeds `threshold`, we send upscale
|
||||
/// requests.
|
||||
threshold: u64,
|
||||
}
|
||||
|
||||
/// Configuration for a `Runner`
|
||||
#[derive(Debug)]
|
||||
pub struct Config {
|
||||
@@ -68,56 +62,16 @@ pub struct Config {
|
||||
/// upscale resource amounts (because we might not *actually* have been upscaled yet). This field
|
||||
/// should be removed once we have a better solution there.
|
||||
sys_buffer_bytes: u64,
|
||||
|
||||
/// Minimum fraction of total system memory reserved *before* the the cgroup threshold; in
|
||||
/// other words, providing a ceiling for the highest value of the threshold by enforcing that
|
||||
/// there's at least `cgroup_min_overhead_fraction` of the total memory remaining beyond the
|
||||
/// threshold.
|
||||
///
|
||||
/// For example, a value of `0.1` means that 10% of total memory must remain after exceeding
|
||||
/// the threshold, so the value of the cgroup threshold would always be capped at 90% of total
|
||||
/// memory.
|
||||
///
|
||||
/// The default value of `0.15` means that we *guarantee* sending upscale requests if the
|
||||
/// cgroup is using more than 85% of total memory (even if we're *not* separately reserving
|
||||
/// memory for the file cache).
|
||||
cgroup_min_overhead_fraction: f64,
|
||||
|
||||
cgroup_downscale_threshold_buffer_bytes: u64,
|
||||
}
|
||||
|
||||
impl Default for Config {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
sys_buffer_bytes: 100 * MiB,
|
||||
cgroup_min_overhead_fraction: 0.15,
|
||||
cgroup_downscale_threshold_buffer_bytes: 100 * MiB,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl Config {
|
||||
fn cgroup_threshold(&self, total_mem: u64, file_cache_disk_size: u64) -> u64 {
|
||||
// If the file cache is in tmpfs, then it will count towards shmem usage of the cgroup,
|
||||
// and thus be non-reclaimable, so we should allow for additional memory usage.
|
||||
//
|
||||
// If the file cache sits on disk, our desired stable system state is for it to be fully
|
||||
// page cached (its contents should only be paged to/from disk in situations where we can't
|
||||
// upscale fast enough). Page-cached memory is reclaimable, so we need to lower the
|
||||
// threshold for non-reclaimable memory so we scale up *before* the kernel starts paging
|
||||
// out the file cache.
|
||||
let memory_remaining_for_cgroup = total_mem.saturating_sub(file_cache_disk_size);
|
||||
|
||||
// Even if we're not separately making room for the file cache (if it's in tmpfs), we still
|
||||
// want our threshold to be met gracefully instead of letting postgres get OOM-killed.
|
||||
// So we guarantee that there's at least `cgroup_min_overhead_fraction` of total memory
|
||||
// remaining above the threshold.
|
||||
let max_threshold = (total_mem as f64 * (1.0 - self.cgroup_min_overhead_fraction)) as u64;
|
||||
|
||||
memory_remaining_for_cgroup.min(max_threshold)
|
||||
}
|
||||
}
|
||||
|
||||
impl Runner {
|
||||
/// Create a new monitor.
|
||||
#[tracing::instrument(skip_all, fields(?config, ?args))]
|
||||
@@ -133,7 +87,12 @@ impl Runner {
|
||||
"invalid monitor Config: sys_buffer_bytes cannot be 0"
|
||||
);
|
||||
|
||||
let dispatcher = Dispatcher::new(ws)
|
||||
// *NOTE*: the dispatcher and cgroup manager talk through these channels
|
||||
// so make sure they each get the correct half, nothing is droppped, etc.
|
||||
let (notified_send, notified_recv) = mpsc::channel(1);
|
||||
let (requesting_send, requesting_recv) = mpsc::channel(1);
|
||||
|
||||
let dispatcher = Dispatcher::new(ws, notified_send, requesting_recv)
|
||||
.await
|
||||
.context("error creating new dispatcher")?;
|
||||
|
||||
@@ -147,18 +106,57 @@ impl Runner {
|
||||
kill,
|
||||
};
|
||||
|
||||
let mem = get_total_system_memory();
|
||||
// If we have both the cgroup and file cache integrations enabled, it's possible for
|
||||
// temporary failures to result in cgroup throttling (from memory.high), that in turn makes
|
||||
// it near-impossible to connect to the file cache (because it times out). Unfortunately,
|
||||
// we *do* still want to determine the file cache size before setting the cgroup's
|
||||
// memory.high, so it's not as simple as just swapping the order.
|
||||
//
|
||||
// Instead, the resolution here is that on vm-monitor startup (note: happens on each
|
||||
// connection from autoscaler-agent, possibly multiple times per compute_ctl lifecycle), we
|
||||
// temporarily unset memory.high, to allow any existing throttling to dissipate. It's a bit
|
||||
// of a hacky solution, but helps with reliability.
|
||||
if let Some(name) = &args.cgroup {
|
||||
// Best not to set up cgroup stuff more than once, so we'll initialize cgroup state
|
||||
// now, and then set limits later.
|
||||
info!("initializing cgroup");
|
||||
|
||||
let mut file_cache_disk_size = 0;
|
||||
let (cgroup, cgroup_event_stream) = CgroupWatcher::new(name.clone(), requesting_send)
|
||||
.context("failed to create cgroup manager")?;
|
||||
|
||||
info!("temporarily unsetting memory.high");
|
||||
|
||||
// Temporarily un-set cgroup memory.high; see above.
|
||||
cgroup
|
||||
.unset_memory_high()
|
||||
.context("failed to unset memory.high")?;
|
||||
|
||||
let cgroup = Arc::new(cgroup);
|
||||
|
||||
let cgroup_clone = Arc::clone(&cgroup);
|
||||
spawn_with_cancel(
|
||||
token.clone(),
|
||||
|_| error!("cgroup watcher terminated"),
|
||||
async move { cgroup_clone.watch(notified_recv, cgroup_event_stream).await },
|
||||
);
|
||||
|
||||
state.cgroup = Some(cgroup);
|
||||
}
|
||||
|
||||
let mut file_cache_reserved_bytes = 0;
|
||||
let mem = get_total_system_memory();
|
||||
|
||||
// We need to process file cache initialization before cgroup initialization, so that the memory
|
||||
// allocated to the file cache is appropriately taken into account when we decide the cgroup's
|
||||
// memory limits.
|
||||
if let Some(connstr) = &args.pgconnstr {
|
||||
info!("initializing file cache");
|
||||
let config = FileCacheConfig::default();
|
||||
let config = match args.file_cache_on_disk {
|
||||
true => FileCacheConfig::default_on_disk(),
|
||||
false => FileCacheConfig::default_in_memory(),
|
||||
};
|
||||
|
||||
let mut file_cache = FileCacheState::new(connstr, config, token.clone())
|
||||
let mut file_cache = FileCacheState::new(connstr, config, token)
|
||||
.await
|
||||
.context("failed to create file cache")?;
|
||||
|
||||
@@ -183,37 +181,23 @@ impl Runner {
|
||||
if actual_size != new_size {
|
||||
info!("file cache size actually got set to {actual_size}")
|
||||
}
|
||||
// Mark the resources given to the file cache as reserved, but only if it's in memory.
|
||||
if !args.file_cache_on_disk {
|
||||
file_cache_reserved_bytes = actual_size;
|
||||
}
|
||||
|
||||
file_cache_disk_size = actual_size;
|
||||
state.filecache = Some(file_cache);
|
||||
}
|
||||
|
||||
if let Some(name) = &args.cgroup {
|
||||
// Best not to set up cgroup stuff more than once, so we'll initialize cgroup state
|
||||
// now, and then set limits later.
|
||||
info!("initializing cgroup");
|
||||
if let Some(cgroup) = &state.cgroup {
|
||||
let available = mem - file_cache_reserved_bytes;
|
||||
let value = cgroup.config.calculate_memory_high_value(available);
|
||||
|
||||
let cgroup =
|
||||
CgroupWatcher::new(name.clone()).context("failed to create cgroup manager")?;
|
||||
info!(value, "setting memory.high");
|
||||
|
||||
let init_value = cgroup::MemoryHistory {
|
||||
avg_non_reclaimable: 0,
|
||||
samples_count: 0,
|
||||
samples_span: Duration::ZERO,
|
||||
};
|
||||
let (hist_tx, hist_rx) = watch::channel((Instant::now(), init_value));
|
||||
|
||||
spawn_with_cancel(token, |_| error!("cgroup watcher terminated"), async move {
|
||||
cgroup.watch(hist_tx).await
|
||||
});
|
||||
|
||||
let threshold = state.config.cgroup_threshold(mem, file_cache_disk_size);
|
||||
info!(threshold, "set initial cgroup threshold",);
|
||||
|
||||
state.cgroup = Some(CgroupState {
|
||||
watcher: hist_rx,
|
||||
threshold,
|
||||
});
|
||||
cgroup
|
||||
.set_memory_high_bytes(value)
|
||||
.context("failed to set cgroup memory.high")?;
|
||||
}
|
||||
|
||||
Ok(state)
|
||||
@@ -233,45 +217,28 @@ impl Runner {
|
||||
|
||||
let requested_mem = target.mem;
|
||||
let usable_system_memory = requested_mem.saturating_sub(self.config.sys_buffer_bytes);
|
||||
let expected_file_cache_size = self
|
||||
let expected_file_cache_mem_usage = self
|
||||
.filecache
|
||||
.as_ref()
|
||||
.map(|file_cache| file_cache.config.calculate_cache_size(usable_system_memory))
|
||||
.unwrap_or(0);
|
||||
let mut new_cgroup_mem_high = 0;
|
||||
if let Some(cgroup) = &self.cgroup {
|
||||
let (last_time, last_history) = *cgroup.watcher.borrow();
|
||||
|
||||
// NB: The ordering of these conditions is intentional. During startup, we should deny
|
||||
// downscaling until we have enough information to determine that it's safe to do so
|
||||
// (i.e. enough samples have come in). But if it's been a while and we *still* haven't
|
||||
// received any information, we should *fail* instead of just denying downscaling.
|
||||
//
|
||||
// `last_time` is set to `Instant::now()` on startup, so checking `last_time.elapsed()`
|
||||
// serves double-duty: it trips if we haven't received *any* metrics for long enough,
|
||||
// OR if we haven't received metrics *recently enough*.
|
||||
//
|
||||
// TODO: make the duration here configurable.
|
||||
if last_time.elapsed() > Duration::from_secs(5) {
|
||||
bail!("haven't gotten cgroup memory stats recently enough to determine downscaling information");
|
||||
} else if last_history.samples_count <= 1 {
|
||||
let status = "haven't received enough cgroup memory stats yet";
|
||||
info!(status, "discontinuing downscale");
|
||||
return Ok((false, status.to_owned()));
|
||||
}
|
||||
|
||||
let new_threshold = self
|
||||
new_cgroup_mem_high = cgroup
|
||||
.config
|
||||
.cgroup_threshold(usable_system_memory, expected_file_cache_size);
|
||||
.calculate_memory_high_value(usable_system_memory - expected_file_cache_mem_usage);
|
||||
|
||||
let current = last_history.avg_non_reclaimable;
|
||||
let current = cgroup
|
||||
.current_memory_usage()
|
||||
.context("failed to fetch cgroup memory")?;
|
||||
|
||||
if new_threshold < current + self.config.cgroup_downscale_threshold_buffer_bytes {
|
||||
if new_cgroup_mem_high < current + cgroup.config.memory_high_buffer_bytes {
|
||||
let status = format!(
|
||||
"{}: {} MiB (new threshold) < {} (current usage) + {} (downscale buffer)",
|
||||
"calculated memory threshold too low",
|
||||
bytes_to_mebibytes(new_threshold),
|
||||
"{}: {} MiB (new high) < {} (current usage) + {} (buffer)",
|
||||
"calculated memory.high too low",
|
||||
bytes_to_mebibytes(new_cgroup_mem_high),
|
||||
bytes_to_mebibytes(current),
|
||||
bytes_to_mebibytes(self.config.cgroup_downscale_threshold_buffer_bytes)
|
||||
bytes_to_mebibytes(cgroup.config.memory_high_buffer_bytes)
|
||||
);
|
||||
|
||||
info!(status, "discontinuing downscale");
|
||||
@@ -282,33 +249,42 @@ impl Runner {
|
||||
|
||||
// The downscaling has been approved. Downscale the file cache, then the cgroup.
|
||||
let mut status = vec![];
|
||||
let mut file_cache_disk_size = 0;
|
||||
let mut file_cache_mem_usage = 0;
|
||||
if let Some(file_cache) = &mut self.filecache {
|
||||
let actual_usage = file_cache
|
||||
.set_file_cache_size(expected_file_cache_size)
|
||||
.set_file_cache_size(expected_file_cache_mem_usage)
|
||||
.await
|
||||
.context("failed to set file cache size")?;
|
||||
file_cache_disk_size = actual_usage;
|
||||
if file_cache.config.in_memory {
|
||||
file_cache_mem_usage = actual_usage;
|
||||
}
|
||||
let message = format!(
|
||||
"set file cache size to {} MiB",
|
||||
"set file cache size to {} MiB (in memory = {})",
|
||||
bytes_to_mebibytes(actual_usage),
|
||||
file_cache.config.in_memory,
|
||||
);
|
||||
info!("downscale: {message}");
|
||||
status.push(message);
|
||||
}
|
||||
|
||||
if let Some(cgroup) = &mut self.cgroup {
|
||||
let new_threshold = self
|
||||
.config
|
||||
.cgroup_threshold(usable_system_memory, file_cache_disk_size);
|
||||
if let Some(cgroup) = &self.cgroup {
|
||||
let available_memory = usable_system_memory - file_cache_mem_usage;
|
||||
|
||||
if file_cache_mem_usage != expected_file_cache_mem_usage {
|
||||
new_cgroup_mem_high = cgroup.config.calculate_memory_high_value(available_memory);
|
||||
}
|
||||
|
||||
// new_cgroup_mem_high is initialized to 0 but it is guaranteed to not be here
|
||||
// since it is properly initialized in the previous cgroup if let block
|
||||
cgroup
|
||||
.set_memory_high_bytes(new_cgroup_mem_high)
|
||||
.context("failed to set cgroup memory.high")?;
|
||||
|
||||
let message = format!(
|
||||
"set cgroup memory threshold from {} MiB to {} MiB, of new total {} MiB",
|
||||
bytes_to_mebibytes(cgroup.threshold),
|
||||
bytes_to_mebibytes(new_threshold),
|
||||
bytes_to_mebibytes(usable_system_memory)
|
||||
"set cgroup memory.high to {} MiB, of new max {} MiB",
|
||||
bytes_to_mebibytes(new_cgroup_mem_high),
|
||||
bytes_to_mebibytes(available_memory)
|
||||
);
|
||||
cgroup.threshold = new_threshold;
|
||||
info!("downscale: {message}");
|
||||
status.push(message);
|
||||
}
|
||||
@@ -329,7 +305,8 @@ impl Runner {
|
||||
let new_mem = resources.mem;
|
||||
let usable_system_memory = new_mem.saturating_sub(self.config.sys_buffer_bytes);
|
||||
|
||||
let mut file_cache_disk_size = 0;
|
||||
// Get the file cache's expected contribution to the memory usage
|
||||
let mut file_cache_mem_usage = 0;
|
||||
if let Some(file_cache) = &mut self.filecache {
|
||||
let expected_usage = file_cache.config.calculate_cache_size(usable_system_memory);
|
||||
info!(
|
||||
@@ -342,7 +319,9 @@ impl Runner {
|
||||
.set_file_cache_size(expected_usage)
|
||||
.await
|
||||
.context("failed to set file cache size")?;
|
||||
file_cache_disk_size = actual_usage;
|
||||
if file_cache.config.in_memory {
|
||||
file_cache_mem_usage = actual_usage;
|
||||
}
|
||||
|
||||
if actual_usage != expected_usage {
|
||||
warn!(
|
||||
@@ -353,18 +332,18 @@ impl Runner {
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(cgroup) = &mut self.cgroup {
|
||||
let new_threshold = self
|
||||
.config
|
||||
.cgroup_threshold(usable_system_memory, file_cache_disk_size);
|
||||
|
||||
if let Some(cgroup) = &self.cgroup {
|
||||
let available_memory = usable_system_memory - file_cache_mem_usage;
|
||||
let new_cgroup_mem_high = cgroup.config.calculate_memory_high_value(available_memory);
|
||||
info!(
|
||||
"set cgroup memory threshold from {} MiB to {} MiB of new total {} MiB",
|
||||
bytes_to_mebibytes(cgroup.threshold),
|
||||
bytes_to_mebibytes(new_threshold),
|
||||
bytes_to_mebibytes(usable_system_memory)
|
||||
target = bytes_to_mebibytes(new_cgroup_mem_high),
|
||||
total = bytes_to_mebibytes(new_mem),
|
||||
name = cgroup.path(),
|
||||
"updating cgroup memory.high",
|
||||
);
|
||||
cgroup.threshold = new_threshold;
|
||||
cgroup
|
||||
.set_memory_high_bytes(new_cgroup_mem_high)
|
||||
.context("failed to set cgroup memory.high")?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
@@ -382,6 +361,10 @@ impl Runner {
|
||||
self.handle_upscale(granted)
|
||||
.await
|
||||
.context("failed to handle upscale")?;
|
||||
self.dispatcher
|
||||
.notify_upscale(Sequenced::new(granted))
|
||||
.await
|
||||
.context("failed to notify notify cgroup of upscale")?;
|
||||
Ok(Some(OutboundMsg::new(
|
||||
OutboundMsgKind::UpscaleConfirmation {},
|
||||
id,
|
||||
@@ -425,53 +408,33 @@ impl Runner {
|
||||
Err(e) => bail!("failed to receive kill signal: {e}")
|
||||
}
|
||||
}
|
||||
|
||||
// New memory stats from the cgroup, *may* need to request upscaling, if we've
|
||||
// exceeded the threshold
|
||||
result = self.cgroup.as_mut().unwrap().watcher.changed(), if self.cgroup.is_some() => {
|
||||
result.context("failed to receive from cgroup memory stats watcher")?;
|
||||
|
||||
let cgroup = self.cgroup.as_ref().unwrap();
|
||||
|
||||
let (_time, cgroup_mem_stat) = *cgroup.watcher.borrow();
|
||||
|
||||
// If we haven't exceeded the threshold, then we're all ok
|
||||
if cgroup_mem_stat.avg_non_reclaimable < cgroup.threshold {
|
||||
continue;
|
||||
// we need to propagate an upscale request
|
||||
request = self.dispatcher.request_upscale_events.recv(), if self.cgroup.is_some() => {
|
||||
if request.is_none() {
|
||||
bail!("failed to listen for upscale event from cgroup")
|
||||
}
|
||||
|
||||
// Otherwise, we generally want upscaling. But, if it's been less than 1 second
|
||||
// since the last time we requested upscaling, ignore the event, to avoid
|
||||
// spamming the agent.
|
||||
// If it's been less than 1 second since the last time we requested upscaling,
|
||||
// ignore the event, to avoid spamming the agent (otherwise, this can happen
|
||||
// ~1k times per second).
|
||||
if let Some(t) = self.last_upscale_request_at {
|
||||
let elapsed = t.elapsed();
|
||||
if elapsed < Duration::from_secs(1) {
|
||||
info!(
|
||||
elapsed_millis = elapsed.as_millis(),
|
||||
avg_non_reclaimable = bytes_to_mebibytes(cgroup_mem_stat.avg_non_reclaimable),
|
||||
threshold = bytes_to_mebibytes(cgroup.threshold),
|
||||
"cgroup memory stats are high enough to upscale but too soon to forward the request, ignoring",
|
||||
);
|
||||
info!(elapsed_millis = elapsed.as_millis(), "cgroup asked for upscale but too soon to forward the request, ignoring");
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
self.last_upscale_request_at = Some(Instant::now());
|
||||
|
||||
info!(
|
||||
avg_non_reclaimable = bytes_to_mebibytes(cgroup_mem_stat.avg_non_reclaimable),
|
||||
threshold = bytes_to_mebibytes(cgroup.threshold),
|
||||
"cgroup memory stats are high enough to upscale, requesting upscale",
|
||||
);
|
||||
|
||||
info!("cgroup asking for upscale; forwarding request");
|
||||
self.counter += 2; // Increment, preserving parity (i.e. keep the
|
||||
// counter odd). See the field comment for more.
|
||||
self.dispatcher
|
||||
.send(OutboundMsg::new(OutboundMsgKind::UpscaleRequest {}, self.counter))
|
||||
.await
|
||||
.context("failed to send message")?;
|
||||
},
|
||||
|
||||
}
|
||||
// there is a message from the agent
|
||||
msg = self.dispatcher.source.next() => {
|
||||
if let Some(msg) = msg {
|
||||
@@ -499,14 +462,11 @@ impl Runner {
|
||||
Ok(Some(out)) => out,
|
||||
Ok(None) => continue,
|
||||
Err(e) => {
|
||||
// use {:#} for our logging because the display impl only
|
||||
// gives the outermost cause, and the debug impl
|
||||
// pretty-prints the error, whereas {:#} contains all the
|
||||
// causes, but is compact (no newlines).
|
||||
warn!(error = format!("{e:#}"), "error handling message");
|
||||
let error = e.to_string();
|
||||
warn!(?error, "error handling message");
|
||||
OutboundMsg::new(
|
||||
OutboundMsgKind::InternalError {
|
||||
error: e.to_string(),
|
||||
error
|
||||
},
|
||||
message.id
|
||||
)
|
||||
|
||||
@@ -1,16 +0,0 @@
|
||||
[package]
|
||||
name = "walproposer"
|
||||
version = "0.1.0"
|
||||
edition.workspace = true
|
||||
license.workspace = true
|
||||
|
||||
[dependencies]
|
||||
anyhow.workspace = true
|
||||
utils.workspace = true
|
||||
postgres_ffi.workspace = true
|
||||
|
||||
workspace_hack.workspace = true
|
||||
|
||||
[build-dependencies]
|
||||
anyhow.workspace = true
|
||||
bindgen.workspace = true
|
||||
@@ -1 +0,0 @@
|
||||
#include "walproposer.h"
|
||||
@@ -1,113 +0,0 @@
|
||||
use std::{env, path::PathBuf, process::Command};
|
||||
|
||||
use anyhow::{anyhow, Context};
|
||||
use bindgen::CargoCallbacks;
|
||||
|
||||
fn main() -> anyhow::Result<()> {
|
||||
// Tell cargo to invalidate the built crate whenever the wrapper changes
|
||||
println!("cargo:rerun-if-changed=bindgen_deps.h");
|
||||
|
||||
// Finding the location of built libraries and Postgres C headers:
|
||||
// - if POSTGRES_INSTALL_DIR is set look into it, otherwise look into `<project_root>/pg_install`
|
||||
// - if there's a `bin/pg_config` file use it for getting include server, otherwise use `<project_root>/pg_install/{PG_MAJORVERSION}/include/postgresql/server`
|
||||
let pg_install_dir = if let Some(postgres_install_dir) = env::var_os("POSTGRES_INSTALL_DIR") {
|
||||
postgres_install_dir.into()
|
||||
} else {
|
||||
PathBuf::from(env!("CARGO_MANIFEST_DIR")).join("../../pg_install")
|
||||
};
|
||||
|
||||
let pg_install_abs = std::fs::canonicalize(pg_install_dir)?;
|
||||
let walproposer_lib_dir = pg_install_abs.join("build/walproposer-lib");
|
||||
let walproposer_lib_search_str = walproposer_lib_dir
|
||||
.to_str()
|
||||
.ok_or(anyhow!("Bad non-UTF path"))?;
|
||||
|
||||
let pgxn_neon = PathBuf::from(env!("CARGO_MANIFEST_DIR")).join("../../pgxn/neon");
|
||||
let pgxn_neon = std::fs::canonicalize(pgxn_neon)?;
|
||||
let pgxn_neon = pgxn_neon.to_str().ok_or(anyhow!("Bad non-UTF path"))?;
|
||||
|
||||
println!("cargo:rustc-link-lib=static=pgport");
|
||||
println!("cargo:rustc-link-lib=static=pgcommon");
|
||||
println!("cargo:rustc-link-lib=static=walproposer");
|
||||
println!("cargo:rustc-link-search={walproposer_lib_search_str}");
|
||||
|
||||
let pg_config_bin = pg_install_abs.join("v16").join("bin").join("pg_config");
|
||||
let inc_server_path: String = if pg_config_bin.exists() {
|
||||
let output = Command::new(pg_config_bin)
|
||||
.arg("--includedir-server")
|
||||
.output()
|
||||
.context("failed to execute `pg_config --includedir-server`")?;
|
||||
|
||||
if !output.status.success() {
|
||||
panic!("`pg_config --includedir-server` failed")
|
||||
}
|
||||
|
||||
String::from_utf8(output.stdout)
|
||||
.context("pg_config output is not UTF-8")?
|
||||
.trim_end()
|
||||
.into()
|
||||
} else {
|
||||
let server_path = pg_install_abs
|
||||
.join("v16")
|
||||
.join("include")
|
||||
.join("postgresql")
|
||||
.join("server")
|
||||
.into_os_string();
|
||||
server_path
|
||||
.into_string()
|
||||
.map_err(|s| anyhow!("Bad postgres server path {s:?}"))?
|
||||
};
|
||||
|
||||
// The bindgen::Builder is the main entry point
|
||||
// to bindgen, and lets you build up options for
|
||||
// the resulting bindings.
|
||||
let bindings = bindgen::Builder::default()
|
||||
// The input header we would like to generate
|
||||
// bindings for.
|
||||
.header("bindgen_deps.h")
|
||||
// Tell cargo to invalidate the built crate whenever any of the
|
||||
// included header files changed.
|
||||
.parse_callbacks(Box::new(CargoCallbacks))
|
||||
.allowlist_type("WalProposer")
|
||||
.allowlist_type("WalProposerConfig")
|
||||
.allowlist_type("walproposer_api")
|
||||
.allowlist_function("WalProposerCreate")
|
||||
.allowlist_function("WalProposerStart")
|
||||
.allowlist_function("WalProposerBroadcast")
|
||||
.allowlist_function("WalProposerPoll")
|
||||
.allowlist_function("WalProposerFree")
|
||||
.allowlist_var("DEBUG5")
|
||||
.allowlist_var("DEBUG4")
|
||||
.allowlist_var("DEBUG3")
|
||||
.allowlist_var("DEBUG2")
|
||||
.allowlist_var("DEBUG1")
|
||||
.allowlist_var("LOG")
|
||||
.allowlist_var("INFO")
|
||||
.allowlist_var("NOTICE")
|
||||
.allowlist_var("WARNING")
|
||||
.allowlist_var("ERROR")
|
||||
.allowlist_var("FATAL")
|
||||
.allowlist_var("PANIC")
|
||||
.allowlist_var("WPEVENT")
|
||||
.allowlist_var("WL_LATCH_SET")
|
||||
.allowlist_var("WL_SOCKET_READABLE")
|
||||
.allowlist_var("WL_SOCKET_WRITEABLE")
|
||||
.allowlist_var("WL_TIMEOUT")
|
||||
.allowlist_var("WL_SOCKET_CLOSED")
|
||||
.allowlist_var("WL_SOCKET_MASK")
|
||||
.clang_arg("-DWALPROPOSER_LIB")
|
||||
.clang_arg(format!("-I{pgxn_neon}"))
|
||||
.clang_arg(format!("-I{inc_server_path}"))
|
||||
// Finish the builder and generate the bindings.
|
||||
.generate()
|
||||
// Unwrap the Result and panic on failure.
|
||||
.expect("Unable to generate bindings");
|
||||
|
||||
// Write the bindings to the $OUT_DIR/bindings.rs file.
|
||||
let out_path = PathBuf::from(env::var("OUT_DIR").unwrap()).join("bindings.rs");
|
||||
bindings
|
||||
.write_to_file(out_path)
|
||||
.expect("Couldn't write bindings!");
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,455 +0,0 @@
|
||||
#![allow(dead_code)]
|
||||
|
||||
use std::ffi::CStr;
|
||||
use std::ffi::CString;
|
||||
|
||||
use crate::bindings::uint32;
|
||||
use crate::bindings::walproposer_api;
|
||||
use crate::bindings::PGAsyncReadResult;
|
||||
use crate::bindings::PGAsyncWriteResult;
|
||||
use crate::bindings::Safekeeper;
|
||||
use crate::bindings::Size;
|
||||
use crate::bindings::StringInfoData;
|
||||
use crate::bindings::TimeLineID;
|
||||
use crate::bindings::TimestampTz;
|
||||
use crate::bindings::WalProposer;
|
||||
use crate::bindings::WalProposerConnStatusType;
|
||||
use crate::bindings::WalProposerConnectPollStatusType;
|
||||
use crate::bindings::WalProposerExecStatusType;
|
||||
use crate::bindings::WalproposerShmemState;
|
||||
use crate::bindings::XLogRecPtr;
|
||||
use crate::walproposer::ApiImpl;
|
||||
use crate::walproposer::WaitResult;
|
||||
|
||||
extern "C" fn get_shmem_state(wp: *mut WalProposer) -> *mut WalproposerShmemState {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).get_shmem_state()
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn start_streaming(wp: *mut WalProposer, startpos: XLogRecPtr) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).start_streaming(startpos)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn get_flush_rec_ptr(wp: *mut WalProposer) -> XLogRecPtr {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).get_flush_rec_ptr()
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn get_current_timestamp(wp: *mut WalProposer) -> TimestampTz {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).get_current_timestamp()
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_error_message(sk: *mut Safekeeper) -> *mut ::std::os::raw::c_char {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
let msg = (*api).conn_error_message(&mut (*sk));
|
||||
let msg = CString::new(msg).unwrap();
|
||||
// TODO: fix leaking error message
|
||||
msg.into_raw()
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_status(sk: *mut Safekeeper) -> WalProposerConnStatusType {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_status(&mut (*sk))
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_connect_start(sk: *mut Safekeeper) {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_connect_start(&mut (*sk))
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_connect_poll(sk: *mut Safekeeper) -> WalProposerConnectPollStatusType {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_connect_poll(&mut (*sk))
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_send_query(sk: *mut Safekeeper, query: *mut ::std::os::raw::c_char) -> bool {
|
||||
let query = unsafe { CStr::from_ptr(query) };
|
||||
let query = query.to_str().unwrap();
|
||||
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_send_query(&mut (*sk), query)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_get_query_result(sk: *mut Safekeeper) -> WalProposerExecStatusType {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_get_query_result(&mut (*sk))
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_flush(sk: *mut Safekeeper) -> ::std::os::raw::c_int {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_flush(&mut (*sk))
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_finish(sk: *mut Safekeeper) {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_finish(&mut (*sk))
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_async_read(
|
||||
sk: *mut Safekeeper,
|
||||
buf: *mut *mut ::std::os::raw::c_char,
|
||||
amount: *mut ::std::os::raw::c_int,
|
||||
) -> PGAsyncReadResult {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
let (res, result) = (*api).conn_async_read(&mut (*sk));
|
||||
|
||||
// This function has guarantee that returned buf will be valid until
|
||||
// the next call. So we can store a Vec in each Safekeeper and reuse
|
||||
// it on the next call.
|
||||
let mut inbuf = take_vec_u8(&mut (*sk).inbuf).unwrap_or_default();
|
||||
|
||||
inbuf.clear();
|
||||
inbuf.extend_from_slice(res);
|
||||
|
||||
// Put a Vec back to sk->inbuf and return data ptr.
|
||||
*buf = store_vec_u8(&mut (*sk).inbuf, inbuf);
|
||||
*amount = res.len() as i32;
|
||||
|
||||
result
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_async_write(
|
||||
sk: *mut Safekeeper,
|
||||
buf: *const ::std::os::raw::c_void,
|
||||
size: usize,
|
||||
) -> PGAsyncWriteResult {
|
||||
unsafe {
|
||||
let buf = std::slice::from_raw_parts(buf as *const u8, size);
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_async_write(&mut (*sk), buf)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn conn_blocking_write(
|
||||
sk: *mut Safekeeper,
|
||||
buf: *const ::std::os::raw::c_void,
|
||||
size: usize,
|
||||
) -> bool {
|
||||
unsafe {
|
||||
let buf = std::slice::from_raw_parts(buf as *const u8, size);
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).conn_blocking_write(&mut (*sk), buf)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn recovery_download(
|
||||
sk: *mut Safekeeper,
|
||||
_timeline: TimeLineID,
|
||||
startpos: XLogRecPtr,
|
||||
endpos: XLogRecPtr,
|
||||
) -> bool {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).recovery_download(&mut (*sk), startpos, endpos)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn wal_read(
|
||||
sk: *mut Safekeeper,
|
||||
buf: *mut ::std::os::raw::c_char,
|
||||
startptr: XLogRecPtr,
|
||||
count: Size,
|
||||
) {
|
||||
unsafe {
|
||||
let buf = std::slice::from_raw_parts_mut(buf as *mut u8, count);
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).wal_read(&mut (*sk), buf, startptr)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn wal_reader_allocate(sk: *mut Safekeeper) {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).wal_reader_allocate(&mut (*sk));
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn free_event_set(wp: *mut WalProposer) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).free_event_set(&mut (*wp));
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn init_event_set(wp: *mut WalProposer) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).init_event_set(&mut (*wp));
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn update_event_set(sk: *mut Safekeeper, events: uint32) {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).update_event_set(&mut (*sk), events);
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn add_safekeeper_event_set(sk: *mut Safekeeper, events: uint32) {
|
||||
unsafe {
|
||||
let callback_data = (*(*(*sk).wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).add_safekeeper_event_set(&mut (*sk), events);
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn wait_event_set(
|
||||
wp: *mut WalProposer,
|
||||
timeout: ::std::os::raw::c_long,
|
||||
event_sk: *mut *mut Safekeeper,
|
||||
events: *mut uint32,
|
||||
) -> ::std::os::raw::c_int {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
let result = (*api).wait_event_set(&mut (*wp), timeout);
|
||||
match result {
|
||||
WaitResult::Latch => {
|
||||
*event_sk = std::ptr::null_mut();
|
||||
*events = crate::bindings::WL_LATCH_SET;
|
||||
1
|
||||
}
|
||||
WaitResult::Timeout => {
|
||||
*event_sk = std::ptr::null_mut();
|
||||
*events = crate::bindings::WL_TIMEOUT;
|
||||
0
|
||||
}
|
||||
WaitResult::Network(sk, event_mask) => {
|
||||
*event_sk = sk;
|
||||
*events = event_mask;
|
||||
1
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn strong_random(
|
||||
wp: *mut WalProposer,
|
||||
buf: *mut ::std::os::raw::c_void,
|
||||
len: usize,
|
||||
) -> bool {
|
||||
unsafe {
|
||||
let buf = std::slice::from_raw_parts_mut(buf as *mut u8, len);
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).strong_random(buf)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn get_redo_start_lsn(wp: *mut WalProposer) -> XLogRecPtr {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).get_redo_start_lsn()
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn finish_sync_safekeepers(wp: *mut WalProposer, lsn: XLogRecPtr) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).finish_sync_safekeepers(lsn)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn process_safekeeper_feedback(wp: *mut WalProposer, commit_lsn: XLogRecPtr) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).process_safekeeper_feedback(&mut (*wp), commit_lsn)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn confirm_wal_streamed(wp: *mut WalProposer, lsn: XLogRecPtr) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).confirm_wal_streamed(&mut (*wp), lsn)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn log_internal(
|
||||
wp: *mut WalProposer,
|
||||
level: ::std::os::raw::c_int,
|
||||
line: *const ::std::os::raw::c_char,
|
||||
) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
let line = CStr::from_ptr(line);
|
||||
let line = line.to_str().unwrap();
|
||||
(*api).log_internal(&mut (*wp), Level::from(level as u32), line)
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" fn after_election(wp: *mut WalProposer) {
|
||||
unsafe {
|
||||
let callback_data = (*(*wp).config).callback_data;
|
||||
let api = callback_data as *mut Box<dyn ApiImpl>;
|
||||
(*api).after_election(&mut (*wp))
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
pub enum Level {
|
||||
Debug5,
|
||||
Debug4,
|
||||
Debug3,
|
||||
Debug2,
|
||||
Debug1,
|
||||
Log,
|
||||
Info,
|
||||
Notice,
|
||||
Warning,
|
||||
Error,
|
||||
Fatal,
|
||||
Panic,
|
||||
WPEvent,
|
||||
}
|
||||
|
||||
impl Level {
|
||||
pub fn from(elevel: u32) -> Level {
|
||||
use crate::bindings::*;
|
||||
|
||||
match elevel {
|
||||
DEBUG5 => Level::Debug5,
|
||||
DEBUG4 => Level::Debug4,
|
||||
DEBUG3 => Level::Debug3,
|
||||
DEBUG2 => Level::Debug2,
|
||||
DEBUG1 => Level::Debug1,
|
||||
LOG => Level::Log,
|
||||
INFO => Level::Info,
|
||||
NOTICE => Level::Notice,
|
||||
WARNING => Level::Warning,
|
||||
ERROR => Level::Error,
|
||||
FATAL => Level::Fatal,
|
||||
PANIC => Level::Panic,
|
||||
WPEVENT => Level::WPEvent,
|
||||
_ => panic!("unknown log level {}", elevel),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn create_api() -> walproposer_api {
|
||||
walproposer_api {
|
||||
get_shmem_state: Some(get_shmem_state),
|
||||
start_streaming: Some(start_streaming),
|
||||
get_flush_rec_ptr: Some(get_flush_rec_ptr),
|
||||
get_current_timestamp: Some(get_current_timestamp),
|
||||
conn_error_message: Some(conn_error_message),
|
||||
conn_status: Some(conn_status),
|
||||
conn_connect_start: Some(conn_connect_start),
|
||||
conn_connect_poll: Some(conn_connect_poll),
|
||||
conn_send_query: Some(conn_send_query),
|
||||
conn_get_query_result: Some(conn_get_query_result),
|
||||
conn_flush: Some(conn_flush),
|
||||
conn_finish: Some(conn_finish),
|
||||
conn_async_read: Some(conn_async_read),
|
||||
conn_async_write: Some(conn_async_write),
|
||||
conn_blocking_write: Some(conn_blocking_write),
|
||||
recovery_download: Some(recovery_download),
|
||||
wal_read: Some(wal_read),
|
||||
wal_reader_allocate: Some(wal_reader_allocate),
|
||||
free_event_set: Some(free_event_set),
|
||||
init_event_set: Some(init_event_set),
|
||||
update_event_set: Some(update_event_set),
|
||||
add_safekeeper_event_set: Some(add_safekeeper_event_set),
|
||||
wait_event_set: Some(wait_event_set),
|
||||
strong_random: Some(strong_random),
|
||||
get_redo_start_lsn: Some(get_redo_start_lsn),
|
||||
finish_sync_safekeepers: Some(finish_sync_safekeepers),
|
||||
process_safekeeper_feedback: Some(process_safekeeper_feedback),
|
||||
confirm_wal_streamed: Some(confirm_wal_streamed),
|
||||
log_internal: Some(log_internal),
|
||||
after_election: Some(after_election),
|
||||
}
|
||||
}
|
||||
|
||||
impl std::fmt::Display for Level {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
|
||||
write!(f, "{:?}", self)
|
||||
}
|
||||
}
|
||||
|
||||
/// Take ownership of `Vec<u8>` from StringInfoData.
|
||||
pub(crate) fn take_vec_u8(pg: &mut StringInfoData) -> Option<Vec<u8>> {
|
||||
if pg.data.is_null() {
|
||||
return None;
|
||||
}
|
||||
|
||||
let ptr = pg.data as *mut u8;
|
||||
let length = pg.len as usize;
|
||||
let capacity = pg.maxlen as usize;
|
||||
|
||||
pg.data = std::ptr::null_mut();
|
||||
pg.len = 0;
|
||||
pg.maxlen = 0;
|
||||
|
||||
unsafe { Some(Vec::from_raw_parts(ptr, length, capacity)) }
|
||||
}
|
||||
|
||||
/// Store `Vec<u8>` in StringInfoData.
|
||||
fn store_vec_u8(pg: &mut StringInfoData, vec: Vec<u8>) -> *mut ::std::os::raw::c_char {
|
||||
let ptr = vec.as_ptr() as *mut ::std::os::raw::c_char;
|
||||
let length = vec.len();
|
||||
let capacity = vec.capacity();
|
||||
|
||||
assert!(pg.data.is_null());
|
||||
|
||||
pg.data = ptr;
|
||||
pg.len = length as i32;
|
||||
pg.maxlen = capacity as i32;
|
||||
|
||||
std::mem::forget(vec);
|
||||
|
||||
ptr
|
||||
}
|
||||
@@ -1,14 +0,0 @@
|
||||
pub mod bindings {
|
||||
#![allow(non_upper_case_globals)]
|
||||
#![allow(non_camel_case_types)]
|
||||
#![allow(non_snake_case)]
|
||||
// bindgen creates some unsafe code with no doc comments.
|
||||
#![allow(clippy::missing_safety_doc)]
|
||||
// noted at 1.63 that in many cases there's a u32 -> u32 transmutes in bindgen code.
|
||||
#![allow(clippy::useless_transmute)]
|
||||
|
||||
include!(concat!(env!("OUT_DIR"), "/bindings.rs"));
|
||||
}
|
||||
|
||||
pub mod api_bindings;
|
||||
pub mod walproposer;
|
||||
@@ -1,485 +0,0 @@
|
||||
use std::ffi::CString;
|
||||
|
||||
use postgres_ffi::WAL_SEGMENT_SIZE;
|
||||
use utils::id::TenantTimelineId;
|
||||
|
||||
use crate::{
|
||||
api_bindings::{create_api, take_vec_u8, Level},
|
||||
bindings::{
|
||||
Safekeeper, WalProposer, WalProposerConfig, WalProposerCreate, WalProposerFree,
|
||||
WalProposerStart,
|
||||
},
|
||||
};
|
||||
|
||||
/// Rust high-level wrapper for C walproposer API. Many methods are not required
|
||||
/// for simple cases, hence todo!() in default implementations.
|
||||
///
|
||||
/// Refer to `pgxn/neon/walproposer.h` for documentation.
|
||||
pub trait ApiImpl {
|
||||
fn get_shmem_state(&self) -> &mut crate::bindings::WalproposerShmemState {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn start_streaming(&self, _startpos: u64) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn get_flush_rec_ptr(&self) -> u64 {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn get_current_timestamp(&self) -> i64 {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_error_message(&self, _sk: &mut Safekeeper) -> String {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_status(&self, _sk: &mut Safekeeper) -> crate::bindings::WalProposerConnStatusType {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_connect_start(&self, _sk: &mut Safekeeper) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_connect_poll(
|
||||
&self,
|
||||
_sk: &mut Safekeeper,
|
||||
) -> crate::bindings::WalProposerConnectPollStatusType {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_send_query(&self, _sk: &mut Safekeeper, _query: &str) -> bool {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_get_query_result(
|
||||
&self,
|
||||
_sk: &mut Safekeeper,
|
||||
) -> crate::bindings::WalProposerExecStatusType {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_flush(&self, _sk: &mut Safekeeper) -> i32 {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_finish(&self, _sk: &mut Safekeeper) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_async_read(&self, _sk: &mut Safekeeper) -> (&[u8], crate::bindings::PGAsyncReadResult) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_async_write(
|
||||
&self,
|
||||
_sk: &mut Safekeeper,
|
||||
_buf: &[u8],
|
||||
) -> crate::bindings::PGAsyncWriteResult {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn conn_blocking_write(&self, _sk: &mut Safekeeper, _buf: &[u8]) -> bool {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn recovery_download(&self, _sk: &mut Safekeeper, _startpos: u64, _endpos: u64) -> bool {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn wal_read(&self, _sk: &mut Safekeeper, _buf: &mut [u8], _startpos: u64) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn wal_reader_allocate(&self, _sk: &mut Safekeeper) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn free_event_set(&self, _wp: &mut WalProposer) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn init_event_set(&self, _wp: &mut WalProposer) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn update_event_set(&self, _sk: &mut Safekeeper, _events_mask: u32) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn add_safekeeper_event_set(&self, _sk: &mut Safekeeper, _events_mask: u32) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn wait_event_set(&self, _wp: &mut WalProposer, _timeout_millis: i64) -> WaitResult {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn strong_random(&self, _buf: &mut [u8]) -> bool {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn get_redo_start_lsn(&self) -> u64 {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn finish_sync_safekeepers(&self, _lsn: u64) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn process_safekeeper_feedback(&self, _wp: &mut WalProposer, _commit_lsn: u64) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn confirm_wal_streamed(&self, _wp: &mut WalProposer, _lsn: u64) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn log_internal(&self, _wp: &mut WalProposer, _level: Level, _msg: &str) {
|
||||
todo!()
|
||||
}
|
||||
|
||||
fn after_election(&self, _wp: &mut WalProposer) {
|
||||
todo!()
|
||||
}
|
||||
}
|
||||
|
||||
pub enum WaitResult {
|
||||
Latch,
|
||||
Timeout,
|
||||
Network(*mut Safekeeper, u32),
|
||||
}
|
||||
|
||||
pub struct Config {
|
||||
/// Tenant and timeline id
|
||||
pub ttid: TenantTimelineId,
|
||||
/// List of safekeepers in format `host:port`
|
||||
pub safekeepers_list: Vec<String>,
|
||||
/// Safekeeper reconnect timeout in milliseconds
|
||||
pub safekeeper_reconnect_timeout: i32,
|
||||
/// Safekeeper connection timeout in milliseconds
|
||||
pub safekeeper_connection_timeout: i32,
|
||||
/// walproposer mode, finish when all safekeepers are synced or subscribe
|
||||
/// to WAL streaming
|
||||
pub sync_safekeepers: bool,
|
||||
}
|
||||
|
||||
/// WalProposer main struct. C methods are reexported as Rust functions.
|
||||
pub struct Wrapper {
|
||||
wp: *mut WalProposer,
|
||||
_safekeepers_list_vec: Vec<u8>,
|
||||
}
|
||||
|
||||
impl Wrapper {
|
||||
pub fn new(api: Box<dyn ApiImpl>, config: Config) -> Wrapper {
|
||||
let neon_tenant = CString::new(config.ttid.tenant_id.to_string())
|
||||
.unwrap()
|
||||
.into_raw();
|
||||
let neon_timeline = CString::new(config.ttid.timeline_id.to_string())
|
||||
.unwrap()
|
||||
.into_raw();
|
||||
|
||||
let mut safekeepers_list_vec = CString::new(config.safekeepers_list.join(","))
|
||||
.unwrap()
|
||||
.into_bytes_with_nul();
|
||||
assert!(safekeepers_list_vec.len() == safekeepers_list_vec.capacity());
|
||||
let safekeepers_list = safekeepers_list_vec.as_mut_ptr() as *mut i8;
|
||||
|
||||
let callback_data = Box::into_raw(Box::new(api)) as *mut ::std::os::raw::c_void;
|
||||
|
||||
let c_config = WalProposerConfig {
|
||||
neon_tenant,
|
||||
neon_timeline,
|
||||
safekeepers_list,
|
||||
safekeeper_reconnect_timeout: config.safekeeper_reconnect_timeout,
|
||||
safekeeper_connection_timeout: config.safekeeper_connection_timeout,
|
||||
wal_segment_size: WAL_SEGMENT_SIZE as i32, // default 16MB
|
||||
syncSafekeepers: config.sync_safekeepers,
|
||||
systemId: 0,
|
||||
pgTimeline: 1,
|
||||
callback_data,
|
||||
};
|
||||
let c_config = Box::into_raw(Box::new(c_config));
|
||||
|
||||
let api = create_api();
|
||||
let wp = unsafe { WalProposerCreate(c_config, api) };
|
||||
Wrapper {
|
||||
wp,
|
||||
_safekeepers_list_vec: safekeepers_list_vec,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn start(&self) {
|
||||
unsafe { WalProposerStart(self.wp) }
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for Wrapper {
|
||||
fn drop(&mut self) {
|
||||
unsafe {
|
||||
let config = (*self.wp).config;
|
||||
drop(Box::from_raw(
|
||||
(*config).callback_data as *mut Box<dyn ApiImpl>,
|
||||
));
|
||||
drop(CString::from_raw((*config).neon_tenant));
|
||||
drop(CString::from_raw((*config).neon_timeline));
|
||||
drop(Box::from_raw(config));
|
||||
|
||||
for i in 0..(*self.wp).n_safekeepers {
|
||||
let sk = &mut (*self.wp).safekeeper[i as usize];
|
||||
take_vec_u8(&mut sk.inbuf);
|
||||
}
|
||||
|
||||
WalProposerFree(self.wp);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use std::{
|
||||
cell::Cell,
|
||||
sync::{atomic::AtomicUsize, mpsc::sync_channel},
|
||||
};
|
||||
|
||||
use utils::id::TenantTimelineId;
|
||||
|
||||
use crate::{api_bindings::Level, walproposer::Wrapper};
|
||||
|
||||
use super::ApiImpl;
|
||||
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
struct WaitEventsData {
|
||||
sk: *mut crate::bindings::Safekeeper,
|
||||
event_mask: u32,
|
||||
}
|
||||
|
||||
struct MockImpl {
|
||||
// data to return from wait_event_set
|
||||
wait_events: Cell<WaitEventsData>,
|
||||
// walproposer->safekeeper messages
|
||||
expected_messages: Vec<Vec<u8>>,
|
||||
expected_ptr: AtomicUsize,
|
||||
// safekeeper->walproposer messages
|
||||
safekeeper_replies: Vec<Vec<u8>>,
|
||||
replies_ptr: AtomicUsize,
|
||||
// channel to send LSN to the main thread
|
||||
sync_channel: std::sync::mpsc::SyncSender<u64>,
|
||||
}
|
||||
|
||||
impl MockImpl {
|
||||
fn check_walproposer_msg(&self, msg: &[u8]) {
|
||||
let ptr = self
|
||||
.expected_ptr
|
||||
.fetch_add(1, std::sync::atomic::Ordering::SeqCst);
|
||||
|
||||
if ptr >= self.expected_messages.len() {
|
||||
panic!("unexpected message from walproposer");
|
||||
}
|
||||
|
||||
let expected_msg = &self.expected_messages[ptr];
|
||||
assert_eq!(msg, expected_msg.as_slice());
|
||||
}
|
||||
|
||||
fn next_safekeeper_reply(&self) -> &[u8] {
|
||||
let ptr = self
|
||||
.replies_ptr
|
||||
.fetch_add(1, std::sync::atomic::Ordering::SeqCst);
|
||||
|
||||
if ptr >= self.safekeeper_replies.len() {
|
||||
panic!("no more safekeeper replies");
|
||||
}
|
||||
|
||||
&self.safekeeper_replies[ptr]
|
||||
}
|
||||
}
|
||||
|
||||
impl ApiImpl for MockImpl {
|
||||
fn get_current_timestamp(&self) -> i64 {
|
||||
println!("get_current_timestamp");
|
||||
0
|
||||
}
|
||||
|
||||
fn conn_status(
|
||||
&self,
|
||||
_: &mut crate::bindings::Safekeeper,
|
||||
) -> crate::bindings::WalProposerConnStatusType {
|
||||
println!("conn_status");
|
||||
crate::bindings::WalProposerConnStatusType_WP_CONNECTION_OK
|
||||
}
|
||||
|
||||
fn conn_connect_start(&self, _: &mut crate::bindings::Safekeeper) {
|
||||
println!("conn_connect_start");
|
||||
}
|
||||
|
||||
fn conn_connect_poll(
|
||||
&self,
|
||||
_: &mut crate::bindings::Safekeeper,
|
||||
) -> crate::bindings::WalProposerConnectPollStatusType {
|
||||
println!("conn_connect_poll");
|
||||
crate::bindings::WalProposerConnectPollStatusType_WP_CONN_POLLING_OK
|
||||
}
|
||||
|
||||
fn conn_send_query(&self, _: &mut crate::bindings::Safekeeper, query: &str) -> bool {
|
||||
println!("conn_send_query: {}", query);
|
||||
true
|
||||
}
|
||||
|
||||
fn conn_get_query_result(
|
||||
&self,
|
||||
_: &mut crate::bindings::Safekeeper,
|
||||
) -> crate::bindings::WalProposerExecStatusType {
|
||||
println!("conn_get_query_result");
|
||||
crate::bindings::WalProposerExecStatusType_WP_EXEC_SUCCESS_COPYBOTH
|
||||
}
|
||||
|
||||
fn conn_async_read(
|
||||
&self,
|
||||
_: &mut crate::bindings::Safekeeper,
|
||||
) -> (&[u8], crate::bindings::PGAsyncReadResult) {
|
||||
println!("conn_async_read");
|
||||
let reply = self.next_safekeeper_reply();
|
||||
println!("conn_async_read result: {:?}", reply);
|
||||
(
|
||||
reply,
|
||||
crate::bindings::PGAsyncReadResult_PG_ASYNC_READ_SUCCESS,
|
||||
)
|
||||
}
|
||||
|
||||
fn conn_blocking_write(&self, _: &mut crate::bindings::Safekeeper, buf: &[u8]) -> bool {
|
||||
println!("conn_blocking_write: {:?}", buf);
|
||||
self.check_walproposer_msg(buf);
|
||||
true
|
||||
}
|
||||
|
||||
fn wal_reader_allocate(&self, _: &mut crate::bindings::Safekeeper) {
|
||||
println!("wal_reader_allocate")
|
||||
}
|
||||
|
||||
fn free_event_set(&self, _: &mut crate::bindings::WalProposer) {
|
||||
println!("free_event_set")
|
||||
}
|
||||
|
||||
fn init_event_set(&self, _: &mut crate::bindings::WalProposer) {
|
||||
println!("init_event_set")
|
||||
}
|
||||
|
||||
fn update_event_set(&self, sk: &mut crate::bindings::Safekeeper, event_mask: u32) {
|
||||
println!(
|
||||
"update_event_set, sk={:?}, events_mask={:#b}",
|
||||
sk as *mut crate::bindings::Safekeeper, event_mask
|
||||
);
|
||||
self.wait_events.set(WaitEventsData { sk, event_mask });
|
||||
}
|
||||
|
||||
fn add_safekeeper_event_set(&self, sk: &mut crate::bindings::Safekeeper, event_mask: u32) {
|
||||
println!(
|
||||
"add_safekeeper_event_set, sk={:?}, events_mask={:#b}",
|
||||
sk as *mut crate::bindings::Safekeeper, event_mask
|
||||
);
|
||||
self.wait_events.set(WaitEventsData { sk, event_mask });
|
||||
}
|
||||
|
||||
fn wait_event_set(
|
||||
&self,
|
||||
_: &mut crate::bindings::WalProposer,
|
||||
timeout_millis: i64,
|
||||
) -> super::WaitResult {
|
||||
let data = self.wait_events.get();
|
||||
println!(
|
||||
"wait_event_set, timeout_millis={}, res={:?}",
|
||||
timeout_millis, data
|
||||
);
|
||||
super::WaitResult::Network(data.sk, data.event_mask)
|
||||
}
|
||||
|
||||
fn strong_random(&self, buf: &mut [u8]) -> bool {
|
||||
println!("strong_random");
|
||||
buf.fill(0);
|
||||
true
|
||||
}
|
||||
|
||||
fn finish_sync_safekeepers(&self, lsn: u64) {
|
||||
self.sync_channel.send(lsn).unwrap();
|
||||
panic!("sync safekeepers finished at lsn={}", lsn);
|
||||
}
|
||||
|
||||
fn log_internal(&self, _wp: &mut crate::bindings::WalProposer, level: Level, msg: &str) {
|
||||
println!("walprop_log[{}] {}", level, msg);
|
||||
}
|
||||
|
||||
fn after_election(&self, _wp: &mut crate::bindings::WalProposer) {
|
||||
println!("after_election");
|
||||
}
|
||||
}
|
||||
|
||||
/// Test that walproposer can successfully connect to safekeeper and finish
|
||||
/// sync_safekeepers. API is mocked in MockImpl.
|
||||
///
|
||||
/// Run this test with valgrind to detect leaks:
|
||||
/// `valgrind --leak-check=full target/debug/deps/walproposer-<build>`
|
||||
#[test]
|
||||
fn test_simple_sync_safekeepers() -> anyhow::Result<()> {
|
||||
let ttid = TenantTimelineId::new(
|
||||
"9e4c8f36063c6c6e93bc20d65a820f3d".parse()?,
|
||||
"9e4c8f36063c6c6e93bc20d65a820f3d".parse()?,
|
||||
);
|
||||
|
||||
let (sender, receiver) = sync_channel(1);
|
||||
|
||||
let my_impl: Box<dyn ApiImpl> = Box::new(MockImpl {
|
||||
wait_events: Cell::new(WaitEventsData {
|
||||
sk: std::ptr::null_mut(),
|
||||
event_mask: 0,
|
||||
}),
|
||||
expected_messages: vec![
|
||||
// Greeting(ProposerGreeting { protocol_version: 2, pg_version: 160000, proposer_id: [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], system_id: 0, timeline_id: 9e4c8f36063c6c6e93bc20d65a820f3d, tenant_id: 9e4c8f36063c6c6e93bc20d65a820f3d, tli: 1, wal_seg_size: 16777216 })
|
||||
vec![
|
||||
103, 0, 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 0, 113, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
||||
0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 158, 76, 143, 54, 6, 60, 108, 110,
|
||||
147, 188, 32, 214, 90, 130, 15, 61, 158, 76, 143, 54, 6, 60, 108, 110, 147,
|
||||
188, 32, 214, 90, 130, 15, 61, 1, 0, 0, 0, 0, 0, 0, 1,
|
||||
],
|
||||
// VoteRequest(VoteRequest { term: 3 })
|
||||
vec![
|
||||
118, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
||||
0, 0, 0, 0, 0, 0,
|
||||
],
|
||||
],
|
||||
expected_ptr: AtomicUsize::new(0),
|
||||
safekeeper_replies: vec![
|
||||
// Greeting(AcceptorGreeting { term: 2, node_id: NodeId(1) })
|
||||
vec![
|
||||
103, 0, 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,
|
||||
],
|
||||
// VoteResponse(VoteResponse { term: 3, vote_given: 1, flush_lsn: 0/539, truncate_lsn: 0/539, term_history: [(2, 0/539)], timeline_start_lsn: 0/539 })
|
||||
vec![
|
||||
118, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 57,
|
||||
5, 0, 0, 0, 0, 0, 0, 57, 5, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 2, 0, 0, 0, 0, 0, 0,
|
||||
0, 57, 5, 0, 0, 0, 0, 0, 0, 57, 5, 0, 0, 0, 0, 0, 0,
|
||||
],
|
||||
],
|
||||
replies_ptr: AtomicUsize::new(0),
|
||||
sync_channel: sender,
|
||||
});
|
||||
let config = crate::walproposer::Config {
|
||||
ttid,
|
||||
safekeepers_list: vec!["localhost:5000".to_string()],
|
||||
safekeeper_reconnect_timeout: 1000,
|
||||
safekeeper_connection_timeout: 10000,
|
||||
sync_safekeepers: true,
|
||||
};
|
||||
|
||||
let wp = Wrapper::new(my_impl, config);
|
||||
|
||||
// walproposer will panic when it finishes sync_safekeepers
|
||||
std::panic::catch_unwind(|| wp.start()).unwrap_err();
|
||||
// validate the resulting LSN
|
||||
assert_eq!(receiver.recv()?, 1337);
|
||||
Ok(())
|
||||
// drop() will free up resources here
|
||||
}
|
||||
}
|
||||
@@ -11,7 +11,10 @@ use std::sync::{Arc, Barrier};
|
||||
|
||||
use bytes::{Buf, Bytes};
|
||||
use pageserver::{
|
||||
config::PageServerConf, repository::Key, walrecord::NeonWalRecord, walredo::PostgresRedoManager,
|
||||
config::PageServerConf,
|
||||
repository::Key,
|
||||
walrecord::NeonWalRecord,
|
||||
walredo::{PostgresRedoManager, WalRedoError},
|
||||
};
|
||||
use utils::{id::TenantId, lsn::Lsn};
|
||||
|
||||
@@ -32,15 +35,9 @@ fn redo_scenarios(c: &mut Criterion) {
|
||||
|
||||
let manager = Arc::new(manager);
|
||||
|
||||
{
|
||||
let rt = tokio::runtime::Builder::new_current_thread()
|
||||
.enable_all()
|
||||
.build()
|
||||
.unwrap();
|
||||
tracing::info!("executing first");
|
||||
short().execute(rt.handle(), &manager).unwrap();
|
||||
tracing::info!("first executed");
|
||||
}
|
||||
tracing::info!("executing first");
|
||||
short().execute(&manager).unwrap();
|
||||
tracing::info!("first executed");
|
||||
|
||||
let thread_counts = [1, 2, 4, 8, 16];
|
||||
|
||||
@@ -83,14 +80,9 @@ fn add_multithreaded_walredo_requesters(
|
||||
assert_ne!(threads, 0);
|
||||
|
||||
if threads == 1 {
|
||||
let rt = tokio::runtime::Builder::new_current_thread()
|
||||
.enable_all()
|
||||
.build()
|
||||
.unwrap();
|
||||
let handle = rt.handle();
|
||||
b.iter_batched_ref(
|
||||
|| Some(input_factory()),
|
||||
|input| execute_all(input.take(), handle, manager),
|
||||
|input| execute_all(input.take(), manager),
|
||||
criterion::BatchSize::PerIteration,
|
||||
);
|
||||
} else {
|
||||
@@ -106,26 +98,19 @@ fn add_multithreaded_walredo_requesters(
|
||||
let manager = manager.clone();
|
||||
let barrier = barrier.clone();
|
||||
let work_rx = work_rx.clone();
|
||||
move || {
|
||||
let rt = tokio::runtime::Builder::new_current_thread()
|
||||
.enable_all()
|
||||
.build()
|
||||
.unwrap();
|
||||
let handle = rt.handle();
|
||||
loop {
|
||||
// queue up and wait if we want to go another round
|
||||
if work_rx.lock().unwrap().recv().is_err() {
|
||||
break;
|
||||
}
|
||||
|
||||
let input = Some(input_factory());
|
||||
|
||||
barrier.wait();
|
||||
|
||||
execute_all(input, handle, &manager).unwrap();
|
||||
|
||||
barrier.wait();
|
||||
move || loop {
|
||||
// queue up and wait if we want to go another round
|
||||
if work_rx.lock().unwrap().recv().is_err() {
|
||||
break;
|
||||
}
|
||||
|
||||
let input = Some(input_factory());
|
||||
|
||||
barrier.wait();
|
||||
|
||||
execute_all(input, &manager).unwrap();
|
||||
|
||||
barrier.wait();
|
||||
}
|
||||
})
|
||||
})
|
||||
@@ -167,19 +152,15 @@ impl Drop for JoinOnDrop {
|
||||
}
|
||||
}
|
||||
|
||||
fn execute_all<I>(
|
||||
input: I,
|
||||
handle: &tokio::runtime::Handle,
|
||||
manager: &PostgresRedoManager,
|
||||
) -> anyhow::Result<()>
|
||||
fn execute_all<I>(input: I, manager: &PostgresRedoManager) -> Result<(), WalRedoError>
|
||||
where
|
||||
I: IntoIterator<Item = Request>,
|
||||
{
|
||||
// just fire all requests as fast as possible
|
||||
input.into_iter().try_for_each(|req| {
|
||||
let page = req.execute(handle, manager)?;
|
||||
let page = req.execute(manager)?;
|
||||
assert_eq!(page.remaining(), 8192);
|
||||
anyhow::Ok(())
|
||||
Ok::<_, WalRedoError>(())
|
||||
})
|
||||
}
|
||||
|
||||
@@ -492,11 +473,9 @@ struct Request {
|
||||
}
|
||||
|
||||
impl Request {
|
||||
fn execute(
|
||||
self,
|
||||
rt: &tokio::runtime::Handle,
|
||||
manager: &PostgresRedoManager,
|
||||
) -> anyhow::Result<Bytes> {
|
||||
fn execute(self, manager: &PostgresRedoManager) -> Result<Bytes, WalRedoError> {
|
||||
use pageserver::walredo::WalRedoManager;
|
||||
|
||||
let Request {
|
||||
key,
|
||||
lsn,
|
||||
@@ -505,6 +484,6 @@ impl Request {
|
||||
pg_version,
|
||||
} = self;
|
||||
|
||||
rt.block_on(manager.request_redo(key, lsn, base_img, records, pg_version))
|
||||
manager.request_redo(key, lsn, base_img, records, pg_version)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -13,7 +13,6 @@
|
||||
use anyhow::{anyhow, bail, ensure, Context};
|
||||
use bytes::{BufMut, BytesMut};
|
||||
use fail::fail_point;
|
||||
use postgres_ffi::pg_constants;
|
||||
use std::fmt::Write as FmtWrite;
|
||||
use std::time::SystemTime;
|
||||
use tokio::io;
|
||||
@@ -181,7 +180,6 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
let mut min_restart_lsn: Lsn = Lsn::MAX;
|
||||
// Create tablespace directories
|
||||
for ((spcnode, dbnode), has_relmap_file) in
|
||||
self.timeline.list_dbdirs(self.lsn, self.ctx).await?
|
||||
@@ -215,34 +213,6 @@ where
|
||||
self.add_rel(rel, rel).await?;
|
||||
}
|
||||
}
|
||||
|
||||
for (path, content) in self.timeline.list_aux_files(self.lsn, self.ctx).await? {
|
||||
if path.starts_with("pg_replslot") {
|
||||
let offs = pg_constants::REPL_SLOT_ON_DISK_OFFSETOF_RESTART_LSN;
|
||||
let restart_lsn = Lsn(u64::from_le_bytes(
|
||||
content[offs..offs + 8].try_into().unwrap(),
|
||||
));
|
||||
info!("Replication slot {} restart LSN={}", path, restart_lsn);
|
||||
min_restart_lsn = Lsn::min(min_restart_lsn, restart_lsn);
|
||||
}
|
||||
let header = new_tar_header(&path, content.len() as u64)?;
|
||||
self.ar
|
||||
.append(&header, &*content)
|
||||
.await
|
||||
.context("could not add aux file to basebackup tarball")?;
|
||||
}
|
||||
}
|
||||
if min_restart_lsn != Lsn::MAX {
|
||||
info!(
|
||||
"Min restart LSN for logical replication is {}",
|
||||
min_restart_lsn
|
||||
);
|
||||
let data = min_restart_lsn.0.to_le_bytes();
|
||||
let header = new_tar_header("restart.lsn", data.len() as u64)?;
|
||||
self.ar
|
||||
.append(&header, &data[..])
|
||||
.await
|
||||
.context("could not add restart.lsn file to basebackup tarball")?;
|
||||
}
|
||||
for xid in self
|
||||
.timeline
|
||||
|
||||
@@ -2,7 +2,6 @@
|
||||
|
||||
use std::env::{var, VarError};
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
use std::{env, ops::ControlFlow, str::FromStr};
|
||||
|
||||
use anyhow::{anyhow, Context};
|
||||
@@ -34,12 +33,11 @@ use postgres_backend::AuthType;
|
||||
use utils::logging::TracingErrorLayerEnablement;
|
||||
use utils::signals::ShutdownSignals;
|
||||
use utils::{
|
||||
auth::JwtAuth, logging, project_build_tag, project_git_version, sentry_init::init_sentry,
|
||||
signals::Signal, tcp_listener,
|
||||
auth::JwtAuth, logging, project_git_version, sentry_init::init_sentry, signals::Signal,
|
||||
tcp_listener,
|
||||
};
|
||||
|
||||
project_git_version!(GIT_VERSION);
|
||||
project_build_tag!(BUILD_TAG);
|
||||
|
||||
const PID_FILE_NAME: &str = "pageserver.pid";
|
||||
|
||||
@@ -202,51 +200,6 @@ fn initialize_config(
|
||||
})
|
||||
}
|
||||
|
||||
struct WaitForPhaseResult<F: std::future::Future + Unpin> {
|
||||
timeout_remaining: Duration,
|
||||
skipped: Option<F>,
|
||||
}
|
||||
|
||||
/// During startup, we apply a timeout to our waits for readiness, to avoid
|
||||
/// stalling the whole service if one Tenant experiences some problem. Each
|
||||
/// phase may consume some of the timeout: this function returns the updated
|
||||
/// timeout for use in the next call.
|
||||
async fn wait_for_phase<F>(phase: &str, mut fut: F, timeout: Duration) -> WaitForPhaseResult<F>
|
||||
where
|
||||
F: std::future::Future + Unpin,
|
||||
{
|
||||
let initial_t = Instant::now();
|
||||
let skipped = match tokio::time::timeout(timeout, &mut fut).await {
|
||||
Ok(_) => None,
|
||||
Err(_) => {
|
||||
tracing::info!(
|
||||
timeout_millis = timeout.as_millis(),
|
||||
%phase,
|
||||
"Startup phase timed out, proceeding anyway"
|
||||
);
|
||||
Some(fut)
|
||||
}
|
||||
};
|
||||
|
||||
WaitForPhaseResult {
|
||||
timeout_remaining: timeout
|
||||
.checked_sub(Instant::now().duration_since(initial_t))
|
||||
.unwrap_or(Duration::ZERO),
|
||||
skipped,
|
||||
}
|
||||
}
|
||||
|
||||
fn startup_checkpoint(started_at: Instant, phase: &str, human_phase: &str) {
|
||||
let elapsed = started_at.elapsed();
|
||||
let secs = elapsed.as_secs_f64();
|
||||
STARTUP_DURATION.with_label_values(&[phase]).set(secs);
|
||||
|
||||
info!(
|
||||
elapsed_ms = elapsed.as_millis(),
|
||||
"{human_phase} ({secs:.3}s since start)"
|
||||
)
|
||||
}
|
||||
|
||||
fn start_pageserver(
|
||||
launch_ts: &'static LaunchTimestamp,
|
||||
conf: &'static PageServerConf,
|
||||
@@ -254,17 +207,26 @@ fn start_pageserver(
|
||||
// Monotonic time for later calculating startup duration
|
||||
let started_startup_at = Instant::now();
|
||||
|
||||
let startup_checkpoint = move |phase: &str, human_phase: &str| {
|
||||
let elapsed = started_startup_at.elapsed();
|
||||
let secs = elapsed.as_secs_f64();
|
||||
STARTUP_DURATION.with_label_values(&[phase]).set(secs);
|
||||
info!(
|
||||
elapsed_ms = elapsed.as_millis(),
|
||||
"{human_phase} ({secs:.3}s since start)"
|
||||
)
|
||||
};
|
||||
|
||||
// Print version and launch timestamp to the log,
|
||||
// and expose them as prometheus metrics.
|
||||
// A changed version string indicates changed software.
|
||||
// A changed launch timestamp indicates a pageserver restart.
|
||||
info!(
|
||||
"version: {} launch_timestamp: {} build_tag: {}",
|
||||
"version: {} launch_timestamp: {}",
|
||||
version(),
|
||||
launch_ts.to_string(),
|
||||
BUILD_TAG,
|
||||
launch_ts.to_string()
|
||||
);
|
||||
set_build_info_metric(GIT_VERSION, BUILD_TAG);
|
||||
set_build_info_metric(GIT_VERSION);
|
||||
set_launch_timestamp_metric(launch_ts);
|
||||
pageserver::preinitialize_metrics();
|
||||
|
||||
@@ -379,7 +341,7 @@ fn start_pageserver(
|
||||
|
||||
// Up to this point no significant I/O has been done: this should have been fast. Record
|
||||
// duration prior to starting I/O intensive phase of startup.
|
||||
startup_checkpoint(started_startup_at, "initial", "Starting loading tenants");
|
||||
startup_checkpoint("initial", "Starting loading tenants");
|
||||
STARTUP_IS_LOADING.set(1);
|
||||
|
||||
// Startup staging or optimizing:
|
||||
@@ -393,7 +355,6 @@ fn start_pageserver(
|
||||
// consumer side) will be dropped once we can start the background jobs. Currently it is behind
|
||||
// completing all initial logical size calculations (init_logical_size_done_rx) and a timeout
|
||||
// (background_task_maximum_delay).
|
||||
let (init_remote_done_tx, init_remote_done_rx) = utils::completion::channel();
|
||||
let (init_done_tx, init_done_rx) = utils::completion::channel();
|
||||
|
||||
let (init_logical_size_done_tx, init_logical_size_done_rx) = utils::completion::channel();
|
||||
@@ -401,8 +362,7 @@ fn start_pageserver(
|
||||
let (background_jobs_can_start, background_jobs_barrier) = utils::completion::channel();
|
||||
|
||||
let order = pageserver::InitializationOrder {
|
||||
initial_tenant_load_remote: Some(init_done_tx),
|
||||
initial_tenant_load: Some(init_remote_done_tx),
|
||||
initial_tenant_load: Some(init_done_tx),
|
||||
initial_logical_size_can_start: init_done_rx.clone(),
|
||||
initial_logical_size_attempt: Some(init_logical_size_done_tx),
|
||||
background_jobs_can_start: background_jobs_barrier.clone(),
|
||||
@@ -426,93 +386,55 @@ fn start_pageserver(
|
||||
let shutdown_pageserver = shutdown_pageserver.clone();
|
||||
let drive_init = async move {
|
||||
// NOTE: unlike many futures in pageserver, this one is cancellation-safe
|
||||
let guard = scopeguard::guard_on_success((), |_| {
|
||||
tracing::info!("Cancelled before initial load completed")
|
||||
});
|
||||
let guard = scopeguard::guard_on_success((), |_| tracing::info!("Cancelled before initial load completed"));
|
||||
|
||||
let timeout = conf.background_task_maximum_delay;
|
||||
|
||||
let init_remote_done = std::pin::pin!(async {
|
||||
init_remote_done_rx.wait().await;
|
||||
startup_checkpoint(
|
||||
started_startup_at,
|
||||
"initial_tenant_load_remote",
|
||||
"Remote part of initial load completed",
|
||||
);
|
||||
});
|
||||
|
||||
let WaitForPhaseResult {
|
||||
timeout_remaining: timeout,
|
||||
skipped: init_remote_skipped,
|
||||
} = wait_for_phase("initial_tenant_load_remote", init_remote_done, timeout).await;
|
||||
|
||||
let init_load_done = std::pin::pin!(async {
|
||||
init_done_rx.wait().await;
|
||||
startup_checkpoint(
|
||||
started_startup_at,
|
||||
"initial_tenant_load",
|
||||
"Initial load completed",
|
||||
);
|
||||
STARTUP_IS_LOADING.set(0);
|
||||
});
|
||||
|
||||
let WaitForPhaseResult {
|
||||
timeout_remaining: timeout,
|
||||
skipped: init_load_skipped,
|
||||
} = wait_for_phase("initial_tenant_load", init_load_done, timeout).await;
|
||||
init_done_rx.wait().await;
|
||||
startup_checkpoint("initial_tenant_load", "Initial load completed");
|
||||
STARTUP_IS_LOADING.set(0);
|
||||
|
||||
// initial logical sizes can now start, as they were waiting on init_done_rx.
|
||||
|
||||
scopeguard::ScopeGuard::into_inner(guard);
|
||||
|
||||
let guard = scopeguard::guard_on_success((), |_| {
|
||||
tracing::info!("Cancelled before initial logical sizes completed")
|
||||
});
|
||||
let mut init_sizes_done = std::pin::pin!(init_logical_size_done_rx.wait());
|
||||
|
||||
let logical_sizes_done = std::pin::pin!(async {
|
||||
init_logical_size_done_rx.wait().await;
|
||||
startup_checkpoint(
|
||||
started_startup_at,
|
||||
"initial_logical_sizes",
|
||||
"Initial logical sizes completed",
|
||||
);
|
||||
});
|
||||
let timeout = conf.background_task_maximum_delay;
|
||||
|
||||
let WaitForPhaseResult {
|
||||
timeout_remaining: _,
|
||||
skipped: logical_sizes_skipped,
|
||||
} = wait_for_phase("initial_logical_sizes", logical_sizes_done, timeout).await;
|
||||
let guard = scopeguard::guard_on_success((), |_| tracing::info!("Cancelled before initial logical sizes completed"));
|
||||
|
||||
let init_sizes_done = match tokio::time::timeout(timeout, &mut init_sizes_done).await {
|
||||
Ok(_) => {
|
||||
startup_checkpoint("initial_logical_sizes", "Initial logical sizes completed");
|
||||
None
|
||||
}
|
||||
Err(_) => {
|
||||
tracing::info!(
|
||||
timeout_millis = timeout.as_millis(),
|
||||
"Initial logical size timeout elapsed; starting background jobs"
|
||||
);
|
||||
Some(init_sizes_done)
|
||||
}
|
||||
};
|
||||
|
||||
scopeguard::ScopeGuard::into_inner(guard);
|
||||
|
||||
// allow background jobs to start: we either completed prior stages, or they reached timeout
|
||||
// and were skipped. It is important that we do not let them block background jobs indefinitely,
|
||||
// because things like consumption metrics for billing are blocked by this barrier.
|
||||
// allow background jobs to start
|
||||
drop(background_jobs_can_start);
|
||||
startup_checkpoint(
|
||||
started_startup_at,
|
||||
"background_jobs_can_start",
|
||||
"Starting background jobs",
|
||||
);
|
||||
startup_checkpoint("background_jobs_can_start", "Starting background jobs");
|
||||
|
||||
// We are done. If we skipped any phases due to timeout, run them to completion here so that
|
||||
// they will eventually update their startup_checkpoint, and so that we do not declare the
|
||||
// 'complete' stage until all the other stages are really done.
|
||||
let guard = scopeguard::guard_on_success((), |_| {
|
||||
tracing::info!("Cancelled before waiting for skipped phases done")
|
||||
});
|
||||
if let Some(f) = init_remote_skipped {
|
||||
f.await;
|
||||
}
|
||||
if let Some(f) = init_load_skipped {
|
||||
f.await;
|
||||
}
|
||||
if let Some(f) = logical_sizes_skipped {
|
||||
f.await;
|
||||
}
|
||||
scopeguard::ScopeGuard::into_inner(guard);
|
||||
if let Some(init_sizes_done) = init_sizes_done {
|
||||
// ending up here is not a bug; at the latest logical sizes will be queried by
|
||||
// consumption metrics.
|
||||
let guard = scopeguard::guard_on_success((), |_| tracing::info!("Cancelled before initial logical sizes completed"));
|
||||
init_sizes_done.await;
|
||||
|
||||
startup_checkpoint(started_startup_at, "complete", "Startup complete");
|
||||
scopeguard::ScopeGuard::into_inner(guard);
|
||||
|
||||
startup_checkpoint("initial_logical_sizes", "Initial logical sizes completed after timeout (background jobs already started)");
|
||||
|
||||
}
|
||||
|
||||
startup_checkpoint("complete", "Startup complete");
|
||||
};
|
||||
|
||||
async move {
|
||||
@@ -652,7 +574,6 @@ fn start_pageserver(
|
||||
pageserver_listener,
|
||||
conf.pg_auth_type,
|
||||
libpq_ctx,
|
||||
task_mgr::shutdown_token(),
|
||||
)
|
||||
.await
|
||||
},
|
||||
|
||||
@@ -33,7 +33,8 @@ use crate::disk_usage_eviction_task::DiskUsageEvictionTaskConfig;
|
||||
use crate::tenant::config::TenantConf;
|
||||
use crate::tenant::config::TenantConfOpt;
|
||||
use crate::tenant::{
|
||||
TENANTS_SEGMENT_NAME, TENANT_DELETED_MARKER_FILE_NAME, TIMELINES_SEGMENT_NAME,
|
||||
TENANTS_SEGMENT_NAME, TENANT_ATTACHING_MARKER_FILENAME, TENANT_DELETED_MARKER_FILE_NAME,
|
||||
TIMELINES_SEGMENT_NAME,
|
||||
};
|
||||
use crate::{
|
||||
IGNORED_TENANT_FILE_NAME, METADATA_FILE_NAME, TENANT_CONFIG_NAME, TENANT_LOCATION_CONFIG_NAME,
|
||||
@@ -632,6 +633,11 @@ impl PageServerConf {
|
||||
self.tenants_path().join(tenant_id.to_string())
|
||||
}
|
||||
|
||||
pub fn tenant_attaching_mark_file_path(&self, tenant_id: &TenantId) -> Utf8PathBuf {
|
||||
self.tenant_path(tenant_id)
|
||||
.join(TENANT_ATTACHING_MARKER_FILENAME)
|
||||
}
|
||||
|
||||
pub fn tenant_ignore_mark_file_path(&self, tenant_id: &TenantId) -> Utf8PathBuf {
|
||||
self.tenant_path(tenant_id).join(IGNORED_TENANT_FILE_NAME)
|
||||
}
|
||||
|
||||
@@ -2,7 +2,6 @@
|
||||
//! and push them to a HTTP endpoint.
|
||||
use crate::context::{DownloadBehavior, RequestContext};
|
||||
use crate::task_mgr::{self, TaskKind, BACKGROUND_RUNTIME};
|
||||
use crate::tenant::tasks::BackgroundLoopKind;
|
||||
use crate::tenant::{mgr, LogicalSizeCalculationCause};
|
||||
use camino::Utf8PathBuf;
|
||||
use consumption_metrics::EventType;
|
||||
@@ -11,7 +10,6 @@ use reqwest::Url;
|
||||
use std::collections::HashMap;
|
||||
use std::sync::Arc;
|
||||
use std::time::{Duration, SystemTime};
|
||||
use tokio::time::Instant;
|
||||
use tracing::*;
|
||||
use utils::id::NodeId;
|
||||
|
||||
@@ -89,12 +87,22 @@ pub async fn collect_metrics(
|
||||
|
||||
let node_id = node_id.to_string();
|
||||
|
||||
// reminder: ticker is ready immediatedly
|
||||
let mut ticker = tokio::time::interval(metric_collection_interval);
|
||||
|
||||
loop {
|
||||
let started_at = Instant::now();
|
||||
let tick_at = tokio::select! {
|
||||
_ = cancel.cancelled() => return Ok(()),
|
||||
tick_at = ticker.tick() => tick_at,
|
||||
};
|
||||
|
||||
// these are point in time, with variable "now"
|
||||
let metrics = metrics::collect_all_metrics(&cached_metrics, &ctx).await;
|
||||
|
||||
if metrics.is_empty() {
|
||||
continue;
|
||||
}
|
||||
|
||||
let metrics = Arc::new(metrics);
|
||||
|
||||
// why not race cancellation here? because we are one of the last tasks, and if we are
|
||||
@@ -133,19 +141,10 @@ pub async fn collect_metrics(
|
||||
let (_, _) = tokio::join!(flush, upload);
|
||||
|
||||
crate::tenant::tasks::warn_when_period_overrun(
|
||||
started_at.elapsed(),
|
||||
tick_at.elapsed(),
|
||||
metric_collection_interval,
|
||||
BackgroundLoopKind::ConsumptionMetricsCollectMetrics,
|
||||
"consumption_metrics_collect_metrics",
|
||||
);
|
||||
|
||||
let res = tokio::time::timeout_at(
|
||||
started_at + metric_collection_interval,
|
||||
task_mgr::shutdown_token().cancelled(),
|
||||
)
|
||||
.await;
|
||||
if res.is_ok() {
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -244,14 +243,16 @@ async fn calculate_synthetic_size_worker(
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<()> {
|
||||
info!("starting calculate_synthetic_size_worker");
|
||||
scopeguard::defer! {
|
||||
info!("calculate_synthetic_size_worker stopped");
|
||||
};
|
||||
|
||||
// reminder: ticker is ready immediatedly
|
||||
let mut ticker = tokio::time::interval(synthetic_size_calculation_interval);
|
||||
let cause = LogicalSizeCalculationCause::ConsumptionMetricsSyntheticSize;
|
||||
|
||||
loop {
|
||||
let started_at = Instant::now();
|
||||
let tick_at = tokio::select! {
|
||||
_ = task_mgr::shutdown_watcher() => return Ok(()),
|
||||
tick_at = ticker.tick() => tick_at,
|
||||
};
|
||||
|
||||
let tenants = match mgr::list_tenants().await {
|
||||
Ok(tenants) => tenants,
|
||||
@@ -267,11 +268,6 @@ async fn calculate_synthetic_size_worker(
|
||||
}
|
||||
|
||||
if let Ok(tenant) = mgr::get_tenant(tenant_id, true).await {
|
||||
// TODO should we use concurrent_background_tasks_rate_limit() here, like the other background tasks?
|
||||
// We can put in some prioritization for consumption metrics.
|
||||
// Same for the loop that fetches computed metrics.
|
||||
// By using the same limiter, we centralize metrics collection for "start" and "finished" counters,
|
||||
// which turns out is really handy to understand the system.
|
||||
if let Err(e) = tenant.calculate_synthetic_size(cause, ctx).await {
|
||||
error!("failed to calculate synthetic size for tenant {tenant_id}: {e:#}");
|
||||
}
|
||||
@@ -279,18 +275,9 @@ async fn calculate_synthetic_size_worker(
|
||||
}
|
||||
|
||||
crate::tenant::tasks::warn_when_period_overrun(
|
||||
started_at.elapsed(),
|
||||
tick_at.elapsed(),
|
||||
synthetic_size_calculation_interval,
|
||||
BackgroundLoopKind::ConsumptionMetricsSyntheticSizeWorker,
|
||||
"consumption_metrics_synthetic_size_worker",
|
||||
);
|
||||
|
||||
let res = tokio::time::timeout_at(
|
||||
started_at + synthetic_size_calculation_interval,
|
||||
task_mgr::shutdown_token().cancelled(),
|
||||
)
|
||||
.await;
|
||||
if res.is_ok() {
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -57,10 +57,7 @@ impl ControlPlaneClient {
|
||||
|
||||
if let Some(jwt) = &conf.control_plane_api_token {
|
||||
let mut headers = hyper::HeaderMap::new();
|
||||
headers.insert(
|
||||
"Authorization",
|
||||
format!("Bearer {}", jwt.get_contents()).parse().unwrap(),
|
||||
);
|
||||
headers.insert("Authorization", jwt.get_contents().parse().unwrap());
|
||||
client = client.default_headers(headers);
|
||||
}
|
||||
|
||||
@@ -147,7 +144,7 @@ impl ControlPlaneGenerationsApi for ControlPlaneClient {
|
||||
Ok(response
|
||||
.tenants
|
||||
.into_iter()
|
||||
.map(|t| (t.id, Generation::new(t.gen)))
|
||||
.map(|t| (t.id, Generation::new(t.generation)))
|
||||
.collect::<HashMap<_, _>>())
|
||||
}
|
||||
|
||||
|
||||
@@ -10,7 +10,6 @@ use crate::control_plane_client::ControlPlaneGenerationsApi;
|
||||
use crate::metrics;
|
||||
use crate::tenant::remote_timeline_client::remote_layer_path;
|
||||
use crate::tenant::remote_timeline_client::remote_timeline_path;
|
||||
use crate::virtual_file::MaybeFatalIo;
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use anyhow::Context;
|
||||
use camino::Utf8PathBuf;
|
||||
@@ -154,7 +153,7 @@ impl FlushOp {
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct DeletionQueueClient {
|
||||
tx: tokio::sync::mpsc::UnboundedSender<ListWriterQueueMessage>,
|
||||
tx: tokio::sync::mpsc::Sender<ListWriterQueueMessage>,
|
||||
executor_tx: tokio::sync::mpsc::Sender<DeleterMessage>,
|
||||
|
||||
lsn_table: Arc<std::sync::RwLock<VisibleLsnUpdates>>,
|
||||
@@ -213,7 +212,7 @@ where
|
||||
|
||||
/// Files ending with this suffix will be ignored and erased
|
||||
/// during recovery as startup.
|
||||
const TEMP_SUFFIX: &str = "tmp";
|
||||
const TEMP_SUFFIX: &str = ".tmp";
|
||||
|
||||
#[serde_as]
|
||||
#[derive(Debug, Serialize, Deserialize)]
|
||||
@@ -272,9 +271,7 @@ impl DeletionHeader {
|
||||
let temp_path = path_with_suffix_extension(&header_path, TEMP_SUFFIX);
|
||||
VirtualFile::crashsafe_overwrite(&header_path, &temp_path, &header_bytes)
|
||||
.await
|
||||
.maybe_fatal_err("save deletion header")?;
|
||||
|
||||
Ok(())
|
||||
.map_err(Into::into)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -363,7 +360,6 @@ impl DeletionList {
|
||||
let bytes = serde_json::to_vec(self).expect("Failed to serialize deletion list");
|
||||
VirtualFile::crashsafe_overwrite(&path, &temp_path, &bytes)
|
||||
.await
|
||||
.maybe_fatal_err("save deletion list")
|
||||
.map_err(Into::into)
|
||||
}
|
||||
}
|
||||
@@ -420,7 +416,7 @@ pub enum DeletionQueueError {
|
||||
impl DeletionQueueClient {
|
||||
pub(crate) fn broken() -> Self {
|
||||
// Channels whose receivers are immediately dropped.
|
||||
let (tx, _rx) = tokio::sync::mpsc::unbounded_channel();
|
||||
let (tx, _rx) = tokio::sync::mpsc::channel(1);
|
||||
let (executor_tx, _executor_rx) = tokio::sync::mpsc::channel(1);
|
||||
Self {
|
||||
tx,
|
||||
@@ -432,12 +428,12 @@ impl DeletionQueueClient {
|
||||
/// This is cancel-safe. If you drop the future before it completes, the message
|
||||
/// is not pushed, although in the context of the deletion queue it doesn't matter: once
|
||||
/// we decide to do a deletion the decision is always final.
|
||||
fn do_push<T>(
|
||||
async fn do_push<T>(
|
||||
&self,
|
||||
queue: &tokio::sync::mpsc::UnboundedSender<T>,
|
||||
queue: &tokio::sync::mpsc::Sender<T>,
|
||||
msg: T,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
match queue.send(msg) {
|
||||
match queue.send(msg).await {
|
||||
Ok(_) => Ok(()),
|
||||
Err(e) => {
|
||||
// This shouldn't happen, we should shut down all tenants before
|
||||
@@ -449,7 +445,7 @@ impl DeletionQueueClient {
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn recover(
|
||||
pub(crate) async fn recover(
|
||||
&self,
|
||||
attached_tenants: HashMap<TenantId, Generation>,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
@@ -457,6 +453,7 @@ impl DeletionQueueClient {
|
||||
&self.tx,
|
||||
ListWriterQueueMessage::Recover(RecoverOp { attached_tenants }),
|
||||
)
|
||||
.await
|
||||
}
|
||||
|
||||
/// When a Timeline wishes to update the remote_consistent_lsn that it exposes to the outside
|
||||
@@ -529,21 +526,6 @@ impl DeletionQueueClient {
|
||||
return self.flush_immediate().await;
|
||||
}
|
||||
|
||||
self.push_layers_sync(tenant_id, timeline_id, current_generation, layers)
|
||||
}
|
||||
|
||||
/// When a Tenant has a generation, push_layers is always synchronous because
|
||||
/// the ListValidator channel is an unbounded channel.
|
||||
///
|
||||
/// This can be merged into push_layers when we remove the Generation-less mode
|
||||
/// support (`<https://github.com/neondatabase/neon/issues/5395>`)
|
||||
pub(crate) fn push_layers_sync(
|
||||
&self,
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
current_generation: Generation,
|
||||
layers: Vec<(LayerFileName, Generation)>,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
metrics::DELETION_QUEUE
|
||||
.keys_submitted
|
||||
.inc_by(layers.len() as u64);
|
||||
@@ -557,16 +539,17 @@ impl DeletionQueueClient {
|
||||
objects: Vec::new(),
|
||||
}),
|
||||
)
|
||||
.await
|
||||
}
|
||||
|
||||
/// This is cancel-safe. If you drop the future the flush may still happen in the background.
|
||||
async fn do_flush<T>(
|
||||
&self,
|
||||
queue: &tokio::sync::mpsc::UnboundedSender<T>,
|
||||
queue: &tokio::sync::mpsc::Sender<T>,
|
||||
msg: T,
|
||||
rx: tokio::sync::oneshot::Receiver<()>,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
self.do_push(queue, msg)?;
|
||||
self.do_push(queue, msg).await?;
|
||||
if rx.await.is_err() {
|
||||
// This shouldn't happen if tenants are shut down before deletion queue. If we
|
||||
// encounter a bug like this, then a flusher will incorrectly believe it has flushed
|
||||
@@ -587,18 +570,6 @@ impl DeletionQueueClient {
|
||||
.await
|
||||
}
|
||||
|
||||
/// Issue a flush without waiting for it to complete. This is useful on advisory flushes where
|
||||
/// the caller wants to avoid the risk of waiting for lots of enqueued work, such as on tenant
|
||||
/// detach where flushing is nice but not necessary.
|
||||
///
|
||||
/// This function provides no guarantees of work being done.
|
||||
pub fn flush_advisory(&self) {
|
||||
let (flush_op, _) = FlushOp::new();
|
||||
|
||||
// Transmit the flush message, ignoring any result (such as a closed channel during shutdown).
|
||||
drop(self.tx.send(ListWriterQueueMessage::FlushExecute(flush_op)));
|
||||
}
|
||||
|
||||
// Wait until all previous deletions are executed
|
||||
pub(crate) async fn flush_execute(&self) -> Result<(), DeletionQueueError> {
|
||||
debug!("flush_execute: flushing to deletion lists...");
|
||||
@@ -615,7 +586,9 @@ impl DeletionQueueClient {
|
||||
// Flush any immediate-mode deletions (the above backend flush will only flush
|
||||
// the executor if deletions had flowed through the backend)
|
||||
debug!("flush_execute: flushing execution...");
|
||||
self.flush_immediate().await?;
|
||||
let (flush_op, rx) = FlushOp::new();
|
||||
self.do_flush(&self.executor_tx, DeleterMessage::Flush(flush_op), rx)
|
||||
.await?;
|
||||
debug!("flush_execute: finished flushing execution...");
|
||||
Ok(())
|
||||
}
|
||||
@@ -670,10 +643,8 @@ impl DeletionQueue {
|
||||
where
|
||||
C: ControlPlaneGenerationsApi + Send + Sync,
|
||||
{
|
||||
// Unbounded channel: enables non-async functions to submit deletions. The actual length is
|
||||
// constrained by how promptly the ListWriter wakes up and drains it, which should be frequent
|
||||
// enough to avoid this taking pathologically large amount of memory.
|
||||
let (tx, rx) = tokio::sync::mpsc::unbounded_channel();
|
||||
// Deep channel: it consumes deletions from all timelines and we do not want to block them
|
||||
let (tx, rx) = tokio::sync::mpsc::channel(16384);
|
||||
|
||||
// Shallow channel: it carries DeletionLists which each contain up to thousands of deletions
|
||||
let (backend_tx, backend_rx) = tokio::sync::mpsc::channel(16);
|
||||
@@ -986,7 +957,7 @@ mod test {
|
||||
// Basic test that the deletion queue processes the deletions we pass into it
|
||||
let ctx = setup("deletion_queue_smoke").expect("Failed test setup");
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
client.recover(HashMap::new())?;
|
||||
client.recover(HashMap::new()).await?;
|
||||
|
||||
let layer_file_name_1: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap();
|
||||
let tenant_id = ctx.harness.tenant_id;
|
||||
@@ -1054,7 +1025,7 @@ mod test {
|
||||
async fn deletion_queue_validation() -> anyhow::Result<()> {
|
||||
let ctx = setup("deletion_queue_validation").expect("Failed test setup");
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
client.recover(HashMap::new())?;
|
||||
client.recover(HashMap::new()).await?;
|
||||
|
||||
// Generation that the control plane thinks is current
|
||||
let latest_generation = Generation::new(0xdeadbeef);
|
||||
@@ -1111,7 +1082,7 @@ mod test {
|
||||
// Basic test that the deletion queue processes the deletions we pass into it
|
||||
let mut ctx = setup("deletion_queue_recovery").expect("Failed test setup");
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
client.recover(HashMap::new())?;
|
||||
client.recover(HashMap::new()).await?;
|
||||
|
||||
let tenant_id = ctx.harness.tenant_id;
|
||||
|
||||
@@ -1174,7 +1145,9 @@ mod test {
|
||||
drop(client);
|
||||
ctx.restart().await;
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
client.recover(HashMap::from([(tenant_id, now_generation)]))?;
|
||||
client
|
||||
.recover(HashMap::from([(tenant_id, now_generation)]))
|
||||
.await?;
|
||||
|
||||
info!("Flush-executing");
|
||||
client.flush_execute().await?;
|
||||
@@ -1200,7 +1173,7 @@ pub(crate) mod mock {
|
||||
};
|
||||
|
||||
pub struct ConsumerState {
|
||||
rx: tokio::sync::mpsc::UnboundedReceiver<ListWriterQueueMessage>,
|
||||
rx: tokio::sync::mpsc::Receiver<ListWriterQueueMessage>,
|
||||
executor_rx: tokio::sync::mpsc::Receiver<DeleterMessage>,
|
||||
}
|
||||
|
||||
@@ -1277,7 +1250,7 @@ pub(crate) mod mock {
|
||||
}
|
||||
|
||||
pub struct MockDeletionQueue {
|
||||
tx: tokio::sync::mpsc::UnboundedSender<ListWriterQueueMessage>,
|
||||
tx: tokio::sync::mpsc::Sender<ListWriterQueueMessage>,
|
||||
executor_tx: tokio::sync::mpsc::Sender<DeleterMessage>,
|
||||
executed: Arc<AtomicUsize>,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
@@ -1287,7 +1260,7 @@ pub(crate) mod mock {
|
||||
|
||||
impl MockDeletionQueue {
|
||||
pub fn new(remote_storage: Option<GenericRemoteStorage>) -> Self {
|
||||
let (tx, rx) = tokio::sync::mpsc::unbounded_channel();
|
||||
let (tx, rx) = tokio::sync::mpsc::channel(16384);
|
||||
let (executor_tx, executor_rx) = tokio::sync::mpsc::channel(16384);
|
||||
|
||||
let executed = Arc::new(AtomicUsize::new(0));
|
||||
@@ -1302,6 +1275,10 @@ pub(crate) mod mock {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get_executed(&self) -> usize {
|
||||
self.executed.load(Ordering::Relaxed)
|
||||
}
|
||||
|
||||
#[allow(clippy::await_holding_lock)]
|
||||
pub async fn pump(&self) {
|
||||
if let Some(remote_storage) = &self.remote_storage {
|
||||
|
||||
@@ -13,7 +13,6 @@ use std::time::Duration;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::info;
|
||||
use tracing::warn;
|
||||
use utils::backoff;
|
||||
|
||||
use crate::metrics;
|
||||
|
||||
@@ -64,19 +63,7 @@ impl Deleter {
|
||||
Err(anyhow::anyhow!("failpoint hit"))
|
||||
});
|
||||
|
||||
// A backoff::retry is used here for two reasons:
|
||||
// - To provide a backoff rather than busy-polling the API on errors
|
||||
// - To absorb transient 429/503 conditions without hitting our error
|
||||
// logging path for issues deleting objects.
|
||||
backoff::retry(
|
||||
|| async { self.remote_storage.delete_objects(&self.accumulator).await },
|
||||
|_| false,
|
||||
3,
|
||||
10,
|
||||
"executing deletion batch",
|
||||
backoff::Cancel::new(self.cancel.clone(), || anyhow::anyhow!("Shutting down")),
|
||||
)
|
||||
.await
|
||||
self.remote_storage.delete_objects(&self.accumulator).await
|
||||
}
|
||||
|
||||
/// Block until everything in accumulator has been executed
|
||||
@@ -101,10 +88,7 @@ impl Deleter {
|
||||
self.accumulator.clear();
|
||||
}
|
||||
Err(e) => {
|
||||
if self.cancel.is_cancelled() {
|
||||
return Err(DeletionQueueError::ShuttingDown);
|
||||
}
|
||||
warn!("DeleteObjects request failed: {e:#}, will continue trying");
|
||||
warn!("DeleteObjects request failed: {e:#}, will retry");
|
||||
metrics::DELETION_QUEUE
|
||||
.remote_errors
|
||||
.with_label_values(&["execute"])
|
||||
|
||||
@@ -34,8 +34,6 @@ use crate::deletion_queue::TEMP_SUFFIX;
|
||||
use crate::metrics;
|
||||
use crate::tenant::remote_timeline_client::remote_layer_path;
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
use crate::virtual_file::on_fatal_io_error;
|
||||
use crate::virtual_file::MaybeFatalIo;
|
||||
|
||||
// The number of keys in a DeletionList before we will proactively persist it
|
||||
// (without reaching a flush deadline). This aims to deliver objects of the order
|
||||
@@ -87,7 +85,7 @@ pub(super) struct ListWriter {
|
||||
conf: &'static PageServerConf,
|
||||
|
||||
// Incoming frontend requests to delete some keys
|
||||
rx: tokio::sync::mpsc::UnboundedReceiver<ListWriterQueueMessage>,
|
||||
rx: tokio::sync::mpsc::Receiver<ListWriterQueueMessage>,
|
||||
|
||||
// Outbound requests to the backend to execute deletion lists we have composed.
|
||||
tx: tokio::sync::mpsc::Sender<ValidatorQueueMessage>,
|
||||
@@ -113,7 +111,7 @@ impl ListWriter {
|
||||
|
||||
pub(super) fn new(
|
||||
conf: &'static PageServerConf,
|
||||
rx: tokio::sync::mpsc::UnboundedReceiver<ListWriterQueueMessage>,
|
||||
rx: tokio::sync::mpsc::Receiver<ListWriterQueueMessage>,
|
||||
tx: tokio::sync::mpsc::Sender<ValidatorQueueMessage>,
|
||||
cancel: CancellationToken,
|
||||
) -> Self {
|
||||
@@ -197,7 +195,7 @@ impl ListWriter {
|
||||
debug!("Deletion header {header_path} not found, first start?");
|
||||
Ok(None)
|
||||
} else {
|
||||
on_fatal_io_error(&e, "reading deletion header");
|
||||
Err(anyhow::anyhow!(e))
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -218,17 +216,23 @@ impl ListWriter {
|
||||
self.pending.sequence = validated_sequence + 1;
|
||||
|
||||
let deletion_directory = self.conf.deletion_prefix();
|
||||
let mut dir = tokio::fs::read_dir(&deletion_directory)
|
||||
.await
|
||||
.fatal_err("read deletion directory");
|
||||
let mut dir = match tokio::fs::read_dir(&deletion_directory).await {
|
||||
Ok(d) => d,
|
||||
Err(e) => {
|
||||
warn!("Failed to open deletion list directory {deletion_directory}: {e:#}");
|
||||
|
||||
// Give up: if we can't read the deletion list directory, we probably can't
|
||||
// write lists into it later, so the queue won't work.
|
||||
return Err(e.into());
|
||||
}
|
||||
};
|
||||
|
||||
let list_name_pattern =
|
||||
Regex::new("(?<sequence>[a-zA-Z0-9]{16})-(?<version>[a-zA-Z0-9]{2}).list").unwrap();
|
||||
|
||||
let temp_extension = format!(".{TEMP_SUFFIX}");
|
||||
let header_path = self.conf.deletion_header_path();
|
||||
let mut seqs: Vec<u64> = Vec::new();
|
||||
while let Some(dentry) = dir.next_entry().await.fatal_err("read deletion dentry") {
|
||||
while let Some(dentry) = dir.next_entry().await? {
|
||||
let file_name = dentry.file_name();
|
||||
let dentry_str = file_name.to_string_lossy();
|
||||
|
||||
@@ -237,13 +241,15 @@ impl ListWriter {
|
||||
continue;
|
||||
}
|
||||
|
||||
if dentry_str.ends_with(&temp_extension) {
|
||||
if dentry_str.ends_with(TEMP_SUFFIX) {
|
||||
info!("Cleaning up temporary file {dentry_str}");
|
||||
let absolute_path =
|
||||
deletion_directory.join(dentry.file_name().to_str().expect("non-Unicode path"));
|
||||
tokio::fs::remove_file(&absolute_path)
|
||||
.await
|
||||
.fatal_err("delete temp file");
|
||||
if let Err(e) = tokio::fs::remove_file(&absolute_path).await {
|
||||
// Non-fatal error: we will just leave the file behind but not
|
||||
// try and load it.
|
||||
warn!("Failed to clean up temporary file {absolute_path}: {e:#}");
|
||||
}
|
||||
|
||||
continue;
|
||||
}
|
||||
@@ -283,9 +289,7 @@ impl ListWriter {
|
||||
for s in seqs {
|
||||
let list_path = self.conf.deletion_list_path(s);
|
||||
|
||||
let list_bytes = tokio::fs::read(&list_path)
|
||||
.await
|
||||
.fatal_err("read deletion list");
|
||||
let list_bytes = tokio::fs::read(&list_path).await?;
|
||||
|
||||
let mut deletion_list = match serde_json::from_slice::<DeletionList>(&list_bytes) {
|
||||
Ok(l) => l,
|
||||
@@ -344,7 +348,7 @@ impl ListWriter {
|
||||
info!("Started deletion frontend worker");
|
||||
|
||||
// Synchronous, but we only do it once per process lifetime so it's tolerable
|
||||
if let Err(e) = create_dir_all(self.conf.deletion_prefix()) {
|
||||
if let Err(e) = create_dir_all(&self.conf.deletion_prefix()) {
|
||||
tracing::error!(
|
||||
"Failed to create deletion list directory {}, deletions will not be executed ({e})",
|
||||
self.conf.deletion_prefix(),
|
||||
|
||||
@@ -28,7 +28,6 @@ use crate::config::PageServerConf;
|
||||
use crate::control_plane_client::ControlPlaneGenerationsApi;
|
||||
use crate::control_plane_client::RetryForeverError;
|
||||
use crate::metrics;
|
||||
use crate::virtual_file::MaybeFatalIo;
|
||||
|
||||
use super::deleter::DeleterMessage;
|
||||
use super::DeletionHeader;
|
||||
@@ -288,9 +287,16 @@ where
|
||||
async fn cleanup_lists(&mut self, list_paths: Vec<Utf8PathBuf>) {
|
||||
for list_path in list_paths {
|
||||
debug!("Removing deletion list {list_path}");
|
||||
tokio::fs::remove_file(&list_path)
|
||||
.await
|
||||
.fatal_err("remove deletion list");
|
||||
|
||||
if let Err(e) = tokio::fs::remove_file(&list_path).await {
|
||||
// Unexpected: we should have permissions and nothing else should
|
||||
// be touching these files. We will leave the file behind. Subsequent
|
||||
// pageservers will try and load it again: hopefully whatever storage
|
||||
// issue (probably permissions) has been fixed by then.
|
||||
tracing::error!("Failed to delete {list_path}: {e:#}");
|
||||
metrics::DELETION_QUEUE.unexpected_errors.inc();
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -60,11 +60,7 @@ use utils::serde_percent::Percent;
|
||||
use crate::{
|
||||
config::PageServerConf,
|
||||
task_mgr::{self, TaskKind, BACKGROUND_RUNTIME},
|
||||
tenant::{
|
||||
self,
|
||||
storage_layer::{AsLayerDesc, EvictionError, Layer},
|
||||
Timeline,
|
||||
},
|
||||
tenant::{self, storage_layer::PersistentLayer, timeline::EvictionError, Timeline},
|
||||
};
|
||||
|
||||
#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)]
|
||||
@@ -112,7 +108,7 @@ pub fn launch_disk_usage_global_eviction_task(
|
||||
_ = background_jobs_barrier.wait() => { }
|
||||
};
|
||||
|
||||
disk_usage_eviction_task(&state, task_config, &storage, &conf.tenants_path(), cancel)
|
||||
disk_usage_eviction_task(&state, task_config, storage, &conf.tenants_path(), cancel)
|
||||
.await;
|
||||
Ok(())
|
||||
},
|
||||
@@ -125,7 +121,7 @@ pub fn launch_disk_usage_global_eviction_task(
|
||||
async fn disk_usage_eviction_task(
|
||||
state: &State,
|
||||
task_config: &DiskUsageEvictionTaskConfig,
|
||||
_storage: &GenericRemoteStorage,
|
||||
storage: GenericRemoteStorage,
|
||||
tenants_dir: &Utf8Path,
|
||||
cancel: CancellationToken,
|
||||
) {
|
||||
@@ -149,8 +145,14 @@ async fn disk_usage_eviction_task(
|
||||
let start = Instant::now();
|
||||
|
||||
async {
|
||||
let res =
|
||||
disk_usage_eviction_task_iteration(state, task_config, tenants_dir, &cancel).await;
|
||||
let res = disk_usage_eviction_task_iteration(
|
||||
state,
|
||||
task_config,
|
||||
&storage,
|
||||
tenants_dir,
|
||||
&cancel,
|
||||
)
|
||||
.await;
|
||||
|
||||
match res {
|
||||
Ok(()) => {}
|
||||
@@ -181,12 +183,13 @@ pub trait Usage: Clone + Copy + std::fmt::Debug {
|
||||
async fn disk_usage_eviction_task_iteration(
|
||||
state: &State,
|
||||
task_config: &DiskUsageEvictionTaskConfig,
|
||||
storage: &GenericRemoteStorage,
|
||||
tenants_dir: &Utf8Path,
|
||||
cancel: &CancellationToken,
|
||||
) -> anyhow::Result<()> {
|
||||
let usage_pre = filesystem_level_usage::get(tenants_dir, task_config)
|
||||
.context("get filesystem-level disk usage before evictions")?;
|
||||
let res = disk_usage_eviction_task_iteration_impl(state, usage_pre, cancel).await;
|
||||
let res = disk_usage_eviction_task_iteration_impl(state, storage, usage_pre, cancel).await;
|
||||
match res {
|
||||
Ok(outcome) => {
|
||||
debug!(?outcome, "disk_usage_eviction_iteration finished");
|
||||
@@ -270,6 +273,7 @@ struct LayerCount {
|
||||
|
||||
pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
state: &State,
|
||||
storage: &GenericRemoteStorage,
|
||||
usage_pre: U,
|
||||
cancel: &CancellationToken,
|
||||
) -> anyhow::Result<IterationOutcome<U>> {
|
||||
@@ -326,10 +330,9 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
// If we get far enough in the list that we start to evict layers that are below
|
||||
// the tenant's min-resident-size threshold, print a warning, and memorize the disk
|
||||
// usage at that point, in 'usage_planned_min_resident_size_respecting'.
|
||||
let mut batched: HashMap<_, Vec<_>> = HashMap::new();
|
||||
let mut batched: HashMap<_, Vec<Arc<dyn PersistentLayer>>> = HashMap::new();
|
||||
let mut warned = None;
|
||||
let mut usage_planned = usage_pre;
|
||||
let mut max_batch_size = 0;
|
||||
for (i, (partition, candidate)) in candidates.into_iter().enumerate() {
|
||||
if !usage_planned.has_pressure() {
|
||||
debug!(
|
||||
@@ -346,18 +349,10 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
|
||||
usage_planned.add_available_bytes(candidate.layer.layer_desc().file_size);
|
||||
|
||||
// FIXME: batching makes no sense anymore because of no layermap locking, should just spawn
|
||||
// tasks to evict all seen layers until we have evicted enough
|
||||
|
||||
let batch = batched.entry(TimelineKey(candidate.timeline)).or_default();
|
||||
|
||||
// semaphore will later be used to limit eviction concurrency, and we can express at
|
||||
// most u32 number of permits. unlikely we would have u32::MAX layers to be evicted,
|
||||
// but fail gracefully by not making batches larger.
|
||||
if batch.len() < u32::MAX as usize {
|
||||
batch.push(candidate.layer);
|
||||
max_batch_size = max_batch_size.max(batch.len());
|
||||
}
|
||||
batched
|
||||
.entry(TimelineKey(candidate.timeline))
|
||||
.or_default()
|
||||
.push(candidate.layer);
|
||||
}
|
||||
|
||||
let usage_planned = match warned {
|
||||
@@ -374,101 +369,64 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
|
||||
// phase2: evict victims batched by timeline
|
||||
|
||||
let mut js = tokio::task::JoinSet::new();
|
||||
|
||||
// ratelimit to 1k files or any higher max batch size
|
||||
let limit = Arc::new(tokio::sync::Semaphore::new(1000.max(max_batch_size)));
|
||||
|
||||
// After the loop, `usage_assumed` is the post-eviction usage,
|
||||
// according to internal accounting.
|
||||
let mut usage_assumed = usage_pre;
|
||||
let mut evictions_failed = LayerCount::default();
|
||||
for (timeline, batch) in batched {
|
||||
let tenant_id = timeline.tenant_id;
|
||||
let timeline_id = timeline.timeline_id;
|
||||
let batch_size =
|
||||
u32::try_from(batch.len()).expect("batch size limited to u32::MAX during partitioning");
|
||||
|
||||
// I dislike naming of `available_permits` but it means current total amount of permits
|
||||
// because permits can be added
|
||||
assert!(batch_size as usize <= limit.available_permits());
|
||||
let batch_size = batch.len();
|
||||
|
||||
debug!(%timeline_id, "evicting batch for timeline");
|
||||
|
||||
let evict = {
|
||||
let limit = limit.clone();
|
||||
let cancel = cancel.clone();
|
||||
async move {
|
||||
let mut evicted_bytes = 0;
|
||||
let mut evictions_failed = LayerCount::default();
|
||||
async {
|
||||
let results = timeline.evict_layers(storage, &batch, cancel.clone()).await;
|
||||
|
||||
let Ok(_permit) = limit.acquire_many_owned(batch_size).await else {
|
||||
// semaphore closing means cancelled
|
||||
return (evicted_bytes, evictions_failed);
|
||||
};
|
||||
|
||||
let results = timeline.evict_layers(&batch, &cancel).await;
|
||||
|
||||
match results {
|
||||
Ok(results) => {
|
||||
assert_eq!(results.len(), batch.len());
|
||||
for (result, layer) in results.into_iter().zip(batch.iter()) {
|
||||
let file_size = layer.layer_desc().file_size;
|
||||
match result {
|
||||
Some(Ok(())) => {
|
||||
evicted_bytes += file_size;
|
||||
}
|
||||
Some(Err(EvictionError::NotFound | EvictionError::Downloaded)) => {
|
||||
evictions_failed.file_sizes += file_size;
|
||||
evictions_failed.count += 1;
|
||||
}
|
||||
None => {
|
||||
assert!(cancel.is_cancelled());
|
||||
}
|
||||
match results {
|
||||
Err(e) => {
|
||||
warn!("failed to evict batch: {:#}", e);
|
||||
}
|
||||
Ok(results) => {
|
||||
assert_eq!(results.len(), batch.len());
|
||||
for (result, layer) in results.into_iter().zip(batch.iter()) {
|
||||
let file_size = layer.layer_desc().file_size;
|
||||
match result {
|
||||
Some(Ok(())) => {
|
||||
usage_assumed.add_available_bytes(file_size);
|
||||
}
|
||||
Some(Err(EvictionError::CannotEvictRemoteLayer)) => {
|
||||
unreachable!("get_local_layers_for_disk_usage_eviction finds only local layers")
|
||||
}
|
||||
Some(Err(EvictionError::FileNotFound)) => {
|
||||
evictions_failed.file_sizes += file_size;
|
||||
evictions_failed.count += 1;
|
||||
}
|
||||
Some(Err(
|
||||
e @ EvictionError::LayerNotFound(_)
|
||||
| e @ EvictionError::StatFailed(_),
|
||||
)) => {
|
||||
let e = utils::error::report_compact_sources(&e);
|
||||
warn!(%layer, "failed to evict layer: {e}");
|
||||
evictions_failed.file_sizes += file_size;
|
||||
evictions_failed.count += 1;
|
||||
}
|
||||
None => {
|
||||
assert!(cancel.is_cancelled());
|
||||
return;
|
||||
}
|
||||
}
|
||||
}
|
||||
Err(e) => {
|
||||
warn!("failed to evict batch: {:#}", e);
|
||||
}
|
||||
}
|
||||
(evicted_bytes, evictions_failed)
|
||||
}
|
||||
}
|
||||
.instrument(tracing::info_span!("evict_batch", %tenant_id, %timeline_id, batch_size));
|
||||
.instrument(tracing::info_span!("evict_batch", %tenant_id, %timeline_id, batch_size))
|
||||
.await;
|
||||
|
||||
js.spawn(evict);
|
||||
|
||||
// spwaning multiple thousands of these is essentially blocking, so give already spawned a
|
||||
// chance of making progress
|
||||
tokio::task::yield_now().await;
|
||||
}
|
||||
|
||||
let join_all = async move {
|
||||
// After the evictions, `usage_assumed` is the post-eviction usage,
|
||||
// according to internal accounting.
|
||||
let mut usage_assumed = usage_pre;
|
||||
let mut evictions_failed = LayerCount::default();
|
||||
|
||||
while let Some(res) = js.join_next().await {
|
||||
match res {
|
||||
Ok((evicted_bytes, failed)) => {
|
||||
usage_assumed.add_available_bytes(evicted_bytes);
|
||||
evictions_failed.file_sizes += failed.file_sizes;
|
||||
evictions_failed.count += failed.count;
|
||||
}
|
||||
Err(je) if je.is_cancelled() => unreachable!("not used"),
|
||||
Err(je) if je.is_panic() => { /* already logged */ }
|
||||
Err(je) => tracing::error!("unknown JoinError: {je:?}"),
|
||||
}
|
||||
}
|
||||
(usage_assumed, evictions_failed)
|
||||
};
|
||||
|
||||
let (usage_assumed, evictions_failed) = tokio::select! {
|
||||
tuple = join_all => { tuple },
|
||||
_ = cancel.cancelled() => {
|
||||
// close the semaphore to stop any pending acquires
|
||||
limit.close();
|
||||
if cancel.is_cancelled() {
|
||||
return Ok(IterationOutcome::Cancelled);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
Ok(IterationOutcome::Finished(IterationOutcomeFinished {
|
||||
before: usage_pre,
|
||||
@@ -483,7 +441,7 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
#[derive(Clone)]
|
||||
struct EvictionCandidate {
|
||||
timeline: Arc<Timeline>,
|
||||
layer: Layer,
|
||||
layer: Arc<dyn PersistentLayer>,
|
||||
last_activity_ts: SystemTime,
|
||||
}
|
||||
|
||||
|
||||
@@ -306,67 +306,6 @@ paths:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ServiceUnavailableError"
|
||||
|
||||
/v1/tenant/{tenant_id}/timeline/{timeline_id}/get_timestamp_of_lsn:
|
||||
parameters:
|
||||
- name: tenant_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
- name: timeline_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
get:
|
||||
description: Get timestamp for a given LSN
|
||||
parameters:
|
||||
- name: lsn
|
||||
in: query
|
||||
required: true
|
||||
schema:
|
||||
type: integer
|
||||
description: A LSN to get the timestamp
|
||||
responses:
|
||||
"200":
|
||||
description: OK
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: string
|
||||
format: date-time
|
||||
"400":
|
||||
description: Error when no tenant id found in path, no timeline id or invalid timestamp
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"404":
|
||||
description: Timeline not found, or there is no timestamp information for the given lsn
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/NotFoundError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
|
||||
/v1/tenant/{tenant_id}/timeline/{timeline_id}/get_lsn_by_timestamp:
|
||||
parameters:
|
||||
@@ -392,19 +331,13 @@ paths:
|
||||
type: string
|
||||
format: date-time
|
||||
description: A timestamp to get the LSN
|
||||
- name: version
|
||||
in: query
|
||||
required: false
|
||||
schema:
|
||||
type: integer
|
||||
description: The version of the endpoint to use
|
||||
responses:
|
||||
"200":
|
||||
description: OK
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/LsnByTimestampResponse"
|
||||
type: string
|
||||
"400":
|
||||
description: Error when no tenant id found in path, no timeline id or invalid timestamp
|
||||
content:
|
||||
@@ -569,17 +502,7 @@ paths:
|
||||
schema:
|
||||
$ref: "#/components/schemas/NotFoundError"
|
||||
"409":
|
||||
description: |
|
||||
The tenant is already known to Pageserver in some way,
|
||||
and hence this `/attach` call has been rejected.
|
||||
|
||||
Some examples of how this can happen:
|
||||
- tenant was created on this pageserver
|
||||
- tenant attachment was started by an earlier call to `/attach`.
|
||||
|
||||
Callers should poll the tenant status's `attachment_status` field,
|
||||
like for status 202. See the longer description for `POST /attach`
|
||||
for details.
|
||||
description: Tenant download is already in progress
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
@@ -723,12 +646,6 @@ paths:
|
||||
|
||||
Errors if the tenant is absent on disk, already present in memory or fails to schedule its load.
|
||||
Scheduling a load does not mean that the tenant would load successfully, check tenant status to ensure load correctness.
|
||||
requestBody:
|
||||
required: false
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/TenantLoadRequest"
|
||||
responses:
|
||||
"202":
|
||||
description: Tenant scheduled to load successfully
|
||||
@@ -1219,15 +1136,6 @@ components:
|
||||
new_tenant_id:
|
||||
type: string
|
||||
format: hex
|
||||
generation:
|
||||
type: integer
|
||||
description: Attachment generation number.
|
||||
TenantLoadRequest:
|
||||
type: object
|
||||
properties:
|
||||
generation:
|
||||
type: integer
|
||||
description: Attachment generation number.
|
||||
TenantAttachRequest:
|
||||
type: object
|
||||
required:
|
||||
@@ -1415,19 +1323,6 @@ components:
|
||||
type: string
|
||||
format: hex
|
||||
|
||||
LsnByTimestampResponse:
|
||||
type: object
|
||||
required:
|
||||
- lsn
|
||||
- kind
|
||||
properties:
|
||||
lsn:
|
||||
type: string
|
||||
format: hex
|
||||
kind:
|
||||
type: string
|
||||
enum: [past, present, future, nodata]
|
||||
|
||||
Error:
|
||||
type: object
|
||||
required:
|
||||
|
||||
@@ -2,13 +2,11 @@
|
||||
//! Management HTTP API
|
||||
//!
|
||||
use std::collections::HashMap;
|
||||
use std::str::FromStr;
|
||||
use std::sync::Arc;
|
||||
|
||||
use anyhow::{anyhow, Context, Result};
|
||||
use futures::TryFutureExt;
|
||||
use humantime::format_rfc3339;
|
||||
use hyper::header;
|
||||
use hyper::header::CONTENT_TYPE;
|
||||
use hyper::StatusCode;
|
||||
use hyper::{Body, Request, Response, Uri};
|
||||
use metrics::launch_timestamp::LaunchTimestamp;
|
||||
@@ -17,7 +15,6 @@ use pageserver_api::models::{
|
||||
TenantLoadRequest, TenantLocationConfigRequest,
|
||||
};
|
||||
use remote_storage::GenericRemoteStorage;
|
||||
use serde_with::{serde_as, DisplayFromStr};
|
||||
use tenant_size_model::{SizeResult, StorageModel};
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::*;
|
||||
@@ -80,7 +77,7 @@ impl State {
|
||||
disk_usage_eviction_state: Arc<disk_usage_eviction_task::State>,
|
||||
deletion_queue_client: DeletionQueueClient,
|
||||
) -> anyhow::Result<Self> {
|
||||
let allowlist_routes = ["/v1/status", "/v1/doc", "/swagger.yml", "/metrics"]
|
||||
let allowlist_routes = ["/v1/status", "/v1/doc", "/swagger.yml"]
|
||||
.iter()
|
||||
.map(|v| v.parse().unwrap())
|
||||
.collect::<Vec<_>>();
|
||||
@@ -139,7 +136,9 @@ impl From<PageReconstructError> for ApiError {
|
||||
PageReconstructError::AncestorStopping(_) => {
|
||||
ApiError::ResourceUnavailable(format!("{pre}").into())
|
||||
}
|
||||
PageReconstructError::WalRedo(pre) => ApiError::InternalServerError(pre),
|
||||
PageReconstructError::WalRedo(pre) => {
|
||||
ApiError::InternalServerError(anyhow::Error::new(pre))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -165,6 +164,9 @@ impl From<TenantStateError> for ApiError {
|
||||
fn from(tse: TenantStateError) -> ApiError {
|
||||
match tse {
|
||||
TenantStateError::NotFound(tid) => ApiError::NotFound(anyhow!("tenant {}", tid).into()),
|
||||
TenantStateError::NotActive(_) => {
|
||||
ApiError::ResourceUnavailable("Tenant not yet active".into())
|
||||
}
|
||||
TenantStateError::IsStopping(_) => {
|
||||
ApiError::ResourceUnavailable("Tenant is stopping".into())
|
||||
}
|
||||
@@ -394,9 +396,6 @@ async fn timeline_create_handler(
|
||||
format!("{err:#}")
|
||||
))
|
||||
}
|
||||
Err(e @ tenant::CreateTimelineError::AncestorNotActive) => {
|
||||
json_response(StatusCode::SERVICE_UNAVAILABLE, HttpErrorBody::from_msg(e.to_string()))
|
||||
}
|
||||
Err(tenant::CreateTimelineError::Other(err)) => Err(ApiError::InternalServerError(err)),
|
||||
}
|
||||
}
|
||||
@@ -485,8 +484,6 @@ async fn get_lsn_by_timestamp_handler(
|
||||
let tenant_id: TenantId = parse_request_param(&request, "tenant_id")?;
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let version: Option<u8> = parse_query_param(&request, "version")?;
|
||||
|
||||
let timeline_id: TimelineId = parse_request_param(&request, "timeline_id")?;
|
||||
let timestamp_raw = must_get_query_param(&request, "timestamp")?;
|
||||
let timestamp = humantime::parse_rfc3339(×tamp_raw)
|
||||
@@ -498,59 +495,13 @@ async fn get_lsn_by_timestamp_handler(
|
||||
let timeline = active_timeline_of_active_tenant(tenant_id, timeline_id).await?;
|
||||
let result = timeline.find_lsn_for_timestamp(timestamp_pg, &ctx).await?;
|
||||
|
||||
if version.unwrap_or(0) > 1 {
|
||||
#[serde_as]
|
||||
#[derive(serde::Serialize)]
|
||||
struct Result {
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
lsn: Lsn,
|
||||
kind: &'static str,
|
||||
}
|
||||
let (lsn, kind) = match result {
|
||||
LsnForTimestamp::Present(lsn) => (lsn, "present"),
|
||||
LsnForTimestamp::Future(lsn) => (lsn, "future"),
|
||||
LsnForTimestamp::Past(lsn) => (lsn, "past"),
|
||||
LsnForTimestamp::NoData(lsn) => (lsn, "nodata"),
|
||||
};
|
||||
json_response(StatusCode::OK, Result { lsn, kind })
|
||||
} else {
|
||||
// FIXME: this is a temporary crutch not to break backwards compatibility
|
||||
// See https://github.com/neondatabase/neon/pull/5608
|
||||
let result = match result {
|
||||
LsnForTimestamp::Present(lsn) => format!("{lsn}"),
|
||||
LsnForTimestamp::Future(_lsn) => "future".into(),
|
||||
LsnForTimestamp::Past(_lsn) => "past".into(),
|
||||
LsnForTimestamp::NoData(_lsn) => "nodata".into(),
|
||||
};
|
||||
json_response(StatusCode::OK, result)
|
||||
}
|
||||
}
|
||||
|
||||
async fn get_timestamp_of_lsn_handler(
|
||||
request: Request<Body>,
|
||||
_cancel: CancellationToken,
|
||||
) -> Result<Response<Body>, ApiError> {
|
||||
let tenant_id: TenantId = parse_request_param(&request, "tenant_id")?;
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let timeline_id: TimelineId = parse_request_param(&request, "timeline_id")?;
|
||||
|
||||
let lsn_str = must_get_query_param(&request, "lsn")?;
|
||||
let lsn = Lsn::from_str(&lsn_str)
|
||||
.with_context(|| format!("Invalid LSN: {lsn_str:?}"))
|
||||
.map_err(ApiError::BadRequest)?;
|
||||
|
||||
let ctx = RequestContext::new(TaskKind::MgmtRequest, DownloadBehavior::Download);
|
||||
let timeline = active_timeline_of_active_tenant(tenant_id, timeline_id).await?;
|
||||
let result = timeline.get_timestamp_for_lsn(lsn, &ctx).await?;
|
||||
|
||||
match result {
|
||||
Some(time) => {
|
||||
let time = format_rfc3339(postgres_ffi::from_pg_timestamp(time)).to_string();
|
||||
json_response(StatusCode::OK, time)
|
||||
}
|
||||
None => json_response(StatusCode::NOT_FOUND, ()),
|
||||
}
|
||||
let result = match result {
|
||||
LsnForTimestamp::Present(lsn) => format!("{lsn}"),
|
||||
LsnForTimestamp::Future(_lsn) => "future".into(),
|
||||
LsnForTimestamp::Past(_lsn) => "past".into(),
|
||||
LsnForTimestamp::NoData(_lsn) => "nodata".into(),
|
||||
};
|
||||
json_response(StatusCode::OK, result)
|
||||
}
|
||||
|
||||
async fn tenant_attach_handler(
|
||||
@@ -621,14 +572,9 @@ async fn tenant_detach_handler(
|
||||
|
||||
let state = get_state(&request);
|
||||
let conf = state.conf;
|
||||
mgr::detach_tenant(
|
||||
conf,
|
||||
tenant_id,
|
||||
detach_ignored.unwrap_or(false),
|
||||
&state.deletion_queue_client,
|
||||
)
|
||||
.instrument(info_span!("tenant_detach", %tenant_id))
|
||||
.await?;
|
||||
mgr::detach_tenant(conf, tenant_id, detach_ignored.unwrap_or(false))
|
||||
.instrument(info_span!("tenant_detach", %tenant_id))
|
||||
.await?;
|
||||
|
||||
json_response(StatusCode::OK, ())
|
||||
}
|
||||
@@ -789,10 +735,6 @@ async fn tenant_size_handler(
|
||||
.map_err(ApiError::InternalServerError)?;
|
||||
|
||||
let mut sizes = None;
|
||||
let accepts_html = headers
|
||||
.get(header::ACCEPT)
|
||||
.map(|v| v == "text/html")
|
||||
.unwrap_or_default();
|
||||
if !inputs_only.unwrap_or(false) {
|
||||
let storage_model = inputs
|
||||
.calculate_model()
|
||||
@@ -800,11 +742,11 @@ async fn tenant_size_handler(
|
||||
let size = storage_model.calculate();
|
||||
|
||||
// If request header expects html, return html
|
||||
if accepts_html {
|
||||
if headers["Accept"] == "text/html" {
|
||||
return synthetic_size_html_response(inputs, storage_model, size);
|
||||
}
|
||||
sizes = Some(size);
|
||||
} else if accepts_html {
|
||||
} else if headers["Accept"] == "text/html" {
|
||||
return Err(ApiError::BadRequest(anyhow!(
|
||||
"inputs_only parameter is incompatible with html output request"
|
||||
)));
|
||||
@@ -955,7 +897,7 @@ fn synthetic_size_html_response(
|
||||
pub fn html_response(status: StatusCode, data: String) -> Result<Response<Body>, ApiError> {
|
||||
let response = Response::builder()
|
||||
.status(status)
|
||||
.header(header::CONTENT_TYPE, "text/html")
|
||||
.header(hyper::header::CONTENT_TYPE, "text/html")
|
||||
.body(Body::from(data.as_bytes().to_vec()))
|
||||
.map_err(|e| ApiError::InternalServerError(e.into()))?;
|
||||
Ok(response)
|
||||
@@ -1089,17 +1031,9 @@ async fn put_tenant_location_config_handler(
|
||||
// The `Detached` state is special, it doesn't upsert a tenant, it removes
|
||||
// its local disk content and drops it from memory.
|
||||
if let LocationConfigMode::Detached = request_data.config.mode {
|
||||
if let Err(e) = mgr::detach_tenant(conf, tenant_id, true, &state.deletion_queue_client)
|
||||
mgr::detach_tenant(conf, tenant_id, true)
|
||||
.instrument(info_span!("tenant_detach", %tenant_id))
|
||||
.await
|
||||
{
|
||||
match e {
|
||||
TenantStateError::NotFound(_) => {
|
||||
// This API is idempotent: a NotFound on a detach is fine.
|
||||
}
|
||||
_ => return Err(e.into()),
|
||||
}
|
||||
}
|
||||
.await?;
|
||||
return json_response(StatusCode::OK, ());
|
||||
}
|
||||
|
||||
@@ -1205,7 +1139,7 @@ async fn timeline_compact_handler(
|
||||
timeline
|
||||
.compact(&cancel, &ctx)
|
||||
.await
|
||||
.map_err(|e| ApiError::InternalServerError(e.into()))?;
|
||||
.map_err(ApiError::InternalServerError)?;
|
||||
json_response(StatusCode::OK, ())
|
||||
}
|
||||
.instrument(info_span!("manual_compaction", %tenant_id, %timeline_id))
|
||||
@@ -1230,7 +1164,7 @@ async fn timeline_checkpoint_handler(
|
||||
timeline
|
||||
.compact(&cancel, &ctx)
|
||||
.await
|
||||
.map_err(|e| ApiError::InternalServerError(e.into()))?;
|
||||
.map_err(ApiError::InternalServerError)?;
|
||||
|
||||
json_response(StatusCode::OK, ())
|
||||
}
|
||||
@@ -1336,7 +1270,7 @@ async fn getpage_at_lsn_handler(
|
||||
Result::<_, ApiError>::Ok(
|
||||
Response::builder()
|
||||
.status(StatusCode::OK)
|
||||
.header(header::CONTENT_TYPE, "application/octet-stream")
|
||||
.header(CONTENT_TYPE, "application/octet-stream")
|
||||
.body(hyper::Body::from(page))
|
||||
.unwrap(),
|
||||
)
|
||||
@@ -1500,11 +1434,11 @@ async fn disk_usage_eviction_run(
|
||||
|
||||
let state = get_state(&r);
|
||||
|
||||
if state.remote_storage.as_ref().is_none() {
|
||||
let Some(storage) = state.remote_storage.clone() else {
|
||||
return Err(ApiError::InternalServerError(anyhow::anyhow!(
|
||||
"remote storage not configured, cannot run eviction iteration"
|
||||
)));
|
||||
}
|
||||
};
|
||||
|
||||
let state = state.disk_usage_eviction_state.clone();
|
||||
|
||||
@@ -1522,6 +1456,7 @@ async fn disk_usage_eviction_run(
|
||||
async move {
|
||||
let res = crate::disk_usage_eviction_task::disk_usage_eviction_task_iteration_impl(
|
||||
&state,
|
||||
&storage,
|
||||
usage,
|
||||
&child_cancel,
|
||||
)
|
||||
@@ -1734,10 +1669,6 @@ pub fn make_router(
|
||||
"/v1/tenant/:tenant_id/timeline/:timeline_id/get_lsn_by_timestamp",
|
||||
|r| api_handler(r, get_lsn_by_timestamp_handler),
|
||||
)
|
||||
.get(
|
||||
"/v1/tenant/:tenant_id/timeline/:timeline_id/get_timestamp_of_lsn",
|
||||
|r| api_handler(r, get_timestamp_of_lsn_handler),
|
||||
)
|
||||
.put("/v1/tenant/:tenant_id/timeline/:timeline_id/do_gc", |r| {
|
||||
api_handler(r, timeline_gc_handler)
|
||||
})
|
||||
|
||||
@@ -149,10 +149,6 @@ fn ends_with_suffix(path: &Utf8Path, suffix: &str) -> bool {
|
||||
}
|
||||
}
|
||||
|
||||
// FIXME: DO NOT ADD new query methods like this, which will have a next step of parsing timelineid
|
||||
// from the directory name. Instead create type "UninitMark(TimelineId)" and only parse it once
|
||||
// from the name.
|
||||
|
||||
pub fn is_uninit_mark(path: &Utf8Path) -> bool {
|
||||
ends_with_suffix(path, TIMELINE_UNINIT_MARK_SUFFIX)
|
||||
}
|
||||
@@ -177,9 +173,6 @@ fn is_walkdir_io_not_found(e: &walkdir::Error) -> bool {
|
||||
/// delaying is needed.
|
||||
#[derive(Clone)]
|
||||
pub struct InitializationOrder {
|
||||
/// Each initial tenant load task carries this until it is done loading timelines from remote storage
|
||||
pub initial_tenant_load_remote: Option<utils::completion::Completion>,
|
||||
|
||||
/// Each initial tenant load task carries this until completion.
|
||||
pub initial_tenant_load: Option<utils::completion::Completion>,
|
||||
|
||||
|
||||
@@ -1067,26 +1067,6 @@ pub(crate) static TENANT_TASK_EVENTS: Lazy<IntCounterVec> = Lazy::new(|| {
|
||||
.expect("Failed to register tenant_task_events metric")
|
||||
});
|
||||
|
||||
pub(crate) static BACKGROUND_LOOP_SEMAPHORE_WAIT_START_COUNT: Lazy<IntCounterVec> =
|
||||
Lazy::new(|| {
|
||||
register_int_counter_vec!(
|
||||
"pageserver_background_loop_semaphore_wait_start_count",
|
||||
"Counter for background loop concurrency-limiting semaphore acquire calls started",
|
||||
&["task"],
|
||||
)
|
||||
.unwrap()
|
||||
});
|
||||
|
||||
pub(crate) static BACKGROUND_LOOP_SEMAPHORE_WAIT_FINISH_COUNT: Lazy<IntCounterVec> =
|
||||
Lazy::new(|| {
|
||||
register_int_counter_vec!(
|
||||
"pageserver_background_loop_semaphore_wait_finish_count",
|
||||
"Counter for background loop concurrency-limiting semaphore acquire calls finished",
|
||||
&["task"],
|
||||
)
|
||||
.unwrap()
|
||||
});
|
||||
|
||||
pub(crate) static BACKGROUND_LOOP_PERIOD_OVERRUN_COUNT: Lazy<IntCounterVec> = Lazy::new(|| {
|
||||
register_int_counter_vec!(
|
||||
"pageserver_background_loop_period_overrun_count",
|
||||
@@ -1388,23 +1368,28 @@ impl TimelineMetrics {
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn record_new_file_metrics(&self, sz: u64) {
|
||||
pub fn record_new_file_metrics(&self, sz: u64) {
|
||||
self.resident_physical_size_add(sz);
|
||||
self.num_persistent_files_created.inc_by(1);
|
||||
self.persistent_bytes_written.inc_by(sz);
|
||||
}
|
||||
|
||||
pub(crate) fn resident_physical_size_sub(&self, sz: u64) {
|
||||
pub fn resident_physical_size_sub(&self, sz: u64) {
|
||||
self.resident_physical_size_gauge.sub(sz);
|
||||
crate::metrics::RESIDENT_PHYSICAL_SIZE_GLOBAL.sub(sz);
|
||||
}
|
||||
|
||||
pub(crate) fn resident_physical_size_add(&self, sz: u64) {
|
||||
pub fn resident_physical_size_add(&self, sz: u64) {
|
||||
self.resident_physical_size_gauge.add(sz);
|
||||
crate::metrics::RESIDENT_PHYSICAL_SIZE_GLOBAL.add(sz);
|
||||
}
|
||||
|
||||
pub(crate) fn resident_physical_size_get(&self) -> u64 {
|
||||
pub fn resident_physical_size_set(&self, sz: u64) {
|
||||
self.resident_physical_size_gauge.set(sz);
|
||||
crate::metrics::RESIDENT_PHYSICAL_SIZE_GLOBAL.set(sz);
|
||||
}
|
||||
|
||||
pub fn resident_physical_size_get(&self) -> u64 {
|
||||
self.resident_physical_size_gauge.get()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -318,6 +318,15 @@ impl std::ops::Deref for PageWriteGuard<'_> {
|
||||
}
|
||||
}
|
||||
|
||||
impl AsMut<[u8; PAGE_SZ]> for PageWriteGuard<'_> {
|
||||
fn as_mut(&mut self) -> &mut [u8; PAGE_SZ] {
|
||||
match &mut self.state {
|
||||
PageWriteGuardState::Invalid { inner, _permit } => inner.buf,
|
||||
PageWriteGuardState::Downgraded => unreachable!(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> PageWriteGuard<'a> {
|
||||
/// Mark that the buffer contents are now valid.
|
||||
#[must_use]
|
||||
|
||||
@@ -35,7 +35,6 @@ use std::time::Duration;
|
||||
use tokio::io::AsyncWriteExt;
|
||||
use tokio::io::{AsyncRead, AsyncWrite};
|
||||
use tokio_util::io::StreamReader;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::field;
|
||||
use tracing::*;
|
||||
use utils::id::ConnectionId;
|
||||
@@ -65,6 +64,69 @@ use crate::trace::Tracer;
|
||||
use postgres_ffi::pg_constants::DEFAULTTABLESPACE_OID;
|
||||
use postgres_ffi::BLCKSZ;
|
||||
|
||||
fn copyin_stream<IO>(pgb: &mut PostgresBackend<IO>) -> impl Stream<Item = io::Result<Bytes>> + '_
|
||||
where
|
||||
IO: AsyncRead + AsyncWrite + Unpin,
|
||||
{
|
||||
async_stream::try_stream! {
|
||||
loop {
|
||||
let msg = tokio::select! {
|
||||
biased;
|
||||
|
||||
_ = task_mgr::shutdown_watcher() => {
|
||||
// We were requested to shut down.
|
||||
let msg = "pageserver is shutting down";
|
||||
let _ = pgb.write_message_noflush(&BeMessage::ErrorResponse(msg, None));
|
||||
Err(QueryError::Other(anyhow::anyhow!(msg)))
|
||||
}
|
||||
|
||||
msg = pgb.read_message() => { msg.map_err(QueryError::from)}
|
||||
};
|
||||
|
||||
match msg {
|
||||
Ok(Some(message)) => {
|
||||
let copy_data_bytes = match message {
|
||||
FeMessage::CopyData(bytes) => bytes,
|
||||
FeMessage::CopyDone => { break },
|
||||
FeMessage::Sync => continue,
|
||||
FeMessage::Terminate => {
|
||||
let msg = "client terminated connection with Terminate message during COPY";
|
||||
let query_error = QueryError::Disconnected(ConnectionError::Io(io::Error::new(io::ErrorKind::ConnectionReset, msg)));
|
||||
// error can't happen here, ErrorResponse serialization should be always ok
|
||||
pgb.write_message_noflush(&BeMessage::ErrorResponse(msg, Some(query_error.pg_error_code()))).map_err(|e| e.into_io_error())?;
|
||||
Err(io::Error::new(io::ErrorKind::ConnectionReset, msg))?;
|
||||
break;
|
||||
}
|
||||
m => {
|
||||
let msg = format!("unexpected message {m:?}");
|
||||
// error can't happen here, ErrorResponse serialization should be always ok
|
||||
pgb.write_message_noflush(&BeMessage::ErrorResponse(&msg, None)).map_err(|e| e.into_io_error())?;
|
||||
Err(io::Error::new(io::ErrorKind::Other, msg))?;
|
||||
break;
|
||||
}
|
||||
};
|
||||
|
||||
yield copy_data_bytes;
|
||||
}
|
||||
Ok(None) => {
|
||||
let msg = "client closed connection during COPY";
|
||||
let query_error = QueryError::Disconnected(ConnectionError::Io(io::Error::new(io::ErrorKind::ConnectionReset, msg)));
|
||||
// error can't happen here, ErrorResponse serialization should be always ok
|
||||
pgb.write_message_noflush(&BeMessage::ErrorResponse(msg, Some(query_error.pg_error_code()))).map_err(|e| e.into_io_error())?;
|
||||
pgb.flush().await?;
|
||||
Err(io::Error::new(io::ErrorKind::ConnectionReset, msg))?;
|
||||
}
|
||||
Err(QueryError::Disconnected(ConnectionError::Io(io_error))) => {
|
||||
Err(io_error)?;
|
||||
}
|
||||
Err(other) => {
|
||||
Err(io::Error::new(io::ErrorKind::Other, other.to_string()))?;
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Read the end of a tar archive.
|
||||
///
|
||||
/// A tar archive normally ends with two consecutive blocks of zeros, 512 bytes each.
|
||||
@@ -122,7 +184,6 @@ pub async fn libpq_listener_main(
|
||||
listener: TcpListener,
|
||||
auth_type: AuthType,
|
||||
listener_ctx: RequestContext,
|
||||
cancel: CancellationToken,
|
||||
) -> anyhow::Result<()> {
|
||||
listener.set_nonblocking(true)?;
|
||||
let tokio_listener = tokio::net::TcpListener::from_std(listener)?;
|
||||
@@ -131,7 +192,7 @@ pub async fn libpq_listener_main(
|
||||
while let Some(res) = tokio::select! {
|
||||
biased;
|
||||
|
||||
_ = cancel.cancelled() => {
|
||||
_ = task_mgr::shutdown_watcher() => {
|
||||
// We were requested to shut down.
|
||||
None
|
||||
}
|
||||
@@ -223,13 +284,7 @@ async fn page_service_conn_main(
|
||||
// and create a child per-query context when it invokes process_query.
|
||||
// But it's in a shared crate, so, we store connection_ctx inside PageServerHandler
|
||||
// and create the per-query context in process_query ourselves.
|
||||
let mut conn_handler = PageServerHandler::new(
|
||||
conf,
|
||||
broker_client,
|
||||
auth,
|
||||
connection_ctx,
|
||||
task_mgr::shutdown_token(),
|
||||
);
|
||||
let mut conn_handler = PageServerHandler::new(conf, broker_client, auth, connection_ctx);
|
||||
let pgbackend = PostgresBackend::new_from_io(socket, peer_addr, auth_type, None)?;
|
||||
|
||||
match pgbackend
|
||||
@@ -263,10 +318,6 @@ struct PageServerHandler {
|
||||
/// For each query received over the connection,
|
||||
/// `process_query` creates a child context from this one.
|
||||
connection_ctx: RequestContext,
|
||||
|
||||
/// A token that should fire when the tenant transitions from
|
||||
/// attached state, or when the pageserver is shutting down.
|
||||
cancel: CancellationToken,
|
||||
}
|
||||
|
||||
impl PageServerHandler {
|
||||
@@ -275,7 +326,6 @@ impl PageServerHandler {
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
auth: Option<Arc<JwtAuth>>,
|
||||
connection_ctx: RequestContext,
|
||||
cancel: CancellationToken,
|
||||
) -> Self {
|
||||
PageServerHandler {
|
||||
_conf: conf,
|
||||
@@ -283,91 +333,6 @@ impl PageServerHandler {
|
||||
auth,
|
||||
claims: None,
|
||||
connection_ctx,
|
||||
cancel,
|
||||
}
|
||||
}
|
||||
|
||||
/// Wrap PostgresBackend::flush to respect our CancellationToken: it is important to use
|
||||
/// this rather than naked flush() in order to shut down promptly. Without this, we would
|
||||
/// block shutdown of a tenant if a postgres client was failing to consume bytes we send
|
||||
/// in the flush.
|
||||
async fn flush_cancellable<IO>(&self, pgb: &mut PostgresBackend<IO>) -> Result<(), QueryError>
|
||||
where
|
||||
IO: AsyncRead + AsyncWrite + Send + Sync + Unpin,
|
||||
{
|
||||
tokio::select!(
|
||||
flush_r = pgb.flush() => {
|
||||
Ok(flush_r?)
|
||||
},
|
||||
_ = self.cancel.cancelled() => {
|
||||
Err(QueryError::Shutdown)
|
||||
}
|
||||
)
|
||||
}
|
||||
|
||||
fn copyin_stream<'a, IO>(
|
||||
&'a self,
|
||||
pgb: &'a mut PostgresBackend<IO>,
|
||||
) -> impl Stream<Item = io::Result<Bytes>> + 'a
|
||||
where
|
||||
IO: AsyncRead + AsyncWrite + Send + Sync + Unpin,
|
||||
{
|
||||
async_stream::try_stream! {
|
||||
loop {
|
||||
let msg = tokio::select! {
|
||||
biased;
|
||||
|
||||
_ = self.cancel.cancelled() => {
|
||||
// We were requested to shut down.
|
||||
let msg = "pageserver is shutting down";
|
||||
let _ = pgb.write_message_noflush(&BeMessage::ErrorResponse(msg, None));
|
||||
Err(QueryError::Shutdown)
|
||||
}
|
||||
|
||||
msg = pgb.read_message() => { msg.map_err(QueryError::from)}
|
||||
};
|
||||
|
||||
match msg {
|
||||
Ok(Some(message)) => {
|
||||
let copy_data_bytes = match message {
|
||||
FeMessage::CopyData(bytes) => bytes,
|
||||
FeMessage::CopyDone => { break },
|
||||
FeMessage::Sync => continue,
|
||||
FeMessage::Terminate => {
|
||||
let msg = "client terminated connection with Terminate message during COPY";
|
||||
let query_error = QueryError::Disconnected(ConnectionError::Io(io::Error::new(io::ErrorKind::ConnectionReset, msg)));
|
||||
// error can't happen here, ErrorResponse serialization should be always ok
|
||||
pgb.write_message_noflush(&BeMessage::ErrorResponse(msg, Some(query_error.pg_error_code()))).map_err(|e| e.into_io_error())?;
|
||||
Err(io::Error::new(io::ErrorKind::ConnectionReset, msg))?;
|
||||
break;
|
||||
}
|
||||
m => {
|
||||
let msg = format!("unexpected message {m:?}");
|
||||
// error can't happen here, ErrorResponse serialization should be always ok
|
||||
pgb.write_message_noflush(&BeMessage::ErrorResponse(&msg, None)).map_err(|e| e.into_io_error())?;
|
||||
Err(io::Error::new(io::ErrorKind::Other, msg))?;
|
||||
break;
|
||||
}
|
||||
};
|
||||
|
||||
yield copy_data_bytes;
|
||||
}
|
||||
Ok(None) => {
|
||||
let msg = "client closed connection during COPY";
|
||||
let query_error = QueryError::Disconnected(ConnectionError::Io(io::Error::new(io::ErrorKind::ConnectionReset, msg)));
|
||||
// error can't happen here, ErrorResponse serialization should be always ok
|
||||
pgb.write_message_noflush(&BeMessage::ErrorResponse(msg, Some(query_error.pg_error_code()))).map_err(|e| e.into_io_error())?;
|
||||
self.flush_cancellable(pgb).await.map_err(|e| io::Error::new(io::ErrorKind::Other, e.to_string()))?;
|
||||
Err(io::Error::new(io::ErrorKind::ConnectionReset, msg))?;
|
||||
}
|
||||
Err(QueryError::Disconnected(ConnectionError::Io(io_error))) => {
|
||||
Err(io_error)?;
|
||||
}
|
||||
Err(other) => {
|
||||
Err(io::Error::new(io::ErrorKind::Other, other.to_string()))?;
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -407,7 +372,7 @@ impl PageServerHandler {
|
||||
|
||||
// switch client to COPYBOTH
|
||||
pgb.write_message_noflush(&BeMessage::CopyBothResponse)?;
|
||||
self.flush_cancellable(pgb).await?;
|
||||
pgb.flush().await?;
|
||||
|
||||
let metrics = metrics::SmgrQueryTimePerTimeline::new(&tenant_id, &timeline_id);
|
||||
|
||||
@@ -415,10 +380,10 @@ impl PageServerHandler {
|
||||
let msg = tokio::select! {
|
||||
biased;
|
||||
|
||||
_ = self.cancel.cancelled() => {
|
||||
_ = task_mgr::shutdown_watcher() => {
|
||||
// We were requested to shut down.
|
||||
info!("shutdown request received in page handler");
|
||||
return Err(QueryError::Shutdown)
|
||||
break;
|
||||
}
|
||||
|
||||
msg = pgb.read_message() => { msg }
|
||||
@@ -500,7 +465,7 @@ impl PageServerHandler {
|
||||
});
|
||||
|
||||
pgb.write_message_noflush(&BeMessage::CopyData(&response.serialize()))?;
|
||||
self.flush_cancellable(pgb).await?;
|
||||
pgb.flush().await?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
@@ -543,9 +508,9 @@ impl PageServerHandler {
|
||||
// Import basebackup provided via CopyData
|
||||
info!("importing basebackup");
|
||||
pgb.write_message_noflush(&BeMessage::CopyInResponse)?;
|
||||
self.flush_cancellable(pgb).await?;
|
||||
pgb.flush().await?;
|
||||
|
||||
let mut copyin_reader = pin!(StreamReader::new(self.copyin_stream(pgb)));
|
||||
let mut copyin_reader = pin!(StreamReader::new(copyin_stream(pgb)));
|
||||
timeline
|
||||
.import_basebackup_from_tar(
|
||||
&mut copyin_reader,
|
||||
@@ -598,8 +563,8 @@ impl PageServerHandler {
|
||||
// Import wal provided via CopyData
|
||||
info!("importing wal");
|
||||
pgb.write_message_noflush(&BeMessage::CopyInResponse)?;
|
||||
self.flush_cancellable(pgb).await?;
|
||||
let mut copyin_reader = pin!(StreamReader::new(self.copyin_stream(pgb)));
|
||||
pgb.flush().await?;
|
||||
let mut copyin_reader = pin!(StreamReader::new(copyin_stream(pgb)));
|
||||
import_wal_from_tar(&timeline, &mut copyin_reader, start_lsn, end_lsn, &ctx).await?;
|
||||
info!("wal import complete");
|
||||
|
||||
@@ -807,7 +772,7 @@ impl PageServerHandler {
|
||||
|
||||
// switch client to COPYOUT
|
||||
pgb.write_message_noflush(&BeMessage::CopyOutResponse)?;
|
||||
self.flush_cancellable(pgb).await?;
|
||||
pgb.flush().await?;
|
||||
|
||||
// Send a tarball of the latest layer on the timeline. Compress if not
|
||||
// fullbackup. TODO Compress in that case too (tests need to be updated)
|
||||
@@ -859,7 +824,7 @@ impl PageServerHandler {
|
||||
}
|
||||
|
||||
pgb.write_message_noflush(&BeMessage::CopyDone)?;
|
||||
self.flush_cancellable(pgb).await?;
|
||||
pgb.flush().await?;
|
||||
|
||||
let basebackup_after = started
|
||||
.elapsed()
|
||||
|
||||
@@ -19,7 +19,6 @@ use postgres_ffi::BLCKSZ;
|
||||
use postgres_ffi::{Oid, TimestampTz, TransactionId};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::collections::{hash_map, HashMap, HashSet};
|
||||
use std::ops::ControlFlow;
|
||||
use std::ops::Range;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::{debug, trace, warn};
|
||||
@@ -371,6 +370,7 @@ impl Timeline {
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Subroutine of find_lsn_for_timestamp(). Returns true, if there are any
|
||||
/// commits that committed after 'search_timestamp', at LSN 'probe_lsn'.
|
||||
///
|
||||
@@ -385,50 +385,6 @@ impl Timeline {
|
||||
found_larger: &mut bool,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<bool, PageReconstructError> {
|
||||
self.map_all_timestamps(probe_lsn, ctx, |timestamp| {
|
||||
if timestamp >= search_timestamp {
|
||||
*found_larger = true;
|
||||
return ControlFlow::Break(true);
|
||||
} else {
|
||||
*found_smaller = true;
|
||||
}
|
||||
ControlFlow::Continue(())
|
||||
})
|
||||
.await
|
||||
}
|
||||
|
||||
/// Obtain the possible timestamp range for the given lsn.
|
||||
///
|
||||
/// If the lsn has no timestamps, returns None. returns `(min, max, median)` if it has timestamps.
|
||||
pub async fn get_timestamp_for_lsn(
|
||||
&self,
|
||||
probe_lsn: Lsn,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<Option<TimestampTz>, PageReconstructError> {
|
||||
let mut max: Option<TimestampTz> = None;
|
||||
self.map_all_timestamps(probe_lsn, ctx, |timestamp| {
|
||||
if let Some(max_prev) = max {
|
||||
max = Some(max_prev.max(timestamp));
|
||||
} else {
|
||||
max = Some(timestamp);
|
||||
}
|
||||
ControlFlow::Continue(())
|
||||
})
|
||||
.await?;
|
||||
|
||||
Ok(max)
|
||||
}
|
||||
|
||||
/// Runs the given function on all the timestamps for a given lsn
|
||||
///
|
||||
/// The return value is either given by the closure, or set to the `Default`
|
||||
/// impl's output.
|
||||
async fn map_all_timestamps<T: Default>(
|
||||
&self,
|
||||
probe_lsn: Lsn,
|
||||
ctx: &RequestContext,
|
||||
mut f: impl FnMut(TimestampTz) -> ControlFlow<T>,
|
||||
) -> Result<T, PageReconstructError> {
|
||||
for segno in self
|
||||
.list_slru_segments(SlruKind::Clog, probe_lsn, ctx)
|
||||
.await?
|
||||
@@ -446,14 +402,16 @@ impl Timeline {
|
||||
timestamp_bytes.copy_from_slice(&clog_page[BLCKSZ as usize..]);
|
||||
let timestamp = TimestampTz::from_be_bytes(timestamp_bytes);
|
||||
|
||||
match f(timestamp) {
|
||||
ControlFlow::Break(b) => return Ok(b),
|
||||
ControlFlow::Continue(()) => (),
|
||||
if timestamp >= search_timestamp {
|
||||
*found_larger = true;
|
||||
return Ok(true);
|
||||
} else {
|
||||
*found_smaller = true;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
Ok(Default::default())
|
||||
Ok(false)
|
||||
}
|
||||
|
||||
/// Get a list of SLRU segments
|
||||
@@ -541,24 +499,6 @@ impl Timeline {
|
||||
self.get(CHECKPOINT_KEY, lsn, ctx).await
|
||||
}
|
||||
|
||||
pub async fn list_aux_files(
|
||||
&self,
|
||||
lsn: Lsn,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<HashMap<String, Bytes>, PageReconstructError> {
|
||||
match self.get(AUX_FILES_KEY, lsn, ctx).await {
|
||||
Ok(buf) => match AuxFilesDirectory::des(&buf).context("deserialization failure") {
|
||||
Ok(dir) => Ok(dir.files),
|
||||
Err(e) => Err(PageReconstructError::from(e)),
|
||||
},
|
||||
Err(e) => {
|
||||
// This is expected: historical databases do not have the key.
|
||||
debug!("Failed to get info about AUX files: {}", e);
|
||||
Ok(HashMap::new())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Does the same as get_current_logical_size but counted on demand.
|
||||
/// Used to initialize the logical size tracking on startup.
|
||||
///
|
||||
@@ -676,9 +616,7 @@ impl Timeline {
|
||||
|
||||
result.add_key(CONTROLFILE_KEY);
|
||||
result.add_key(CHECKPOINT_KEY);
|
||||
if self.get(AUX_FILES_KEY, lsn, ctx).await.is_ok() {
|
||||
result.add_key(AUX_FILES_KEY);
|
||||
}
|
||||
|
||||
Ok(result.to_keyspace())
|
||||
}
|
||||
|
||||
@@ -754,12 +692,6 @@ impl<'a> DatadirModification<'a> {
|
||||
})?;
|
||||
self.put(DBDIR_KEY, Value::Image(buf.into()));
|
||||
|
||||
// Create AuxFilesDirectory
|
||||
let buf = AuxFilesDirectory::ser(&AuxFilesDirectory {
|
||||
files: HashMap::new(),
|
||||
})?;
|
||||
self.put(AUX_FILES_KEY, Value::Image(Bytes::from(buf)));
|
||||
|
||||
let buf = TwoPhaseDirectory::ser(&TwoPhaseDirectory {
|
||||
xids: HashSet::new(),
|
||||
})?;
|
||||
@@ -864,12 +796,6 @@ impl<'a> DatadirModification<'a> {
|
||||
// 'true', now write the updated 'dbdirs' map back.
|
||||
let buf = DbDirectory::ser(&dbdir)?;
|
||||
self.put(DBDIR_KEY, Value::Image(buf.into()));
|
||||
|
||||
// Create AuxFilesDirectory as well
|
||||
let buf = AuxFilesDirectory::ser(&AuxFilesDirectory {
|
||||
files: HashMap::new(),
|
||||
})?;
|
||||
self.put(AUX_FILES_KEY, Value::Image(Bytes::from(buf)));
|
||||
}
|
||||
if r.is_none() {
|
||||
// Create RelDirectory
|
||||
@@ -1194,37 +1120,6 @@ impl<'a> DatadirModification<'a> {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub async fn put_file(
|
||||
&mut self,
|
||||
path: &str,
|
||||
content: &[u8],
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<()> {
|
||||
let mut dir = match self.get(AUX_FILES_KEY, ctx).await {
|
||||
Ok(buf) => AuxFilesDirectory::des(&buf)?,
|
||||
Err(e) => {
|
||||
// This is expected: historical databases do not have the key.
|
||||
debug!("Failed to get info about AUX files: {}", e);
|
||||
AuxFilesDirectory {
|
||||
files: HashMap::new(),
|
||||
}
|
||||
}
|
||||
};
|
||||
let path = path.to_string();
|
||||
if content.is_empty() {
|
||||
dir.files.remove(&path);
|
||||
} else {
|
||||
dir.files.insert(path, Bytes::copy_from_slice(content));
|
||||
}
|
||||
self.put(
|
||||
AUX_FILES_KEY,
|
||||
Value::Image(Bytes::from(
|
||||
AuxFilesDirectory::ser(&dir).context("serialize")?,
|
||||
)),
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
///
|
||||
/// Flush changes accumulated so far to the underlying repository.
|
||||
///
|
||||
@@ -1360,11 +1255,6 @@ struct RelDirectory {
|
||||
rels: HashSet<(Oid, u8)>,
|
||||
}
|
||||
|
||||
#[derive(Debug, Serialize, Deserialize, Default)]
|
||||
struct AuxFilesDirectory {
|
||||
files: HashMap<String, Bytes>,
|
||||
}
|
||||
|
||||
#[derive(Debug, Serialize, Deserialize)]
|
||||
struct RelSizeEntry {
|
||||
nblocks: u32,
|
||||
@@ -1413,12 +1303,10 @@ static ZERO_PAGE: Bytes = Bytes::from_static(&[0u8; BLCKSZ as usize]);
|
||||
// 02 pg_twophase
|
||||
//
|
||||
// 03 misc
|
||||
// Controlfile
|
||||
// controlfile
|
||||
// checkpoint
|
||||
// pg_version
|
||||
//
|
||||
// 04 aux files
|
||||
//
|
||||
// Below is a full list of the keyspace allocation:
|
||||
//
|
||||
// DbDir:
|
||||
@@ -1456,11 +1344,6 @@ static ZERO_PAGE: Bytes = Bytes::from_static(&[0u8; BLCKSZ as usize]);
|
||||
//
|
||||
// Checkpoint:
|
||||
// 03 00000000 00000000 00000000 00 00000001
|
||||
//
|
||||
// AuxFiles:
|
||||
// 03 00000000 00000000 00000000 00 00000002
|
||||
//
|
||||
|
||||
//-- Section 01: relation data and metadata
|
||||
|
||||
const DBDIR_KEY: Key = Key {
|
||||
@@ -1684,15 +1567,6 @@ const CHECKPOINT_KEY: Key = Key {
|
||||
field6: 1,
|
||||
};
|
||||
|
||||
const AUX_FILES_KEY: Key = Key {
|
||||
field1: 0x03,
|
||||
field2: 0,
|
||||
field3: 0,
|
||||
field4: 0,
|
||||
field5: 0,
|
||||
field6: 2,
|
||||
};
|
||||
|
||||
// Reverse mappings for a few Keys.
|
||||
// These are needed by WAL redo manager.
|
||||
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -3,10 +3,10 @@ use std::sync::Arc;
|
||||
use anyhow::Context;
|
||||
use camino::{Utf8Path, Utf8PathBuf};
|
||||
use pageserver_api::models::TenantState;
|
||||
use remote_storage::{GenericRemoteStorage, RemotePath};
|
||||
use remote_storage::{DownloadError, GenericRemoteStorage, RemotePath};
|
||||
use tokio::sync::OwnedMutexGuard;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::{error, instrument, warn, Instrument, Span};
|
||||
use tracing::{error, info, instrument, warn, Instrument, Span};
|
||||
|
||||
use utils::{
|
||||
backoff, completion, crashsafe, fs_ext,
|
||||
@@ -25,11 +25,13 @@ use super::{
|
||||
remote_timeline_client::{FAILED_REMOTE_OP_RETRIES, FAILED_UPLOAD_WARN_THRESHOLD},
|
||||
span,
|
||||
timeline::delete::DeleteTimelineFlow,
|
||||
tree_sort_timelines, DeleteTimelineError, Tenant, TenantPreload,
|
||||
tree_sort_timelines, DeleteTimelineError, Tenant,
|
||||
};
|
||||
|
||||
const SHOULD_RESUME_DELETION_FETCH_MARK_ATTEMPTS: u32 = 3;
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum DeleteTenantError {
|
||||
pub enum DeleteTenantError {
|
||||
#[error("GetTenant {0}")]
|
||||
Get(#[from] GetTenantError),
|
||||
|
||||
@@ -58,7 +60,7 @@ fn remote_tenant_delete_mark_path(
|
||||
.context("Failed to strip workdir prefix")
|
||||
.and_then(RemotePath::new)
|
||||
.context("tenant path")?;
|
||||
Ok(tenant_remote_path.join(Utf8Path::new("timelines/deleted")))
|
||||
Ok(tenant_remote_path.join(Utf8Path::new("deleted")))
|
||||
}
|
||||
|
||||
async fn create_remote_delete_mark(
|
||||
@@ -148,8 +150,7 @@ async fn ensure_timelines_dir_empty(timelines_path: &Utf8Path) -> Result<(), Del
|
||||
// Assert timelines dir is empty.
|
||||
if !fs_ext::is_directory_empty(timelines_path).await? {
|
||||
// Display first 10 items in directory
|
||||
let list = fs_ext::list_dir(timelines_path).await.context("list_dir")?;
|
||||
let list = &list.into_iter().take(10).collect::<Vec<_>>();
|
||||
let list = &fs_ext::list_dir(timelines_path).await.context("list_dir")?[..10];
|
||||
return Err(DeleteTenantError::Other(anyhow::anyhow!(
|
||||
"Timelines directory is not empty after all timelines deletion: {list:?}"
|
||||
)));
|
||||
@@ -238,6 +239,32 @@ async fn cleanup_remaining_fs_traces(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) async fn remote_delete_mark_exists(
|
||||
conf: &PageServerConf,
|
||||
tenant_id: &TenantId,
|
||||
remote_storage: &GenericRemoteStorage,
|
||||
) -> anyhow::Result<bool> {
|
||||
// If remote storage is there we rely on it
|
||||
let remote_mark_path = remote_tenant_delete_mark_path(conf, tenant_id).context("path")?;
|
||||
|
||||
let result = backoff::retry(
|
||||
|| async { remote_storage.download(&remote_mark_path).await },
|
||||
|e| matches!(e, DownloadError::NotFound),
|
||||
SHOULD_RESUME_DELETION_FETCH_MARK_ATTEMPTS,
|
||||
SHOULD_RESUME_DELETION_FETCH_MARK_ATTEMPTS,
|
||||
"fetch_tenant_deletion_mark",
|
||||
// TODO: use a cancellation token (https://github.com/neondatabase/neon/issues/5066)
|
||||
backoff::Cancel::new(CancellationToken::new(), || unreachable!()),
|
||||
)
|
||||
.await;
|
||||
|
||||
match result {
|
||||
Ok(_) => Ok(true),
|
||||
Err(DownloadError::NotFound) => Ok(false),
|
||||
Err(e) => Err(anyhow::anyhow!(e)).context("remote_delete_mark_exists")?,
|
||||
}
|
||||
}
|
||||
|
||||
/// Orchestrates tenant shut down of all tasks, removes its in-memory structures,
|
||||
/// and deletes its data from both disk and s3.
|
||||
/// The sequence of steps:
|
||||
@@ -249,9 +276,10 @@ async fn cleanup_remaining_fs_traces(
|
||||
/// 6. Remove remote mark
|
||||
/// 7. Cleanup remaining fs traces, tenant dir, config, timelines dir, local delete mark
|
||||
/// It is resumable from any step in case a crash/restart occurs.
|
||||
/// There are two entrypoints to the process:
|
||||
/// There are three entrypoints to the process:
|
||||
/// 1. [`DeleteTenantFlow::run`] this is the main one called by a management api handler.
|
||||
/// 2. [`DeleteTenantFlow::resume_from_attach`] is called when deletion is resumed tenant is found to be deleted during attach process.
|
||||
/// 2. [`DeleteTenantFlow::resume_from_load`] is called during restarts when local or remote deletion marks are still there.
|
||||
/// 3. [`DeleteTenantFlow::resume_from_attach`] is called when deletion is resumed tenant is found to be deleted during attach process.
|
||||
/// Note the only other place that messes around timeline delete mark is the `Tenant::spawn_load` function.
|
||||
#[derive(Default)]
|
||||
pub enum DeleteTenantFlow {
|
||||
@@ -348,9 +376,9 @@ impl DeleteTenantFlow {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) async fn should_resume_deletion(
|
||||
pub async fn should_resume_deletion(
|
||||
conf: &'static PageServerConf,
|
||||
remote_mark_exists: bool,
|
||||
remote_storage: Option<&GenericRemoteStorage>,
|
||||
tenant: &Tenant,
|
||||
) -> Result<Option<DeletionGuard>, DeleteTenantError> {
|
||||
let acquire = |t: &Tenant| {
|
||||
@@ -361,25 +389,66 @@ impl DeleteTenantFlow {
|
||||
)
|
||||
};
|
||||
|
||||
if remote_mark_exists {
|
||||
return Ok(acquire(tenant));
|
||||
}
|
||||
|
||||
let tenant_id = tenant.tenant_id;
|
||||
// Check local mark first, if its there there is no need to go to s3 to check whether remote one exists.
|
||||
if conf.tenant_deleted_mark_file_path(&tenant_id).exists() {
|
||||
return Ok(acquire(tenant));
|
||||
}
|
||||
|
||||
let remote_storage = match remote_storage {
|
||||
Some(remote_storage) => remote_storage,
|
||||
None => return Ok(None),
|
||||
};
|
||||
|
||||
if remote_delete_mark_exists(conf, &tenant_id, remote_storage).await? {
|
||||
Ok(acquire(tenant))
|
||||
} else {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) async fn resume_from_load(
|
||||
guard: DeletionGuard,
|
||||
tenant: &Arc<Tenant>,
|
||||
init_order: Option<&InitializationOrder>,
|
||||
tenants: &'static tokio::sync::RwLock<TenantsMap>,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<(), DeleteTenantError> {
|
||||
let (_, progress) = completion::channel();
|
||||
|
||||
tenant
|
||||
.set_stopping(progress, true, false)
|
||||
.await
|
||||
.expect("cant be stopping or broken");
|
||||
|
||||
// Do not consume valuable resources during the load phase, continue deletion once init phase is complete.
|
||||
let background_jobs_can_start = init_order.as_ref().map(|x| &x.background_jobs_can_start);
|
||||
if let Some(background) = background_jobs_can_start {
|
||||
info!("waiting for backgound jobs barrier");
|
||||
background.clone().wait().await;
|
||||
info!("ready for backgound jobs barrier");
|
||||
}
|
||||
|
||||
// Tenant may not be loadable if we fail late in cleanup_remaining_fs_traces (e g remove timelines dir)
|
||||
let timelines_path = tenant.conf.timelines_path(&tenant.tenant_id);
|
||||
if timelines_path.exists() {
|
||||
tenant.load(init_order, ctx).await.context("load")?;
|
||||
}
|
||||
|
||||
Self::background(
|
||||
guard,
|
||||
tenant.conf,
|
||||
tenant.remote_storage.clone(),
|
||||
tenants,
|
||||
tenant,
|
||||
)
|
||||
.await
|
||||
}
|
||||
|
||||
pub(crate) async fn resume_from_attach(
|
||||
guard: DeletionGuard,
|
||||
tenant: &Arc<Tenant>,
|
||||
preload: Option<TenantPreload>,
|
||||
tenants: &'static tokio::sync::RwLock<TenantsMap>,
|
||||
init_order: Option<InitializationOrder>,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<(), DeleteTenantError> {
|
||||
let (_, progress) = completion::channel();
|
||||
@@ -389,10 +458,7 @@ impl DeleteTenantFlow {
|
||||
.await
|
||||
.expect("cant be stopping or broken");
|
||||
|
||||
tenant
|
||||
.attach(init_order, preload, ctx)
|
||||
.await
|
||||
.context("attach")?;
|
||||
tenant.attach(ctx).await.context("attach")?;
|
||||
|
||||
Self::background(
|
||||
guard,
|
||||
|
||||
@@ -354,7 +354,8 @@ mod tests {
|
||||
}
|
||||
|
||||
// Test a large blob that spans multiple pages
|
||||
let mut large_data = vec![0; 20000];
|
||||
let mut large_data = Vec::new();
|
||||
large_data.resize(20000, 0);
|
||||
thread_rng().fill_bytes(&mut large_data);
|
||||
let pos_large = file.write_blob(&large_data, &ctx).await?;
|
||||
let result = file.block_cursor().read_blob(pos_large, &ctx).await?;
|
||||
|
||||
@@ -639,10 +639,147 @@ impl LayerMap {
|
||||
}
|
||||
|
||||
println!("historic_layers:");
|
||||
for desc in self.iter_historic_layers() {
|
||||
desc.dump();
|
||||
for layer in self.iter_historic_layers() {
|
||||
layer.dump(verbose, ctx)?;
|
||||
}
|
||||
println!("End dump LayerMap");
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::LayerMap;
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
use std::str::FromStr;
|
||||
use std::sync::Arc;
|
||||
|
||||
mod l0_delta_layers_updated {
|
||||
|
||||
use crate::tenant::{
|
||||
storage_layer::{AsLayerDesc, PersistentLayerDesc},
|
||||
timeline::layer_manager::LayerFileManager,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
|
||||
struct LayerObject(PersistentLayerDesc);
|
||||
|
||||
impl AsLayerDesc for LayerObject {
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl LayerObject {
|
||||
fn new(desc: PersistentLayerDesc) -> Self {
|
||||
LayerObject(desc)
|
||||
}
|
||||
}
|
||||
|
||||
type TestLayerFileManager = LayerFileManager<LayerObject>;
|
||||
|
||||
#[test]
|
||||
fn for_full_range_delta() {
|
||||
// l0_delta_layers are used by compaction, and should observe all buffered updates
|
||||
l0_delta_layers_updated_scenario(
|
||||
"000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69",
|
||||
true
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn for_non_full_range_delta() {
|
||||
// has minimal uncovered areas compared to l0_delta_layers_updated_on_insert_replace_remove_for_full_range_delta
|
||||
l0_delta_layers_updated_scenario(
|
||||
"000000000000000000000000000000000001-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE__0000000053423C21-0000000053424D69",
|
||||
// because not full range
|
||||
false
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn for_image() {
|
||||
l0_delta_layers_updated_scenario(
|
||||
"000000000000000000000000000000000000-000000000000000000000000000000010000__0000000053424D69",
|
||||
// code only checks if it is a full range layer, doesn't care about images, which must
|
||||
// mean we should in practice never have full range images
|
||||
false
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn replacing_missing_l0_is_notfound() {
|
||||
// original impl had an oversight, and L0 was an anyhow::Error. anyhow::Error should
|
||||
// however only happen for precondition failures.
|
||||
|
||||
let layer = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69";
|
||||
let layer = LayerFileName::from_str(layer).unwrap();
|
||||
let layer = PersistentLayerDesc::from(layer);
|
||||
|
||||
// same skeletan construction; see scenario below
|
||||
let not_found = Arc::new(LayerObject::new(layer.clone()));
|
||||
let new_version = Arc::new(LayerObject::new(layer));
|
||||
|
||||
// after the immutable storage state refactor, the replace operation
|
||||
// will not use layer map any more. We keep it here for consistency in test cases
|
||||
// and can remove it in the future.
|
||||
let _map = LayerMap::default();
|
||||
|
||||
let mut mapping = TestLayerFileManager::new();
|
||||
|
||||
mapping
|
||||
.replace_and_verify(not_found, new_version)
|
||||
.unwrap_err();
|
||||
}
|
||||
|
||||
fn l0_delta_layers_updated_scenario(layer_name: &str, expected_l0: bool) {
|
||||
let name = LayerFileName::from_str(layer_name).unwrap();
|
||||
let skeleton = PersistentLayerDesc::from(name);
|
||||
|
||||
let remote = Arc::new(LayerObject::new(skeleton.clone()));
|
||||
let downloaded = Arc::new(LayerObject::new(skeleton));
|
||||
|
||||
let mut map = LayerMap::default();
|
||||
let mut mapping = LayerFileManager::new();
|
||||
|
||||
// two disjoint Arcs in different lifecycle phases. even if it seems they must be the
|
||||
// same layer, we use LayerMap::compare_arced_layers as the identity of layers.
|
||||
assert_eq!(remote.layer_desc(), downloaded.layer_desc());
|
||||
|
||||
let expected_in_counts = (1, usize::from(expected_l0));
|
||||
|
||||
map.batch_update()
|
||||
.insert_historic(remote.layer_desc().clone());
|
||||
mapping.insert(remote.clone());
|
||||
assert_eq!(
|
||||
count_layer_in(&map, remote.layer_desc()),
|
||||
expected_in_counts
|
||||
);
|
||||
|
||||
mapping
|
||||
.replace_and_verify(remote, downloaded.clone())
|
||||
.expect("name derived attributes are the same");
|
||||
assert_eq!(
|
||||
count_layer_in(&map, downloaded.layer_desc()),
|
||||
expected_in_counts
|
||||
);
|
||||
|
||||
map.batch_update().remove_historic(downloaded.layer_desc());
|
||||
assert_eq!(count_layer_in(&map, downloaded.layer_desc()), (0, 0));
|
||||
}
|
||||
|
||||
fn count_layer_in(map: &LayerMap, layer: &PersistentLayerDesc) -> (usize, usize) {
|
||||
let historic = map
|
||||
.iter_historic_layers()
|
||||
.filter(|x| x.key() == layer.key())
|
||||
.count();
|
||||
let l0s = map
|
||||
.get_level0_deltas()
|
||||
.expect("why does this return a result");
|
||||
let l0 = l0s.iter().filter(|x| x.key() == layer.key()).count();
|
||||
|
||||
(historic, l0)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
//! This module acts as a switchboard to access different repositories managed by this
|
||||
//! page server.
|
||||
|
||||
use camino::{Utf8DirEntry, Utf8Path, Utf8PathBuf};
|
||||
use camino::{Utf8Path, Utf8PathBuf};
|
||||
use rand::{distributions::Alphanumeric, Rng};
|
||||
use std::collections::{hash_map, HashMap};
|
||||
use std::sync::Arc;
|
||||
@@ -24,9 +24,11 @@ use crate::control_plane_client::{
|
||||
};
|
||||
use crate::deletion_queue::DeletionQueueClient;
|
||||
use crate::task_mgr::{self, TaskKind};
|
||||
use crate::tenant::config::{AttachmentMode, LocationConf, LocationMode, TenantConfOpt};
|
||||
use crate::tenant::config::{LocationConf, LocationMode, TenantConfOpt};
|
||||
use crate::tenant::delete::DeleteTenantFlow;
|
||||
use crate::tenant::{create_tenant_files, AttachedTenantConf, SpawnMode, Tenant, TenantState};
|
||||
use crate::tenant::{
|
||||
create_tenant_files, AttachedTenantConf, CreateTenantFilesMode, Tenant, TenantState,
|
||||
};
|
||||
use crate::{InitializationOrder, IGNORED_TENANT_FILE_NAME, TEMP_FILE_SUFFIX};
|
||||
|
||||
use utils::crashsafe::path_with_suffix_extension;
|
||||
@@ -48,7 +50,7 @@ use super::TenantSharedResources;
|
||||
/// its lifetime, and we can preserve some important safety invariants like `Tenant` always
|
||||
/// having a properly acquired generation (Secondary doesn't need a generation)
|
||||
#[derive(Clone)]
|
||||
pub(crate) enum TenantSlot {
|
||||
pub enum TenantSlot {
|
||||
Attached(Arc<Tenant>),
|
||||
Secondary,
|
||||
}
|
||||
@@ -149,49 +151,6 @@ async fn safe_rename_tenant_dir(path: impl AsRef<Utf8Path>) -> std::io::Result<U
|
||||
|
||||
static TENANTS: Lazy<RwLock<TenantsMap>> = Lazy::new(|| RwLock::new(TenantsMap::Initializing));
|
||||
|
||||
/// Create a directory, including parents. This does no fsyncs and makes
|
||||
/// no guarantees about the persistence of the resulting metadata: for
|
||||
/// use when creating dirs for use as cache.
|
||||
async fn unsafe_create_dir_all(path: &Utf8PathBuf) -> std::io::Result<()> {
|
||||
let mut dirs_to_create = Vec::new();
|
||||
let mut path: &Utf8Path = path.as_ref();
|
||||
|
||||
// Figure out which directories we need to create.
|
||||
loop {
|
||||
let meta = tokio::fs::metadata(path).await;
|
||||
match meta {
|
||||
Ok(metadata) if metadata.is_dir() => break,
|
||||
Ok(_) => {
|
||||
return Err(std::io::Error::new(
|
||||
std::io::ErrorKind::AlreadyExists,
|
||||
format!("non-directory found in path: {path}"),
|
||||
));
|
||||
}
|
||||
Err(ref e) if e.kind() == std::io::ErrorKind::NotFound => {}
|
||||
Err(e) => return Err(e),
|
||||
}
|
||||
|
||||
dirs_to_create.push(path);
|
||||
|
||||
match path.parent() {
|
||||
Some(parent) => path = parent,
|
||||
None => {
|
||||
return Err(std::io::Error::new(
|
||||
std::io::ErrorKind::InvalidInput,
|
||||
format!("can't find parent of path '{path}'"),
|
||||
));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Create directories from parent to child.
|
||||
for &path in dirs_to_create.iter().rev() {
|
||||
tokio::fs::create_dir(path).await?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn emergency_generations(
|
||||
tenant_confs: &HashMap<TenantId, anyhow::Result<LocationConf>>,
|
||||
) -> HashMap<TenantId, Generation> {
|
||||
@@ -247,105 +206,90 @@ async fn init_load_generations(
|
||||
if resources.remote_storage.is_some() {
|
||||
resources
|
||||
.deletion_queue_client
|
||||
.recover(generations.clone())?;
|
||||
.recover(generations.clone())
|
||||
.await?;
|
||||
}
|
||||
|
||||
Ok(Some(generations))
|
||||
}
|
||||
|
||||
/// Given a directory discovered in the pageserver's tenants/ directory, attempt
|
||||
/// to load a tenant config from it.
|
||||
///
|
||||
/// If file is missing, return Ok(None)
|
||||
fn load_tenant_config(
|
||||
conf: &'static PageServerConf,
|
||||
dentry: Utf8DirEntry,
|
||||
) -> anyhow::Result<Option<(TenantId, anyhow::Result<LocationConf>)>> {
|
||||
let tenant_dir_path = dentry.path().to_path_buf();
|
||||
if crate::is_temporary(&tenant_dir_path) {
|
||||
info!("Found temporary tenant directory, removing: {tenant_dir_path}");
|
||||
// No need to use safe_remove_tenant_dir_all because this is already
|
||||
// a temporary path
|
||||
if let Err(e) = std::fs::remove_dir_all(&tenant_dir_path) {
|
||||
error!(
|
||||
"Failed to remove temporary directory '{}': {:?}",
|
||||
tenant_dir_path, e
|
||||
);
|
||||
}
|
||||
return Ok(None);
|
||||
}
|
||||
|
||||
// This case happens if we crash during attachment before writing a config into the dir
|
||||
let is_empty = tenant_dir_path
|
||||
.is_empty_dir()
|
||||
.with_context(|| format!("Failed to check whether {tenant_dir_path:?} is an empty dir"))?;
|
||||
if is_empty {
|
||||
info!("removing empty tenant directory {tenant_dir_path:?}");
|
||||
if let Err(e) = std::fs::remove_dir(&tenant_dir_path) {
|
||||
error!(
|
||||
"Failed to remove empty tenant directory '{}': {e:#}",
|
||||
tenant_dir_path
|
||||
)
|
||||
}
|
||||
return Ok(None);
|
||||
}
|
||||
|
||||
let tenant_ignore_mark_file = tenant_dir_path.join(IGNORED_TENANT_FILE_NAME);
|
||||
if tenant_ignore_mark_file.exists() {
|
||||
info!("Found an ignore mark file {tenant_ignore_mark_file:?}, skipping the tenant");
|
||||
return Ok(None);
|
||||
}
|
||||
|
||||
let tenant_id = match tenant_dir_path
|
||||
.file_name()
|
||||
.unwrap_or_default()
|
||||
.parse::<TenantId>()
|
||||
{
|
||||
Ok(id) => id,
|
||||
Err(_) => {
|
||||
warn!("Invalid tenant path (garbage in our repo directory?): {tenant_dir_path}",);
|
||||
return Ok(None);
|
||||
}
|
||||
};
|
||||
|
||||
Ok(Some((
|
||||
tenant_id,
|
||||
Tenant::load_tenant_config(conf, &tenant_id),
|
||||
)))
|
||||
}
|
||||
|
||||
/// Initial stage of load: walk the local tenants directory, clean up any temp files,
|
||||
/// and load configurations for the tenants we found.
|
||||
///
|
||||
/// Do this in parallel, because we expect 10k+ tenants, so serial execution can take
|
||||
/// seconds even on reasonably fast drives.
|
||||
async fn init_load_tenant_configs(
|
||||
conf: &'static PageServerConf,
|
||||
) -> anyhow::Result<HashMap<TenantId, anyhow::Result<LocationConf>>> {
|
||||
let tenants_dir = conf.tenants_path();
|
||||
|
||||
let dentries = tokio::task::spawn_blocking(move || -> anyhow::Result<Vec<Utf8DirEntry>> {
|
||||
let dir_entries = tenants_dir
|
||||
.read_dir_utf8()
|
||||
.with_context(|| format!("Failed to list tenants dir {tenants_dir:?}"))?;
|
||||
|
||||
Ok(dir_entries.collect::<Result<Vec<_>, std::io::Error>>()?)
|
||||
})
|
||||
.await??;
|
||||
let mut dir_entries = tenants_dir
|
||||
.read_dir_utf8()
|
||||
.with_context(|| format!("Failed to list tenants dir {tenants_dir:?}"))?;
|
||||
|
||||
let mut configs = HashMap::new();
|
||||
|
||||
let mut join_set = JoinSet::new();
|
||||
for dentry in dentries {
|
||||
join_set.spawn_blocking(move || load_tenant_config(conf, dentry));
|
||||
}
|
||||
loop {
|
||||
match dir_entries.next() {
|
||||
None => break,
|
||||
Some(Ok(dentry)) => {
|
||||
let tenant_dir_path = dentry.path().to_path_buf();
|
||||
if crate::is_temporary(&tenant_dir_path) {
|
||||
info!("Found temporary tenant directory, removing: {tenant_dir_path}");
|
||||
// No need to use safe_remove_tenant_dir_all because this is already
|
||||
// a temporary path
|
||||
if let Err(e) = fs::remove_dir_all(&tenant_dir_path).await {
|
||||
error!(
|
||||
"Failed to remove temporary directory '{}': {:?}",
|
||||
tenant_dir_path, e
|
||||
);
|
||||
}
|
||||
continue;
|
||||
}
|
||||
|
||||
while let Some(r) = join_set.join_next().await {
|
||||
if let Some((tenant_id, tenant_config)) = r?? {
|
||||
configs.insert(tenant_id, tenant_config);
|
||||
// This case happens if we:
|
||||
// * crash during attach before creating the attach marker file
|
||||
// * crash during tenant delete before removing tenant directory
|
||||
let is_empty = tenant_dir_path.is_empty_dir().with_context(|| {
|
||||
format!("Failed to check whether {tenant_dir_path:?} is an empty dir")
|
||||
})?;
|
||||
if is_empty {
|
||||
info!("removing empty tenant directory {tenant_dir_path:?}");
|
||||
if let Err(e) = fs::remove_dir(&tenant_dir_path).await {
|
||||
error!(
|
||||
"Failed to remove empty tenant directory '{}': {e:#}",
|
||||
tenant_dir_path
|
||||
)
|
||||
}
|
||||
continue;
|
||||
}
|
||||
|
||||
let tenant_ignore_mark_file = tenant_dir_path.join(IGNORED_TENANT_FILE_NAME);
|
||||
if tenant_ignore_mark_file.exists() {
|
||||
info!("Found an ignore mark file {tenant_ignore_mark_file:?}, skipping the tenant");
|
||||
continue;
|
||||
}
|
||||
|
||||
let tenant_id = match tenant_dir_path
|
||||
.file_name()
|
||||
.unwrap_or_default()
|
||||
.parse::<TenantId>()
|
||||
{
|
||||
Ok(id) => id,
|
||||
Err(_) => {
|
||||
warn!(
|
||||
"Invalid tenant path (garbage in our repo directory?): {tenant_dir_path}",
|
||||
);
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
configs.insert(tenant_id, Tenant::load_tenant_config(conf, &tenant_id));
|
||||
}
|
||||
Some(Err(e)) => {
|
||||
// An error listing the top level directory indicates serious problem
|
||||
// with local filesystem: we will fail to load, and fail to start.
|
||||
anyhow::bail!(e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Ok(configs)
|
||||
}
|
||||
|
||||
@@ -434,15 +378,14 @@ pub async fn init_tenant_mgr(
|
||||
location_conf.attach_in_generation(generation);
|
||||
Tenant::persist_tenant_config(conf, &tenant_id, &location_conf).await?;
|
||||
|
||||
match tenant_spawn(
|
||||
match schedule_local_tenant_processing(
|
||||
conf,
|
||||
tenant_id,
|
||||
&tenant_dir_path,
|
||||
resources.clone(),
|
||||
AttachedTenantConf::try_from(location_conf)?,
|
||||
resources.clone(),
|
||||
Some(init_order.clone()),
|
||||
&TENANTS,
|
||||
SpawnMode::Normal,
|
||||
&ctx,
|
||||
) {
|
||||
Ok(tenant) => {
|
||||
@@ -462,18 +405,15 @@ pub async fn init_tenant_mgr(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Wrapper for Tenant::spawn that checks invariants before running, and inserts
|
||||
/// a broken tenant in the map if Tenant::spawn fails.
|
||||
#[allow(clippy::too_many_arguments)]
|
||||
pub(crate) fn tenant_spawn(
|
||||
pub(crate) fn schedule_local_tenant_processing(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
tenant_path: &Utf8Path,
|
||||
resources: TenantSharedResources,
|
||||
location_conf: AttachedTenantConf,
|
||||
resources: TenantSharedResources,
|
||||
init_order: Option<InitializationOrder>,
|
||||
tenants: &'static tokio::sync::RwLock<TenantsMap>,
|
||||
mode: SpawnMode,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<Arc<Tenant>> {
|
||||
anyhow::ensure!(
|
||||
@@ -497,24 +437,37 @@ pub(crate) fn tenant_spawn(
|
||||
"Cannot load tenant, ignore mark found at {tenant_ignore_mark:?}"
|
||||
);
|
||||
|
||||
info!("Attaching tenant {tenant_id}");
|
||||
let tenant = match Tenant::spawn(
|
||||
conf,
|
||||
tenant_id,
|
||||
resources,
|
||||
location_conf,
|
||||
init_order,
|
||||
tenants,
|
||||
mode,
|
||||
ctx,
|
||||
) {
|
||||
Ok(tenant) => tenant,
|
||||
Err(e) => {
|
||||
error!("Failed to spawn tenant {tenant_id}, reason: {e:#}");
|
||||
Tenant::create_broken_tenant(conf, tenant_id, format!("{e:#}"))
|
||||
let tenant = if conf.tenant_attaching_mark_file_path(&tenant_id).exists() {
|
||||
info!("tenant {tenant_id} has attaching mark file, resuming its attach operation");
|
||||
if resources.remote_storage.is_none() {
|
||||
warn!("tenant {tenant_id} has attaching mark file, but pageserver has no remote storage configured");
|
||||
Tenant::create_broken_tenant(
|
||||
conf,
|
||||
tenant_id,
|
||||
"attaching mark file present but no remote storage configured".to_string(),
|
||||
)
|
||||
} else {
|
||||
match Tenant::spawn_attach(conf, tenant_id, resources, location_conf, tenants, ctx) {
|
||||
Ok(tenant) => tenant,
|
||||
Err(e) => {
|
||||
error!("Failed to spawn_attach tenant {tenant_id}, reason: {e:#}");
|
||||
Tenant::create_broken_tenant(conf, tenant_id, format!("{e:#}"))
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
info!("tenant {tenant_id} is assumed to be loadable, starting load operation");
|
||||
// Start loading the tenant into memory. It will initially be in Loading state.
|
||||
Tenant::spawn_load(
|
||||
conf,
|
||||
tenant_id,
|
||||
location_conf,
|
||||
resources,
|
||||
init_order,
|
||||
tenants,
|
||||
ctx,
|
||||
)
|
||||
};
|
||||
|
||||
Ok(tenant)
|
||||
}
|
||||
|
||||
@@ -529,7 +482,7 @@ pub(crate) fn tenant_spawn(
|
||||
/// management API. For example, it could attach the tenant on a different pageserver.
|
||||
/// We would then be in split-brain once this pageserver restarts.
|
||||
#[instrument(skip_all)]
|
||||
pub(crate) async fn shutdown_all_tenants() {
|
||||
pub async fn shutdown_all_tenants() {
|
||||
shutdown_all_tenants0(&TENANTS).await
|
||||
}
|
||||
|
||||
@@ -641,7 +594,7 @@ async fn shutdown_all_tenants0(tenants: &tokio::sync::RwLock<TenantsMap>) {
|
||||
// caller will log how long we took
|
||||
}
|
||||
|
||||
pub(crate) async fn create_tenant(
|
||||
pub async fn create_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_conf: TenantConfOpt,
|
||||
tenant_id: TenantId,
|
||||
@@ -650,52 +603,40 @@ pub(crate) async fn create_tenant(
|
||||
ctx: &RequestContext,
|
||||
) -> Result<Arc<Tenant>, TenantMapInsertError> {
|
||||
tenant_map_insert(tenant_id, || async {
|
||||
|
||||
let location_conf = LocationConf::attached_single(tenant_conf, generation);
|
||||
|
||||
// We're holding the tenants lock in write mode while doing local IO.
|
||||
// If this section ever becomes contentious, introduce a new `TenantState::Creating`
|
||||
// and do the work in that state.
|
||||
super::create_tenant_files(conf, &location_conf, &tenant_id).await?;
|
||||
|
||||
let tenant_directory = super::create_tenant_files(conf, &location_conf, &tenant_id, CreateTenantFilesMode::Create).await?;
|
||||
// TODO: tenant directory remains on disk if we bail out from here on.
|
||||
// See https://github.com/neondatabase/neon/issues/4233
|
||||
|
||||
let tenant_path = conf.tenant_path(&tenant_id);
|
||||
|
||||
let created_tenant = tenant_spawn(
|
||||
conf,
|
||||
tenant_id,
|
||||
&tenant_path,
|
||||
resources,
|
||||
AttachedTenantConf::try_from(location_conf)?,
|
||||
None,
|
||||
&TENANTS,
|
||||
SpawnMode::Create,
|
||||
ctx,
|
||||
)?;
|
||||
let created_tenant =
|
||||
schedule_local_tenant_processing(conf, tenant_id, &tenant_directory,
|
||||
AttachedTenantConf::try_from(location_conf)?, resources, None, &TENANTS, ctx)?;
|
||||
// TODO: tenant object & its background loops remain, untracked in tenant map, if we fail here.
|
||||
// See https://github.com/neondatabase/neon/issues/4233
|
||||
|
||||
let crated_tenant_id = created_tenant.tenant_id();
|
||||
anyhow::ensure!(
|
||||
tenant_id == crated_tenant_id,
|
||||
"loaded created tenant has unexpected tenant id \
|
||||
(expect {tenant_id} != actual {crated_tenant_id})",
|
||||
);
|
||||
tenant_id == crated_tenant_id,
|
||||
"loaded created tenant has unexpected tenant id (expect {tenant_id} != actual {crated_tenant_id})",
|
||||
);
|
||||
Ok(created_tenant)
|
||||
})
|
||||
.await
|
||||
}).await
|
||||
}
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum SetNewTenantConfigError {
|
||||
pub enum SetNewTenantConfigError {
|
||||
#[error(transparent)]
|
||||
GetTenant(#[from] GetTenantError),
|
||||
#[error(transparent)]
|
||||
Persist(anyhow::Error),
|
||||
}
|
||||
|
||||
pub(crate) async fn set_new_tenant_config(
|
||||
pub async fn set_new_tenant_config(
|
||||
conf: &'static PageServerConf,
|
||||
new_tenant_conf: TenantConfOpt,
|
||||
tenant_id: TenantId,
|
||||
@@ -715,7 +656,7 @@ pub(crate) async fn set_new_tenant_config(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[instrument(skip_all, fields(%tenant_id))]
|
||||
#[instrument(skip_all, fields(tenant_id, new_location_config))]
|
||||
pub(crate) async fn upsert_location(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
@@ -754,18 +695,6 @@ pub(crate) async fn upsert_location(
|
||||
|
||||
if let Some(tenant) = shutdown_tenant {
|
||||
let (_guard, progress) = utils::completion::channel();
|
||||
|
||||
match tenant.get_attach_mode() {
|
||||
AttachmentMode::Single | AttachmentMode::Multi => {
|
||||
// Before we leave our state as the presumed holder of the latest generation,
|
||||
// flush any outstanding deletions to reduce the risk of leaking objects.
|
||||
deletion_queue_client.flush_advisory()
|
||||
}
|
||||
AttachmentMode::Stale => {
|
||||
// If we're stale there's not point trying to flush deletions
|
||||
}
|
||||
};
|
||||
|
||||
info!("Shutting down attached tenant");
|
||||
match tenant.shutdown(progress, false).await {
|
||||
Ok(()) => {}
|
||||
@@ -793,56 +722,37 @@ pub(crate) async fn upsert_location(
|
||||
}
|
||||
}
|
||||
|
||||
let tenant_path = conf.tenant_path(&tenant_id);
|
||||
|
||||
let new_slot = match &new_location_config.mode {
|
||||
LocationMode::Secondary(_) => {
|
||||
// Directory doesn't need to be fsync'd because if we crash it can
|
||||
// safely be recreated next time this tenant location is configured.
|
||||
unsafe_create_dir_all(&tenant_path)
|
||||
.await
|
||||
.with_context(|| format!("Creating {tenant_path}"))?;
|
||||
|
||||
Tenant::persist_tenant_config(conf, &tenant_id, &new_location_config)
|
||||
.await
|
||||
.map_err(SetNewTenantConfigError::Persist)?;
|
||||
|
||||
TenantSlot::Secondary
|
||||
}
|
||||
LocationMode::Secondary(_) => TenantSlot::Secondary,
|
||||
LocationMode::Attached(_attach_config) => {
|
||||
// Do a schedule_local_tenant_processing
|
||||
// FIXME: should avoid doing this disk I/O inside the TenantsMap lock,
|
||||
// we have the same problem in load_tenant/attach_tenant. Probably
|
||||
// need a lock in TenantSlot to fix this.
|
||||
let timelines_path = conf.timelines_path(&tenant_id);
|
||||
|
||||
// Directory doesn't need to be fsync'd because we do not depend on
|
||||
// it to exist after crashes: it may be recreated when tenant is
|
||||
// re-attached, see https://github.com/neondatabase/neon/issues/5550
|
||||
unsafe_create_dir_all(&timelines_path)
|
||||
.await
|
||||
.with_context(|| format!("Creating {timelines_path}"))?;
|
||||
|
||||
Tenant::persist_tenant_config(conf, &tenant_id, &new_location_config)
|
||||
.await
|
||||
.map_err(SetNewTenantConfigError::Persist)?;
|
||||
|
||||
let tenant = tenant_spawn(
|
||||
let tenant_path = conf.tenant_path(&tenant_id);
|
||||
let resources = TenantSharedResources {
|
||||
broker_client,
|
||||
remote_storage,
|
||||
deletion_queue_client,
|
||||
};
|
||||
let new_tenant = schedule_local_tenant_processing(
|
||||
conf,
|
||||
tenant_id,
|
||||
&tenant_path,
|
||||
TenantSharedResources {
|
||||
broker_client,
|
||||
remote_storage,
|
||||
deletion_queue_client,
|
||||
},
|
||||
AttachedTenantConf::try_from(new_location_config)?,
|
||||
resources,
|
||||
None,
|
||||
&TENANTS,
|
||||
SpawnMode::Normal,
|
||||
ctx,
|
||||
)?;
|
||||
)
|
||||
.with_context(|| {
|
||||
format!("Failed to schedule tenant processing in path {tenant_path:?}")
|
||||
})?;
|
||||
|
||||
TenantSlot::Attached(tenant)
|
||||
TenantSlot::Attached(new_tenant)
|
||||
}
|
||||
};
|
||||
|
||||
@@ -850,11 +760,12 @@ pub(crate) async fn upsert_location(
|
||||
})
|
||||
.await?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum GetTenantError {
|
||||
pub enum GetTenantError {
|
||||
#[error("Tenant {0} not found")]
|
||||
NotFound(TenantId),
|
||||
#[error("Tenant {0} is not active")]
|
||||
@@ -870,7 +781,7 @@ pub(crate) enum GetTenantError {
|
||||
/// `active_only = true` allows to query only tenants that are ready for operations, erroring on other kinds of tenants.
|
||||
///
|
||||
/// This method is cancel-safe.
|
||||
pub(crate) async fn get_tenant(
|
||||
pub async fn get_tenant(
|
||||
tenant_id: TenantId,
|
||||
active_only: bool,
|
||||
) -> Result<Arc<Tenant>, GetTenantError> {
|
||||
@@ -895,7 +806,7 @@ pub(crate) async fn get_tenant(
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) async fn delete_tenant(
|
||||
pub async fn delete_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
tenant_id: TenantId,
|
||||
@@ -904,7 +815,7 @@ pub(crate) async fn delete_tenant(
|
||||
}
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum DeleteTimelineError {
|
||||
pub enum DeleteTimelineError {
|
||||
#[error("Tenant {0}")]
|
||||
Tenant(#[from] GetTenantError),
|
||||
|
||||
@@ -912,7 +823,7 @@ pub(crate) enum DeleteTimelineError {
|
||||
Timeline(#[from] crate::tenant::DeleteTimelineError),
|
||||
}
|
||||
|
||||
pub(crate) async fn delete_timeline(
|
||||
pub async fn delete_timeline(
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
_ctx: &RequestContext,
|
||||
@@ -923,29 +834,23 @@ pub(crate) async fn delete_timeline(
|
||||
}
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum TenantStateError {
|
||||
pub enum TenantStateError {
|
||||
#[error("Tenant {0} not found")]
|
||||
NotFound(TenantId),
|
||||
#[error("Tenant {0} is stopping")]
|
||||
IsStopping(TenantId),
|
||||
#[error("Tenant {0} is not active")]
|
||||
NotActive(TenantId),
|
||||
#[error(transparent)]
|
||||
Other(#[from] anyhow::Error),
|
||||
}
|
||||
|
||||
pub(crate) async fn detach_tenant(
|
||||
pub async fn detach_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
detach_ignored: bool,
|
||||
deletion_queue_client: &DeletionQueueClient,
|
||||
) -> Result<(), TenantStateError> {
|
||||
let tmp_path = detach_tenant0(
|
||||
conf,
|
||||
&TENANTS,
|
||||
tenant_id,
|
||||
detach_ignored,
|
||||
deletion_queue_client,
|
||||
)
|
||||
.await?;
|
||||
let tmp_path = detach_tenant0(conf, &TENANTS, tenant_id, detach_ignored).await?;
|
||||
// Although we are cleaning up the tenant, this task is not meant to be bound by the lifetime of the tenant in memory.
|
||||
// After a tenant is detached, there are no more task_mgr tasks for that tenant_id.
|
||||
let task_tenant_id = None;
|
||||
@@ -970,7 +875,6 @@ async fn detach_tenant0(
|
||||
tenants: &tokio::sync::RwLock<TenantsMap>,
|
||||
tenant_id: TenantId,
|
||||
detach_ignored: bool,
|
||||
deletion_queue_client: &DeletionQueueClient,
|
||||
) -> Result<Utf8PathBuf, TenantStateError> {
|
||||
let tenant_dir_rename_operation = |tenant_id_to_clean| async move {
|
||||
let local_tenant_directory = conf.tenant_path(&tenant_id_to_clean);
|
||||
@@ -982,10 +886,6 @@ async fn detach_tenant0(
|
||||
let removal_result =
|
||||
remove_tenant_from_memory(tenants, tenant_id, tenant_dir_rename_operation(tenant_id)).await;
|
||||
|
||||
// Flush pending deletions, so that they have a good chance of passing validation
|
||||
// before this tenant is potentially re-attached elsewhere.
|
||||
deletion_queue_client.flush_advisory();
|
||||
|
||||
// Ignored tenants are not present in memory and will bail the removal from memory operation.
|
||||
// Before returning the error, check for ignored tenant removal case — we only need to clean its local files then.
|
||||
if detach_ignored && matches!(removal_result, Err(TenantStateError::NotFound(_))) {
|
||||
@@ -1002,7 +902,7 @@ async fn detach_tenant0(
|
||||
removal_result
|
||||
}
|
||||
|
||||
pub(crate) async fn load_tenant(
|
||||
pub async fn load_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
@@ -1029,7 +929,7 @@ pub(crate) async fn load_tenant(
|
||||
location_conf.attach_in_generation(generation);
|
||||
Tenant::persist_tenant_config(conf, &tenant_id, &location_conf).await?;
|
||||
|
||||
let new_tenant = tenant_spawn(conf, tenant_id, &tenant_path, resources, AttachedTenantConf::try_from(location_conf)?, None, &TENANTS, SpawnMode::Normal, ctx)
|
||||
let new_tenant = schedule_local_tenant_processing(conf, tenant_id, &tenant_path, AttachedTenantConf::try_from(location_conf)?, resources, None, &TENANTS, ctx)
|
||||
.with_context(|| {
|
||||
format!("Failed to schedule tenant processing in path {tenant_path:?}")
|
||||
})?;
|
||||
@@ -1039,7 +939,7 @@ pub(crate) async fn load_tenant(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) async fn ignore_tenant(
|
||||
pub async fn ignore_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
) -> Result<(), TenantStateError> {
|
||||
@@ -1067,7 +967,7 @@ async fn ignore_tenant0(
|
||||
}
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum TenantMapListError {
|
||||
pub enum TenantMapListError {
|
||||
#[error("tenant map is still initiailizing")]
|
||||
Initializing,
|
||||
}
|
||||
@@ -1075,7 +975,7 @@ pub(crate) enum TenantMapListError {
|
||||
///
|
||||
/// Get list of tenants, for the mgmt API
|
||||
///
|
||||
pub(crate) async fn list_tenants() -> Result<Vec<(TenantId, TenantState)>, TenantMapListError> {
|
||||
pub async fn list_tenants() -> Result<Vec<(TenantId, TenantState)>, TenantMapListError> {
|
||||
let tenants = TENANTS.read().await;
|
||||
let m = match &*tenants {
|
||||
TenantsMap::Initializing => return Err(TenantMapListError::Initializing),
|
||||
@@ -1093,7 +993,7 @@ pub(crate) async fn list_tenants() -> Result<Vec<(TenantId, TenantState)>, Tenan
|
||||
///
|
||||
/// Downloading all the tenant data is performed in the background, this merely
|
||||
/// spawns the background task and returns quickly.
|
||||
pub(crate) async fn attach_tenant(
|
||||
pub async fn attach_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
@@ -1103,12 +1003,18 @@ pub(crate) async fn attach_tenant(
|
||||
) -> Result<(), TenantMapInsertError> {
|
||||
tenant_map_insert(tenant_id, || async {
|
||||
let location_conf = LocationConf::attached_single(tenant_conf, generation);
|
||||
let tenant_dir = create_tenant_files(conf, &location_conf, &tenant_id).await?;
|
||||
let tenant_dir = create_tenant_files(conf, &location_conf, &tenant_id, CreateTenantFilesMode::Attach).await?;
|
||||
// TODO: tenant directory remains on disk if we bail out from here on.
|
||||
// See https://github.com/neondatabase/neon/issues/4233
|
||||
|
||||
let attached_tenant = tenant_spawn(conf, tenant_id, &tenant_dir,
|
||||
resources, AttachedTenantConf::try_from(location_conf)?, None, &TENANTS, SpawnMode::Normal, ctx)?;
|
||||
// Without the attach marker, schedule_local_tenant_processing will treat the attached tenant as fully attached
|
||||
let marker_file_exists = conf
|
||||
.tenant_attaching_mark_file_path(&tenant_id)
|
||||
.try_exists()
|
||||
.context("check for attach marker file existence")?;
|
||||
anyhow::ensure!(marker_file_exists, "create_tenant_files should have created the attach marker file");
|
||||
|
||||
let attached_tenant = schedule_local_tenant_processing(conf, tenant_id, &tenant_dir, AttachedTenantConf::try_from(location_conf)?, resources, None, &TENANTS, ctx)?;
|
||||
// TODO: tenant object & its background loops remain, untracked in tenant map, if we fail here.
|
||||
// See https://github.com/neondatabase/neon/issues/4233
|
||||
|
||||
@@ -1124,7 +1030,7 @@ pub(crate) async fn attach_tenant(
|
||||
}
|
||||
|
||||
#[derive(Debug, thiserror::Error)]
|
||||
pub(crate) enum TenantMapInsertError {
|
||||
pub enum TenantMapInsertError {
|
||||
#[error("tenant map is still initializing")]
|
||||
StillInitializing,
|
||||
#[error("tenant map is shutting down")]
|
||||
@@ -1287,7 +1193,7 @@ use {
|
||||
utils::http::error::ApiError,
|
||||
};
|
||||
|
||||
pub(crate) async fn immediate_gc(
|
||||
pub async fn immediate_gc(
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
gc_req: TimelineGcRequest,
|
||||
|
||||
@@ -57,7 +57,8 @@ pub fn par_fsync(paths: &[Utf8PathBuf]) -> io::Result<()> {
|
||||
fsync_in_thread_pool(paths)
|
||||
}
|
||||
|
||||
/// Parallel fsync asynchronously.
|
||||
/// Parallel fsync asynchronously. If number of files are less than PARALLEL_PATH_THRESHOLD, fsync is done in the current
|
||||
/// execution thread. Otherwise, we will spawn_blocking and run it in tokio.
|
||||
pub async fn par_fsync_async(paths: &[Utf8PathBuf]) -> io::Result<()> {
|
||||
const MAX_CONCURRENT_FSYNC: usize = 64;
|
||||
let mut next = paths.iter().peekable();
|
||||
|
||||
@@ -167,15 +167,39 @@
|
||||
//! - download their remote [`IndexPart`]s
|
||||
//! - create `Timeline` struct and a `RemoteTimelineClient`
|
||||
//! - initialize the client's upload queue with its `IndexPart`
|
||||
//! - create [`RemoteLayer`](super::storage_layer::RemoteLayer) instances
|
||||
//! for layers that are referenced by `IndexPart` but not present locally
|
||||
//! - schedule uploads for layers that are only present locally.
|
||||
//! - if the remote `IndexPart`'s metadata was newer than the metadata in
|
||||
//! the local filesystem, write the remote metadata to the local filesystem
|
||||
//! - After the above is done for each timeline, open the tenant for business by
|
||||
//! transitioning it from `TenantState::Attaching` to `TenantState::Active` state.
|
||||
//! This starts the timelines' WAL-receivers and the tenant's GC & Compaction loops.
|
||||
//!
|
||||
//! We keep track of the fact that a client is in `Attaching` state in a marker
|
||||
//! file on the local disk. This is critical because, when we restart the pageserver,
|
||||
//! we do not want to do the `List timelines` step for each tenant that has already
|
||||
//! been successfully attached (for performance & cost reasons).
|
||||
//! Instead, for a tenant without the attach marker file, we assume that the
|
||||
//! local state is in sync or ahead of the remote state. This includes the list
|
||||
//! of all of the tenant's timelines, which is particularly critical to be up-to-date:
|
||||
//! if there's a timeline on the remote that the pageserver doesn't know about,
|
||||
//! the GC will not consider its branch point, leading to data loss.
|
||||
//! So, for a tenant with the attach marker file, we know that we do not yet have
|
||||
//! persisted all the remote timeline's metadata files locally. To exclude the
|
||||
//! risk above, we re-run the procedure for such tenants
|
||||
//!
|
||||
//! # Operating Without Remote Storage
|
||||
//!
|
||||
//! If no remote storage configuration is provided, the [`RemoteTimelineClient`] is
|
||||
//! not created and the uploads are skipped.
|
||||
//! Theoretically, it should be ok to remove and re-add remote storage configuration to
|
||||
//! the pageserver config at any time, since it doesn't make a difference to
|
||||
//! [`Timeline::load_layer_map`].
|
||||
//! Of course, the remote timeline dir must not change while we have de-configured
|
||||
//! remote storage, i.e., the pageserver must remain the owner of the given prefix
|
||||
//! in remote storage.
|
||||
//! But note that we don't test any of this right now.
|
||||
//!
|
||||
//! [`Tenant::timeline_init_and_sync`]: super::Tenant::timeline_init_and_sync
|
||||
//! [`Timeline::load_layer_map`]: super::Timeline::load_layer_map
|
||||
@@ -187,7 +211,8 @@ mod upload;
|
||||
use anyhow::Context;
|
||||
use camino::Utf8Path;
|
||||
use chrono::{NaiveDateTime, Utc};
|
||||
|
||||
// re-export these
|
||||
pub use download::{is_temp_download_file, list_remote_timelines};
|
||||
use scopeguard::ScopeGuard;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use utils::backoff::{
|
||||
@@ -212,7 +237,7 @@ use crate::metrics::{
|
||||
};
|
||||
use crate::task_mgr::shutdown_token;
|
||||
use crate::tenant::debug_assert_current_span_has_tenant_and_timeline_id;
|
||||
use crate::tenant::storage_layer::AsLayerDesc;
|
||||
use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
|
||||
use crate::tenant::upload_queue::Delete;
|
||||
use crate::tenant::TIMELINES_SEGMENT_NAME;
|
||||
use crate::{
|
||||
@@ -230,13 +255,10 @@ use utils::id::{TenantId, TimelineId};
|
||||
|
||||
use self::index::IndexPart;
|
||||
|
||||
use super::storage_layer::{Layer, LayerFileName, ResidentLayer};
|
||||
use super::storage_layer::LayerFileName;
|
||||
use super::upload_queue::SetDeletedFlagProgress;
|
||||
use super::Generation;
|
||||
|
||||
pub(crate) use download::{is_temp_download_file, list_remote_timelines};
|
||||
pub(crate) use index::LayerFileMetadata;
|
||||
|
||||
// Occasional network issues and such can cause remote operations to fail, and
|
||||
// that's expected. If a download fails, we log it at info-level, and retry.
|
||||
// But after FAILED_DOWNLOAD_WARN_THRESHOLD retries, we start to log it at WARN
|
||||
@@ -446,10 +468,7 @@ impl RemoteTimelineClient {
|
||||
//
|
||||
|
||||
/// Download index file
|
||||
pub async fn download_index_file(
|
||||
&self,
|
||||
cancel: CancellationToken,
|
||||
) -> Result<MaybeDeletedIndexPart, DownloadError> {
|
||||
pub async fn download_index_file(&self) -> Result<MaybeDeletedIndexPart, DownloadError> {
|
||||
let _unfinished_gauge_guard = self.metrics.call_begin(
|
||||
&RemoteOpFileKind::Index,
|
||||
&RemoteOpKind::Download,
|
||||
@@ -463,7 +482,6 @@ impl RemoteTimelineClient {
|
||||
&self.tenant_id,
|
||||
&self.timeline_id,
|
||||
self.generation,
|
||||
cancel,
|
||||
)
|
||||
.measure_remote_op(
|
||||
self.tenant_id,
|
||||
@@ -609,203 +627,101 @@ impl RemoteTimelineClient {
|
||||
///
|
||||
/// Launch an upload operation in the background.
|
||||
///
|
||||
pub(crate) fn schedule_layer_file_upload(
|
||||
pub fn schedule_layer_file_upload(
|
||||
self: &Arc<Self>,
|
||||
layer: ResidentLayer,
|
||||
layer_file_name: &LayerFileName,
|
||||
layer_metadata: &LayerFileMetadata,
|
||||
) -> anyhow::Result<()> {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
self.schedule_layer_file_upload0(upload_queue, layer);
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn schedule_layer_file_upload0(
|
||||
self: &Arc<Self>,
|
||||
upload_queue: &mut UploadQueueInitialized,
|
||||
layer: ResidentLayer,
|
||||
) {
|
||||
let metadata = layer.metadata();
|
||||
|
||||
upload_queue
|
||||
.latest_files
|
||||
.insert(layer.layer_desc().filename(), metadata.clone());
|
||||
.insert(layer_file_name.clone(), layer_metadata.clone());
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
|
||||
|
||||
info!("scheduled layer file upload {layer}");
|
||||
let op = UploadOp::UploadLayer(layer, metadata);
|
||||
let op = UploadOp::UploadLayer(layer_file_name.clone(), layer_metadata.clone());
|
||||
self.calls_unfinished_metric_begin(&op);
|
||||
upload_queue.queued_operations.push_back(op);
|
||||
|
||||
info!("scheduled layer file upload {layer_file_name}");
|
||||
|
||||
// Launch the task immediately, if possible
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Launch a delete operation in the background.
|
||||
///
|
||||
/// The operation does not modify local filesystem state.
|
||||
/// The operation does not modify local state but assumes the local files have already been
|
||||
/// deleted, and is used to mirror those changes to remote.
|
||||
///
|
||||
/// Note: This schedules an index file upload before the deletions. The
|
||||
/// deletion won't actually be performed, until all previously scheduled
|
||||
/// deletion won't actually be performed, until any previously scheduled
|
||||
/// upload operations, and the index file upload, have completed
|
||||
/// successfully.
|
||||
pub fn schedule_layer_file_deletion(
|
||||
self: &Arc<Self>,
|
||||
names: &[LayerFileName],
|
||||
names: Vec<LayerFileName>,
|
||||
) -> anyhow::Result<()> {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
let with_generations =
|
||||
self.schedule_unlinking_of_layers_from_index_part0(upload_queue, names.iter().cloned());
|
||||
|
||||
self.schedule_deletion_of_unlinked0(upload_queue, with_generations);
|
||||
|
||||
// Launch the tasks immediately, if possible
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Unlinks the layer files from `index_part.json` but does not yet schedule deletion for the
|
||||
/// layer files, leaving them dangling.
|
||||
///
|
||||
/// The files will be leaked in remote storage unless [`Self::schedule_deletion_of_unlinked`]
|
||||
/// is invoked on them.
|
||||
pub(crate) fn schedule_gc_update(self: &Arc<Self>, gc_layers: &[Layer]) -> anyhow::Result<()> {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
// just forget the return value; after uploading the next index_part.json, we can consider
|
||||
// the layer files as "dangling". this is fine, at worst case we create work for the
|
||||
// scrubber.
|
||||
|
||||
let names = gc_layers.iter().map(|x| x.layer_desc().filename());
|
||||
|
||||
self.schedule_unlinking_of_layers_from_index_part0(upload_queue, names);
|
||||
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Update the remote index file, removing the to-be-deleted files from the index,
|
||||
/// allowing scheduling of actual deletions later.
|
||||
fn schedule_unlinking_of_layers_from_index_part0<I>(
|
||||
self: &Arc<Self>,
|
||||
upload_queue: &mut UploadQueueInitialized,
|
||||
names: I,
|
||||
) -> Vec<(LayerFileName, Generation)>
|
||||
where
|
||||
I: IntoIterator<Item = LayerFileName>,
|
||||
{
|
||||
// Deleting layers doesn't affect the values stored in TimelineMetadata,
|
||||
// so we don't need update it. Just serialize it.
|
||||
let metadata = upload_queue.latest_metadata.clone();
|
||||
|
||||
// Decorate our list of names with each name's generation, dropping
|
||||
// names that are unexpectedly missing from our metadata.
|
||||
let with_generations: Vec<_> = names
|
||||
.into_iter()
|
||||
.filter_map(|name| {
|
||||
let meta = upload_queue.latest_files.remove(&name);
|
||||
// Update the remote index file, removing the to-be-deleted files from the index,
|
||||
// before deleting the actual files.
|
||||
//
|
||||
// Once we start removing files from upload_queue.latest_files, there's
|
||||
// no going back! Otherwise, some of the files would already be removed
|
||||
// from latest_files, but not yet scheduled for deletion. Use a closure
|
||||
// to syntactically forbid ? or bail! calls here.
|
||||
let no_bail_here = || {
|
||||
// Decorate our list of names with each name's generation, dropping
|
||||
// makes that are unexpectedly missing from our metadata.
|
||||
let with_generations: Vec<_> = names
|
||||
.into_iter()
|
||||
.filter_map(|name| {
|
||||
// Remove from latest_files, learning the file's remote generation in the process
|
||||
let meta = upload_queue.latest_files.remove(&name);
|
||||
|
||||
if let Some(meta) = meta {
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
|
||||
Some((name, meta.generation))
|
||||
} else {
|
||||
// This can only happen if we forgot to to schedule the file upload
|
||||
// before scheduling the delete. Log it because it is a rare/strange
|
||||
// situation, and in case something is misbehaving, we'd like to know which
|
||||
// layers experienced this.
|
||||
info!("Deleting layer {name} not found in latest_files list, never uploaded?");
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect();
|
||||
if let Some(meta) = meta {
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
|
||||
Some((name, meta.generation))
|
||||
} else {
|
||||
// This can only happen if we forgot to to schedule the file upload
|
||||
// before scheduling the delete. Log it because it is a rare/strange
|
||||
// situation, and in case something is misbehaving, we'd like to know which
|
||||
// layers experienced this.
|
||||
info!(
|
||||
"Deleting layer {name} not found in latest_files list, never uploaded?"
|
||||
);
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect();
|
||||
|
||||
#[cfg(feature = "testing")]
|
||||
for (name, gen) in &with_generations {
|
||||
if let Some(unexpected) = upload_queue.dangling_files.insert(name.to_owned(), *gen) {
|
||||
if &unexpected == gen {
|
||||
tracing::error!("{name} was unlinked twice with same generation");
|
||||
} else {
|
||||
tracing::error!("{name} was unlinked twice with different generations {gen:?} and {unexpected:?}");
|
||||
}
|
||||
if upload_queue.latest_files_changes_since_metadata_upload_scheduled > 0 {
|
||||
self.schedule_index_upload(upload_queue, metadata);
|
||||
}
|
||||
}
|
||||
|
||||
// after unlinking files from the upload_queue.latest_files we must always schedule an
|
||||
// index_part update, because that needs to be uploaded before we can actually delete the
|
||||
// files.
|
||||
if upload_queue.latest_files_changes_since_metadata_upload_scheduled > 0 {
|
||||
self.schedule_index_upload(upload_queue, metadata);
|
||||
}
|
||||
|
||||
with_generations
|
||||
}
|
||||
|
||||
/// Schedules deletion for layer files which have previously been unlinked from the
|
||||
/// `index_part.json` with [`Self::schedule_gc_update`] or [`Self::schedule_compaction_update`].
|
||||
pub(crate) fn schedule_deletion_of_unlinked(
|
||||
self: &Arc<Self>,
|
||||
layers: Vec<(LayerFileName, Generation)>,
|
||||
) -> anyhow::Result<()> {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
self.schedule_deletion_of_unlinked0(upload_queue, layers);
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn schedule_deletion_of_unlinked0(
|
||||
self: &Arc<Self>,
|
||||
upload_queue: &mut UploadQueueInitialized,
|
||||
with_generations: Vec<(LayerFileName, Generation)>,
|
||||
) {
|
||||
for (name, gen) in &with_generations {
|
||||
info!("scheduling deletion of layer {}{}", name, gen.get_suffix());
|
||||
}
|
||||
|
||||
#[cfg(feature = "testing")]
|
||||
for (name, gen) in &with_generations {
|
||||
match upload_queue.dangling_files.remove(name) {
|
||||
Some(same) if &same == gen => { /* expected */ }
|
||||
Some(other) => {
|
||||
tracing::error!("{name} was unlinked with {other:?} but deleted with {gen:?}");
|
||||
}
|
||||
None => {
|
||||
tracing::error!("{name} was unlinked but was not dangling");
|
||||
}
|
||||
for (name, gen) in &with_generations {
|
||||
info!("scheduling deletion of layer {}{}", name, gen.get_suffix());
|
||||
}
|
||||
}
|
||||
|
||||
// schedule the actual deletions
|
||||
let op = UploadOp::Delete(Delete {
|
||||
layers: with_generations,
|
||||
});
|
||||
self.calls_unfinished_metric_begin(&op);
|
||||
upload_queue.queued_operations.push_back(op);
|
||||
}
|
||||
|
||||
/// Schedules a compaction update to the remote `index_part.json`.
|
||||
///
|
||||
/// `compacted_from` represent the L0 names which have been `compacted_to` L1 layers.
|
||||
pub(crate) fn schedule_compaction_update(
|
||||
self: &Arc<Self>,
|
||||
compacted_from: &[Layer],
|
||||
compacted_to: &[ResidentLayer],
|
||||
) -> anyhow::Result<()> {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
for layer in compacted_to {
|
||||
self.schedule_layer_file_upload0(upload_queue, layer.clone());
|
||||
}
|
||||
|
||||
let names = compacted_from.iter().map(|x| x.layer_desc().filename());
|
||||
|
||||
self.schedule_unlinking_of_layers_from_index_part0(upload_queue, names);
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
// schedule the actual deletions
|
||||
let op = UploadOp::Delete(Delete {
|
||||
layers: with_generations,
|
||||
});
|
||||
self.calls_unfinished_metric_begin(&op);
|
||||
upload_queue.queued_operations.push_back(op);
|
||||
|
||||
// Launch the tasks immediately, if possible
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
};
|
||||
no_bail_here();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -1177,12 +1093,16 @@ impl RemoteTimelineClient {
|
||||
}
|
||||
|
||||
let upload_result: anyhow::Result<()> = match &task.op {
|
||||
UploadOp::UploadLayer(ref layer, ref layer_metadata) => {
|
||||
let path = layer.local_path();
|
||||
UploadOp::UploadLayer(ref layer_file_name, ref layer_metadata) => {
|
||||
let path = self
|
||||
.conf
|
||||
.timeline_path(&self.tenant_id, &self.timeline_id)
|
||||
.join(layer_file_name.file_name());
|
||||
|
||||
upload::upload_timeline_layer(
|
||||
self.conf,
|
||||
&self.storage_impl,
|
||||
path,
|
||||
&path,
|
||||
layer_metadata,
|
||||
self.generation,
|
||||
)
|
||||
@@ -1456,8 +1376,6 @@ impl RemoteTimelineClient {
|
||||
num_inprogress_deletions: 0,
|
||||
inprogress_tasks: HashMap::default(),
|
||||
queued_operations: VecDeque::default(),
|
||||
#[cfg(feature = "testing")]
|
||||
dangling_files: HashMap::default(),
|
||||
};
|
||||
|
||||
let upload_queue = std::mem::replace(
|
||||
@@ -1588,7 +1506,6 @@ mod tests {
|
||||
context::RequestContext,
|
||||
tenant::{
|
||||
harness::{TenantHarness, TIMELINE_ID},
|
||||
storage_layer::Layer,
|
||||
Generation, Tenant, Timeline,
|
||||
},
|
||||
DEFAULT_PG_VERSION,
|
||||
@@ -1731,11 +1648,7 @@ mod tests {
|
||||
let client = timeline.remote_client.as_ref().unwrap();
|
||||
|
||||
// Download back the index.json, and check that the list of files is correct
|
||||
let initial_index_part = match client
|
||||
.download_index_file(CancellationToken::new())
|
||||
.await
|
||||
.unwrap()
|
||||
{
|
||||
let initial_index_part = match client.download_index_file().await.unwrap() {
|
||||
MaybeDeletedIndexPart::IndexPart(index_part) => index_part,
|
||||
MaybeDeletedIndexPart::Deleted(_) => panic!("unexpectedly got deleted index part"),
|
||||
};
|
||||
@@ -1761,29 +1674,32 @@ mod tests {
|
||||
let generation = harness.generation;
|
||||
|
||||
// Create a couple of dummy files, schedule upload for them
|
||||
let layer_file_name_1: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap();
|
||||
let layer_file_name_2: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D9-00000000016B5A52".parse().unwrap();
|
||||
let layer_file_name_3: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59DA-00000000016B5A53".parse().unwrap();
|
||||
let content_1 = dummy_contents("foo");
|
||||
let content_2 = dummy_contents("bar");
|
||||
let content_3 = dummy_contents("baz");
|
||||
|
||||
let layers = [
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap(), dummy_contents("foo")),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D9-00000000016B5A52".parse().unwrap(), dummy_contents("bar")),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59DA-00000000016B5A53".parse().unwrap(), dummy_contents("baz"))
|
||||
]
|
||||
.into_iter()
|
||||
.map(|(name, contents): (LayerFileName, Vec<u8>)| {
|
||||
std::fs::write(timeline_path.join(name.file_name()), &contents).unwrap();
|
||||
|
||||
Layer::for_resident(
|
||||
harness.conf,
|
||||
&timeline,
|
||||
name,
|
||||
LayerFileMetadata::new(contents.len() as u64, generation),
|
||||
)
|
||||
}).collect::<Vec<_>>();
|
||||
for (filename, content) in [
|
||||
(&layer_file_name_1, &content_1),
|
||||
(&layer_file_name_2, &content_2),
|
||||
(&layer_file_name_3, &content_3),
|
||||
] {
|
||||
std::fs::write(timeline_path.join(filename.file_name()), content).unwrap();
|
||||
}
|
||||
|
||||
client
|
||||
.schedule_layer_file_upload(layers[0].clone())
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_1,
|
||||
&LayerFileMetadata::new(content_1.len() as u64, generation),
|
||||
)
|
||||
.unwrap();
|
||||
client
|
||||
.schedule_layer_file_upload(layers[1].clone())
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_2,
|
||||
&LayerFileMetadata::new(content_2.len() as u64, generation),
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
// Check that they are started immediately, not queued
|
||||
@@ -1824,11 +1740,7 @@ mod tests {
|
||||
}
|
||||
|
||||
// Download back the index.json, and check that the list of files is correct
|
||||
let index_part = match client
|
||||
.download_index_file(CancellationToken::new())
|
||||
.await
|
||||
.unwrap()
|
||||
{
|
||||
let index_part = match client.download_index_file().await.unwrap() {
|
||||
MaybeDeletedIndexPart::IndexPart(index_part) => index_part,
|
||||
MaybeDeletedIndexPart::Deleted(_) => panic!("unexpectedly got deleted index part"),
|
||||
};
|
||||
@@ -1841,42 +1753,38 @@ mod tests {
|
||||
.collect(),
|
||||
&[
|
||||
&initial_layer.file_name(),
|
||||
&layers[0].layer_desc().filename().file_name(),
|
||||
&layers[1].layer_desc().filename().file_name(),
|
||||
&layer_file_name_1.file_name(),
|
||||
&layer_file_name_2.file_name(),
|
||||
],
|
||||
);
|
||||
assert_eq!(index_part.metadata, metadata);
|
||||
|
||||
// Schedule upload and then a deletion. Check that the deletion is queued
|
||||
client
|
||||
.schedule_layer_file_upload(layers[2].clone())
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_3,
|
||||
&LayerFileMetadata::new(content_3.len() as u64, generation),
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
// this is no longer consistent with how deletion works with Layer::drop, but in this test
|
||||
// keep using schedule_layer_file_deletion because we don't have a way to wait for the
|
||||
// spawn_blocking started by the drop.
|
||||
client
|
||||
.schedule_layer_file_deletion(&[layers[0].layer_desc().filename()])
|
||||
.schedule_layer_file_deletion([layer_file_name_1.clone()].to_vec())
|
||||
.unwrap();
|
||||
{
|
||||
let mut guard = client.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut().unwrap();
|
||||
|
||||
// Deletion schedules upload of the index file, and the file deletion itself
|
||||
assert_eq!(upload_queue.queued_operations.len(), 2);
|
||||
assert_eq!(upload_queue.inprogress_tasks.len(), 1);
|
||||
assert_eq!(upload_queue.num_inprogress_layer_uploads, 1);
|
||||
assert_eq!(upload_queue.num_inprogress_deletions, 0);
|
||||
assert_eq!(
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled,
|
||||
0
|
||||
);
|
||||
assert!(upload_queue.queued_operations.len() == 2);
|
||||
assert!(upload_queue.inprogress_tasks.len() == 1);
|
||||
assert!(upload_queue.num_inprogress_layer_uploads == 1);
|
||||
assert!(upload_queue.num_inprogress_deletions == 0);
|
||||
assert!(upload_queue.latest_files_changes_since_metadata_upload_scheduled == 0);
|
||||
}
|
||||
assert_remote_files(
|
||||
&[
|
||||
&initial_layer.file_name(),
|
||||
&layers[0].layer_desc().filename().file_name(),
|
||||
&layers[1].layer_desc().filename().file_name(),
|
||||
&layer_file_name_1.file_name(),
|
||||
&layer_file_name_2.file_name(),
|
||||
"index_part.json",
|
||||
],
|
||||
&remote_timeline_dir,
|
||||
@@ -1890,8 +1798,8 @@ mod tests {
|
||||
assert_remote_files(
|
||||
&[
|
||||
&initial_layer.file_name(),
|
||||
&layers[1].layer_desc().filename().file_name(),
|
||||
&layers[2].layer_desc().filename().file_name(),
|
||||
&layer_file_name_2.file_name(),
|
||||
&layer_file_name_3.file_name(),
|
||||
"index_part.json",
|
||||
],
|
||||
&remote_timeline_dir,
|
||||
@@ -1920,13 +1828,6 @@ mod tests {
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
let layer_file_1 = Layer::for_resident(
|
||||
harness.conf,
|
||||
&timeline,
|
||||
layer_file_name_1.clone(),
|
||||
LayerFileMetadata::new(content_1.len() as u64, harness.generation),
|
||||
);
|
||||
|
||||
#[derive(Debug, PartialEq, Clone, Copy)]
|
||||
struct BytesStartedFinished {
|
||||
started: Option<usize>,
|
||||
@@ -1962,7 +1863,10 @@ mod tests {
|
||||
let actual_a = get_bytes_started_stopped();
|
||||
|
||||
client
|
||||
.schedule_layer_file_upload(layer_file_1.clone())
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_1,
|
||||
&LayerFileMetadata::new(content_1.len() as u64, harness.generation),
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
let actual_b = get_bytes_started_stopped();
|
||||
@@ -2027,7 +1931,7 @@ mod tests {
|
||||
let client = test_state.build_client(get_generation);
|
||||
|
||||
let download_r = client
|
||||
.download_index_file(CancellationToken::new())
|
||||
.download_index_file()
|
||||
.await
|
||||
.expect("download should always succeed");
|
||||
assert!(matches!(download_r, MaybeDeletedIndexPart::IndexPart(_)));
|
||||
|
||||
@@ -19,7 +19,7 @@ use crate::tenant::remote_timeline_client::{remote_layer_path, remote_timelines_
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
use crate::tenant::timeline::span::debug_assert_current_span_has_tenant_and_timeline_id;
|
||||
use crate::tenant::Generation;
|
||||
use remote_storage::{DownloadError, GenericRemoteStorage, ListingMode};
|
||||
use remote_storage::{DownloadError, GenericRemoteStorage};
|
||||
use utils::crashsafe::path_with_suffix_extension;
|
||||
use utils::id::{TenantId, TimelineId};
|
||||
|
||||
@@ -170,43 +170,47 @@ pub fn is_temp_download_file(path: &Utf8Path) -> bool {
|
||||
pub async fn list_remote_timelines(
|
||||
storage: &GenericRemoteStorage,
|
||||
tenant_id: TenantId,
|
||||
cancel: CancellationToken,
|
||||
) -> anyhow::Result<(HashSet<TimelineId>, HashSet<String>)> {
|
||||
) -> anyhow::Result<HashSet<TimelineId>> {
|
||||
let remote_path = remote_timelines_path(&tenant_id);
|
||||
|
||||
fail::fail_point!("storage-sync-list-remote-timelines", |_| {
|
||||
anyhow::bail!("storage-sync-list-remote-timelines");
|
||||
});
|
||||
|
||||
let listing = download_retry_forever(
|
||||
|| storage.list(Some(&remote_path), ListingMode::WithDelimiter),
|
||||
&format!("list timelines for {tenant_id}"),
|
||||
cancel,
|
||||
let timelines = download_retry(
|
||||
|| storage.list_prefixes(Some(&remote_path)),
|
||||
&format!("list prefixes for {tenant_id}"),
|
||||
)
|
||||
.await?;
|
||||
|
||||
let mut timeline_ids = HashSet::new();
|
||||
let mut other_prefixes = HashSet::new();
|
||||
if timelines.is_empty() {
|
||||
anyhow::bail!("no timelines found on the remote storage")
|
||||
}
|
||||
|
||||
for timeline_remote_storage_key in listing.prefixes {
|
||||
let mut timeline_ids = HashSet::new();
|
||||
|
||||
for timeline_remote_storage_key in timelines {
|
||||
let object_name = timeline_remote_storage_key.object_name().ok_or_else(|| {
|
||||
anyhow::anyhow!("failed to get timeline id for remote tenant {tenant_id}")
|
||||
})?;
|
||||
|
||||
match object_name.parse::<TimelineId>() {
|
||||
Ok(t) => timeline_ids.insert(t),
|
||||
Err(_) => other_prefixes.insert(object_name.to_string()),
|
||||
};
|
||||
let timeline_id: TimelineId = object_name
|
||||
.parse()
|
||||
.with_context(|| format!("parse object name into timeline id '{object_name}'"))?;
|
||||
|
||||
// list_prefixes is assumed to return unique names. Ensure this here.
|
||||
// NB: it's safer to bail out than warn-log this because the pageserver
|
||||
// needs to absolutely know about _all_ timelines that exist, so that
|
||||
// GC knows all the branchpoints. If we skipped over a timeline instead,
|
||||
// GC could delete a layer that's still needed by that timeline.
|
||||
anyhow::ensure!(
|
||||
!timeline_ids.contains(&timeline_id),
|
||||
"list_prefixes contains duplicate timeline id {timeline_id}"
|
||||
);
|
||||
timeline_ids.insert(timeline_id);
|
||||
}
|
||||
|
||||
for key in listing.keys {
|
||||
let object_name = key
|
||||
.object_name()
|
||||
.ok_or_else(|| anyhow::anyhow!("object name for key {key}"))?;
|
||||
other_prefixes.insert(object_name.to_string());
|
||||
}
|
||||
|
||||
Ok((timeline_ids, other_prefixes))
|
||||
Ok(timeline_ids)
|
||||
}
|
||||
|
||||
async fn do_download_index_part(
|
||||
@@ -214,11 +218,10 @@ async fn do_download_index_part(
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
index_generation: Generation,
|
||||
cancel: CancellationToken,
|
||||
) -> Result<IndexPart, DownloadError> {
|
||||
let remote_path = remote_index_path(tenant_id, timeline_id, index_generation);
|
||||
|
||||
let index_part_bytes = download_retry_forever(
|
||||
let index_part_bytes = download_retry(
|
||||
|| async {
|
||||
let mut index_part_download = storage.download(&remote_path).await?;
|
||||
|
||||
@@ -233,7 +236,6 @@ async fn do_download_index_part(
|
||||
Ok(index_part_bytes)
|
||||
},
|
||||
&format!("download {remote_path:?}"),
|
||||
cancel,
|
||||
)
|
||||
.await?;
|
||||
|
||||
@@ -255,28 +257,19 @@ pub(super) async fn download_index_part(
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
my_generation: Generation,
|
||||
cancel: CancellationToken,
|
||||
) -> Result<IndexPart, DownloadError> {
|
||||
debug_assert_current_span_has_tenant_and_timeline_id();
|
||||
|
||||
if my_generation.is_none() {
|
||||
// Operating without generations: just fetch the generation-less path
|
||||
return do_download_index_part(storage, tenant_id, timeline_id, my_generation, cancel)
|
||||
.await;
|
||||
return do_download_index_part(storage, tenant_id, timeline_id, my_generation).await;
|
||||
}
|
||||
|
||||
// Stale case: If we were intentionally attached in a stale generation, there may already be a remote
|
||||
// index in our generation.
|
||||
//
|
||||
// This is an optimization to avoid doing the listing for the general case below.
|
||||
let res = do_download_index_part(
|
||||
storage,
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
my_generation,
|
||||
cancel.clone(),
|
||||
)
|
||||
.await;
|
||||
let res = do_download_index_part(storage, tenant_id, timeline_id, my_generation).await;
|
||||
match res {
|
||||
Ok(index_part) => {
|
||||
tracing::debug!(
|
||||
@@ -296,14 +289,8 @@ pub(super) async fn download_index_part(
|
||||
// we want to find the most recent index from a previous generation.
|
||||
//
|
||||
// This is an optimization to avoid doing the listing for the general case below.
|
||||
let res = do_download_index_part(
|
||||
storage,
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
my_generation.previous(),
|
||||
cancel.clone(),
|
||||
)
|
||||
.await;
|
||||
let res =
|
||||
do_download_index_part(storage, tenant_id, timeline_id, my_generation.previous()).await;
|
||||
match res {
|
||||
Ok(index_part) => {
|
||||
tracing::debug!("Found index_part from previous generation");
|
||||
@@ -347,14 +334,13 @@ pub(super) async fn download_index_part(
|
||||
match max_previous_generation {
|
||||
Some(g) => {
|
||||
tracing::debug!("Found index_part in generation {g:?}");
|
||||
do_download_index_part(storage, tenant_id, timeline_id, g, cancel).await
|
||||
do_download_index_part(storage, tenant_id, timeline_id, g).await
|
||||
}
|
||||
None => {
|
||||
// Migration from legacy pre-generation state: we have a generation but no prior
|
||||
// attached pageservers did. Try to load from a no-generation path.
|
||||
tracing::info!("No index_part.json* found");
|
||||
do_download_index_part(storage, tenant_id, timeline_id, Generation::none(), cancel)
|
||||
.await
|
||||
do_download_index_part(storage, tenant_id, timeline_id, Generation::none()).await
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -384,23 +370,3 @@ where
|
||||
)
|
||||
.await
|
||||
}
|
||||
|
||||
async fn download_retry_forever<T, O, F>(
|
||||
op: O,
|
||||
description: &str,
|
||||
cancel: CancellationToken,
|
||||
) -> Result<T, DownloadError>
|
||||
where
|
||||
O: FnMut() -> F,
|
||||
F: Future<Output = Result<T, DownloadError>>,
|
||||
{
|
||||
backoff::retry(
|
||||
op,
|
||||
|e| matches!(e, DownloadError::BadInput(_) | DownloadError::NotFound),
|
||||
FAILED_DOWNLOAD_WARN_THRESHOLD,
|
||||
u32::MAX,
|
||||
description,
|
||||
backoff::Cancel::new(cancel, || DownloadError::Cancelled),
|
||||
)
|
||||
.await
|
||||
}
|
||||
|
||||
@@ -98,7 +98,7 @@ impl IndexPart {
|
||||
const LATEST_VERSION: usize = 4;
|
||||
|
||||
// Versions we may see when reading from a bucket.
|
||||
pub const KNOWN_VERSIONS: &'static [usize] = &[1, 2, 3, 4];
|
||||
pub const KNOWN_VERSIONS: &[usize] = &[1, 2, 3, 4];
|
||||
|
||||
pub const FILE_NAME: &'static str = "index_part.json";
|
||||
|
||||
|
||||
@@ -31,7 +31,6 @@ pub(super) async fn upload_index_part<'a>(
|
||||
fail_point!("before-upload-index", |_| {
|
||||
bail!("failpoint before-upload-index")
|
||||
});
|
||||
pausable_failpoint!("before-upload-index-pausable");
|
||||
|
||||
let index_part_bytes =
|
||||
serde_json::to_vec(&index_part).context("serialize index part file into bytes")?;
|
||||
@@ -60,8 +59,6 @@ pub(super) async fn upload_timeline_layer<'a>(
|
||||
bail!("failpoint before-upload-layer")
|
||||
});
|
||||
|
||||
pausable_failpoint!("before-upload-layer-pausable");
|
||||
|
||||
let storage_path = remote_path(conf, source_path, generation)?;
|
||||
let source_file_res = fs::File::open(&source_path).await;
|
||||
let source_file = match source_file_res {
|
||||
@@ -72,8 +69,6 @@ pub(super) async fn upload_timeline_layer<'a>(
|
||||
// upload. However, a nonexistent file can also be indicative of
|
||||
// something worse, like when a file is scheduled for upload before
|
||||
// it has been written to disk yet.
|
||||
//
|
||||
// This is tested against `test_compaction_delete_before_upload`
|
||||
info!(path = %source_path, "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more.");
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
@@ -4,21 +4,26 @@ pub mod delta_layer;
|
||||
mod filename;
|
||||
mod image_layer;
|
||||
mod inmemory_layer;
|
||||
mod layer;
|
||||
mod layer_desc;
|
||||
mod remote_layer;
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::context::{AccessStatsBehavior, RequestContext};
|
||||
use crate::repository::Key;
|
||||
use crate::task_mgr::TaskKind;
|
||||
use crate::walrecord::NeonWalRecord;
|
||||
use anyhow::Result;
|
||||
use bytes::Bytes;
|
||||
use camino::Utf8PathBuf;
|
||||
use enum_map::EnumMap;
|
||||
use enumset::EnumSet;
|
||||
use once_cell::sync::Lazy;
|
||||
use pageserver_api::models::LayerAccessKind;
|
||||
use pageserver_api::models::{
|
||||
LayerAccessKind, LayerResidenceEvent, LayerResidenceEventReason, LayerResidenceStatus,
|
||||
HistoricLayerInfo, LayerResidenceEvent, LayerResidenceEventReason, LayerResidenceStatus,
|
||||
};
|
||||
use std::ops::Range;
|
||||
use std::sync::Mutex;
|
||||
use std::sync::{Arc, Mutex};
|
||||
use std::time::{Duration, SystemTime, UNIX_EPOCH};
|
||||
use tracing::warn;
|
||||
use utils::history_buffer::HistoryBufferWithDropCounter;
|
||||
@@ -34,8 +39,7 @@ pub use filename::{DeltaFileName, ImageFileName, LayerFileName};
|
||||
pub use image_layer::{ImageLayer, ImageLayerWriter};
|
||||
pub use inmemory_layer::InMemoryLayer;
|
||||
pub use layer_desc::{PersistentLayerDesc, PersistentLayerKey};
|
||||
|
||||
pub(crate) use layer::{EvictionError, Layer, ResidentLayer};
|
||||
pub use remote_layer::RemoteLayer;
|
||||
|
||||
pub fn range_overlaps<T>(a: &Range<T>, b: &Range<T>) -> bool
|
||||
where
|
||||
@@ -70,7 +74,7 @@ pub struct ValueReconstructState {
|
||||
pub img: Option<(Lsn, Bytes)>,
|
||||
}
|
||||
|
||||
/// Return value from [`Layer::get_value_reconstruct_data`]
|
||||
/// Return value from Layer::get_page_reconstruct_data
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
pub enum ValueReconstructResult {
|
||||
/// Got all the data needed to reconstruct the requested page
|
||||
@@ -175,6 +179,26 @@ impl LayerAccessStats {
|
||||
new
|
||||
}
|
||||
|
||||
/// Creates a clone of `self` and records `new_status` in the clone.
|
||||
///
|
||||
/// The `new_status` is not recorded in `self`.
|
||||
///
|
||||
/// See [`record_residence_event`] for why you need to do this while holding the layer map lock.
|
||||
///
|
||||
/// [`record_residence_event`]: Self::record_residence_event
|
||||
pub(crate) fn clone_for_residence_change(
|
||||
&self,
|
||||
new_status: LayerResidenceStatus,
|
||||
) -> LayerAccessStats {
|
||||
let clone = {
|
||||
let inner = self.0.lock().unwrap();
|
||||
inner.clone()
|
||||
};
|
||||
let new = LayerAccessStats(Mutex::new(clone));
|
||||
new.record_residence_event(new_status, LayerResidenceEventReason::ResidenceChange);
|
||||
new
|
||||
}
|
||||
|
||||
/// Record a change in layer residency.
|
||||
///
|
||||
/// Recording the event must happen while holding the layer map lock to
|
||||
@@ -297,12 +321,95 @@ impl LayerAccessStats {
|
||||
}
|
||||
}
|
||||
|
||||
/// Supertrait of the [`Layer`] trait that captures the bare minimum interface
|
||||
/// required by [`LayerMap`](super::layer_map::LayerMap).
|
||||
///
|
||||
/// All layers should implement a minimal `std::fmt::Debug` without tenant or
|
||||
/// timeline names, because those are known in the context of which the layers
|
||||
/// are used in (timeline).
|
||||
#[async_trait::async_trait]
|
||||
pub trait Layer: std::fmt::Debug + std::fmt::Display + Send + Sync + 'static {
|
||||
///
|
||||
/// Return data needed to reconstruct given page at LSN.
|
||||
///
|
||||
/// It is up to the caller to collect more data from previous layer and
|
||||
/// perform WAL redo, if necessary.
|
||||
///
|
||||
/// See PageReconstructResult for possible return values. The collected data
|
||||
/// is appended to reconstruct_data; the caller should pass an empty struct
|
||||
/// on first call, or a struct with a cached older image of the page if one
|
||||
/// is available. If this returns ValueReconstructResult::Continue, look up
|
||||
/// the predecessor layer and call again with the same 'reconstruct_data' to
|
||||
/// collect more data.
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_data: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<ValueReconstructResult>;
|
||||
}
|
||||
|
||||
/// Get a layer descriptor from a layer.
|
||||
pub trait AsLayerDesc {
|
||||
/// Get the layer descriptor.
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc;
|
||||
}
|
||||
|
||||
/// A Layer contains all data in a "rectangle" consisting of a range of keys and
|
||||
/// range of LSNs.
|
||||
///
|
||||
/// There are two kinds of layers, in-memory and on-disk layers. In-memory
|
||||
/// layers are used to ingest incoming WAL, and provide fast access to the
|
||||
/// recent page versions. On-disk layers are stored as files on disk, and are
|
||||
/// immutable. This trait presents the common functionality of in-memory and
|
||||
/// on-disk layers.
|
||||
///
|
||||
/// Furthermore, there are two kinds of on-disk layers: delta and image layers.
|
||||
/// A delta layer contains all modifications within a range of LSNs and keys.
|
||||
/// An image layer is a snapshot of all the data in a key-range, at a single
|
||||
/// LSN.
|
||||
pub trait PersistentLayer: Layer + AsLayerDesc {
|
||||
/// File name used for this layer, both in the pageserver's local filesystem
|
||||
/// state as well as in the remote storage.
|
||||
fn filename(&self) -> LayerFileName {
|
||||
self.layer_desc().filename()
|
||||
}
|
||||
|
||||
// Path to the layer file in the local filesystem.
|
||||
// `None` for `RemoteLayer`.
|
||||
fn local_path(&self) -> Option<Utf8PathBuf>;
|
||||
|
||||
/// Permanently remove this layer from disk.
|
||||
fn delete_resident_layer_file(&self) -> Result<()>;
|
||||
|
||||
fn downcast_remote_layer(self: Arc<Self>) -> Option<std::sync::Arc<RemoteLayer>> {
|
||||
None
|
||||
}
|
||||
|
||||
fn downcast_delta_layer(self: Arc<Self>) -> Option<std::sync::Arc<DeltaLayer>> {
|
||||
None
|
||||
}
|
||||
|
||||
fn is_remote_layer(&self) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo;
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats;
|
||||
}
|
||||
|
||||
pub fn downcast_remote_layer(
|
||||
layer: &Arc<dyn PersistentLayer>,
|
||||
) -> Option<std::sync::Arc<RemoteLayer>> {
|
||||
if layer.is_remote_layer() {
|
||||
Arc::clone(layer).downcast_remote_layer()
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
pub mod tests {
|
||||
use super::*;
|
||||
|
||||
@@ -340,6 +447,19 @@ pub mod tests {
|
||||
}
|
||||
}
|
||||
|
||||
/// Helper enum to hold a PageServerConf, or a path
|
||||
///
|
||||
/// This is used by DeltaLayer and ImageLayer. Normally, this holds a reference to the
|
||||
/// global config, and paths to layer files are constructed using the tenant/timeline
|
||||
/// path from the config. But in the 'pagectl' binary, we need to construct a Layer
|
||||
/// struct for a file on disk, without having a page server running, so that we have no
|
||||
/// config. In that case, we use the Path variant to hold the full path to the file on
|
||||
/// disk.
|
||||
enum PathOrConf {
|
||||
Path(Utf8PathBuf),
|
||||
Conf(&'static PageServerConf),
|
||||
}
|
||||
|
||||
/// Range wrapping newtype, which uses display to render Debug.
|
||||
///
|
||||
/// Useful with `Key`, which has too verbose `{:?}` for printing multiple layers.
|
||||
|
||||
@@ -34,17 +34,18 @@ use crate::repository::{Key, Value, KEY_SIZE};
|
||||
use crate::tenant::blob_io::BlobWriter;
|
||||
use crate::tenant::block_io::{BlockBuf, BlockCursor, BlockLease, BlockReader, FileBlockReader};
|
||||
use crate::tenant::disk_btree::{DiskBtreeBuilder, DiskBtreeReader, VisitDirection};
|
||||
use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState};
|
||||
use crate::tenant::Timeline;
|
||||
use crate::tenant::storage_layer::{
|
||||
PersistentLayer, ValueReconstructResult, ValueReconstructState,
|
||||
};
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use crate::{walrecord, TEMP_FILE_SUFFIX};
|
||||
use crate::{DELTA_FILE_MAGIC, STORAGE_FORMAT_VERSION};
|
||||
use anyhow::{bail, ensure, Context, Result};
|
||||
use camino::{Utf8Path, Utf8PathBuf};
|
||||
use pageserver_api::models::LayerAccessKind;
|
||||
use pageserver_api::models::{HistoricLayerInfo, LayerAccessKind};
|
||||
use rand::{distributions::Alphanumeric, Rng};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::fs::File;
|
||||
use std::fs::{self, File};
|
||||
use std::io::SeekFrom;
|
||||
use std::ops::Range;
|
||||
use std::os::unix::fs::FileExt;
|
||||
@@ -58,7 +59,10 @@ use utils::{
|
||||
lsn::Lsn,
|
||||
};
|
||||
|
||||
use super::{AsLayerDesc, LayerAccessStats, PersistentLayerDesc, ResidentLayer};
|
||||
use super::{
|
||||
AsLayerDesc, DeltaFileName, Layer, LayerAccessStats, LayerAccessStatsReset, PathOrConf,
|
||||
PersistentLayerDesc,
|
||||
};
|
||||
|
||||
///
|
||||
/// Header stored in the beginning of the file
|
||||
@@ -178,12 +182,20 @@ impl DeltaKey {
|
||||
}
|
||||
}
|
||||
|
||||
/// This is used only from `pagectl`. Within pageserver, all layers are
|
||||
/// [`crate::tenant::storage_layer::Layer`], which can hold a [`DeltaLayerInner`].
|
||||
/// DeltaLayer is the in-memory data structure associated with an on-disk delta
|
||||
/// file.
|
||||
///
|
||||
/// We keep a DeltaLayer in memory for each file, in the LayerMap. If a layer
|
||||
/// is in "loaded" state, we have a copy of the index in memory, in 'inner'.
|
||||
/// Otherwise the struct is just a placeholder for a file that exists on disk,
|
||||
/// and it needs to be loaded before using it in queries.
|
||||
pub struct DeltaLayer {
|
||||
path: Utf8PathBuf,
|
||||
path_or_conf: PathOrConf,
|
||||
|
||||
pub desc: PersistentLayerDesc,
|
||||
|
||||
access_stats: LayerAccessStats,
|
||||
|
||||
inner: OnceCell<Arc<DeltaLayerInner>>,
|
||||
}
|
||||
|
||||
@@ -200,8 +212,6 @@ impl std::fmt::Debug for DeltaLayer {
|
||||
}
|
||||
}
|
||||
|
||||
/// `DeltaLayerInner` is the in-memory data structure associated with an on-disk delta
|
||||
/// file.
|
||||
pub struct DeltaLayerInner {
|
||||
// values copied from summary
|
||||
index_start_blk: u32,
|
||||
@@ -211,6 +221,12 @@ pub struct DeltaLayerInner {
|
||||
file: FileBlockReader,
|
||||
}
|
||||
|
||||
impl AsRef<DeltaLayerInner> for DeltaLayerInner {
|
||||
fn as_ref(&self) -> &DeltaLayerInner {
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
impl std::fmt::Debug for DeltaLayerInner {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.debug_struct("DeltaLayerInner")
|
||||
@@ -220,6 +236,19 @@ impl std::fmt::Debug for DeltaLayerInner {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for DeltaLayer {
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
self.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
|
||||
.await
|
||||
}
|
||||
}
|
||||
/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
|
||||
impl std::fmt::Display for DeltaLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
@@ -233,9 +262,40 @@ impl AsLayerDesc for DeltaLayer {
|
||||
}
|
||||
}
|
||||
|
||||
impl PersistentLayer for DeltaLayer {
|
||||
fn downcast_delta_layer(self: Arc<Self>) -> Option<std::sync::Arc<DeltaLayer>> {
|
||||
Some(self)
|
||||
}
|
||||
|
||||
fn local_path(&self) -> Option<Utf8PathBuf> {
|
||||
self.local_path()
|
||||
}
|
||||
|
||||
fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
self.delete_resident_layer_file()
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
self.info(reset)
|
||||
}
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats {
|
||||
self.access_stats()
|
||||
}
|
||||
}
|
||||
|
||||
impl DeltaLayer {
|
||||
pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
|
||||
self.desc.dump();
|
||||
println!(
|
||||
"----- delta layer for ten {} tli {} keys {}-{} lsn {}-{} size {} ----",
|
||||
self.desc.tenant_id,
|
||||
self.desc.timeline_id,
|
||||
self.desc.key_range.start,
|
||||
self.desc.key_range.end,
|
||||
self.desc.lsn_range.start,
|
||||
self.desc.lsn_range.end,
|
||||
self.desc.file_size,
|
||||
);
|
||||
|
||||
if !verbose {
|
||||
return Ok(());
|
||||
@@ -243,7 +303,119 @@ impl DeltaLayer {
|
||||
|
||||
let inner = self.load(LayerAccessKind::Dump, ctx).await?;
|
||||
|
||||
inner.dump(ctx).await
|
||||
println!(
|
||||
"index_start_blk: {}, root {}",
|
||||
inner.index_start_blk, inner.index_root_blk
|
||||
);
|
||||
|
||||
let file = &inner.file;
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
inner.index_start_blk,
|
||||
inner.index_root_blk,
|
||||
file,
|
||||
);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
let keys = DeltaLayerInner::load_keys(&inner, ctx).await?;
|
||||
|
||||
// A subroutine to dump a single blob
|
||||
async fn dump_blob(val: ValueRef<'_>, ctx: &RequestContext) -> Result<String> {
|
||||
let buf = val.reader.read_blob(val.blob_ref.pos(), ctx).await?;
|
||||
let val = Value::des(&buf)?;
|
||||
let desc = match val {
|
||||
Value::Image(img) => {
|
||||
format!(" img {} bytes", img.len())
|
||||
}
|
||||
Value::WalRecord(rec) => {
|
||||
let wal_desc = walrecord::describe_wal_record(&rec)?;
|
||||
format!(
|
||||
" rec {} bytes will_init: {} {}",
|
||||
buf.len(),
|
||||
rec.will_init(),
|
||||
wal_desc
|
||||
)
|
||||
}
|
||||
};
|
||||
Ok(desc)
|
||||
}
|
||||
|
||||
for entry in keys {
|
||||
let DeltaEntry { key, lsn, val, .. } = entry;
|
||||
let desc = match dump_blob(val, ctx).await {
|
||||
Ok(desc) => desc,
|
||||
Err(err) => {
|
||||
let err: anyhow::Error = err;
|
||||
format!("ERROR: {err}")
|
||||
}
|
||||
};
|
||||
println!(" key {key} at {lsn}: {desc}");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
ensure!(lsn_range.start >= self.desc.lsn_range.start);
|
||||
|
||||
ensure!(self.desc.key_range.contains(&key));
|
||||
|
||||
let inner = self
|
||||
.load(LayerAccessKind::GetValueReconstructData, ctx)
|
||||
.await?;
|
||||
inner
|
||||
.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
|
||||
.await
|
||||
}
|
||||
|
||||
pub(crate) fn local_path(&self) -> Option<Utf8PathBuf> {
|
||||
Some(self.path())
|
||||
}
|
||||
|
||||
pub(crate) fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
// delete underlying file
|
||||
fs::remove_file(self.path())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
let layer_file_name = self.layer_desc().filename().file_name();
|
||||
let lsn_range = self.layer_desc().lsn_range.clone();
|
||||
|
||||
let access_stats = self.access_stats.as_api_model(reset);
|
||||
|
||||
HistoricLayerInfo::Delta {
|
||||
layer_file_name,
|
||||
layer_file_size: self.desc.file_size,
|
||||
lsn_start: lsn_range.start,
|
||||
lsn_end: lsn_range.end,
|
||||
remote: false,
|
||||
access_stats,
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn access_stats(&self) -> &LayerAccessStats {
|
||||
&self.access_stats
|
||||
}
|
||||
|
||||
fn path_for(
|
||||
path_or_conf: &PathOrConf,
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
fname: &DeltaFileName,
|
||||
) -> Utf8PathBuf {
|
||||
match path_or_conf {
|
||||
PathOrConf::Path(path) => path.clone(),
|
||||
PathOrConf::Conf(conf) => conf
|
||||
.timeline_path(tenant_id, timeline_id)
|
||||
.join(fname.to_string()),
|
||||
}
|
||||
}
|
||||
|
||||
fn temp_path_for(
|
||||
@@ -289,21 +461,52 @@ impl DeltaLayer {
|
||||
async fn load_inner(&self, ctx: &RequestContext) -> Result<Arc<DeltaLayerInner>> {
|
||||
let path = self.path();
|
||||
|
||||
let loaded = DeltaLayerInner::load(&path, None, ctx).await?;
|
||||
let summary = match &self.path_or_conf {
|
||||
PathOrConf::Conf(_) => Some(Summary::from(self)),
|
||||
PathOrConf::Path(_) => None,
|
||||
};
|
||||
|
||||
// not production code
|
||||
let actual_filename = path.file_name().unwrap().to_owned();
|
||||
let expected_filename = self.layer_desc().filename().file_name();
|
||||
let loaded = DeltaLayerInner::load(&path, summary, ctx).await?;
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
if let PathOrConf::Path(ref path) = self.path_or_conf {
|
||||
// not production code
|
||||
|
||||
let actual_filename = path.file_name().unwrap().to_owned();
|
||||
let expected_filename = self.filename().file_name();
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(Arc::new(loaded))
|
||||
}
|
||||
|
||||
/// Create a DeltaLayer struct representing an existing file on disk.
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
tenant_id: TenantId,
|
||||
filename: &DeltaFileName,
|
||||
file_size: u64,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> DeltaLayer {
|
||||
DeltaLayer {
|
||||
path_or_conf: PathOrConf::Conf(conf),
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
filename.key_range.clone(),
|
||||
filename.lsn_range.clone(),
|
||||
file_size,
|
||||
),
|
||||
access_stats,
|
||||
inner: OnceCell::new(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create a DeltaLayer struct representing an existing file on disk.
|
||||
///
|
||||
/// This variant is only used for debugging purposes, by the 'pagectl' binary.
|
||||
@@ -317,7 +520,7 @@ impl DeltaLayer {
|
||||
.context("get file metadata to determine size")?;
|
||||
|
||||
Ok(DeltaLayer {
|
||||
path: path.to_path_buf(),
|
||||
path_or_conf: PathOrConf::Path(path.to_path_buf()),
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
summary.tenant_id,
|
||||
summary.timeline_id,
|
||||
@@ -330,9 +533,29 @@ impl DeltaLayer {
|
||||
})
|
||||
}
|
||||
|
||||
fn layer_name(&self) -> DeltaFileName {
|
||||
self.desc.delta_file_name()
|
||||
}
|
||||
/// Path to the layer file in pageserver workdir.
|
||||
fn path(&self) -> Utf8PathBuf {
|
||||
self.path.clone()
|
||||
pub fn path(&self) -> Utf8PathBuf {
|
||||
Self::path_for(
|
||||
&self.path_or_conf,
|
||||
&self.desc.tenant_id,
|
||||
&self.desc.timeline_id,
|
||||
&self.layer_name(),
|
||||
)
|
||||
}
|
||||
/// Loads all keys stored in the layer. Returns key, lsn, value size and value reference.
|
||||
///
|
||||
/// The value can be obtained via the [`ValueRef::load`] function.
|
||||
pub(crate) async fn load_keys(&self, ctx: &RequestContext) -> Result<Vec<DeltaEntry<'_>>> {
|
||||
let inner = self
|
||||
.load(LayerAccessKind::KeyIter, ctx)
|
||||
.await
|
||||
.context("load delta layer keys")?;
|
||||
DeltaLayerInner::load_keys(inner, ctx)
|
||||
.await
|
||||
.context("Layer index is corrupted")
|
||||
}
|
||||
}
|
||||
|
||||
@@ -437,7 +660,7 @@ impl DeltaLayerWriterInner {
|
||||
///
|
||||
/// Finish writing the delta layer.
|
||||
///
|
||||
async fn finish(self, key_end: Key, timeline: &Arc<Timeline>) -> anyhow::Result<ResidentLayer> {
|
||||
async fn finish(self, key_end: Key) -> anyhow::Result<DeltaLayer> {
|
||||
let index_start_blk =
|
||||
((self.blob_writer.size() + PAGE_SZ as u64 - 1) / PAGE_SZ as u64) as u32;
|
||||
|
||||
@@ -494,21 +717,37 @@ impl DeltaLayerWriterInner {
|
||||
// Note: Because we opened the file in write-only mode, we cannot
|
||||
// reuse the same VirtualFile for reading later. That's why we don't
|
||||
// set inner.file here. The first read will have to re-open it.
|
||||
|
||||
let desc = PersistentLayerDesc::new_delta(
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_start..key_end,
|
||||
self.lsn_range.clone(),
|
||||
metadata.len(),
|
||||
);
|
||||
let layer = DeltaLayer {
|
||||
path_or_conf: PathOrConf::Conf(self.conf),
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_start..key_end,
|
||||
self.lsn_range.clone(),
|
||||
metadata.len(),
|
||||
),
|
||||
access_stats: LayerAccessStats::empty_will_record_residence_event_later(),
|
||||
inner: OnceCell::new(),
|
||||
};
|
||||
|
||||
// fsync the file
|
||||
file.sync_all().await?;
|
||||
// Rename the file to its final name
|
||||
//
|
||||
// Note: This overwrites any existing file. There shouldn't be any.
|
||||
// FIXME: throw an error instead?
|
||||
let final_path = DeltaLayer::path_for(
|
||||
&PathOrConf::Conf(self.conf),
|
||||
&self.tenant_id,
|
||||
&self.timeline_id,
|
||||
&DeltaFileName {
|
||||
key_range: self.key_start..key_end,
|
||||
lsn_range: self.lsn_range,
|
||||
},
|
||||
);
|
||||
std::fs::rename(self.path, &final_path)?;
|
||||
|
||||
let layer = Layer::finish_creating(self.conf, timeline, desc, &self.path)?;
|
||||
|
||||
trace!("created delta layer {}", layer.local_path());
|
||||
trace!("created delta layer {final_path}");
|
||||
|
||||
Ok(layer)
|
||||
}
|
||||
@@ -589,12 +828,8 @@ impl DeltaLayerWriter {
|
||||
///
|
||||
/// Finish writing the delta layer.
|
||||
///
|
||||
pub(crate) async fn finish(
|
||||
mut self,
|
||||
key_end: Key,
|
||||
timeline: &Arc<Timeline>,
|
||||
) -> anyhow::Result<ResidentLayer> {
|
||||
self.inner.take().unwrap().finish(key_end, timeline).await
|
||||
pub async fn finish(mut self, key_end: Key) -> anyhow::Result<DeltaLayer> {
|
||||
self.inner.take().unwrap().finish(key_end).await
|
||||
}
|
||||
}
|
||||
|
||||
@@ -732,17 +967,15 @@ impl DeltaLayerInner {
|
||||
}
|
||||
}
|
||||
|
||||
pub(super) async fn load_keys<'a>(
|
||||
&'a self,
|
||||
ctx: &RequestContext,
|
||||
pub(super) async fn load_keys<'a, 'b, T: AsRef<DeltaLayerInner> + Clone>(
|
||||
this: &'a T,
|
||||
ctx: &'b RequestContext,
|
||||
) -> Result<Vec<DeltaEntry<'a>>> {
|
||||
let file = &self.file;
|
||||
let dl = this.as_ref();
|
||||
let file = &dl.file;
|
||||
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
self.index_start_blk,
|
||||
self.index_root_blk,
|
||||
file,
|
||||
);
|
||||
let tree_reader =
|
||||
DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(dl.index_start_blk, dl.index_root_blk, file);
|
||||
|
||||
let mut all_keys: Vec<DeltaEntry<'_>> = Vec::new();
|
||||
|
||||
@@ -755,7 +988,7 @@ impl DeltaLayerInner {
|
||||
let val_ref = ValueRef {
|
||||
blob_ref: BlobRef(value),
|
||||
reader: BlockCursor::new(crate::tenant::block_io::BlockReaderRef::Adapter(
|
||||
Adapter(self),
|
||||
Adapter(dl),
|
||||
)),
|
||||
};
|
||||
let pos = BlobRef(value).pos();
|
||||
@@ -782,61 +1015,10 @@ impl DeltaLayerInner {
|
||||
if let Some(last) = all_keys.last_mut() {
|
||||
// Last key occupies all space till end of value storage,
|
||||
// which corresponds to beginning of the index
|
||||
last.size = self.index_start_blk as u64 * PAGE_SZ as u64 - last.size;
|
||||
last.size = dl.index_start_blk as u64 * PAGE_SZ as u64 - last.size;
|
||||
}
|
||||
Ok(all_keys)
|
||||
}
|
||||
|
||||
pub(super) async fn dump(&self, ctx: &RequestContext) -> anyhow::Result<()> {
|
||||
println!(
|
||||
"index_start_blk: {}, root {}",
|
||||
self.index_start_blk, self.index_root_blk
|
||||
);
|
||||
|
||||
let file = &self.file;
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
self.index_start_blk,
|
||||
self.index_root_blk,
|
||||
file,
|
||||
);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
let keys = self.load_keys(ctx).await?;
|
||||
|
||||
async fn dump_blob(val: ValueRef<'_>, ctx: &RequestContext) -> anyhow::Result<String> {
|
||||
let buf = val.reader.read_blob(val.blob_ref.pos(), ctx).await?;
|
||||
let val = Value::des(&buf)?;
|
||||
let desc = match val {
|
||||
Value::Image(img) => {
|
||||
format!(" img {} bytes", img.len())
|
||||
}
|
||||
Value::WalRecord(rec) => {
|
||||
let wal_desc = walrecord::describe_wal_record(&rec)?;
|
||||
format!(
|
||||
" rec {} bytes will_init: {} {}",
|
||||
buf.len(),
|
||||
rec.will_init(),
|
||||
wal_desc
|
||||
)
|
||||
}
|
||||
};
|
||||
Ok(desc)
|
||||
}
|
||||
|
||||
for entry in keys {
|
||||
let DeltaEntry { key, lsn, val, .. } = entry;
|
||||
let desc = match dump_blob(val, ctx).await {
|
||||
Ok(desc) => desc,
|
||||
Err(err) => {
|
||||
format!("ERROR: {err}")
|
||||
}
|
||||
};
|
||||
println!(" key {key} at {lsn}: {desc}");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// A set of data associated with a delta layer key and its value
|
||||
@@ -876,9 +1058,3 @@ impl<T: AsRef<DeltaLayerInner>> Adapter<T> {
|
||||
self.0.as_ref().file.read_blk(blknum, ctx).await
|
||||
}
|
||||
}
|
||||
|
||||
impl AsRef<DeltaLayerInner> for DeltaLayerInner {
|
||||
fn as_ref(&self) -> &DeltaLayerInner {
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
@@ -226,14 +226,6 @@ impl LayerFileName {
|
||||
_ => false,
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn kind(&self) -> &'static str {
|
||||
use LayerFileName::*;
|
||||
match self {
|
||||
Delta(_) => "delta",
|
||||
Image(_) => "image",
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for LayerFileName {
|
||||
|
||||
@@ -31,23 +31,21 @@ use crate::tenant::blob_io::BlobWriter;
|
||||
use crate::tenant::block_io::{BlockBuf, BlockReader, FileBlockReader};
|
||||
use crate::tenant::disk_btree::{DiskBtreeBuilder, DiskBtreeReader, VisitDirection};
|
||||
use crate::tenant::storage_layer::{
|
||||
LayerAccessStats, ValueReconstructResult, ValueReconstructState,
|
||||
LayerAccessStats, PersistentLayer, ValueReconstructResult, ValueReconstructState,
|
||||
};
|
||||
use crate::tenant::Timeline;
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use crate::{IMAGE_FILE_MAGIC, STORAGE_FORMAT_VERSION, TEMP_FILE_SUFFIX};
|
||||
use anyhow::{bail, ensure, Context, Result};
|
||||
use bytes::Bytes;
|
||||
use camino::{Utf8Path, Utf8PathBuf};
|
||||
use hex;
|
||||
use pageserver_api::models::LayerAccessKind;
|
||||
use pageserver_api::models::{HistoricLayerInfo, LayerAccessKind};
|
||||
use rand::{distributions::Alphanumeric, Rng};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::fs::File;
|
||||
use std::fs::{self, File};
|
||||
use std::io::SeekFrom;
|
||||
use std::ops::Range;
|
||||
use std::os::unix::prelude::FileExt;
|
||||
use std::sync::Arc;
|
||||
use tokio::sync::OnceCell;
|
||||
use tracing::*;
|
||||
|
||||
@@ -58,7 +56,7 @@ use utils::{
|
||||
};
|
||||
|
||||
use super::filename::ImageFileName;
|
||||
use super::{AsLayerDesc, Layer, PersistentLayerDesc, ResidentLayer};
|
||||
use super::{AsLayerDesc, Layer, LayerAccessStatsReset, PathOrConf, PersistentLayerDesc};
|
||||
|
||||
///
|
||||
/// Header stored in the beginning of the file
|
||||
@@ -116,14 +114,22 @@ impl Summary {
|
||||
}
|
||||
}
|
||||
|
||||
/// This is used only from `pagectl`. Within pageserver, all layers are
|
||||
/// [`crate::tenant::storage_layer::Layer`], which can hold an [`ImageLayerInner`].
|
||||
/// ImageLayer is the in-memory data structure associated with an on-disk image
|
||||
/// file.
|
||||
///
|
||||
/// We keep an ImageLayer in memory for each file, in the LayerMap. If a layer
|
||||
/// is in "loaded" state, we have a copy of the index in memory, in 'inner'.
|
||||
/// Otherwise the struct is just a placeholder for a file that exists on disk,
|
||||
/// and it needs to be loaded before using it in queries.
|
||||
pub struct ImageLayer {
|
||||
path: Utf8PathBuf,
|
||||
path_or_conf: PathOrConf,
|
||||
|
||||
pub desc: PersistentLayerDesc,
|
||||
// This entry contains an image of all pages as of this LSN, should be the same as desc.lsn
|
||||
pub lsn: Lsn,
|
||||
|
||||
access_stats: LayerAccessStats,
|
||||
|
||||
inner: OnceCell<ImageLayerInner>,
|
||||
}
|
||||
|
||||
@@ -140,8 +146,6 @@ impl std::fmt::Debug for ImageLayer {
|
||||
}
|
||||
}
|
||||
|
||||
/// ImageLayer is the in-memory data structure associated with an on-disk image
|
||||
/// file.
|
||||
pub struct ImageLayerInner {
|
||||
// values copied from summary
|
||||
index_start_blk: u32,
|
||||
@@ -162,11 +166,73 @@ impl std::fmt::Debug for ImageLayerInner {
|
||||
}
|
||||
}
|
||||
|
||||
impl ImageLayerInner {
|
||||
pub(super) async fn dump(&self, ctx: &RequestContext) -> anyhow::Result<()> {
|
||||
let file = &self.file;
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for ImageLayer {
|
||||
/// Look up given page in the file
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
self.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
|
||||
.await
|
||||
}
|
||||
}
|
||||
|
||||
/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
|
||||
impl std::fmt::Display for ImageLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
write!(f, "{}", self.layer_desc().short_id())
|
||||
}
|
||||
}
|
||||
|
||||
impl AsLayerDesc for ImageLayer {
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc {
|
||||
&self.desc
|
||||
}
|
||||
}
|
||||
|
||||
impl PersistentLayer for ImageLayer {
|
||||
fn local_path(&self) -> Option<Utf8PathBuf> {
|
||||
self.local_path()
|
||||
}
|
||||
|
||||
fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
self.delete_resident_layer_file()
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
self.info(reset)
|
||||
}
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats {
|
||||
self.access_stats()
|
||||
}
|
||||
}
|
||||
|
||||
impl ImageLayer {
|
||||
pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
|
||||
println!(
|
||||
"----- image layer for ten {} tli {} key {}-{} at {} is_incremental {} size {} ----",
|
||||
self.desc.tenant_id,
|
||||
self.desc.timeline_id,
|
||||
self.desc.key_range.start,
|
||||
self.desc.key_range.end,
|
||||
self.lsn,
|
||||
self.desc.is_incremental(),
|
||||
self.desc.file_size
|
||||
);
|
||||
|
||||
if !verbose {
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let inner = self.load(LayerAccessKind::Dump, ctx).await?;
|
||||
let file = &inner.file;
|
||||
let tree_reader =
|
||||
DiskBtreeReader::<_, KEY_SIZE>::new(self.index_start_blk, self.index_root_blk, file);
|
||||
DiskBtreeReader::<_, KEY_SIZE>::new(inner.index_start_blk, inner.index_root_blk, file);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
@@ -184,36 +250,69 @@ impl ImageLayerInner {
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
|
||||
impl std::fmt::Display for ImageLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
write!(f, "{}", self.layer_desc().short_id())
|
||||
pub(crate) async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
assert!(self.desc.key_range.contains(&key));
|
||||
assert!(lsn_range.start >= self.lsn);
|
||||
assert!(lsn_range.end >= self.lsn);
|
||||
|
||||
let inner = self
|
||||
.load(LayerAccessKind::GetValueReconstructData, ctx)
|
||||
.await?;
|
||||
inner
|
||||
.get_value_reconstruct_data(key, reconstruct_state, ctx)
|
||||
.await
|
||||
// FIXME: makes no sense to dump paths
|
||||
.with_context(|| format!("read {}", self.path()))
|
||||
}
|
||||
}
|
||||
|
||||
impl AsLayerDesc for ImageLayer {
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc {
|
||||
&self.desc
|
||||
pub(crate) fn local_path(&self) -> Option<Utf8PathBuf> {
|
||||
Some(self.path())
|
||||
}
|
||||
}
|
||||
|
||||
impl ImageLayer {
|
||||
pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
|
||||
self.desc.dump();
|
||||
|
||||
if !verbose {
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let inner = self.load(LayerAccessKind::Dump, ctx).await?;
|
||||
|
||||
inner.dump(ctx).await?;
|
||||
|
||||
pub(crate) fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
// delete underlying file
|
||||
fs::remove_file(self.path())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
let layer_file_name = self.layer_desc().filename().file_name();
|
||||
let lsn_start = self.layer_desc().image_layer_lsn();
|
||||
|
||||
HistoricLayerInfo::Image {
|
||||
layer_file_name,
|
||||
layer_file_size: self.desc.file_size,
|
||||
lsn_start,
|
||||
remote: false,
|
||||
access_stats: self.access_stats.as_api_model(reset),
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn access_stats(&self) -> &LayerAccessStats {
|
||||
&self.access_stats
|
||||
}
|
||||
|
||||
fn path_for(
|
||||
path_or_conf: &PathOrConf,
|
||||
timeline_id: TimelineId,
|
||||
tenant_id: TenantId,
|
||||
fname: &ImageFileName,
|
||||
) -> Utf8PathBuf {
|
||||
match path_or_conf {
|
||||
PathOrConf::Path(path) => path.to_path_buf(),
|
||||
PathOrConf::Conf(conf) => conf
|
||||
.timeline_path(&tenant_id, &timeline_id)
|
||||
.join(fname.to_string()),
|
||||
}
|
||||
}
|
||||
|
||||
fn temp_path_for(
|
||||
conf: &PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
@@ -249,21 +348,54 @@ impl ImageLayer {
|
||||
async fn load_inner(&self, ctx: &RequestContext) -> Result<ImageLayerInner> {
|
||||
let path = self.path();
|
||||
|
||||
let loaded = ImageLayerInner::load(&path, self.desc.image_layer_lsn(), None, ctx).await?;
|
||||
let expected_summary = match &self.path_or_conf {
|
||||
PathOrConf::Conf(_) => Some(Summary::from(self)),
|
||||
PathOrConf::Path(_) => None,
|
||||
};
|
||||
|
||||
// not production code
|
||||
let actual_filename = path.file_name().unwrap().to_owned();
|
||||
let expected_filename = self.layer_desc().filename().file_name();
|
||||
let loaded =
|
||||
ImageLayerInner::load(&path, self.desc.image_layer_lsn(), expected_summary, ctx)
|
||||
.await?;
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
if let PathOrConf::Path(ref path) = self.path_or_conf {
|
||||
// not production code
|
||||
let actual_filename = path.file_name().unwrap().to_owned();
|
||||
let expected_filename = self.filename().file_name();
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(loaded)
|
||||
}
|
||||
|
||||
/// Create an ImageLayer struct representing an existing file on disk
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
tenant_id: TenantId,
|
||||
filename: &ImageFileName,
|
||||
file_size: u64,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> ImageLayer {
|
||||
ImageLayer {
|
||||
path_or_conf: PathOrConf::Conf(conf),
|
||||
desc: PersistentLayerDesc::new_img(
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
filename.key_range.clone(),
|
||||
filename.lsn,
|
||||
file_size,
|
||||
), // Now we assume image layer ALWAYS covers the full range. This may change in the future.
|
||||
lsn: filename.lsn,
|
||||
access_stats,
|
||||
inner: OnceCell::new(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create an ImageLayer struct representing an existing file on disk.
|
||||
///
|
||||
/// This variant is only used for debugging purposes, by the 'pagectl' binary.
|
||||
@@ -275,7 +407,7 @@ impl ImageLayer {
|
||||
.metadata()
|
||||
.context("get file metadata to determine size")?;
|
||||
Ok(ImageLayer {
|
||||
path: path.to_path_buf(),
|
||||
path_or_conf: PathOrConf::Path(path.to_path_buf()),
|
||||
desc: PersistentLayerDesc::new_img(
|
||||
summary.tenant_id,
|
||||
summary.timeline_id,
|
||||
@@ -289,8 +421,18 @@ impl ImageLayer {
|
||||
})
|
||||
}
|
||||
|
||||
fn path(&self) -> Utf8PathBuf {
|
||||
self.path.clone()
|
||||
fn layer_name(&self) -> ImageFileName {
|
||||
self.desc.image_file_name()
|
||||
}
|
||||
|
||||
/// Path to the layer file in pageserver workdir.
|
||||
pub fn path(&self) -> Utf8PathBuf {
|
||||
Self::path_for(
|
||||
&self.path_or_conf,
|
||||
self.desc.timeline_id,
|
||||
self.desc.tenant_id,
|
||||
&self.layer_name(),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -462,7 +604,7 @@ impl ImageLayerWriterInner {
|
||||
///
|
||||
/// Finish writing the image layer.
|
||||
///
|
||||
async fn finish(self, timeline: &Arc<Timeline>) -> anyhow::Result<ResidentLayer> {
|
||||
async fn finish(self) -> anyhow::Result<ImageLayer> {
|
||||
let index_start_blk =
|
||||
((self.blob_writer.size() + PAGE_SZ as u64 - 1) / PAGE_SZ as u64) as u32;
|
||||
|
||||
@@ -516,14 +658,33 @@ impl ImageLayerWriterInner {
|
||||
// Note: Because we open the file in write-only mode, we cannot
|
||||
// reuse the same VirtualFile for reading later. That's why we don't
|
||||
// set inner.file here. The first read will have to re-open it.
|
||||
let layer = ImageLayer {
|
||||
path_or_conf: PathOrConf::Conf(self.conf),
|
||||
desc,
|
||||
lsn: self.lsn,
|
||||
access_stats: LayerAccessStats::empty_will_record_residence_event_later(),
|
||||
inner: OnceCell::new(),
|
||||
};
|
||||
|
||||
// fsync the file
|
||||
file.sync_all().await?;
|
||||
|
||||
// FIXME: why not carry the virtualfile here, it supports renaming?
|
||||
let layer = Layer::finish_creating(self.conf, timeline, desc, &self.path)?;
|
||||
// Rename the file to its final name
|
||||
//
|
||||
// Note: This overwrites any existing file. There shouldn't be any.
|
||||
// FIXME: throw an error instead?
|
||||
let final_path = ImageLayer::path_for(
|
||||
&PathOrConf::Conf(self.conf),
|
||||
self.timeline_id,
|
||||
self.tenant_id,
|
||||
&ImageFileName {
|
||||
key_range: self.key_range.clone(),
|
||||
lsn: self.lsn,
|
||||
},
|
||||
);
|
||||
std::fs::rename(self.path, final_path)?;
|
||||
|
||||
trace!("created image layer {}", layer.local_path());
|
||||
trace!("created image layer {}", layer.path());
|
||||
|
||||
Ok(layer)
|
||||
}
|
||||
@@ -585,11 +746,8 @@ impl ImageLayerWriter {
|
||||
///
|
||||
/// Finish writing the image layer.
|
||||
///
|
||||
pub(crate) async fn finish(
|
||||
mut self,
|
||||
timeline: &Arc<Timeline>,
|
||||
) -> anyhow::Result<super::ResidentLayer> {
|
||||
self.inner.take().unwrap().finish(timeline).await
|
||||
pub async fn finish(mut self) -> anyhow::Result<ImageLayer> {
|
||||
self.inner.take().unwrap().finish().await
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -10,12 +10,11 @@ use crate::repository::{Key, Value};
|
||||
use crate::tenant::block_io::BlockReader;
|
||||
use crate::tenant::ephemeral_file::EphemeralFile;
|
||||
use crate::tenant::storage_layer::{ValueReconstructResult, ValueReconstructState};
|
||||
use crate::tenant::Timeline;
|
||||
use crate::walrecord;
|
||||
use anyhow::{ensure, Result};
|
||||
use pageserver_api::models::InMemoryLayerInfo;
|
||||
use std::collections::HashMap;
|
||||
use std::sync::{Arc, OnceLock};
|
||||
use std::sync::OnceLock;
|
||||
use tracing::*;
|
||||
use utils::{
|
||||
bin_ser::BeSer,
|
||||
@@ -29,7 +28,7 @@ use std::fmt::Write as _;
|
||||
use std::ops::Range;
|
||||
use tokio::sync::RwLock;
|
||||
|
||||
use super::{DeltaLayerWriter, ResidentLayer};
|
||||
use super::{DeltaLayer, DeltaLayerWriter, Layer};
|
||||
|
||||
pub struct InMemoryLayer {
|
||||
conf: &'static PageServerConf,
|
||||
@@ -208,6 +207,20 @@ impl InMemoryLayer {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for InMemoryLayer {
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_data: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<ValueReconstructResult> {
|
||||
self.get_value_reconstruct_data(key, lsn_range, reconstruct_data, ctx)
|
||||
.await
|
||||
}
|
||||
}
|
||||
|
||||
impl std::fmt::Display for InMemoryLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
let end_lsn = self.end_lsn_or_max();
|
||||
@@ -216,13 +229,17 @@ impl std::fmt::Display for InMemoryLayer {
|
||||
}
|
||||
|
||||
impl InMemoryLayer {
|
||||
///
|
||||
/// Get layer size.
|
||||
///
|
||||
pub async fn size(&self) -> Result<u64> {
|
||||
let inner = self.inner.read().await;
|
||||
Ok(inner.file.len())
|
||||
}
|
||||
|
||||
///
|
||||
/// Create a new, empty, in-memory layer
|
||||
///
|
||||
pub async fn create(
|
||||
conf: &'static PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
@@ -314,11 +331,7 @@ impl InMemoryLayer {
|
||||
/// Write this frozen in-memory layer to disk.
|
||||
///
|
||||
/// Returns a new delta layer with all the same data as this in-memory layer
|
||||
pub(crate) async fn write_to_disk(
|
||||
&self,
|
||||
timeline: &Arc<Timeline>,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<ResidentLayer> {
|
||||
pub(crate) async fn write_to_disk(&self, ctx: &RequestContext) -> Result<DeltaLayer> {
|
||||
// Grab the lock in read-mode. We hold it over the I/O, but because this
|
||||
// layer is not writeable anymore, no one should be trying to acquire the
|
||||
// write lock on it, so we shouldn't block anyone. There's one exception
|
||||
@@ -363,8 +376,7 @@ impl InMemoryLayer {
|
||||
}
|
||||
}
|
||||
|
||||
// MAX is used here because we identify L0 layers by full key range
|
||||
let delta_layer = delta_layer_writer.finish(Key::MAX, timeline).await?;
|
||||
let delta_layer = delta_layer_writer.finish(Key::MAX).await?;
|
||||
Ok(delta_layer)
|
||||
}
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,3 +1,4 @@
|
||||
use anyhow::Result;
|
||||
use core::fmt::Display;
|
||||
use std::ops::Range;
|
||||
use utils::{
|
||||
@@ -5,7 +6,7 @@ use utils::{
|
||||
lsn::Lsn,
|
||||
};
|
||||
|
||||
use crate::repository::Key;
|
||||
use crate::{context::RequestContext, repository::Key};
|
||||
|
||||
use super::{DeltaFileName, ImageFileName, LayerFileName};
|
||||
|
||||
@@ -99,22 +100,6 @@ impl PersistentLayerDesc {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn from_filename(
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
filename: LayerFileName,
|
||||
file_size: u64,
|
||||
) -> Self {
|
||||
match filename {
|
||||
LayerFileName::Image(i) => {
|
||||
Self::new_img(tenant_id, timeline_id, i.key_range, i.lsn, file_size)
|
||||
}
|
||||
LayerFileName::Delta(d) => {
|
||||
Self::new_delta(tenant_id, timeline_id, d.key_range, d.lsn_range, file_size)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Get the LSN that the image layer covers.
|
||||
pub fn image_layer_lsn(&self) -> Lsn {
|
||||
assert!(!self.is_delta);
|
||||
@@ -188,31 +173,21 @@ impl PersistentLayerDesc {
|
||||
self.is_delta
|
||||
}
|
||||
|
||||
pub fn dump(&self) {
|
||||
if self.is_delta {
|
||||
println!(
|
||||
"----- delta layer for ten {} tli {} keys {}-{} lsn {}-{} is_incremental {} size {} ----",
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_range.start,
|
||||
self.key_range.end,
|
||||
self.lsn_range.start,
|
||||
self.lsn_range.end,
|
||||
self.is_incremental(),
|
||||
self.file_size,
|
||||
);
|
||||
} else {
|
||||
println!(
|
||||
"----- image layer for ten {} tli {} key {}-{} at {} is_incremental {} size {} ----",
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_range.start,
|
||||
self.key_range.end,
|
||||
self.image_layer_lsn(),
|
||||
self.is_incremental(),
|
||||
self.file_size
|
||||
);
|
||||
}
|
||||
pub fn dump(&self, _verbose: bool, _ctx: &RequestContext) -> Result<()> {
|
||||
println!(
|
||||
"----- layer for ten {} tli {} keys {}-{} lsn {}-{} is_delta {} is_incremental {} size {} ----",
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_range.start,
|
||||
self.key_range.end,
|
||||
self.lsn_range.start,
|
||||
self.lsn_range.end,
|
||||
self.is_delta,
|
||||
self.is_incremental(),
|
||||
self.file_size,
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn file_size(&self) -> u64 {
|
||||
|
||||
216
pageserver/src/tenant/storage_layer/remote_layer.rs
Normal file
216
pageserver/src/tenant/storage_layer/remote_layer.rs
Normal file
@@ -0,0 +1,216 @@
|
||||
//! A RemoteLayer is an in-memory placeholder for a layer file that exists
|
||||
//! in remote storage.
|
||||
//!
|
||||
use crate::config::PageServerConf;
|
||||
use crate::context::RequestContext;
|
||||
use crate::repository::Key;
|
||||
use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
|
||||
use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState};
|
||||
use crate::tenant::timeline::layer_manager::LayerManager;
|
||||
use anyhow::{bail, Result};
|
||||
use camino::Utf8PathBuf;
|
||||
use pageserver_api::models::HistoricLayerInfo;
|
||||
use std::ops::Range;
|
||||
use std::sync::Arc;
|
||||
|
||||
use utils::{
|
||||
id::{TenantId, TimelineId},
|
||||
lsn::Lsn,
|
||||
};
|
||||
|
||||
use super::filename::{DeltaFileName, ImageFileName};
|
||||
use super::{
|
||||
AsLayerDesc, DeltaLayer, ImageLayer, LayerAccessStats, LayerAccessStatsReset,
|
||||
LayerResidenceStatus, PersistentLayer, PersistentLayerDesc,
|
||||
};
|
||||
|
||||
/// RemoteLayer is a not yet downloaded [`ImageLayer`] or
|
||||
/// [`DeltaLayer`](super::DeltaLayer).
|
||||
///
|
||||
/// RemoteLayer might be downloaded on-demand during operations which are
|
||||
/// allowed download remote layers and during which, it gets replaced with a
|
||||
/// concrete `DeltaLayer` or `ImageLayer`.
|
||||
///
|
||||
/// See: [`crate::context::RequestContext`] for authorization to download
|
||||
pub struct RemoteLayer {
|
||||
pub desc: PersistentLayerDesc,
|
||||
|
||||
pub layer_metadata: LayerFileMetadata,
|
||||
|
||||
access_stats: LayerAccessStats,
|
||||
|
||||
pub(crate) ongoing_download: Arc<tokio::sync::Semaphore>,
|
||||
|
||||
/// Has `LayerMap::replace` failed for this (true) or not (false).
|
||||
///
|
||||
/// Used together with [`ongoing_download`] semaphore in `Timeline::download_remote_layer`.
|
||||
/// The field is used to mark a RemoteLayer permanently (until restart or ignore+load)
|
||||
/// unprocessable, because a LayerMap::replace failed.
|
||||
///
|
||||
/// It is very unlikely to accumulate these in the Timeline's LayerMap, but having this avoids
|
||||
/// a possible fast loop between `Timeline::get_reconstruct_data` and
|
||||
/// `Timeline::download_remote_layer`, which also logs.
|
||||
///
|
||||
/// [`ongoing_download`]: Self::ongoing_download
|
||||
pub(crate) download_replacement_failure: std::sync::atomic::AtomicBool,
|
||||
}
|
||||
|
||||
impl std::fmt::Debug for RemoteLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.debug_struct("RemoteLayer")
|
||||
.field("file_name", &self.desc.filename())
|
||||
.field("layer_metadata", &self.layer_metadata)
|
||||
.field("is_incremental", &self.desc.is_incremental())
|
||||
.finish()
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for RemoteLayer {
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
_key: Key,
|
||||
_lsn_range: Range<Lsn>,
|
||||
_reconstruct_state: &mut ValueReconstructState,
|
||||
_ctx: &RequestContext,
|
||||
) -> Result<ValueReconstructResult> {
|
||||
Err(anyhow::anyhow!("layer {self} needs to be downloaded"))
|
||||
}
|
||||
}
|
||||
|
||||
/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
|
||||
impl std::fmt::Display for RemoteLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
write!(f, "{}", self.layer_desc().short_id())
|
||||
}
|
||||
}
|
||||
|
||||
impl AsLayerDesc for RemoteLayer {
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc {
|
||||
&self.desc
|
||||
}
|
||||
}
|
||||
|
||||
impl PersistentLayer for RemoteLayer {
|
||||
fn local_path(&self) -> Option<Utf8PathBuf> {
|
||||
None
|
||||
}
|
||||
|
||||
fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
bail!("remote layer has no layer file");
|
||||
}
|
||||
|
||||
fn downcast_remote_layer<'a>(self: Arc<Self>) -> Option<std::sync::Arc<RemoteLayer>> {
|
||||
Some(self)
|
||||
}
|
||||
|
||||
fn is_remote_layer(&self) -> bool {
|
||||
true
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
let layer_file_name = self.layer_desc().filename().file_name();
|
||||
let lsn_range = self.layer_desc().lsn_range.clone();
|
||||
|
||||
if self.desc.is_delta {
|
||||
HistoricLayerInfo::Delta {
|
||||
layer_file_name,
|
||||
layer_file_size: self.layer_metadata.file_size(),
|
||||
lsn_start: lsn_range.start,
|
||||
lsn_end: lsn_range.end,
|
||||
remote: true,
|
||||
access_stats: self.access_stats.as_api_model(reset),
|
||||
}
|
||||
} else {
|
||||
HistoricLayerInfo::Image {
|
||||
layer_file_name,
|
||||
layer_file_size: self.layer_metadata.file_size(),
|
||||
lsn_start: lsn_range.start,
|
||||
remote: true,
|
||||
access_stats: self.access_stats.as_api_model(reset),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats {
|
||||
&self.access_stats
|
||||
}
|
||||
}
|
||||
|
||||
impl RemoteLayer {
|
||||
pub fn new_img(
|
||||
tenantid: TenantId,
|
||||
timelineid: TimelineId,
|
||||
fname: &ImageFileName,
|
||||
layer_metadata: &LayerFileMetadata,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> RemoteLayer {
|
||||
RemoteLayer {
|
||||
desc: PersistentLayerDesc::new_img(
|
||||
tenantid,
|
||||
timelineid,
|
||||
fname.key_range.clone(),
|
||||
fname.lsn,
|
||||
layer_metadata.file_size(),
|
||||
),
|
||||
layer_metadata: layer_metadata.clone(),
|
||||
ongoing_download: Arc::new(tokio::sync::Semaphore::new(1)),
|
||||
download_replacement_failure: std::sync::atomic::AtomicBool::default(),
|
||||
access_stats,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn new_delta(
|
||||
tenantid: TenantId,
|
||||
timelineid: TimelineId,
|
||||
fname: &DeltaFileName,
|
||||
layer_metadata: &LayerFileMetadata,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> RemoteLayer {
|
||||
RemoteLayer {
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
tenantid,
|
||||
timelineid,
|
||||
fname.key_range.clone(),
|
||||
fname.lsn_range.clone(),
|
||||
layer_metadata.file_size(),
|
||||
),
|
||||
layer_metadata: layer_metadata.clone(),
|
||||
ongoing_download: Arc::new(tokio::sync::Semaphore::new(1)),
|
||||
download_replacement_failure: std::sync::atomic::AtomicBool::default(),
|
||||
access_stats,
|
||||
}
|
||||
}
|
||||
|
||||
/// Create a Layer struct representing this layer, after it has been downloaded.
|
||||
pub(crate) fn create_downloaded_layer(
|
||||
&self,
|
||||
_layer_map_lock_held_witness: &LayerManager,
|
||||
conf: &'static PageServerConf,
|
||||
file_size: u64,
|
||||
) -> Arc<dyn PersistentLayer> {
|
||||
if self.desc.is_delta {
|
||||
let fname = self.desc.delta_file_name();
|
||||
Arc::new(DeltaLayer::new(
|
||||
conf,
|
||||
self.desc.timeline_id,
|
||||
self.desc.tenant_id,
|
||||
&fname,
|
||||
file_size,
|
||||
self.access_stats
|
||||
.clone_for_residence_change(LayerResidenceStatus::Resident),
|
||||
))
|
||||
} else {
|
||||
let fname = self.desc.image_file_name();
|
||||
Arc::new(ImageLayer::new(
|
||||
conf,
|
||||
self.desc.timeline_id,
|
||||
self.desc.tenant_id,
|
||||
&fname,
|
||||
file_size,
|
||||
self.access_stats
|
||||
.clone_for_residence_change(LayerResidenceStatus::Resident),
|
||||
))
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -12,74 +12,7 @@ use crate::task_mgr::{TaskKind, BACKGROUND_RUNTIME};
|
||||
use crate::tenant::{Tenant, TenantState};
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::*;
|
||||
use utils::{backoff, completion};
|
||||
|
||||
static CONCURRENT_BACKGROUND_TASKS: once_cell::sync::Lazy<tokio::sync::Semaphore> =
|
||||
once_cell::sync::Lazy::new(|| {
|
||||
let total_threads = *task_mgr::BACKGROUND_RUNTIME_WORKER_THREADS;
|
||||
let permits = usize::max(
|
||||
1,
|
||||
// while a lot of the work is done on spawn_blocking, we still do
|
||||
// repartitioning in the async context. this should give leave us some workers
|
||||
// unblocked to be blocked on other work, hopefully easing any outside visible
|
||||
// effects of restarts.
|
||||
//
|
||||
// 6/8 is a guess; previously we ran with unlimited 8 and more from
|
||||
// spawn_blocking.
|
||||
(total_threads * 3).checked_div(4).unwrap_or(0),
|
||||
);
|
||||
assert_ne!(permits, 0, "we will not be adding in permits later");
|
||||
assert!(
|
||||
permits < total_threads,
|
||||
"need threads avail for shorter work"
|
||||
);
|
||||
tokio::sync::Semaphore::new(permits)
|
||||
});
|
||||
|
||||
#[derive(Debug, PartialEq, Eq, Clone, Copy, strum_macros::IntoStaticStr)]
|
||||
#[strum(serialize_all = "snake_case")]
|
||||
pub(crate) enum BackgroundLoopKind {
|
||||
Compaction,
|
||||
Gc,
|
||||
Eviction,
|
||||
ConsumptionMetricsCollectMetrics,
|
||||
ConsumptionMetricsSyntheticSizeWorker,
|
||||
}
|
||||
|
||||
impl BackgroundLoopKind {
|
||||
fn as_static_str(&self) -> &'static str {
|
||||
let s: &'static str = self.into();
|
||||
s
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) enum RateLimitError {
|
||||
Cancelled,
|
||||
}
|
||||
|
||||
pub(crate) async fn concurrent_background_tasks_rate_limit(
|
||||
loop_kind: BackgroundLoopKind,
|
||||
_ctx: &RequestContext,
|
||||
cancel: &CancellationToken,
|
||||
) -> Result<impl Drop, RateLimitError> {
|
||||
crate::metrics::BACKGROUND_LOOP_SEMAPHORE_WAIT_START_COUNT
|
||||
.with_label_values(&[loop_kind.as_static_str()])
|
||||
.inc();
|
||||
scopeguard::defer!(
|
||||
crate::metrics::BACKGROUND_LOOP_SEMAPHORE_WAIT_FINISH_COUNT.with_label_values(&[loop_kind.as_static_str()]).inc();
|
||||
);
|
||||
tokio::select! {
|
||||
permit = CONCURRENT_BACKGROUND_TASKS.acquire() => {
|
||||
match permit {
|
||||
Ok(permit) => Ok(permit),
|
||||
Err(_closed) => unreachable!("we never close the semaphore"),
|
||||
}
|
||||
},
|
||||
_ = cancel.cancelled() => {
|
||||
Err(RateLimitError::Cancelled)
|
||||
}
|
||||
}
|
||||
}
|
||||
use utils::completion;
|
||||
|
||||
/// Start per tenant background loops: compaction and gc.
|
||||
pub fn start_background_loops(
|
||||
@@ -139,10 +72,7 @@ pub fn start_background_loops(
|
||||
/// Compaction task's main loop
|
||||
///
|
||||
async fn compaction_loop(tenant: Arc<Tenant>, cancel: CancellationToken) {
|
||||
const MAX_BACKOFF_SECS: f64 = 300.0;
|
||||
// How many errors we have seen consequtively
|
||||
let mut error_run_count = 0;
|
||||
|
||||
let wait_duration = Duration::from_secs(2);
|
||||
TENANT_TASK_EVENTS.with_label_values(&["start"]).inc();
|
||||
async {
|
||||
let ctx = RequestContext::todo_child(TaskKind::Compaction, DownloadBehavior::Download);
|
||||
@@ -179,24 +109,14 @@ async fn compaction_loop(tenant: Arc<Tenant>, cancel: CancellationToken) {
|
||||
} else {
|
||||
// Run compaction
|
||||
if let Err(e) = tenant.compaction_iteration(&cancel, &ctx).await {
|
||||
let wait_duration = backoff::exponential_backoff_duration_seconds(
|
||||
error_run_count,
|
||||
1.0,
|
||||
MAX_BACKOFF_SECS,
|
||||
);
|
||||
error_run_count += 1;
|
||||
error!(
|
||||
"Compaction failed {error_run_count} times, retrying in {:?}: {e:?}",
|
||||
wait_duration
|
||||
);
|
||||
Duration::from_secs_f64(wait_duration)
|
||||
error!("Compaction failed, retrying in {:?}: {e:?}", wait_duration);
|
||||
wait_duration
|
||||
} else {
|
||||
error_run_count = 0;
|
||||
period
|
||||
}
|
||||
};
|
||||
|
||||
warn_when_period_overrun(started_at.elapsed(), period, BackgroundLoopKind::Compaction);
|
||||
warn_when_period_overrun(started_at.elapsed(), period, "compaction");
|
||||
|
||||
// Sleep
|
||||
if tokio::time::timeout(sleep_duration, cancel.cancelled())
|
||||
@@ -215,10 +135,7 @@ async fn compaction_loop(tenant: Arc<Tenant>, cancel: CancellationToken) {
|
||||
/// GC task's main loop
|
||||
///
|
||||
async fn gc_loop(tenant: Arc<Tenant>, cancel: CancellationToken) {
|
||||
const MAX_BACKOFF_SECS: f64 = 300.0;
|
||||
// How many errors we have seen consequtively
|
||||
let mut error_run_count = 0;
|
||||
|
||||
let wait_duration = Duration::from_secs(2);
|
||||
TENANT_TASK_EVENTS.with_label_values(&["start"]).inc();
|
||||
async {
|
||||
// GC might require downloading, to find the cutoff LSN that corresponds to the
|
||||
@@ -260,24 +177,14 @@ async fn gc_loop(tenant: Arc<Tenant>, cancel: CancellationToken) {
|
||||
.gc_iteration(None, gc_horizon, tenant.get_pitr_interval(), &ctx)
|
||||
.await;
|
||||
if let Err(e) = res {
|
||||
let wait_duration = backoff::exponential_backoff_duration_seconds(
|
||||
error_run_count,
|
||||
1.0,
|
||||
MAX_BACKOFF_SECS,
|
||||
);
|
||||
error_run_count += 1;
|
||||
error!(
|
||||
"Gc failed {error_run_count} times, retrying in {:?}: {e:?}",
|
||||
wait_duration
|
||||
);
|
||||
Duration::from_secs_f64(wait_duration)
|
||||
error!("Gc failed, retrying in {:?}: {e:?}", wait_duration);
|
||||
wait_duration
|
||||
} else {
|
||||
error_run_count = 0;
|
||||
period
|
||||
}
|
||||
};
|
||||
|
||||
warn_when_period_overrun(started_at.elapsed(), period, BackgroundLoopKind::Gc);
|
||||
warn_when_period_overrun(started_at.elapsed(), period, "gc");
|
||||
|
||||
// Sleep
|
||||
if tokio::time::timeout(sleep_duration, cancel.cancelled())
|
||||
@@ -351,24 +258,20 @@ pub(crate) async fn random_init_delay(
|
||||
}
|
||||
|
||||
/// Attention: the `task` and `period` beocme labels of a pageserver-wide prometheus metric.
|
||||
pub(crate) fn warn_when_period_overrun(
|
||||
elapsed: Duration,
|
||||
period: Duration,
|
||||
task: BackgroundLoopKind,
|
||||
) {
|
||||
pub(crate) fn warn_when_period_overrun(elapsed: Duration, period: Duration, task: &str) {
|
||||
// Duration::ZERO will happen because it's the "disable [bgtask]" value.
|
||||
if elapsed >= period && period != Duration::ZERO {
|
||||
// humantime does no significant digits clamping whereas Duration's debug is a bit more
|
||||
// intelligent. however it makes sense to keep the "configuration format" for period, even
|
||||
// though there's no way to output the actual config value.
|
||||
info!(
|
||||
warn!(
|
||||
?elapsed,
|
||||
period = %humantime::format_duration(period),
|
||||
?task,
|
||||
task,
|
||||
"task iteration took longer than the configured period"
|
||||
);
|
||||
crate::metrics::BACKGROUND_LOOP_PERIOD_OVERRUN_COUNT
|
||||
.with_label_values(&[task.as_static_str(), &format!("{}", period.as_secs())])
|
||||
.with_label_values(&[task, &format!("{}", period.as_secs())])
|
||||
.inc();
|
||||
}
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user