HACK: BACKGROUND_RUNTIME webserver to measure response time using wrk

In logs it is confusing to see seqwait timeouts which seemingly arise
from the branched lsn but actually are about the ancestor, leading to
questions like "has the last_record_lsn went back".

Noticed by @problame.

.github/actions/run-python-test-set/action.yml

@@ -145,7 +145,11 @@ runs:
 
         if [ "${RERUN_FLAKY}" == "true" ]; then
           mkdir -p $TEST_OUTPUT
-          poetry run ./scripts/flaky_tests.py "${TEST_RESULT_CONNSTR}" --days 10 --output "$TEST_OUTPUT/flaky.json"
+          poetry run ./scripts/flaky_tests.py "${TEST_RESULT_CONNSTR}" \
+                                              --days 7 \
+                                              --output "$TEST_OUTPUT/flaky.json" \
+                                              --pg-version "${DEFAULT_PG_VERSION}" \
+                                              --build-type "${BUILD_TYPE}"
 
           EXTRA_PARAMS="--flaky-tests-json $TEST_OUTPUT/flaky.json $EXTRA_PARAMS"
         fi

Cargo.lock

@@ -5014,6 +5014,7 @@ dependencies = [
  "nix 0.26.2",
  "once_cell",
  "pin-project-lite",
+ "postgres_connection",
  "pq_proto",
  "rand",
  "regex",

Dockerfile.compute-node

@@ -211,8 +211,8 @@ RUN wget https://github.com/df7cb/postgresql-unit/archive/refs/tags/7.7.tar.gz -
 FROM build-deps AS vector-pg-build
 COPY --from=pg-build /usr/local/pgsql/ /usr/local/pgsql/
 
-RUN wget https://github.com/pgvector/pgvector/archive/refs/tags/v0.4.4.tar.gz -O pgvector.tar.gz && \
-    echo "1cb70a63f8928e396474796c22a20be9f7285a8a013009deb8152445b61b72e6 pgvector.tar.gz" | sha256sum --check && \
+RUN wget https://github.com/pgvector/pgvector/archive/refs/tags/v0.5.0.tar.gz -O pgvector.tar.gz && \
+    echo "d8aa3504b215467ca528525a6de12c3f85f9891b091ce0e5864dd8a9b757f77b pgvector.tar.gz" | sha256sum --check && \
     mkdir pgvector-src && cd pgvector-src && tar xvzf ../pgvector.tar.gz --strip-components=1 -C . && \
     make -j $(getconf _NPROCESSORS_ONLN) PG_CONFIG=/usr/local/pgsql/bin/pg_config && \
     make -j $(getconf _NPROCESSORS_ONLN) install PG_CONFIG=/usr/local/pgsql/bin/pg_config && \

compute_tools/README.md

@@ -19,9 +19,10 @@ Also `compute_ctl` spawns two separate service threads:
 - `http-endpoint` runs a Hyper HTTP API server, which serves readiness and the
   last activity requests.
 
-If the `vm-informant` binary is present at `/bin/vm-informant`, it will also be started. For VM
-compute nodes, `vm-informant` communicates with the VM autoscaling system. It coordinates
-downscaling and (eventually) will request immediate upscaling under resource pressure.
+If `AUTOSCALING` environment variable is set, `compute_ctl` will start the
+`vm-monitor` located in [`neon/libs/vm_monitor`]. For VM compute nodes,
+`vm-monitor` communicates with the VM autoscaling system. It coordinates
+downscaling and requests immediate upscaling under resource pressure.
 
 Usage example:
 ```sh

compute_tools/src/bin/compute_ctl.rs

@@ -20,9 +20,10 @@
 //! - `http-endpoint` runs a Hyper HTTP API server, which serves readiness and the
 //!   last activity requests.
 //!
-//! If the `vm-informant` binary is present at `/bin/vm-informant`, it will also be started. For VM
-//! compute nodes, `vm-informant` communicates with the VM autoscaling system. It coordinates
-//! downscaling and (eventually) will request immediate upscaling under resource pressure.
+//! If `AUTOSCALING` environment variable is set, `compute_ctl` will start the
+//! `vm-monitor` located in [`neon/libs/vm_monitor`]. For VM compute nodes,
+//! `vm-monitor` communicates with the VM autoscaling system. It coordinates
+//! downscaling and requests immediate upscaling under resource pressure.
 //!
 //! Usage example:
 //! ```sh
@@ -278,8 +279,9 @@ fn main() -> Result<()> {
             use tokio_util::sync::CancellationToken;
             use tracing::warn;
             let vm_monitor_addr = matches.get_one::<String>("vm-monitor-addr");
-            let cgroup = matches.get_one::<String>("filecache-connstr");
-            let file_cache_connstr = matches.get_one::<String>("cgroup");
+            let file_cache_connstr = matches.get_one::<String>("filecache-connstr");
+            let cgroup = matches.get_one::<String>("cgroup");
+            let file_cache_on_disk = matches.get_flag("file-cache-on-disk");
 
             // Only make a runtime if we need to.
             // Note: it seems like you can make a runtime in an inner scope and
@@ -312,6 +314,7 @@ fn main() -> Result<()> {
                         cgroup: cgroup.cloned(),
                         pgconnstr: file_cache_connstr.cloned(),
                         addr: vm_monitor_addr.cloned().unwrap(),
+                        file_cache_on_disk,
                     })),
                     token.clone(),
                 ))
@@ -482,6 +485,11 @@ fn cli() -> clap::Command {
                 )
                 .value_name("FILECACHE_CONNSTR"),
         )
+        .arg(
+            Arg::new("file-cache-on-disk")
+                .long("file-cache-on-disk")
+                .action(clap::ArgAction::SetTrue),
+        )
 }
 
 #[test]

docs/rfcs/025-generation-numbers.md

@@ -0,0 +1,957 @@
+# Pageserver: split-brain safety for remote storage through generation numbers
+
+## Summary
+
+A scheme of logical "generation numbers" for tenant attachment to pageservers is proposed, along with
+changes to the remote storage format to include these generation numbers in S3 keys.
+
+Using the control plane as the issuer of these generation numbers enables strong anti-split-brain
+properties in the pageserver cluster without implementing a consensus mechanism directly
+in the pageservers.
+
+## Motivation
+
+Currently, the pageserver's remote storage format does not provide a mechanism for addressing
+split brain conditions that may happen when replacing a node or when migrating
+a tenant from one pageserver to another.
+
+From a remote storage perspective, a split brain condition occurs whenever two nodes both think
+they have the same tenant attached, and both can write to S3. This can happen in the case of a
+network partition, pathologically long delays (e.g. suspended VM), or software bugs.
+
+In the current deployment model, control plane guarantees that a tenant is attached to one
+pageserver at a time, thereby ruling out split-brain conditions resulting from dual
+attachment (however, there is always the risk of a control plane bug). This control
+plane guarantee prevents robust response to failures, as if a pageserver is unresponsive
+we may not detach from it. The mechanism in this RFC fixes this, by making it safe to
+attach to a new, different pageserver even if an unresponsive pageserver may be running.
+
+Futher, lack of safety during split-brain conditions blocks two important features where occasional
+split-brain conditions are part of the design assumptions:
+
+- seamless tenant migration ([RFC PR](https://github.com/neondatabase/neon/pull/5029))
+- automatic pageserver instance failure handling (aka "failover") (RFC TBD)
+
+### Prior art
+
+- 020-pageserver-s3-coordination.md
+- 023-the-state-of-pageserver-tenant-relocation.md
+- 026-pageserver-s3-mvcc.md
+
+This RFC has broad similarities to the proposal to implement a MVCC scheme in
+S3 object names, but this RFC avoids a general purpose transaction scheme in
+favour of more specialized "generations" that work like a transaction ID that
+always has the same lifetime as a pageserver process or tenant attachment, whichever
+is shorter.
+
+## Requirements
+
+- Accommodate storage backends with no atomic or fencing capability (i.e. work within
+  S3's limitation that there are no atomics and clients can't be fenced)
+- Don't depend on any STONITH or node fencing in the compute layer (i.e. we will not
+  assume that we can reliably kill and EC2 instance and have it die)
+- Scoped per-tenant, not per-pageserver; for _seamless tenant migration_, we need
+  per-tenant granularity, and for _failover_, we likely want to spread the workload
+  of the failed pageserver instance to a number of peers, rather than monolithically
+  moving the entire workload to another machine.
+  We do not rule out the latter case, but should not constrain ourselves to it.
+
+## Design Tenets
+
+These are not requirements, but are ideas that guide the following design:
+
+- Avoid implementing another consensus system: we already have a strongly consistent
+  database in the control plane that can do atomic operations where needed, and we also
+  have a Paxos implementation in the safekeeper.
+- Avoiding locking in to specific models of how failover will work (e.g. do not assume that
+  all the tenants on a pageserver will fail over as a unit).
+- Be strictly correct when it comes to data integrity. Occasional failures of availability
+  are tolerable, occasional data loss is not.
+
+## Non Goals
+
+The changes in this RFC intentionally isolate the design decision of how to define
+logical generations numbers and object storage format in a way that is somewhat flexible with
+respect to how actual orchestration of failover works.
+
+This RFC intentionally does not cover:
+
+- Failure detection
+- Orchestration of failover
+- Standby modes to keep data ready for fast migration
+- Intentional multi-writer operation on tenants (multi-writer scenarios are assumed to be transient split-brain situations).
+- Sharding.
+
+The interaction between this RFC and those features is discussed in [Appendix B](#appendix-b-interoperability-with-other-features)
+
+## Impacted Components
+
+pageserver, control plane, safekeeper (optional)
+
+## Implementation Part 1: Correctness
+
+### Summary
+
+- A per-tenant **generation number** is introduced to uniquely identifying tenant attachments to pageserver processes.
+
+  - This generation number increments each time the control plane modifies a tenant (`Project`)'s assigned pageserver, or when the assigned pageserver restarts.
+  - the control plane is the authority for generation numbers: only it may
+    increment a generation number.
+
+- **Object keys are suffixed** with the generation number
+- **Safety for multiply-attached tenants** is provided by the
+  generation number in the object key: the competing pageservers will not
+  try to write to the same keys.
+- **Safety in split brain for multiple nodes running with
+  the same node ID** is provided by the pageserver calling out to the control plane
+  on startup, to re-attach and thereby increment the generations of any attached tenants
+- **Safety for deletions** is achieved by deferring the DELETE from S3 to a point in time where the deleting node has validated with control plane that no attachment with a higher generation has a reference to the to-be-DELETEd key.
+- **The control plane is used to issue generation numbers** to avoid the need for
+  a built-in consensus system in the pageserver, although this could in principle
+  be changed without changing the storage format.
+
+### Generation numbers
+
+A generation number is associated with each tenant in the control plane,
+and each time the attachment status of the tenant changes, this is incremented.
+Changes in attachment status include:
+
+- Attaching the tenant to a different pageserver
+- A pageserver restarting, and "re-attaching" its tenants on startup
+
+These increments of attachment generation provide invariants we need to avoid
+split-brain issues in storage:
+
+- If two pageservers have the same tenant attached, the attachments are guaranteed to have different generation numbers, because the generation would increment
+  while attaching the second one.
+- If there are multiple pageservers running with the same node ID, all the attachments on all pageservers are guaranteed to have different generation numbers, because the generation would increment
+  when the second node started and re-attached its tenants.
+
+As long as the infrastructure does not transparently replace an underlying
+physical machine, we are totally safe. See the later [unsafe case](#unsafe-case-on-badly-behaved-infrastructure) section for details.
+
+### Object Key Changes
+
+#### Generation suffix
+
+All object keys (layer objects and index objects) will contain the attachment
+generation as a [suffix](#why-a-generation-suffix-rather-than-prefix).
+This suffix is the primary mechanism for protecting against split-brain situations, and
+enabling safe multi-attachment of tenants:
+
+- Two pageservers running with the same node ID (e.g. after a failure, where there is
+  some rogue pageserver still running) will not try to write to the same objects, because at startup they will have re-attached tenants and thereby incremented
+  generation numbers.
+- Multiple attachments (to different pageservers) of the same tenant will not try to write to the same objects, as each attachment would have a distinct generation.
+
+The generation is appended in hex format (8 byte string representing
+u32), to all our existing key names. A u32's range limit would permit
+27 restarts _per second_ over a 5 year system lifetime: orders of magnitude more than
+is realistic.
+
+The exact meaning of the generation suffix can evolve over time if necessary, for
+example if we chose to implement a failover mechanism internally to the pageservers
+rather than going via the control plane. The storage format just sees it as a number,
+with the only semantic property being that the highest numbered index is the latest.
+
+#### Index changes
+
+Since object keys now include a generation suffix, the index of these keys must also be updated. IndexPart currently stores keys and LSNs sufficient to reconstruct key names: this would be extended to store the generation as well.
+
+This will increase the size of the file, but only modestly: layers are already encoded as
+their string-ized form, so the overhead is about 10 bytes per layer. This will be less if/when
+the index storage format is migrated to a binary format from JSON.
+
+#### Visibility
+
+_This section doesn't describe code changes, but extends on the consequences of the
+object key changes given above_
+
+##### Visibility of objects to pageservers
+
+Pageservers can of course list objects in S3 at any time, but in practice their
+visible set is based on the contents of their LayerMap, which is initialized
+from the `index_part.json.???` that they load.
+
+Starting with the `index_part` from the most recent previous generation
+(see [loading index_part](#finding-the-remote-indices-for-timelines)), a pageserver
+initially has visibility of all the objects that were referenced in the loaded index.
+These objects are guaranteed to remain visible until the current generation is
+superseded, via pageservers in older generations avoiding deletions (see [deletion](#deletion)).
+
+The "most recent previous generation" is _not_ necessarily the most recent
+in terms of walltime, it is the one that is readable at the time a new generation
+starts. Consider the following sequence of a tenant being re-attached to different
+pageserver nodes:
+
+- Create + attach on PS1 in generation 1
+- PS1 Do some work, write out index_part.json-0001
+- Attach to PS2 in generation 2
+- Read index_part.json-0001
+- PS2 starts doing some work...
+- Attach to PS3 in generation 3
+- Read index_part.json-0001
+- **...PS2 finishes its work: now it writes index_part.json-0002**
+- PS3 writes out index_part.json-0003
+
+In the above sequence, the ancestry of indices is:
+
+```
+0001 -> 0002
+     |
+     -> 0003
+```
+
+This is not an issue for safety: if the 0002 references some object that is
+not in 0001, then 0003 simply does not see it, and will re-do whatever
+work was required (e.g. ingesting WAL or doing compaction). Objects referenced
+by only the 0002 index will never be read by future attachment generations, and
+will eventually be cleaned up by a scrub (see [scrubbing](#cleaning-up-orphan-objects-scrubbing)).
+
+##### Visibility of LSNs to clients
+
+Because index_part.json is now written with a generation suffix, which data
+is visible depends on which generation the reader is operating in:
+
+- If one was passively reading from S3 from outside of a pageserver, the
+  visibility of data would depend on which index_part.json-<generation> file
+  one had chosen to read from.
+- If two pageservers have the same tenant attached, they may have different
+  data visible as they're independently replaying the WAL, and maintaining
+  independent LayerMaps that are written to independent index_part.json files.
+  Data does not have to be remotely committed to be visible.
+- For a pageserver writing with a stale generation, historic LSNs
+  remain readable until another pageserver (with a higher generation suffix)
+  decides to execute GC deletions. At this point, we may think of the stale
+  attachment's generation as having logically ended: during its existence
+  the generation had a consistent view of the world.
+- For a newly attached pageserver, its highest visible LSN may appears to
+  go backwards with respect to an earlier attachment, if that earlier
+  attachment had not uploaded all data to S3 before the new attachment.
+
+### Deletion
+
+#### Generation number validation
+
+While writes are de-conflicted by writers always using their own generation number in the key,
+deletions are slightly more challenging: if a pageserver A is isolated, and the true active node is
+pageserver B, then it is dangerous for A to do any object deletions, even of objects that it wrote
+itself, because pageserver's B metadata might reference those objects.
+
+We solve this by inserting a "generation validation" step between the write of a remote index
+that un-links a particular object from the index, and the actual deletion of the object, such
+that deletions strictly obey the following ordering:
+
+1. Write out index_part.json: this guarantees that any subsequent reader of the metadata will
+   not try and read the object we unlinked.
+2. Call out to control plane to validate that the generation which we use for our attachment is still the latest.
+3. If step 2 passes, it is safe to delete the object. Why? The check-in with control plane
+   together with our visibility rules guarantees that any later generation
+   will use either the exact `index_part.json` that we uploaded in step 1, or a successor
+   of it; not an earlier one. In both cases, the `index_part.json` doesn't reference the
+   key we are deleting anymore, so, the key is invisible to any later attachment generation.
+   Hence it's safe to delete it.
+
+Note that at step 2 we are only confirming that deletions of objects _no longer referenced
+by the specific `index_part.json` written in step 1_ are safe. If we were attempting other deletions concurrently,
+these would need their own generation validation step.
+
+If step 2 fails, we may leak the object. This is safe, but has a cost: see [scrubbing](#cleaning-up-orphan-objects-scrubbing). We may avoid this entirely outside of node
+failures, if we do proper flushing of deletions on clean shutdown and clean migration.
+
+To avoid doing a huge number of control plane requests to perform generation validation,
+validation of many tenants will be done in a single request, and deletions will be queued up
+prior to validation: see [Persistent deletion queue](#persistent-deletion-queue) for more.
+
+#### `remote_consistent_lsn` updates
+
+Remote objects are not the only kind of deletion the pageserver does: it also indirectly deletes
+WAL data, by feeding back remote_consistent_lsn to safekeepers, as a signal to the safekeepers that
+they may drop data below this LSN.
+
+For the same reasons that deletion of objects must be guarded by an attachment generation number
+validation step, updates to `remote_consistent_lsn` are subject to the same rules, using
+an ordering as follows:
+
+1. upload the index_part that covers data up to LSN `L0` to S3
+2. Call out to control plane to validate that the generation which we use for our attachment is still the latest.
+3. advance the `remote_consistent_lsn` that we advertise to the safekeepers to `L0`
+
+If step 2 fails, then the `remote_consistent_lsn` advertised
+to safekeepers will not advance again until a pageserver
+with the latest generation is ready to do so.
+
+**Note:** at step 3 we are not advertising the _latest_ remote_consistent_lsn, we are
+advertising the value in the index_part that we uploaded in step 1. This provides
+a strong ordering guarantee.
+
+Internally to the pageserver, each timeline will have two remote_consistent_lsn values: the one that
+reflects its latest write to remote storage, and the one that reflects the most
+recent validation of generation number. It is only the latter value that may
+be advertised to the outside world (i.e. to the safekeeper).
+
+The control plane remains unaware of `remote_consistent_lsn`: it only has to validate
+the freshness of generation numbers, thereby granting the pageserver permission to
+share the information with the safekeeper.
+
+For convenience, in subsequent sections and RFCs we will use "deletion" to mean both deletion
+of objects in S3, and updates to the `remote_consistent_lsn`, as updates to the remote consistent
+LSN are de-facto deletions done via the safekeeper, and both kinds of deletion are subject to
+the same generation validation requirement.
+
+### Pageserver attach/startup changes
+
+#### Attachment
+
+Calls to `/v1/tenant/{tenant_id}/attach` are augmented with an additional
+`generation` field in the body.
+
+The pageserver does not persist this: a generation is only good for the lifetime
+of a process.
+
+#### Finding the remote indices for timelines
+
+Because index files are now suffixed with generation numbers, the pageserver
+cannot always GET the remote index in one request, because it can't always
+know a-priori what the latest remote index is.
+
+Typically, the most recent generation to write an index would be our own
+generation minus 1. However, this might not be the case: the previous
+node might have started and acquired a generation number, and then crashed
+before writing out a remote index.
+
+In the general case and as a fallback, the pageserver may list all the `index_part.json`
+files for a timeline, sort them by generation, and pick the highest that is `<=`
+its current generation for this attachment. The tenant should never load an index
+with an attachment generation _newer_ than its own.
+These two rules combined ensure that objects written by later generations are never visible to earlier generations.
+
+Note that if a given attachment picks an index part from an earlier generation (say n-2), but crashes & restarts before it writes its own generation's index part, next time it tries to pick an index part there may be an index part from generation n-1.
+It would pick the n-1 index part in that case, because it's sorted higher than the previous one from generation n-2.
+So, above rules guarantee no determinism in selecting the index part.
+are allowed to be attached with stale attachment generations during a multiply-attached
+phase in a migration, and in this instance if the old location's pageserver restarts,
+it should not try and load the newer generation's index.
+
+To summarize, on starting a timeline, the pageserver will:
+
+1. Issue a GET for index_part.json-<my generation - 1>
+2. If 1 failed, issue a ListObjectsv2 request for index_part.json\* and
+   pick the newest.
+
+One could optimize this further by using the control plane to record specifically
+which generation most recently wrote an index_part.json, if necessary, to increase
+the probability of finding the index_part.json in one GET. One could also improve
+the chances by having pageservers proactively write out index_part.json after they
+get a new generation ID.
+
+#### Re-attachment on startup
+
+On startup, the pageserver will call out to an new control plane `/re-attach`
+API (see [Generation API](#generation-api)). This returns a list of
+tenants that should be attached to the pageserver, and their generation numbers, which
+the control plane will increment before returning.
+
+The pageserver should still scan its local disk on startup, but should _delete_
+any local content for tenants not indicated in the `/re-attach` response: their
+absence is an implicit detach operation.
+
+**Note** if a tenant is omitted from the re-attach response, its local disk content
+will be deleted. This will change in subsequent work, when the control plane gains
+the concept of a secondary/standby location: a node with local content may revert
+to this status and retain some local content.
+
+#### Cleaning up previous generations' remote indices
+
+Deletion of old indices is not necessary for correctness, although it is necessary
+to avoid the ListObjects fallback in the previous section becoming ever more expensive.
+
+Once the new attachment has written out its index_part.json, it may asynchronously clean up historic index_part.json
+objects that were found.
+
+We may choose to implement this deletion either as an explicit step after we
+write out index_part for the first time in a pageserver's lifetime, or for
+simplicity just do it periodically as part of the background scrub (see [scrubbing](#cleaning-up-orphan-objects-scrubbing));
+
+### Control Plane Changes
+
+#### Store generations for attaching tenants
+
+- The `Project` table must store the generation number for use when
+  attaching the tenant to a new pageserver.
+- The `/v1/tenant/:tenant_id/attach` pageserver API will require the generation number,
+  which the control plane can supply by simply incrementing the `Project`'s
+  generation number each time the tenant is attached to a different server: the same database
+  transaction that changes the assigned pageserver should also change the generation number.
+
+#### Generation API
+
+This section describes an API that could be provided directly by the control plane,
+or built as a separate microservice. In earlier parts of the RFC, when we
+discuss the control plane providing generation numbers, we are referring to this API.
+
+The API endpoints used by the pageserver to acquire and validate generation
+numbers are quite simple, and only require access to some persistent and
+linerizable storage (such as a database).
+
+Building this into the control plane is proposed as a least-effort option to exploit existing infrastructure and implement generation number issuance in the same transaction that mandates it (i.e., the transaction that updates the `Project` assignment to another pageserver).
+However, this is not mandatory: this "Generation Number Issuer" could
+be built as a microservice. In practice, we will write such a miniature service
+anyway, to enable E2E pageserver/compute testing without control plane.
+
+The endpoints required by pageservers are:
+
+##### `/re-attach`
+
+- Request: `{node_id: <u32>}`
+- Response:
+  - 200 `{tenants: [{id: <TenantId>, gen: <u32>}]}`
+  - 404: unknown node_id
+  - (Future: 429: flapping detected, perhaps nodes are fighting for the same node ID,
+    or perhaps this node was in a retry loop)
+  - (On unknown tenants, omit tenant from `tenants` array)
+- Server behavior: query database for which tenants should be attached to this pageserver.
+  - for each tenant that should be attached, increment the attachment generation and
+    include the new generation in the response
+- Client behavior:
+  - for all tenants in the response, activate with the new generation number
+  - for any local disk content _not_ referenced in the response, act as if we
+    had been asked to detach it (i.e. delete local files)
+
+**Note** the `node_id` in this request will change in future if we move to ephemeral
+node IDs, to be replaced with some correlation ID that helps the control plane realize
+if a process is running with the same storage as a previous pageserver process (e.g.
+we might use EC instance ID, or we might just write some UUID to the disk the first
+time we use it)
+
+##### `/validate`
+
+- Request: `{'tenants': [{tenant: <tenant id>, attach_gen: <gen>}, ...]}'`
+- Response:
+  - 200 `{'tenants': [{tenant: <tenant id>, status: <bool>}...]}`
+  - (On unknown tenants, omit tenant from `tenants` array)
+- Purpose: enable the pageserver to discover for the given attachments whether they are still the latest.
+- Server behavior: this is a read-only operation: simply compare the generations in the request with
+  the generations known to the server, and set status to `true` if they match.
+- Client behavior: clients must not do deletions within a tenant's remote data until they have
+  received a response indicating the generation they hold for the attachment is current.
+
+#### Use of `/load` and `/ignore` APIs
+
+Because the pageserver will be changed to only attach tenants on startup
+based on the control plane's response to a `/re-attach` request, the load/ignore
+APIs no longer make sense in their current form.
+
+The `/load` API becomes functionally equivalent to attach, and will be removed:
+any location that used `/load` before should just attach instead.
+
+The `/ignore` API is equivalent to detaching, but without deleting local files.
+
+### Timeline/Branch creation & deletion
+
+All of the previous arguments for safety have described operations within
+a timeline, where we may describe a sequence that includes updates to
+index_part.json, and where reads and writes are coming from a postgres
+endpoint (writes via the safekeeper).
+
+Creating or destroying timeline is a bit different, because writes
+are coming from the control plane.
+
+We must be safe against scenarios such as:
+
+- A tenant is attached to pageserver B while pageserver A is
+  in the middle of servicing an RPC from the control plane to
+  create or delete a tenant.
+- A pageserver A has been sent a timeline creation request
+  but becomes unresponsive. The tenant is attached to a
+  different pageserver B, and the timeline creation request
+  is sent there too.
+
+#### Timeline Creation
+
+If some very slow node tries to do a timeline creation _after_
+a more recent generation node has already created the timeline
+and written some data into it, that must not cause harm. This
+is provided in timeline creations by the way all the objects
+within the timeline's remote path include a generation suffix:
+a slow node in an old generation that attempts to "create" a timeline
+that already exists will just emit an index_part.json with
+an old generation suffix.
+
+Timeline IDs are never reused, so we don't have
+to worry about the case of create/delete/create cycles. If they
+were re-used during a disaster recovery "un-delete" of a timeline,
+that special case can be handled by calling out to all available pageservers
+to check that they return 404 for the timeline, and to flush their
+deletion queues in case they had any deletions pending from the
+timeline.
+
+The above makes it safe for control plane to change the assignment of
+tenant to pageserver in control plane while a timeline creation is ongoing.
+The reason is that the creation request against the new assigned pageserver
+uses a new generation number. However, care must be taken by control plane
+to ensure that a "timeline creation successul" response from some pageserver
+is checked for the pageserver's generation for that timeline's tenant still being the latest.
+If it is not the latest, the response does not constitute a successful timeline creation.
+It is acceptable to discard such responses, the scrubber will clean up the S3 state.
+It is better to issue a timelien deletion request to the stale attachment.
+
+#### Timeline Deletion
+
+Tenant/timeline deletion operations are exempt from generation validation
+on deletes, and therefore don't have to go through the same deletion
+queue as GC/compaction layer deletions. This is because once a
+delete is issued by the control plane, it is a promise that the
+control plane will keep trying until the deletion is done, so even stale
+pageservers are permitted to go ahead and delete the objects.
+
+The implications of this for control plane are:
+
+- During timeline/tenant deletion, the control plane must wait for the deletion to
+  be truly complete (status 404) and also handle the case where the pageserver
+  becomes unavailable, either by waiting for a replacement with the same node_id,
+  or by *re-attaching the tenant elsewhere.
+
+- The control plane must persist its intent to delete
+  a timeline/tenant before issuing any RPCs, and then once it starts, it must
+  keep retrying until the tenant/timeline is gone. This is already handled
+  by using a persistent `Operation` record that is retried indefinitely.
+
+Timeline deletion may result in a special kind of object leak, where
+the latest generation attachment completes a deletion (including erasing
+all objects in the timeline path), but some slow/partitioned node is
+writing into the timeline path with a stale generation number. This would
+not be caught by any per-timeline scrubbing (see [scrubbing](#cleaning-up-orphan-objects-scrubbing)), since scrubbing happens on the
+attached pageserver, and once the timeline is deleted it isn't attached anywhere.
+This scenario should be pretty rare, and the control plane can make it even
+rarer by ensuring that if a tenant is in a multi-attached state (e.g. during
+migration), we wait for that to complete before processing the deletion. Beyond
+that, we may implement some other top-level scrub of timelines in
+an external tool, to identify any tenant/timeline paths that are not found
+in the control plane database.
+
+#### Examples
+
+- Deletion, node restarts partway through:
+  - By the time we returned 202, we have written a remote delete marker
+  - Any subsequent incarnation of the same node_id will see the remote
+    delete marker and continue to process the deletion
+  - If the original pageserver is lost permanently and no replacement
+    with the same node_id is available, then the control plane must recover
+    by re-attaching the tenant to a different node.
+- Creation, node becomes unresponsive partway through.
+  - Control plane will see HTTP request timeout, keep re-issuing
+    request to whoever is the latest attachment point for the tenant
+    until it succeeds.
+  - Stale nodes may be trying to execute timeline creation: they will
+    write out index_part.json files with
+    stale attachment generation: these will be eventually cleaned up
+    by the same mechanism as other old indices.
+
+### Unsafe case on badly behaved infrastructure
+
+This section is only relevant if running on a different environment
+than EC2 machines with ephemeral disks.
+
+If we ever run pageservers on infrastructure that might transparently restart
+a pageserver while leaving an old process running (e.g. a VM gets rescheduled
+without the old one being fenced), then there is a risk of corruption, when
+the control plane attaches the tenant, as follows:
+
+- If the control plane sends an `/attach` request to node A, then node A dies
+  and is replaced, and the control plane's retries the request without
+  incrementing that attachment ID, then it could end up with two physical nodes
+  both using the same generation number.
+- This is not an issue when using EC2 instances with ephemeral storage, as long
+  as the control plane never re-uses a node ID, but it would need re-examining
+  if running on different infrastructure.
+- To robustly protect against this class of issue, we would either:
+  - add a "node generation" to distinguish between different processes holding the
+    same node_id.
+  - or, dispense with static node_id entirely and issue an ephemeral ID to each
+    pageserver process when it starts.
+
+## Implementation Part 2: Optimizations
+
+### Persistent deletion queue
+
+Between writing our a new index_part.json that doesn't reference an object,
+and executing the deletion, an object passes through a window where it is
+only referenced in memory, and could be leaked if the pageserver is stopped
+uncleanly. That introduces conflicting incentives: on the one hand, we would
+like to delay and batch deletions to
+1. minimize the cost of the mandatory validations calls to control plane, and
+2. minimize cost for DeleteObjects requests.
+On the other hand we would also like to minimize leakage by executing
+deletions promptly.
+
+To resolve this, we may make the deletion queue persistent
+and then executing these in the background at a later time.
+
+_Note: The deletion queue's reason for existence is optimization rather than correctness,
+so there is a lot of flexibility in exactly how the it should work,
+as long as it obeys the rule to validate generations before executing deletions,
+so the following details are not essential to the overall RFC._
+
+#### Scope
+
+The deletion queue will be global per pageserver, not per-tenant. There
+are several reasons for this choice:
+
+- Use the queue as a central point to coalesce validation requests to the
+  control plane: this avoids individual `Timeline` objects ever touching
+  the control plane API, and avoids them having to know the rules about
+  validating deletions. This separation of concerns will avoid burdening
+  the already many-LoC `Timeline` type with even more responsibility.
+- Decouple the deletion queue from Tenant attachment lifetime: we may
+  "hibernate" an inactive tenant by tearing down its `Tenant`/`Timeline`
+  objects in the pageserver, without having to wait for deletions to be done.
+- Amortize the cost of I/O for the persistent queue, instead of having many
+  tiny queues.
+- Coalesce deletions into a smaller number of larger DeleteObjects calls
+
+Because of the cost of doing I/O for persistence, and the desire to coalesce
+generation validation requests across tenants, and coalesce deletions into
+larger DeleteObjects requests, there will be one deletion queue per pageserver
+rather than one per tenant. This has the added benefit that when deactivating
+a tenant, we do not have to drain their deletion queue: deletions can proceed
+for a tenant whose main `Tenant` object has been torn down.
+
+#### Flow of deletion
+
+The flow of a deletion is becomes:
+
+1. Need for deletion of an object (=> layer file) is identified.
+2. Unlink the object from all the places that reference it (=> `index_part.json`).
+3. Enqueue the deletion to a persistent queue.
+   Each entry is `tenant_id, attachment_generation, S3 key`.
+4. Validate & execute in batches:
+  4.1 For a batch of entries, call into control plane.
+  4.2 For the subset of entries that passed validation, execute a `DeleteObjects` S3 DELETE request for their S3 keys.
+
+As outlined in the Part 1 on correctness, it is critical that deletions are only
+executed once the key is not referenced anywhere in S3.
+This property is obviously upheld by the scheme above.
+
+#### We Accept Object Leakage In Acceptable Circumcstances
+
+If we crash in the flow above between (2) and (3), we lose track of unreferenced object.
+Further, enqueuing a single to the persistent queue may not be durable immediately to amortize cost of flush to disk.
+This is acceptable for now, it can be caught by [the scrubber](#cleaning-up-orphan-objects-scrubbing).
+
+There are various measures we can take to improve this in the future.
+1. Cap amount of time until enqueued entry becomes durable (timeout for flush-to-tisk)
+2. Proactively flush:
+    - On graceful shutdown, as we anticipate that some or
+      all of our attachments may be re-assigned while we are offline.
+    - On tenant detach.
+3. For each entry, keep track of whether it has passed (2).
+   Only admit entries to (4) one they have passed (2).
+   This requires re-writing / two queue entries (intent, commit) per deletion.
+
+The important take-away with any of the above is that it's not
+disastrous to leak objects in exceptional circumstances.
+
+#### Operations that may skip the queue
+
+Deletions of an entire timeline are [exempt](#Timeline-Deletion) from generation number validation. Once the
+control plane sends the deletion request, there is no requirement to retain the readability
+of any data within the timeline, and all objects within the timeline path may be deleted
+at any time from the control plane's deletion request onwards.
+
+Since deletions of smaller timelines won't have enough objects to compose a full sized
+DeleteObjects request, it is still useful to send these through the last part of the
+deletion pipeline to coalesce with other executing deletions: to enable this, the
+deletion queue should expose two input channels: one for deletions that must be
+processed in a generation-aware way, and a fast path for timeline deletions, where
+that fast path may skip validation and the persistent queue.
+
+### Cleaning up orphan objects (scrubbing)
+
+An orphan object is any object which is no longer referenced by a running node or by metadata.
+
+Examples of how orphan objects arise:
+
+- A node PUTs a layer object, then crashes before it writes the
+  index_part.json that references that layer.
+- A stale node carries on running for some time, and writes out an unbounded number of
+  objects while it believes itself to be the rightful writer for a tenant.
+- A pageserver crashes between un-linking an object from the index, and persisting
+  the object to its deletion queue.
+
+Orphan objects are functionally harmless, but have a small cost due to S3 capacity consumed. We
+may clean them up at some time in the future, but doing a ListObjectsv2 operation and cross
+referencing with the latest metadata to identify objects which are not referenced.
+
+Scrubbing will be done only by an attached pageserver (not some third party process), and deletions requested during scrub will go through the same
+validation as all other deletions: the attachment generation must be
+fresh. This avoids the possibility of a stale pageserver incorrectly
+thinking than an object written by a newer generation is stale, and deleting
+it.
+
+It is not strictly necessary that scrubbing be done by an attached
+pageserver: it could also be done externally. However, an external
+scrubber would still require the same validation procedure that
+a pageserver's deletion queue performs, before actually erasing
+objects.
+
+## Operational impact
+
+### Availability
+
+Coordination of generation numbers via the control plane introduce a dependency for certain
+operations:
+
+1. Starting new pageservers (or activating pageservers after a restart)
+2. Executing enqueued deletions
+3. Advertising updated `remote_consistent_lsn` to enable WAL trimming
+
+Item 1. would mean that some in-place restarts that previously would have resumed service even if the control plane were
+unavailable, will now not resume service to users until the control plane is available. We could
+avoid this by having a timeout on communication with the control plane, and after some timeout,
+resume service with the previous generation numbers (assuming this was persisted to disk). However,
+this is unlikely to be needed as the control plane is already an essential & highly available component. Also, having a node re-use an old generation number would complicate
+reasoning about the system, as it would break the invariant that a generation number uniquely identifies
+a tenant's attachment to a given pageserver _process_: it would merely identify the tenant's attachment
+to the pageserver _machine_ or its _on-disk-state_.
+
+Item 2. is a non-issue operationally: it's harmless to delay deletions, the only impact of objects pending deletion is
+the S3 capacity cost.
+
+Item 3. could be an issue if safekeepers are low on disk space and the control plane is unavailable for a long time. If this became an issue,
+we could adjust the safekeeper to delete segments from local disk sooner, as soon as they're uploaded to S3, rather than waiting for
+remote_consistent_lsn to advance.
+
+For a managed service, the general approach should be to make sure we are monitoring & respond fast enough
+that control plane outages are bounded in time.
+
+There is also the fact that control plane runs in a single region.
+The latency for distant regions is not a big concern for us because all request types added by this RFC are either infrequent or not in the way of the data path.
+However, we lose region isolation for the operations listed above.
+The ongoing work to split console and control will give us per-region control plane, and all operations in this RFC can be handled by these per-region control planes.
+With that in mind, we accept the trade-offs outlined in this paragraph.
+
+We will also implement an "escape hatch" config generation numbers, where in a major disaster outage,
+we may manually run pageservers with a hand-selected generation number, so that we can bring them online
+independently of a control plane.
+
+### Rollout
+
+Although there is coupling between components, we may deploy most of the new data plane components
+independently of the control plane: initially they can just use a static generation number.
+
+#### Phase 1
+
+The pageserver is deployed with some special config to:
+
+- Always act like everything is generation 1 and do not wait for a control plane issued generation on attach
+- Skip the places in deletion and remote_consistent_lsn updates where we would call into control plane
+
+#### Phase 2
+
+The control plane changes are deployed: control plane will now track and increment generation numbers.
+
+#### Phase 3
+
+The pageserver is deployed with its control-plane-dependent changes enabled: it will now require
+the control plane to service re-attach requests on startup, and handle generation
+validation requests.
+
+### On-disk backward compatibility
+
+Backward compatibility with existing data is straightforward:
+
+- When reading the index, we may assume that any layer whose metadata doesn't include
+  generations will have a path without generation suffix.
+- When locating the index file on attachment, we may use the "fallback" listing path
+  and if there is only an index without generation suffix, that is the one we load.
+
+It is not necessary to re-write existing layers: even new index files will be able
+to represent generation-less layers.
+
+### On-disk forward compatibility
+
+We will do a two phase rollout, probably over multiple releases because we will naturally
+have some of the read-side code ready before the overall functionality is ready:
+
+1. Deploy pageservers which understand the new index format and generation suffixes
+   in keys, but do not write objects with generation numbers in the keys.
+2. Deploy pageservers that write objects with generation numbers in the keys.
+
+Old pageservers will be oblivious to generation numbers. That means that they can't
+read objects with generation numbers in the name. This is why we must
+first step must deploy the ability to read, before the second step
+starts writing them.
+
+# Frequently Asked Questions
+
+## Why a generation _suffix_ rather than _prefix_?
+
+The choice is motivated by object listing, since one can list by prefix but not
+suffix.
+
+In [finding remote indices](#finding-the-remote-indices-for-timelines), we rely
+on being able to do a prefix listing for `<tenant>/<timeline>/index_part.json*`.
+That relies on the prefix listing.
+
+The converse case of using a generation prefix and listing by generation is
+not needed: one could imagine listing by generation while scrubbing (so that
+a particular generation's layers could be scrubbed), but this is not part
+of normal operations, and the [scrubber](#cleaning-up-orphan-objects-scrubbing) probably won't work that way anyway.
+
+## Wouldn't it be simpler to have a separate deletion queue per timeline?
+
+Functionally speaking, we could. That's how RemoteTimelineClient currently works,
+but this approach does not map well to a long-lived persistent queue with
+generation validation.
+
+Anything we do per-timeline generates tiny random I/O, on a pageserver with
+tens of thousands of timelines operating: to be ready for high scale, we should:
+
+- A) Amortize costs where we can (e.g. a shared deletion queue)
+- B) Expect to put tenants into a quiescent state while they're not
+  busy: i.e. we shouldn't keep a tenant alive to service its deletion queue.
+
+This was discussed in the [scope](#scope) part of the deletion queue section.
+
+# Appendix A: Examples of use in high availability/failover
+
+The generation numbers proposed in this RFC are adaptable to a variety of different
+failover scenarios and models. The sections below sketch how they would work in practice.
+
+### In-place restart of a pageserver
+
+"In-place" here means that the restart is done before any other element in the system
+has taken action in response to the node being down.
+
+- After restart, the node issues a re-attach request to the control plane, and
+  receives new generation numbers for all its attached tenants.
+- Tenants may be activated with the generation number in the re-attach response.
+- If any of its attachments were in fact stale (i.e. had be reassigned to another
+  node while this node was offline), then
+  - the re-attach response will inform the tenant about this by not including
+    the tenant of this by _not_ incrementing the generation for that attachment.
+  - This will implicitly block deletions in the tenant, but as an optimization
+    the pageserver should also proactively stop doing S3 uploads when it notices this stale-generation state.
+  - The control plane is expected to eventually detach this tenant from the
+    pageserver.
+
+If the control plane does not include a tenant in the re-attach response,
+but there is still local state for the tenant in the filesystem, the pageserver
+deletes the local state in response and does not load/active the tenant.
+See the [earlier section on pageserver startup](#pageserver-attachstartup-changes) for details.
+Control plane can use this mechanism to clean up a pageserver that has been
+down for so long that all its tenants were migrated away before it came back
+up again and asked for re-attach.
+
+### Failure of a pageserver
+
+In this context, read "failure" as the most ambiguous possible case, where
+a pageserver is unavailable to clients and control plane, but may still be executing and talking
+to S3.
+
+#### Case A: re-attachment to other nodes
+
+1. Let's say node 0 becomes unresponsive in a cluster of three nodes 0, 1, 2.
+2. Some external mechanism notices that the node is unavailable and initiates
+   movement of all tenants attached to that node to a different node according
+   to some distribution rule.
+   In this example, it would mean incrementing the generation
+   of all tenants that were attached to node 0, as each tenant's assigned pageserver changes.
+3. A tenant which is now attached to node 1 will _also_ still be attached to node
+   0, from the perspective of node 0. Node 0 will still be using its old generation,
+   node 1 will be using a newer generation.
+4. S3 writes will continue from nodes 0 and 1: there will be an index_part.json-00000001
+   \_and\* an index_part.json-00000002. Objects written under the old suffix
+   after the new attachment was created do not matter from the rest of the system's
+   perspective: the endpoints are reading from the new attachment location. Objects
+   written by node 0 are just garbage that can be cleaned up at leisure. Node 0 will
+   not do any deletions because it can't synchronize with control plane, or if it could,
+   its deletion queue processing would get errors for the validation requests.
+
+#### Case B: direct node replacement with same node_id and drive
+
+This is the scenario we would experience if running pageservers in some dynamic
+VM/container environment that would auto-replace a given node_id when it became
+unresponsive, with the node's storage supplied by some network block device
+that is attached to the replacement VM/container.
+
+1. Let's say node 0 fails, and there may be some other peers but they aren't relevant.
+2. Some external mechanism notices that the node is unavailable, and creates
+   a "new node 0" (Node 0b) which is a physically separate server. The original node 0
+   (Node 0a) may still be running, because we do not assume the environment fences nodes.
+3. On startup, node 0b re-attaches and gets higher generation numbers for
+   all tenants.
+4. S3 writes continue from nodes 0a and 0b, but the writes do not collide due to different
+   generation in the suffix, and the writes from node 0a are not visible to the rest
+   of the system because endpoints are reading only from node 0b.
+
+# Appendix B: interoperability with other features
+
+## Sharded Keyspace
+
+The design in this RFC maps neatly to a sharded keyspace design where subsets of the key space
+for a tenant are assigned to different pageservers:
+
+- the "unit of work" for attachments becomes something like a TenantShard rather than a Tenant
+- TenantShards get generation numbers just as Tenants do.
+- Write workload (ingest, compaction) for a tenant is spread out across pageservers via
+  TenantShards, but each TenantShard still has exactly one valid writer at a time.
+
+## Read replicas
+
+_This section is about a passive reader of S3 pageserver state, not a postgres
+read replica_
+
+For historical reads to LSNs below the remote persistent LSN, any node may act as a reader at any
+time: remote data is logically immutable data, and the use of deferred deletion in this RFC helps
+mitigate the fact that remote data is not _physically_ immutable (i.e. the actual data for a given
+page moves around as compaction happens).
+
+A read replica needs to be aware of generations in remote data in order to read the latest
+metadata (find the index_part.json with the latest suffix). It may either query this
+from the control plane, or find it with ListObjectsv2 request
+
+## Seamless migration
+
+To make tenant migration totally seamless, we will probably want to intentionally double-attach
+a tenant briefly, serving reads from the old node while waiting for the new node to be ready.
+
+This RFC enables that double-attachment: two nodes may be attached at the same time, with the migration destination
+having a higher generation number. The old node will be able to ingest and serve reads, but not
+do any deletes. The new node's attachment must also avoid deleting layers that the old node may
+still use. A new piece of state
+will be needed for this in the control plane's definition of an attachment.
+
+## Warm secondary locations
+
+To enable faster tenant movement after a pageserver is lost, we will probably want to spend some
+disk capacity on keeping standby locations populated with local disk data.
+
+There's no conflict between this RFC and that: implementing warm secondary locations on a per-tenant basis
+would be a separate change to the control plane to store standby location(s) for a tenant. Because
+the standbys do not write to S3, they do not need to be assigned generation numbers. When a tenant is
+re-attached to a standby location, that would increment the tenant attachment generation and this
+would work the same as any other attachment change, but with a warm cache.
+
+## Ephemeral node IDs
+
+This RFC intentionally avoids changing anything fundamental about how pageservers are identified
+and registered with the control plane, to avoid coupling the implementation of pageserver split
+brain protection with more fundamental changes in the management of the pageservers.
+
+Moving to ephemeral node IDs would provide an extra layer of
+resilience in the system, as it would prevent the control plane
+accidentally attaching to two physical nodes with the same
+generation, if somehow there were two physical nodes with
+the same node IDs (currently we rely on EC2 guarantees to
+eliminate this scenario). With ephemeral node IDs, there would be
+no possibility of that happening, no matter the behavior of
+underlying infrastructure.
+
+Nothing fundamental in the pageserver's handling of generations needs to change to handle ephemeral node IDs, since we hardly use the
+`node_id` anywhere. The `/re-attach` API would be extended
+to enable the pageserver to obtain its ephemeral ID, and provide
+some correlation identifier (e.g. EC instance ID), to help the
+control plane re-attach tenants to the same physical server that
+previously had them attached.

libs/safekeeper_api/src/models.rs

@@ -31,6 +31,8 @@ fn lsn_invalid() -> Lsn {
 #[serde_as]
 #[derive(Debug, Clone, Deserialize, Serialize)]
 pub struct SkTimelineInfo {
+    /// Term.
+    pub term: Option<u64>,
     /// Term of the last entry.
     pub last_log_term: Option<u64>,
     /// LSN of the last record.
@@ -58,4 +60,6 @@ pub struct SkTimelineInfo {
     /// A connection string to use for WAL receiving.
     #[serde(default)]
     pub safekeeper_connstr: Option<String>,
+    #[serde(default)]
+    pub http_connstr: Option<String>,
 }

libs/utils/Cargo.toml

@@ -38,6 +38,7 @@ url.workspace = true
 uuid.workspace = true
 
 pq_proto.workspace = true
+postgres_connection.workspace = true
 metrics.workspace = true
 workspace_hack.workspace = true
 

libs/utils/src/lib.rs

@@ -58,6 +58,8 @@ pub mod serde_regex;
 
 pub mod pageserver_feedback;
 
+pub mod postgres_client;
+
 pub mod tracing_span_assert;
 
 pub mod rate_limit;
@@ -68,8 +70,6 @@ pub mod completion;
 /// Reporting utilities
 pub mod error;
 
-pub mod sync;
-
 /// This is a shortcut to embed git sha into binaries and avoid copying the same build script to all packages
 ///
 /// we have several cases:

libs/utils/src/postgres_client.rs

@@ -0,0 +1,37 @@
+//! Postgres client connection code common to other crates (safekeeper and
+//! pageserver) which depends on tenant/timeline ids and thus not fitting into
+//! postgres_connection crate.
+
+use anyhow::Context;
+use postgres_connection::{parse_host_port, PgConnectionConfig};
+
+use crate::id::TenantTimelineId;
+
+/// Create client config for fetching WAL from safekeeper on particular timeline.
+/// listen_pg_addr_str is in form host:\[port\].
+pub fn wal_stream_connection_config(
+    TenantTimelineId {
+        tenant_id,
+        timeline_id,
+    }: TenantTimelineId,
+    listen_pg_addr_str: &str,
+    auth_token: Option<&str>,
+    availability_zone: Option<&str>,
+) -> anyhow::Result<PgConnectionConfig> {
+    let (host, port) =
+        parse_host_port(listen_pg_addr_str).context("Unable to parse listen_pg_addr_str")?;
+    let port = port.unwrap_or(5432);
+    let mut connstr = PgConnectionConfig::new_host_port(host, port)
+        .extend_options([
+            "-c".to_owned(),
+            format!("timeline_id={}", timeline_id),
+            format!("tenant_id={}", tenant_id),
+        ])
+        .set_password(auth_token.map(|s| s.to_owned()));
+
+    if let Some(availability_zone) = availability_zone {
+        connstr = connstr.extend_options([format!("availability_zone={}", availability_zone)]);
+    }
+
+    Ok(connstr)
+}

libs/utils/src/sync.rs

@@ -1 +0,0 @@
-pub mod heavier_once_cell;

libs/utils/src/sync/heavier_once_cell.rs

@@ -1,306 +0,0 @@
-use std::sync::{Arc, Mutex, MutexGuard};
-use tokio::sync::Semaphore;
-
-/// Custom design like [`tokio::sync::OnceCell`] but using [`OwnedSemaphorePermit`] instead of
-/// `SemaphorePermit`, allowing use of `take` which does not require holding an outer mutex guard
-/// for the duration of initialization.
-///
-/// Has no unsafe, builds upon [`tokio::sync::Semaphore`] and [`std::sync::Mutex`].
-///
-/// [`OwnedSemaphorePermit`]: tokio::sync::OwnedSemaphorePermit
-pub struct OnceCell<T> {
-    inner: Mutex<Inner<T>>,
-}
-
-impl<T> Default for OnceCell<T> {
-    /// Create new uninitialized [`OnceCell`].
-    fn default() -> Self {
-        Self {
-            inner: Default::default(),
-        }
-    }
-}
-
-/// Semaphore is the current state:
-/// - open semaphore means the value is `None`, not yet initialized
-/// - closed semaphore means the value has been initialized
-#[derive(Debug)]
-struct Inner<T> {
-    init_semaphore: Arc<Semaphore>,
-    value: Option<T>,
-}
-
-impl<T> Default for Inner<T> {
-    fn default() -> Self {
-        Self {
-            init_semaphore: Arc::new(Semaphore::new(1)),
-            value: None,
-        }
-    }
-}
-
-impl<T> OnceCell<T> {
-    /// Creates an already initialized `OnceCell` with the given value.
-    pub fn new(value: T) -> Self {
-        let sem = Semaphore::new(1);
-        sem.close();
-        Self {
-            inner: Mutex::new(Inner {
-                init_semaphore: Arc::new(sem),
-                value: Some(value),
-            }),
-        }
-    }
-
-    /// Returns a guard to an existing initialized value, or uniquely initializes the value before
-    /// returning the guard.
-    ///
-    /// Initializing might wait on any existing [`Guard::take_and_deinit`] deinitialization.
-    ///
-    /// Initialization is panic-safe and cancellation-safe.
-    pub async fn get_or_init<F, Fut, E>(&self, factory: F) -> Result<Guard<'_, T>, E>
-    where
-        F: FnOnce() -> Fut,
-        Fut: std::future::Future<Output = Result<T, E>>,
-    {
-        let sem = {
-            let guard = self.inner.lock().unwrap();
-            if guard.value.is_some() {
-                return Ok(Guard(guard));
-            }
-            guard.init_semaphore.clone()
-        };
-
-        let permit = sem.acquire_owned().await;
-        if permit.is_err() {
-            let guard = self.inner.lock().unwrap();
-            assert!(
-                guard.value.is_some(),
-                "semaphore got closed, must be initialized"
-            );
-            return Ok(Guard(guard));
-        } else {
-            // now we try
-            let value = factory().await?;
-
-            let mut guard = self.inner.lock().unwrap();
-            assert!(
-                guard.value.is_none(),
-                "we won permit, must not be initialized"
-            );
-            guard.value = Some(value);
-            guard.init_semaphore.close();
-            Ok(Guard(guard))
-        }
-    }
-
-    /// Returns a guard to an existing initialized value, if any.
-    pub fn get(&self) -> Option<Guard<'_, T>> {
-        let guard = self.inner.lock().unwrap();
-        if guard.value.is_some() {
-            Some(Guard(guard))
-        } else {
-            None
-        }
-    }
-}
-
-/// Uninteresting guard object to allow short-lived access to inspect or clone the held,
-/// initialized value.
-#[derive(Debug)]
-pub struct Guard<'a, T>(MutexGuard<'a, Inner<T>>);
-
-impl<T> std::ops::Deref for Guard<'_, T> {
-    type Target = T;
-
-    fn deref(&self) -> &Self::Target {
-        self.0
-            .value
-            .as_ref()
-            .expect("guard is not created unless value has been initialized")
-    }
-}
-
-impl<T> std::ops::DerefMut for Guard<'_, T> {
-    fn deref_mut(&mut self) -> &mut Self::Target {
-        self.0
-            .value
-            .as_mut()
-            .expect("guard is not created unless value has been initialized")
-    }
-}
-
-impl<'a, T> Guard<'a, T> {
-    /// Take the current value, and a new permit for it's deinitialization.
-    ///
-    /// The permit will be on a semaphore part of the new internal value, and any following
-    /// [`OnceCell::get_or_init`] will wait on it to complete.
-    pub fn take_and_deinit(&mut self) -> (T, tokio::sync::OwnedSemaphorePermit) {
-        let mut swapped = Inner::default();
-        let permit = swapped
-            .init_semaphore
-            .clone()
-            .try_acquire_owned()
-            .expect("we just created this");
-        std::mem::swap(&mut *self.0, &mut swapped);
-        swapped
-            .value
-            .map(|v| (v, permit))
-            .expect("guard is not created unless value has been initialized")
-    }
-}
-
-#[cfg(test)]
-mod tests {
-    use super::*;
-    use std::{
-        convert::Infallible,
-        sync::atomic::{AtomicUsize, Ordering},
-        time::Duration,
-    };
-
-    #[tokio::test]
-    async fn many_initializers() {
-        #[derive(Default, Debug)]
-        struct Counters {
-            factory_got_to_run: AtomicUsize,
-            future_polled: AtomicUsize,
-            winners: AtomicUsize,
-        }
-
-        let initializers = 100;
-
-        let cell = Arc::new(OnceCell::default());
-        let counters = Arc::new(Counters::default());
-        let barrier = Arc::new(tokio::sync::Barrier::new(initializers + 1));
-
-        let mut js = tokio::task::JoinSet::new();
-        for i in 0..initializers {
-            js.spawn({
-                let cell = cell.clone();
-                let counters = counters.clone();
-                let barrier = barrier.clone();
-
-                async move {
-                    barrier.wait().await;
-                    let won = {
-                        let g = cell
-                            .get_or_init(|| {
-                                counters.factory_got_to_run.fetch_add(1, Ordering::Relaxed);
-                                async {
-                                    counters.future_polled.fetch_add(1, Ordering::Relaxed);
-                                    Ok::<_, Infallible>(i)
-                                }
-                            })
-                            .await
-                            .unwrap();
-
-                        *g == i
-                    };
-
-                    if won {
-                        counters.winners.fetch_add(1, Ordering::Relaxed);
-                    }
-                }
-            });
-        }
-
-        barrier.wait().await;
-
-        while let Some(next) = js.join_next().await {
-            next.expect("no panics expected");
-        }
-
-        let mut counters = Arc::try_unwrap(counters).unwrap();
-
-        assert_eq!(*counters.factory_got_to_run.get_mut(), 1);
-        assert_eq!(*counters.future_polled.get_mut(), 1);
-        assert_eq!(*counters.winners.get_mut(), 1);
-    }
-
-    #[tokio::test(start_paused = true)]
-    async fn reinit_waits_for_deinit() {
-        // with he tokio::time paused, we will "sleep" for 1s while holding the reinitialization
-        let sleep_for = Duration::from_secs(1);
-        let initial = 42;
-        let reinit = 1;
-        let cell = Arc::new(OnceCell::new(initial));
-
-        let deinitialization_started = Arc::new(tokio::sync::Barrier::new(2));
-
-        let jh = tokio::spawn({
-            let cell = cell.clone();
-            let deinitialization_started = deinitialization_started.clone();
-            async move {
-                let (answer, _permit) = cell.get().expect("initialized to value").take_and_deinit();
-                assert_eq!(answer, initial);
-
-                deinitialization_started.wait().await;
-                tokio::time::sleep(sleep_for).await;
-            }
-        });
-
-        deinitialization_started.wait().await;
-
-        let started_at = tokio::time::Instant::now();
-        cell.get_or_init(|| async { Ok::<_, Infallible>(reinit) })
-            .await
-            .unwrap();
-
-        let elapsed = started_at.elapsed();
-        assert!(
-            elapsed >= sleep_for,
-            "initialization should had taken at least the time time slept with permit"
-        );
-
-        jh.await.unwrap();
-
-        assert_eq!(*cell.get().unwrap(), reinit);
-    }
-
-    #[tokio::test]
-    async fn initialization_attemptable_until_ok() {
-        let cell = OnceCell::default();
-
-        for _ in 0..10 {
-            cell.get_or_init(|| async { Err("whatever error") })
-                .await
-                .unwrap_err();
-        }
-
-        let g = cell
-            .get_or_init(|| async { Ok::<_, Infallible>("finally success") })
-            .await
-            .unwrap();
-        assert_eq!(*g, "finally success");
-    }
-
-    #[tokio::test]
-    async fn initialization_is_cancellation_safe() {
-        let cell = OnceCell::default();
-
-        let barrier = tokio::sync::Barrier::new(2);
-
-        let initializer = cell.get_or_init(|| async {
-            barrier.wait().await;
-            futures::future::pending::<()>().await;
-
-            Ok::<_, Infallible>("never reached")
-        });
-
-        tokio::select! {
-            _ = initializer => { unreachable!("cannot complete; stuck in pending().await") },
-            _ = barrier.wait() => {}
-        };
-
-        // now initializer is dropped
-
-        assert!(cell.get().is_none());
-
-        let g = cell
-            .get_or_init(|| async { Ok::<_, Infallible>("now initialized") })
-            .await
-            .unwrap();
-        assert_eq!(*g, "now initialized");
-    }
-}

libs/vm_monitor/README.md

@@ -16,3 +16,19 @@ in the `neon-postgres` cgroup and set its `memory.{max,high}`.
 * See also: [`neondatabase/vm-monitor`](https://github.com/neondatabase/vm-monitor/),
 where initial development of the monitor happened. The repository is no longer
 maintained but the commit history may be useful for debugging.
+
+## Structure
+
+The `vm-monitor` is loosely comprised of a few systems. These are:
+* the server: this is just a simple `axum` server that accepts requests and
+upgrades them to websocket connections. The server only allows one connection at
+a time. This means that upon receiving a new connection, the server will terminate
+and old one if it exists.
+* the filecache: a struct that allows communication with the Postgres file cache.
+On startup, we connect to the filecache and hold on to the connection for the
+entire monitor lifetime.
+* the cgroup watcher: the `CgroupWatcher` manages the `neon-postgres` cgroup by
+listening for `memory.high` events and setting its `memory.{high,max}` values.
+* the runner: the runner marries the filecache and cgroup watcher together,
+communicating with the agent throught the `Dispatcher`, and then calling filecache
+and cgroup watcher functions as needed to upscale and downscale

libs/vm_monitor/src/dispatcher.rs

@@ -1,7 +1,7 @@
 //! Managing the websocket connection and other signals in the monitor.
 //!
 //! Contains types that manage the interaction (not data interchange, see `protocol`)
-//! between informant and monitor, allowing us to to process and send messages in a
+//! between agent and monitor, allowing us to to process and send messages in a
 //! straightforward way. The dispatcher also manages that signals that come from
 //! the cgroup (requesting upscale), and the signals that go to the cgroup
 //! (notifying it of upscale).
@@ -24,16 +24,16 @@ use crate::protocol::{
 /// The central handler for all communications in the monitor.
 ///
 /// The dispatcher has two purposes:
-/// 1. Manage the connection to the informant, sending and receiving messages.
+/// 1. Manage the connection to the agent, sending and receiving messages.
 /// 2. Communicate with the cgroup manager, notifying it when upscale is received,
-///    and sending a message to the informant when the cgroup manager requests
+///    and sending a message to the agent when the cgroup manager requests
 ///    upscale.
 #[derive(Debug)]
 pub struct Dispatcher {
-    /// We read informant messages of of `source`
+    /// We read agent messages of of `source`
     pub(crate) source: SplitStream<WebSocket>,
 
-    /// We send messages to the informant through `sink`
+    /// We send messages to the agent through `sink`
     sink: SplitSink<WebSocket, Message>,
 
     /// Used to notify the cgroup when we are upscaled.
@@ -43,7 +43,7 @@ pub struct Dispatcher {
     /// we send an `UpscaleRequst` to the agent.
     pub(crate) request_upscale_events: mpsc::Receiver<()>,
 
-    /// The protocol version we have agreed to use with the informant. This is negotiated
+    /// The protocol version we have agreed to use with the agent. This is negotiated
     /// during the creation of the dispatcher, and should be the highest shared protocol
     /// version.
     ///
@@ -56,9 +56,9 @@ pub struct Dispatcher {
 impl Dispatcher {
     /// Creates a new dispatcher using the passed-in connection.
     ///
-    /// Performs a negotiation with the informant to determine the highest protocol
+    /// Performs a negotiation with the agent to determine the highest protocol
     /// version that both support. This consists of two steps:
-    /// 1. Wait for the informant to sent the range of protocols it supports.
+    /// 1. Wait for the agent to sent the range of protocols it supports.
     /// 2. Send a protocol version that works for us as well, or an error if there
     ///    is no compatible version.
     pub async fn new(
@@ -69,7 +69,7 @@ impl Dispatcher {
         let (mut sink, mut source) = stream.split();
 
         // Figure out the highest protocol version we both support
-        info!("waiting for informant to send protocol version range");
+        info!("waiting for agent to send protocol version range");
         let Some(message) = source.next().await else {
             bail!("websocket connection closed while performing protocol handshake")
         };
@@ -79,7 +79,7 @@ impl Dispatcher {
         let Message::Text(message_text) = message else {
             // All messages should be in text form, since we don't do any
             // pinging/ponging. See nhooyr/websocket's implementation and the
-            // informant/agent for more info
+            // agent for more info
             bail!("received non-text message during proocol handshake: {message:?}")
         };
 
@@ -88,32 +88,30 @@ impl Dispatcher {
             max: PROTOCOL_MAX_VERSION,
         };
 
-        let informant_range: ProtocolRange = serde_json::from_str(&message_text)
+        let agent_range: ProtocolRange = serde_json::from_str(&message_text)
             .context("failed to deserialize protocol version range")?;
 
-        info!(range = ?informant_range, "received protocol version range");
+        info!(range = ?agent_range, "received protocol version range");
 
-        let highest_shared_version = match monitor_range.highest_shared_version(&informant_range) {
+        let highest_shared_version = match monitor_range.highest_shared_version(&agent_range) {
             Ok(version) => {
                 sink.send(Message::Text(
                     serde_json::to_string(&ProtocolResponse::Version(version)).unwrap(),
                 ))
                 .await
-                .context("failed to notify informant of negotiated protocol version")?;
+                .context("failed to notify agent of negotiated protocol version")?;
                 version
             }
             Err(e) => {
                 sink.send(Message::Text(
                     serde_json::to_string(&ProtocolResponse::Error(format!(
                         "Received protocol version range {} which does not overlap with {}",
-                        informant_range, monitor_range
+                        agent_range, monitor_range
                     )))
                     .unwrap(),
                 ))
                 .await
-                .context(
-                    "failed to notify informant of no overlap between protocol version ranges",
-                )?;
+                .context("failed to notify agent of no overlap between protocol version ranges")?;
                 Err(e).context("error determining suitable protocol version range")?
             }
         };
@@ -137,7 +135,7 @@ impl Dispatcher {
             .context("failed to send resources and oneshot sender across channel")
     }
 
-    /// Send a message to the informant.
+    /// Send a message to the agent.
     ///
     /// Although this function is small, it has one major benefit: it is the only
     /// way to send data accross the connection, and you can only pass in a proper

libs/vm_monitor/src/filecache.rs

@@ -59,8 +59,8 @@ pub struct FileCacheConfig {
     spread_factor: f64,
 }
 
-impl Default for FileCacheConfig {
-    fn default() -> Self {
+impl FileCacheConfig {
+    pub fn default_in_memory() -> Self {
         Self {
             in_memory: true,
             // 75 %
@@ -71,9 +71,19 @@ impl Default for FileCacheConfig {
             spread_factor: 0.1,
         }
     }
-}
 
-impl FileCacheConfig {
+    pub fn default_on_disk() -> Self {
+        Self {
+            in_memory: false,
+            resource_multiplier: 0.75,
+            // 256 MiB - lower than when in memory because overcommitting is safe; if we don't have
+            // memory, the kernel will just evict from its page cache, rather than e.g. killing
+            // everything.
+            min_remaining_after_cache: NonZeroU64::new(256 * MiB).unwrap(),
+            spread_factor: 0.1,
+        }
+    }
+
     /// Make sure fields of the config are consistent.
     pub fn validate(&self) -> anyhow::Result<()> {
         // Single field validity

libs/vm_monitor/src/lib.rs

@@ -39,6 +39,16 @@ pub struct Args {
     #[arg(short, long)]
     pub pgconnstr: Option<String>,
 
+    /// Flag to signal that the Postgres file cache is on disk (i.e. not in memory aside from the
+    /// kernel's page cache), and therefore should not count against available memory.
+    //
+    // NB: Ideally this flag would directly refer to whether the file cache is in memory (rather
+    // than a roundabout way, via whether it's on disk), but in order to be backwards compatible
+    // during the switch away from an in-memory file cache, we had to default to the previous
+    // behavior.
+    #[arg(long)]
+    pub file_cache_on_disk: bool,
+
     /// The address we should listen on for connection requests. For the
     /// agent, this is 0.0.0.0:10301. For the informant, this is 127.0.0.1:10369.
     #[arg(short, long)]
@@ -146,7 +156,7 @@ pub async fn start(args: &'static Args, token: CancellationToken) -> anyhow::Res
 
 /// Handles incoming websocket connections.
 ///
-/// If we are already to connected to an informant, we kill that old connection
+/// If we are already to connected to an agent, we kill that old connection
 /// and accept the new one.
 #[tracing::instrument(name = "/monitor", skip_all, fields(?args))]
 pub async fn ws_handler(
@@ -196,7 +206,7 @@ async fn start_monitor(
             return;
         }
     };
-    info!("connected to informant");
+    info!("connected to agent");
 
     match monitor.run().await {
         Ok(()) => info!("monitor was killed due to new connection"),

libs/vm_monitor/src/protocol.rs

@@ -1,13 +1,13 @@
-//! Types representing protocols and actual informant-monitor messages.
+//! Types representing protocols and actual agent-monitor messages.
 //!
 //! The pervasive use of serde modifiers throughout this module is to ease
 //! serialization on the go side. Because go does not have enums (which model
 //! messages well), it is harder to model messages, and we accomodate that with
 //! serde.
 //!
-//! *Note*: the informant sends and receives messages in different ways.
+//! *Note*: the agent sends and receives messages in different ways.
 //!
-//! The informant serializes messages in the form and then sends them. The use
+//! The agent serializes messages in the form and then sends them. The use
 //! of `#[serde(tag = "type", content = "content")]` allows us to use `Type`
 //! to determine how to deserialize `Content`.
 //! ```ignore
@@ -25,9 +25,9 @@
 //!     Id   uint64
 //! }
 //! ```
-//! After reading the type field, the informant will decode the entire message
+//! After reading the type field, the agent will decode the entire message
 //! again, this time into the correct type using the embedded fields.
-//! Because the informant cannot just extract the json contained in a certain field
+//! Because the agent cannot just extract the json contained in a certain field
 //! (it initially deserializes to `map[string]interface{}`), we keep the fields
 //! at the top level, so the entire piece of json can be deserialized into a struct,
 //! such as a `DownscaleResult`, with the `Type` and `Id` fields ignored.
@@ -37,7 +37,7 @@ use std::cmp;
 
 use serde::{de::Error, Deserialize, Serialize};
 
-/// A Message we send to the informant.
+/// A Message we send to the agent.
 #[derive(Serialize, Deserialize, Debug, Clone)]
 pub struct OutboundMsg {
     #[serde(flatten)]
@@ -51,31 +51,31 @@ impl OutboundMsg {
     }
 }
 
-/// The different underlying message types we can send to the informant.
+/// The different underlying message types we can send to the agent.
 #[derive(Serialize, Deserialize, Debug, Clone)]
 #[serde(tag = "type")]
 pub enum OutboundMsgKind {
-    /// Indicates that the informant sent an invalid message, i.e, we couldn't
+    /// Indicates that the agent sent an invalid message, i.e, we couldn't
     /// properly deserialize it.
     InvalidMessage { error: String },
     /// Indicates that we experienced an internal error while processing a message.
     /// For example, if a cgroup operation fails while trying to handle an upscale,
     /// we return `InternalError`.
     InternalError { error: String },
-    /// Returned to the informant once we have finished handling an upscale. If the
+    /// Returned to the agent once we have finished handling an upscale. If the
     /// handling was unsuccessful, an `InternalError` will get returned instead.
     /// *Note*: this is a struct variant because of the way go serializes struct{}
     UpscaleConfirmation {},
     /// Indicates to the monitor that we are urgently requesting resources.
     /// *Note*: this is a struct variant because of the way go serializes struct{}
     UpscaleRequest {},
-    /// Returned to the informant once we have finished attempting to downscale. If
+    /// Returned to the agent once we have finished attempting to downscale. If
     /// an error occured trying to do so, an `InternalError` will get returned instead.
     /// However, if we are simply unsuccessful (for example, do to needing the resources),
     /// that gets included in the `DownscaleResult`.
     DownscaleResult {
         // FIXME for the future (once the informant is deprecated)
-        // As of the time of writing, the informant/agent version of this struct is
+        // As of the time of writing, the agent/informant version of this struct is
         // called api.DownscaleResult. This struct has uppercase fields which are
         // serialized as such. Thus, we serialize using uppercase names so we don't
         // have to make a breaking change to the agent<->informant protocol. Once
@@ -88,12 +88,12 @@ pub enum OutboundMsgKind {
         status: String,
     },
     /// Part of the bidirectional heartbeat. The heartbeat is initiated by the
-    /// informant.
+    /// agent.
     /// *Note*: this is a struct variant because of the way go serializes struct{}
     HealthCheck {},
 }
 
-/// A message received form the informant.
+/// A message received form the agent.
 #[derive(Serialize, Deserialize, Debug, Clone)]
 pub struct InboundMsg {
     #[serde(flatten)]
@@ -101,7 +101,7 @@ pub struct InboundMsg {
     pub(crate) id: usize,
 }
 
-/// The different underlying message types we can receive from the informant.
+/// The different underlying message types we can receive from the agent.
 #[derive(Serialize, Deserialize, Debug, Clone)]
 #[serde(tag = "type", content = "content")]
 pub enum InboundMsgKind {
@@ -120,14 +120,14 @@ pub enum InboundMsgKind {
     /// when done.
     DownscaleRequest { target: Resources },
     /// Part of the bidirectional heartbeat. The heartbeat is initiated by the
-    /// informant.
+    /// agent.
     /// *Note*: this is a struct variant because of the way go serializes struct{}
     HealthCheck {},
 }
 
 /// Represents the resources granted to a VM.
 #[derive(Serialize, Deserialize, Debug, Clone, Copy)]
-// Renamed because the agent/informant has multiple resources types:
+// Renamed because the agent has multiple resources types:
 // `Resources` (milliCPU/memory slots)
 // `Allocation` (vCPU/bytes) <- what we correspond to
 #[serde(rename(serialize = "Allocation", deserialize = "Allocation"))]
@@ -151,7 +151,7 @@ pub const PROTOCOL_MAX_VERSION: ProtocolVersion = ProtocolVersion::V1_0;
 pub struct ProtocolVersion(u8);
 
 impl ProtocolVersion {
-    /// Represents v1.0 of the informant<-> monitor protocol - the initial version
+    /// Represents v1.0 of the agent<-> monitor protocol - the initial version
     ///
     /// Currently the latest version.
     const V1_0: ProtocolVersion = ProtocolVersion(1);

libs/vm_monitor/src/runner.rs

@@ -1,4 +1,4 @@
-//! Exposes the `Runner`, which handles messages received from informant and
+//! Exposes the `Runner`, which handles messages received from agent and
 //! sends upscale requests.
 //!
 //! This is the "Monitor" part of the monitor binary and is the main entrypoint for
@@ -21,8 +21,8 @@ use crate::filecache::{FileCacheConfig, FileCacheState};
 use crate::protocol::{InboundMsg, InboundMsgKind, OutboundMsg, OutboundMsgKind, Resources};
 use crate::{bytes_to_mebibytes, get_total_system_memory, spawn_with_cancel, Args, MiB};
 
-/// Central struct that interacts with informant, dispatcher, and cgroup to handle
-/// signals from the informant.
+/// Central struct that interacts with agent, dispatcher, and cgroup to handle
+/// signals from the agent.
 #[derive(Debug)]
 pub struct Runner {
     config: Config,
@@ -110,10 +110,10 @@ impl Runner {
         // memory limits.
         if let Some(connstr) = &args.pgconnstr {
             info!("initializing file cache");
-            let config: FileCacheConfig = Default::default();
-            if !config.in_memory {
-                panic!("file cache not in-memory implemented")
-            }
+            let config = match args.file_cache_on_disk {
+                true => FileCacheConfig::default_on_disk(),
+                false => FileCacheConfig::default_in_memory(),
+            };
 
             let mut file_cache = FileCacheState::new(connstr, config, token.clone())
                 .await
@@ -140,7 +140,10 @@ impl Runner {
             if actual_size != new_size {
                 info!("file cache size actually got set to {actual_size}")
             }
-            file_cache_reserved_bytes = actual_size;
+            // Mark the resources given to the file cache as reserved, but only if it's in memory.
+            if !args.file_cache_on_disk {
+                file_cache_reserved_bytes = actual_size;
+            }
 
             state.filecache = Some(file_cache);
         }
@@ -227,18 +230,17 @@ impl Runner {
         let mut status = vec![];
         let mut file_cache_mem_usage = 0;
         if let Some(file_cache) = &mut self.filecache {
-            if !file_cache.config.in_memory {
-                panic!("file cache not in-memory unimplemented")
-            }
-
             let actual_usage = file_cache
                 .set_file_cache_size(expected_file_cache_mem_usage)
                 .await
                 .context("failed to set file cache size")?;
-            file_cache_mem_usage = actual_usage;
+            if file_cache.config.in_memory {
+                file_cache_mem_usage = actual_usage;
+            }
             let message = format!(
-                "set file cache size to {} MiB",
-                bytes_to_mebibytes(actual_usage)
+                "set file cache size to {} MiB (in memory = {})",
+                bytes_to_mebibytes(actual_usage),
+                file_cache.config.in_memory,
             );
             info!("downscale: {message}");
             status.push(message);
@@ -289,10 +291,6 @@ impl Runner {
         // Get the file cache's expected contribution to the memory usage
         let mut file_cache_mem_usage = 0;
         if let Some(file_cache) = &mut self.filecache {
-            if !file_cache.config.in_memory {
-                panic!("file cache not in-memory unimplemented");
-            }
-
             let expected_usage = file_cache.config.calculate_cache_size(usable_system_memory);
             info!(
                 target = bytes_to_mebibytes(expected_usage),
@@ -304,6 +302,9 @@ impl Runner {
                 .set_file_cache_size(expected_usage)
                 .await
                 .context("failed to set file cache size")?;
+            if file_cache.config.in_memory {
+                file_cache_mem_usage = actual_usage;
+            }
 
             if actual_usage != expected_usage {
                 warn!(
@@ -312,7 +313,6 @@ impl Runner {
                     bytes_to_mebibytes(actual_usage)
                 )
             }
-            file_cache_mem_usage = actual_usage;
         }
 
         if let Some(cgroup) = &self.cgroup {
@@ -371,7 +371,7 @@ impl Runner {
                 Ok(None)
             }
             InboundMsgKind::InternalError { error } => {
-                warn!(error, id, "informant experienced an internal error");
+                warn!(error, id, "agent experienced an internal error");
                 Ok(None)
             }
             InboundMsgKind::HealthCheck {} => {
@@ -405,7 +405,7 @@ impl Runner {
                         .await
                         .context("failed to send message")?;
                 }
-                // there is a message from the informant
+                // there is a message from the agent
                 msg = self.dispatcher.source.next() => {
                     if let Some(msg) = msg {
                         // Don't use 'message' as a key as the string also uses
@@ -422,7 +422,7 @@ impl Runner {
                                             // Don't use 'message' as a key as the
                                             // string also uses that for its key
                                             msg = ?other,
-                                            "informant should only send text messages but received different type"
+                                            "agent should only send text messages but received different type"
                                         );
                                         continue
                                     },

pageserver/ctl/src/layer_map_analyzer.rs

@@ -97,7 +97,7 @@ pub(crate) fn parse_filename(name: &str) -> Option<LayerFile> {
 // Finds the max_holes largest holes, ignoring any that are smaller than MIN_HOLE_LENGTH"
 async fn get_holes(path: &Path, max_holes: usize) -> Result<Vec<Hole>> {
     let file = FileBlockReader::new(VirtualFile::open(path)?);
-    let summary_blk = file.read_blk(0)?;
+    let summary_blk = file.read_blk(0).await?;
     let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
     let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
         actual_summary.index_start_blk,

pageserver/ctl/src/layers.rs

@@ -48,7 +48,7 @@ async fn read_delta_file(path: impl AsRef<Path>) -> Result<()> {
     virtual_file::init(10);
     page_cache::init(100);
     let file = FileBlockReader::new(VirtualFile::open(path)?);
-    let summary_blk = file.read_blk(0)?;
+    let summary_blk = file.read_blk(0).await?;
     let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
     let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
         actual_summary.index_start_blk,

pageserver/src/bin/pageserver.rs

@@ -581,6 +581,31 @@ fn start_pageserver(
         );
     }
 
+    task_mgr::spawn(
+        BACKGROUND_RUNTIME.handle(),
+        TaskKind::BackgroundRuntimeTurnaroundMeasure,
+        None,
+        None,
+        "background runtime turnaround measure",
+        true,
+        async move {
+            let server = hyper::Server::try_bind(&"0.0.0.0:2342".parse().unwrap()).expect("bind");
+            let server = server
+                .serve(hyper::service::make_service_fn(|_| async move {
+                    Ok::<_, std::convert::Infallible>(hyper::service::service_fn(
+                        move |_: hyper::Request<hyper::Body>| async move {
+                            Ok::<_, std::convert::Infallible>(hyper::Response::new(
+                                hyper::Body::from(format!("alive")),
+                            ))
+                        },
+                    ))
+                }))
+                .with_graceful_shutdown(task_mgr::shutdown_watcher());
+            server.await?;
+            Ok(())
+        },
+    );
+
     let mut shutdown_pageserver = Some(shutdown_pageserver.drop_guard());
 
     // All started up! Now just sit and wait for shutdown signal.

pageserver/src/disk_usage_eviction_task.rs

@@ -60,11 +60,7 @@ use utils::serde_percent::Percent;
 use crate::{
     config::PageServerConf,
     task_mgr::{self, TaskKind, BACKGROUND_RUNTIME},
-    tenant::{
-        self,
-        storage_layer::{AsLayerDesc, EvictionError, Layer},
-        Timeline,
-    },
+    tenant::{self, storage_layer::PersistentLayer, timeline::EvictionError, Timeline},
 };
 
 #[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)]
@@ -112,7 +108,7 @@ pub fn launch_disk_usage_global_eviction_task(
                 _ = background_jobs_barrier.wait() => { }
             };
 
-            disk_usage_eviction_task(&state, task_config, &storage, &conf.tenants_path(), cancel)
+            disk_usage_eviction_task(&state, task_config, storage, &conf.tenants_path(), cancel)
                 .await;
             Ok(())
         },
@@ -125,7 +121,7 @@ pub fn launch_disk_usage_global_eviction_task(
 async fn disk_usage_eviction_task(
     state: &State,
     task_config: &DiskUsageEvictionTaskConfig,
-    _storage: &GenericRemoteStorage,
+    storage: GenericRemoteStorage,
     tenants_dir: &Path,
     cancel: CancellationToken,
 ) {
@@ -149,8 +145,14 @@ async fn disk_usage_eviction_task(
         let start = Instant::now();
 
         async {
-            let res =
-                disk_usage_eviction_task_iteration(state, task_config, tenants_dir, &cancel).await;
+            let res = disk_usage_eviction_task_iteration(
+                state,
+                task_config,
+                &storage,
+                tenants_dir,
+                &cancel,
+            )
+            .await;
 
             match res {
                 Ok(()) => {}
@@ -181,12 +183,13 @@ pub trait Usage: Clone + Copy + std::fmt::Debug {
 async fn disk_usage_eviction_task_iteration(
     state: &State,
     task_config: &DiskUsageEvictionTaskConfig,
+    storage: &GenericRemoteStorage,
     tenants_dir: &Path,
     cancel: &CancellationToken,
 ) -> anyhow::Result<()> {
     let usage_pre = filesystem_level_usage::get(tenants_dir, task_config)
         .context("get filesystem-level disk usage before evictions")?;
-    let res = disk_usage_eviction_task_iteration_impl(state, usage_pre, cancel).await;
+    let res = disk_usage_eviction_task_iteration_impl(state, storage, usage_pre, cancel).await;
     match res {
         Ok(outcome) => {
             debug!(?outcome, "disk_usage_eviction_iteration finished");
@@ -270,6 +273,7 @@ struct LayerCount {
 
 pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
     state: &State,
+    storage: &GenericRemoteStorage,
     usage_pre: U,
     cancel: &CancellationToken,
 ) -> anyhow::Result<IterationOutcome<U>> {
@@ -326,10 +330,9 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
     // If we get far enough in the list that we start to evict layers that are below
     // the tenant's min-resident-size threshold, print a warning, and memorize the disk
     // usage at that point, in 'usage_planned_min_resident_size_respecting'.
-    let mut batched: HashMap<_, Vec<_>> = HashMap::new();
+    let mut batched: HashMap<_, Vec<Arc<dyn PersistentLayer>>> = HashMap::new();
     let mut warned = None;
     let mut usage_planned = usage_pre;
-    let mut max_batch_size = 0;
     for (i, (partition, candidate)) in candidates.into_iter().enumerate() {
         if !usage_planned.has_pressure() {
             debug!(
@@ -346,15 +349,10 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
 
         usage_planned.add_available_bytes(candidate.layer.layer_desc().file_size);
 
-        let batch = batched.entry(TimelineKey(candidate.timeline)).or_default();
-
-        // semaphore will later be used to limit eviction concurrency, and we can express at
-        // most u32 number of permits. unlikely we would have u32::MAX layers to be evicted,
-        // but fail gracefully by not making batches larger.
-        if batch.len() < u32::MAX as usize {
-            batch.push(candidate.layer);
-            max_batch_size = max_batch_size.max(batch.len());
-        }
+        batched
+            .entry(TimelineKey(candidate.timeline))
+            .or_default()
+            .push(candidate.layer);
     }
 
     let usage_planned = match warned {
@@ -371,101 +369,64 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
 
     // phase2: evict victims batched by timeline
 
-    let mut js = tokio::task::JoinSet::new();
-
-    // ratelimit to 1k files or any higher max batch size
-    let limit = Arc::new(tokio::sync::Semaphore::new(1000.max(max_batch_size)));
-
+    // After the loop, `usage_assumed` is the post-eviction usage,
+    // according to internal accounting.
+    let mut usage_assumed = usage_pre;
+    let mut evictions_failed = LayerCount::default();
     for (timeline, batch) in batched {
         let tenant_id = timeline.tenant_id;
         let timeline_id = timeline.timeline_id;
-        let batch_size =
-            u32::try_from(batch.len()).expect("batch size limited to u32::MAX during partitioning");
-
-        // I dislike naming of `available_permits` but it means current total amount of permits
-        // because permits can be added
-        assert!(batch_size as usize <= limit.available_permits());
+        let batch_size = batch.len();
 
         debug!(%timeline_id, "evicting batch for timeline");
 
-        let evict = {
-            let limit = limit.clone();
-            let cancel = cancel.clone();
-            async move {
-                let mut evicted_bytes = 0;
-                let mut evictions_failed = LayerCount::default();
+        async {
+            let results = timeline.evict_layers(storage, &batch, cancel.clone()).await;
 
-                let Ok(_permit) = limit.acquire_many_owned(batch_size).await else {
-                    // semaphore closing means cancelled
-                    return (evicted_bytes, evictions_failed);
-                };
-
-                let results = timeline.evict_layers(&batch, &cancel).await;
-
-                match results {
-                    Ok(results) => {
-                        assert_eq!(results.len(), batch.len());
-                        for (result, layer) in results.into_iter().zip(batch.iter()) {
-                            let file_size = layer.layer_desc().file_size;
-                            match result {
-                                Some(Ok(())) => {
-                                    evicted_bytes += file_size;
-                                }
-                                Some(Err(EvictionError::NotFound | EvictionError::Downloaded)) => {
-                                    evictions_failed.file_sizes += file_size;
-                                    evictions_failed.count += 1;
-                                }
-                                None => {
-                                    assert!(cancel.is_cancelled());
-                                }
+            match results {
+                Err(e) => {
+                    warn!("failed to evict batch: {:#}", e);
+                }
+                Ok(results) => {
+                    assert_eq!(results.len(), batch.len());
+                    for (result, layer) in results.into_iter().zip(batch.iter()) {
+                        let file_size = layer.layer_desc().file_size;
+                        match result {
+                            Some(Ok(())) => {
+                                usage_assumed.add_available_bytes(file_size);
+                            }
+                            Some(Err(EvictionError::CannotEvictRemoteLayer)) => {
+                                unreachable!("get_local_layers_for_disk_usage_eviction finds only local layers")
+                            }
+                            Some(Err(EvictionError::FileNotFound)) => {
+                                evictions_failed.file_sizes += file_size;
+                                evictions_failed.count += 1;
+                            }
+                            Some(Err(
+                                e @ EvictionError::LayerNotFound(_)
+                                | e @ EvictionError::StatFailed(_),
+                            )) => {
+                                let e = utils::error::report_compact_sources(&e);
+                                warn!(%layer, "failed to evict layer: {e}");
+                                evictions_failed.file_sizes += file_size;
+                                evictions_failed.count += 1;
+                            }
+                            None => {
+                                assert!(cancel.is_cancelled());
+                                return;
                             }
                         }
                     }
-                    Err(e) => {
-                        warn!("failed to evict batch: {:#}", e);
-                    }
                 }
-                (evicted_bytes, evictions_failed)
             }
         }
-        .instrument(tracing::info_span!("evict_batch", %tenant_id, %timeline_id, batch_size));
+        .instrument(tracing::info_span!("evict_batch", %tenant_id, %timeline_id, batch_size))
+        .await;
 
-        js.spawn(evict);
-
-        // spwaning multiple thousands of these is essentially blocking, so give already spawned a
-        // chance of making progress
-        tokio::task::yield_now().await;
-    }
-
-    let join_all = async move {
-        // After the evictions, `usage_assumed` is the post-eviction usage,
-        // according to internal accounting.
-        let mut usage_assumed = usage_pre;
-        let mut evictions_failed = LayerCount::default();
-
-        while let Some(res) = js.join_next().await {
-            match res {
-                Ok((evicted_bytes, failed)) => {
-                    usage_assumed.add_available_bytes(evicted_bytes);
-                    evictions_failed.file_sizes += failed.file_sizes;
-                    evictions_failed.count += failed.count;
-                }
-                Err(je) if je.is_cancelled() => unreachable!("not used"),
-                Err(je) if je.is_panic() => { /* already logged */ }
-                Err(je) => tracing::error!("unknown JoinError: {je:?}"),
-            }
-        }
-        (usage_assumed, evictions_failed)
-    };
-
-    let (usage_assumed, evictions_failed) = tokio::select! {
-        tuple = join_all => { tuple },
-        _ = cancel.cancelled() => {
-            // close the semaphore to stop any pending acquires
-            limit.close();
+        if cancel.is_cancelled() {
             return Ok(IterationOutcome::Cancelled);
         }
-    };
+    }
 
     Ok(IterationOutcome::Finished(IterationOutcomeFinished {
         before: usage_pre,
@@ -480,7 +441,7 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
 #[derive(Clone)]
 struct EvictionCandidate {
     timeline: Arc<Timeline>,
-    layer: Layer,
+    layer: Arc<dyn PersistentLayer>,
     last_activity_ts: SystemTime,
 }
 

pageserver/src/http/routes.rs

@@ -1028,7 +1028,7 @@ async fn timeline_compact_handler(
         timeline
             .compact(&cancel, &ctx)
             .await
-            .map_err(|e| ApiError::InternalServerError(e.into()))?;
+            .map_err(ApiError::InternalServerError)?;
         json_response(StatusCode::OK, ())
     }
     .instrument(info_span!("manual_compaction", %tenant_id, %timeline_id))
@@ -1053,7 +1053,7 @@ async fn timeline_checkpoint_handler(
         timeline
             .compact(&cancel, &ctx)
             .await
-            .map_err(|e| ApiError::InternalServerError(e.into()))?;
+            .map_err(ApiError::InternalServerError)?;
 
         json_response(StatusCode::OK, ())
     }
@@ -1160,11 +1160,11 @@ async fn disk_usage_eviction_run(
 
     let state = get_state(&r);
 
-    if state.remote_storage.as_ref().is_none() {
+    let Some(storage) = state.remote_storage.clone() else {
         return Err(ApiError::InternalServerError(anyhow::anyhow!(
             "remote storage not configured, cannot run eviction iteration"
         )));
-    }
+    };
 
     let state = state.disk_usage_eviction_state.clone();
 
@@ -1182,6 +1182,7 @@ async fn disk_usage_eviction_run(
         async move {
             let res = crate::disk_usage_eviction_task::disk_usage_eviction_task_iteration_impl(
                 &state,
+                &storage,
                 usage,
                 &child_cancel,
             )

pageserver/src/page_cache.rs

@@ -75,10 +75,7 @@
 use std::{
     collections::{hash_map::Entry, HashMap},
     convert::TryInto,
-    sync::{
-        atomic::{AtomicU64, AtomicU8, AtomicUsize, Ordering},
-        RwLock, RwLockReadGuard, RwLockWriteGuard, TryLockError,
-    },
+    sync::atomic::{AtomicU64, AtomicU8, AtomicUsize, Ordering},
 };
 
 use anyhow::Context;
@@ -162,7 +159,7 @@ struct Version {
 }
 
 struct Slot {
-    inner: RwLock<SlotInner>,
+    inner: tokio::sync::RwLock<SlotInner>,
     usage_count: AtomicU8,
 }
 
@@ -203,6 +200,11 @@ impl Slot {
             Err(usage_count) => usage_count,
         }
     }
+
+    /// Sets the usage count to a specific value.
+    fn set_usage_count(&self, count: u8) {
+        self.usage_count.store(count, Ordering::Relaxed);
+    }
 }
 
 pub struct PageCache {
@@ -215,9 +217,9 @@ pub struct PageCache {
     ///
     /// If you add support for caching different kinds of objects, each object kind
     /// can have a separate mapping map, next to this field.
-    materialized_page_map: RwLock<HashMap<MaterializedPageHashKey, Vec<Version>>>,
+    materialized_page_map: std::sync::RwLock<HashMap<MaterializedPageHashKey, Vec<Version>>>,
 
-    immutable_page_map: RwLock<HashMap<(FileId, u32), usize>>,
+    immutable_page_map: std::sync::RwLock<HashMap<(FileId, u32), usize>>,
 
     /// The actual buffers with their metadata.
     slots: Box<[Slot]>,
@@ -233,7 +235,7 @@ pub struct PageCache {
 /// PageReadGuard is a "lease" on a buffer, for reading. The page is kept locked
 /// until the guard is dropped.
 ///
-pub struct PageReadGuard<'i>(RwLockReadGuard<'i, SlotInner>);
+pub struct PageReadGuard<'i>(tokio::sync::RwLockReadGuard<'i, SlotInner>);
 
 impl std::ops::Deref for PageReadGuard<'_> {
     type Target = [u8; PAGE_SZ];
@@ -260,9 +262,10 @@ impl AsRef<[u8; PAGE_SZ]> for PageReadGuard<'_> {
 /// to initialize.
 ///
 pub struct PageWriteGuard<'i> {
-    inner: RwLockWriteGuard<'i, SlotInner>,
+    inner: tokio::sync::RwLockWriteGuard<'i, SlotInner>,
 
     // Are the page contents currently valid?
+    // Used to mark pages as invalid that are assigned but not yet filled with data.
     valid: bool,
 }
 
@@ -337,7 +340,7 @@ impl PageCache {
     /// The 'lsn' is an upper bound, this will return the latest version of
     /// the given block, but not newer than 'lsn'. Returns the actual LSN of the
     /// returned page.
-    pub fn lookup_materialized_page(
+    pub async fn lookup_materialized_page(
         &self,
         tenant_id: TenantId,
         timeline_id: TimelineId,
@@ -357,7 +360,7 @@ impl PageCache {
             lsn,
         };
 
-        if let Some(guard) = self.try_lock_for_read(&mut cache_key) {
+        if let Some(guard) = self.try_lock_for_read(&mut cache_key).await {
             if let CacheKey::MaterializedPage {
                 hash_key: _,
                 lsn: available_lsn,
@@ -384,7 +387,7 @@ impl PageCache {
     ///
     /// Store an image of the given page in the cache.
     ///
-    pub fn memorize_materialized_page(
+    pub async fn memorize_materialized_page(
         &self,
         tenant_id: TenantId,
         timeline_id: TimelineId,
@@ -401,7 +404,7 @@ impl PageCache {
             lsn,
         };
 
-        match self.lock_for_write(&cache_key)? {
+        match self.lock_for_write(&cache_key).await? {
             WriteBufResult::Found(write_guard) => {
                 // We already had it in cache. Another thread must've put it there
                 // concurrently. Check that it had the same contents that we
@@ -419,31 +422,14 @@ impl PageCache {
 
     // Section 1.2: Public interface functions for working with immutable file pages.
 
-    pub fn read_immutable_buf(&self, file_id: FileId, blkno: u32) -> anyhow::Result<ReadBufResult> {
+    pub async fn read_immutable_buf(
+        &self,
+        file_id: FileId,
+        blkno: u32,
+    ) -> anyhow::Result<ReadBufResult> {
         let mut cache_key = CacheKey::ImmutableFilePage { file_id, blkno };
 
-        self.lock_for_read(&mut cache_key)
-    }
-
-    /// Immediately drop all buffers belonging to given file
-    pub fn drop_buffers_for_immutable(&self, drop_file_id: FileId) {
-        for slot_idx in 0..self.slots.len() {
-            let slot = &self.slots[slot_idx];
-
-            let mut inner = slot.inner.write().unwrap();
-            if let Some(key) = &inner.key {
-                match key {
-                    CacheKey::ImmutableFilePage { file_id, blkno: _ }
-                        if *file_id == drop_file_id =>
-                    {
-                        // remove mapping for old buffer
-                        self.remove_mapping(key);
-                        inner.key = None;
-                    }
-                    _ => {}
-                }
-            }
-        }
+        self.lock_for_read(&mut cache_key).await
     }
 
     //
@@ -463,14 +449,14 @@ impl PageCache {
     ///
     /// If no page is found, returns None and *cache_key is left unmodified.
     ///
-    fn try_lock_for_read(&self, cache_key: &mut CacheKey) -> Option<PageReadGuard> {
+    async fn try_lock_for_read(&self, cache_key: &mut CacheKey) -> Option<PageReadGuard> {
         let cache_key_orig = cache_key.clone();
         if let Some(slot_idx) = self.search_mapping(cache_key) {
             // The page was found in the mapping. Lock the slot, and re-check
             // that it's still what we expected (because we released the mapping
             // lock already, another thread could have evicted the page)
             let slot = &self.slots[slot_idx];
-            let inner = slot.inner.read().unwrap();
+            let inner = slot.inner.read().await;
             if inner.key.as_ref() == Some(cache_key) {
                 slot.inc_usage_count();
                 return Some(PageReadGuard(inner));
@@ -511,7 +497,7 @@ impl PageCache {
     /// }
     /// ```
     ///
-    fn lock_for_read(&self, cache_key: &mut CacheKey) -> anyhow::Result<ReadBufResult> {
+    async fn lock_for_read(&self, cache_key: &mut CacheKey) -> anyhow::Result<ReadBufResult> {
         let (read_access, hit) = match cache_key {
             CacheKey::MaterializedPage { .. } => {
                 unreachable!("Materialized pages use lookup_materialized_page")
@@ -526,7 +512,7 @@ impl PageCache {
         let mut is_first_iteration = true;
         loop {
             // First check if the key already exists in the cache.
-            if let Some(read_guard) = self.try_lock_for_read(cache_key) {
+            if let Some(read_guard) = self.try_lock_for_read(cache_key).await {
                 if is_first_iteration {
                     hit.inc();
                 }
@@ -556,7 +542,7 @@ impl PageCache {
             // Make the slot ready
             let slot = &self.slots[slot_idx];
             inner.key = Some(cache_key.clone());
-            slot.usage_count.store(1, Ordering::Relaxed);
+            slot.set_usage_count(1);
 
             return Ok(ReadBufResult::NotFound(PageWriteGuard {
                 inner,
@@ -569,13 +555,13 @@ impl PageCache {
     /// found, returns None.
     ///
     /// When locking a page for writing, the search criteria is always "exact".
-    fn try_lock_for_write(&self, cache_key: &CacheKey) -> Option<PageWriteGuard> {
+    async fn try_lock_for_write(&self, cache_key: &CacheKey) -> Option<PageWriteGuard> {
         if let Some(slot_idx) = self.search_mapping_for_write(cache_key) {
             // The page was found in the mapping. Lock the slot, and re-check
             // that it's still what we expected (because we don't released the mapping
             // lock already, another thread could have evicted the page)
             let slot = &self.slots[slot_idx];
-            let inner = slot.inner.write().unwrap();
+            let inner = slot.inner.write().await;
             if inner.key.as_ref() == Some(cache_key) {
                 slot.inc_usage_count();
                 return Some(PageWriteGuard { inner, valid: true });
@@ -588,10 +574,10 @@ impl PageCache {
     ///
     /// Similar to lock_for_read(), but the returned buffer is write-locked and
     /// may be modified by the caller even if it's already found in the cache.
-    fn lock_for_write(&self, cache_key: &CacheKey) -> anyhow::Result<WriteBufResult> {
+    async fn lock_for_write(&self, cache_key: &CacheKey) -> anyhow::Result<WriteBufResult> {
         loop {
             // First check if the key already exists in the cache.
-            if let Some(write_guard) = self.try_lock_for_write(cache_key) {
+            if let Some(write_guard) = self.try_lock_for_write(cache_key).await {
                 return Ok(WriteBufResult::Found(write_guard));
             }
 
@@ -617,7 +603,7 @@ impl PageCache {
             // Make the slot ready
             let slot = &self.slots[slot_idx];
             inner.key = Some(cache_key.clone());
-            slot.usage_count.store(1, Ordering::Relaxed);
+            slot.set_usage_count(1);
 
             return Ok(WriteBufResult::NotFound(PageWriteGuard {
                 inner,
@@ -772,7 +758,7 @@ impl PageCache {
     /// Find a slot to evict.
     ///
     /// On return, the slot is empty and write-locked.
-    fn find_victim(&self) -> anyhow::Result<(usize, RwLockWriteGuard<SlotInner>)> {
+    fn find_victim(&self) -> anyhow::Result<(usize, tokio::sync::RwLockWriteGuard<SlotInner>)> {
         let iter_limit = self.slots.len() * 10;
         let mut iters = 0;
         loop {
@@ -784,10 +770,7 @@ impl PageCache {
             if slot.dec_usage_count() == 0 {
                 let mut inner = match slot.inner.try_write() {
                     Ok(inner) => inner,
-                    Err(TryLockError::Poisoned(err)) => {
-                        anyhow::bail!("buffer lock was poisoned: {err:?}")
-                    }
-                    Err(TryLockError::WouldBlock) => {
+                    Err(_err) => {
                         // If we have looped through the whole buffer pool 10 times
                         // and still haven't found a victim buffer, something's wrong.
                         // Maybe all the buffers were in locked. That could happen in
@@ -816,6 +799,8 @@ impl PageCache {
     fn new(num_pages: usize) -> Self {
         assert!(num_pages > 0, "page cache size must be > 0");
 
+        // We use Box::leak here and into_boxed_slice to avoid leaking uninitialized
+        // memory that Vec's might contain.
         let page_buffer = Box::leak(vec![0u8; num_pages * PAGE_SZ].into_boxed_slice());
 
         let size_metrics = &crate::metrics::PAGE_CACHE_SIZE;
@@ -829,7 +814,7 @@ impl PageCache {
                 let buf: &mut [u8; PAGE_SZ] = chunk.try_into().unwrap();
 
                 Slot {
-                    inner: RwLock::new(SlotInner { key: None, buf }),
+                    inner: tokio::sync::RwLock::new(SlotInner { key: None, buf }),
                     usage_count: AtomicU8::new(0),
                 }
             })

pageserver/src/task_mgr.rs

@@ -292,6 +292,8 @@ pub enum TaskKind {
 
     DebugTool,
 
+    BackgroundRuntimeTurnaroundMeasure,
+
     #[cfg(test)]
     UnitTest,
 }

pageserver/src/tenant.rs

@@ -133,7 +133,9 @@ pub(crate) mod timeline;
 pub mod size;
 
 pub(crate) use timeline::span::debug_assert_current_span_has_tenant_and_timeline_id;
-pub(crate) use timeline::{LogicalSizeCalculationCause, PageReconstructError, Timeline};
+pub use timeline::{
+    LocalLayerInfoForDiskUsageEviction, LogicalSizeCalculationCause, PageReconstructError, Timeline,
+};
 
 // re-export for use in remote_timeline_client.rs
 pub use crate::tenant::metadata::save_metadata;
@@ -4039,7 +4041,6 @@ mod tests {
 
     #[tokio::test]
     async fn delta_layer_dumping() -> anyhow::Result<()> {
-        use storage_layer::AsLayerDesc;
         let (tenant, ctx) = TenantHarness::create("test_layer_dumping")?.load().await;
         let tline = tenant
             .create_test_timeline(TIMELINE_ID, Lsn(0x10), DEFAULT_PG_VERSION, &ctx)
@@ -4047,18 +4048,16 @@ mod tests {
         make_some_layers(tline.as_ref(), Lsn(0x20)).await?;
 
         let layer_map = tline.layers.read().await;
-        let level0_deltas = layer_map
-            .layer_map()
-            .get_level0_deltas()?
-            .into_iter()
-            .map(|desc| layer_map.get_from_desc(&desc))
-            .collect::<Vec<_>>();
+        let level0_deltas = layer_map.layer_map().get_level0_deltas()?;
 
         assert!(!level0_deltas.is_empty());
 
         for delta in level0_deltas {
+            let delta = layer_map.get_from_desc(&delta);
             // Ensure we are dumping a delta layer here
-            assert!(delta.layer_desc().is_delta);
+            let delta = delta.downcast_delta_layer().unwrap();
+
+            delta.dump(false, &ctx).await.unwrap();
             delta.dump(true, &ctx).await.unwrap();
         }
 

pageserver/src/tenant/blob_io.rs

@@ -33,7 +33,7 @@ impl<'a> BlockCursor<'a> {
         let mut blknum = (offset / PAGE_SZ as u64) as u32;
         let mut off = (offset % PAGE_SZ as u64) as usize;
 
-        let mut buf = self.read_blk(blknum)?;
+        let mut buf = self.read_blk(blknum).await?;
 
         // peek at the first byte, to determine if it's a 1- or 4-byte length
         let first_len_byte = buf[off];
@@ -49,7 +49,7 @@ impl<'a> BlockCursor<'a> {
                 // it is split across two pages
                 len_buf[..thislen].copy_from_slice(&buf[off..PAGE_SZ]);
                 blknum += 1;
-                buf = self.read_blk(blknum)?;
+                buf = self.read_blk(blknum).await?;
                 len_buf[thislen..].copy_from_slice(&buf[0..4 - thislen]);
                 off = 4 - thislen;
             } else {
@@ -70,7 +70,7 @@ impl<'a> BlockCursor<'a> {
             if page_remain == 0 {
                 // continue on next page
                 blknum += 1;
-                buf = self.read_blk(blknum)?;
+                buf = self.read_blk(blknum).await?;
                 off = 0;
                 page_remain = PAGE_SZ;
             }

pageserver/src/tenant/block_io.rs

@@ -39,7 +39,7 @@ pub enum BlockLease<'a> {
     PageReadGuard(PageReadGuard<'static>),
     EphemeralFileMutableTail(&'a [u8; PAGE_SZ]),
     #[cfg(test)]
-    Rc(std::rc::Rc<[u8; PAGE_SZ]>),
+    Arc(std::sync::Arc<[u8; PAGE_SZ]>),
 }
 
 impl From<PageReadGuard<'static>> for BlockLease<'static> {
@@ -49,9 +49,9 @@ impl From<PageReadGuard<'static>> for BlockLease<'static> {
 }
 
 #[cfg(test)]
-impl<'a> From<std::rc::Rc<[u8; PAGE_SZ]>> for BlockLease<'a> {
-    fn from(value: std::rc::Rc<[u8; PAGE_SZ]>) -> Self {
-        BlockLease::Rc(value)
+impl<'a> From<std::sync::Arc<[u8; PAGE_SZ]>> for BlockLease<'a> {
+    fn from(value: std::sync::Arc<[u8; PAGE_SZ]>) -> Self {
+        BlockLease::Arc(value)
     }
 }
 
@@ -63,7 +63,7 @@ impl<'a> Deref for BlockLease<'a> {
             BlockLease::PageReadGuard(v) => v.deref(),
             BlockLease::EphemeralFileMutableTail(v) => v,
             #[cfg(test)]
-            BlockLease::Rc(v) => v.deref(),
+            BlockLease::Arc(v) => v.deref(),
         }
     }
 }
@@ -83,13 +83,13 @@ pub(crate) enum BlockReaderRef<'a> {
 
 impl<'a> BlockReaderRef<'a> {
     #[inline(always)]
-    fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
+    async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
         use BlockReaderRef::*;
         match self {
-            FileBlockReaderVirtual(r) => r.read_blk(blknum),
-            FileBlockReaderFile(r) => r.read_blk(blknum),
-            EphemeralFile(r) => r.read_blk(blknum),
-            Adapter(r) => r.read_blk(blknum),
+            FileBlockReaderVirtual(r) => r.read_blk(blknum).await,
+            FileBlockReaderFile(r) => r.read_blk(blknum).await,
+            EphemeralFile(r) => r.read_blk(blknum).await,
+            Adapter(r) => r.read_blk(blknum).await,
             #[cfg(test)]
             TestDisk(r) => r.read_blk(blknum),
         }
@@ -134,8 +134,8 @@ impl<'a> BlockCursor<'a> {
     /// access to the contents of the page. (For the page cache, the
     /// lease object represents a lock on the buffer.)
     #[inline(always)]
-    pub fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
-        self.reader.read_blk(blknum)
+    pub async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
+        self.reader.read_blk(blknum).await
     }
 }
 
@@ -170,11 +170,12 @@ where
     /// Returns a "lease" object that can be used to
     /// access to the contents of the page. (For the page cache, the
     /// lease object represents a lock on the buffer.)
-    pub fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
+    pub async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
         let cache = page_cache::get();
         loop {
             match cache
                 .read_immutable_buf(self.file_id, blknum)
+                .await
                 .map_err(|e| {
                     std::io::Error::new(
                         std::io::ErrorKind::Other,

pageserver/src/tenant/disk_btree.rs

@@ -262,7 +262,7 @@ where
         let block_cursor = self.reader.block_cursor();
         while let Some((node_blknum, opt_iter)) = stack.pop() {
             // Locate the node.
-            let node_buf = block_cursor.read_blk(self.start_blk + node_blknum)?;
+            let node_buf = block_cursor.read_blk(self.start_blk + node_blknum).await?;
 
             let node = OnDiskNode::deparse(node_buf.as_ref())?;
             let prefix_len = node.prefix_len as usize;
@@ -357,7 +357,7 @@ where
         let block_cursor = self.reader.block_cursor();
 
         while let Some((blknum, path, depth, child_idx, key_off)) = stack.pop() {
-            let blk = block_cursor.read_blk(self.start_blk + blknum)?;
+            let blk = block_cursor.read_blk(self.start_blk + blknum).await?;
             let buf: &[u8] = blk.as_ref();
             let node = OnDiskNode::<L>::deparse(buf)?;
 
@@ -704,7 +704,7 @@ pub(crate) mod tests {
         pub(crate) fn read_blk(&self, blknum: u32) -> io::Result<BlockLease> {
             let mut buf = [0u8; PAGE_SZ];
             buf.copy_from_slice(&self.blocks[blknum as usize]);
-            Ok(std::rc::Rc::new(buf).into())
+            Ok(std::sync::Arc::new(buf).into())
         }
     }
     impl BlockReader for TestDisk {

pageserver/src/tenant/ephemeral_file.rs

@@ -61,13 +61,14 @@ impl EphemeralFile {
         self.len
     }
 
-    pub(crate) fn read_blk(&self, blknum: u32) -> Result<BlockLease, io::Error> {
+    pub(crate) async fn read_blk(&self, blknum: u32) -> Result<BlockLease, io::Error> {
         let flushed_blknums = 0..self.len / PAGE_SZ as u64;
         if flushed_blknums.contains(&(blknum as u64)) {
             let cache = page_cache::get();
             loop {
                 match cache
                     .read_immutable_buf(self.page_cache_file_id, blknum)
+                    .await
                     .map_err(|e| {
                         std::io::Error::new(
                             std::io::ErrorKind::Other,
@@ -135,10 +136,13 @@ impl EphemeralFile {
                                 // Pre-warm the page cache with what we just wrote.
                                 // This isn't necessary for coherency/correctness, but it's how we've always done it.
                                 let cache = page_cache::get();
-                                match cache.read_immutable_buf(
-                                    self.ephemeral_file.page_cache_file_id,
-                                    self.blknum,
-                                ) {
+                                match cache
+                                    .read_immutable_buf(
+                                        self.ephemeral_file.page_cache_file_id,
+                                        self.blknum,
+                                    )
+                                    .await
+                                {
                                     Ok(page_cache::ReadBufResult::Found(_guard)) => {
                                         // This function takes &mut self, so, it shouldn't be possible to reach this point.
                                         unreachable!("we just wrote blknum {} and this function takes &mut self, so, no concurrent read_blk is possible", self.blknum);
@@ -221,9 +225,8 @@ pub fn is_ephemeral_file(filename: &str) -> bool {
 
 impl Drop for EphemeralFile {
     fn drop(&mut self) {
-        // drop all pages from page cache
-        let cache = page_cache::get();
-        cache.drop_buffers_for_immutable(self.page_cache_file_id);
+        // There might still be pages in the [`crate::page_cache`] for this file.
+        // We leave them there, [`crate::page_cache::PageCache::find_victim`] will evict them when needed.
 
         // unlink the file
         let res = std::fs::remove_file(&self.file.path);

pageserver/src/tenant/layer_map.rs

@@ -639,10 +639,147 @@ impl LayerMap {
         }
 
         println!("historic_layers:");
-        for desc in self.iter_historic_layers() {
-            desc.dump();
+        for layer in self.iter_historic_layers() {
+            layer.dump(verbose, ctx)?;
         }
         println!("End dump LayerMap");
         Ok(())
     }
 }
+
+#[cfg(test)]
+mod tests {
+    use super::LayerMap;
+    use crate::tenant::storage_layer::LayerFileName;
+    use std::str::FromStr;
+    use std::sync::Arc;
+
+    mod l0_delta_layers_updated {
+
+        use crate::tenant::{
+            storage_layer::{AsLayerDesc, PersistentLayerDesc},
+            timeline::layer_manager::LayerFileManager,
+        };
+
+        use super::*;
+
+        struct LayerObject(PersistentLayerDesc);
+
+        impl AsLayerDesc for LayerObject {
+            fn layer_desc(&self) -> &PersistentLayerDesc {
+                &self.0
+            }
+        }
+
+        impl LayerObject {
+            fn new(desc: PersistentLayerDesc) -> Self {
+                LayerObject(desc)
+            }
+        }
+
+        type TestLayerFileManager = LayerFileManager<LayerObject>;
+
+        #[test]
+        fn for_full_range_delta() {
+            // l0_delta_layers are used by compaction, and should observe all buffered updates
+            l0_delta_layers_updated_scenario(
+                 "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69",
+                 true
+             )
+        }
+
+        #[test]
+        fn for_non_full_range_delta() {
+            // has minimal uncovered areas compared to l0_delta_layers_updated_on_insert_replace_remove_for_full_range_delta
+            l0_delta_layers_updated_scenario(
+                 "000000000000000000000000000000000001-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE__0000000053423C21-0000000053424D69",
+                 // because not full range
+                 false
+             )
+        }
+
+        #[test]
+        fn for_image() {
+            l0_delta_layers_updated_scenario(
+                 "000000000000000000000000000000000000-000000000000000000000000000000010000__0000000053424D69",
+                 // code only checks if it is a full range layer, doesn't care about images, which must
+                 // mean we should in practice never have full range images
+                 false
+             )
+        }
+
+        #[test]
+        fn replacing_missing_l0_is_notfound() {
+            // original impl had an oversight, and L0 was an anyhow::Error. anyhow::Error should
+            // however only happen for precondition failures.
+
+            let layer = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69";
+            let layer = LayerFileName::from_str(layer).unwrap();
+            let layer = PersistentLayerDesc::from(layer);
+
+            // same skeletan construction; see scenario below
+            let not_found = Arc::new(LayerObject::new(layer.clone()));
+            let new_version = Arc::new(LayerObject::new(layer));
+
+            // after the immutable storage state refactor, the replace operation
+            // will not use layer map any more. We keep it here for consistency in test cases
+            // and can remove it in the future.
+            let _map = LayerMap::default();
+
+            let mut mapping = TestLayerFileManager::new();
+
+            mapping
+                .replace_and_verify(not_found, new_version)
+                .unwrap_err();
+        }
+
+        fn l0_delta_layers_updated_scenario(layer_name: &str, expected_l0: bool) {
+            let name = LayerFileName::from_str(layer_name).unwrap();
+            let skeleton = PersistentLayerDesc::from(name);
+
+            let remote = Arc::new(LayerObject::new(skeleton.clone()));
+            let downloaded = Arc::new(LayerObject::new(skeleton));
+
+            let mut map = LayerMap::default();
+            let mut mapping = LayerFileManager::new();
+
+            // two disjoint Arcs in different lifecycle phases. even if it seems they must be the
+            // same layer, we use LayerMap::compare_arced_layers as the identity of layers.
+            assert_eq!(remote.layer_desc(), downloaded.layer_desc());
+
+            let expected_in_counts = (1, usize::from(expected_l0));
+
+            map.batch_update()
+                .insert_historic(remote.layer_desc().clone());
+            mapping.insert(remote.clone());
+            assert_eq!(
+                count_layer_in(&map, remote.layer_desc()),
+                expected_in_counts
+            );
+
+            mapping
+                .replace_and_verify(remote, downloaded.clone())
+                .expect("name derived attributes are the same");
+            assert_eq!(
+                count_layer_in(&map, downloaded.layer_desc()),
+                expected_in_counts
+            );
+
+            map.batch_update().remove_historic(downloaded.layer_desc());
+            assert_eq!(count_layer_in(&map, downloaded.layer_desc()), (0, 0));
+        }
+
+        fn count_layer_in(map: &LayerMap, layer: &PersistentLayerDesc) -> (usize, usize) {
+            let historic = map
+                .iter_historic_layers()
+                .filter(|x| x.key() == layer.key())
+                .count();
+            let l0s = map
+                .get_level0_deltas()
+                .expect("why does this return a result");
+            let l0 = l0s.iter().filter(|x| x.key() == layer.key()).count();
+
+            (historic, l0)
+        }
+    }
+}

pageserver/src/tenant/remote_timeline_client.rs

@@ -163,6 +163,8 @@
 //!   - download their remote [`IndexPart`]s
 //!   - create `Timeline` struct and a `RemoteTimelineClient`
 //!   - initialize the client's upload queue with its `IndexPart`
+//!   - create [`RemoteLayer`](super::storage_layer::RemoteLayer) instances
+//!     for layers that are referenced by `IndexPart` but not present locally
 //!   - schedule uploads for layers that are only present locally.
 //!   - if the remote `IndexPart`'s metadata was newer than the metadata in
 //!     the local filesystem, write the remote metadata to the local filesystem
@@ -231,8 +233,7 @@ use crate::metrics::{
 };
 use crate::task_mgr::shutdown_token;
 use crate::tenant::debug_assert_current_span_has_tenant_and_timeline_id;
-pub(crate) use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
-use crate::tenant::storage_layer::AsLayerDesc;
+use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
 use crate::tenant::upload_queue::Delete;
 use crate::{
     config::PageServerConf,
@@ -249,7 +250,7 @@ use utils::id::{TenantId, TimelineId};
 
 use self::index::IndexPart;
 
-use super::storage_layer::{LayerFileName, ResidentLayer};
+use super::storage_layer::LayerFileName;
 use super::upload_queue::SetDeletedFlagProgress;
 
 // Occasional network issues and such can cause remote operations to fail, and
@@ -597,25 +598,25 @@ impl RemoteTimelineClient {
     ///
     /// Launch an upload operation in the background.
     ///
-    pub(crate) fn schedule_layer_file_upload(
+    pub fn schedule_layer_file_upload(
         self: &Arc<Self>,
-        layer: ResidentLayer,
+        layer_file_name: &LayerFileName,
+        layer_metadata: &LayerFileMetadata,
     ) -> anyhow::Result<()> {
         let mut guard = self.upload_queue.lock().unwrap();
         let upload_queue = guard.initialized_mut()?;
 
-        let metadata = LayerFileMetadata::new(layer.layer_desc().file_size);
-
         upload_queue
             .latest_files
-            .insert(layer.layer_desc().filename(), metadata.clone());
+            .insert(layer_file_name.clone(), layer_metadata.clone());
         upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
 
-        info!("scheduled layer file upload {layer}");
-        let op = UploadOp::UploadLayer(layer, metadata);
+        let op = UploadOp::UploadLayer(layer_file_name.clone(), layer_metadata.clone());
         self.calls_unfinished_metric_begin(&op);
         upload_queue.queued_operations.push_back(op);
 
+        info!("scheduled layer file upload {layer_file_name}");
+
         // Launch the task immediately, if possible
         self.launch_queued_tasks(upload_queue);
         Ok(())
@@ -1053,8 +1054,11 @@ impl RemoteTimelineClient {
             }
 
             let upload_result: anyhow::Result<()> = match &task.op {
-                UploadOp::UploadLayer(ref layer, ref layer_metadata) => {
-                    let path = layer.local_path();
+                UploadOp::UploadLayer(ref layer_file_name, ref layer_metadata) => {
+                    let path = &self
+                        .conf
+                        .timeline_path(&self.tenant_id, &self.timeline_id)
+                        .join(layer_file_name.file_name());
                     upload::upload_timeline_layer(
                         self.conf,
                         &self.storage_impl,
@@ -1363,7 +1367,6 @@ mod tests {
         context::RequestContext,
         tenant::{
             harness::{TenantHarness, TIMELINE_ID},
-            storage_layer::Layer,
             Tenant, Timeline,
         },
         DEFAULT_PG_VERSION,
@@ -1504,7 +1507,7 @@ mod tests {
         let TestSetup {
             harness,
             tenant: _tenant,
-            timeline,
+            timeline: _timeline,
             tenant_ctx: _tenant_ctx,
             remote_fs_dir,
             client,
@@ -1524,29 +1527,32 @@ mod tests {
             .unwrap();
 
         // Create a couple of dummy files,  schedule upload for them
+        let layer_file_name_1: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap();
+        let layer_file_name_2: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D9-00000000016B5A52".parse().unwrap();
+        let layer_file_name_3: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59DA-00000000016B5A53".parse().unwrap();
+        let content_1 = dummy_contents("foo");
+        let content_2 = dummy_contents("bar");
+        let content_3 = dummy_contents("baz");
 
-        let layers = [
-            ("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap(), dummy_contents("foo")),
-            ("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D9-00000000016B5A52".parse().unwrap(), dummy_contents("bar")),
-            ("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59DA-00000000016B5A53".parse().unwrap(), dummy_contents("baz"))
-        ]
-        .into_iter()
-        .map(|(name, contents): (LayerFileName, Vec<u8>)| {
-            std::fs::write(timeline_path.join(name.file_name()), &contents).unwrap();
-
-            Layer::for_resident(
-                harness.conf,
-                &timeline,
-                name,
-                LayerFileMetadata::new(contents.len() as u64),
-            )
-        }).collect::<Vec<_>>();
+        for (filename, content) in [
+            (&layer_file_name_1, &content_1),
+            (&layer_file_name_2, &content_2),
+            (&layer_file_name_3, &content_3),
+        ] {
+            std::fs::write(timeline_path.join(filename.file_name()), content).unwrap();
+        }
 
         client
-            .schedule_layer_file_upload(layers[0].clone())
+            .schedule_layer_file_upload(
+                &layer_file_name_1,
+                &LayerFileMetadata::new(content_1.len() as u64),
+            )
             .unwrap();
         client
-            .schedule_layer_file_upload(layers[1].clone())
+            .schedule_layer_file_upload(
+                &layer_file_name_2,
+                &LayerFileMetadata::new(content_2.len() as u64),
+            )
             .unwrap();
 
         // Check that they are started immediately, not queued
@@ -1599,18 +1605,21 @@ mod tests {
                 .map(|f| f.to_owned())
                 .collect(),
             &[
-                &layers[0].layer_desc().filename().file_name(),
-                &layers[1].layer_desc().filename().file_name(),
+                &layer_file_name_1.file_name(),
+                &layer_file_name_2.file_name(),
             ],
         );
         assert_eq!(index_part.metadata, metadata);
 
         // Schedule upload and then a deletion. Check that the deletion is queued
         client
-            .schedule_layer_file_upload(layers[2].clone())
+            .schedule_layer_file_upload(
+                &layer_file_name_3,
+                &LayerFileMetadata::new(content_3.len() as u64),
+            )
             .unwrap();
         client
-            .schedule_layer_file_deletion(&[layers[0].layer_desc().filename()])
+            .schedule_layer_file_deletion(&[layer_file_name_1.clone()])
             .unwrap();
         {
             let mut guard = client.upload_queue.lock().unwrap();
@@ -1625,8 +1634,8 @@ mod tests {
         }
         assert_remote_files(
             &[
-                &layers[0].layer_desc().filename().file_name(),
-                &layers[1].layer_desc().filename().file_name(),
+                &layer_file_name_1.file_name(),
+                &layer_file_name_2.file_name(),
                 "index_part.json",
             ],
             &remote_timeline_dir,
@@ -1637,8 +1646,8 @@ mod tests {
 
         assert_remote_files(
             &[
-                &layers[1].layer_desc().filename().file_name(),
-                &layers[2].layer_desc().filename().file_name(),
+                &layer_file_name_2.file_name(),
+                &layer_file_name_3.file_name(),
                 "index_part.json",
             ],
             &remote_timeline_dir,
@@ -1652,7 +1661,7 @@ mod tests {
         let TestSetup {
             harness,
             tenant: _tenant,
-            timeline,
+            timeline: _timeline,
             client,
             ..
         } = TestSetup::new("metrics").await.unwrap();
@@ -1672,13 +1681,6 @@ mod tests {
         )
         .unwrap();
 
-        let layer_file_1 = Layer::for_resident(
-            harness.conf,
-            &timeline,
-            layer_file_name_1.clone(),
-            LayerFileMetadata::new(content_1.len() as u64),
-        );
-
         #[derive(Debug, PartialEq)]
         struct BytesStartedFinished {
             started: Option<usize>,
@@ -1704,7 +1706,10 @@ mod tests {
         let init = get_bytes_started_stopped();
 
         client
-            .schedule_layer_file_upload(layer_file_1.clone())
+            .schedule_layer_file_upload(
+                &layer_file_name_1,
+                &LayerFileMetadata::new(content_1.len() as u64),
+            )
             .unwrap();
 
         let pre = get_bytes_started_stopped();

pageserver/src/tenant/remote_timeline_client/upload.rs

@@ -67,8 +67,6 @@ pub(super) async fn upload_timeline_layer<'a>(
             // upload. However, a nonexistent file can also be indicative of
             // something worse, like when a file is scheduled for upload before
             // it has been written to disk yet.
-            //
-            // This is tested against `test_compaction_delete_before_upload`
             info!(path = %source_path.display(), "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more.");
             return Ok(());
         }

pageserver/src/tenant/storage_layer.rs

@@ -4,21 +4,26 @@ pub mod delta_layer;
 mod filename;
 mod image_layer;
 mod inmemory_layer;
-mod layer;
 mod layer_desc;
+mod remote_layer;
 
+use crate::config::PageServerConf;
 use crate::context::{AccessStatsBehavior, RequestContext};
+use crate::repository::Key;
 use crate::task_mgr::TaskKind;
 use crate::walrecord::NeonWalRecord;
+use anyhow::Result;
 use bytes::Bytes;
 use enum_map::EnumMap;
 use enumset::EnumSet;
 use once_cell::sync::Lazy;
+use pageserver_api::models::LayerAccessKind;
 use pageserver_api::models::{
-    LayerAccessKind, LayerResidenceEvent, LayerResidenceEventReason, LayerResidenceStatus,
+    HistoricLayerInfo, LayerResidenceEvent, LayerResidenceEventReason, LayerResidenceStatus,
 };
 use std::ops::Range;
-use std::sync::Mutex;
+use std::path::PathBuf;
+use std::sync::{Arc, Mutex};
 use std::time::{Duration, SystemTime, UNIX_EPOCH};
 use tracing::warn;
 use utils::history_buffer::HistoryBufferWithDropCounter;
@@ -34,8 +39,7 @@ pub use filename::{DeltaFileName, ImageFileName, LayerFileName};
 pub use image_layer::{ImageLayer, ImageLayerWriter};
 pub use inmemory_layer::InMemoryLayer;
 pub use layer_desc::{PersistentLayerDesc, PersistentLayerKey};
-
-pub(crate) use layer::{EvictionError, Layer, ResidentLayer};
+pub use remote_layer::RemoteLayer;
 
 pub fn range_overlaps<T>(a: &Range<T>, b: &Range<T>) -> bool
 where
@@ -70,7 +74,7 @@ pub struct ValueReconstructState {
     pub img: Option<(Lsn, Bytes)>,
 }
 
-/// Return value from [`Layer::get_value_reconstruct_data`]
+/// Return value from Layer::get_page_reconstruct_data
 #[derive(Clone, Copy, Debug)]
 pub enum ValueReconstructResult {
     /// Got all the data needed to reconstruct the requested page
@@ -175,6 +179,26 @@ impl LayerAccessStats {
         new
     }
 
+    /// Creates a clone of `self` and records `new_status` in the clone.
+    ///
+    /// The `new_status` is not recorded in `self`.
+    ///
+    /// See [`record_residence_event`] for why you need to do this while holding the layer map lock.
+    ///
+    /// [`record_residence_event`]: Self::record_residence_event
+    pub(crate) fn clone_for_residence_change(
+        &self,
+        new_status: LayerResidenceStatus,
+    ) -> LayerAccessStats {
+        let clone = {
+            let inner = self.0.lock().unwrap();
+            inner.clone()
+        };
+        let new = LayerAccessStats(Mutex::new(clone));
+        new.record_residence_event(new_status, LayerResidenceEventReason::ResidenceChange);
+        new
+    }
+
     /// Record a change in layer residency.
     ///
     /// Recording the event must happen while holding the layer map lock to
@@ -297,12 +321,95 @@ impl LayerAccessStats {
     }
 }
 
+/// Supertrait of the [`Layer`] trait that captures the bare minimum interface
+/// required by [`LayerMap`](super::layer_map::LayerMap).
+///
+/// All layers should implement a minimal `std::fmt::Debug` without tenant or
+/// timeline names, because those are known in the context of which the layers
+/// are used in (timeline).
+#[async_trait::async_trait]
+pub trait Layer: std::fmt::Debug + std::fmt::Display + Send + Sync + 'static {
+    ///
+    /// Return data needed to reconstruct given page at LSN.
+    ///
+    /// It is up to the caller to collect more data from previous layer and
+    /// perform WAL redo, if necessary.
+    ///
+    /// See PageReconstructResult for possible return values. The collected data
+    /// is appended to reconstruct_data; the caller should pass an empty struct
+    /// on first call, or a struct with a cached older image of the page if one
+    /// is available. If this returns ValueReconstructResult::Continue, look up
+    /// the predecessor layer and call again with the same 'reconstruct_data' to
+    /// collect more data.
+    async fn get_value_reconstruct_data(
+        &self,
+        key: Key,
+        lsn_range: Range<Lsn>,
+        reconstruct_data: &mut ValueReconstructState,
+        ctx: &RequestContext,
+    ) -> Result<ValueReconstructResult>;
+}
+
 /// Get a layer descriptor from a layer.
 pub trait AsLayerDesc {
     /// Get the layer descriptor.
     fn layer_desc(&self) -> &PersistentLayerDesc;
 }
 
+/// A Layer contains all data in a "rectangle" consisting of a range of keys and
+/// range of LSNs.
+///
+/// There are two kinds of layers, in-memory and on-disk layers. In-memory
+/// layers are used to ingest incoming WAL, and provide fast access to the
+/// recent page versions. On-disk layers are stored as files on disk, and are
+/// immutable. This trait presents the common functionality of in-memory and
+/// on-disk layers.
+///
+/// Furthermore, there are two kinds of on-disk layers: delta and image layers.
+/// A delta layer contains all modifications within a range of LSNs and keys.
+/// An image layer is a snapshot of all the data in a key-range, at a single
+/// LSN.
+pub trait PersistentLayer: Layer + AsLayerDesc {
+    /// File name used for this layer, both in the pageserver's local filesystem
+    /// state as well as in the remote storage.
+    fn filename(&self) -> LayerFileName {
+        self.layer_desc().filename()
+    }
+
+    // Path to the layer file in the local filesystem.
+    // `None` for `RemoteLayer`.
+    fn local_path(&self) -> Option<PathBuf>;
+
+    /// Permanently remove this layer from disk.
+    fn delete_resident_layer_file(&self) -> Result<()>;
+
+    fn downcast_remote_layer(self: Arc<Self>) -> Option<std::sync::Arc<RemoteLayer>> {
+        None
+    }
+
+    fn downcast_delta_layer(self: Arc<Self>) -> Option<std::sync::Arc<DeltaLayer>> {
+        None
+    }
+
+    fn is_remote_layer(&self) -> bool {
+        false
+    }
+
+    fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo;
+
+    fn access_stats(&self) -> &LayerAccessStats;
+}
+
+pub fn downcast_remote_layer(
+    layer: &Arc<dyn PersistentLayer>,
+) -> Option<std::sync::Arc<RemoteLayer>> {
+    if layer.is_remote_layer() {
+        Arc::clone(layer).downcast_remote_layer()
+    } else {
+        None
+    }
+}
+
 pub mod tests {
     use super::*;
 
@@ -340,6 +447,19 @@ pub mod tests {
     }
 }
 
+/// Helper enum to hold a PageServerConf, or a path
+///
+/// This is used by DeltaLayer and ImageLayer. Normally, this holds a reference to the
+/// global config, and paths to layer files are constructed using the tenant/timeline
+/// path from the config. But in the 'pagectl' binary, we need to construct a Layer
+/// struct for a file on disk, without having a page server running, so that we have no
+/// config. In that case, we use the Path variant to hold the full path to the file on
+/// disk.
+enum PathOrConf {
+    Path(PathBuf),
+    Conf(&'static PageServerConf),
+}
+
 /// Range wrapping newtype, which uses display to render Debug.
 ///
 /// Useful with `Key`, which has too verbose `{:?}` for printing multiple layers.

pageserver/src/tenant/storage_layer/delta_layer.rs

@@ -34,16 +34,17 @@ use crate::repository::{Key, Value, KEY_SIZE};
 use crate::tenant::blob_io::{BlobWriter, WriteBlobWriter};
 use crate::tenant::block_io::{BlockBuf, BlockCursor, BlockLease, BlockReader, FileBlockReader};
 use crate::tenant::disk_btree::{DiskBtreeBuilder, DiskBtreeReader, VisitDirection};
-use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState};
-use crate::tenant::Timeline;
+use crate::tenant::storage_layer::{
+    PersistentLayer, ValueReconstructResult, ValueReconstructState,
+};
 use crate::virtual_file::VirtualFile;
 use crate::{walrecord, TEMP_FILE_SUFFIX};
 use crate::{DELTA_FILE_MAGIC, STORAGE_FORMAT_VERSION};
 use anyhow::{bail, ensure, Context, Result};
-use pageserver_api::models::LayerAccessKind;
+use pageserver_api::models::{HistoricLayerInfo, LayerAccessKind};
 use rand::{distributions::Alphanumeric, Rng};
 use serde::{Deserialize, Serialize};
-use std::fs::File;
+use std::fs::{self, File};
 use std::io::{BufWriter, Write};
 use std::io::{Seek, SeekFrom};
 use std::ops::Range;
@@ -59,7 +60,10 @@ use utils::{
     lsn::Lsn,
 };
 
-use super::{AsLayerDesc, LayerAccessStats, PersistentLayerDesc, ResidentLayer};
+use super::{
+    AsLayerDesc, DeltaFileName, Layer, LayerAccessStats, LayerAccessStatsReset, PathOrConf,
+    PersistentLayerDesc,
+};
 
 ///
 /// Header stored in the beginning of the file
@@ -179,12 +183,20 @@ impl DeltaKey {
     }
 }
 
-/// This is used only from `pagectl`. Within pageserver, all layers are
-/// [`crate::tenant::storage_layer::Layer`], which can hold a [`DeltaLayerInner`].
+/// DeltaLayer is the in-memory data structure associated with an on-disk delta
+/// file.
+///
+/// We keep a DeltaLayer in memory for each file, in the LayerMap. If a layer
+/// is in "loaded" state, we have a copy of the index in memory, in 'inner'.
+/// Otherwise the struct is just a placeholder for a file that exists on disk,
+/// and it needs to be loaded before using it in queries.
 pub struct DeltaLayer {
-    path: PathBuf,
+    path_or_conf: PathOrConf,
+
     pub desc: PersistentLayerDesc,
+
     access_stats: LayerAccessStats,
+
     inner: OnceCell<Arc<DeltaLayerInner>>,
 }
 
@@ -201,8 +213,6 @@ impl std::fmt::Debug for DeltaLayer {
     }
 }
 
-/// `DeltaLayerInner` is the in-memory data structure associated with an on-disk delta
-/// file.
 pub struct DeltaLayerInner {
     // values copied from summary
     index_start_blk: u32,
@@ -212,6 +222,12 @@ pub struct DeltaLayerInner {
     file: FileBlockReader<VirtualFile>,
 }
 
+impl AsRef<DeltaLayerInner> for DeltaLayerInner {
+    fn as_ref(&self) -> &DeltaLayerInner {
+        self
+    }
+}
+
 impl std::fmt::Debug for DeltaLayerInner {
     fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
         f.debug_struct("DeltaLayerInner")
@@ -221,6 +237,19 @@ impl std::fmt::Debug for DeltaLayerInner {
     }
 }
 
+#[async_trait::async_trait]
+impl Layer for DeltaLayer {
+    async fn get_value_reconstruct_data(
+        &self,
+        key: Key,
+        lsn_range: Range<Lsn>,
+        reconstruct_state: &mut ValueReconstructState,
+        ctx: &RequestContext,
+    ) -> anyhow::Result<ValueReconstructResult> {
+        self.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
+            .await
+    }
+}
 /// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
 impl std::fmt::Display for DeltaLayer {
     fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
@@ -234,9 +263,40 @@ impl AsLayerDesc for DeltaLayer {
     }
 }
 
+impl PersistentLayer for DeltaLayer {
+    fn downcast_delta_layer(self: Arc<Self>) -> Option<std::sync::Arc<DeltaLayer>> {
+        Some(self)
+    }
+
+    fn local_path(&self) -> Option<PathBuf> {
+        self.local_path()
+    }
+
+    fn delete_resident_layer_file(&self) -> Result<()> {
+        self.delete_resident_layer_file()
+    }
+
+    fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
+        self.info(reset)
+    }
+
+    fn access_stats(&self) -> &LayerAccessStats {
+        self.access_stats()
+    }
+}
+
 impl DeltaLayer {
     pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
-        self.desc.dump();
+        println!(
+            "----- delta layer for ten {} tli {} keys {}-{} lsn {}-{} size {} ----",
+            self.desc.tenant_id,
+            self.desc.timeline_id,
+            self.desc.key_range.start,
+            self.desc.key_range.end,
+            self.desc.lsn_range.start,
+            self.desc.lsn_range.end,
+            self.desc.file_size,
+        );
 
         if !verbose {
             return Ok(());
@@ -244,7 +304,119 @@ impl DeltaLayer {
 
         let inner = self.load(LayerAccessKind::Dump, ctx).await?;
 
-        inner.dump().await
+        println!(
+            "index_start_blk: {}, root {}",
+            inner.index_start_blk, inner.index_root_blk
+        );
+
+        let file = &inner.file;
+        let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
+            inner.index_start_blk,
+            inner.index_root_blk,
+            file,
+        );
+
+        tree_reader.dump().await?;
+
+        let keys = DeltaLayerInner::load_keys(&inner).await?;
+
+        // A subroutine to dump a single blob
+        async fn dump_blob(val: ValueRef<'_>) -> Result<String> {
+            let buf = val.reader.read_blob(val.blob_ref.pos()).await?;
+            let val = Value::des(&buf)?;
+            let desc = match val {
+                Value::Image(img) => {
+                    format!(" img {} bytes", img.len())
+                }
+                Value::WalRecord(rec) => {
+                    let wal_desc = walrecord::describe_wal_record(&rec)?;
+                    format!(
+                        " rec {} bytes will_init: {} {}",
+                        buf.len(),
+                        rec.will_init(),
+                        wal_desc
+                    )
+                }
+            };
+            Ok(desc)
+        }
+
+        for entry in keys {
+            let DeltaEntry { key, lsn, val, .. } = entry;
+            let desc = match dump_blob(val).await {
+                Ok(desc) => desc,
+                Err(err) => {
+                    let err: anyhow::Error = err;
+                    format!("ERROR: {err}")
+                }
+            };
+            println!("  key {key} at {lsn}: {desc}");
+        }
+
+        Ok(())
+    }
+
+    pub(crate) async fn get_value_reconstruct_data(
+        &self,
+        key: Key,
+        lsn_range: Range<Lsn>,
+        reconstruct_state: &mut ValueReconstructState,
+        ctx: &RequestContext,
+    ) -> anyhow::Result<ValueReconstructResult> {
+        ensure!(lsn_range.start >= self.desc.lsn_range.start);
+
+        ensure!(self.desc.key_range.contains(&key));
+
+        let inner = self
+            .load(LayerAccessKind::GetValueReconstructData, ctx)
+            .await?;
+        inner
+            .get_value_reconstruct_data(key, lsn_range, reconstruct_state)
+            .await
+    }
+
+    pub(crate) fn local_path(&self) -> Option<PathBuf> {
+        Some(self.path())
+    }
+
+    pub(crate) fn delete_resident_layer_file(&self) -> Result<()> {
+        // delete underlying file
+        fs::remove_file(self.path())?;
+        Ok(())
+    }
+
+    pub(crate) fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
+        let layer_file_name = self.layer_desc().filename().file_name();
+        let lsn_range = self.layer_desc().lsn_range.clone();
+
+        let access_stats = self.access_stats.as_api_model(reset);
+
+        HistoricLayerInfo::Delta {
+            layer_file_name,
+            layer_file_size: self.desc.file_size,
+            lsn_start: lsn_range.start,
+            lsn_end: lsn_range.end,
+            remote: false,
+            access_stats,
+        }
+    }
+
+    pub(crate) fn access_stats(&self) -> &LayerAccessStats {
+        &self.access_stats
+    }
+
+    fn path_for(
+        path_or_conf: &PathOrConf,
+        tenant_id: &TenantId,
+        timeline_id: &TimelineId,
+        fname: &DeltaFileName,
+    ) -> PathBuf {
+        match path_or_conf {
+            PathOrConf::Path(path) => path.clone(),
+            PathOrConf::Conf(conf) => conf
+                .timeline_path(tenant_id, timeline_id)
+                .join(fname.to_string()),
+        }
     }
 
     fn temp_path_for(
@@ -290,22 +462,52 @@ impl DeltaLayer {
     async fn load_inner(&self) -> Result<Arc<DeltaLayerInner>> {
         let path = self.path();
 
-        let loaded = DeltaLayerInner::load(&path, None)?;
+        let summary = match &self.path_or_conf {
+            PathOrConf::Conf(_) => Some(Summary::from(self)),
+            PathOrConf::Path(_) => None,
+        };
 
-        // not production code
+        let loaded = DeltaLayerInner::load(&path, summary).await?;
 
-        let actual_filename = self.path.file_name().unwrap().to_str().unwrap().to_owned();
-        let expected_filename = self.layer_desc().filename().file_name();
+        if let PathOrConf::Path(ref path) = self.path_or_conf {
+            // not production code
 
-        if actual_filename != expected_filename {
-            println!("warning: filename does not match what is expected from in-file summary");
-            println!("actual: {:?}", actual_filename);
-            println!("expected: {:?}", expected_filename);
+            let actual_filename = path.file_name().unwrap().to_str().unwrap().to_owned();
+            let expected_filename = self.filename().file_name();
+
+            if actual_filename != expected_filename {
+                println!("warning: filename does not match what is expected from in-file summary");
+                println!("actual: {:?}", actual_filename);
+                println!("expected: {:?}", expected_filename);
+            }
         }
 
         Ok(Arc::new(loaded))
     }
 
+    /// Create a DeltaLayer struct representing an existing file on disk.
+    pub fn new(
+        conf: &'static PageServerConf,
+        timeline_id: TimelineId,
+        tenant_id: TenantId,
+        filename: &DeltaFileName,
+        file_size: u64,
+        access_stats: LayerAccessStats,
+    ) -> DeltaLayer {
+        DeltaLayer {
+            path_or_conf: PathOrConf::Conf(conf),
+            desc: PersistentLayerDesc::new_delta(
+                tenant_id,
+                timeline_id,
+                filename.key_range.clone(),
+                filename.lsn_range.clone(),
+                file_size,
+            ),
+            access_stats,
+            inner: OnceCell::new(),
+        }
+    }
+
     /// Create a DeltaLayer struct representing an existing file on disk.
     ///
     /// This variant is only used for debugging purposes, by the 'pagectl' binary.
@@ -320,7 +522,7 @@ impl DeltaLayer {
             .context("get file metadata to determine size")?;
 
         Ok(DeltaLayer {
-            path: path.to_path_buf(),
+            path_or_conf: PathOrConf::Path(path.to_path_buf()),
             desc: PersistentLayerDesc::new_delta(
                 summary.tenant_id,
                 summary.timeline_id,
@@ -333,9 +535,29 @@ impl DeltaLayer {
         })
     }
 
-    /// Path to the layer file
-    fn path(&self) -> PathBuf {
-        self.path.clone()
+    fn layer_name(&self) -> DeltaFileName {
+        self.desc.delta_file_name()
+    }
+    /// Path to the layer file in pageserver workdir.
+    pub fn path(&self) -> PathBuf {
+        Self::path_for(
+            &self.path_or_conf,
+            &self.desc.tenant_id,
+            &self.desc.timeline_id,
+            &self.layer_name(),
+        )
+    }
+    /// Loads all keys stored in the layer. Returns key, lsn, value size and value reference.
+    ///
+    /// The value can be obtained via the [`ValueRef::load`] function.
+    pub(crate) async fn load_keys(&self, ctx: &RequestContext) -> Result<Vec<DeltaEntry<'_>>> {
+        let inner = self
+            .load(LayerAccessKind::KeyIter, ctx)
+            .await
+            .context("load delta layer keys")?;
+        DeltaLayerInner::load_keys(inner)
+            .await
+            .context("Layer index is corrupted")
     }
 }
 
@@ -440,7 +662,7 @@ impl DeltaLayerWriterInner {
     ///
     /// Finish writing the delta layer.
     ///
-    fn finish(self, key_end: Key, timeline: &Arc<Timeline>) -> anyhow::Result<ResidentLayer> {
+    fn finish(self, key_end: Key) -> anyhow::Result<DeltaLayer> {
         let index_start_blk =
             ((self.blob_writer.size() + PAGE_SZ as u64 - 1) / PAGE_SZ as u64) as u32;
 
@@ -486,21 +708,37 @@ impl DeltaLayerWriterInner {
         // Note: Because we opened the file in write-only mode, we cannot
         // reuse the same VirtualFile for reading later. That's why we don't
         // set inner.file here. The first read will have to re-open it.
-
-        let desc = PersistentLayerDesc::new_delta(
-            self.tenant_id,
-            self.timeline_id,
-            self.key_start..key_end,
-            self.lsn_range.clone(),
-            metadata.len(),
-        );
+        let layer = DeltaLayer {
+            path_or_conf: PathOrConf::Conf(self.conf),
+            desc: PersistentLayerDesc::new_delta(
+                self.tenant_id,
+                self.timeline_id,
+                self.key_start..key_end,
+                self.lsn_range.clone(),
+                metadata.len(),
+            ),
+            access_stats: LayerAccessStats::empty_will_record_residence_event_later(),
+            inner: OnceCell::new(),
+        };
 
         // fsync the file
         file.sync_all()?;
+        // Rename the file to its final name
+        //
+        // Note: This overwrites any existing file. There shouldn't be any.
+        // FIXME: throw an error instead?
+        let final_path = DeltaLayer::path_for(
+            &PathOrConf::Conf(self.conf),
+            &self.tenant_id,
+            &self.timeline_id,
+            &DeltaFileName {
+                key_range: self.key_start..key_end,
+                lsn_range: self.lsn_range,
+            },
+        );
+        std::fs::rename(self.path, &final_path)?;
 
-        let layer = Layer::finish_creating(self.conf, timeline, desc, &self.path)?;
-
-        trace!("created delta layer {}", layer.local_path().display());
+        trace!("created delta layer {}", final_path.display());
 
         Ok(layer)
     }
@@ -583,12 +821,8 @@ impl DeltaLayerWriter {
     ///
     /// Finish writing the delta layer.
     ///
-    pub(crate) fn finish(
-        mut self,
-        key_end: Key,
-        timeline: &Arc<Timeline>,
-    ) -> anyhow::Result<ResidentLayer> {
-        self.inner.take().unwrap().finish(key_end, timeline)
+    pub fn finish(mut self, key_end: Key) -> anyhow::Result<DeltaLayer> {
+        self.inner.take().unwrap().finish(key_end)
     }
 }
 
@@ -607,12 +841,15 @@ impl Drop for DeltaLayerWriter {
 }
 
 impl DeltaLayerInner {
-    pub(super) fn load(path: &std::path::Path, summary: Option<Summary>) -> anyhow::Result<Self> {
+    pub(super) async fn load(
+        path: &std::path::Path,
+        summary: Option<Summary>,
+    ) -> anyhow::Result<Self> {
         let file = VirtualFile::open(path)
             .with_context(|| format!("Failed to open file '{}'", path.display()))?;
         let file = FileBlockReader::new(file);
 
-        let summary_blk = file.read_blk(0)?;
+        let summary_blk = file.read_blk(0).await?;
         let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
 
         if let Some(mut expected_summary) = summary {
@@ -620,11 +857,11 @@ impl DeltaLayerInner {
             expected_summary.index_start_blk = actual_summary.index_start_blk;
             expected_summary.index_root_blk = actual_summary.index_root_blk;
             if actual_summary != expected_summary {
-                bail!(
-                    "in-file summary does not match expected summary. actual = {:?} expected = {:?}",
-                    actual_summary,
-                    expected_summary
-                );
+                // bail!(
+                //     "in-file summary does not match expected summary. actual = {:?} expected = {:?}",
+                //     actual_summary,
+                //     expected_summary
+                // );
             }
         }
 
@@ -715,14 +952,14 @@ impl DeltaLayerInner {
         }
     }
 
-    pub(super) async fn load_keys(&self) -> Result<Vec<DeltaEntry<'_>>> {
-        let file = &self.file;
+    pub(super) async fn load_keys<T: AsRef<DeltaLayerInner> + Clone>(
+        this: &T,
+    ) -> Result<Vec<DeltaEntry<'_>>> {
+        let dl = this.as_ref();
+        let file = &dl.file;
 
-        let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
-            self.index_start_blk,
-            self.index_root_blk,
-            file,
-        );
+        let tree_reader =
+            DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(dl.index_start_blk, dl.index_root_blk, file);
 
         let mut all_keys: Vec<DeltaEntry<'_>> = Vec::new();
 
@@ -735,7 +972,7 @@ impl DeltaLayerInner {
                     let val_ref = ValueRef {
                         blob_ref: BlobRef(value),
                         reader: BlockCursor::new(crate::tenant::block_io::BlockReaderRef::Adapter(
-                            Adapter(self),
+                            Adapter(dl),
                         )),
                     };
                     let pos = BlobRef(value).pos();
@@ -759,61 +996,10 @@ impl DeltaLayerInner {
         if let Some(last) = all_keys.last_mut() {
             // Last key occupies all space till end of value storage,
             // which corresponds to beginning of the index
-            last.size = self.index_start_blk as u64 * PAGE_SZ as u64 - last.size;
+            last.size = dl.index_start_blk as u64 * PAGE_SZ as u64 - last.size;
         }
         Ok(all_keys)
     }
-
-    pub(super) async fn dump(&self) -> anyhow::Result<()> {
-        println!(
-            "index_start_blk: {}, root {}",
-            self.index_start_blk, self.index_root_blk
-        );
-
-        let file = &self.file;
-        let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
-            self.index_start_blk,
-            self.index_root_blk,
-            file,
-        );
-
-        tree_reader.dump().await?;
-
-        let keys = self.load_keys().await?;
-
-        async fn dump_blob(val: ValueRef<'_>) -> anyhow::Result<String> {
-            let buf = val.reader.read_blob(val.blob_ref.pos()).await?;
-            let val = Value::des(&buf)?;
-            let desc = match val {
-                Value::Image(img) => {
-                    format!(" img {} bytes", img.len())
-                }
-                Value::WalRecord(rec) => {
-                    let wal_desc = walrecord::describe_wal_record(&rec)?;
-                    format!(
-                        " rec {} bytes will_init: {} {}",
-                        buf.len(),
-                        rec.will_init(),
-                        wal_desc
-                    )
-                }
-            };
-            Ok(desc)
-        }
-
-        for entry in keys {
-            let DeltaEntry { key, lsn, val, .. } = entry;
-            let desc = match dump_blob(val).await {
-                Ok(desc) => desc,
-                Err(err) => {
-                    format!("ERROR: {err}")
-                }
-            };
-            println!("  key {key} at {lsn}: {desc}");
-        }
-
-        Ok(())
-    }
 }
 
 /// A set of data associated with a delta layer key and its value
@@ -845,13 +1031,7 @@ impl<'a> ValueRef<'a> {
 pub(crate) struct Adapter<T>(T);
 
 impl<T: AsRef<DeltaLayerInner>> Adapter<T> {
-    pub(crate) fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
-        self.0.as_ref().file.read_blk(blknum)
-    }
-}
-
-impl AsRef<DeltaLayerInner> for DeltaLayerInner {
-    fn as_ref(&self) -> &DeltaLayerInner {
-        self
+    pub(crate) async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
+        self.0.as_ref().file.read_blk(blknum).await
     }
 }

pageserver/src/tenant/storage_layer/image_layer.rs

@@ -31,24 +31,22 @@ use crate::tenant::blob_io::{BlobWriter, WriteBlobWriter};
 use crate::tenant::block_io::{BlockBuf, BlockReader, FileBlockReader};
 use crate::tenant::disk_btree::{DiskBtreeBuilder, DiskBtreeReader, VisitDirection};
 use crate::tenant::storage_layer::{
-    LayerAccessStats, ValueReconstructResult, ValueReconstructState,
+    LayerAccessStats, PersistentLayer, ValueReconstructResult, ValueReconstructState,
 };
-use crate::tenant::Timeline;
 use crate::virtual_file::VirtualFile;
 use crate::{IMAGE_FILE_MAGIC, STORAGE_FORMAT_VERSION, TEMP_FILE_SUFFIX};
 use anyhow::{bail, ensure, Context, Result};
 use bytes::Bytes;
 use hex;
-use pageserver_api::models::LayerAccessKind;
+use pageserver_api::models::{HistoricLayerInfo, LayerAccessKind};
 use rand::{distributions::Alphanumeric, Rng};
 use serde::{Deserialize, Serialize};
-use std::fs::File;
+use std::fs::{self, File};
 use std::io::Write;
 use std::io::{Seek, SeekFrom};
 use std::ops::Range;
 use std::os::unix::prelude::FileExt;
 use std::path::{Path, PathBuf};
-use std::sync::Arc;
 use tokio::sync::OnceCell;
 use tracing::*;
 
@@ -59,7 +57,7 @@ use utils::{
 };
 
 use super::filename::ImageFileName;
-use super::{AsLayerDesc, Layer, PersistentLayerDesc, ResidentLayer};
+use super::{AsLayerDesc, Layer, LayerAccessStatsReset, PathOrConf, PersistentLayerDesc};
 
 ///
 /// Header stored in the beginning of the file
@@ -117,14 +115,22 @@ impl Summary {
     }
 }
 
-/// This is used only from `pagectl`. Within pageserver, all layers are
-/// [`crate::tenant::storage_layer::Layer`], which can hold an [`ImageLayerInner`].
+/// ImageLayer is the in-memory data structure associated with an on-disk image
+/// file.
+///
+/// We keep an ImageLayer in memory for each file, in the LayerMap. If a layer
+/// is in "loaded" state, we have a copy of the index in memory, in 'inner'.
+/// Otherwise the struct is just a placeholder for a file that exists on disk,
+/// and it needs to be loaded before using it in queries.
 pub struct ImageLayer {
-    path: PathBuf,
+    path_or_conf: PathOrConf,
+
     pub desc: PersistentLayerDesc,
     // This entry contains an image of all pages as of this LSN, should be the same as desc.lsn
     pub lsn: Lsn,
+
     access_stats: LayerAccessStats,
+
     inner: OnceCell<ImageLayerInner>,
 }
 
@@ -141,8 +147,6 @@ impl std::fmt::Debug for ImageLayer {
     }
 }
 
-/// ImageLayer is the in-memory data structure associated with an on-disk image
-/// file.
 pub struct ImageLayerInner {
     // values copied from summary
     index_start_blk: u32,
@@ -163,22 +167,18 @@ impl std::fmt::Debug for ImageLayerInner {
     }
 }
 
-impl ImageLayerInner {
-    pub(super) async fn dump(&self) -> anyhow::Result<()> {
-        let file = &self.file;
-        let tree_reader =
-            DiskBtreeReader::<_, KEY_SIZE>::new(self.index_start_blk, self.index_root_blk, file);
-
-        tree_reader.dump().await?;
-
-        tree_reader
-            .visit(&[0u8; KEY_SIZE], VisitDirection::Forwards, |key, value| {
-                println!("key: {} offset {}", hex::encode(key), value);
-                true
-            })
-            .await?;
-
-        Ok(())
+#[async_trait::async_trait]
+impl Layer for ImageLayer {
+    /// Look up given page in the file
+    async fn get_value_reconstruct_data(
+        &self,
+        key: Key,
+        lsn_range: Range<Lsn>,
+        reconstruct_state: &mut ValueReconstructState,
+        ctx: &RequestContext,
+    ) -> anyhow::Result<ValueReconstructResult> {
+        self.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
+            .await
     }
 }
 
@@ -195,21 +195,120 @@ impl AsLayerDesc for ImageLayer {
     }
 }
 
+impl PersistentLayer for ImageLayer {
+    fn local_path(&self) -> Option<PathBuf> {
+        self.local_path()
+    }
+
+    fn delete_resident_layer_file(&self) -> Result<()> {
+        self.delete_resident_layer_file()
+    }
+
+    fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
+        self.info(reset)
+    }
+
+    fn access_stats(&self) -> &LayerAccessStats {
+        self.access_stats()
+    }
+}
+
 impl ImageLayer {
     pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
-        self.desc.dump();
+        println!(
+            "----- image layer for ten {} tli {} key {}-{} at {} is_incremental {} size {} ----",
+            self.desc.tenant_id,
+            self.desc.timeline_id,
+            self.desc.key_range.start,
+            self.desc.key_range.end,
+            self.lsn,
+            self.desc.is_incremental(),
+            self.desc.file_size
+        );
 
         if !verbose {
             return Ok(());
         }
 
         let inner = self.load(LayerAccessKind::Dump, ctx).await?;
+        let file = &inner.file;
+        let tree_reader =
+            DiskBtreeReader::<_, KEY_SIZE>::new(inner.index_start_blk, inner.index_root_blk, file);
 
-        inner.dump().await?;
+        tree_reader.dump().await?;
+
+        tree_reader
+            .visit(&[0u8; KEY_SIZE], VisitDirection::Forwards, |key, value| {
+                println!("key: {} offset {}", hex::encode(key), value);
+                true
+            })
+            .await?;
 
         Ok(())
     }
 
+    pub(crate) async fn get_value_reconstruct_data(
+        &self,
+        key: Key,
+        lsn_range: Range<Lsn>,
+        reconstruct_state: &mut ValueReconstructState,
+        ctx: &RequestContext,
+    ) -> anyhow::Result<ValueReconstructResult> {
+        assert!(self.desc.key_range.contains(&key));
+        assert!(lsn_range.start >= self.lsn);
+        assert!(lsn_range.end >= self.lsn);
+
+        let inner = self
+            .load(LayerAccessKind::GetValueReconstructData, ctx)
+            .await?;
+        inner
+            .get_value_reconstruct_data(key, reconstruct_state)
+            .await
+            // FIXME: makes no sense to dump paths
+            .with_context(|| format!("read {}", self.path().display()))
+    }
+
+    pub(crate) fn local_path(&self) -> Option<PathBuf> {
+        Some(self.path())
+    }
+
+    pub(crate) fn delete_resident_layer_file(&self) -> Result<()> {
+        // delete underlying file
+        fs::remove_file(self.path())?;
+        Ok(())
+    }
+
+    pub(crate) fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
+        let layer_file_name = self.layer_desc().filename().file_name();
+        let lsn_start = self.layer_desc().image_layer_lsn();
+
+        HistoricLayerInfo::Image {
+            layer_file_name,
+            layer_file_size: self.desc.file_size,
+            lsn_start,
+            remote: false,
+            access_stats: self.access_stats.as_api_model(reset),
+        }
+    }
+
+    pub(crate) fn access_stats(&self) -> &LayerAccessStats {
+        &self.access_stats
+    }
+
+    fn path_for(
+        path_or_conf: &PathOrConf,
+        timeline_id: TimelineId,
+        tenant_id: TenantId,
+        fname: &ImageFileName,
+    ) -> PathBuf {
+        match path_or_conf {
+            PathOrConf::Path(path) => path.to_path_buf(),
+            PathOrConf::Conf(conf) => conf
+                .timeline_path(&tenant_id, &timeline_id)
+                .join(fname.to_string()),
+        }
+    }
+
     fn temp_path_for(
         conf: &PageServerConf,
         timeline_id: TimelineId,
@@ -245,21 +344,53 @@ impl ImageLayer {
     async fn load_inner(&self) -> Result<ImageLayerInner> {
         let path = self.path();
 
-        let loaded = ImageLayerInner::load(&path, self.desc.image_layer_lsn(), None)?;
+        let expected_summary = match &self.path_or_conf {
+            PathOrConf::Conf(_) => Some(Summary::from(self)),
+            PathOrConf::Path(_) => None,
+        };
 
-        // not production code
-        let actual_filename = self.path.file_name().unwrap().to_str().unwrap().to_owned();
-        let expected_filename = self.layer_desc().filename().file_name();
+        let loaded =
+            ImageLayerInner::load(&path, self.desc.image_layer_lsn(), expected_summary).await?;
 
-        if actual_filename != expected_filename {
-            println!("warning: filename does not match what is expected from in-file summary");
-            println!("actual: {:?}", actual_filename);
-            println!("expected: {:?}", expected_filename);
+        if let PathOrConf::Path(ref path) = self.path_or_conf {
+            // not production code
+            let actual_filename = path.file_name().unwrap().to_str().unwrap().to_owned();
+            let expected_filename = self.filename().file_name();
+
+            if actual_filename != expected_filename {
+                println!("warning: filename does not match what is expected from in-file summary");
+                println!("actual: {:?}", actual_filename);
+                println!("expected: {:?}", expected_filename);
+            }
         }
 
         Ok(loaded)
     }
 
+    /// Create an ImageLayer struct representing an existing file on disk
+    pub fn new(
+        conf: &'static PageServerConf,
+        timeline_id: TimelineId,
+        tenant_id: TenantId,
+        filename: &ImageFileName,
+        file_size: u64,
+        access_stats: LayerAccessStats,
+    ) -> ImageLayer {
+        ImageLayer {
+            path_or_conf: PathOrConf::Conf(conf),
+            desc: PersistentLayerDesc::new_img(
+                tenant_id,
+                timeline_id,
+                filename.key_range.clone(),
+                filename.lsn,
+                file_size,
+            ), // Now we assume image layer ALWAYS covers the full range. This may change in the future.
+            lsn: filename.lsn,
+            access_stats,
+            inner: OnceCell::new(),
+        }
+    }
+
     /// Create an ImageLayer struct representing an existing file on disk.
     ///
     /// This variant is only used for debugging purposes, by the 'pagectl' binary.
@@ -272,7 +403,7 @@ impl ImageLayer {
             .metadata()
             .context("get file metadata to determine size")?;
         Ok(ImageLayer {
-            path: path.to_path_buf(),
+            path_or_conf: PathOrConf::Path(path.to_path_buf()),
             desc: PersistentLayerDesc::new_img(
                 summary.tenant_id,
                 summary.timeline_id,
@@ -286,14 +417,23 @@ impl ImageLayer {
         })
     }
 
+    fn layer_name(&self) -> ImageFileName {
+        self.desc.image_file_name()
+    }
+
     /// Path to the layer file in pageserver workdir.
-    fn path(&self) -> PathBuf {
-        self.path.clone()
+    pub fn path(&self) -> PathBuf {
+        Self::path_for(
+            &self.path_or_conf,
+            self.desc.timeline_id,
+            self.desc.tenant_id,
+            &self.layer_name(),
+        )
     }
 }
 
 impl ImageLayerInner {
-    pub(super) fn load(
+    pub(super) async fn load(
         path: &std::path::Path,
         lsn: Lsn,
         summary: Option<Summary>,
@@ -301,7 +441,7 @@ impl ImageLayerInner {
         let file = VirtualFile::open(path)
             .with_context(|| format!("Failed to open file '{}'", path.display()))?;
         let file = FileBlockReader::new(file);
-        let summary_blk = file.read_blk(0)?;
+        let summary_blk = file.read_blk(0).await?;
         let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
 
         if let Some(mut expected_summary) = summary {
@@ -310,11 +450,11 @@ impl ImageLayerInner {
             expected_summary.index_root_blk = actual_summary.index_root_blk;
 
             if actual_summary != expected_summary {
-                bail!(
-                    "in-file summary does not match expected summary. actual = {:?} expected = {:?}",
-                    actual_summary,
-                    expected_summary
-                );
+                // bail!(
+                //     "in-file summary does not match expected summary. actual = {:?} expected = {:?}",
+                //     actual_summary,
+                //     expected_summary
+                // );
             }
         }
 
@@ -443,7 +583,7 @@ impl ImageLayerWriterInner {
     ///
     /// Finish writing the image layer.
     ///
-    fn finish(self, timeline: &Arc<Timeline>) -> anyhow::Result<ResidentLayer> {
+    fn finish(self) -> anyhow::Result<ImageLayer> {
         let index_start_blk =
             ((self.blob_writer.size() + PAGE_SZ as u64 - 1) / PAGE_SZ as u64) as u32;
 
@@ -485,13 +625,33 @@ impl ImageLayerWriterInner {
         // Note: Because we open the file in write-only mode, we cannot
         // reuse the same VirtualFile for reading later. That's why we don't
         // set inner.file here. The first read will have to re-open it.
+        let layer = ImageLayer {
+            path_or_conf: PathOrConf::Conf(self.conf),
+            desc,
+            lsn: self.lsn,
+            access_stats: LayerAccessStats::empty_will_record_residence_event_later(),
+            inner: OnceCell::new(),
+        };
 
         // fsync the file
         file.sync_all()?;
 
-        let layer = Layer::finish_creating(self.conf, timeline, desc, &self.path)?;
+        // Rename the file to its final name
+        //
+        // Note: This overwrites any existing file. There shouldn't be any.
+        // FIXME: throw an error instead?
+        let final_path = ImageLayer::path_for(
+            &PathOrConf::Conf(self.conf),
+            self.timeline_id,
+            self.tenant_id,
+            &ImageFileName {
+                key_range: self.key_range.clone(),
+                lsn: self.lsn,
+            },
+        );
+        std::fs::rename(self.path, final_path)?;
 
-        trace!("created image layer {}", layer.local_path().display());
+        trace!("created image layer {}", layer.path().display());
 
         Ok(layer)
     }
@@ -557,11 +717,8 @@ impl ImageLayerWriter {
     ///
     /// Finish writing the image layer.
     ///
-    pub(crate) fn finish(
-        mut self,
-        timeline: &Arc<Timeline>,
-    ) -> anyhow::Result<super::ResidentLayer> {
-        self.inner.take().unwrap().finish(timeline)
+    pub fn finish(mut self) -> anyhow::Result<ImageLayer> {
+        self.inner.take().unwrap().finish()
     }
 }
 

pageserver/src/tenant/storage_layer/inmemory_layer.rs

@@ -10,12 +10,11 @@ use crate::repository::{Key, Value};
 use crate::tenant::block_io::BlockReader;
 use crate::tenant::ephemeral_file::EphemeralFile;
 use crate::tenant::storage_layer::{ValueReconstructResult, ValueReconstructState};
-use crate::tenant::Timeline;
 use crate::walrecord;
 use anyhow::{ensure, Result};
 use pageserver_api::models::InMemoryLayerInfo;
 use std::collections::HashMap;
-use std::sync::{Arc, OnceLock};
+use std::sync::OnceLock;
 use tracing::*;
 use utils::{
     bin_ser::BeSer,
@@ -29,7 +28,7 @@ use std::fmt::Write as _;
 use std::ops::Range;
 use tokio::sync::RwLock;
 
-use super::{DeltaLayerWriter, ResidentLayer};
+use super::{DeltaLayer, DeltaLayerWriter, Layer};
 
 pub struct InMemoryLayer {
     conf: &'static PageServerConf,
@@ -204,6 +203,20 @@ impl InMemoryLayer {
     }
 }
 
+#[async_trait::async_trait]
+impl Layer for InMemoryLayer {
+    async fn get_value_reconstruct_data(
+        &self,
+        key: Key,
+        lsn_range: Range<Lsn>,
+        reconstruct_data: &mut ValueReconstructState,
+        ctx: &RequestContext,
+    ) -> Result<ValueReconstructResult> {
+        self.get_value_reconstruct_data(key, lsn_range, reconstruct_data, ctx)
+            .await
+    }
+}
+
 impl std::fmt::Display for InMemoryLayer {
     fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
         let end_lsn = self.end_lsn_or_max();
@@ -212,13 +225,17 @@ impl std::fmt::Display for InMemoryLayer {
 }
 
 impl InMemoryLayer {
+    ///
     /// Get layer size.
+    ///
     pub async fn size(&self) -> Result<u64> {
         let inner = self.inner.read().await;
         Ok(inner.file.len())
     }
 
+    ///
     /// Create a new, empty, in-memory layer
+    ///
     pub fn create(
         conf: &'static PageServerConf,
         timeline_id: TimelineId,
@@ -296,7 +313,7 @@ impl InMemoryLayer {
     /// Write this frozen in-memory layer to disk.
     ///
     /// Returns a new delta layer with all the same data as this in-memory layer
-    pub(crate) async fn write_to_disk(&self, timeline: &Arc<Timeline>) -> Result<ResidentLayer> {
+    pub(crate) async fn write_to_disk(&self) -> Result<DeltaLayer> {
         // Grab the lock in read-mode. We hold it over the I/O, but because this
         // layer is not writeable anymore, no one should be trying to acquire the
         // write lock on it, so we shouldn't block anyone. There's one exception
@@ -335,7 +352,7 @@ impl InMemoryLayer {
             }
         }
 
-        let delta_layer = delta_layer_writer.finish(Key::MAX, timeline)?;
+        let delta_layer = delta_layer_writer.finish(Key::MAX)?;
         Ok(delta_layer)
     }
 }

pageserver/src/tenant/storage_layer/layer_desc.rs

@@ -1,3 +1,4 @@
+use anyhow::Result;
 use core::fmt::Display;
 use std::ops::Range;
 use utils::{
@@ -5,7 +6,7 @@ use utils::{
     lsn::Lsn,
 };
 
-use crate::repository::Key;
+use crate::{context::RequestContext, repository::Key};
 
 use super::{DeltaFileName, ImageFileName, LayerFileName};
 
@@ -99,22 +100,6 @@ impl PersistentLayerDesc {
         }
     }
 
-    pub fn from_filename(
-        tenant_id: TenantId,
-        timeline_id: TimelineId,
-        filename: LayerFileName,
-        file_size: u64,
-    ) -> Self {
-        match filename {
-            LayerFileName::Image(i) => {
-                Self::new_img(tenant_id, timeline_id, i.key_range, i.lsn, file_size)
-            }
-            LayerFileName::Delta(d) => {
-                Self::new_delta(tenant_id, timeline_id, d.key_range, d.lsn_range, file_size)
-            }
-        }
-    }
-
     /// Get the LSN that the image layer covers.
     pub fn image_layer_lsn(&self) -> Lsn {
         assert!(!self.is_delta);
@@ -188,31 +173,21 @@ impl PersistentLayerDesc {
         self.is_delta
     }
 
-    pub fn dump(&self) {
-        if self.is_delta {
-            println!(
-                "----- delta layer for ten {} tli {} keys {}-{} lsn {}-{} is_incremental {} size {} ----",
-                self.tenant_id,
-                self.timeline_id,
-                self.key_range.start,
-                self.key_range.end,
-                self.lsn_range.start,
-                self.lsn_range.end,
-                self.is_incremental(),
-                self.file_size,
-            );
-        } else {
-            println!(
-                "----- image layer for ten {} tli {} key {}-{} at {} is_incremental {} size {} ----",
-                self.tenant_id,
-                self.timeline_id,
-                self.key_range.start,
-                self.key_range.end,
-                self.image_layer_lsn(),
-                self.is_incremental(),
-                self.file_size
-            );
-        }
+    pub fn dump(&self, _verbose: bool, _ctx: &RequestContext) -> Result<()> {
+        println!(
+            "----- layer for ten {} tli {} keys {}-{} lsn {}-{} is_delta {} is_incremental {} size {} ----",
+            self.tenant_id,
+            self.timeline_id,
+            self.key_range.start,
+            self.key_range.end,
+            self.lsn_range.start,
+            self.lsn_range.end,
+            self.is_delta,
+            self.is_incremental(),
+            self.file_size,
+        );
+
+        Ok(())
     }
 
     pub fn file_size(&self) -> u64 {

pageserver/src/tenant/storage_layer/remote_layer.rs

@@ -0,0 +1,216 @@
+//! A RemoteLayer is an in-memory placeholder for a layer file that exists
+//! in remote storage.
+//!
+use crate::config::PageServerConf;
+use crate::context::RequestContext;
+use crate::repository::Key;
+use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
+use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState};
+use crate::tenant::timeline::layer_manager::LayerManager;
+use anyhow::{bail, Result};
+use pageserver_api::models::HistoricLayerInfo;
+use std::ops::Range;
+use std::path::PathBuf;
+use std::sync::Arc;
+
+use utils::{
+    id::{TenantId, TimelineId},
+    lsn::Lsn,
+};
+
+use super::filename::{DeltaFileName, ImageFileName};
+use super::{
+    AsLayerDesc, DeltaLayer, ImageLayer, LayerAccessStats, LayerAccessStatsReset,
+    LayerResidenceStatus, PersistentLayer, PersistentLayerDesc,
+};
+
+/// RemoteLayer is a not yet downloaded [`ImageLayer`] or
+/// [`DeltaLayer`](super::DeltaLayer).
+///
+/// RemoteLayer might be downloaded on-demand during operations which are
+/// allowed download remote layers and during which, it gets replaced with a
+/// concrete `DeltaLayer` or `ImageLayer`.
+///
+/// See: [`crate::context::RequestContext`] for authorization to download
+pub struct RemoteLayer {
+    pub desc: PersistentLayerDesc,
+
+    pub layer_metadata: LayerFileMetadata,
+
+    access_stats: LayerAccessStats,
+
+    pub(crate) ongoing_download: Arc<tokio::sync::Semaphore>,
+
+    /// Has `LayerMap::replace` failed for this (true) or not (false).
+    ///
+    /// Used together with [`ongoing_download`] semaphore in `Timeline::download_remote_layer`.
+    /// The field is used to mark a RemoteLayer permanently (until restart or ignore+load)
+    /// unprocessable, because a LayerMap::replace failed.
+    ///
+    /// It is very unlikely to accumulate these in the Timeline's LayerMap, but having this avoids
+    /// a possible fast loop between `Timeline::get_reconstruct_data` and
+    /// `Timeline::download_remote_layer`, which also logs.
+    ///
+    /// [`ongoing_download`]: Self::ongoing_download
+    pub(crate) download_replacement_failure: std::sync::atomic::AtomicBool,
+}
+
+impl std::fmt::Debug for RemoteLayer {
+    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
+        f.debug_struct("RemoteLayer")
+            .field("file_name", &self.desc.filename())
+            .field("layer_metadata", &self.layer_metadata)
+            .field("is_incremental", &self.desc.is_incremental())
+            .finish()
+    }
+}
+
+#[async_trait::async_trait]
+impl Layer for RemoteLayer {
+    async fn get_value_reconstruct_data(
+        &self,
+        _key: Key,
+        _lsn_range: Range<Lsn>,
+        _reconstruct_state: &mut ValueReconstructState,
+        _ctx: &RequestContext,
+    ) -> Result<ValueReconstructResult> {
+        bail!("layer {self} needs to be downloaded");
+    }
+}
+
+/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
+impl std::fmt::Display for RemoteLayer {
+    fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
+        write!(f, "{}", self.layer_desc().short_id())
+    }
+}
+
+impl AsLayerDesc for RemoteLayer {
+    fn layer_desc(&self) -> &PersistentLayerDesc {
+        &self.desc
+    }
+}
+
+impl PersistentLayer for RemoteLayer {
+    fn local_path(&self) -> Option<PathBuf> {
+        None
+    }
+
+    fn delete_resident_layer_file(&self) -> Result<()> {
+        bail!("remote layer has no layer file");
+    }
+
+    fn downcast_remote_layer<'a>(self: Arc<Self>) -> Option<std::sync::Arc<RemoteLayer>> {
+        Some(self)
+    }
+
+    fn is_remote_layer(&self) -> bool {
+        true
+    }
+
+    fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
+        let layer_file_name = self.layer_desc().filename().file_name();
+        let lsn_range = self.layer_desc().lsn_range.clone();
+
+        if self.desc.is_delta {
+            HistoricLayerInfo::Delta {
+                layer_file_name,
+                layer_file_size: self.layer_metadata.file_size(),
+                lsn_start: lsn_range.start,
+                lsn_end: lsn_range.end,
+                remote: true,
+                access_stats: self.access_stats.as_api_model(reset),
+            }
+        } else {
+            HistoricLayerInfo::Image {
+                layer_file_name,
+                layer_file_size: self.layer_metadata.file_size(),
+                lsn_start: lsn_range.start,
+                remote: true,
+                access_stats: self.access_stats.as_api_model(reset),
+            }
+        }
+    }
+
+    fn access_stats(&self) -> &LayerAccessStats {
+        &self.access_stats
+    }
+}
+
+impl RemoteLayer {
+    pub fn new_img(
+        tenantid: TenantId,
+        timelineid: TimelineId,
+        fname: &ImageFileName,
+        layer_metadata: &LayerFileMetadata,
+        access_stats: LayerAccessStats,
+    ) -> RemoteLayer {
+        RemoteLayer {
+            desc: PersistentLayerDesc::new_img(
+                tenantid,
+                timelineid,
+                fname.key_range.clone(),
+                fname.lsn,
+                layer_metadata.file_size(),
+            ),
+            layer_metadata: layer_metadata.clone(),
+            ongoing_download: Arc::new(tokio::sync::Semaphore::new(1)),
+            download_replacement_failure: std::sync::atomic::AtomicBool::default(),
+            access_stats,
+        }
+    }
+
+    pub fn new_delta(
+        tenantid: TenantId,
+        timelineid: TimelineId,
+        fname: &DeltaFileName,
+        layer_metadata: &LayerFileMetadata,
+        access_stats: LayerAccessStats,
+    ) -> RemoteLayer {
+        RemoteLayer {
+            desc: PersistentLayerDesc::new_delta(
+                tenantid,
+                timelineid,
+                fname.key_range.clone(),
+                fname.lsn_range.clone(),
+                layer_metadata.file_size(),
+            ),
+            layer_metadata: layer_metadata.clone(),
+            ongoing_download: Arc::new(tokio::sync::Semaphore::new(1)),
+            download_replacement_failure: std::sync::atomic::AtomicBool::default(),
+            access_stats,
+        }
+    }
+
+    /// Create a Layer struct representing this layer, after it has been downloaded.
+    pub(crate) fn create_downloaded_layer(
+        &self,
+        _layer_map_lock_held_witness: &LayerManager,
+        conf: &'static PageServerConf,
+        file_size: u64,
+    ) -> Arc<dyn PersistentLayer> {
+        if self.desc.is_delta {
+            let fname = self.desc.delta_file_name();
+            Arc::new(DeltaLayer::new(
+                conf,
+                self.desc.timeline_id,
+                self.desc.tenant_id,
+                &fname,
+                file_size,
+                self.access_stats
+                    .clone_for_residence_change(LayerResidenceStatus::Resident),
+            ))
+        } else {
+            let fname = self.desc.image_file_name();
+            Arc::new(ImageLayer::new(
+                conf,
+                self.desc.timeline_id,
+                self.desc.tenant_id,
+                &fname,
+                file_size,
+                self.access_stats
+                    .clone_for_residence_change(LayerResidenceStatus::Resident),
+            ))
+        }
+    }
+}

pageserver/src/tenant/timeline/eviction_task.rs

@@ -29,6 +29,7 @@ use crate::{
     task_mgr::{self, TaskKind, BACKGROUND_RUNTIME},
     tenant::{
         config::{EvictionPolicy, EvictionPolicyLayerAccessThreshold},
+        storage_layer::PersistentLayer,
         timeline::EvictionError,
         LogicalSizeCalculationCause, Tenant,
     },
@@ -193,26 +194,15 @@ impl Timeline {
         // NB: all the checks can be invalidated as soon as we release the layer map lock.
         // We don't want to hold the layer map lock during eviction.
         // So, we just need to deal with this.
-        let candidates: Vec<_> = {
+        let candidates: Vec<Arc<dyn PersistentLayer>> = {
             let guard = self.layers.read().await;
             let layers = guard.layer_map();
             let mut candidates = Vec::new();
             for hist_layer in layers.iter_historic_layers() {
                 let hist_layer = guard.get_from_desc(&hist_layer);
-
-                // guard against eviction while we inspect it; it might be that eviction_task and
-                // disk_usage_eviction_task both select the same layers to be evicted, and
-                // seemingly free up double the space. both succeeding is of no consequence.
-                let guard = match hist_layer.keep_resident().await {
-                    Ok(Some(l)) => l,
-                    Ok(None) => continue,
-                    Err(e) => {
-                        // these should not happen, but we cannot make them statically impossible right
-                        // now.
-                        tracing::warn!(layer=%hist_layer, "failed to keep the layer resident: {e:#}");
-                        continue;
-                    }
-                };
+                if hist_layer.is_remote_layer() {
+                    continue;
+                }
 
                 let last_activity_ts = hist_layer.access_stats().latest_activity().unwrap_or_else(|| {
                     // We only use this fallback if there's an implementation error.
@@ -243,7 +233,7 @@ impl Timeline {
                     }
                 };
                 if no_activity_for > p.threshold {
-                    candidates.push(guard.drop_eviction_guard())
+                    candidates.push(hist_layer)
                 }
             }
             candidates
@@ -262,7 +252,7 @@ impl Timeline {
         };
 
         let results = match self
-            .evict_layer_batch(remote_client, &candidates, cancel)
+            .evict_layer_batch(remote_client, &candidates[..], cancel.clone())
             .await
         {
             Err(pre_err) => {
@@ -273,7 +263,7 @@ impl Timeline {
             Ok(results) => results,
         };
         assert_eq!(results.len(), candidates.len());
-        for result in results {
+        for (l, result) in candidates.iter().zip(results) {
             match result {
                 None => {
                     stats.skipped_for_shutdown += 1;
@@ -281,10 +271,20 @@ impl Timeline {
                 Some(Ok(())) => {
                     stats.evicted += 1;
                 }
-                Some(Err(EvictionError::NotFound | EvictionError::Downloaded)) => {
+                Some(Err(EvictionError::CannotEvictRemoteLayer)) => {
+                    stats.not_evictable += 1;
+                }
+                Some(Err(EvictionError::FileNotFound)) => {
                     // compaction/gc removed the file while we were waiting on layer_removal_cs
                     stats.not_evictable += 1;
                 }
+                Some(Err(
+                    e @ EvictionError::LayerNotFound(_) | e @ EvictionError::StatFailed(_),
+                )) => {
+                    let e = utils::error::report_compact_sources(&e);
+                    warn!(layer = %l, "failed to evict layer: {e}");
+                    stats.not_evictable += 1;
+                }
             }
         }
         if stats.candidates == stats.not_evictable {

pageserver/src/tenant/timeline/layer_manager.rs

@@ -8,19 +8,21 @@ use utils::{
 
 use crate::{
     config::PageServerConf,
+    metrics::TimelineMetrics,
     tenant::{
         layer_map::{BatchedUpdates, LayerMap},
         storage_layer::{
-            AsLayerDesc, InMemoryLayer, Layer, PersistentLayerDesc, PersistentLayerKey,
-            ResidentLayer,
+            AsLayerDesc, DeltaLayer, ImageLayer, InMemoryLayer, PersistentLayer,
+            PersistentLayerDesc, PersistentLayerKey,
         },
+        timeline::compare_arced_layers,
     },
 };
 
 /// Provides semantic APIs to manipulate the layer map.
 pub(crate) struct LayerManager {
     layer_map: LayerMap,
-    layer_fmgr: LayerFileManager<Layer>,
+    layer_fmgr: LayerFileManager,
 }
 
 /// After GC, the layer map changes will not be applied immediately. Users should manually apply the changes after
@@ -41,7 +43,7 @@ impl LayerManager {
         }
     }
 
-    pub(crate) fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Layer {
+    pub(crate) fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc<dyn PersistentLayer> {
         self.layer_fmgr.get_from_desc(desc)
     }
 
@@ -53,12 +55,21 @@ impl LayerManager {
         &self.layer_map
     }
 
+    /// Replace layers in the layer file manager, used in evictions and layer downloads.
+    pub(crate) fn replace_and_verify(
+        &mut self,
+        expected: Arc<dyn PersistentLayer>,
+        new: Arc<dyn PersistentLayer>,
+    ) -> Result<()> {
+        self.layer_fmgr.replace_and_verify(expected, new)
+    }
+
     /// Called from `load_layer_map`. Initialize the layer manager with:
     /// 1. all on-disk layers
     /// 2. next open layer (with disk disk_consistent_lsn LSN)
     pub(crate) fn initialize_local_layers(
         &mut self,
-        on_disk_layers: Vec<Layer>,
+        on_disk_layers: Vec<Arc<dyn PersistentLayer>>,
         next_open_layer_at: Lsn,
     ) {
         let mut updates = self.layer_map.batch_update();
@@ -153,10 +164,10 @@ impl LayerManager {
     }
 
     /// Add image layers to the layer map, called from `create_image_layers`.
-    pub(crate) fn track_new_image_layers(&mut self, image_layers: &[ResidentLayer]) {
+    pub(crate) fn track_new_image_layers(&mut self, image_layers: Vec<ImageLayer>) {
         let mut updates = self.layer_map.batch_update();
         for layer in image_layers {
-            Self::insert_historic_layer(layer.as_ref().clone(), &mut updates, &mut self.layer_fmgr);
+            Self::insert_historic_layer(Arc::new(layer), &mut updates, &mut self.layer_fmgr);
         }
         updates.flush();
     }
@@ -164,47 +175,46 @@ impl LayerManager {
     /// Flush a frozen layer and add the written delta layer to the layer map.
     pub(crate) fn finish_flush_l0_layer(
         &mut self,
-        delta_layer: Option<&ResidentLayer>,
+        delta_layer: Option<DeltaLayer>,
         frozen_layer_for_check: &Arc<InMemoryLayer>,
     ) {
-        let inmem = self
-            .layer_map
-            .frozen_layers
-            .pop_front()
-            .expect("there must be a inmem layer to flush");
+        let l = self.layer_map.frozen_layers.pop_front();
+        let mut updates = self.layer_map.batch_update();
 
-        // Only one task may call this function at a time (for this
-        // timeline). If two tasks tried to flush the same frozen
+        // Only one thread may call this function at a time (for this
+        // timeline). If two threads tried to flush the same frozen
         // layer to disk at the same time, that would not work.
-        assert_eq!(Arc::as_ptr(&inmem), Arc::as_ptr(frozen_layer_for_check));
+        assert!(compare_arced_layers(&l.unwrap(), frozen_layer_for_check));
 
-        if let Some(l) = delta_layer {
-            let mut updates = self.layer_map.batch_update();
-            Self::insert_historic_layer(l.as_ref().clone(), &mut updates, &mut self.layer_fmgr);
-            updates.flush();
+        if let Some(delta_layer) = delta_layer {
+            Self::insert_historic_layer(Arc::new(delta_layer), &mut updates, &mut self.layer_fmgr);
         }
+        updates.flush();
     }
 
     /// Called when compaction is completed.
     pub(crate) fn finish_compact_l0(
         &mut self,
-        layer_removal_cs: &Arc<tokio::sync::OwnedMutexGuard<()>>,
-        compact_from: Vec<Layer>,
-        compact_to: &[ResidentLayer],
-        duplicates: &[(ResidentLayer, ResidentLayer)],
+        layer_removal_cs: Arc<tokio::sync::OwnedMutexGuard<()>>,
+        compact_from: Vec<Arc<dyn PersistentLayer>>,
+        compact_to: Vec<Arc<dyn PersistentLayer>>,
+        metrics: &TimelineMetrics,
     ) -> Result<()> {
         let mut updates = self.layer_map.batch_update();
         for l in compact_to {
-            Self::insert_historic_layer(l.as_ref().clone(), &mut updates, &mut self.layer_fmgr);
+            Self::insert_historic_layer(l, &mut updates, &mut self.layer_fmgr);
         }
         for l in compact_from {
             // NB: the layer file identified by descriptor `l` is guaranteed to be present
             // in the LayerFileManager because compaction kept holding `layer_removal_cs` the entire
             // time, even though we dropped `Timeline::layers` inbetween.
-            Self::delete_historic_layer(layer_removal_cs, l, &mut updates, &mut self.layer_fmgr)?;
-        }
-        for (old, new) in duplicates {
-            self.layer_fmgr.replace(old.as_ref(), new.as_ref().clone());
+            Self::delete_historic_layer(
+                layer_removal_cs.clone(),
+                l,
+                &mut updates,
+                metrics,
+                &mut self.layer_fmgr,
+            )?;
         }
         updates.flush();
         Ok(())
@@ -213,26 +223,28 @@ impl LayerManager {
     /// Called when garbage collect the timeline. Returns a guard that will apply the updates to the layer map.
     pub(crate) fn finish_gc_timeline(
         &mut self,
-        layer_removal_cs: &Arc<tokio::sync::OwnedMutexGuard<()>>,
-        gc_layers: Vec<Layer>,
+        layer_removal_cs: Arc<tokio::sync::OwnedMutexGuard<()>>,
+        gc_layers: Vec<Arc<dyn PersistentLayer>>,
+        metrics: &TimelineMetrics,
     ) -> Result<ApplyGcResultGuard> {
         let mut updates = self.layer_map.batch_update();
         for doomed_layer in gc_layers {
             Self::delete_historic_layer(
-                layer_removal_cs,
+                layer_removal_cs.clone(),
                 doomed_layer,
                 &mut updates,
+                metrics,
                 &mut self.layer_fmgr,
-            )?;
+            )?; // FIXME: schedule succeeded deletions in timeline.rs `gc_timeline` instead of in batch?
         }
         Ok(ApplyGcResultGuard(updates))
     }
 
     /// Helper function to insert a layer into the layer map and file manager.
     fn insert_historic_layer(
-        layer: Layer,
+        layer: Arc<dyn PersistentLayer>,
         updates: &mut BatchedUpdates<'_>,
-        mapping: &mut LayerFileManager<Layer>,
+        mapping: &mut LayerFileManager,
     ) {
         updates.insert_historic(layer.layer_desc().clone());
         mapping.insert(layer);
@@ -242,12 +254,17 @@ impl LayerManager {
     /// Remote storage is not affected by this operation.
     fn delete_historic_layer(
         // we cannot remove layers otherwise, since gc and compaction will race
-        _layer_removal_cs: &Arc<tokio::sync::OwnedMutexGuard<()>>,
-        layer: Layer,
+        _layer_removal_cs: Arc<tokio::sync::OwnedMutexGuard<()>>,
+        layer: Arc<dyn PersistentLayer>,
         updates: &mut BatchedUpdates<'_>,
-        mapping: &mut LayerFileManager<Layer>,
+        metrics: &TimelineMetrics,
+        mapping: &mut LayerFileManager,
     ) -> anyhow::Result<()> {
         let desc = layer.layer_desc();
+        if !layer.is_remote_layer() {
+            layer.delete_resident_layer_file()?;
+            metrics.resident_physical_size_gauge.sub(desc.file_size);
+        }
 
         // TODO Removing from the bottom of the layer map is expensive.
         //      Maybe instead discard all layer map historic versions that
@@ -255,21 +272,22 @@ impl LayerManager {
         //      and mark what we can't delete yet as deleted from the layer
         //      map index without actually rebuilding the index.
         updates.remove_historic(desc);
-        mapping.remove(&layer);
-        layer.garbage_collect_on_drop();
+        mapping.remove(layer);
 
         Ok(())
     }
 
-    pub(crate) fn contains(&self, layer: &Layer) -> bool {
+    pub(crate) fn contains(&self, layer: &Arc<dyn PersistentLayer>) -> bool {
         self.layer_fmgr.contains(layer)
     }
 }
 
-pub(crate) struct LayerFileManager<T>(HashMap<PersistentLayerKey, T>);
+pub(crate) struct LayerFileManager<T: AsLayerDesc + ?Sized = dyn PersistentLayer>(
+    HashMap<PersistentLayerKey, Arc<T>>,
+);
 
-impl<T: AsLayerDesc + Clone + PartialEq + std::fmt::Debug> LayerFileManager<T> {
-    fn get_from_desc(&self, desc: &PersistentLayerDesc) -> T {
+impl<T: AsLayerDesc + ?Sized> LayerFileManager<T> {
+    fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc<T> {
         // The assumption for the `expect()` is that all code maintains the following invariant:
         // A layer's descriptor is present in the LayerMap => the LayerFileManager contains a layer for the descriptor.
         self.0
@@ -279,14 +297,14 @@ impl<T: AsLayerDesc + Clone + PartialEq + std::fmt::Debug> LayerFileManager<T> {
             .clone()
     }
 
-    pub(crate) fn insert(&mut self, layer: T) {
+    pub(crate) fn insert(&mut self, layer: Arc<T>) {
         let present = self.0.insert(layer.layer_desc().key(), layer.clone());
         if present.is_some() && cfg!(debug_assertions) {
             panic!("overwriting a layer: {:?}", layer.layer_desc())
         }
     }
 
-    pub(crate) fn contains(&self, layer: &T) -> bool {
+    pub(crate) fn contains(&self, layer: &Arc<T>) -> bool {
         self.0.contains_key(&layer.layer_desc().key())
     }
 
@@ -294,7 +312,7 @@ impl<T: AsLayerDesc + Clone + PartialEq + std::fmt::Debug> LayerFileManager<T> {
         Self(HashMap::new())
     }
 
-    pub(crate) fn remove(&mut self, layer: &T) {
+    pub(crate) fn remove(&mut self, layer: Arc<T>) {
         let present = self.0.remove(&layer.layer_desc().key());
         if present.is_none() && cfg!(debug_assertions) {
             panic!(
@@ -304,13 +322,38 @@ impl<T: AsLayerDesc + Clone + PartialEq + std::fmt::Debug> LayerFileManager<T> {
         }
     }
 
-    pub(crate) fn replace(&mut self, old: &T, new: T) {
-        let key = old.layer_desc().key();
-        assert_eq!(key, new.layer_desc().key());
+    pub(crate) fn replace_and_verify(&mut self, expected: Arc<T>, new: Arc<T>) -> Result<()> {
+        let key = expected.layer_desc().key();
+        let other = new.layer_desc().key();
 
-        if let Some(existing) = self.0.get_mut(&key) {
-            assert_eq!(existing, old);
-            *existing = new;
+        let expected_l0 = LayerMap::is_l0(expected.layer_desc());
+        let new_l0 = LayerMap::is_l0(new.layer_desc());
+
+        fail::fail_point!("layermap-replace-notfound", |_| anyhow::bail!(
+            "layermap-replace-notfound"
+        ));
+
+        anyhow::ensure!(
+            key == other,
+            "expected and new layer have different keys: {key:?} != {other:?}"
+        );
+
+        anyhow::ensure!(
+            expected_l0 == new_l0,
+            "one layer is l0 while the other is not: {expected_l0} != {new_l0}"
+        );
+
+        if let Some(layer) = self.0.get_mut(&key) {
+            anyhow::ensure!(
+                compare_arced_layers(&expected, layer),
+                "another layer was found instead of expected, expected={expected:?}, new={new:?}",
+                expected = Arc::as_ptr(&expected),
+                new = Arc::as_ptr(layer),
+            );
+            *layer = new;
+            Ok(())
+        } else {
+            anyhow::bail!("layer was not found");
         }
     }
 }

pageserver/src/tenant/timeline/walreceiver/connection_manager.rs

@@ -31,10 +31,11 @@ use storage_broker::Streaming;
 use tokio::select;
 use tracing::*;
 
-use postgres_connection::{parse_host_port, PgConnectionConfig};
+use postgres_connection::PgConnectionConfig;
 use utils::backoff::{
     exponential_backoff, DEFAULT_BASE_BACKOFF_SECONDS, DEFAULT_MAX_BACKOFF_SECONDS,
 };
+use utils::postgres_client::wal_stream_connection_config;
 use utils::{
     id::{NodeId, TenantTimelineId},
     lsn::Lsn,
@@ -879,33 +880,6 @@ impl ReconnectReason {
     }
 }
 
-fn wal_stream_connection_config(
-    TenantTimelineId {
-        tenant_id,
-        timeline_id,
-    }: TenantTimelineId,
-    listen_pg_addr_str: &str,
-    auth_token: Option<&str>,
-    availability_zone: Option<&str>,
-) -> anyhow::Result<PgConnectionConfig> {
-    let (host, port) =
-        parse_host_port(listen_pg_addr_str).context("Unable to parse listen_pg_addr_str")?;
-    let port = port.unwrap_or(5432);
-    let mut connstr = PgConnectionConfig::new_host_port(host, port)
-        .extend_options([
-            "-c".to_owned(),
-            format!("timeline_id={}", timeline_id),
-            format!("tenant_id={}", tenant_id),
-        ])
-        .set_password(auth_token.map(|s| s.to_owned()));
-
-    if let Some(availability_zone) = availability_zone {
-        connstr = connstr.extend_options([format!("availability_zone={}", availability_zone)]);
-    }
-
-    Ok(connstr)
-}
-
 #[cfg(test)]
 mod tests {
     use super::*;
@@ -921,6 +895,7 @@ mod tests {
             timeline: SafekeeperTimelineInfo {
                 safekeeper_id: 0,
                 tenant_timeline_id: None,
+                term: 0,
                 last_log_term: 0,
                 flush_lsn: 0,
                 commit_lsn,
@@ -929,6 +904,7 @@ mod tests {
                 peer_horizon_lsn: 0,
                 local_start_lsn: 0,
                 safekeeper_connstr: safekeeper_connstr.to_owned(),
+                http_connstr: safekeeper_connstr.to_owned(),
                 availability_zone: None,
             },
             latest_update,

pageserver/src/tenant/upload_queue.rs

@@ -1,7 +1,6 @@
 use crate::metrics::RemoteOpFileKind;
 
 use super::storage_layer::LayerFileName;
-use super::storage_layer::ResidentLayer;
 use crate::tenant::metadata::TimelineMetadata;
 use crate::tenant::remote_timeline_client::index::IndexPart;
 use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
@@ -211,7 +210,7 @@ pub(crate) struct Delete {
 #[derive(Debug)]
 pub(crate) enum UploadOp {
     /// Upload a layer file
-    UploadLayer(ResidentLayer, LayerFileMetadata),
+    UploadLayer(LayerFileName, LayerFileMetadata),
 
     /// Upload the metadata file
     UploadMetadata(IndexPart, Lsn),
@@ -226,8 +225,13 @@ pub(crate) enum UploadOp {
 impl std::fmt::Display for UploadOp {
     fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
         match self {
-            UploadOp::UploadLayer(layer, metadata) => {
-                write!(f, "UploadLayer({}, size={:?})", layer, metadata.file_size())
+            UploadOp::UploadLayer(path, metadata) => {
+                write!(
+                    f,
+                    "UploadLayer({}, size={:?})",
+                    path.file_name(),
+                    metadata.file_size()
+                )
             }
             UploadOp::UploadMetadata(_, lsn) => write!(f, "UploadMetadata(lsn: {})", lsn),
             UploadOp::Delete(delete) => write!(

safekeeper/src/bin/safekeeper.rs

@@ -341,21 +341,35 @@ async fn start_safekeeper(conf: SafeKeeperConf) -> Result<()> {
 
     let (wal_backup_launcher_tx, wal_backup_launcher_rx) = mpsc::channel(100);
 
-    // Load all timelines from disk to memory.
-    GlobalTimelines::init(conf.clone(), wal_backup_launcher_tx)?;
-
     // Keep handles to main tasks to die if any of them disappears.
     let mut tasks_handles: FuturesUnordered<BoxFuture<(String, JoinTaskRes)>> =
         FuturesUnordered::new();
 
+    // Start wal backup launcher before loading timelines as we'll notify it
+    // through the channel about timelines which need offloading, not draining
+    // the channel would cause deadlock.
+    let current_thread_rt = conf
+        .current_thread_runtime
+        .then(|| Handle::try_current().expect("no runtime in main"));
+    let conf_ = conf.clone();
+    let wal_backup_handle = current_thread_rt
+        .as_ref()
+        .unwrap_or_else(|| WAL_BACKUP_RUNTIME.handle())
+        .spawn(wal_backup::wal_backup_launcher_task_main(
+            conf_,
+            wal_backup_launcher_rx,
+        ))
+        .map(|res| ("WAL backup launcher".to_owned(), res));
+    tasks_handles.push(Box::pin(wal_backup_handle));
+
+    // Load all timelines from disk to memory.
+    GlobalTimelines::init(conf.clone(), wal_backup_launcher_tx).await?;
+
     let conf_ = conf.clone();
     // Run everything in current thread rt, if asked.
     if conf.current_thread_runtime {
         info!("running in current thread runtime");
     }
-    let current_thread_rt = conf
-        .current_thread_runtime
-        .then(|| Handle::try_current().expect("no runtime in main"));
 
     let wal_service_handle = current_thread_rt
         .as_ref()
@@ -408,17 +422,6 @@ async fn start_safekeeper(conf: SafeKeeperConf) -> Result<()> {
         .map(|res| ("WAL remover".to_owned(), res));
     tasks_handles.push(Box::pin(wal_remover_handle));
 
-    let conf_ = conf.clone();
-    let wal_backup_handle = current_thread_rt
-        .as_ref()
-        .unwrap_or_else(|| WAL_BACKUP_RUNTIME.handle())
-        .spawn(wal_backup::wal_backup_launcher_task_main(
-            conf_,
-            wal_backup_launcher_rx,
-        ))
-        .map(|res| ("WAL backup launcher".to_owned(), res));
-    tasks_handles.push(Box::pin(wal_backup_handle));
-
     set_build_info_metric(GIT_VERSION);
 
     // TODO: update tokio-stream, convert to real async Stream with

safekeeper/src/control_file_upgrade.rs

@@ -1,7 +1,6 @@
 //! Code to deal with safekeeper control file upgrades
 use crate::safekeeper::{
-    AcceptorState, PersistedPeers, PgUuid, SafeKeeperState, ServerInfo, Term, TermHistory,
-    TermSwitchEntry,
+    AcceptorState, PersistedPeers, PgUuid, SafeKeeperState, ServerInfo, Term, TermHistory, TermLsn,
 };
 use anyhow::{bail, Result};
 use pq_proto::SystemId;
@@ -145,7 +144,7 @@ pub fn upgrade_control_file(buf: &[u8], version: u32) -> Result<SafeKeeperState>
         let oldstate = SafeKeeperStateV1::des(&buf[..buf.len()])?;
         let ac = AcceptorState {
             term: oldstate.acceptor_state.term,
-            term_history: TermHistory(vec![TermSwitchEntry {
+            term_history: TermHistory(vec![TermLsn {
                 term: oldstate.acceptor_state.epoch,
                 lsn: Lsn(0),
             }]),

safekeeper/src/http/routes.rs

@@ -19,6 +19,7 @@ use crate::receive_wal::WalReceiverState;
 use crate::safekeeper::ServerInfo;
 use crate::safekeeper::Term;
 use crate::send_wal::WalSenderState;
+use crate::timeline::PeerInfo;
 use crate::{debug_dump, pull_timeline};
 
 use crate::timelines_global_map::TimelineDeleteForceResult;
@@ -101,6 +102,7 @@ pub struct TimelineStatus {
     pub peer_horizon_lsn: Lsn,
     #[serde_as(as = "DisplayFromStr")]
     pub remote_consistent_lsn: Lsn,
+    pub peers: Vec<PeerInfo>,
     pub walsenders: Vec<WalSenderState>,
     pub walreceivers: Vec<WalReceiverState>,
 }
@@ -140,6 +142,7 @@ async fn timeline_status_handler(request: Request<Body>) -> Result<Response<Body
         term_history,
     };
 
+    let conf = get_conf(&request);
     // Note: we report in memory values which can be lost.
     let status = TimelineStatus {
         tenant_id: ttid.tenant_id,
@@ -153,6 +156,7 @@ async fn timeline_status_handler(request: Request<Body>) -> Result<Response<Body
         backup_lsn: inmem.backup_lsn,
         peer_horizon_lsn: inmem.peer_horizon_lsn,
         remote_consistent_lsn: tli.get_walsenders().get_remote_consistent_lsn(),
+        peers: tli.get_peers(conf).await,
         walsenders: tli.get_walsenders().get_all(),
         walreceivers: tli.get_walreceivers().get_all(),
     };
@@ -282,12 +286,14 @@ async fn record_safekeeper_info(mut request: Request<Body>) -> Result<Response<B
             tenant_id: ttid.tenant_id.as_ref().to_owned(),
             timeline_id: ttid.timeline_id.as_ref().to_owned(),
         }),
+        term: sk_info.term.unwrap_or(0),
         last_log_term: sk_info.last_log_term.unwrap_or(0),
         flush_lsn: sk_info.flush_lsn.0,
         commit_lsn: sk_info.commit_lsn.0,
         remote_consistent_lsn: sk_info.remote_consistent_lsn.0,
         peer_horizon_lsn: sk_info.peer_horizon_lsn.0,
         safekeeper_connstr: sk_info.safekeeper_connstr.unwrap_or_else(|| "".to_owned()),
+        http_connstr: sk_info.http_connstr.unwrap_or_else(|| "".to_owned()),
         backup_lsn: sk_info.backup_lsn.0,
         local_start_lsn: sk_info.local_start_lsn.0,
         availability_zone: None,

safekeeper/src/json_ctrl.rs

@@ -21,7 +21,7 @@ use crate::safekeeper::{AcceptorProposerMessage, AppendResponse, ServerInfo};
 use crate::safekeeper::{
     AppendRequest, AppendRequestHeader, ProposerAcceptorMessage, ProposerElected,
 };
-use crate::safekeeper::{SafeKeeperState, Term, TermHistory, TermSwitchEntry};
+use crate::safekeeper::{SafeKeeperState, Term, TermHistory, TermLsn};
 use crate::timeline::Timeline;
 use crate::GlobalTimelines;
 use postgres_backend::PostgresBackend;
@@ -119,7 +119,7 @@ async fn send_proposer_elected(tli: &Arc<Timeline>, term: Term, lsn: Lsn) -> any
     let history = tli.get_state().await.1.acceptor_state.term_history;
     let history = history.up_to(lsn.checked_sub(1u64).unwrap());
     let mut history_entries = history.0;
-    history_entries.push(TermSwitchEntry { term, lsn });
+    history_entries.push(TermLsn { term, lsn });
     let history = TermHistory(history_entries);
 
     let proposer_elected_request = ProposerAcceptorMessage::Elected(ProposerElected {

safekeeper/src/lib.rs

@@ -19,6 +19,7 @@ pub mod json_ctrl;
 pub mod metrics;
 pub mod pull_timeline;
 pub mod receive_wal;
+pub mod recovery;
 pub mod remove_wal;
 pub mod safekeeper;
 pub mod send_wal;

safekeeper/src/pull_timeline.rs

@@ -227,7 +227,9 @@ async fn pull_timeline(status: TimelineStatus, host: String) -> Result<Response>
     tokio::fs::create_dir_all(conf.tenant_dir(&ttid.tenant_id)).await?;
     tokio::fs::rename(tli_dir_path, &timeline_path).await?;
 
-    let tli = GlobalTimelines::load_timeline(ttid).context("Failed to load timeline after copy")?;
+    let tli = GlobalTimelines::load_timeline(ttid)
+        .await
+        .context("Failed to load timeline after copy")?;
 
     info!(
         "Loaded timeline {}, flush_lsn={}",

safekeeper/src/recovery.rs

@@ -0,0 +1,40 @@
+//! This module implements pulling WAL from peer safekeepers if compute can't
+//! provide it, i.e. safekeeper lags too much.
+
+use std::sync::Arc;
+
+use tokio::{select, time::sleep, time::Duration};
+use tracing::{info, instrument};
+
+use crate::{timeline::Timeline, SafeKeeperConf};
+
+/// Entrypoint for per timeline task which always runs, checking whether
+/// recovery for this safekeeper is needed and starting it if so.
+#[instrument(name = "recovery task", skip_all, fields(ttid = %tli.ttid))]
+pub async fn recovery_main(tli: Arc<Timeline>, _conf: SafeKeeperConf) {
+    info!("started");
+    let mut cancellation_rx = match tli.get_cancellation_rx() {
+        Ok(rx) => rx,
+        Err(_) => {
+            info!("timeline canceled during task start");
+            return;
+        }
+    };
+
+    select! {
+        _ = recovery_main_loop(tli) => { unreachable!() }
+        _ = cancellation_rx.changed() => {
+            info!("stopped");
+        }
+    }
+}
+
+const CHECK_INTERVAL_MS: u64 = 2000;
+
+/// Check regularly whether we need to start recovery.
+async fn recovery_main_loop(_tli: Arc<Timeline>) {
+    let check_duration = Duration::from_millis(CHECK_INTERVAL_MS);
+    loop {
+        sleep(check_duration).await;
+    }
+}

safekeeper/src/safekeeper.rs

@@ -34,22 +34,33 @@ pub const UNKNOWN_SERVER_VERSION: u32 = 0;
 
 /// Consensus logical timestamp.
 pub type Term = u64;
-const INVALID_TERM: Term = 0;
+pub const INVALID_TERM: Term = 0;
 
-#[derive(Debug, Clone, Copy, Serialize, Deserialize)]
-pub struct TermSwitchEntry {
+#[derive(Debug, Clone, Copy, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
+pub struct TermLsn {
     pub term: Term,
     pub lsn: Lsn,
 }
+
+// Creation from tuple provides less typing (e.g. for unit tests).
+impl From<(Term, Lsn)> for TermLsn {
+    fn from(pair: (Term, Lsn)) -> TermLsn {
+        TermLsn {
+            term: pair.0,
+            lsn: pair.1,
+        }
+    }
+}
+
 #[derive(Clone, Serialize, Deserialize)]
-pub struct TermHistory(pub Vec<TermSwitchEntry>);
+pub struct TermHistory(pub Vec<TermLsn>);
 
 impl TermHistory {
     pub fn empty() -> TermHistory {
         TermHistory(Vec::new())
     }
 
-    // Parse TermHistory as n_entries followed by TermSwitchEntry pairs
+    // Parse TermHistory as n_entries followed by TermLsn pairs
     pub fn from_bytes(bytes: &mut Bytes) -> Result<TermHistory> {
         if bytes.remaining() < 4 {
             bail!("TermHistory misses len");
@@ -60,7 +71,7 @@ impl TermHistory {
             if bytes.remaining() < 16 {
                 bail!("TermHistory is incomplete");
             }
-            res.push(TermSwitchEntry {
+            res.push(TermLsn {
                 term: bytes.get_u64_le(),
                 lsn: bytes.get_u64_le().into(),
             })
@@ -557,12 +568,17 @@ where
             .up_to(self.flush_lsn())
     }
 
+    /// Get current term.
+    pub fn get_term(&self) -> Term {
+        self.state.acceptor_state.term
+    }
+
     pub fn get_epoch(&self) -> Term {
         self.state.acceptor_state.get_epoch(self.flush_lsn())
     }
 
     /// wal_store wrapper avoiding commit_lsn <= flush_lsn violation when we don't have WAL yet.
-    fn flush_lsn(&self) -> Lsn {
+    pub fn flush_lsn(&self) -> Lsn {
         max(self.wal_store.flush_lsn(), self.state.timeline_start_lsn)
     }
 
@@ -1138,7 +1154,7 @@ mod tests {
         let pem = ProposerElected {
             term: 1,
             start_streaming_at: Lsn(1),
-            term_history: TermHistory(vec![TermSwitchEntry {
+            term_history: TermHistory(vec![TermLsn {
                 term: 1,
                 lsn: Lsn(3),
             }]),

safekeeper/src/send_wal.rs

@@ -2,12 +2,12 @@
 //! with the "START_REPLICATION" message, and registry of walsenders.
 
 use crate::handler::SafekeeperPostgresHandler;
-use crate::safekeeper::Term;
+use crate::safekeeper::{Term, TermLsn};
 use crate::timeline::Timeline;
 use crate::wal_service::ConnectionId;
 use crate::wal_storage::WalReader;
 use crate::GlobalTimelines;
-use anyhow::Context as AnyhowContext;
+use anyhow::{bail, Context as AnyhowContext};
 use bytes::Bytes;
 use parking_lot::Mutex;
 use postgres_backend::PostgresBackend;
@@ -390,26 +390,25 @@ impl SafekeeperPostgresHandler {
             self.appname.clone(),
         ));
 
-        let commit_lsn_watch_rx = tli.get_commit_lsn_watch_rx();
-
-        // Walproposer gets special handling: safekeeper must give proposer all
-        // local WAL till the end, whether committed or not (walproposer will
-        // hang otherwise). That's because walproposer runs the consensus and
-        // synchronizes safekeepers on the most advanced one.
+        // Walsender can operate in one of two modes which we select by
+        // application_name: give only committed WAL (used by pageserver) or all
+        // existing WAL (up to flush_lsn, used by walproposer or peer recovery).
+        // The second case is always driven by a consensus leader which term
+        // must generally be also supplied. However we're sloppy to do this in
+        // walproposer recovery which will be removed soon. So TODO is to make
+        // it not Option'al then.
         //
-        // There is a small risk of this WAL getting concurrently garbaged if
-        // another compute rises which collects majority and starts fixing log
-        // on this safekeeper itself. That's ok as (old) proposer will never be
-        // able to commit such WAL.
-        let stop_pos: Option<Lsn> = if self.is_walproposer_recovery() {
-            let wal_end = tli.get_flush_lsn().await;
-            Some(wal_end)
+        // Fetching WAL without term in recovery creates a small risk of this
+        // WAL getting concurrently garbaged if another compute rises which
+        // collects majority and starts fixing log on this safekeeper itself.
+        // That's ok as (old) proposer will never be able to commit such WAL.
+        let end_watch = if self.is_walproposer_recovery() {
+            EndWatch::Flush(tli.get_term_flush_lsn_watch_rx())
         } else {
-            None
+            EndWatch::Commit(tli.get_commit_lsn_watch_rx())
         };
-
-        // take the latest commit_lsn if don't have stop_pos
-        let end_pos = stop_pos.unwrap_or(*commit_lsn_watch_rx.borrow());
+        // we don't check term here; it will be checked on first waiting/WAL reading anyway.
+        let end_pos = end_watch.get();
 
         if end_pos < start_pos {
             warn!(
@@ -419,8 +418,10 @@ impl SafekeeperPostgresHandler {
         }
 
         info!(
-            "starting streaming from {:?} till {:?}, available WAL ends at {}",
-            start_pos, stop_pos, end_pos
+            "starting streaming from {:?}, available WAL ends at {}, recovery={}",
+            start_pos,
+            end_pos,
+            matches!(end_watch, EndWatch::Flush(_))
         );
 
         // switch to copy
@@ -445,9 +446,8 @@ impl SafekeeperPostgresHandler {
             appname,
             start_pos,
             end_pos,
-            stop_pos,
             term,
-            commit_lsn_watch_rx,
+            end_watch,
             ws_guard: ws_guard.clone(),
             wal_reader,
             send_buf: [0; MAX_SEND_SIZE],
@@ -466,6 +466,32 @@ impl SafekeeperPostgresHandler {
     }
 }
 
+/// Walsender streams either up to commit_lsn (normally) or flush_lsn in the
+/// given term (recovery by walproposer or peer safekeeper).
+enum EndWatch {
+    Commit(Receiver<Lsn>),
+    Flush(Receiver<TermLsn>),
+}
+
+impl EndWatch {
+    /// Get current end of WAL.
+    fn get(&self) -> Lsn {
+        match self {
+            EndWatch::Commit(r) => *r.borrow(),
+            EndWatch::Flush(r) => r.borrow().lsn,
+        }
+    }
+
+    /// Wait for the update.
+    async fn changed(&mut self) -> anyhow::Result<()> {
+        match self {
+            EndWatch::Commit(r) => r.changed().await?,
+            EndWatch::Flush(r) => r.changed().await?,
+        }
+        Ok(())
+    }
+}
+
 /// A half driving sending WAL.
 struct WalSender<'a, IO> {
     pgb: &'a mut PostgresBackend<IO>,
@@ -480,14 +506,12 @@ struct WalSender<'a, IO> {
     // We send this LSN to the receiver as wal_end, so that it knows how much
     // WAL this safekeeper has. This LSN should be as fresh as possible.
     end_pos: Lsn,
-    // If present, terminate after reaching this position; used by walproposer
-    // in recovery.
-    stop_pos: Option<Lsn>,
     /// When streaming uncommitted part, the term the client acts as the leader
     /// in. Streaming is stopped if local term changes to a different (higher)
     /// value.
     term: Option<Term>,
-    commit_lsn_watch_rx: Receiver<Lsn>,
+    /// Watch channel receiver to learn end of available WAL (and wait for its advancement).
+    end_watch: EndWatch,
     ws_guard: Arc<WalSenderGuard>,
     wal_reader: WalReader,
     // buffer for readling WAL into to send it
@@ -497,29 +521,20 @@ struct WalSender<'a, IO> {
 impl<IO: AsyncRead + AsyncWrite + Unpin> WalSender<'_, IO> {
     /// Send WAL until
     /// - an error occurs
-    /// - if we are streaming to walproposer, we've streamed until stop_pos
-    ///   (recovery finished)
-    /// - receiver is caughtup and there is no computes
+    /// - receiver is caughtup and there is no computes (if streaming up to commit_lsn)
     ///
     /// Err(CopyStreamHandlerEnd) is always returned; Result is used only for ?
     /// convenience.
     async fn run(&mut self) -> Result<(), CopyStreamHandlerEnd> {
         loop {
-            // If we are streaming to walproposer, check it is time to stop.
-            if let Some(stop_pos) = self.stop_pos {
-                if self.start_pos >= stop_pos {
-                    // recovery finished
-                    return Err(CopyStreamHandlerEnd::ServerInitiated(format!(
-                        "ending streaming to walproposer at {}, recovery finished",
-                        self.start_pos
-                    )));
-                }
-            } else {
-                // Wait for the next portion if it is not there yet, or just
-                // update our end of WAL available for sending value, we
-                // communicate it to the receiver.
-                self.wait_wal().await?;
-            }
+            // Wait for the next portion if it is not there yet, or just
+            // update our end of WAL available for sending value, we
+            // communicate it to the receiver.
+            self.wait_wal().await?;
+            assert!(
+                self.end_pos > self.start_pos,
+                "nothing to send after waiting for WAL"
+            );
 
             // try to send as much as available, capped by MAX_SEND_SIZE
             let mut send_size = self
@@ -567,7 +582,7 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> WalSender<'_, IO> {
     /// exit in the meanwhile
     async fn wait_wal(&mut self) -> Result<(), CopyStreamHandlerEnd> {
         loop {
-            self.end_pos = *self.commit_lsn_watch_rx.borrow();
+            self.end_pos = self.end_watch.get();
             if self.end_pos > self.start_pos {
                 // We have something to send.
                 trace!("got end_pos {:?}, streaming", self.end_pos);
@@ -575,27 +590,31 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> WalSender<'_, IO> {
             }
 
             // Wait for WAL to appear, now self.end_pos == self.start_pos.
-            if let Some(lsn) = wait_for_lsn(&mut self.commit_lsn_watch_rx, self.start_pos).await? {
+            if let Some(lsn) = wait_for_lsn(&mut self.end_watch, self.term, self.start_pos).await? {
                 self.end_pos = lsn;
                 trace!("got end_pos {:?}, streaming", self.end_pos);
                 return Ok(());
             }
 
-            // Timed out waiting for WAL, check for termination and send KA
-            if let Some(remote_consistent_lsn) = self
-                .ws_guard
-                .walsenders
-                .get_ws_remote_consistent_lsn(self.ws_guard.id)
-            {
-                if self.tli.should_walsender_stop(remote_consistent_lsn).await {
-                    // Terminate if there is nothing more to send.
-                    // Note that "ending streaming" part of the string is used by
-                    // pageserver to identify WalReceiverError::SuccessfulCompletion,
-                    // do not change this string without updating pageserver.
-                    return Err(CopyStreamHandlerEnd::ServerInitiated(format!(
+            // Timed out waiting for WAL, check for termination and send KA.
+            // Check for termination only if we are streaming up to commit_lsn
+            // (to pageserver).
+            if let EndWatch::Commit(_) = self.end_watch {
+                if let Some(remote_consistent_lsn) = self
+                    .ws_guard
+                    .walsenders
+                    .get_ws_remote_consistent_lsn(self.ws_guard.id)
+                {
+                    if self.tli.should_walsender_stop(remote_consistent_lsn).await {
+                        // Terminate if there is nothing more to send.
+                        // Note that "ending streaming" part of the string is used by
+                        // pageserver to identify WalReceiverError::SuccessfulCompletion,
+                        // do not change this string without updating pageserver.
+                        return Err(CopyStreamHandlerEnd::ServerInitiated(format!(
                         "ending streaming to {:?} at {}, receiver is caughtup and there is no computes",
                         self.appname, self.start_pos,
                     )));
+                    }
                 }
             }
 
@@ -663,22 +682,32 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> ReplyReader<IO> {
 
 const POLL_STATE_TIMEOUT: Duration = Duration::from_secs(1);
 
-/// Wait until we have commit_lsn > lsn or timeout expires. Returns
-/// - Ok(Some(commit_lsn)) if needed lsn is successfully observed;
+/// Wait until we have available WAL > start_pos or timeout expires. Returns
+/// - Ok(Some(end_pos)) if needed lsn is successfully observed;
 /// - Ok(None) if timeout expired;
-/// - Err in case of error (if watch channel is in trouble, shouldn't happen).
-async fn wait_for_lsn(rx: &mut Receiver<Lsn>, lsn: Lsn) -> anyhow::Result<Option<Lsn>> {
+/// - Err in case of error -- only if 1) term changed while fetching in recovery
+///   mode 2) watch channel closed, which must never happen.
+async fn wait_for_lsn(
+    rx: &mut EndWatch,
+    client_term: Option<Term>,
+    start_pos: Lsn,
+) -> anyhow::Result<Option<Lsn>> {
     let res = timeout(POLL_STATE_TIMEOUT, async move {
-        let mut commit_lsn;
         loop {
-            rx.changed().await?;
-            commit_lsn = *rx.borrow();
-            if commit_lsn > lsn {
-                break;
+            let end_pos = rx.get();
+            if end_pos > start_pos {
+                return Ok(end_pos);
             }
+            if let EndWatch::Flush(rx) = rx {
+                let curr_term = rx.borrow().term;
+                if let Some(client_term) = client_term {
+                    if curr_term != client_term {
+                        bail!("term changed: requested {}, now {}", client_term, curr_term);
+                    }
+                }
+            }
+            rx.changed().await?;
         }
-
-        Ok(commit_lsn)
     })
     .await;
 

safekeeper/src/timeline.rs

@@ -3,8 +3,11 @@
 
 use anyhow::{anyhow, bail, Result};
 use postgres_ffi::XLogSegNo;
+use serde::{Deserialize, Serialize};
+use serde_with::serde_as;
 use tokio::fs;
 
+use serde_with::DisplayFromStr;
 use std::cmp::max;
 use std::path::PathBuf;
 use std::sync::Arc;
@@ -24,9 +27,10 @@ use storage_broker::proto::SafekeeperTimelineInfo;
 use storage_broker::proto::TenantTimelineId as ProtoTenantTimelineId;
 
 use crate::receive_wal::WalReceivers;
+use crate::recovery::recovery_main;
 use crate::safekeeper::{
     AcceptorProposerMessage, ProposerAcceptorMessage, SafeKeeper, SafeKeeperState,
-    SafekeeperMemState, ServerInfo, Term,
+    SafekeeperMemState, ServerInfo, Term, TermLsn, INVALID_TERM,
 };
 use crate::send_wal::WalSenders;
 use crate::{control_file, safekeeper::UNKNOWN_SERVER_VERSION};
@@ -37,18 +41,25 @@ use crate::SafeKeeperConf;
 use crate::{debug_dump, wal_storage};
 
 /// Things safekeeper should know about timeline state on peers.
-#[derive(Debug, Clone)]
+#[serde_as]
+#[derive(Debug, Clone, Serialize, Deserialize)]
 pub struct PeerInfo {
     pub sk_id: NodeId,
     /// Term of the last entry.
     _last_log_term: Term,
     /// LSN of the last record.
+    #[serde_as(as = "DisplayFromStr")]
     _flush_lsn: Lsn,
+    #[serde_as(as = "DisplayFromStr")]
     pub commit_lsn: Lsn,
     /// Since which LSN safekeeper has WAL. TODO: remove this once we fill new
     /// sk since backup_lsn.
+    #[serde_as(as = "DisplayFromStr")]
     pub local_start_lsn: Lsn,
-    /// When info was received.
+    /// When info was received. Serde annotations are not very useful but make
+    /// the code compile -- we don't rely on this field externally.
+    #[serde(skip)]
+    #[serde(default = "Instant::now")]
     ts: Instant,
 }
 
@@ -237,8 +248,9 @@ impl SharedState {
                 tenant_id: ttid.tenant_id.as_ref().to_owned(),
                 timeline_id: ttid.timeline_id.as_ref().to_owned(),
             }),
+            term: self.sk.state.acceptor_state.term,
             last_log_term: self.sk.get_epoch(),
-            flush_lsn: self.sk.wal_store.flush_lsn().0,
+            flush_lsn: self.sk.flush_lsn().0,
             // note: this value is not flushed to control file yet and can be lost
             commit_lsn: self.sk.inmem.commit_lsn.0,
             remote_consistent_lsn: remote_consistent_lsn.0,
@@ -247,6 +259,7 @@ impl SharedState {
                 .advertise_pg_addr
                 .to_owned()
                 .unwrap_or(conf.listen_pg_addr.clone()),
+            http_connstr: conf.listen_http_addr.to_owned(),
             backup_lsn: self.sk.inmem.backup_lsn.0,
             local_start_lsn: self.sk.state.local_start_lsn.0,
             availability_zone: conf.availability_zone.clone(),
@@ -296,6 +309,13 @@ pub struct Timeline {
     commit_lsn_watch_tx: watch::Sender<Lsn>,
     commit_lsn_watch_rx: watch::Receiver<Lsn>,
 
+    /// Broadcasts (current term, flush_lsn) updates, walsender is interested in
+    /// them when sending in recovery mode (to walproposer or peers). Note: this
+    /// is just a notification, WAL reading should always done with lock held as
+    /// term can change otherwise.
+    term_flush_lsn_watch_tx: watch::Sender<TermLsn>,
+    term_flush_lsn_watch_rx: watch::Receiver<TermLsn>,
+
     /// Safekeeper and other state, that should remain consistent and
     /// synchronized with the disk. This is tokio mutex as we write WAL to disk
     /// while holding it, ensuring that consensus checks are in order.
@@ -317,16 +337,20 @@ pub struct Timeline {
 impl Timeline {
     /// Load existing timeline from disk.
     pub fn load_timeline(
-        conf: SafeKeeperConf,
+        conf: &SafeKeeperConf,
         ttid: TenantTimelineId,
         wal_backup_launcher_tx: Sender<TenantTimelineId>,
     ) -> Result<Timeline> {
         let _enter = info_span!("load_timeline", timeline = %ttid.timeline_id).entered();
 
-        let shared_state = SharedState::restore(&conf, &ttid)?;
+        let shared_state = SharedState::restore(conf, &ttid)?;
         let rcl = shared_state.sk.state.remote_consistent_lsn;
         let (commit_lsn_watch_tx, commit_lsn_watch_rx) =
             watch::channel(shared_state.sk.state.commit_lsn);
+        let (term_flush_lsn_watch_tx, term_flush_lsn_watch_rx) = watch::channel(TermLsn::from((
+            shared_state.sk.get_term(),
+            shared_state.sk.flush_lsn(),
+        )));
         let (cancellation_tx, cancellation_rx) = watch::channel(false);
 
         Ok(Timeline {
@@ -334,6 +358,8 @@ impl Timeline {
             wal_backup_launcher_tx,
             commit_lsn_watch_tx,
             commit_lsn_watch_rx,
+            term_flush_lsn_watch_tx,
+            term_flush_lsn_watch_rx,
             mutex: Mutex::new(shared_state),
             walsenders: WalSenders::new(rcl),
             walreceivers: WalReceivers::new(),
@@ -345,7 +371,7 @@ impl Timeline {
 
     /// Create a new timeline, which is not yet persisted to disk.
     pub fn create_empty(
-        conf: SafeKeeperConf,
+        conf: &SafeKeeperConf,
         ttid: TenantTimelineId,
         wal_backup_launcher_tx: Sender<TenantTimelineId>,
         server_info: ServerInfo,
@@ -353,6 +379,8 @@ impl Timeline {
         local_start_lsn: Lsn,
     ) -> Result<Timeline> {
         let (commit_lsn_watch_tx, commit_lsn_watch_rx) = watch::channel(Lsn::INVALID);
+        let (term_flush_lsn_watch_tx, term_flush_lsn_watch_rx) =
+            watch::channel(TermLsn::from((INVALID_TERM, Lsn::INVALID)));
         let (cancellation_tx, cancellation_rx) = watch::channel(false);
         let state = SafeKeeperState::new(&ttid, server_info, vec![], commit_lsn, local_start_lsn);
 
@@ -361,7 +389,9 @@ impl Timeline {
             wal_backup_launcher_tx,
             commit_lsn_watch_tx,
             commit_lsn_watch_rx,
-            mutex: Mutex::new(SharedState::create_new(&conf, &ttid, state)?),
+            term_flush_lsn_watch_tx,
+            term_flush_lsn_watch_rx,
+            mutex: Mutex::new(SharedState::create_new(conf, &ttid, state)?),
             walsenders: WalSenders::new(Lsn(0)),
             walreceivers: WalReceivers::new(),
             cancellation_rx,
@@ -370,12 +400,16 @@ impl Timeline {
         })
     }
 
-    /// Initialize fresh timeline on disk and start background tasks. If bootstrap
+    /// Initialize fresh timeline on disk and start background tasks. If init
     /// fails, timeline is cancelled and cannot be used anymore.
     ///
-    /// Bootstrap is transactional, so if it fails, created files will be deleted,
+    /// Init is transactional, so if it fails, created files will be deleted,
     /// and state on disk should remain unchanged.
-    pub async fn bootstrap(&self, shared_state: &mut MutexGuard<'_, SharedState>) -> Result<()> {
+    pub async fn init_new(
+        self: &Arc<Timeline>,
+        shared_state: &mut MutexGuard<'_, SharedState>,
+        conf: &SafeKeeperConf,
+    ) -> Result<()> {
         match fs::metadata(&self.timeline_dir).await {
             Ok(_) => {
                 // Timeline directory exists on disk, we should leave state unchanged
@@ -391,7 +425,7 @@ impl Timeline {
         // Create timeline directory.
         fs::create_dir_all(&self.timeline_dir).await?;
 
-        // Write timeline to disk and TODO: start background tasks.
+        // Write timeline to disk and start background tasks.
         if let Err(e) = shared_state.sk.persist().await {
             // Bootstrap failed, cancel timeline and remove timeline directory.
             self.cancel(shared_state);
@@ -405,12 +439,16 @@ impl Timeline {
 
             return Err(e);
         }
-
-        // TODO: add more initialization steps here
-        self.update_status(shared_state);
+        self.bootstrap(conf);
         Ok(())
     }
 
+    /// Bootstrap new or existing timeline starting background stasks.
+    pub fn bootstrap(self: &Arc<Timeline>, conf: &SafeKeeperConf) {
+        // Start recovery task which always runs on the timeline.
+        tokio::spawn(recovery_main(self.clone(), conf.clone()));
+    }
+
     /// Delete timeline from disk completely, by removing timeline directory. Background
     /// timeline activities will stop eventually.
     pub async fn delete_from_disk(
@@ -444,6 +482,16 @@ impl Timeline {
         *self.cancellation_rx.borrow()
     }
 
+    /// Returns watch channel which gets value when timeline is cancelled. It is
+    /// guaranteed to have not cancelled value observed (errors otherwise).
+    pub fn get_cancellation_rx(&self) -> Result<watch::Receiver<bool>> {
+        let rx = self.cancellation_rx.clone();
+        if *rx.borrow() {
+            bail!(TimelineError::Cancelled(self.ttid));
+        }
+        Ok(rx)
+    }
+
     /// Take a writing mutual exclusive lock on timeline shared_state.
     pub async fn write_shared_state(&self) -> MutexGuard<SharedState> {
         self.mutex.lock().await
@@ -520,6 +568,11 @@ impl Timeline {
         self.commit_lsn_watch_rx.clone()
     }
 
+    /// Returns term_flush_lsn watch channel.
+    pub fn get_term_flush_lsn_watch_rx(&self) -> watch::Receiver<TermLsn> {
+        self.term_flush_lsn_watch_rx.clone()
+    }
+
     /// Pass arrived message to the safekeeper.
     pub async fn process_msg(
         &self,
@@ -531,6 +584,7 @@ impl Timeline {
 
         let mut rmsg: Option<AcceptorProposerMessage>;
         let commit_lsn: Lsn;
+        let term_flush_lsn: TermLsn;
         {
             let mut shared_state = self.write_shared_state().await;
             rmsg = shared_state.sk.process_msg(msg).await?;
@@ -544,8 +598,11 @@ impl Timeline {
             }
 
             commit_lsn = shared_state.sk.inmem.commit_lsn;
+            term_flush_lsn =
+                TermLsn::from((shared_state.sk.get_term(), shared_state.sk.flush_lsn()));
         }
         self.commit_lsn_watch_tx.send(commit_lsn)?;
+        self.term_flush_lsn_watch_tx.send(term_flush_lsn)?;
         Ok(rmsg)
     }
 

safekeeper/src/timelines_global_map.rs

@@ -11,7 +11,7 @@ use serde::Serialize;
 use std::collections::HashMap;
 use std::path::PathBuf;
 use std::str::FromStr;
-use std::sync::{Arc, Mutex, MutexGuard};
+use std::sync::{Arc, Mutex};
 use tokio::sync::mpsc::Sender;
 use tracing::*;
 use utils::id::{TenantId, TenantTimelineId, TimelineId};
@@ -71,19 +71,23 @@ pub struct GlobalTimelines;
 
 impl GlobalTimelines {
     /// Inject dependencies needed for the timeline constructors and load all timelines to memory.
-    pub fn init(
+    pub async fn init(
         conf: SafeKeeperConf,
         wal_backup_launcher_tx: Sender<TenantTimelineId>,
     ) -> Result<()> {
-        let mut state = TIMELINES_STATE.lock().unwrap();
-        assert!(state.wal_backup_launcher_tx.is_none());
-        state.wal_backup_launcher_tx = Some(wal_backup_launcher_tx);
-        state.conf = Some(conf);
+        // clippy isn't smart enough to understand that drop(state) releases the
+        // lock, so use explicit block
+        let tenants_dir = {
+            let mut state = TIMELINES_STATE.lock().unwrap();
+            assert!(state.wal_backup_launcher_tx.is_none());
+            state.wal_backup_launcher_tx = Some(wal_backup_launcher_tx);
+            state.conf = Some(conf);
 
-        // Iterate through all directories and load tenants for all directories
-        // named as a valid tenant_id.
+            // Iterate through all directories and load tenants for all directories
+            // named as a valid tenant_id.
+            state.get_conf().workdir.clone()
+        };
         let mut tenant_count = 0;
-        let tenants_dir = state.get_conf().workdir.clone();
         for tenants_dir_entry in std::fs::read_dir(&tenants_dir)
             .with_context(|| format!("failed to list tenants dir {}", tenants_dir.display()))?
         {
@@ -93,7 +97,7 @@ impl GlobalTimelines {
                         TenantId::from_str(tenants_dir_entry.file_name().to_str().unwrap_or(""))
                     {
                         tenant_count += 1;
-                        GlobalTimelines::load_tenant_timelines(&mut state, tenant_id)?;
+                        GlobalTimelines::load_tenant_timelines(tenant_id).await?;
                     }
                 }
                 Err(e) => error!(
@@ -108,7 +112,7 @@ impl GlobalTimelines {
         info!(
             "found {} tenants directories, successfully loaded {} timelines",
             tenant_count,
-            state.timelines.len()
+            TIMELINES_STATE.lock().unwrap().timelines.len()
         );
         Ok(())
     }
@@ -116,17 +120,21 @@ impl GlobalTimelines {
     /// Loads all timelines for the given tenant to memory. Returns fs::read_dir
     /// errors if any.
     ///
-    /// Note: This function (and all reading/loading below) is sync because
-    /// timelines are loaded while holding GlobalTimelinesState lock. Which is
-    /// fine as this is called only from single threaded main runtime on boot,
-    /// but clippy complains anyway, and suppressing that isn't trivial as async
-    /// is the keyword, ha. That only other user is pull_timeline.rs for which
-    /// being blocked is not that bad, and we can do spawn_blocking.
-    fn load_tenant_timelines(
-        state: &mut MutexGuard<'_, GlobalTimelinesState>,
-        tenant_id: TenantId,
-    ) -> Result<()> {
-        let timelines_dir = state.get_conf().tenant_dir(&tenant_id);
+    /// It is async for update_status_notify sake. Since TIMELINES_STATE lock is
+    /// sync and there is no important reason to make it async (it is always
+    /// held for a short while) we just lock and unlock it for each timeline --
+    /// this function is called during init when nothing else is running, so
+    /// this is fine.
+    async fn load_tenant_timelines(tenant_id: TenantId) -> Result<()> {
+        let (conf, wal_backup_launcher_tx) = {
+            let state = TIMELINES_STATE.lock().unwrap();
+            (
+                state.get_conf().clone(),
+                state.wal_backup_launcher_tx.as_ref().unwrap().clone(),
+            )
+        };
+
+        let timelines_dir = conf.tenant_dir(&tenant_id);
         for timelines_dir_entry in std::fs::read_dir(&timelines_dir)
             .with_context(|| format!("failed to list timelines dir {}", timelines_dir.display()))?
         {
@@ -136,13 +144,16 @@ impl GlobalTimelines {
                         TimelineId::from_str(timeline_dir_entry.file_name().to_str().unwrap_or(""))
                     {
                         let ttid = TenantTimelineId::new(tenant_id, timeline_id);
-                        match Timeline::load_timeline(
-                            state.get_conf().clone(),
-                            ttid,
-                            state.wal_backup_launcher_tx.as_ref().unwrap().clone(),
-                        ) {
+                        match Timeline::load_timeline(&conf, ttid, wal_backup_launcher_tx.clone()) {
                             Ok(timeline) => {
-                                state.timelines.insert(ttid, Arc::new(timeline));
+                                let tli = Arc::new(timeline);
+                                TIMELINES_STATE
+                                    .lock()
+                                    .unwrap()
+                                    .timelines
+                                    .insert(ttid, tli.clone());
+                                tli.bootstrap(&conf);
+                                tli.update_status_notify().await.unwrap();
                             }
                             // If we can't load a timeline, it's most likely because of a corrupted
                             // directory. We will log an error and won't allow to delete/recreate
@@ -168,18 +179,22 @@ impl GlobalTimelines {
     }
 
     /// Load timeline from disk to the memory.
-    pub fn load_timeline(ttid: TenantTimelineId) -> Result<Arc<Timeline>> {
+    pub async fn load_timeline(ttid: TenantTimelineId) -> Result<Arc<Timeline>> {
         let (conf, wal_backup_launcher_tx) = TIMELINES_STATE.lock().unwrap().get_dependencies();
 
-        match Timeline::load_timeline(conf, ttid, wal_backup_launcher_tx) {
+        match Timeline::load_timeline(&conf, ttid, wal_backup_launcher_tx) {
             Ok(timeline) => {
                 let tli = Arc::new(timeline);
+
                 // TODO: prevent concurrent timeline creation/loading
                 TIMELINES_STATE
                     .lock()
                     .unwrap()
                     .timelines
                     .insert(ttid, tli.clone());
+
+                tli.bootstrap(&conf);
+
                 Ok(tli)
             }
             // If we can't load a timeline, it's bad. Caller will figure it out.
@@ -217,7 +232,7 @@ impl GlobalTimelines {
         info!("creating new timeline {}", ttid);
 
         let timeline = Arc::new(Timeline::create_empty(
-            conf,
+            &conf,
             ttid,
             wal_backup_launcher_tx,
             server_info,
@@ -240,23 +255,24 @@ impl GlobalTimelines {
             // Write the new timeline to the disk and start background workers.
             // Bootstrap is transactional, so if it fails, the timeline will be deleted,
             // and the state on disk should remain unchanged.
-            if let Err(e) = timeline.bootstrap(&mut shared_state).await {
-                // Note: the most likely reason for bootstrap failure is that the timeline
+            if let Err(e) = timeline.init_new(&mut shared_state, &conf).await {
+                // Note: the most likely reason for init failure is that the timeline
                 // directory already exists on disk. This happens when timeline is corrupted
                 // and wasn't loaded from disk on startup because of that. We want to preserve
                 // the timeline directory in this case, for further inspection.
 
                 // TODO: this is an unusual error, perhaps we should send it to sentry
                 // TODO: compute will try to create timeline every second, we should add backoff
-                error!("failed to bootstrap timeline {}: {}", ttid, e);
+                error!("failed to init new timeline {}: {}", ttid, e);
 
-                // Timeline failed to bootstrap, it cannot be used. Remove it from the map.
+                // Timeline failed to init, it cannot be used. Remove it from the map.
                 TIMELINES_STATE.lock().unwrap().timelines.remove(&ttid);
                 return Err(e);
             }
             // We are done with bootstrap, release the lock, return the timeline.
             // {} block forces release before .await
         }
+        timeline.update_status_notify().await?;
         timeline.wal_backup_launcher_tx.send(timeline.ttid).await?;
         Ok(timeline)
     }

scripts/flaky_tests.py

@@ -12,25 +12,26 @@ import psycopg2.extras
 # We call the test "flaky" if it failed at least once on the main branch in the last N=10 days.
 FLAKY_TESTS_QUERY = """
     SELECT
-        DISTINCT parent_suite, suite, test
+        DISTINCT parent_suite, suite, REGEXP_REPLACE(test, '(release|debug)-pg(\\d+)-?', '') as deparametrized_test
     FROM
         (
             SELECT
-                revision,
-                jsonb_array_elements(data -> 'children') -> 'name' as parent_suite,
-                jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'name' as suite,
-                jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'name' as test,
-                jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'status' as status,
-                jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'retriesStatusChange' as retries_status_change,
-                to_timestamp((jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'time' -> 'start')::bigint / 1000)::date as timestamp
+                reference,
+                jsonb_array_elements(data -> 'children') ->> 'name' as parent_suite,
+                jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') ->> 'name' as suite,
+                jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'name' as test,
+                jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'status' as status,
+                jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'retriesStatusChange' as retries_status_change,
+                to_timestamp((jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'time' ->> 'start')::bigint / 1000)::date as timestamp
             FROM
                 regress_test_results
-            WHERE
-                reference = 'refs/heads/main'
         ) data
     WHERE
         timestamp > CURRENT_DATE - INTERVAL '%s' day
-        AND (status::text IN ('"failed"', '"broken"') OR retries_status_change::boolean)
+        AND (
+            (status IN ('failed', 'broken') AND reference = 'refs/heads/main')
+            OR retries_status_change::boolean
+        )
     ;
 """
 
@@ -40,6 +41,9 @@ def main(args: argparse.Namespace):
     interval_days = args.days
     output = args.output
 
+    build_type = args.build_type
+    pg_version = args.pg_version
+
     res: DefaultDict[str, DefaultDict[str, Dict[str, bool]]]
     res = defaultdict(lambda: defaultdict(dict))
 
@@ -55,8 +59,21 @@ def main(args: argparse.Namespace):
         rows = []
 
     for row in rows:
-        logging.info(f"\t{row['parent_suite'].replace('.', '/')}/{row['suite']}.py::{row['test']}")
-        res[row["parent_suite"]][row["suite"]][row["test"]] = True
+        # We don't want to automatically rerun tests in a performance suite
+        if row["parent_suite"] != "test_runner.regress":
+            continue
+
+        deparametrized_test = row["deparametrized_test"]
+        dash_if_needed = "" if deparametrized_test.endswith("[]") else "-"
+        parametrized_test = deparametrized_test.replace(
+            "[",
+            f"[{build_type}-pg{pg_version}{dash_if_needed}",
+        )
+        res[row["parent_suite"]][row["suite"]][parametrized_test] = True
+
+        logging.info(
+            f"\t{row['parent_suite'].replace('.', '/')}/{row['suite']}.py::{parametrized_test}"
+        )
 
     logging.info(f"saving results to {output.name}")
     json.dump(res, output, indent=2)
@@ -77,6 +94,18 @@ if __name__ == "__main__":
         type=int,
         help="how many days to look back for flaky tests (default: 10)",
     )
+    parser.add_argument(
+        "--build-type",
+        required=True,
+        type=str,
+        help="for which build type to create list of flaky tests (debug or release)",
+    )
+    parser.add_argument(
+        "--pg-version",
+        required=True,
+        type=int,
+        help="for which Postgres version to create list of flaky tests (14, 15, etc.)",
+    )
     parser.add_argument(
         "connstr",
         help="connection string to the test results database",

storage_broker/benches/rps.rs

@@ -125,6 +125,7 @@ async fn publish(client: Option<BrokerClientChannel>, n_keys: u64) {
                     tenant_id: vec![0xFF; 16],
                     timeline_id: tli_from_u64(counter % n_keys),
                 }),
+                term: 0,
                 last_log_term: 0,
                 flush_lsn: counter,
                 commit_lsn: 2,
@@ -132,6 +133,7 @@ async fn publish(client: Option<BrokerClientChannel>, n_keys: u64) {
                 remote_consistent_lsn: 4,
                 peer_horizon_lsn: 5,
                 safekeeper_connstr: "zenith-1-sk-1.local:7676".to_owned(),
+                http_connstr: "zenith-1-sk-1.local:7677".to_owned(),
                 local_start_lsn: 0,
                 availability_zone: None,
             };

storage_broker/proto/broker.proto

@@ -22,6 +22,8 @@ message SubscribeSafekeeperInfoRequest {
 message SafekeeperTimelineInfo {
     uint64 safekeeper_id = 1;
     TenantTimelineId tenant_timeline_id = 2;
+    // Safekeeper term
+    uint64 term = 12;
     // Term of the last entry.
     uint64 last_log_term = 3;
     // LSN of the last record.
@@ -36,6 +38,8 @@ message SafekeeperTimelineInfo {
     uint64 local_start_lsn = 9;
     // A connection string to use for WAL receiving.
     string safekeeper_connstr = 10;
+    // HTTP endpoint connection string
+    string http_connstr = 13;
     // Availability zone of a safekeeper.
     optional string availability_zone = 11;
 }

storage_broker/src/bin/storage_broker.rs

@@ -519,6 +519,7 @@ mod tests {
                 tenant_id: vec![0x00; 16],
                 timeline_id,
             }),
+            term: 0,
             last_log_term: 0,
             flush_lsn: 1,
             commit_lsn: 2,
@@ -526,6 +527,7 @@ mod tests {
             remote_consistent_lsn: 4,
             peer_horizon_lsn: 5,
             safekeeper_connstr: "neon-1-sk-1.local:7676".to_owned(),
+            http_connstr: "neon-1-sk-1.local:7677".to_owned(),
             local_start_lsn: 0,
             availability_zone: None,
         }

test_runner/fixtures/neon_fixtures.py

@@ -1524,7 +1524,7 @@ class NeonPageserver(PgProtocol):
             ".*wait for layer upload ops to complete.*",  # .*Caused by:.*wait_completion aborted because upload queue was stopped
             ".*gc_loop.*Gc failed, retrying in.*timeline is Stopping",  # When gc checks timeline state after acquiring layer_removal_cs
             ".*gc_loop.*Gc failed, retrying in.*: Cannot run GC iteration on inactive tenant",  # Tenant::gc precondition
-            ".*compaction_loop.*Compaction failed, retrying in.*timeline or pageserver is shutting down",  # When compaction checks timeline state after acquiring layer_removal_cs
+            ".*compaction_loop.*Compaction failed, retrying in.*timeline is Stopping",  # When compaction checks timeline state after acquiring layer_removal_cs
             ".*query handler for 'pagestream.*failed: Timeline .* was not found",  # postgres reconnects while timeline_delete doesn't hold the tenant's timelines.lock()
             ".*query handler for 'pagestream.*failed: Timeline .* is not active",  # timeline delete in progress
             ".*task iteration took longer than the configured period.*",

test_runner/fixtures/pageserver/utils.py

@@ -233,10 +233,19 @@ if TYPE_CHECKING:
 
 def assert_prefix_empty(neon_env_builder: "NeonEnvBuilder", prefix: Optional[str] = None):
     response = list_prefix(neon_env_builder, prefix)
-    objects = response.get("Contents")
-    assert (
-        response["KeyCount"] == 0
-    ), f"remote dir with prefix {prefix} is not empty after deletion: {objects}"
+    keys = response["KeyCount"]
+    objects = response.get("Contents", [])
+
+    if keys != 0 and len(objects) == 0:
+        # this has been seen in one case with mock_s3:
+        # https://neon-github-public-dev.s3.amazonaws.com/reports/pr-4938/6000769714/index.html#suites/3556ed71f2d69272a7014df6dcb02317/ca01e4f4d8d9a11f
+        # looking at moto impl, it might be there's a race with common prefix (sub directory) not going away with deletes
+        common_prefixes = response.get("CommonPrefixes", [])
+        log.warn(
+            f"contradicting ListObjectsV2 response with KeyCount={keys} and Contents={objects}, CommonPrefixes={common_prefixes}"
+        )
+
+    assert keys == 0, f"remote dir with prefix {prefix} is not empty after deletion: {objects}"
 
 
 def assert_prefix_not_empty(neon_env_builder: "NeonEnvBuilder", prefix: Optional[str] = None):

test_runner/performance/test_pageserver_startup_many_tenants.py

@@ -0,0 +1,32 @@
+import queue
+import threading
+from fixtures.neon_fixtures import NeonEnvBuilder, PgBin, wait_for_last_flush_lsn
+from fixtures.types import TenantId
+
+
+def test_pageserver_startup_many_tenants(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
+    env = neon_env_builder.init_start()
+
+    #  below doesn't work because summaries contain tenant and timeline ids and we check for them
+
+    tenant_id, timeline_id = env.initial_tenant, env.initial_timeline
+    pshttp = env.pageserver.http_client()
+    ep = env.endpoints.create_start("main")
+    ep.safe_psql("create table foo(b text)")
+    for i in range(0, 8):
+        ep.safe_psql("insert into foo(b) values ('some text')")
+        # pg_bin.run_capture(["pgbench", "-i", "-s1", ep.connstr()])
+        wait_for_last_flush_lsn(env, ep, tenant_id, timeline_id)
+        pshttp.timeline_checkpoint(tenant_id, timeline_id)
+    ep.stop_and_destroy()
+
+    env.pageserver.stop()
+    for sk in env.safekeepers:
+        sk.stop()
+
+    tenant_dir = env.repo_dir / "tenants" / str(env.initial_tenant)
+
+    for i in range(0, 20_000):
+        import shutil
+
+        shutil.copytree(tenant_dir, tenant_dir.parent / str(TenantId.generate()))

test_runner/regress/test_attach_tenant_config.py

@@ -22,7 +22,7 @@ def positive_env(neon_env_builder: NeonEnvBuilder) -> NeonEnv:
 
     # eviction might be the first one after an attach to access the layers
     env.pageserver.allowed_errors.append(
-        ".*unexpectedly on-demand downloading remote layer .* for task kind Eviction"
+        ".*unexpectedly on-demand downloading remote layer remote.* for task kind Eviction"
     )
     assert isinstance(env.remote_storage, LocalFsStorage)
     return env

test_runner/regress/test_broken_timeline.py

@@ -15,7 +15,7 @@ def test_broken_timeline(neon_env_builder: NeonEnvBuilder):
 
     env.pageserver.allowed_errors.extend(
         [
-            ".*layer loading failed:.*",
+            ".*Failed to load delta layer.*",
             ".*could not find data for key.*",
             ".*is not active. Current state: Broken.*",
             ".*will not become active. Current state: Broken.*",
@@ -99,7 +99,7 @@ def test_broken_timeline(neon_env_builder: NeonEnvBuilder):
     # Third timeline will also fail during basebackup, because the layer file is corrupt.
     # It will fail when we try to read (and reconstruct) a page from it, ergo the error message.
     # (We don't check layer file contents on startup, when loading the timeline)
-    with pytest.raises(Exception, match="layer loading failed:") as err:
+    with pytest.raises(Exception, match="Failed to load delta layer") as err:
         pg3.start()
     log.info(
         f"As expected, compute startup failed for timeline {tenant3}/{timeline3} with corrupt layers: {err}"

test_runner/regress/test_duplicate_layers.py

@@ -2,137 +2,35 @@ import time
 
 import pytest
 from fixtures.neon_fixtures import NeonEnvBuilder, PgBin
-from fixtures.pageserver.utils import wait_for_upload_queue_empty
-from fixtures.remote_storage import LocalFsStorage, RemoteStorageKind
-from requests.exceptions import ConnectionError
 
 
+# Test duplicate layer detection
+#
+# This test sets fail point at the end of first compaction phase:
+# after flushing new L1 layers but before deletion of L0 layers
+# it should cause generation of duplicate L1 layer by compaction after restart.
 @pytest.mark.timeout(600)
-def test_compaction_duplicates_all(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
-    """
-    Makes compact_level0_phase1 return input layers as the output layers with a
-    failpoint as if those L0 inputs would had all been recreated when L1s were
-    supposed to be created.
-    """
-    neon_env_builder.enable_remote_storage(
-        remote_storage_kind=RemoteStorageKind.LOCAL_FS,
-        test_name="test_compaction_duplicates_all",
-    )
+def test_duplicate_layers(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
+    env = neon_env_builder.init_start()
+    pageserver_http = env.pageserver.http_client()
 
-    env = neon_env_builder.init_start(
-        initial_tenant_conf={
+    # Use aggressive compaction and checkpoint settings
+    tenant_id, _ = env.neon_cli.create_tenant(
+        conf={
             "checkpoint_distance": f"{1024 ** 2}",
             "compaction_target_size": f"{1024 ** 2}",
-            "compaction_period": "0 s",
+            "compaction_period": "5 s",
             "compaction_threshold": "3",
         }
     )
-    pageserver_http = env.pageserver.http_client()
-
-    tenant_id, timeline_id = env.initial_tenant, env.initial_timeline
 
     pageserver_http.configure_failpoints(("compact-level0-phase1-return-same", "return"))
-    # pageserver_http.configure_failpoints(("after-timeline-compacted-first-L1", "exit"))
 
     endpoint = env.endpoints.create_start("main", tenant_id=tenant_id)
     connstr = endpoint.connstr(options="-csynchronous_commit=off")
     pg_bin.run_capture(["pgbench", "-i", "-s1", connstr])
 
-    pageserver_http.timeline_compact(tenant_id, timeline_id)
+    time.sleep(10)  # let compaction to be performed
     assert env.pageserver.log_contains("compact-level0-phase1-return-same")
 
-
-def test_duplicate_layers(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
-    """
-    This test sets fail point at the end of first compaction phase:
-    after flushing new L1 layers but before deletion of L0 layers
-    it should cause generation of duplicate L1 layer by compaction after restart.
-    """
-    neon_env_builder.enable_remote_storage(
-        remote_storage_kind=RemoteStorageKind.LOCAL_FS,
-        test_name="test_duplicate_layers",
-    )
-
-    env = neon_env_builder.init_start(
-        initial_tenant_conf={
-            "checkpoint_distance": f"{1024 ** 2}",
-            "compaction_target_size": f"{1024 ** 2}",
-            "compaction_period": "0 s",
-            "compaction_threshold": "3",
-        }
-    )
-    pageserver_http = env.pageserver.http_client()
-
-    tenant_id, timeline_id = env.initial_tenant, env.initial_timeline
-
-    pageserver_http.configure_failpoints(("after-timeline-compacted-first-L1", "exit"))
-
-    endpoint = env.endpoints.create_start("main", tenant_id=tenant_id)
-    connstr = endpoint.connstr(options="-csynchronous_commit=off")
-    pg_bin.run_capture(["pgbench", "-i", "-s1", connstr])
-
-    with pytest.raises(ConnectionError, match="Remote end closed connection without response"):
-        pageserver_http.timeline_compact(tenant_id, timeline_id)
-
-    # pageserver has already exited at this point
-    env.pageserver.stop()
-
-    # now the duplicate L1 has been created, but is not yet uploaded
-    assert isinstance(env.remote_storage, LocalFsStorage)
-
-    # path = env.remote_storage.timeline_path(tenant_id, timeline_id)
-    l1_found = None
-    for path in env.timeline_dir(tenant_id, timeline_id).iterdir():
-        if path.name == "metadata" or path.name.startswith("ephemeral-"):
-            continue
-
-        if len(path.suffixes) > 0:
-            # temp files
-            continue
-
-        [key_range, lsn_range] = path.name.split("__", maxsplit=1)
-
-        if "-" not in lsn_range:
-            # image layer
-            continue
-
-        [key_start, key_end] = key_range.split("-", maxsplit=1)
-
-        if key_start == "0" * 36 and key_end == "F" * 36:
-            # L0
-            continue
-
-        assert l1_found is None, f"found multiple L1: {l1_found.name} and {path.name}"
-        l1_found = path
-
-    assert l1_found is not None, "failed to find L1 locally"
-    original_created_at = l1_found.stat()[8]
-
-    uploaded = env.remote_storage.timeline_path(tenant_id, timeline_id) / l1_found.name
-    assert not uploaded.exists(), "to-be-overwritten should not yet be uploaded"
-
-    # give room for fs timestamps
-    time.sleep(1)
-
-    env.pageserver.start()
-    warning = f".*duplicated L1 layer layer={l1_found.name}"
-    env.pageserver.allowed_errors.append(warning)
-
-    pageserver_http.timeline_compact(tenant_id, timeline_id)
-    # give time for log flush
-    time.sleep(1)
-
-    env.pageserver.log_contains(warning)
-
-    overwritten_at = l1_found.stat()[8]
-    assert original_created_at < overwritten_at, "expected the L1 to be overwritten"
-
-    wait_for_upload_queue_empty(pageserver_http, tenant_id, timeline_id)
-
-    uploaded_at = uploaded.stat()[8]
-    assert overwritten_at <= uploaded_at, "expected the L1 to finally be uploaded"
-
-    # why does compaction not wait for uploads? probably so that we can compact
-    # faster than we can upload in some cases.
-    #
-    # timeline_compact should wait for uploads as well
+    pg_bin.run_capture(["pgbench", "-P1", "-N", "-c5", "-T200", "-Mprepared", connstr])

test_runner/regress/test_layer_eviction.py

@@ -256,34 +256,34 @@ def test_gc_of_remote_layers(neon_env_builder: NeonEnvBuilder):
     ps_http.evict_all_layers(tenant_id, timeline_id)
 
     def ensure_resident_and_remote_size_metrics():
+        log.info("ensure that all the layers are gone")
         resident_layers = list(env.timeline_dir(tenant_id, timeline_id).glob("*-*_*"))
         # we have disabled all background loops, so, this should hold
-        assert len(resident_layers) == 0, "ensure that all the layers are gone"
+        assert len(resident_layers) == 0
 
         info = ps_http.layer_map_info(tenant_id, timeline_id)
         log.info("layer map dump: %s", info)
 
+        log.info("ensure that resident_physical_size metric is zero")
         resident_physical_size_metric = ps_http.get_timeline_metric(
             tenant_id, timeline_id, "pageserver_resident_physical_size"
         )
-        assert (
-            resident_physical_size_metric == 0
-        ), "ensure that resident_physical_size metric is zero"
+        assert resident_physical_size_metric == 0
+        log.info("ensure that resident_physical_size metric corresponds to layer map dump")
         assert resident_physical_size_metric == sum(
-            layer.layer_file_size or 0 for layer in info.historic_layers if not layer.remote
-        ), "ensure that resident_physical_size metric corresponds to layer map dump"
+            [layer.layer_file_size or 0 for layer in info.historic_layers if not layer.remote]
+        )
 
+        log.info("ensure that remote_physical_size metric matches layer map")
         remote_physical_size_metric = ps_http.get_timeline_metric(
             tenant_id, timeline_id, "pageserver_remote_physical_size"
         )
+        log.info("ensure that remote_physical_size metric corresponds to layer map dump")
         assert remote_physical_size_metric == sum(
             layer.layer_file_size or 0 for layer in info.historic_layers if layer.remote
-        ), "ensure that remote_physical_size metric corresponds to layer map dump"
+        )
 
     log.info("before runnning GC, ensure that remote_physical size is zero")
-    # leaving index_part.json upload from successful compaction out will show
-    # up here as a mismatch between remove_physical_size and summed up layermap
-    # size
     ensure_resident_and_remote_size_metrics()
 
     log.info("run GC")

test_runner/regress/test_ondemand_download.py

@@ -13,12 +13,13 @@ from fixtures.neon_fixtures import (
     last_flush_lsn_upload,
     wait_for_last_flush_lsn,
 )
-from fixtures.pageserver.http import PageserverHttpClient
+from fixtures.pageserver.http import PageserverApiException, PageserverHttpClient
 from fixtures.pageserver.utils import (
     assert_tenant_state,
     wait_for_last_record_lsn,
     wait_for_upload,
     wait_for_upload_queue_empty,
+    wait_until_tenant_state,
 )
 from fixtures.remote_storage import RemoteStorageKind, available_remote_storages
 from fixtures.types import Lsn
@@ -390,7 +391,7 @@ def test_download_remote_layers_api(
     env.pageserver.start(extra_env_vars={"FAILPOINTS": "remote-storage-download-pre-rename=return"})
     env.pageserver.allowed_errors.extend(
         [
-            ".*download failed: downloading evicted layer file failed.*",
+            f".*download_all_remote_layers.*{tenant_id}.*{timeline_id}.*layer download failed.*remote-storage-download-pre-rename failpoint",
             f".*initial size calculation.*{tenant_id}.*{timeline_id}.*Failed to calculate logical size",
         ]
     )
@@ -657,5 +658,62 @@ def test_compaction_downloads_on_demand_with_image_creation(
     assert dict(kinds_after) == {"Delta": 4, "Image": 1}
 
 
+@pytest.mark.parametrize("remote_storage_kind", [RemoteStorageKind.LOCAL_FS])
+def test_ondemand_download_failure_to_replace(
+    neon_env_builder: NeonEnvBuilder, remote_storage_kind: RemoteStorageKind
+):
+    """
+    Make sure that we fail on being unable to replace a RemoteLayer instead of for example livelocking.
+
+    See: https://github.com/neondatabase/neon/issues/3533
+    """
+
+    neon_env_builder.enable_remote_storage(
+        remote_storage_kind=remote_storage_kind,
+        test_name="test_ondemand_download_failure_to_replace",
+    )
+
+    # disable gc and compaction via default tenant config because config is lost while detaching
+    # so that compaction will not be the one to download the layer but the http handler is
+    neon_env_builder.pageserver_config_override = (
+        """tenant_config={gc_period = "0s", compaction_period = "0s"}"""
+    )
+
+    env = neon_env_builder.init_start()
+
+    tenant_id = env.initial_tenant
+    timeline_id = env.initial_timeline
+    assert timeline_id is not None
+
+    pageserver_http = env.pageserver.http_client()
+
+    # remove layers so that they will be redownloaded
+    pageserver_http.tenant_detach(tenant_id)
+    pageserver_http.tenant_attach(tenant_id)
+
+    wait_until_tenant_state(pageserver_http, tenant_id, "Active", 5)
+    pageserver_http.configure_failpoints(("layermap-replace-notfound", "return"))
+
+    # requesting details with non-incremental size should trigger a download of the only layer
+    # this will need to be adjusted if an index for logical sizes is ever implemented
+    with pytest.raises(PageserverApiException):
+        # PageserverApiException is expected because of the failpoint (timeline_detail building does something)
+        # ReadTimeout can happen on our busy CI, but it should not, because there is no more busylooping
+        # but should it be added back, we would wait for 15s here.
+        pageserver_http.timeline_detail(tenant_id, timeline_id, True, timeout=15)
+
+    actual_message = ".* ERROR .*layermap-replace-notfound"
+    assert env.pageserver.log_contains(actual_message) is not None
+    env.pageserver.allowed_errors.append(actual_message)
+
+    env.pageserver.allowed_errors.append(
+        ".* ERROR .*Error processing HTTP request: InternalServerError\\(get local timeline info"
+    )
+    # this might get to run and attempt on-demand, but not always
+    env.pageserver.allowed_errors.append(".* ERROR .*Task 'initial size calculation'")
+
+    # if the above returned, then we didn't have a livelock, and all is well
+
+
 def stringify(conf: Dict[str, Any]) -> Dict[str, str]:
     return dict(map(lambda x: (x[0], str(x[1])), conf.items()))

test_runner/regress/test_remote_storage.py

@@ -603,7 +603,7 @@ def test_timeline_deletion_with_files_stuck_in_upload_queue(
     log.info("sending delete request")
     checkpoint_allowed_to_fail.set()
     env.pageserver.allowed_errors.append(
-        ".* ERROR .*Error processing HTTP request: InternalServerError\\(The timeline or pageserver is shutting down"
+        ".* ERROR .*Error processing HTTP request: InternalServerError\\(timeline is Stopping"
     )
 
     # Generous timeout, because currently deletions can get blocked waiting for compaction
@@ -861,8 +861,10 @@ def test_compaction_delete_before_upload(
     # Ensure that this actually terminates
     wait_upload_queue_empty(client, tenant_id, timeline_id)
 
-    # fixed in #4938
-    assert not env.pageserver.log_contains(
+    # For now we are hitting this message.
+    # Maybe in the future the underlying race condition will be fixed,
+    # but until then, ensure that this message is hit instead.
+    assert env.pageserver.log_contains(
         "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more."
     )
 

test_runner/regress/test_tenant_detach.py

@@ -688,7 +688,7 @@ def test_ignored_tenant_stays_broken_without_metadata(
     # temporarily detached produces these errors in the pageserver log.
     env.pageserver.allowed_errors.append(f".*Tenant {tenant_id} not found.*")
     env.pageserver.allowed_errors.append(
-        f".*Tenant {tenant_id} will not become active\\. Current state: (Stopping|Broken).*"
+        f".*Tenant {tenant_id} will not become active\\. Current state: Broken.*"
     )
 
     # ignore the tenant and remove its metadata

test_runner/regress/test_tenants_with_remote_storage.py

@@ -239,7 +239,9 @@ def test_tenant_redownloads_truncated_file_on_startup(
 
     assert isinstance(env.remote_storage, LocalFsStorage)
 
-    env.pageserver.allowed_errors.append(".*removing local file .* because .*")
+    env.pageserver.allowed_errors.append(
+        ".*removing local file .* because it has unexpected length.*"
+    )
 
     # FIXME: Are these expected?
     env.pageserver.allowed_errors.append(

vm-cgconfig.conf

@@ -1,12 +0,0 @@
-# Configuration for cgroups in VM compute nodes
-group neon-postgres {
-    perm {
-        admin {
-            uid = vm-informant;
-        }
-        task {
-            gid = users;
-        }
-    }
-    memory {}
-}