mirror of
https://github.com/neondatabase/neon.git
synced 2026-02-16 09:00:38 +00:00
Compare commits
166 Commits
jcsp/gener
...
remove_rem
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
396e6a4b62 | ||
|
|
3295d6245a | ||
|
|
a4bfdd8013 | ||
|
|
cd869e5737 | ||
|
|
544136f13f | ||
|
|
1cbb7fccaa | ||
|
|
9ab35cc5d2 | ||
|
|
bb03c74217 | ||
|
|
774f34d778 | ||
|
|
f5a171076b | ||
|
|
881fdbc04c | ||
|
|
8a27e58894 | ||
|
|
b4c81f7dff | ||
|
|
9151b71b19 | ||
|
|
8348bc9b1a | ||
|
|
6e47438f43 | ||
|
|
579e85e92d | ||
|
|
53d2b48ea2 | ||
|
|
ac6604b6ed | ||
|
|
91b64427ed | ||
|
|
ffe0f90083 | ||
|
|
59b5a55dbf | ||
|
|
b9290c7005 | ||
|
|
302a58e8ea | ||
|
|
def51361ae | ||
|
|
d67d4b3eee | ||
|
|
cd1b548a8f | ||
|
|
282372aa5a | ||
|
|
1f0cd3b50e | ||
|
|
4973419a38 | ||
|
|
44ef584842 | ||
|
|
55c42da91b | ||
|
|
5c343af807 | ||
|
|
87ecb2e6ca | ||
|
|
c659d0f218 | ||
|
|
9f7688b1d2 | ||
|
|
3edff352b5 | ||
|
|
08680f6591 | ||
|
|
55105ad1c3 | ||
|
|
df328758f0 | ||
|
|
d5ac61d566 | ||
|
|
355ea43ac7 | ||
|
|
6f0ab326b4 | ||
|
|
c06a4fb511 | ||
|
|
9a714ac6b8 | ||
|
|
8c21edc9c5 | ||
|
|
6ff324a12d | ||
|
|
090f9a5a80 | ||
|
|
74aefa0b07 | ||
|
|
ce1abef0bd | ||
|
|
53eacacb6b | ||
|
|
d40b9a515a | ||
|
|
7c2f687bd6 | ||
|
|
effc151244 | ||
|
|
bdfc895642 | ||
|
|
96161c8cfd | ||
|
|
da99399d16 | ||
|
|
7eb74d3720 | ||
|
|
7b39681caf | ||
|
|
5ff5c580ad | ||
|
|
6ccc6cbc69 | ||
|
|
2ecf6727c5 | ||
|
|
f957616f1c | ||
|
|
b154a5e908 | ||
|
|
c66e859bcc | ||
|
|
1559ef36af | ||
|
|
ef1c3d3914 | ||
|
|
83e28083b0 | ||
|
|
0950f8c752 | ||
|
|
41d36b65e2 | ||
|
|
d8cb81118a | ||
|
|
ecf34bb3e4 | ||
|
|
fb4d404553 | ||
|
|
450f79b3f5 | ||
|
|
a47b7d1d4c | ||
|
|
b01022d8df | ||
|
|
0155ff95e7 | ||
|
|
46b6a1a5e8 | ||
|
|
290f121b59 | ||
|
|
786ddeff62 | ||
|
|
732e155b8e | ||
|
|
e10c5b0a9b | ||
|
|
b608eaa410 | ||
|
|
7b2ae073f0 | ||
|
|
d4a7bdad55 | ||
|
|
96c9fd330c | ||
|
|
39b85cc6fd | ||
|
|
eccb868a50 | ||
|
|
de93c70f2f | ||
|
|
72430eb539 | ||
|
|
e2443a0147 | ||
|
|
e5d00b6c2a | ||
|
|
dc97970215 | ||
|
|
bc5a643c19 | ||
|
|
b1134f6857 | ||
|
|
04ab9b78fe | ||
|
|
fa0b881c4c | ||
|
|
106bda1ef9 | ||
|
|
c2de71e1fe | ||
|
|
3eba531c3d | ||
|
|
088bea8680 | ||
|
|
a9b0ac92bc | ||
|
|
3045956ddd | ||
|
|
599069b612 | ||
|
|
54873844c2 | ||
|
|
dfdd41a771 | ||
|
|
12763ca312 | ||
|
|
4c80c8c1ab | ||
|
|
acd2e7f222 | ||
|
|
a6b6dd2f36 | ||
|
|
0fd14ad74b | ||
|
|
52eaa52573 | ||
|
|
1e33692c1c | ||
|
|
f82ba477a4 | ||
|
|
761644af25 | ||
|
|
cd12d97ba7 | ||
|
|
1e4ded860c | ||
|
|
a0f29853b3 | ||
|
|
c4cdf747f8 | ||
|
|
e658f16810 | ||
|
|
a4b4305422 | ||
|
|
d8807eb651 | ||
|
|
1500f711f3 | ||
|
|
dafa42eb71 | ||
|
|
b5e5ead2ee | ||
|
|
24251b8d17 | ||
|
|
e6378197a7 | ||
|
|
4bb0cc2fe4 | ||
|
|
9304f42ea5 | ||
|
|
18f4eb2622 | ||
|
|
2caa8bcc23 | ||
|
|
bb222abde1 | ||
|
|
dd2b4ad26f | ||
|
|
b65cb8ea05 | ||
|
|
3a7efc10a0 | ||
|
|
a682de1dba | ||
|
|
45a542c335 | ||
|
|
bdb98b288e | ||
|
|
a06c8e9add | ||
|
|
18eefd61eb | ||
|
|
a2de0574b5 | ||
|
|
aa8e954197 | ||
|
|
30847e59b9 | ||
|
|
d930a581f8 | ||
|
|
931c22545b | ||
|
|
366f3c8ff8 | ||
|
|
26c39d7b4c | ||
|
|
6ffa5138ce | ||
|
|
975e1558cc | ||
|
|
82a955ebfe | ||
|
|
82596f8807 | ||
|
|
e3e57579a1 | ||
|
|
56d551e6a3 | ||
|
|
b4a0f8baf7 | ||
|
|
2e686ed6ea | ||
|
|
c46f72d411 | ||
|
|
ed46713e5c | ||
|
|
c228cb7b3f | ||
|
|
c88e4a0974 | ||
|
|
b71a2f4cb2 | ||
|
|
98a7b090de | ||
|
|
235a8cbd28 | ||
|
|
6afeb3c6f7 | ||
|
|
8c42aeac9f | ||
|
|
f36658ac10 | ||
|
|
f8227da9da |
@@ -145,11 +145,7 @@ runs:
|
||||
|
||||
if [ "${RERUN_FLAKY}" == "true" ]; then
|
||||
mkdir -p $TEST_OUTPUT
|
||||
poetry run ./scripts/flaky_tests.py "${TEST_RESULT_CONNSTR}" \
|
||||
--days 7 \
|
||||
--output "$TEST_OUTPUT/flaky.json" \
|
||||
--pg-version "${DEFAULT_PG_VERSION}" \
|
||||
--build-type "${BUILD_TYPE}"
|
||||
poetry run ./scripts/flaky_tests.py "${TEST_RESULT_CONNSTR}" --days 10 --output "$TEST_OUTPUT/flaky.json"
|
||||
|
||||
EXTRA_PARAMS="--flaky-tests-json $TEST_OUTPUT/flaky.json $EXTRA_PARAMS"
|
||||
fi
|
||||
|
||||
4
Cargo.lock
generated
4
Cargo.lock
generated
@@ -1001,7 +1001,6 @@ dependencies = [
|
||||
"comfy-table",
|
||||
"compute_api",
|
||||
"git-version",
|
||||
"hyper",
|
||||
"nix 0.26.2",
|
||||
"once_cell",
|
||||
"pageserver_api",
|
||||
@@ -1017,7 +1016,6 @@ dependencies = [
|
||||
"storage_broker",
|
||||
"tar",
|
||||
"thiserror",
|
||||
"tokio",
|
||||
"toml",
|
||||
"tracing",
|
||||
"url",
|
||||
@@ -2686,7 +2684,6 @@ dependencies = [
|
||||
"bytes",
|
||||
"const_format",
|
||||
"enum-map",
|
||||
"hex",
|
||||
"postgres_ffi",
|
||||
"serde",
|
||||
"serde_json",
|
||||
@@ -5017,7 +5014,6 @@ dependencies = [
|
||||
"nix 0.26.2",
|
||||
"once_cell",
|
||||
"pin-project-lite",
|
||||
"postgres_connection",
|
||||
"pq_proto",
|
||||
"rand",
|
||||
"regex",
|
||||
|
||||
@@ -211,8 +211,8 @@ RUN wget https://github.com/df7cb/postgresql-unit/archive/refs/tags/7.7.tar.gz -
|
||||
FROM build-deps AS vector-pg-build
|
||||
COPY --from=pg-build /usr/local/pgsql/ /usr/local/pgsql/
|
||||
|
||||
RUN wget https://github.com/pgvector/pgvector/archive/refs/tags/v0.5.0.tar.gz -O pgvector.tar.gz && \
|
||||
echo "d8aa3504b215467ca528525a6de12c3f85f9891b091ce0e5864dd8a9b757f77b pgvector.tar.gz" | sha256sum --check && \
|
||||
RUN wget https://github.com/pgvector/pgvector/archive/refs/tags/v0.4.4.tar.gz -O pgvector.tar.gz && \
|
||||
echo "1cb70a63f8928e396474796c22a20be9f7285a8a013009deb8152445b61b72e6 pgvector.tar.gz" | sha256sum --check && \
|
||||
mkdir pgvector-src && cd pgvector-src && tar xvzf ../pgvector.tar.gz --strip-components=1 -C . && \
|
||||
make -j $(getconf _NPROCESSORS_ONLN) PG_CONFIG=/usr/local/pgsql/bin/pg_config && \
|
||||
make -j $(getconf _NPROCESSORS_ONLN) install PG_CONFIG=/usr/local/pgsql/bin/pg_config && \
|
||||
|
||||
@@ -19,10 +19,9 @@ Also `compute_ctl` spawns two separate service threads:
|
||||
- `http-endpoint` runs a Hyper HTTP API server, which serves readiness and the
|
||||
last activity requests.
|
||||
|
||||
If `AUTOSCALING` environment variable is set, `compute_ctl` will start the
|
||||
`vm-monitor` located in [`neon/libs/vm_monitor`]. For VM compute nodes,
|
||||
`vm-monitor` communicates with the VM autoscaling system. It coordinates
|
||||
downscaling and requests immediate upscaling under resource pressure.
|
||||
If the `vm-informant` binary is present at `/bin/vm-informant`, it will also be started. For VM
|
||||
compute nodes, `vm-informant` communicates with the VM autoscaling system. It coordinates
|
||||
downscaling and (eventually) will request immediate upscaling under resource pressure.
|
||||
|
||||
Usage example:
|
||||
```sh
|
||||
|
||||
@@ -20,10 +20,9 @@
|
||||
//! - `http-endpoint` runs a Hyper HTTP API server, which serves readiness and the
|
||||
//! last activity requests.
|
||||
//!
|
||||
//! If `AUTOSCALING` environment variable is set, `compute_ctl` will start the
|
||||
//! `vm-monitor` located in [`neon/libs/vm_monitor`]. For VM compute nodes,
|
||||
//! `vm-monitor` communicates with the VM autoscaling system. It coordinates
|
||||
//! downscaling and requests immediate upscaling under resource pressure.
|
||||
//! If the `vm-informant` binary is present at `/bin/vm-informant`, it will also be started. For VM
|
||||
//! compute nodes, `vm-informant` communicates with the VM autoscaling system. It coordinates
|
||||
//! downscaling and (eventually) will request immediate upscaling under resource pressure.
|
||||
//!
|
||||
//! Usage example:
|
||||
//! ```sh
|
||||
@@ -279,9 +278,8 @@ fn main() -> Result<()> {
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::warn;
|
||||
let vm_monitor_addr = matches.get_one::<String>("vm-monitor-addr");
|
||||
let file_cache_connstr = matches.get_one::<String>("filecache-connstr");
|
||||
let cgroup = matches.get_one::<String>("cgroup");
|
||||
let file_cache_on_disk = matches.get_flag("file-cache-on-disk");
|
||||
let cgroup = matches.get_one::<String>("filecache-connstr");
|
||||
let file_cache_connstr = matches.get_one::<String>("cgroup");
|
||||
|
||||
// Only make a runtime if we need to.
|
||||
// Note: it seems like you can make a runtime in an inner scope and
|
||||
@@ -314,7 +312,6 @@ fn main() -> Result<()> {
|
||||
cgroup: cgroup.cloned(),
|
||||
pgconnstr: file_cache_connstr.cloned(),
|
||||
addr: vm_monitor_addr.cloned().unwrap(),
|
||||
file_cache_on_disk,
|
||||
})),
|
||||
token.clone(),
|
||||
))
|
||||
@@ -485,11 +482,6 @@ fn cli() -> clap::Command {
|
||||
)
|
||||
.value_name("FILECACHE_CONNSTR"),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("file-cache-on-disk")
|
||||
.long("file-cache-on-disk")
|
||||
.action(clap::ArgAction::SetTrue),
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
|
||||
@@ -12,7 +12,6 @@ git-version.workspace = true
|
||||
nix.workspace = true
|
||||
once_cell.workspace = true
|
||||
postgres.workspace = true
|
||||
hyper.workspace = true
|
||||
regex.workspace = true
|
||||
reqwest = { workspace = true, features = ["blocking", "json"] }
|
||||
serde.workspace = true
|
||||
@@ -21,7 +20,6 @@ serde_with.workspace = true
|
||||
tar.workspace = true
|
||||
thiserror.workspace = true
|
||||
toml.workspace = true
|
||||
tokio.workspace = true
|
||||
url.workspace = true
|
||||
# Note: Do not directly depend on pageserver or safekeeper; use pageserver_api or safekeeper_api
|
||||
# instead, so that recompile times are better.
|
||||
|
||||
@@ -1,104 +0,0 @@
|
||||
use crate::{background_process, local_env::LocalEnv};
|
||||
use anyhow::anyhow;
|
||||
use pageserver_api::control_api::HexTenantId;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::{path::PathBuf, process::Child};
|
||||
use utils::id::{NodeId, TenantId};
|
||||
|
||||
pub struct AttachmentService {
|
||||
env: LocalEnv,
|
||||
listen: String,
|
||||
path: PathBuf,
|
||||
}
|
||||
|
||||
const COMMAND: &str = "attachment_service";
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct AttachHookRequest {
|
||||
pub tenant_id: HexTenantId,
|
||||
pub pageserver_id: Option<NodeId>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct AttachHookResponse {
|
||||
pub gen: Option<u32>,
|
||||
}
|
||||
|
||||
impl AttachmentService {
|
||||
pub fn from_env(env: &LocalEnv) -> Self {
|
||||
let path = env.base_data_dir.join("attachments.json");
|
||||
|
||||
// Makes no sense to construct this if pageservers aren't going to use it: assume
|
||||
// pageservers have control plane API set
|
||||
let listen_url = env.pageserver.control_plane_api.clone().unwrap();
|
||||
|
||||
let listen = format!(
|
||||
"{}:{}",
|
||||
listen_url.host_str().unwrap(),
|
||||
listen_url.port().unwrap()
|
||||
);
|
||||
|
||||
Self {
|
||||
env: env.clone(),
|
||||
path,
|
||||
listen,
|
||||
}
|
||||
}
|
||||
|
||||
fn pid_file(&self) -> PathBuf {
|
||||
self.env.base_data_dir.join("attachment_service.pid")
|
||||
}
|
||||
|
||||
pub fn start(&self) -> anyhow::Result<Child> {
|
||||
let path_str = self.path.to_string_lossy();
|
||||
|
||||
background_process::start_process(
|
||||
COMMAND,
|
||||
&self.env.base_data_dir,
|
||||
&self.env.attachment_service_bin(),
|
||||
["-l", &self.listen, "-p", &path_str],
|
||||
[],
|
||||
background_process::InitialPidFile::Create(&self.pid_file()),
|
||||
// TODO: a real status check
|
||||
|| Ok(true),
|
||||
)
|
||||
}
|
||||
|
||||
pub fn stop(&self, immediate: bool) -> anyhow::Result<()> {
|
||||
background_process::stop_process(immediate, COMMAND, &self.pid_file())
|
||||
}
|
||||
|
||||
/// Call into the attach_hook API, for use before handing out attachments to pageservers
|
||||
pub fn attach_hook(
|
||||
&self,
|
||||
tenant_id: TenantId,
|
||||
pageserver_id: NodeId,
|
||||
) -> anyhow::Result<Option<u32>> {
|
||||
use hyper::StatusCode;
|
||||
|
||||
let url = self
|
||||
.env
|
||||
.pageserver
|
||||
.control_plane_api
|
||||
.clone()
|
||||
.unwrap()
|
||||
.join("attach_hook")
|
||||
.unwrap();
|
||||
let client = reqwest::blocking::ClientBuilder::new()
|
||||
.build()
|
||||
.expect("Failed to construct http client");
|
||||
|
||||
let request = AttachHookRequest {
|
||||
tenant_id: HexTenantId::new(tenant_id),
|
||||
pageserver_id: Some(pageserver_id),
|
||||
};
|
||||
|
||||
let response = client.post(url).json(&request).send()?;
|
||||
if response.status() != StatusCode::OK {
|
||||
return Err(anyhow!("Unexpected status {0}", response.status()));
|
||||
}
|
||||
|
||||
let response = response.json::<AttachHookResponse>()?;
|
||||
Ok(response.gen)
|
||||
}
|
||||
}
|
||||
@@ -1,264 +0,0 @@
|
||||
/// The attachment service mimics the aspects of the control plane API
|
||||
/// that are required for a pageserver to operate.
|
||||
///
|
||||
/// This enables running & testing pageservers without a full-blown
|
||||
/// deployment of the Neon cloud platform.
|
||||
///
|
||||
use anyhow::anyhow;
|
||||
use clap::Parser;
|
||||
use hyper::StatusCode;
|
||||
use hyper::{Body, Request, Response};
|
||||
use pageserver_api::control_api::*;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::{collections::HashMap, sync::Arc};
|
||||
use utils::logging::{self, LogFormat};
|
||||
|
||||
use utils::{
|
||||
http::{
|
||||
endpoint::{self},
|
||||
error::ApiError,
|
||||
json::{json_request, json_response},
|
||||
RequestExt, RouterBuilder,
|
||||
},
|
||||
id::{NodeId, TenantId},
|
||||
tcp_listener,
|
||||
};
|
||||
|
||||
use control_plane::attachment_service::{AttachHookRequest, AttachHookResponse};
|
||||
|
||||
#[derive(Parser)]
|
||||
#[command(author, version, about, long_about = None)]
|
||||
#[command(arg_required_else_help(true))]
|
||||
struct Cli {
|
||||
#[arg(short, long)]
|
||||
listen: String,
|
||||
|
||||
#[arg(short, long)]
|
||||
path: PathBuf,
|
||||
}
|
||||
|
||||
// The persistent state of each Tenant
|
||||
#[derive(Serialize, Deserialize, Clone)]
|
||||
struct TenantState {
|
||||
// Currently attached pageserver
|
||||
pageserver: Option<NodeId>,
|
||||
|
||||
// Latest generation number: next time we attach, increment this
|
||||
// and use the incremented number when attaching
|
||||
generation: u32,
|
||||
}
|
||||
|
||||
fn to_hex_map<S, V>(input: &HashMap<TenantId, V>, serializer: S) -> Result<S::Ok, S::Error>
|
||||
where
|
||||
S: serde::Serializer,
|
||||
V: Clone + Serialize,
|
||||
{
|
||||
eprintln!("to_hex_map");
|
||||
let transformed = input
|
||||
.iter()
|
||||
.map(|(k, v)| (HexTenantId::new(k.clone()), v.clone()));
|
||||
|
||||
transformed
|
||||
.collect::<HashMap<HexTenantId, V>>()
|
||||
.serialize(serializer)
|
||||
}
|
||||
|
||||
fn from_hex_map<'de, D, V>(deserializer: D) -> Result<HashMap<TenantId, V>, D::Error>
|
||||
where
|
||||
D: serde::de::Deserializer<'de>,
|
||||
V: Deserialize<'de>,
|
||||
{
|
||||
eprintln!("from_hex_map");
|
||||
let hex_map = HashMap::<HexTenantId, V>::deserialize(deserializer)?;
|
||||
|
||||
Ok(hex_map.into_iter().map(|(k, v)| (k.take(), v)).collect())
|
||||
}
|
||||
|
||||
// Top level state available to all HTTP handlers
|
||||
#[derive(Serialize, Deserialize)]
|
||||
struct PersistentState {
|
||||
#[serde(serialize_with = "to_hex_map", deserialize_with = "from_hex_map")]
|
||||
tenants: HashMap<TenantId, TenantState>,
|
||||
|
||||
#[serde(skip)]
|
||||
path: PathBuf,
|
||||
}
|
||||
|
||||
impl PersistentState {
|
||||
async fn save(&self) -> anyhow::Result<()> {
|
||||
let bytes = serde_json::to_vec(self)?;
|
||||
tokio::fs::write(&self.path, &bytes).await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn load(path: &Path) -> anyhow::Result<Self> {
|
||||
let bytes = tokio::fs::read(path).await?;
|
||||
let mut decoded = serde_json::from_slice::<Self>(&bytes)?;
|
||||
decoded.path = path.to_owned();
|
||||
Ok(decoded)
|
||||
}
|
||||
|
||||
async fn load_or_new(path: &Path) -> Self {
|
||||
match Self::load(path).await {
|
||||
Ok(s) => s,
|
||||
Err(e) => {
|
||||
tracing::info!(
|
||||
"Creating new state file at {0} (load returned {e})",
|
||||
path.to_string_lossy()
|
||||
);
|
||||
Self {
|
||||
tenants: HashMap::new(),
|
||||
path: path.to_owned(),
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// State available to HTTP request handlers
|
||||
#[derive(Clone)]
|
||||
struct State {
|
||||
inner: Arc<tokio::sync::RwLock<PersistentState>>,
|
||||
}
|
||||
|
||||
impl State {
|
||||
fn new(persistent_state: PersistentState) -> State {
|
||||
Self {
|
||||
inner: Arc::new(tokio::sync::RwLock::new(persistent_state)),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
fn get_state(request: &Request<Body>) -> &State {
|
||||
request
|
||||
.data::<Arc<State>>()
|
||||
.expect("unknown state type")
|
||||
.as_ref()
|
||||
}
|
||||
|
||||
/// Pageserver calls into this on startup, to learn which tenants it should attach
|
||||
async fn handle_re_attach(mut req: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let reattach_req = json_request::<ReAttachRequest>(&mut req).await?;
|
||||
|
||||
let state = get_state(&req).inner.clone();
|
||||
let mut locked = state.write().await;
|
||||
|
||||
let mut response = ReAttachResponse {
|
||||
tenants: Vec::new(),
|
||||
};
|
||||
for (t, state) in &mut locked.tenants {
|
||||
if state.pageserver == Some(reattach_req.node_id) {
|
||||
state.generation += 1;
|
||||
response.tenants.push(ReAttachResponseTenant {
|
||||
id: HexTenantId::new(t.clone()),
|
||||
generation: state.generation,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
locked
|
||||
.save()
|
||||
.await
|
||||
.map_err(|e| ApiError::InternalServerError(e))?;
|
||||
|
||||
json_response(StatusCode::OK, response)
|
||||
}
|
||||
|
||||
/// Pageserver calls into this before doing deletions, to confirm that it still
|
||||
/// holds the latest generation for the tenants with deletions enqueued
|
||||
async fn handle_validate(mut req: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let validate_req = json_request::<ValidateRequest>(&mut req).await?;
|
||||
|
||||
let state = get_state(&req).inner.clone();
|
||||
let locked = state.read().await;
|
||||
|
||||
let mut response = ValidateResponse {
|
||||
tenants: Vec::new(),
|
||||
};
|
||||
|
||||
for req_tenant in validate_req.tenants {
|
||||
if let Some(tenant_state) = locked.tenants.get(req_tenant.id.as_ref()) {
|
||||
let valid = tenant_state.generation == req_tenant.gen;
|
||||
response.tenants.push(ValidateResponseTenant {
|
||||
id: req_tenant.id,
|
||||
valid,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
json_response(StatusCode::OK, response)
|
||||
}
|
||||
/// Call into this before attaching a tenant to a pageserver, to acquire a generation number
|
||||
/// (in the real control plane this is unnecessary, because the same program is managing
|
||||
/// generation numbers and doing attachments).
|
||||
async fn handle_attach_hook(mut req: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let attach_req = json_request::<AttachHookRequest>(&mut req).await?;
|
||||
|
||||
let state = get_state(&req).inner.clone();
|
||||
let mut locked = state.write().await;
|
||||
|
||||
let tenant_state = locked
|
||||
.tenants
|
||||
.entry(attach_req.tenant_id.take())
|
||||
.or_insert_with(|| TenantState {
|
||||
pageserver: attach_req.pageserver_id,
|
||||
generation: 0,
|
||||
});
|
||||
|
||||
if attach_req.pageserver_id.is_some() {
|
||||
tenant_state.generation += 1;
|
||||
}
|
||||
let generation = tenant_state.generation;
|
||||
|
||||
locked
|
||||
.save()
|
||||
.await
|
||||
.map_err(|e| ApiError::InternalServerError(e))?;
|
||||
|
||||
json_response(
|
||||
StatusCode::OK,
|
||||
AttachHookResponse {
|
||||
gen: attach_req.pageserver_id.map(|_| generation),
|
||||
},
|
||||
)
|
||||
}
|
||||
|
||||
fn make_router(persistent_state: PersistentState) -> RouterBuilder<hyper::Body, ApiError> {
|
||||
endpoint::make_router()
|
||||
.data(Arc::new(State::new(persistent_state)))
|
||||
.post("/re-attach", |r| handle_re_attach(r))
|
||||
.post("/validate", |r| handle_validate(r))
|
||||
.post("/attach_hook", |r| handle_attach_hook(r))
|
||||
}
|
||||
|
||||
#[tokio::main]
|
||||
async fn main() -> anyhow::Result<()> {
|
||||
logging::init(
|
||||
LogFormat::Plain,
|
||||
logging::TracingErrorLayerEnablement::Disabled,
|
||||
)?;
|
||||
|
||||
let args = Cli::parse();
|
||||
tracing::info!(
|
||||
"Starting, state at {}, listening on {}",
|
||||
args.path.to_string_lossy(),
|
||||
args.listen
|
||||
);
|
||||
|
||||
let persistent_state = PersistentState::load_or_new(&args.path).await;
|
||||
|
||||
let http_listener = tcp_listener::bind(&args.listen)?;
|
||||
let router = make_router(persistent_state)
|
||||
.build()
|
||||
.map_err(|err| anyhow!(err))?;
|
||||
let service = utils::http::RouterService::new(router).unwrap();
|
||||
let server = hyper::Server::from_tcp(http_listener)?.serve(service);
|
||||
|
||||
tracing::info!("Serving on {0}", args.listen.as_str());
|
||||
server.await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -8,7 +8,6 @@
|
||||
use anyhow::{anyhow, bail, Context, Result};
|
||||
use clap::{value_parser, Arg, ArgAction, ArgMatches, Command};
|
||||
use compute_api::spec::ComputeMode;
|
||||
use control_plane::attachment_service::AttachmentService;
|
||||
use control_plane::endpoint::ComputeControlPlane;
|
||||
use control_plane::local_env::LocalEnv;
|
||||
use control_plane::pageserver::PageServerNode;
|
||||
@@ -44,8 +43,6 @@ project_git_version!(GIT_VERSION);
|
||||
|
||||
const DEFAULT_PG_VERSION: &str = "15";
|
||||
|
||||
const DEFAULT_PAGESERVER_CONTROL_PLANE_API: &str = "http://127.0.0.1:1234/";
|
||||
|
||||
fn default_conf() -> String {
|
||||
format!(
|
||||
r#"
|
||||
@@ -59,13 +56,11 @@ listen_pg_addr = '{DEFAULT_PAGESERVER_PG_ADDR}'
|
||||
listen_http_addr = '{DEFAULT_PAGESERVER_HTTP_ADDR}'
|
||||
pg_auth_type = '{trust_auth}'
|
||||
http_auth_type = '{trust_auth}'
|
||||
control_plane_api = '{DEFAULT_PAGESERVER_CONTROL_PLANE_API}'
|
||||
|
||||
[[safekeepers]]
|
||||
id = {DEFAULT_SAFEKEEPER_ID}
|
||||
pg_port = {DEFAULT_SAFEKEEPER_PG_PORT}
|
||||
http_port = {DEFAULT_SAFEKEEPER_HTTP_PORT}
|
||||
|
||||
"#,
|
||||
trust_auth = AuthType::Trust,
|
||||
)
|
||||
@@ -112,7 +107,6 @@ fn main() -> Result<()> {
|
||||
"start" => handle_start_all(sub_args, &env),
|
||||
"stop" => handle_stop_all(sub_args, &env),
|
||||
"pageserver" => handle_pageserver(sub_args, &env),
|
||||
"attachment_service" => handle_attachment_service(sub_args, &env),
|
||||
"safekeeper" => handle_safekeeper(sub_args, &env),
|
||||
"endpoint" => handle_endpoint(sub_args, &env),
|
||||
"pg" => bail!("'pg' subcommand has been renamed to 'endpoint'"),
|
||||
@@ -348,25 +342,13 @@ fn handle_tenant(tenant_match: &ArgMatches, env: &mut local_env::LocalEnv) -> an
|
||||
}
|
||||
}
|
||||
Some(("create", create_match)) => {
|
||||
let initial_tenant_id = parse_tenant_id(create_match)?;
|
||||
let tenant_conf: HashMap<_, _> = create_match
|
||||
.get_many::<String>("config")
|
||||
.map(|vals| vals.flat_map(|c| c.split_once(':')).collect())
|
||||
.unwrap_or_default();
|
||||
|
||||
// If tenant ID was not specified, generate one
|
||||
let tenant_id = parse_tenant_id(create_match)?.unwrap_or(TenantId::generate());
|
||||
|
||||
let generation = if env.pageserver.control_plane_api.is_some() {
|
||||
// We must register the tenant with the attachment service, so
|
||||
// that when the pageserver restarts, it will be re-attached.
|
||||
let attachment_service = AttachmentService::from_env(env);
|
||||
attachment_service.attach_hook(tenant_id, env.pageserver.id)?
|
||||
} else {
|
||||
None
|
||||
};
|
||||
|
||||
pageserver.tenant_create(tenant_id, generation, tenant_conf)?;
|
||||
println!("tenant {tenant_id} successfully created on the pageserver");
|
||||
let new_tenant_id = pageserver.tenant_create(initial_tenant_id, tenant_conf)?;
|
||||
println!("tenant {new_tenant_id} successfully created on the pageserver");
|
||||
|
||||
// Create an initial timeline for the new tenant
|
||||
let new_timeline_id = parse_timeline_id(create_match)?;
|
||||
@@ -376,7 +358,7 @@ fn handle_tenant(tenant_match: &ArgMatches, env: &mut local_env::LocalEnv) -> an
|
||||
.context("Failed to parse postgres version from the argument string")?;
|
||||
|
||||
let timeline_info = pageserver.timeline_create(
|
||||
tenant_id,
|
||||
new_tenant_id,
|
||||
new_timeline_id,
|
||||
None,
|
||||
None,
|
||||
@@ -387,17 +369,17 @@ fn handle_tenant(tenant_match: &ArgMatches, env: &mut local_env::LocalEnv) -> an
|
||||
|
||||
env.register_branch_mapping(
|
||||
DEFAULT_BRANCH_NAME.to_string(),
|
||||
tenant_id,
|
||||
new_tenant_id,
|
||||
new_timeline_id,
|
||||
)?;
|
||||
|
||||
println!(
|
||||
"Created an initial timeline '{new_timeline_id}' at Lsn {last_record_lsn} for tenant: {tenant_id}",
|
||||
"Created an initial timeline '{new_timeline_id}' at Lsn {last_record_lsn} for tenant: {new_tenant_id}",
|
||||
);
|
||||
|
||||
if create_match.get_flag("set-default") {
|
||||
println!("Setting tenant {tenant_id} as a default one");
|
||||
env.default_tenant_id = Some(tenant_id);
|
||||
println!("Setting tenant {new_tenant_id} as a default one");
|
||||
env.default_tenant_id = Some(new_tenant_id);
|
||||
}
|
||||
}
|
||||
Some(("set-default", set_default_match)) => {
|
||||
@@ -835,33 +817,6 @@ fn handle_pageserver(sub_match: &ArgMatches, env: &local_env::LocalEnv) -> Resul
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn handle_attachment_service(sub_match: &ArgMatches, env: &local_env::LocalEnv) -> Result<()> {
|
||||
let svc = AttachmentService::from_env(env);
|
||||
match sub_match.subcommand() {
|
||||
Some(("start", _start_match)) => {
|
||||
if let Err(e) = svc.start() {
|
||||
eprintln!("start failed: {e}");
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
|
||||
Some(("stop", stop_match)) => {
|
||||
let immediate = stop_match
|
||||
.get_one::<String>("stop-mode")
|
||||
.map(|s| s.as_str())
|
||||
== Some("immediate");
|
||||
|
||||
if let Err(e) = svc.stop(immediate) {
|
||||
eprintln!("stop failed: {}", e);
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
Some((sub_name, _)) => bail!("Unexpected attachment_service subcommand '{}'", sub_name),
|
||||
None => bail!("no attachment_service subcommand provided"),
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn get_safekeeper(env: &local_env::LocalEnv, id: NodeId) -> Result<SafekeeperNode> {
|
||||
if let Some(node) = env.safekeepers.iter().find(|node| node.id == id) {
|
||||
Ok(SafekeeperNode::from_env(env, node))
|
||||
@@ -942,16 +897,6 @@ fn handle_start_all(sub_match: &ArgMatches, env: &local_env::LocalEnv) -> anyhow
|
||||
|
||||
broker::start_broker_process(env)?;
|
||||
|
||||
// Only start the attachment service if the pageserver is configured to need it
|
||||
if env.pageserver.control_plane_api.is_some() {
|
||||
let attachment_service = AttachmentService::from_env(env);
|
||||
if let Err(e) = attachment_service.start() {
|
||||
eprintln!("attachment_service start failed: {:#}", e);
|
||||
try_stop_all(env, true);
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
|
||||
let pageserver = PageServerNode::from_env(env);
|
||||
if let Err(e) = pageserver.start(&pageserver_config_overrides(sub_match)) {
|
||||
eprintln!("pageserver {} start failed: {:#}", env.pageserver.id, e);
|
||||
@@ -1010,13 +955,6 @@ fn try_stop_all(env: &local_env::LocalEnv, immediate: bool) {
|
||||
if let Err(e) = broker::stop_broker_process(env) {
|
||||
eprintln!("neon broker stop failed: {e:#}");
|
||||
}
|
||||
|
||||
if env.pageserver.control_plane_api.is_some() {
|
||||
let attachment_service = AttachmentService::from_env(env);
|
||||
if let Err(e) = attachment_service.stop(immediate) {
|
||||
eprintln!("attachment service stop failed: {e:#}");
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn cli() -> Command {
|
||||
@@ -1200,14 +1138,6 @@ fn cli() -> Command {
|
||||
.arg(stop_mode_arg.clone()))
|
||||
.subcommand(Command::new("restart").about("Restart local pageserver").arg(pageserver_config_args.clone()))
|
||||
)
|
||||
.subcommand(
|
||||
Command::new("attachment_service")
|
||||
.arg_required_else_help(true)
|
||||
.about("Manage attachment_service")
|
||||
.subcommand(Command::new("start").about("Start local pageserver").arg(pageserver_config_args.clone()))
|
||||
.subcommand(Command::new("stop").about("Stop local pageserver")
|
||||
.arg(stop_mode_arg.clone()))
|
||||
)
|
||||
.subcommand(
|
||||
Command::new("safekeeper")
|
||||
.arg_required_else_help(true)
|
||||
|
||||
@@ -7,7 +7,6 @@
|
||||
// local installations.
|
||||
//
|
||||
|
||||
pub mod attachment_service;
|
||||
mod background_process;
|
||||
pub mod broker;
|
||||
pub mod endpoint;
|
||||
|
||||
@@ -118,9 +118,6 @@ pub struct PageServerConf {
|
||||
// auth type used for the PG and HTTP ports
|
||||
pub pg_auth_type: AuthType,
|
||||
pub http_auth_type: AuthType,
|
||||
|
||||
// Control plane location
|
||||
pub control_plane_api: Option<Url>,
|
||||
}
|
||||
|
||||
impl Default for PageServerConf {
|
||||
@@ -131,7 +128,6 @@ impl Default for PageServerConf {
|
||||
listen_http_addr: String::new(),
|
||||
pg_auth_type: AuthType::Trust,
|
||||
http_auth_type: AuthType::Trust,
|
||||
control_plane_api: None,
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -206,10 +202,6 @@ impl LocalEnv {
|
||||
self.neon_distrib_dir.join("pageserver")
|
||||
}
|
||||
|
||||
pub fn attachment_service_bin(&self) -> PathBuf {
|
||||
self.neon_distrib_dir.join("attachment_service")
|
||||
}
|
||||
|
||||
pub fn safekeeper_bin(&self) -> PathBuf {
|
||||
self.neon_distrib_dir.join("safekeeper")
|
||||
}
|
||||
|
||||
@@ -126,13 +126,6 @@ impl PageServerNode {
|
||||
broker_endpoint_param,
|
||||
];
|
||||
|
||||
if let Some(control_plane_api) = &self.env.pageserver.control_plane_api {
|
||||
overrides.push(format!(
|
||||
"control_plane_api='{}'",
|
||||
control_plane_api.as_str()
|
||||
));
|
||||
}
|
||||
|
||||
if self.env.pageserver.http_auth_type != AuthType::Trust
|
||||
|| self.env.pageserver.pg_auth_type != AuthType::Trust
|
||||
{
|
||||
@@ -323,8 +316,7 @@ impl PageServerNode {
|
||||
|
||||
pub fn tenant_create(
|
||||
&self,
|
||||
new_tenant_id: TenantId,
|
||||
generation: Option<u32>,
|
||||
new_tenant_id: Option<TenantId>,
|
||||
settings: HashMap<&str, &str>,
|
||||
) -> anyhow::Result<TenantId> {
|
||||
let mut settings = settings.clone();
|
||||
@@ -390,9 +382,11 @@ impl PageServerNode {
|
||||
.context("Failed to parse 'gc_feedback' as bool")?,
|
||||
};
|
||||
|
||||
// If tenant ID was not specified, generate one
|
||||
let new_tenant_id = new_tenant_id.unwrap_or(TenantId::generate());
|
||||
|
||||
let request = models::TenantCreateRequest {
|
||||
new_tenant_id,
|
||||
generation,
|
||||
config,
|
||||
};
|
||||
if !settings.is_empty() {
|
||||
|
||||
@@ -1,957 +0,0 @@
|
||||
# Pageserver: split-brain safety for remote storage through generation numbers
|
||||
|
||||
## Summary
|
||||
|
||||
A scheme of logical "generation numbers" for tenant attachment to pageservers is proposed, along with
|
||||
changes to the remote storage format to include these generation numbers in S3 keys.
|
||||
|
||||
Using the control plane as the issuer of these generation numbers enables strong anti-split-brain
|
||||
properties in the pageserver cluster without implementing a consensus mechanism directly
|
||||
in the pageservers.
|
||||
|
||||
## Motivation
|
||||
|
||||
Currently, the pageserver's remote storage format does not provide a mechanism for addressing
|
||||
split brain conditions that may happen when replacing a node or when migrating
|
||||
a tenant from one pageserver to another.
|
||||
|
||||
From a remote storage perspective, a split brain condition occurs whenever two nodes both think
|
||||
they have the same tenant attached, and both can write to S3. This can happen in the case of a
|
||||
network partition, pathologically long delays (e.g. suspended VM), or software bugs.
|
||||
|
||||
In the current deployment model, control plane guarantees that a tenant is attached to one
|
||||
pageserver at a time, thereby ruling out split-brain conditions resulting from dual
|
||||
attachment (however, there is always the risk of a control plane bug). This control
|
||||
plane guarantee prevents robust response to failures, as if a pageserver is unresponsive
|
||||
we may not detach from it. The mechanism in this RFC fixes this, by making it safe to
|
||||
attach to a new, different pageserver even if an unresponsive pageserver may be running.
|
||||
|
||||
Futher, lack of safety during split-brain conditions blocks two important features where occasional
|
||||
split-brain conditions are part of the design assumptions:
|
||||
|
||||
- seamless tenant migration ([RFC PR](https://github.com/neondatabase/neon/pull/5029))
|
||||
- automatic pageserver instance failure handling (aka "failover") (RFC TBD)
|
||||
|
||||
### Prior art
|
||||
|
||||
- 020-pageserver-s3-coordination.md
|
||||
- 023-the-state-of-pageserver-tenant-relocation.md
|
||||
- 026-pageserver-s3-mvcc.md
|
||||
|
||||
This RFC has broad similarities to the proposal to implement a MVCC scheme in
|
||||
S3 object names, but this RFC avoids a general purpose transaction scheme in
|
||||
favour of more specialized "generations" that work like a transaction ID that
|
||||
always has the same lifetime as a pageserver process or tenant attachment, whichever
|
||||
is shorter.
|
||||
|
||||
## Requirements
|
||||
|
||||
- Accommodate storage backends with no atomic or fencing capability (i.e. work within
|
||||
S3's limitation that there are no atomics and clients can't be fenced)
|
||||
- Don't depend on any STONITH or node fencing in the compute layer (i.e. we will not
|
||||
assume that we can reliably kill and EC2 instance and have it die)
|
||||
- Scoped per-tenant, not per-pageserver; for _seamless tenant migration_, we need
|
||||
per-tenant granularity, and for _failover_, we likely want to spread the workload
|
||||
of the failed pageserver instance to a number of peers, rather than monolithically
|
||||
moving the entire workload to another machine.
|
||||
We do not rule out the latter case, but should not constrain ourselves to it.
|
||||
|
||||
## Design Tenets
|
||||
|
||||
These are not requirements, but are ideas that guide the following design:
|
||||
|
||||
- Avoid implementing another consensus system: we already have a strongly consistent
|
||||
database in the control plane that can do atomic operations where needed, and we also
|
||||
have a Paxos implementation in the safekeeper.
|
||||
- Avoiding locking in to specific models of how failover will work (e.g. do not assume that
|
||||
all the tenants on a pageserver will fail over as a unit).
|
||||
- Be strictly correct when it comes to data integrity. Occasional failures of availability
|
||||
are tolerable, occasional data loss is not.
|
||||
|
||||
## Non Goals
|
||||
|
||||
The changes in this RFC intentionally isolate the design decision of how to define
|
||||
logical generations numbers and object storage format in a way that is somewhat flexible with
|
||||
respect to how actual orchestration of failover works.
|
||||
|
||||
This RFC intentionally does not cover:
|
||||
|
||||
- Failure detection
|
||||
- Orchestration of failover
|
||||
- Standby modes to keep data ready for fast migration
|
||||
- Intentional multi-writer operation on tenants (multi-writer scenarios are assumed to be transient split-brain situations).
|
||||
- Sharding.
|
||||
|
||||
The interaction between this RFC and those features is discussed in [Appendix B](#appendix-b-interoperability-with-other-features)
|
||||
|
||||
## Impacted Components
|
||||
|
||||
pageserver, control plane, safekeeper (optional)
|
||||
|
||||
## Implementation Part 1: Correctness
|
||||
|
||||
### Summary
|
||||
|
||||
- A per-tenant **generation number** is introduced to uniquely identifying tenant attachments to pageserver processes.
|
||||
|
||||
- This generation number increments each time the control plane modifies a tenant (`Project`)'s assigned pageserver, or when the assigned pageserver restarts.
|
||||
- the control plane is the authority for generation numbers: only it may
|
||||
increment a generation number.
|
||||
|
||||
- **Object keys are suffixed** with the generation number
|
||||
- **Safety for multiply-attached tenants** is provided by the
|
||||
generation number in the object key: the competing pageservers will not
|
||||
try to write to the same keys.
|
||||
- **Safety in split brain for multiple nodes running with
|
||||
the same node ID** is provided by the pageserver calling out to the control plane
|
||||
on startup, to re-attach and thereby increment the generations of any attached tenants
|
||||
- **Safety for deletions** is achieved by deferring the DELETE from S3 to a point in time where the deleting node has validated with control plane that no attachment with a higher generation has a reference to the to-be-DELETEd key.
|
||||
- **The control plane is used to issue generation numbers** to avoid the need for
|
||||
a built-in consensus system in the pageserver, although this could in principle
|
||||
be changed without changing the storage format.
|
||||
|
||||
### Generation numbers
|
||||
|
||||
A generation number is associated with each tenant in the control plane,
|
||||
and each time the attachment status of the tenant changes, this is incremented.
|
||||
Changes in attachment status include:
|
||||
|
||||
- Attaching the tenant to a different pageserver
|
||||
- A pageserver restarting, and "re-attaching" its tenants on startup
|
||||
|
||||
These increments of attachment generation provide invariants we need to avoid
|
||||
split-brain issues in storage:
|
||||
|
||||
- If two pageservers have the same tenant attached, the attachments are guaranteed to have different generation numbers, because the generation would increment
|
||||
while attaching the second one.
|
||||
- If there are multiple pageservers running with the same node ID, all the attachments on all pageservers are guaranteed to have different generation numbers, because the generation would increment
|
||||
when the second node started and re-attached its tenants.
|
||||
|
||||
As long as the infrastructure does not transparently replace an underlying
|
||||
physical machine, we are totally safe. See the later [unsafe case](#unsafe-case-on-badly-behaved-infrastructure) section for details.
|
||||
|
||||
### Object Key Changes
|
||||
|
||||
#### Generation suffix
|
||||
|
||||
All object keys (layer objects and index objects) will contain the attachment
|
||||
generation as a [suffix](#why-a-generation-suffix-rather-than-prefix).
|
||||
This suffix is the primary mechanism for protecting against split-brain situations, and
|
||||
enabling safe multi-attachment of tenants:
|
||||
|
||||
- Two pageservers running with the same node ID (e.g. after a failure, where there is
|
||||
some rogue pageserver still running) will not try to write to the same objects, because at startup they will have re-attached tenants and thereby incremented
|
||||
generation numbers.
|
||||
- Multiple attachments (to different pageservers) of the same tenant will not try to write to the same objects, as each attachment would have a distinct generation.
|
||||
|
||||
The generation is appended in hex format (8 byte string representing
|
||||
u32), to all our existing key names. A u32's range limit would permit
|
||||
27 restarts _per second_ over a 5 year system lifetime: orders of magnitude more than
|
||||
is realistic.
|
||||
|
||||
The exact meaning of the generation suffix can evolve over time if necessary, for
|
||||
example if we chose to implement a failover mechanism internally to the pageservers
|
||||
rather than going via the control plane. The storage format just sees it as a number,
|
||||
with the only semantic property being that the highest numbered index is the latest.
|
||||
|
||||
#### Index changes
|
||||
|
||||
Since object keys now include a generation suffix, the index of these keys must also be updated. IndexPart currently stores keys and LSNs sufficient to reconstruct key names: this would be extended to store the generation as well.
|
||||
|
||||
This will increase the size of the file, but only modestly: layers are already encoded as
|
||||
their string-ized form, so the overhead is about 10 bytes per layer. This will be less if/when
|
||||
the index storage format is migrated to a binary format from JSON.
|
||||
|
||||
#### Visibility
|
||||
|
||||
_This section doesn't describe code changes, but extends on the consequences of the
|
||||
object key changes given above_
|
||||
|
||||
##### Visibility of objects to pageservers
|
||||
|
||||
Pageservers can of course list objects in S3 at any time, but in practice their
|
||||
visible set is based on the contents of their LayerMap, which is initialized
|
||||
from the `index_part.json.???` that they load.
|
||||
|
||||
Starting with the `index_part` from the most recent previous generation
|
||||
(see [loading index_part](#finding-the-remote-indices-for-timelines)), a pageserver
|
||||
initially has visibility of all the objects that were referenced in the loaded index.
|
||||
These objects are guaranteed to remain visible until the current generation is
|
||||
superseded, via pageservers in older generations avoiding deletions (see [deletion](#deletion)).
|
||||
|
||||
The "most recent previous generation" is _not_ necessarily the most recent
|
||||
in terms of walltime, it is the one that is readable at the time a new generation
|
||||
starts. Consider the following sequence of a tenant being re-attached to different
|
||||
pageserver nodes:
|
||||
|
||||
- Create + attach on PS1 in generation 1
|
||||
- PS1 Do some work, write out index_part.json-0001
|
||||
- Attach to PS2 in generation 2
|
||||
- Read index_part.json-0001
|
||||
- PS2 starts doing some work...
|
||||
- Attach to PS3 in generation 3
|
||||
- Read index_part.json-0001
|
||||
- **...PS2 finishes its work: now it writes index_part.json-0002**
|
||||
- PS3 writes out index_part.json-0003
|
||||
|
||||
In the above sequence, the ancestry of indices is:
|
||||
|
||||
```
|
||||
0001 -> 0002
|
||||
|
|
||||
-> 0003
|
||||
```
|
||||
|
||||
This is not an issue for safety: if the 0002 references some object that is
|
||||
not in 0001, then 0003 simply does not see it, and will re-do whatever
|
||||
work was required (e.g. ingesting WAL or doing compaction). Objects referenced
|
||||
by only the 0002 index will never be read by future attachment generations, and
|
||||
will eventually be cleaned up by a scrub (see [scrubbing](#cleaning-up-orphan-objects-scrubbing)).
|
||||
|
||||
##### Visibility of LSNs to clients
|
||||
|
||||
Because index_part.json is now written with a generation suffix, which data
|
||||
is visible depends on which generation the reader is operating in:
|
||||
|
||||
- If one was passively reading from S3 from outside of a pageserver, the
|
||||
visibility of data would depend on which index_part.json-<generation> file
|
||||
one had chosen to read from.
|
||||
- If two pageservers have the same tenant attached, they may have different
|
||||
data visible as they're independently replaying the WAL, and maintaining
|
||||
independent LayerMaps that are written to independent index_part.json files.
|
||||
Data does not have to be remotely committed to be visible.
|
||||
- For a pageserver writing with a stale generation, historic LSNs
|
||||
remain readable until another pageserver (with a higher generation suffix)
|
||||
decides to execute GC deletions. At this point, we may think of the stale
|
||||
attachment's generation as having logically ended: during its existence
|
||||
the generation had a consistent view of the world.
|
||||
- For a newly attached pageserver, its highest visible LSN may appears to
|
||||
go backwards with respect to an earlier attachment, if that earlier
|
||||
attachment had not uploaded all data to S3 before the new attachment.
|
||||
|
||||
### Deletion
|
||||
|
||||
#### Generation number validation
|
||||
|
||||
While writes are de-conflicted by writers always using their own generation number in the key,
|
||||
deletions are slightly more challenging: if a pageserver A is isolated, and the true active node is
|
||||
pageserver B, then it is dangerous for A to do any object deletions, even of objects that it wrote
|
||||
itself, because pageserver's B metadata might reference those objects.
|
||||
|
||||
We solve this by inserting a "generation validation" step between the write of a remote index
|
||||
that un-links a particular object from the index, and the actual deletion of the object, such
|
||||
that deletions strictly obey the following ordering:
|
||||
|
||||
1. Write out index_part.json: this guarantees that any subsequent reader of the metadata will
|
||||
not try and read the object we unlinked.
|
||||
2. Call out to control plane to validate that the generation which we use for our attachment is still the latest.
|
||||
3. If step 2 passes, it is safe to delete the object. Why? The check-in with control plane
|
||||
together with our visibility rules guarantees that any later generation
|
||||
will use either the exact `index_part.json` that we uploaded in step 1, or a successor
|
||||
of it; not an earlier one. In both cases, the `index_part.json` doesn't reference the
|
||||
key we are deleting anymore, so, the key is invisible to any later attachment generation.
|
||||
Hence it's safe to delete it.
|
||||
|
||||
Note that at step 2 we are only confirming that deletions of objects _no longer referenced
|
||||
by the specific `index_part.json` written in step 1_ are safe. If we were attempting other deletions concurrently,
|
||||
these would need their own generation validation step.
|
||||
|
||||
If step 2 fails, we may leak the object. This is safe, but has a cost: see [scrubbing](#cleaning-up-orphan-objects-scrubbing). We may avoid this entirely outside of node
|
||||
failures, if we do proper flushing of deletions on clean shutdown and clean migration.
|
||||
|
||||
To avoid doing a huge number of control plane requests to perform generation validation,
|
||||
validation of many tenants will be done in a single request, and deletions will be queued up
|
||||
prior to validation: see [Persistent deletion queue](#persistent-deletion-queue) for more.
|
||||
|
||||
#### `remote_consistent_lsn` updates
|
||||
|
||||
Remote objects are not the only kind of deletion the pageserver does: it also indirectly deletes
|
||||
WAL data, by feeding back remote_consistent_lsn to safekeepers, as a signal to the safekeepers that
|
||||
they may drop data below this LSN.
|
||||
|
||||
For the same reasons that deletion of objects must be guarded by an attachment generation number
|
||||
validation step, updates to `remote_consistent_lsn` are subject to the same rules, using
|
||||
an ordering as follows:
|
||||
|
||||
1. upload the index_part that covers data up to LSN `L0` to S3
|
||||
2. Call out to control plane to validate that the generation which we use for our attachment is still the latest.
|
||||
3. advance the `remote_consistent_lsn` that we advertise to the safekeepers to `L0`
|
||||
|
||||
If step 2 fails, then the `remote_consistent_lsn` advertised
|
||||
to safekeepers will not advance again until a pageserver
|
||||
with the latest generation is ready to do so.
|
||||
|
||||
**Note:** at step 3 we are not advertising the _latest_ remote_consistent_lsn, we are
|
||||
advertising the value in the index_part that we uploaded in step 1. This provides
|
||||
a strong ordering guarantee.
|
||||
|
||||
Internally to the pageserver, each timeline will have two remote_consistent_lsn values: the one that
|
||||
reflects its latest write to remote storage, and the one that reflects the most
|
||||
recent validation of generation number. It is only the latter value that may
|
||||
be advertised to the outside world (i.e. to the safekeeper).
|
||||
|
||||
The control plane remains unaware of `remote_consistent_lsn`: it only has to validate
|
||||
the freshness of generation numbers, thereby granting the pageserver permission to
|
||||
share the information with the safekeeper.
|
||||
|
||||
For convenience, in subsequent sections and RFCs we will use "deletion" to mean both deletion
|
||||
of objects in S3, and updates to the `remote_consistent_lsn`, as updates to the remote consistent
|
||||
LSN are de-facto deletions done via the safekeeper, and both kinds of deletion are subject to
|
||||
the same generation validation requirement.
|
||||
|
||||
### Pageserver attach/startup changes
|
||||
|
||||
#### Attachment
|
||||
|
||||
Calls to `/v1/tenant/{tenant_id}/attach` are augmented with an additional
|
||||
`generation` field in the body.
|
||||
|
||||
The pageserver does not persist this: a generation is only good for the lifetime
|
||||
of a process.
|
||||
|
||||
#### Finding the remote indices for timelines
|
||||
|
||||
Because index files are now suffixed with generation numbers, the pageserver
|
||||
cannot always GET the remote index in one request, because it can't always
|
||||
know a-priori what the latest remote index is.
|
||||
|
||||
Typically, the most recent generation to write an index would be our own
|
||||
generation minus 1. However, this might not be the case: the previous
|
||||
node might have started and acquired a generation number, and then crashed
|
||||
before writing out a remote index.
|
||||
|
||||
In the general case and as a fallback, the pageserver may list all the `index_part.json`
|
||||
files for a timeline, sort them by generation, and pick the highest that is `<=`
|
||||
its current generation for this attachment. The tenant should never load an index
|
||||
with an attachment generation _newer_ than its own.
|
||||
These two rules combined ensure that objects written by later generations are never visible to earlier generations.
|
||||
|
||||
Note that if a given attachment picks an index part from an earlier generation (say n-2), but crashes & restarts before it writes its own generation's index part, next time it tries to pick an index part there may be an index part from generation n-1.
|
||||
It would pick the n-1 index part in that case, because it's sorted higher than the previous one from generation n-2.
|
||||
So, above rules guarantee no determinism in selecting the index part.
|
||||
are allowed to be attached with stale attachment generations during a multiply-attached
|
||||
phase in a migration, and in this instance if the old location's pageserver restarts,
|
||||
it should not try and load the newer generation's index.
|
||||
|
||||
To summarize, on starting a timeline, the pageserver will:
|
||||
|
||||
1. Issue a GET for index_part.json-<my generation - 1>
|
||||
2. If 1 failed, issue a ListObjectsv2 request for index_part.json\* and
|
||||
pick the newest.
|
||||
|
||||
One could optimize this further by using the control plane to record specifically
|
||||
which generation most recently wrote an index_part.json, if necessary, to increase
|
||||
the probability of finding the index_part.json in one GET. One could also improve
|
||||
the chances by having pageservers proactively write out index_part.json after they
|
||||
get a new generation ID.
|
||||
|
||||
#### Re-attachment on startup
|
||||
|
||||
On startup, the pageserver will call out to an new control plane `/re-attach`
|
||||
API (see [Generation API](#generation-api)). This returns a list of
|
||||
tenants that should be attached to the pageserver, and their generation numbers, which
|
||||
the control plane will increment before returning.
|
||||
|
||||
The pageserver should still scan its local disk on startup, but should _delete_
|
||||
any local content for tenants not indicated in the `/re-attach` response: their
|
||||
absence is an implicit detach operation.
|
||||
|
||||
**Note** if a tenant is omitted from the re-attach response, its local disk content
|
||||
will be deleted. This will change in subsequent work, when the control plane gains
|
||||
the concept of a secondary/standby location: a node with local content may revert
|
||||
to this status and retain some local content.
|
||||
|
||||
#### Cleaning up previous generations' remote indices
|
||||
|
||||
Deletion of old indices is not necessary for correctness, although it is necessary
|
||||
to avoid the ListObjects fallback in the previous section becoming ever more expensive.
|
||||
|
||||
Once the new attachment has written out its index_part.json, it may asynchronously clean up historic index_part.json
|
||||
objects that were found.
|
||||
|
||||
We may choose to implement this deletion either as an explicit step after we
|
||||
write out index_part for the first time in a pageserver's lifetime, or for
|
||||
simplicity just do it periodically as part of the background scrub (see [scrubbing](#cleaning-up-orphan-objects-scrubbing));
|
||||
|
||||
### Control Plane Changes
|
||||
|
||||
#### Store generations for attaching tenants
|
||||
|
||||
- The `Project` table must store the generation number for use when
|
||||
attaching the tenant to a new pageserver.
|
||||
- The `/v1/tenant/:tenant_id/attach` pageserver API will require the generation number,
|
||||
which the control plane can supply by simply incrementing the `Project`'s
|
||||
generation number each time the tenant is attached to a different server: the same database
|
||||
transaction that changes the assigned pageserver should also change the generation number.
|
||||
|
||||
#### Generation API
|
||||
|
||||
This section describes an API that could be provided directly by the control plane,
|
||||
or built as a separate microservice. In earlier parts of the RFC, when we
|
||||
discuss the control plane providing generation numbers, we are referring to this API.
|
||||
|
||||
The API endpoints used by the pageserver to acquire and validate generation
|
||||
numbers are quite simple, and only require access to some persistent and
|
||||
linerizable storage (such as a database).
|
||||
|
||||
Building this into the control plane is proposed as a least-effort option to exploit existing infrastructure and implement generation number issuance in the same transaction that mandates it (i.e., the transaction that updates the `Project` assignment to another pageserver).
|
||||
However, this is not mandatory: this "Generation Number Issuer" could
|
||||
be built as a microservice. In practice, we will write such a miniature service
|
||||
anyway, to enable E2E pageserver/compute testing without control plane.
|
||||
|
||||
The endpoints required by pageservers are:
|
||||
|
||||
##### `/re-attach`
|
||||
|
||||
- Request: `{node_id: <u32>}`
|
||||
- Response:
|
||||
- 200 `{tenants: [{id: <TenantId>, gen: <u32>}]}`
|
||||
- 404: unknown node_id
|
||||
- (Future: 429: flapping detected, perhaps nodes are fighting for the same node ID,
|
||||
or perhaps this node was in a retry loop)
|
||||
- (On unknown tenants, omit tenant from `tenants` array)
|
||||
- Server behavior: query database for which tenants should be attached to this pageserver.
|
||||
- for each tenant that should be attached, increment the attachment generation and
|
||||
include the new generation in the response
|
||||
- Client behavior:
|
||||
- for all tenants in the response, activate with the new generation number
|
||||
- for any local disk content _not_ referenced in the response, act as if we
|
||||
had been asked to detach it (i.e. delete local files)
|
||||
|
||||
**Note** the `node_id` in this request will change in future if we move to ephemeral
|
||||
node IDs, to be replaced with some correlation ID that helps the control plane realize
|
||||
if a process is running with the same storage as a previous pageserver process (e.g.
|
||||
we might use EC instance ID, or we might just write some UUID to the disk the first
|
||||
time we use it)
|
||||
|
||||
##### `/validate`
|
||||
|
||||
- Request: `{'tenants': [{tenant: <tenant id>, attach_gen: <gen>}, ...]}'`
|
||||
- Response:
|
||||
- 200 `{'tenants': [{tenant: <tenant id>, status: <bool>}...]}`
|
||||
- (On unknown tenants, omit tenant from `tenants` array)
|
||||
- Purpose: enable the pageserver to discover for the given attachments whether they are still the latest.
|
||||
- Server behavior: this is a read-only operation: simply compare the generations in the request with
|
||||
the generations known to the server, and set status to `true` if they match.
|
||||
- Client behavior: clients must not do deletions within a tenant's remote data until they have
|
||||
received a response indicating the generation they hold for the attachment is current.
|
||||
|
||||
#### Use of `/load` and `/ignore` APIs
|
||||
|
||||
Because the pageserver will be changed to only attach tenants on startup
|
||||
based on the control plane's response to a `/re-attach` request, the load/ignore
|
||||
APIs no longer make sense in their current form.
|
||||
|
||||
The `/load` API becomes functionally equivalent to attach, and will be removed:
|
||||
any location that used `/load` before should just attach instead.
|
||||
|
||||
The `/ignore` API is equivalent to detaching, but without deleting local files.
|
||||
|
||||
### Timeline/Branch creation & deletion
|
||||
|
||||
All of the previous arguments for safety have described operations within
|
||||
a timeline, where we may describe a sequence that includes updates to
|
||||
index_part.json, and where reads and writes are coming from a postgres
|
||||
endpoint (writes via the safekeeper).
|
||||
|
||||
Creating or destroying timeline is a bit different, because writes
|
||||
are coming from the control plane.
|
||||
|
||||
We must be safe against scenarios such as:
|
||||
|
||||
- A tenant is attached to pageserver B while pageserver A is
|
||||
in the middle of servicing an RPC from the control plane to
|
||||
create or delete a tenant.
|
||||
- A pageserver A has been sent a timeline creation request
|
||||
but becomes unresponsive. The tenant is attached to a
|
||||
different pageserver B, and the timeline creation request
|
||||
is sent there too.
|
||||
|
||||
#### Timeline Creation
|
||||
|
||||
If some very slow node tries to do a timeline creation _after_
|
||||
a more recent generation node has already created the timeline
|
||||
and written some data into it, that must not cause harm. This
|
||||
is provided in timeline creations by the way all the objects
|
||||
within the timeline's remote path include a generation suffix:
|
||||
a slow node in an old generation that attempts to "create" a timeline
|
||||
that already exists will just emit an index_part.json with
|
||||
an old generation suffix.
|
||||
|
||||
Timeline IDs are never reused, so we don't have
|
||||
to worry about the case of create/delete/create cycles. If they
|
||||
were re-used during a disaster recovery "un-delete" of a timeline,
|
||||
that special case can be handled by calling out to all available pageservers
|
||||
to check that they return 404 for the timeline, and to flush their
|
||||
deletion queues in case they had any deletions pending from the
|
||||
timeline.
|
||||
|
||||
The above makes it safe for control plane to change the assignment of
|
||||
tenant to pageserver in control plane while a timeline creation is ongoing.
|
||||
The reason is that the creation request against the new assigned pageserver
|
||||
uses a new generation number. However, care must be taken by control plane
|
||||
to ensure that a "timeline creation successul" response from some pageserver
|
||||
is checked for the pageserver's generation for that timeline's tenant still being the latest.
|
||||
If it is not the latest, the response does not constitute a successful timeline creation.
|
||||
It is acceptable to discard such responses, the scrubber will clean up the S3 state.
|
||||
It is better to issue a timelien deletion request to the stale attachment.
|
||||
|
||||
#### Timeline Deletion
|
||||
|
||||
Tenant/timeline deletion operations are exempt from generation validation
|
||||
on deletes, and therefore don't have to go through the same deletion
|
||||
queue as GC/compaction layer deletions. This is because once a
|
||||
delete is issued by the control plane, it is a promise that the
|
||||
control plane will keep trying until the deletion is done, so even stale
|
||||
pageservers are permitted to go ahead and delete the objects.
|
||||
|
||||
The implications of this for control plane are:
|
||||
|
||||
- During timeline/tenant deletion, the control plane must wait for the deletion to
|
||||
be truly complete (status 404) and also handle the case where the pageserver
|
||||
becomes unavailable, either by waiting for a replacement with the same node_id,
|
||||
or by *re-attaching the tenant elsewhere.
|
||||
|
||||
- The control plane must persist its intent to delete
|
||||
a timeline/tenant before issuing any RPCs, and then once it starts, it must
|
||||
keep retrying until the tenant/timeline is gone. This is already handled
|
||||
by using a persistent `Operation` record that is retried indefinitely.
|
||||
|
||||
Timeline deletion may result in a special kind of object leak, where
|
||||
the latest generation attachment completes a deletion (including erasing
|
||||
all objects in the timeline path), but some slow/partitioned node is
|
||||
writing into the timeline path with a stale generation number. This would
|
||||
not be caught by any per-timeline scrubbing (see [scrubbing](#cleaning-up-orphan-objects-scrubbing)), since scrubbing happens on the
|
||||
attached pageserver, and once the timeline is deleted it isn't attached anywhere.
|
||||
This scenario should be pretty rare, and the control plane can make it even
|
||||
rarer by ensuring that if a tenant is in a multi-attached state (e.g. during
|
||||
migration), we wait for that to complete before processing the deletion. Beyond
|
||||
that, we may implement some other top-level scrub of timelines in
|
||||
an external tool, to identify any tenant/timeline paths that are not found
|
||||
in the control plane database.
|
||||
|
||||
#### Examples
|
||||
|
||||
- Deletion, node restarts partway through:
|
||||
- By the time we returned 202, we have written a remote delete marker
|
||||
- Any subsequent incarnation of the same node_id will see the remote
|
||||
delete marker and continue to process the deletion
|
||||
- If the original pageserver is lost permanently and no replacement
|
||||
with the same node_id is available, then the control plane must recover
|
||||
by re-attaching the tenant to a different node.
|
||||
- Creation, node becomes unresponsive partway through.
|
||||
- Control plane will see HTTP request timeout, keep re-issuing
|
||||
request to whoever is the latest attachment point for the tenant
|
||||
until it succeeds.
|
||||
- Stale nodes may be trying to execute timeline creation: they will
|
||||
write out index_part.json files with
|
||||
stale attachment generation: these will be eventually cleaned up
|
||||
by the same mechanism as other old indices.
|
||||
|
||||
### Unsafe case on badly behaved infrastructure
|
||||
|
||||
This section is only relevant if running on a different environment
|
||||
than EC2 machines with ephemeral disks.
|
||||
|
||||
If we ever run pageservers on infrastructure that might transparently restart
|
||||
a pageserver while leaving an old process running (e.g. a VM gets rescheduled
|
||||
without the old one being fenced), then there is a risk of corruption, when
|
||||
the control plane attaches the tenant, as follows:
|
||||
|
||||
- If the control plane sends an `/attach` request to node A, then node A dies
|
||||
and is replaced, and the control plane's retries the request without
|
||||
incrementing that attachment ID, then it could end up with two physical nodes
|
||||
both using the same generation number.
|
||||
- This is not an issue when using EC2 instances with ephemeral storage, as long
|
||||
as the control plane never re-uses a node ID, but it would need re-examining
|
||||
if running on different infrastructure.
|
||||
- To robustly protect against this class of issue, we would either:
|
||||
- add a "node generation" to distinguish between different processes holding the
|
||||
same node_id.
|
||||
- or, dispense with static node_id entirely and issue an ephemeral ID to each
|
||||
pageserver process when it starts.
|
||||
|
||||
## Implementation Part 2: Optimizations
|
||||
|
||||
### Persistent deletion queue
|
||||
|
||||
Between writing our a new index_part.json that doesn't reference an object,
|
||||
and executing the deletion, an object passes through a window where it is
|
||||
only referenced in memory, and could be leaked if the pageserver is stopped
|
||||
uncleanly. That introduces conflicting incentives: on the one hand, we would
|
||||
like to delay and batch deletions to
|
||||
1. minimize the cost of the mandatory validations calls to control plane, and
|
||||
2. minimize cost for DeleteObjects requests.
|
||||
On the other hand we would also like to minimize leakage by executing
|
||||
deletions promptly.
|
||||
|
||||
To resolve this, we may make the deletion queue persistent
|
||||
and then executing these in the background at a later time.
|
||||
|
||||
_Note: The deletion queue's reason for existence is optimization rather than correctness,
|
||||
so there is a lot of flexibility in exactly how the it should work,
|
||||
as long as it obeys the rule to validate generations before executing deletions,
|
||||
so the following details are not essential to the overall RFC._
|
||||
|
||||
#### Scope
|
||||
|
||||
The deletion queue will be global per pageserver, not per-tenant. There
|
||||
are several reasons for this choice:
|
||||
|
||||
- Use the queue as a central point to coalesce validation requests to the
|
||||
control plane: this avoids individual `Timeline` objects ever touching
|
||||
the control plane API, and avoids them having to know the rules about
|
||||
validating deletions. This separation of concerns will avoid burdening
|
||||
the already many-LoC `Timeline` type with even more responsibility.
|
||||
- Decouple the deletion queue from Tenant attachment lifetime: we may
|
||||
"hibernate" an inactive tenant by tearing down its `Tenant`/`Timeline`
|
||||
objects in the pageserver, without having to wait for deletions to be done.
|
||||
- Amortize the cost of I/O for the persistent queue, instead of having many
|
||||
tiny queues.
|
||||
- Coalesce deletions into a smaller number of larger DeleteObjects calls
|
||||
|
||||
Because of the cost of doing I/O for persistence, and the desire to coalesce
|
||||
generation validation requests across tenants, and coalesce deletions into
|
||||
larger DeleteObjects requests, there will be one deletion queue per pageserver
|
||||
rather than one per tenant. This has the added benefit that when deactivating
|
||||
a tenant, we do not have to drain their deletion queue: deletions can proceed
|
||||
for a tenant whose main `Tenant` object has been torn down.
|
||||
|
||||
#### Flow of deletion
|
||||
|
||||
The flow of a deletion is becomes:
|
||||
|
||||
1. Need for deletion of an object (=> layer file) is identified.
|
||||
2. Unlink the object from all the places that reference it (=> `index_part.json`).
|
||||
3. Enqueue the deletion to a persistent queue.
|
||||
Each entry is `tenant_id, attachment_generation, S3 key`.
|
||||
4. Validate & execute in batches:
|
||||
4.1 For a batch of entries, call into control plane.
|
||||
4.2 For the subset of entries that passed validation, execute a `DeleteObjects` S3 DELETE request for their S3 keys.
|
||||
|
||||
As outlined in the Part 1 on correctness, it is critical that deletions are only
|
||||
executed once the key is not referenced anywhere in S3.
|
||||
This property is obviously upheld by the scheme above.
|
||||
|
||||
#### We Accept Object Leakage In Acceptable Circumcstances
|
||||
|
||||
If we crash in the flow above between (2) and (3), we lose track of unreferenced object.
|
||||
Further, enqueuing a single to the persistent queue may not be durable immediately to amortize cost of flush to disk.
|
||||
This is acceptable for now, it can be caught by [the scrubber](#cleaning-up-orphan-objects-scrubbing).
|
||||
|
||||
There are various measures we can take to improve this in the future.
|
||||
1. Cap amount of time until enqueued entry becomes durable (timeout for flush-to-tisk)
|
||||
2. Proactively flush:
|
||||
- On graceful shutdown, as we anticipate that some or
|
||||
all of our attachments may be re-assigned while we are offline.
|
||||
- On tenant detach.
|
||||
3. For each entry, keep track of whether it has passed (2).
|
||||
Only admit entries to (4) one they have passed (2).
|
||||
This requires re-writing / two queue entries (intent, commit) per deletion.
|
||||
|
||||
The important take-away with any of the above is that it's not
|
||||
disastrous to leak objects in exceptional circumstances.
|
||||
|
||||
#### Operations that may skip the queue
|
||||
|
||||
Deletions of an entire timeline are [exempt](#Timeline-Deletion) from generation number validation. Once the
|
||||
control plane sends the deletion request, there is no requirement to retain the readability
|
||||
of any data within the timeline, and all objects within the timeline path may be deleted
|
||||
at any time from the control plane's deletion request onwards.
|
||||
|
||||
Since deletions of smaller timelines won't have enough objects to compose a full sized
|
||||
DeleteObjects request, it is still useful to send these through the last part of the
|
||||
deletion pipeline to coalesce with other executing deletions: to enable this, the
|
||||
deletion queue should expose two input channels: one for deletions that must be
|
||||
processed in a generation-aware way, and a fast path for timeline deletions, where
|
||||
that fast path may skip validation and the persistent queue.
|
||||
|
||||
### Cleaning up orphan objects (scrubbing)
|
||||
|
||||
An orphan object is any object which is no longer referenced by a running node or by metadata.
|
||||
|
||||
Examples of how orphan objects arise:
|
||||
|
||||
- A node PUTs a layer object, then crashes before it writes the
|
||||
index_part.json that references that layer.
|
||||
- A stale node carries on running for some time, and writes out an unbounded number of
|
||||
objects while it believes itself to be the rightful writer for a tenant.
|
||||
- A pageserver crashes between un-linking an object from the index, and persisting
|
||||
the object to its deletion queue.
|
||||
|
||||
Orphan objects are functionally harmless, but have a small cost due to S3 capacity consumed. We
|
||||
may clean them up at some time in the future, but doing a ListObjectsv2 operation and cross
|
||||
referencing with the latest metadata to identify objects which are not referenced.
|
||||
|
||||
Scrubbing will be done only by an attached pageserver (not some third party process), and deletions requested during scrub will go through the same
|
||||
validation as all other deletions: the attachment generation must be
|
||||
fresh. This avoids the possibility of a stale pageserver incorrectly
|
||||
thinking than an object written by a newer generation is stale, and deleting
|
||||
it.
|
||||
|
||||
It is not strictly necessary that scrubbing be done by an attached
|
||||
pageserver: it could also be done externally. However, an external
|
||||
scrubber would still require the same validation procedure that
|
||||
a pageserver's deletion queue performs, before actually erasing
|
||||
objects.
|
||||
|
||||
## Operational impact
|
||||
|
||||
### Availability
|
||||
|
||||
Coordination of generation numbers via the control plane introduce a dependency for certain
|
||||
operations:
|
||||
|
||||
1. Starting new pageservers (or activating pageservers after a restart)
|
||||
2. Executing enqueued deletions
|
||||
3. Advertising updated `remote_consistent_lsn` to enable WAL trimming
|
||||
|
||||
Item 1. would mean that some in-place restarts that previously would have resumed service even if the control plane were
|
||||
unavailable, will now not resume service to users until the control plane is available. We could
|
||||
avoid this by having a timeout on communication with the control plane, and after some timeout,
|
||||
resume service with the previous generation numbers (assuming this was persisted to disk). However,
|
||||
this is unlikely to be needed as the control plane is already an essential & highly available component. Also, having a node re-use an old generation number would complicate
|
||||
reasoning about the system, as it would break the invariant that a generation number uniquely identifies
|
||||
a tenant's attachment to a given pageserver _process_: it would merely identify the tenant's attachment
|
||||
to the pageserver _machine_ or its _on-disk-state_.
|
||||
|
||||
Item 2. is a non-issue operationally: it's harmless to delay deletions, the only impact of objects pending deletion is
|
||||
the S3 capacity cost.
|
||||
|
||||
Item 3. could be an issue if safekeepers are low on disk space and the control plane is unavailable for a long time. If this became an issue,
|
||||
we could adjust the safekeeper to delete segments from local disk sooner, as soon as they're uploaded to S3, rather than waiting for
|
||||
remote_consistent_lsn to advance.
|
||||
|
||||
For a managed service, the general approach should be to make sure we are monitoring & respond fast enough
|
||||
that control plane outages are bounded in time.
|
||||
|
||||
There is also the fact that control plane runs in a single region.
|
||||
The latency for distant regions is not a big concern for us because all request types added by this RFC are either infrequent or not in the way of the data path.
|
||||
However, we lose region isolation for the operations listed above.
|
||||
The ongoing work to split console and control will give us per-region control plane, and all operations in this RFC can be handled by these per-region control planes.
|
||||
With that in mind, we accept the trade-offs outlined in this paragraph.
|
||||
|
||||
We will also implement an "escape hatch" config generation numbers, where in a major disaster outage,
|
||||
we may manually run pageservers with a hand-selected generation number, so that we can bring them online
|
||||
independently of a control plane.
|
||||
|
||||
### Rollout
|
||||
|
||||
Although there is coupling between components, we may deploy most of the new data plane components
|
||||
independently of the control plane: initially they can just use a static generation number.
|
||||
|
||||
#### Phase 1
|
||||
|
||||
The pageserver is deployed with some special config to:
|
||||
|
||||
- Always act like everything is generation 1 and do not wait for a control plane issued generation on attach
|
||||
- Skip the places in deletion and remote_consistent_lsn updates where we would call into control plane
|
||||
|
||||
#### Phase 2
|
||||
|
||||
The control plane changes are deployed: control plane will now track and increment generation numbers.
|
||||
|
||||
#### Phase 3
|
||||
|
||||
The pageserver is deployed with its control-plane-dependent changes enabled: it will now require
|
||||
the control plane to service re-attach requests on startup, and handle generation
|
||||
validation requests.
|
||||
|
||||
### On-disk backward compatibility
|
||||
|
||||
Backward compatibility with existing data is straightforward:
|
||||
|
||||
- When reading the index, we may assume that any layer whose metadata doesn't include
|
||||
generations will have a path without generation suffix.
|
||||
- When locating the index file on attachment, we may use the "fallback" listing path
|
||||
and if there is only an index without generation suffix, that is the one we load.
|
||||
|
||||
It is not necessary to re-write existing layers: even new index files will be able
|
||||
to represent generation-less layers.
|
||||
|
||||
### On-disk forward compatibility
|
||||
|
||||
We will do a two phase rollout, probably over multiple releases because we will naturally
|
||||
have some of the read-side code ready before the overall functionality is ready:
|
||||
|
||||
1. Deploy pageservers which understand the new index format and generation suffixes
|
||||
in keys, but do not write objects with generation numbers in the keys.
|
||||
2. Deploy pageservers that write objects with generation numbers in the keys.
|
||||
|
||||
Old pageservers will be oblivious to generation numbers. That means that they can't
|
||||
read objects with generation numbers in the name. This is why we must
|
||||
first step must deploy the ability to read, before the second step
|
||||
starts writing them.
|
||||
|
||||
# Frequently Asked Questions
|
||||
|
||||
## Why a generation _suffix_ rather than _prefix_?
|
||||
|
||||
The choice is motivated by object listing, since one can list by prefix but not
|
||||
suffix.
|
||||
|
||||
In [finding remote indices](#finding-the-remote-indices-for-timelines), we rely
|
||||
on being able to do a prefix listing for `<tenant>/<timeline>/index_part.json*`.
|
||||
That relies on the prefix listing.
|
||||
|
||||
The converse case of using a generation prefix and listing by generation is
|
||||
not needed: one could imagine listing by generation while scrubbing (so that
|
||||
a particular generation's layers could be scrubbed), but this is not part
|
||||
of normal operations, and the [scrubber](#cleaning-up-orphan-objects-scrubbing) probably won't work that way anyway.
|
||||
|
||||
## Wouldn't it be simpler to have a separate deletion queue per timeline?
|
||||
|
||||
Functionally speaking, we could. That's how RemoteTimelineClient currently works,
|
||||
but this approach does not map well to a long-lived persistent queue with
|
||||
generation validation.
|
||||
|
||||
Anything we do per-timeline generates tiny random I/O, on a pageserver with
|
||||
tens of thousands of timelines operating: to be ready for high scale, we should:
|
||||
|
||||
- A) Amortize costs where we can (e.g. a shared deletion queue)
|
||||
- B) Expect to put tenants into a quiescent state while they're not
|
||||
busy: i.e. we shouldn't keep a tenant alive to service its deletion queue.
|
||||
|
||||
This was discussed in the [scope](#scope) part of the deletion queue section.
|
||||
|
||||
# Appendix A: Examples of use in high availability/failover
|
||||
|
||||
The generation numbers proposed in this RFC are adaptable to a variety of different
|
||||
failover scenarios and models. The sections below sketch how they would work in practice.
|
||||
|
||||
### In-place restart of a pageserver
|
||||
|
||||
"In-place" here means that the restart is done before any other element in the system
|
||||
has taken action in response to the node being down.
|
||||
|
||||
- After restart, the node issues a re-attach request to the control plane, and
|
||||
receives new generation numbers for all its attached tenants.
|
||||
- Tenants may be activated with the generation number in the re-attach response.
|
||||
- If any of its attachments were in fact stale (i.e. had be reassigned to another
|
||||
node while this node was offline), then
|
||||
- the re-attach response will inform the tenant about this by not including
|
||||
the tenant of this by _not_ incrementing the generation for that attachment.
|
||||
- This will implicitly block deletions in the tenant, but as an optimization
|
||||
the pageserver should also proactively stop doing S3 uploads when it notices this stale-generation state.
|
||||
- The control plane is expected to eventually detach this tenant from the
|
||||
pageserver.
|
||||
|
||||
If the control plane does not include a tenant in the re-attach response,
|
||||
but there is still local state for the tenant in the filesystem, the pageserver
|
||||
deletes the local state in response and does not load/active the tenant.
|
||||
See the [earlier section on pageserver startup](#pageserver-attachstartup-changes) for details.
|
||||
Control plane can use this mechanism to clean up a pageserver that has been
|
||||
down for so long that all its tenants were migrated away before it came back
|
||||
up again and asked for re-attach.
|
||||
|
||||
### Failure of a pageserver
|
||||
|
||||
In this context, read "failure" as the most ambiguous possible case, where
|
||||
a pageserver is unavailable to clients and control plane, but may still be executing and talking
|
||||
to S3.
|
||||
|
||||
#### Case A: re-attachment to other nodes
|
||||
|
||||
1. Let's say node 0 becomes unresponsive in a cluster of three nodes 0, 1, 2.
|
||||
2. Some external mechanism notices that the node is unavailable and initiates
|
||||
movement of all tenants attached to that node to a different node according
|
||||
to some distribution rule.
|
||||
In this example, it would mean incrementing the generation
|
||||
of all tenants that were attached to node 0, as each tenant's assigned pageserver changes.
|
||||
3. A tenant which is now attached to node 1 will _also_ still be attached to node
|
||||
0, from the perspective of node 0. Node 0 will still be using its old generation,
|
||||
node 1 will be using a newer generation.
|
||||
4. S3 writes will continue from nodes 0 and 1: there will be an index_part.json-00000001
|
||||
\_and\* an index_part.json-00000002. Objects written under the old suffix
|
||||
after the new attachment was created do not matter from the rest of the system's
|
||||
perspective: the endpoints are reading from the new attachment location. Objects
|
||||
written by node 0 are just garbage that can be cleaned up at leisure. Node 0 will
|
||||
not do any deletions because it can't synchronize with control plane, or if it could,
|
||||
its deletion queue processing would get errors for the validation requests.
|
||||
|
||||
#### Case B: direct node replacement with same node_id and drive
|
||||
|
||||
This is the scenario we would experience if running pageservers in some dynamic
|
||||
VM/container environment that would auto-replace a given node_id when it became
|
||||
unresponsive, with the node's storage supplied by some network block device
|
||||
that is attached to the replacement VM/container.
|
||||
|
||||
1. Let's say node 0 fails, and there may be some other peers but they aren't relevant.
|
||||
2. Some external mechanism notices that the node is unavailable, and creates
|
||||
a "new node 0" (Node 0b) which is a physically separate server. The original node 0
|
||||
(Node 0a) may still be running, because we do not assume the environment fences nodes.
|
||||
3. On startup, node 0b re-attaches and gets higher generation numbers for
|
||||
all tenants.
|
||||
4. S3 writes continue from nodes 0a and 0b, but the writes do not collide due to different
|
||||
generation in the suffix, and the writes from node 0a are not visible to the rest
|
||||
of the system because endpoints are reading only from node 0b.
|
||||
|
||||
# Appendix B: interoperability with other features
|
||||
|
||||
## Sharded Keyspace
|
||||
|
||||
The design in this RFC maps neatly to a sharded keyspace design where subsets of the key space
|
||||
for a tenant are assigned to different pageservers:
|
||||
|
||||
- the "unit of work" for attachments becomes something like a TenantShard rather than a Tenant
|
||||
- TenantShards get generation numbers just as Tenants do.
|
||||
- Write workload (ingest, compaction) for a tenant is spread out across pageservers via
|
||||
TenantShards, but each TenantShard still has exactly one valid writer at a time.
|
||||
|
||||
## Read replicas
|
||||
|
||||
_This section is about a passive reader of S3 pageserver state, not a postgres
|
||||
read replica_
|
||||
|
||||
For historical reads to LSNs below the remote persistent LSN, any node may act as a reader at any
|
||||
time: remote data is logically immutable data, and the use of deferred deletion in this RFC helps
|
||||
mitigate the fact that remote data is not _physically_ immutable (i.e. the actual data for a given
|
||||
page moves around as compaction happens).
|
||||
|
||||
A read replica needs to be aware of generations in remote data in order to read the latest
|
||||
metadata (find the index_part.json with the latest suffix). It may either query this
|
||||
from the control plane, or find it with ListObjectsv2 request
|
||||
|
||||
## Seamless migration
|
||||
|
||||
To make tenant migration totally seamless, we will probably want to intentionally double-attach
|
||||
a tenant briefly, serving reads from the old node while waiting for the new node to be ready.
|
||||
|
||||
This RFC enables that double-attachment: two nodes may be attached at the same time, with the migration destination
|
||||
having a higher generation number. The old node will be able to ingest and serve reads, but not
|
||||
do any deletes. The new node's attachment must also avoid deleting layers that the old node may
|
||||
still use. A new piece of state
|
||||
will be needed for this in the control plane's definition of an attachment.
|
||||
|
||||
## Warm secondary locations
|
||||
|
||||
To enable faster tenant movement after a pageserver is lost, we will probably want to spend some
|
||||
disk capacity on keeping standby locations populated with local disk data.
|
||||
|
||||
There's no conflict between this RFC and that: implementing warm secondary locations on a per-tenant basis
|
||||
would be a separate change to the control plane to store standby location(s) for a tenant. Because
|
||||
the standbys do not write to S3, they do not need to be assigned generation numbers. When a tenant is
|
||||
re-attached to a standby location, that would increment the tenant attachment generation and this
|
||||
would work the same as any other attachment change, but with a warm cache.
|
||||
|
||||
## Ephemeral node IDs
|
||||
|
||||
This RFC intentionally avoids changing anything fundamental about how pageservers are identified
|
||||
and registered with the control plane, to avoid coupling the implementation of pageserver split
|
||||
brain protection with more fundamental changes in the management of the pageservers.
|
||||
|
||||
Moving to ephemeral node IDs would provide an extra layer of
|
||||
resilience in the system, as it would prevent the control plane
|
||||
accidentally attaching to two physical nodes with the same
|
||||
generation, if somehow there were two physical nodes with
|
||||
the same node IDs (currently we rely on EC2 guarantees to
|
||||
eliminate this scenario). With ephemeral node IDs, there would be
|
||||
no possibility of that happening, no matter the behavior of
|
||||
underlying infrastructure.
|
||||
|
||||
Nothing fundamental in the pageserver's handling of generations needs to change to handle ephemeral node IDs, since we hardly use the
|
||||
`node_id` anywhere. The `/re-attach` API would be extended
|
||||
to enable the pageserver to obtain its ephemeral ID, and provide
|
||||
some correlation identifier (e.g. EC instance ID), to help the
|
||||
control plane re-attach tenants to the same physical server that
|
||||
previously had them attached.
|
||||
@@ -12,7 +12,6 @@ const_format.workspace = true
|
||||
anyhow.workspace = true
|
||||
bytes.workspace = true
|
||||
byteorder.workspace = true
|
||||
hex.workspace = true
|
||||
utils.workspace = true
|
||||
postgres_ffi.workspace = true
|
||||
enum-map.workspace = true
|
||||
|
||||
@@ -1,89 +0,0 @@
|
||||
/// Types in this file are for pageserver's upward-facing API calls to the control plane
|
||||
use hex::FromHex;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use utils::id::{NodeId, TenantId};
|
||||
|
||||
/// TenantId's serialization is an array of u8, which is rather unfriendly
|
||||
/// for outside callers who aren't working with the native Rust TenantId.
|
||||
/// This class wraps it in serialization that is just the hex strict
|
||||
/// representation.
|
||||
#[derive(Eq, PartialEq, Clone, Hash)]
|
||||
pub struct HexTenantId(TenantId);
|
||||
|
||||
impl HexTenantId {
|
||||
pub fn new(t: TenantId) -> Self {
|
||||
Self(t)
|
||||
}
|
||||
|
||||
pub fn take(self) -> TenantId {
|
||||
self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl AsRef<TenantId> for HexTenantId {
|
||||
fn as_ref(&self) -> &TenantId {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl Serialize for HexTenantId {
|
||||
fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error>
|
||||
where
|
||||
S: serde::Serializer,
|
||||
{
|
||||
let hex = self.0.hex_encode();
|
||||
serializer.collect_str(&hex)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'de> Deserialize<'de> for HexTenantId {
|
||||
fn deserialize<D>(deserializer: D) -> Result<Self, D::Error>
|
||||
where
|
||||
D: serde::Deserializer<'de>,
|
||||
{
|
||||
let string = String::deserialize(deserializer)?;
|
||||
TenantId::from_hex(string)
|
||||
.map(|t| HexTenantId::new(t))
|
||||
.map_err(|e| serde::de::Error::custom(format!("{e}")))
|
||||
}
|
||||
}
|
||||
|
||||
// Top level s
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ReAttachRequest {
|
||||
pub node_id: NodeId,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ReAttachResponseTenant {
|
||||
pub id: HexTenantId,
|
||||
pub generation: u32,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ReAttachResponse {
|
||||
pub tenants: Vec<ReAttachResponseTenant>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ValidateRequestTenant {
|
||||
pub id: HexTenantId,
|
||||
pub gen: u32,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ValidateRequest {
|
||||
pub tenants: Vec<ValidateRequestTenant>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ValidateResponse {
|
||||
pub tenants: Vec<ValidateResponseTenant>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct ValidateResponseTenant {
|
||||
pub id: HexTenantId,
|
||||
pub valid: bool,
|
||||
}
|
||||
@@ -1,7 +1,6 @@
|
||||
use const_format::formatcp;
|
||||
|
||||
/// Public API types
|
||||
pub mod control_api;
|
||||
pub mod models;
|
||||
pub mod reltag;
|
||||
|
||||
|
||||
@@ -194,9 +194,6 @@ pub struct TimelineCreateRequest {
|
||||
pub struct TenantCreateRequest {
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
pub new_tenant_id: TenantId,
|
||||
#[serde(default)]
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
pub generation: Option<u32>,
|
||||
#[serde(flatten)]
|
||||
pub config: TenantConfig, // as we have a flattened field, we should reject all unknown fields in it
|
||||
}
|
||||
@@ -244,6 +241,15 @@ pub struct StatusResponse {
|
||||
pub id: NodeId,
|
||||
}
|
||||
|
||||
impl TenantCreateRequest {
|
||||
pub fn new(new_tenant_id: TenantId) -> TenantCreateRequest {
|
||||
TenantCreateRequest {
|
||||
new_tenant_id,
|
||||
config: TenantConfig::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[serde_as]
|
||||
#[derive(Serialize, Deserialize, Debug)]
|
||||
#[serde(deny_unknown_fields)]
|
||||
@@ -287,11 +293,9 @@ impl TenantConfigRequest {
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, Deserialize)]
|
||||
#[derive(Debug, Serialize, Deserialize)]
|
||||
pub struct TenantAttachRequest {
|
||||
pub config: TenantAttachConfig,
|
||||
#[serde(default)]
|
||||
pub generation: Option<u32>,
|
||||
}
|
||||
|
||||
/// Newtype to enforce deny_unknown_fields on TenantConfig for
|
||||
|
||||
@@ -13,14 +13,13 @@ use std::{
|
||||
collections::HashMap,
|
||||
fmt::Debug,
|
||||
num::{NonZeroU32, NonZeroUsize},
|
||||
path::{Path, PathBuf, StripPrefixError},
|
||||
path::{Path, PathBuf},
|
||||
pin::Pin,
|
||||
sync::Arc,
|
||||
};
|
||||
|
||||
use anyhow::{bail, Context};
|
||||
|
||||
use serde::{Deserialize, Serialize};
|
||||
use tokio::io;
|
||||
use toml_edit::Item;
|
||||
use tracing::info;
|
||||
@@ -45,34 +44,12 @@ pub const DEFAULT_MAX_KEYS_PER_LIST_RESPONSE: Option<i32> = None;
|
||||
|
||||
const REMOTE_STORAGE_PREFIX_SEPARATOR: char = '/';
|
||||
|
||||
// From the S3 spec
|
||||
pub const MAX_KEYS_PER_DELETE: usize = 1000;
|
||||
|
||||
/// Path on the remote storage, relative to some inner prefix.
|
||||
/// The prefix is an implementation detail, that allows representing local paths
|
||||
/// as the remote ones, stripping the local storage prefix away.
|
||||
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord, Hash)]
|
||||
pub struct RemotePath(PathBuf);
|
||||
|
||||
impl Serialize for RemotePath {
|
||||
fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error>
|
||||
where
|
||||
S: serde::Serializer,
|
||||
{
|
||||
serializer.collect_str(self)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'de> Deserialize<'de> for RemotePath {
|
||||
fn deserialize<D>(deserializer: D) -> Result<Self, D::Error>
|
||||
where
|
||||
D: serde::Deserializer<'de>,
|
||||
{
|
||||
let str = String::deserialize(deserializer)?;
|
||||
Ok(Self(PathBuf::from(&str)))
|
||||
}
|
||||
}
|
||||
|
||||
impl std::fmt::Display for RemotePath {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
write!(f, "{}", self.0.display())
|
||||
@@ -111,15 +88,6 @@ impl RemotePath {
|
||||
pub fn extension(&self) -> Option<&str> {
|
||||
self.0.extension()?.to_str()
|
||||
}
|
||||
|
||||
/// Unwrap the PathBuf that RemotePath wraps
|
||||
pub fn take(self) -> PathBuf {
|
||||
self.0
|
||||
}
|
||||
|
||||
pub fn strip_prefix(&self, p: &RemotePath) -> Result<&Path, StripPrefixError> {
|
||||
self.0.strip_prefix(&p.0)
|
||||
}
|
||||
}
|
||||
|
||||
/// Storage (potentially remote) API to manage its state.
|
||||
@@ -198,8 +166,6 @@ pub enum DownloadError {
|
||||
BadInput(anyhow::Error),
|
||||
/// The file was not found in the remote storage.
|
||||
NotFound,
|
||||
/// The client was shut down
|
||||
Shutdown,
|
||||
/// The file was found in the remote storage, but the download failed.
|
||||
Other(anyhow::Error),
|
||||
}
|
||||
@@ -211,7 +177,6 @@ impl std::fmt::Display for DownloadError {
|
||||
write!(f, "Failed to download a remote file due to user input: {e}")
|
||||
}
|
||||
DownloadError::NotFound => write!(f, "No file found for the remote object id given"),
|
||||
DownloadError::Shutdown => write!(f, "Client shutting down"),
|
||||
DownloadError::Other(e) => write!(f, "Failed to download a remote file: {e:?}"),
|
||||
}
|
||||
}
|
||||
@@ -276,18 +241,6 @@ impl GenericRemoteStorage {
|
||||
}
|
||||
}
|
||||
|
||||
/// For small, simple downloads where caller doesn't want to handle the streaming: return the full body
|
||||
pub async fn download_all(&self, from: &RemotePath) -> Result<Vec<u8>, DownloadError> {
|
||||
let mut download = self.download(from).await?;
|
||||
|
||||
let mut bytes = Vec::new();
|
||||
tokio::io::copy(&mut download.download_stream, &mut bytes)
|
||||
.await
|
||||
.with_context(|| format!("Failed to download body from {from}"))
|
||||
.map_err(DownloadError::Other)?;
|
||||
Ok(bytes)
|
||||
}
|
||||
|
||||
pub async fn download_byte_range(
|
||||
&self,
|
||||
from: &RemotePath,
|
||||
|
||||
@@ -148,53 +148,21 @@ impl RemoteStorage for LocalFs {
|
||||
Some(folder) => folder.with_base(&self.storage_root),
|
||||
None => self.storage_root.clone(),
|
||||
};
|
||||
|
||||
// If we were given a directory, we may use it as our starting point.
|
||||
// Otherwise, we must go up to the parent directory. This is because
|
||||
// S3 object list prefixes can be arbitrary strings, but when reading
|
||||
// the local filesystem we need a directory to start calling read_dir on.
|
||||
let mut initial_dir = full_path.clone();
|
||||
match fs::metadata(full_path.clone()).await {
|
||||
Err(e) => {
|
||||
// It's not a file that exists: strip the prefix back to the parent directory
|
||||
if matches!(e.kind(), ErrorKind::NotFound) {
|
||||
initial_dir.pop();
|
||||
}
|
||||
}
|
||||
Ok(meta) => {
|
||||
if !meta.is_dir() {
|
||||
// It's not a directory: strip back to the parent
|
||||
initial_dir.pop();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Note that PathBuf starts_with only considers full path segments, but
|
||||
// object prefixes are arbitrary strings, so we need the strings for doing
|
||||
// starts_with later.
|
||||
let prefix = full_path.to_string_lossy();
|
||||
|
||||
let mut files = vec![];
|
||||
let mut directory_queue = vec![initial_dir.clone()];
|
||||
let mut directory_queue = vec![full_path.clone()];
|
||||
|
||||
while let Some(cur_folder) = directory_queue.pop() {
|
||||
let mut entries = fs::read_dir(cur_folder.clone()).await?;
|
||||
while let Some(entry) = entries.next_entry().await? {
|
||||
let file_name: PathBuf = entry.file_name().into();
|
||||
let full_file_name = cur_folder.clone().join(&file_name);
|
||||
if full_file_name
|
||||
.to_str()
|
||||
.map(|s| s.starts_with(prefix.as_ref()))
|
||||
.unwrap_or(false)
|
||||
{
|
||||
let file_remote_path = self.local_file_to_relative_path(full_file_name.clone());
|
||||
files.push(file_remote_path.clone());
|
||||
if full_file_name.is_dir() {
|
||||
directory_queue.push(full_file_name);
|
||||
}
|
||||
let file_remote_path = self.local_file_to_relative_path(full_file_name.clone());
|
||||
files.push(file_remote_path.clone());
|
||||
if full_file_name.is_dir() {
|
||||
directory_queue.push(full_file_name);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Ok(files)
|
||||
}
|
||||
|
||||
|
||||
@@ -22,7 +22,7 @@ use aws_sdk_s3::{
|
||||
Client,
|
||||
};
|
||||
use aws_smithy_http::body::SdkBody;
|
||||
use hyper::{Body, StatusCode};
|
||||
use hyper::Body;
|
||||
use scopeguard::ScopeGuard;
|
||||
use tokio::{
|
||||
io::{self, AsyncRead},
|
||||
@@ -529,16 +529,7 @@ impl RemoteStorage for S3Bucket {
|
||||
}
|
||||
}
|
||||
Err(e) => {
|
||||
if let Some(r) = e.raw_response() {
|
||||
if r.http().status() == StatusCode::NOT_FOUND {
|
||||
// 404 is acceptable for deletions. AWS S3 does not return this, but
|
||||
// some other implementations might (e.g. GCS XML API returns 404 on DeleteObject
|
||||
// to a missing key)
|
||||
continue;
|
||||
} else {
|
||||
return Err(anyhow::format_err!("DeleteObjects response error: {e}"));
|
||||
}
|
||||
}
|
||||
return Err(e.into());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -31,8 +31,6 @@ fn lsn_invalid() -> Lsn {
|
||||
#[serde_as]
|
||||
#[derive(Debug, Clone, Deserialize, Serialize)]
|
||||
pub struct SkTimelineInfo {
|
||||
/// Term.
|
||||
pub term: Option<u64>,
|
||||
/// Term of the last entry.
|
||||
pub last_log_term: Option<u64>,
|
||||
/// LSN of the last record.
|
||||
@@ -60,6 +58,4 @@ pub struct SkTimelineInfo {
|
||||
/// A connection string to use for WAL receiving.
|
||||
#[serde(default)]
|
||||
pub safekeeper_connstr: Option<String>,
|
||||
#[serde(default)]
|
||||
pub http_connstr: Option<String>,
|
||||
}
|
||||
|
||||
@@ -38,7 +38,6 @@ url.workspace = true
|
||||
uuid.workspace = true
|
||||
|
||||
pq_proto.workspace = true
|
||||
postgres_connection.workspace = true
|
||||
metrics.workspace = true
|
||||
workspace_hack.workspace = true
|
||||
|
||||
|
||||
@@ -1,121 +0,0 @@
|
||||
use std::fmt::Display;
|
||||
|
||||
use serde::{Deserialize, Serialize};
|
||||
|
||||
#[derive(Copy, Clone, Debug, Eq, PartialEq, PartialOrd, Ord)]
|
||||
pub enum Generation {
|
||||
// Generations with this magic value will not add a suffix to S3 keys, and will not
|
||||
// be included in persisted index_part.json. This value is only to be used
|
||||
// during migration from pre-generation metadata to generation-aware metadata,
|
||||
// and should eventually go away.
|
||||
//
|
||||
// A special Generation is used rather than always wrapping Generation in an Option,
|
||||
// so that code handling generations doesn't have to be aware of the legacy
|
||||
// case everywhere it touches a generation.
|
||||
None,
|
||||
// Generations with this magic value may never be used to construct S3 keys:
|
||||
// we will panic if someone tries to. This is for Tenants in the "Broken" state,
|
||||
// so that we can satisfy their constructor with a Generation without risking
|
||||
// a code bug using it in an S3 write (broken tenants should never write)
|
||||
Broken,
|
||||
Valid(u32),
|
||||
}
|
||||
|
||||
/// The Generation type represents a number associated with a Tenant, which
|
||||
/// increments every time the tenant is attached to a new pageserver, or
|
||||
/// an attached pageserver restarts.
|
||||
///
|
||||
/// It is included as a suffix in S3 keys, as a protection against split-brain
|
||||
/// scenarios where pageservers might otherwise issue conflicting writes to
|
||||
/// remote storage
|
||||
impl Generation {
|
||||
/// Create a new Generation that represents a legacy key format with
|
||||
/// no generation suffix
|
||||
pub fn none() -> Self {
|
||||
Self::None
|
||||
}
|
||||
|
||||
// Create a new generation that will panic if you try to use get_suffix
|
||||
pub fn broken() -> Self {
|
||||
Self::Broken
|
||||
}
|
||||
|
||||
pub fn new(v: u32) -> Self {
|
||||
Self::Valid(v)
|
||||
}
|
||||
|
||||
pub fn is_none(&self) -> bool {
|
||||
matches!(self, Self::None)
|
||||
}
|
||||
|
||||
pub fn get_suffix(&self) -> String {
|
||||
match self {
|
||||
Self::Valid(v) => {
|
||||
format!("-{:08x}", v)
|
||||
}
|
||||
Self::None => "".into(),
|
||||
Self::Broken => {
|
||||
panic!("Tried to use a broken generation");
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn previous(&self) -> Self {
|
||||
if let Self::Valid(v) = self {
|
||||
Self::new(v - 1)
|
||||
} else {
|
||||
Self::none()
|
||||
}
|
||||
}
|
||||
|
||||
pub fn into(self) -> Option<u32> {
|
||||
if let Self::Valid(v) = self {
|
||||
Some(v)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl Serialize for Generation {
|
||||
fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error>
|
||||
where
|
||||
S: serde::Serializer,
|
||||
{
|
||||
if let Self::Valid(v) = self {
|
||||
v.serialize(serializer)
|
||||
} else {
|
||||
// We should never be asked to serialize a None or Broken. Structures
|
||||
// that include an optional generation should convert None to an
|
||||
// Option<Generation>::None
|
||||
Err(serde::ser::Error::custom(
|
||||
"Tried to serialize invalid generation",
|
||||
))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'de> Deserialize<'de> for Generation {
|
||||
fn deserialize<D>(deserializer: D) -> Result<Self, D::Error>
|
||||
where
|
||||
D: serde::Deserializer<'de>,
|
||||
{
|
||||
Ok(Self::Valid(u32::deserialize(deserializer)?))
|
||||
}
|
||||
}
|
||||
|
||||
impl Display for Generation {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
match self {
|
||||
Self::Valid(v) => {
|
||||
write!(f, "{:08x}", v)
|
||||
}
|
||||
Self::None => {
|
||||
write!(f, "<none>")
|
||||
}
|
||||
Self::Broken => {
|
||||
write!(f, "<broken>")
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -24,9 +24,6 @@ pub enum ApiError {
|
||||
#[error("Precondition failed: {0}")]
|
||||
PreconditionFailed(Box<str>),
|
||||
|
||||
#[error("Shutting down")]
|
||||
ShuttingDown,
|
||||
|
||||
#[error(transparent)]
|
||||
InternalServerError(anyhow::Error),
|
||||
}
|
||||
@@ -55,10 +52,6 @@ impl ApiError {
|
||||
self.to_string(),
|
||||
StatusCode::PRECONDITION_FAILED,
|
||||
),
|
||||
ApiError::ShuttingDown => HttpErrorBody::response_from_msg_and_status(
|
||||
"Shutting down".to_string(),
|
||||
StatusCode::SERVICE_UNAVAILABLE,
|
||||
),
|
||||
ApiError::InternalServerError(err) => HttpErrorBody::response_from_msg_and_status(
|
||||
err.to_string(),
|
||||
StatusCode::INTERNAL_SERVER_ERROR,
|
||||
|
||||
@@ -50,7 +50,7 @@ impl Id {
|
||||
Id::from(tli_buf)
|
||||
}
|
||||
|
||||
pub fn hex_encode(&self) -> String {
|
||||
fn hex_encode(&self) -> String {
|
||||
static HEX: &[u8] = b"0123456789abcdef";
|
||||
|
||||
let mut buf = vec![0u8; self.0.len() * 2];
|
||||
@@ -133,10 +133,6 @@ macro_rules! id_newtype {
|
||||
pub const fn from_array(b: [u8; 16]) -> Self {
|
||||
$t(Id(b))
|
||||
}
|
||||
|
||||
pub fn hex_encode(&self) -> String {
|
||||
self.0.hex_encode()
|
||||
}
|
||||
}
|
||||
|
||||
impl FromStr for $t {
|
||||
@@ -248,13 +244,13 @@ id_newtype!(TenantId);
|
||||
/// NOTE: It (de)serializes as an array of hex bytes, so the string representation would look
|
||||
/// like `[173,80,132,115,129,226,72,254,170,201,135,108,199,26,228,24]`.
|
||||
/// See [`Id`] for alternative ways to serialize it.
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Hash, PartialOrd, Ord)]
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Hash, Serialize, Deserialize, PartialOrd, Ord)]
|
||||
pub struct ConnectionId(Id);
|
||||
|
||||
id_newtype!(ConnectionId);
|
||||
|
||||
// A pair uniquely identifying Neon instance.
|
||||
#[derive(Debug, Clone, Copy, PartialOrd, Ord, PartialEq, Eq, Hash)]
|
||||
#[derive(Debug, Clone, Copy, PartialOrd, Ord, PartialEq, Eq, Hash, Serialize, Deserialize)]
|
||||
pub struct TenantTimelineId {
|
||||
pub tenant_id: TenantId,
|
||||
pub timeline_id: TimelineId,
|
||||
@@ -277,36 +273,6 @@ impl TenantTimelineId {
|
||||
}
|
||||
}
|
||||
|
||||
impl Serialize for TenantTimelineId {
|
||||
fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error>
|
||||
where
|
||||
S: serde::Serializer,
|
||||
{
|
||||
serializer.collect_str(self)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'de> Deserialize<'de> for TenantTimelineId {
|
||||
fn deserialize<D>(deserializer: D) -> Result<Self, D::Error>
|
||||
where
|
||||
D: serde::Deserializer<'de>,
|
||||
{
|
||||
let str = String::deserialize(deserializer)?;
|
||||
if let Some((tenant_part, timeline_part)) = str.split_once('/') {
|
||||
Ok(Self {
|
||||
tenant_id: TenantId(Id::from_hex(tenant_part).map_err(|e| {
|
||||
serde::de::Error::custom(format!("Malformed tenant in TenantTimelineId: {e}"))
|
||||
})?),
|
||||
timeline_id: TimelineId(Id::from_hex(timeline_part).map_err(|e| {
|
||||
serde::de::Error::custom(format!("Malformed timeline in TenantTimelineId {e}"))
|
||||
})?),
|
||||
})
|
||||
} else {
|
||||
Err(serde::de::Error::custom("Malformed TenantTimelineId"))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for TenantTimelineId {
|
||||
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
|
||||
write!(f, "{}/{}", self.tenant_id, self.timeline_id)
|
||||
|
||||
@@ -27,9 +27,6 @@ pub mod id;
|
||||
// http endpoint utils
|
||||
pub mod http;
|
||||
|
||||
// definition of the Generation type for pageserver attachment APIs
|
||||
pub mod generation;
|
||||
|
||||
// common log initialisation routine
|
||||
pub mod logging;
|
||||
|
||||
@@ -61,8 +58,6 @@ pub mod serde_regex;
|
||||
|
||||
pub mod pageserver_feedback;
|
||||
|
||||
pub mod postgres_client;
|
||||
|
||||
pub mod tracing_span_assert;
|
||||
|
||||
pub mod rate_limit;
|
||||
@@ -73,6 +68,8 @@ pub mod completion;
|
||||
/// Reporting utilities
|
||||
pub mod error;
|
||||
|
||||
pub mod sync;
|
||||
|
||||
/// This is a shortcut to embed git sha into binaries and avoid copying the same build script to all packages
|
||||
///
|
||||
/// we have several cases:
|
||||
|
||||
@@ -1,37 +0,0 @@
|
||||
//! Postgres client connection code common to other crates (safekeeper and
|
||||
//! pageserver) which depends on tenant/timeline ids and thus not fitting into
|
||||
//! postgres_connection crate.
|
||||
|
||||
use anyhow::Context;
|
||||
use postgres_connection::{parse_host_port, PgConnectionConfig};
|
||||
|
||||
use crate::id::TenantTimelineId;
|
||||
|
||||
/// Create client config for fetching WAL from safekeeper on particular timeline.
|
||||
/// listen_pg_addr_str is in form host:\[port\].
|
||||
pub fn wal_stream_connection_config(
|
||||
TenantTimelineId {
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
}: TenantTimelineId,
|
||||
listen_pg_addr_str: &str,
|
||||
auth_token: Option<&str>,
|
||||
availability_zone: Option<&str>,
|
||||
) -> anyhow::Result<PgConnectionConfig> {
|
||||
let (host, port) =
|
||||
parse_host_port(listen_pg_addr_str).context("Unable to parse listen_pg_addr_str")?;
|
||||
let port = port.unwrap_or(5432);
|
||||
let mut connstr = PgConnectionConfig::new_host_port(host, port)
|
||||
.extend_options([
|
||||
"-c".to_owned(),
|
||||
format!("timeline_id={}", timeline_id),
|
||||
format!("tenant_id={}", tenant_id),
|
||||
])
|
||||
.set_password(auth_token.map(|s| s.to_owned()));
|
||||
|
||||
if let Some(availability_zone) = availability_zone {
|
||||
connstr = connstr.extend_options([format!("availability_zone={}", availability_zone)]);
|
||||
}
|
||||
|
||||
Ok(connstr)
|
||||
}
|
||||
1
libs/utils/src/sync.rs
Normal file
1
libs/utils/src/sync.rs
Normal file
@@ -0,0 +1 @@
|
||||
pub mod heavier_once_cell;
|
||||
306
libs/utils/src/sync/heavier_once_cell.rs
Normal file
306
libs/utils/src/sync/heavier_once_cell.rs
Normal file
@@ -0,0 +1,306 @@
|
||||
use std::sync::{Arc, Mutex, MutexGuard};
|
||||
use tokio::sync::Semaphore;
|
||||
|
||||
/// Custom design like [`tokio::sync::OnceCell`] but using [`OwnedSemaphorePermit`] instead of
|
||||
/// `SemaphorePermit`, allowing use of `take` which does not require holding an outer mutex guard
|
||||
/// for the duration of initialization.
|
||||
///
|
||||
/// Has no unsafe, builds upon [`tokio::sync::Semaphore`] and [`std::sync::Mutex`].
|
||||
///
|
||||
/// [`OwnedSemaphorePermit`]: tokio::sync::OwnedSemaphorePermit
|
||||
pub struct OnceCell<T> {
|
||||
inner: Mutex<Inner<T>>,
|
||||
}
|
||||
|
||||
impl<T> Default for OnceCell<T> {
|
||||
/// Create new uninitialized [`OnceCell`].
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
inner: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Semaphore is the current state:
|
||||
/// - open semaphore means the value is `None`, not yet initialized
|
||||
/// - closed semaphore means the value has been initialized
|
||||
#[derive(Debug)]
|
||||
struct Inner<T> {
|
||||
init_semaphore: Arc<Semaphore>,
|
||||
value: Option<T>,
|
||||
}
|
||||
|
||||
impl<T> Default for Inner<T> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
init_semaphore: Arc::new(Semaphore::new(1)),
|
||||
value: None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> OnceCell<T> {
|
||||
/// Creates an already initialized `OnceCell` with the given value.
|
||||
pub fn new(value: T) -> Self {
|
||||
let sem = Semaphore::new(1);
|
||||
sem.close();
|
||||
Self {
|
||||
inner: Mutex::new(Inner {
|
||||
init_semaphore: Arc::new(sem),
|
||||
value: Some(value),
|
||||
}),
|
||||
}
|
||||
}
|
||||
|
||||
/// Returns a guard to an existing initialized value, or uniquely initializes the value before
|
||||
/// returning the guard.
|
||||
///
|
||||
/// Initializing might wait on any existing [`Guard::take_and_deinit`] deinitialization.
|
||||
///
|
||||
/// Initialization is panic-safe and cancellation-safe.
|
||||
pub async fn get_or_init<F, Fut, E>(&self, factory: F) -> Result<Guard<'_, T>, E>
|
||||
where
|
||||
F: FnOnce() -> Fut,
|
||||
Fut: std::future::Future<Output = Result<T, E>>,
|
||||
{
|
||||
let sem = {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
if guard.value.is_some() {
|
||||
return Ok(Guard(guard));
|
||||
}
|
||||
guard.init_semaphore.clone()
|
||||
};
|
||||
|
||||
let permit = sem.acquire_owned().await;
|
||||
if permit.is_err() {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
assert!(
|
||||
guard.value.is_some(),
|
||||
"semaphore got closed, must be initialized"
|
||||
);
|
||||
return Ok(Guard(guard));
|
||||
} else {
|
||||
// now we try
|
||||
let value = factory().await?;
|
||||
|
||||
let mut guard = self.inner.lock().unwrap();
|
||||
assert!(
|
||||
guard.value.is_none(),
|
||||
"we won permit, must not be initialized"
|
||||
);
|
||||
guard.value = Some(value);
|
||||
guard.init_semaphore.close();
|
||||
Ok(Guard(guard))
|
||||
}
|
||||
}
|
||||
|
||||
/// Returns a guard to an existing initialized value, if any.
|
||||
pub fn get(&self) -> Option<Guard<'_, T>> {
|
||||
let guard = self.inner.lock().unwrap();
|
||||
if guard.value.is_some() {
|
||||
Some(Guard(guard))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Uninteresting guard object to allow short-lived access to inspect or clone the held,
|
||||
/// initialized value.
|
||||
#[derive(Debug)]
|
||||
pub struct Guard<'a, T>(MutexGuard<'a, Inner<T>>);
|
||||
|
||||
impl<T> std::ops::Deref for Guard<'_, T> {
|
||||
type Target = T;
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
self.0
|
||||
.value
|
||||
.as_ref()
|
||||
.expect("guard is not created unless value has been initialized")
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> std::ops::DerefMut for Guard<'_, T> {
|
||||
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||
self.0
|
||||
.value
|
||||
.as_mut()
|
||||
.expect("guard is not created unless value has been initialized")
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, T> Guard<'a, T> {
|
||||
/// Take the current value, and a new permit for it's deinitialization.
|
||||
///
|
||||
/// The permit will be on a semaphore part of the new internal value, and any following
|
||||
/// [`OnceCell::get_or_init`] will wait on it to complete.
|
||||
pub fn take_and_deinit(&mut self) -> (T, tokio::sync::OwnedSemaphorePermit) {
|
||||
let mut swapped = Inner::default();
|
||||
let permit = swapped
|
||||
.init_semaphore
|
||||
.clone()
|
||||
.try_acquire_owned()
|
||||
.expect("we just created this");
|
||||
std::mem::swap(&mut *self.0, &mut swapped);
|
||||
swapped
|
||||
.value
|
||||
.map(|v| (v, permit))
|
||||
.expect("guard is not created unless value has been initialized")
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use std::{
|
||||
convert::Infallible,
|
||||
sync::atomic::{AtomicUsize, Ordering},
|
||||
time::Duration,
|
||||
};
|
||||
|
||||
#[tokio::test]
|
||||
async fn many_initializers() {
|
||||
#[derive(Default, Debug)]
|
||||
struct Counters {
|
||||
factory_got_to_run: AtomicUsize,
|
||||
future_polled: AtomicUsize,
|
||||
winners: AtomicUsize,
|
||||
}
|
||||
|
||||
let initializers = 100;
|
||||
|
||||
let cell = Arc::new(OnceCell::default());
|
||||
let counters = Arc::new(Counters::default());
|
||||
let barrier = Arc::new(tokio::sync::Barrier::new(initializers + 1));
|
||||
|
||||
let mut js = tokio::task::JoinSet::new();
|
||||
for i in 0..initializers {
|
||||
js.spawn({
|
||||
let cell = cell.clone();
|
||||
let counters = counters.clone();
|
||||
let barrier = barrier.clone();
|
||||
|
||||
async move {
|
||||
barrier.wait().await;
|
||||
let won = {
|
||||
let g = cell
|
||||
.get_or_init(|| {
|
||||
counters.factory_got_to_run.fetch_add(1, Ordering::Relaxed);
|
||||
async {
|
||||
counters.future_polled.fetch_add(1, Ordering::Relaxed);
|
||||
Ok::<_, Infallible>(i)
|
||||
}
|
||||
})
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
*g == i
|
||||
};
|
||||
|
||||
if won {
|
||||
counters.winners.fetch_add(1, Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
barrier.wait().await;
|
||||
|
||||
while let Some(next) = js.join_next().await {
|
||||
next.expect("no panics expected");
|
||||
}
|
||||
|
||||
let mut counters = Arc::try_unwrap(counters).unwrap();
|
||||
|
||||
assert_eq!(*counters.factory_got_to_run.get_mut(), 1);
|
||||
assert_eq!(*counters.future_polled.get_mut(), 1);
|
||||
assert_eq!(*counters.winners.get_mut(), 1);
|
||||
}
|
||||
|
||||
#[tokio::test(start_paused = true)]
|
||||
async fn reinit_waits_for_deinit() {
|
||||
// with he tokio::time paused, we will "sleep" for 1s while holding the reinitialization
|
||||
let sleep_for = Duration::from_secs(1);
|
||||
let initial = 42;
|
||||
let reinit = 1;
|
||||
let cell = Arc::new(OnceCell::new(initial));
|
||||
|
||||
let deinitialization_started = Arc::new(tokio::sync::Barrier::new(2));
|
||||
|
||||
let jh = tokio::spawn({
|
||||
let cell = cell.clone();
|
||||
let deinitialization_started = deinitialization_started.clone();
|
||||
async move {
|
||||
let (answer, _permit) = cell.get().expect("initialized to value").take_and_deinit();
|
||||
assert_eq!(answer, initial);
|
||||
|
||||
deinitialization_started.wait().await;
|
||||
tokio::time::sleep(sleep_for).await;
|
||||
}
|
||||
});
|
||||
|
||||
deinitialization_started.wait().await;
|
||||
|
||||
let started_at = tokio::time::Instant::now();
|
||||
cell.get_or_init(|| async { Ok::<_, Infallible>(reinit) })
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
let elapsed = started_at.elapsed();
|
||||
assert!(
|
||||
elapsed >= sleep_for,
|
||||
"initialization should had taken at least the time time slept with permit"
|
||||
);
|
||||
|
||||
jh.await.unwrap();
|
||||
|
||||
assert_eq!(*cell.get().unwrap(), reinit);
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn initialization_attemptable_until_ok() {
|
||||
let cell = OnceCell::default();
|
||||
|
||||
for _ in 0..10 {
|
||||
cell.get_or_init(|| async { Err("whatever error") })
|
||||
.await
|
||||
.unwrap_err();
|
||||
}
|
||||
|
||||
let g = cell
|
||||
.get_or_init(|| async { Ok::<_, Infallible>("finally success") })
|
||||
.await
|
||||
.unwrap();
|
||||
assert_eq!(*g, "finally success");
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn initialization_is_cancellation_safe() {
|
||||
let cell = OnceCell::default();
|
||||
|
||||
let barrier = tokio::sync::Barrier::new(2);
|
||||
|
||||
let initializer = cell.get_or_init(|| async {
|
||||
barrier.wait().await;
|
||||
futures::future::pending::<()>().await;
|
||||
|
||||
Ok::<_, Infallible>("never reached")
|
||||
});
|
||||
|
||||
tokio::select! {
|
||||
_ = initializer => { unreachable!("cannot complete; stuck in pending().await") },
|
||||
_ = barrier.wait() => {}
|
||||
};
|
||||
|
||||
// now initializer is dropped
|
||||
|
||||
assert!(cell.get().is_none());
|
||||
|
||||
let g = cell
|
||||
.get_or_init(|| async { Ok::<_, Infallible>("now initialized") })
|
||||
.await
|
||||
.unwrap();
|
||||
assert_eq!(*g, "now initialized");
|
||||
}
|
||||
}
|
||||
@@ -16,19 +16,3 @@ in the `neon-postgres` cgroup and set its `memory.{max,high}`.
|
||||
* See also: [`neondatabase/vm-monitor`](https://github.com/neondatabase/vm-monitor/),
|
||||
where initial development of the monitor happened. The repository is no longer
|
||||
maintained but the commit history may be useful for debugging.
|
||||
|
||||
## Structure
|
||||
|
||||
The `vm-monitor` is loosely comprised of a few systems. These are:
|
||||
* the server: this is just a simple `axum` server that accepts requests and
|
||||
upgrades them to websocket connections. The server only allows one connection at
|
||||
a time. This means that upon receiving a new connection, the server will terminate
|
||||
and old one if it exists.
|
||||
* the filecache: a struct that allows communication with the Postgres file cache.
|
||||
On startup, we connect to the filecache and hold on to the connection for the
|
||||
entire monitor lifetime.
|
||||
* the cgroup watcher: the `CgroupWatcher` manages the `neon-postgres` cgroup by
|
||||
listening for `memory.high` events and setting its `memory.{high,max}` values.
|
||||
* the runner: the runner marries the filecache and cgroup watcher together,
|
||||
communicating with the agent throught the `Dispatcher`, and then calling filecache
|
||||
and cgroup watcher functions as needed to upscale and downscale
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
//! Managing the websocket connection and other signals in the monitor.
|
||||
//!
|
||||
//! Contains types that manage the interaction (not data interchange, see `protocol`)
|
||||
//! between agent and monitor, allowing us to to process and send messages in a
|
||||
//! between informant and monitor, allowing us to to process and send messages in a
|
||||
//! straightforward way. The dispatcher also manages that signals that come from
|
||||
//! the cgroup (requesting upscale), and the signals that go to the cgroup
|
||||
//! (notifying it of upscale).
|
||||
@@ -24,16 +24,16 @@ use crate::protocol::{
|
||||
/// The central handler for all communications in the monitor.
|
||||
///
|
||||
/// The dispatcher has two purposes:
|
||||
/// 1. Manage the connection to the agent, sending and receiving messages.
|
||||
/// 1. Manage the connection to the informant, sending and receiving messages.
|
||||
/// 2. Communicate with the cgroup manager, notifying it when upscale is received,
|
||||
/// and sending a message to the agent when the cgroup manager requests
|
||||
/// and sending a message to the informant when the cgroup manager requests
|
||||
/// upscale.
|
||||
#[derive(Debug)]
|
||||
pub struct Dispatcher {
|
||||
/// We read agent messages of of `source`
|
||||
/// We read informant messages of of `source`
|
||||
pub(crate) source: SplitStream<WebSocket>,
|
||||
|
||||
/// We send messages to the agent through `sink`
|
||||
/// We send messages to the informant through `sink`
|
||||
sink: SplitSink<WebSocket, Message>,
|
||||
|
||||
/// Used to notify the cgroup when we are upscaled.
|
||||
@@ -43,7 +43,7 @@ pub struct Dispatcher {
|
||||
/// we send an `UpscaleRequst` to the agent.
|
||||
pub(crate) request_upscale_events: mpsc::Receiver<()>,
|
||||
|
||||
/// The protocol version we have agreed to use with the agent. This is negotiated
|
||||
/// The protocol version we have agreed to use with the informant. This is negotiated
|
||||
/// during the creation of the dispatcher, and should be the highest shared protocol
|
||||
/// version.
|
||||
///
|
||||
@@ -56,9 +56,9 @@ pub struct Dispatcher {
|
||||
impl Dispatcher {
|
||||
/// Creates a new dispatcher using the passed-in connection.
|
||||
///
|
||||
/// Performs a negotiation with the agent to determine the highest protocol
|
||||
/// Performs a negotiation with the informant to determine the highest protocol
|
||||
/// version that both support. This consists of two steps:
|
||||
/// 1. Wait for the agent to sent the range of protocols it supports.
|
||||
/// 1. Wait for the informant to sent the range of protocols it supports.
|
||||
/// 2. Send a protocol version that works for us as well, or an error if there
|
||||
/// is no compatible version.
|
||||
pub async fn new(
|
||||
@@ -69,7 +69,7 @@ impl Dispatcher {
|
||||
let (mut sink, mut source) = stream.split();
|
||||
|
||||
// Figure out the highest protocol version we both support
|
||||
info!("waiting for agent to send protocol version range");
|
||||
info!("waiting for informant to send protocol version range");
|
||||
let Some(message) = source.next().await else {
|
||||
bail!("websocket connection closed while performing protocol handshake")
|
||||
};
|
||||
@@ -79,7 +79,7 @@ impl Dispatcher {
|
||||
let Message::Text(message_text) = message else {
|
||||
// All messages should be in text form, since we don't do any
|
||||
// pinging/ponging. See nhooyr/websocket's implementation and the
|
||||
// agent for more info
|
||||
// informant/agent for more info
|
||||
bail!("received non-text message during proocol handshake: {message:?}")
|
||||
};
|
||||
|
||||
@@ -88,30 +88,32 @@ impl Dispatcher {
|
||||
max: PROTOCOL_MAX_VERSION,
|
||||
};
|
||||
|
||||
let agent_range: ProtocolRange = serde_json::from_str(&message_text)
|
||||
let informant_range: ProtocolRange = serde_json::from_str(&message_text)
|
||||
.context("failed to deserialize protocol version range")?;
|
||||
|
||||
info!(range = ?agent_range, "received protocol version range");
|
||||
info!(range = ?informant_range, "received protocol version range");
|
||||
|
||||
let highest_shared_version = match monitor_range.highest_shared_version(&agent_range) {
|
||||
let highest_shared_version = match monitor_range.highest_shared_version(&informant_range) {
|
||||
Ok(version) => {
|
||||
sink.send(Message::Text(
|
||||
serde_json::to_string(&ProtocolResponse::Version(version)).unwrap(),
|
||||
))
|
||||
.await
|
||||
.context("failed to notify agent of negotiated protocol version")?;
|
||||
.context("failed to notify informant of negotiated protocol version")?;
|
||||
version
|
||||
}
|
||||
Err(e) => {
|
||||
sink.send(Message::Text(
|
||||
serde_json::to_string(&ProtocolResponse::Error(format!(
|
||||
"Received protocol version range {} which does not overlap with {}",
|
||||
agent_range, monitor_range
|
||||
informant_range, monitor_range
|
||||
)))
|
||||
.unwrap(),
|
||||
))
|
||||
.await
|
||||
.context("failed to notify agent of no overlap between protocol version ranges")?;
|
||||
.context(
|
||||
"failed to notify informant of no overlap between protocol version ranges",
|
||||
)?;
|
||||
Err(e).context("error determining suitable protocol version range")?
|
||||
}
|
||||
};
|
||||
@@ -135,7 +137,7 @@ impl Dispatcher {
|
||||
.context("failed to send resources and oneshot sender across channel")
|
||||
}
|
||||
|
||||
/// Send a message to the agent.
|
||||
/// Send a message to the informant.
|
||||
///
|
||||
/// Although this function is small, it has one major benefit: it is the only
|
||||
/// way to send data accross the connection, and you can only pass in a proper
|
||||
|
||||
@@ -59,8 +59,8 @@ pub struct FileCacheConfig {
|
||||
spread_factor: f64,
|
||||
}
|
||||
|
||||
impl FileCacheConfig {
|
||||
pub fn default_in_memory() -> Self {
|
||||
impl Default for FileCacheConfig {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
in_memory: true,
|
||||
// 75 %
|
||||
@@ -71,19 +71,9 @@ impl FileCacheConfig {
|
||||
spread_factor: 0.1,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn default_on_disk() -> Self {
|
||||
Self {
|
||||
in_memory: false,
|
||||
resource_multiplier: 0.75,
|
||||
// 256 MiB - lower than when in memory because overcommitting is safe; if we don't have
|
||||
// memory, the kernel will just evict from its page cache, rather than e.g. killing
|
||||
// everything.
|
||||
min_remaining_after_cache: NonZeroU64::new(256 * MiB).unwrap(),
|
||||
spread_factor: 0.1,
|
||||
}
|
||||
}
|
||||
|
||||
impl FileCacheConfig {
|
||||
/// Make sure fields of the config are consistent.
|
||||
pub fn validate(&self) -> anyhow::Result<()> {
|
||||
// Single field validity
|
||||
|
||||
@@ -39,16 +39,6 @@ pub struct Args {
|
||||
#[arg(short, long)]
|
||||
pub pgconnstr: Option<String>,
|
||||
|
||||
/// Flag to signal that the Postgres file cache is on disk (i.e. not in memory aside from the
|
||||
/// kernel's page cache), and therefore should not count against available memory.
|
||||
//
|
||||
// NB: Ideally this flag would directly refer to whether the file cache is in memory (rather
|
||||
// than a roundabout way, via whether it's on disk), but in order to be backwards compatible
|
||||
// during the switch away from an in-memory file cache, we had to default to the previous
|
||||
// behavior.
|
||||
#[arg(long)]
|
||||
pub file_cache_on_disk: bool,
|
||||
|
||||
/// The address we should listen on for connection requests. For the
|
||||
/// agent, this is 0.0.0.0:10301. For the informant, this is 127.0.0.1:10369.
|
||||
#[arg(short, long)]
|
||||
@@ -156,7 +146,7 @@ pub async fn start(args: &'static Args, token: CancellationToken) -> anyhow::Res
|
||||
|
||||
/// Handles incoming websocket connections.
|
||||
///
|
||||
/// If we are already to connected to an agent, we kill that old connection
|
||||
/// If we are already to connected to an informant, we kill that old connection
|
||||
/// and accept the new one.
|
||||
#[tracing::instrument(name = "/monitor", skip_all, fields(?args))]
|
||||
pub async fn ws_handler(
|
||||
@@ -206,7 +196,7 @@ async fn start_monitor(
|
||||
return;
|
||||
}
|
||||
};
|
||||
info!("connected to agent");
|
||||
info!("connected to informant");
|
||||
|
||||
match monitor.run().await {
|
||||
Ok(()) => info!("monitor was killed due to new connection"),
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
//! Types representing protocols and actual agent-monitor messages.
|
||||
//! Types representing protocols and actual informant-monitor messages.
|
||||
//!
|
||||
//! The pervasive use of serde modifiers throughout this module is to ease
|
||||
//! serialization on the go side. Because go does not have enums (which model
|
||||
//! messages well), it is harder to model messages, and we accomodate that with
|
||||
//! serde.
|
||||
//!
|
||||
//! *Note*: the agent sends and receives messages in different ways.
|
||||
//! *Note*: the informant sends and receives messages in different ways.
|
||||
//!
|
||||
//! The agent serializes messages in the form and then sends them. The use
|
||||
//! The informant serializes messages in the form and then sends them. The use
|
||||
//! of `#[serde(tag = "type", content = "content")]` allows us to use `Type`
|
||||
//! to determine how to deserialize `Content`.
|
||||
//! ```ignore
|
||||
@@ -25,9 +25,9 @@
|
||||
//! Id uint64
|
||||
//! }
|
||||
//! ```
|
||||
//! After reading the type field, the agent will decode the entire message
|
||||
//! After reading the type field, the informant will decode the entire message
|
||||
//! again, this time into the correct type using the embedded fields.
|
||||
//! Because the agent cannot just extract the json contained in a certain field
|
||||
//! Because the informant cannot just extract the json contained in a certain field
|
||||
//! (it initially deserializes to `map[string]interface{}`), we keep the fields
|
||||
//! at the top level, so the entire piece of json can be deserialized into a struct,
|
||||
//! such as a `DownscaleResult`, with the `Type` and `Id` fields ignored.
|
||||
@@ -37,7 +37,7 @@ use std::cmp;
|
||||
|
||||
use serde::{de::Error, Deserialize, Serialize};
|
||||
|
||||
/// A Message we send to the agent.
|
||||
/// A Message we send to the informant.
|
||||
#[derive(Serialize, Deserialize, Debug, Clone)]
|
||||
pub struct OutboundMsg {
|
||||
#[serde(flatten)]
|
||||
@@ -51,31 +51,31 @@ impl OutboundMsg {
|
||||
}
|
||||
}
|
||||
|
||||
/// The different underlying message types we can send to the agent.
|
||||
/// The different underlying message types we can send to the informant.
|
||||
#[derive(Serialize, Deserialize, Debug, Clone)]
|
||||
#[serde(tag = "type")]
|
||||
pub enum OutboundMsgKind {
|
||||
/// Indicates that the agent sent an invalid message, i.e, we couldn't
|
||||
/// Indicates that the informant sent an invalid message, i.e, we couldn't
|
||||
/// properly deserialize it.
|
||||
InvalidMessage { error: String },
|
||||
/// Indicates that we experienced an internal error while processing a message.
|
||||
/// For example, if a cgroup operation fails while trying to handle an upscale,
|
||||
/// we return `InternalError`.
|
||||
InternalError { error: String },
|
||||
/// Returned to the agent once we have finished handling an upscale. If the
|
||||
/// Returned to the informant once we have finished handling an upscale. If the
|
||||
/// handling was unsuccessful, an `InternalError` will get returned instead.
|
||||
/// *Note*: this is a struct variant because of the way go serializes struct{}
|
||||
UpscaleConfirmation {},
|
||||
/// Indicates to the monitor that we are urgently requesting resources.
|
||||
/// *Note*: this is a struct variant because of the way go serializes struct{}
|
||||
UpscaleRequest {},
|
||||
/// Returned to the agent once we have finished attempting to downscale. If
|
||||
/// Returned to the informant once we have finished attempting to downscale. If
|
||||
/// an error occured trying to do so, an `InternalError` will get returned instead.
|
||||
/// However, if we are simply unsuccessful (for example, do to needing the resources),
|
||||
/// that gets included in the `DownscaleResult`.
|
||||
DownscaleResult {
|
||||
// FIXME for the future (once the informant is deprecated)
|
||||
// As of the time of writing, the agent/informant version of this struct is
|
||||
// As of the time of writing, the informant/agent version of this struct is
|
||||
// called api.DownscaleResult. This struct has uppercase fields which are
|
||||
// serialized as such. Thus, we serialize using uppercase names so we don't
|
||||
// have to make a breaking change to the agent<->informant protocol. Once
|
||||
@@ -88,12 +88,12 @@ pub enum OutboundMsgKind {
|
||||
status: String,
|
||||
},
|
||||
/// Part of the bidirectional heartbeat. The heartbeat is initiated by the
|
||||
/// agent.
|
||||
/// informant.
|
||||
/// *Note*: this is a struct variant because of the way go serializes struct{}
|
||||
HealthCheck {},
|
||||
}
|
||||
|
||||
/// A message received form the agent.
|
||||
/// A message received form the informant.
|
||||
#[derive(Serialize, Deserialize, Debug, Clone)]
|
||||
pub struct InboundMsg {
|
||||
#[serde(flatten)]
|
||||
@@ -101,7 +101,7 @@ pub struct InboundMsg {
|
||||
pub(crate) id: usize,
|
||||
}
|
||||
|
||||
/// The different underlying message types we can receive from the agent.
|
||||
/// The different underlying message types we can receive from the informant.
|
||||
#[derive(Serialize, Deserialize, Debug, Clone)]
|
||||
#[serde(tag = "type", content = "content")]
|
||||
pub enum InboundMsgKind {
|
||||
@@ -120,14 +120,14 @@ pub enum InboundMsgKind {
|
||||
/// when done.
|
||||
DownscaleRequest { target: Resources },
|
||||
/// Part of the bidirectional heartbeat. The heartbeat is initiated by the
|
||||
/// agent.
|
||||
/// informant.
|
||||
/// *Note*: this is a struct variant because of the way go serializes struct{}
|
||||
HealthCheck {},
|
||||
}
|
||||
|
||||
/// Represents the resources granted to a VM.
|
||||
#[derive(Serialize, Deserialize, Debug, Clone, Copy)]
|
||||
// Renamed because the agent has multiple resources types:
|
||||
// Renamed because the agent/informant has multiple resources types:
|
||||
// `Resources` (milliCPU/memory slots)
|
||||
// `Allocation` (vCPU/bytes) <- what we correspond to
|
||||
#[serde(rename(serialize = "Allocation", deserialize = "Allocation"))]
|
||||
@@ -151,7 +151,7 @@ pub const PROTOCOL_MAX_VERSION: ProtocolVersion = ProtocolVersion::V1_0;
|
||||
pub struct ProtocolVersion(u8);
|
||||
|
||||
impl ProtocolVersion {
|
||||
/// Represents v1.0 of the agent<-> monitor protocol - the initial version
|
||||
/// Represents v1.0 of the informant<-> monitor protocol - the initial version
|
||||
///
|
||||
/// Currently the latest version.
|
||||
const V1_0: ProtocolVersion = ProtocolVersion(1);
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
//! Exposes the `Runner`, which handles messages received from agent and
|
||||
//! Exposes the `Runner`, which handles messages received from informant and
|
||||
//! sends upscale requests.
|
||||
//!
|
||||
//! This is the "Monitor" part of the monitor binary and is the main entrypoint for
|
||||
@@ -21,8 +21,8 @@ use crate::filecache::{FileCacheConfig, FileCacheState};
|
||||
use crate::protocol::{InboundMsg, InboundMsgKind, OutboundMsg, OutboundMsgKind, Resources};
|
||||
use crate::{bytes_to_mebibytes, get_total_system_memory, spawn_with_cancel, Args, MiB};
|
||||
|
||||
/// Central struct that interacts with agent, dispatcher, and cgroup to handle
|
||||
/// signals from the agent.
|
||||
/// Central struct that interacts with informant, dispatcher, and cgroup to handle
|
||||
/// signals from the informant.
|
||||
#[derive(Debug)]
|
||||
pub struct Runner {
|
||||
config: Config,
|
||||
@@ -110,10 +110,10 @@ impl Runner {
|
||||
// memory limits.
|
||||
if let Some(connstr) = &args.pgconnstr {
|
||||
info!("initializing file cache");
|
||||
let config = match args.file_cache_on_disk {
|
||||
true => FileCacheConfig::default_on_disk(),
|
||||
false => FileCacheConfig::default_in_memory(),
|
||||
};
|
||||
let config: FileCacheConfig = Default::default();
|
||||
if !config.in_memory {
|
||||
panic!("file cache not in-memory implemented")
|
||||
}
|
||||
|
||||
let mut file_cache = FileCacheState::new(connstr, config, token.clone())
|
||||
.await
|
||||
@@ -140,10 +140,7 @@ impl Runner {
|
||||
if actual_size != new_size {
|
||||
info!("file cache size actually got set to {actual_size}")
|
||||
}
|
||||
// Mark the resources given to the file cache as reserved, but only if it's in memory.
|
||||
if !args.file_cache_on_disk {
|
||||
file_cache_reserved_bytes = actual_size;
|
||||
}
|
||||
file_cache_reserved_bytes = actual_size;
|
||||
|
||||
state.filecache = Some(file_cache);
|
||||
}
|
||||
@@ -230,17 +227,18 @@ impl Runner {
|
||||
let mut status = vec![];
|
||||
let mut file_cache_mem_usage = 0;
|
||||
if let Some(file_cache) = &mut self.filecache {
|
||||
if !file_cache.config.in_memory {
|
||||
panic!("file cache not in-memory unimplemented")
|
||||
}
|
||||
|
||||
let actual_usage = file_cache
|
||||
.set_file_cache_size(expected_file_cache_mem_usage)
|
||||
.await
|
||||
.context("failed to set file cache size")?;
|
||||
if file_cache.config.in_memory {
|
||||
file_cache_mem_usage = actual_usage;
|
||||
}
|
||||
file_cache_mem_usage = actual_usage;
|
||||
let message = format!(
|
||||
"set file cache size to {} MiB (in memory = {})",
|
||||
bytes_to_mebibytes(actual_usage),
|
||||
file_cache.config.in_memory,
|
||||
"set file cache size to {} MiB",
|
||||
bytes_to_mebibytes(actual_usage)
|
||||
);
|
||||
info!("downscale: {message}");
|
||||
status.push(message);
|
||||
@@ -291,6 +289,10 @@ impl Runner {
|
||||
// Get the file cache's expected contribution to the memory usage
|
||||
let mut file_cache_mem_usage = 0;
|
||||
if let Some(file_cache) = &mut self.filecache {
|
||||
if !file_cache.config.in_memory {
|
||||
panic!("file cache not in-memory unimplemented");
|
||||
}
|
||||
|
||||
let expected_usage = file_cache.config.calculate_cache_size(usable_system_memory);
|
||||
info!(
|
||||
target = bytes_to_mebibytes(expected_usage),
|
||||
@@ -302,9 +304,6 @@ impl Runner {
|
||||
.set_file_cache_size(expected_usage)
|
||||
.await
|
||||
.context("failed to set file cache size")?;
|
||||
if file_cache.config.in_memory {
|
||||
file_cache_mem_usage = actual_usage;
|
||||
}
|
||||
|
||||
if actual_usage != expected_usage {
|
||||
warn!(
|
||||
@@ -313,6 +312,7 @@ impl Runner {
|
||||
bytes_to_mebibytes(actual_usage)
|
||||
)
|
||||
}
|
||||
file_cache_mem_usage = actual_usage;
|
||||
}
|
||||
|
||||
if let Some(cgroup) = &self.cgroup {
|
||||
@@ -371,7 +371,7 @@ impl Runner {
|
||||
Ok(None)
|
||||
}
|
||||
InboundMsgKind::InternalError { error } => {
|
||||
warn!(error, id, "agent experienced an internal error");
|
||||
warn!(error, id, "informant experienced an internal error");
|
||||
Ok(None)
|
||||
}
|
||||
InboundMsgKind::HealthCheck {} => {
|
||||
@@ -405,7 +405,7 @@ impl Runner {
|
||||
.await
|
||||
.context("failed to send message")?;
|
||||
}
|
||||
// there is a message from the agent
|
||||
// there is a message from the informant
|
||||
msg = self.dispatcher.source.next() => {
|
||||
if let Some(msg) = msg {
|
||||
// Don't use 'message' as a key as the string also uses
|
||||
@@ -422,7 +422,7 @@ impl Runner {
|
||||
// Don't use 'message' as a key as the
|
||||
// string also uses that for its key
|
||||
msg = ?other,
|
||||
"agent should only send text messages but received different type"
|
||||
"informant should only send text messages but received different type"
|
||||
);
|
||||
continue
|
||||
},
|
||||
|
||||
@@ -97,7 +97,7 @@ pub(crate) fn parse_filename(name: &str) -> Option<LayerFile> {
|
||||
// Finds the max_holes largest holes, ignoring any that are smaller than MIN_HOLE_LENGTH"
|
||||
async fn get_holes(path: &Path, max_holes: usize) -> Result<Vec<Hole>> {
|
||||
let file = FileBlockReader::new(VirtualFile::open(path)?);
|
||||
let summary_blk = file.read_blk(0).await?;
|
||||
let summary_blk = file.read_blk(0)?;
|
||||
let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
actual_summary.index_start_blk,
|
||||
|
||||
@@ -48,7 +48,7 @@ async fn read_delta_file(path: impl AsRef<Path>) -> Result<()> {
|
||||
virtual_file::init(10);
|
||||
page_cache::init(100);
|
||||
let file = FileBlockReader::new(VirtualFile::open(path)?);
|
||||
let summary_blk = file.read_blk(0).await?;
|
||||
let summary_blk = file.read_blk(0)?;
|
||||
let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
actual_summary.index_start_blk,
|
||||
|
||||
@@ -2,14 +2,12 @@
|
||||
|
||||
use std::env::{var, VarError};
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
use std::{env, ops::ControlFlow, path::Path, str::FromStr};
|
||||
|
||||
use anyhow::{anyhow, Context};
|
||||
use clap::{Arg, ArgAction, Command};
|
||||
|
||||
use metrics::launch_timestamp::{set_launch_timestamp_metric, LaunchTimestamp};
|
||||
use pageserver::deletion_queue::{DeletionQueue, DeletionQueueError};
|
||||
use pageserver::disk_usage_eviction_task::{self, launch_disk_usage_global_eviction_task};
|
||||
use pageserver::metrics::{STARTUP_DURATION, STARTUP_IS_LOADING};
|
||||
use pageserver::task_mgr::WALRECEIVER_RUNTIME;
|
||||
@@ -351,35 +349,6 @@ fn start_pageserver(
|
||||
// Set up remote storage client
|
||||
let remote_storage = create_remote_storage_client(conf)?;
|
||||
|
||||
// Set up deletion queue
|
||||
let deletion_queue_cancel = tokio_util::sync::CancellationToken::new();
|
||||
let (deletion_queue, deletion_frontend, deletion_backend, deletion_executor) =
|
||||
DeletionQueue::new(remote_storage.clone(), conf, deletion_queue_cancel.clone());
|
||||
if let Some(mut deletion_frontend) = deletion_frontend {
|
||||
BACKGROUND_RUNTIME.spawn(async move {
|
||||
deletion_frontend
|
||||
.background()
|
||||
.instrument(info_span!(parent:None, "deletion frontend"))
|
||||
.await
|
||||
});
|
||||
}
|
||||
if let Some(mut deletion_backend) = deletion_backend {
|
||||
BACKGROUND_RUNTIME.spawn(async move {
|
||||
deletion_backend
|
||||
.background()
|
||||
.instrument(info_span!(parent: None, "deletion backend"))
|
||||
.await
|
||||
});
|
||||
}
|
||||
if let Some(mut deletion_executor) = deletion_executor {
|
||||
BACKGROUND_RUNTIME.spawn(async move {
|
||||
deletion_executor
|
||||
.background()
|
||||
.instrument(info_span!(parent: None, "deletion executor"))
|
||||
.await
|
||||
});
|
||||
}
|
||||
|
||||
// Up to this point no significant I/O has been done: this should have been fast. Record
|
||||
// duration prior to starting I/O intensive phase of startup.
|
||||
startup_checkpoint("initial", "Starting loading tenants");
|
||||
@@ -417,7 +386,6 @@ fn start_pageserver(
|
||||
TenantSharedResources {
|
||||
broker_client: broker_client.clone(),
|
||||
remote_storage: remote_storage.clone(),
|
||||
deletion_queue_client: deletion_queue.new_client(),
|
||||
},
|
||||
order,
|
||||
))?;
|
||||
@@ -514,7 +482,6 @@ fn start_pageserver(
|
||||
http_auth,
|
||||
broker_client.clone(),
|
||||
remote_storage,
|
||||
deletion_queue.clone(),
|
||||
disk_usage_eviction_state,
|
||||
)?
|
||||
.build()
|
||||
@@ -637,36 +604,6 @@ fn start_pageserver(
|
||||
// The plan is to change that over time.
|
||||
shutdown_pageserver.take();
|
||||
BACKGROUND_RUNTIME.block_on(pageserver::shutdown_pageserver(0));
|
||||
|
||||
// Best effort to persist any outstanding deletions, to avoid leaking objects
|
||||
let dq = deletion_queue.clone();
|
||||
BACKGROUND_RUNTIME.block_on(async move {
|
||||
match tokio::time::timeout(Duration::from_secs(5), dq.new_client().flush()).await {
|
||||
Ok(flush_r) => {
|
||||
match flush_r {
|
||||
Ok(()) => {
|
||||
info!("Deletion queue flushed successfully on shutdown")
|
||||
}
|
||||
Err(e) => {
|
||||
match e {
|
||||
DeletionQueueError::ShuttingDown => {
|
||||
// This is not harmful for correctness, but is unexpected: the deletion
|
||||
// queue's workers should stay alive as long as there are any client handles instantiated.
|
||||
warn!("Deletion queue stopped prematurely");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
Err(e) => {
|
||||
warn!("Timed out flushing deletion queue on shutdown ({e})")
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
// Clean shutdown of deletion queue workers
|
||||
deletion_queue_cancel.cancel();
|
||||
|
||||
unreachable!()
|
||||
}
|
||||
})
|
||||
|
||||
@@ -204,8 +204,6 @@ pub struct PageServerConf {
|
||||
/// has it's initial logical size calculated. Not running background tasks for some seconds is
|
||||
/// not terrible.
|
||||
pub background_task_maximum_delay: Duration,
|
||||
|
||||
pub control_plane_api: Option<Url>,
|
||||
}
|
||||
|
||||
/// We do not want to store this in a PageServerConf because the latter may be logged
|
||||
@@ -280,8 +278,6 @@ struct PageServerConfigBuilder {
|
||||
ondemand_download_behavior_treat_error_as_warn: BuilderValue<bool>,
|
||||
|
||||
background_task_maximum_delay: BuilderValue<Duration>,
|
||||
|
||||
control_plane_api: BuilderValue<Option<Url>>,
|
||||
}
|
||||
|
||||
impl Default for PageServerConfigBuilder {
|
||||
@@ -344,8 +340,6 @@ impl Default for PageServerConfigBuilder {
|
||||
DEFAULT_BACKGROUND_TASK_MAXIMUM_DELAY,
|
||||
)
|
||||
.unwrap()),
|
||||
|
||||
control_plane_api: Set(None),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -474,10 +468,6 @@ impl PageServerConfigBuilder {
|
||||
self.background_task_maximum_delay = BuilderValue::Set(delay);
|
||||
}
|
||||
|
||||
pub fn control_plane_api(&mut self, api: Url) {
|
||||
self.control_plane_api = BuilderValue::Set(Some(api))
|
||||
}
|
||||
|
||||
pub fn build(self) -> anyhow::Result<PageServerConf> {
|
||||
let concurrent_tenant_size_logical_size_queries = self
|
||||
.concurrent_tenant_size_logical_size_queries
|
||||
@@ -563,9 +553,6 @@ impl PageServerConfigBuilder {
|
||||
background_task_maximum_delay: self
|
||||
.background_task_maximum_delay
|
||||
.ok_or(anyhow!("missing background_task_maximum_delay"))?,
|
||||
control_plane_api: self
|
||||
.control_plane_api
|
||||
.ok_or(anyhow!("missing control_plane_api"))?,
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -579,27 +566,6 @@ impl PageServerConf {
|
||||
self.workdir.join("tenants")
|
||||
}
|
||||
|
||||
pub fn deletion_prefix(&self) -> PathBuf {
|
||||
self.workdir.join("deletion")
|
||||
}
|
||||
|
||||
pub fn deletion_list_path(&self, sequence: u64) -> PathBuf {
|
||||
// Encode a version in the filename, so that if we ever switch away from JSON we can
|
||||
// increment this.
|
||||
const VERSION: u8 = 1;
|
||||
|
||||
self.deletion_prefix()
|
||||
.join(format!("{sequence:016x}-{VERSION:02x}.list"))
|
||||
}
|
||||
|
||||
pub fn deletion_header_path(&self) -> PathBuf {
|
||||
// Encode a version in the filename, so that if we ever switch away from JSON we can
|
||||
// increment this.
|
||||
const VERSION: u8 = 1;
|
||||
|
||||
self.deletion_prefix().join(format!("header-{VERSION:02x}"))
|
||||
}
|
||||
|
||||
pub fn tenant_path(&self, tenant_id: &TenantId) -> PathBuf {
|
||||
self.tenants_path().join(tenant_id.to_string())
|
||||
}
|
||||
@@ -677,6 +643,23 @@ impl PageServerConf {
|
||||
.join(METADATA_FILE_NAME)
|
||||
}
|
||||
|
||||
/// Files on the remote storage are stored with paths, relative to the workdir.
|
||||
/// That path includes in itself both tenant and timeline ids, allowing to have a unique remote storage path.
|
||||
///
|
||||
/// Errors if the path provided does not start from pageserver's workdir.
|
||||
pub fn remote_path(&self, local_path: &Path) -> anyhow::Result<RemotePath> {
|
||||
local_path
|
||||
.strip_prefix(&self.workdir)
|
||||
.context("Failed to strip workdir prefix")
|
||||
.and_then(RemotePath::new)
|
||||
.with_context(|| {
|
||||
format!(
|
||||
"Failed to resolve remote part of path {:?} for base {:?}",
|
||||
local_path, self.workdir
|
||||
)
|
||||
})
|
||||
}
|
||||
|
||||
/// Turns storage remote path of a file into its local path.
|
||||
pub fn local_path(&self, remote_path: &RemotePath) -> PathBuf {
|
||||
remote_path.with_base(&self.workdir)
|
||||
@@ -775,7 +758,6 @@ impl PageServerConf {
|
||||
},
|
||||
"ondemand_download_behavior_treat_error_as_warn" => builder.ondemand_download_behavior_treat_error_as_warn(parse_toml_bool(key, item)?),
|
||||
"background_task_maximum_delay" => builder.background_task_maximum_delay(parse_toml_duration(key, item)?),
|
||||
"control_plane_api" => builder.control_plane_api(parse_toml_string(key, item)?.parse().context("failed to parse control plane URL")?),
|
||||
_ => bail!("unrecognized pageserver option '{key}'"),
|
||||
}
|
||||
}
|
||||
@@ -944,7 +926,6 @@ impl PageServerConf {
|
||||
test_remote_failures: 0,
|
||||
ondemand_download_behavior_treat_error_as_warn: false,
|
||||
background_task_maximum_delay: Duration::ZERO,
|
||||
control_plane_api: None,
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1168,7 +1149,6 @@ background_task_maximum_delay = '334 s'
|
||||
background_task_maximum_delay: humantime::parse_duration(
|
||||
defaults::DEFAULT_BACKGROUND_TASK_MAXIMUM_DELAY
|
||||
)?,
|
||||
control_plane_api: None
|
||||
},
|
||||
"Correct defaults should be used when no config values are provided"
|
||||
);
|
||||
@@ -1224,7 +1204,6 @@ background_task_maximum_delay = '334 s'
|
||||
test_remote_failures: 0,
|
||||
ondemand_download_behavior_treat_error_as_warn: false,
|
||||
background_task_maximum_delay: Duration::from_secs(334),
|
||||
control_plane_api: None
|
||||
},
|
||||
"Should be able to parse all basic config values correctly"
|
||||
);
|
||||
|
||||
@@ -1,850 +0,0 @@
|
||||
mod backend;
|
||||
mod executor;
|
||||
mod frontend;
|
||||
|
||||
use std::collections::HashMap;
|
||||
use std::path::PathBuf;
|
||||
|
||||
use crate::metrics::DELETION_QUEUE_SUBMITTED;
|
||||
use crate::tenant::remote_timeline_client::remote_timeline_path;
|
||||
use remote_storage::{GenericRemoteStorage, RemotePath};
|
||||
use serde::Deserialize;
|
||||
use serde::Serialize;
|
||||
use serde_with::serde_as;
|
||||
use thiserror::Error;
|
||||
use tokio;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::{self, debug, error};
|
||||
use utils::generation::Generation;
|
||||
use utils::id::{TenantId, TimelineId};
|
||||
|
||||
pub(crate) use self::backend::BackendQueueWorker;
|
||||
use self::executor::ExecutorWorker;
|
||||
use self::frontend::DeletionOp;
|
||||
pub(crate) use self::frontend::FrontendQueueWorker;
|
||||
use backend::BackendQueueMessage;
|
||||
use executor::ExecutorMessage;
|
||||
use frontend::FrontendQueueMessage;
|
||||
|
||||
use crate::{config::PageServerConf, tenant::storage_layer::LayerFileName};
|
||||
|
||||
// TODO: adminstrative "panic button" config property to disable all deletions
|
||||
// TODO: configurable for how long to wait before executing deletions
|
||||
|
||||
/// We aggregate object deletions from many tenants in one place, for several reasons:
|
||||
/// - Coalesce deletions into fewer DeleteObjects calls
|
||||
/// - Enable Tenant/Timeline lifetimes to be shorter than the time it takes
|
||||
/// to flush any outstanding deletions.
|
||||
/// - Globally control throughput of deletions, as these are a low priority task: do
|
||||
/// not compete with the same S3 clients/connections used for higher priority uploads.
|
||||
/// - Future: enable validating that we may do deletions in a multi-attached scenario,
|
||||
/// via generation numbers (see https://github.com/neondatabase/neon/pull/4919)
|
||||
///
|
||||
/// There are two kinds of deletion: deferred and immediate. A deferred deletion
|
||||
/// may be intentionally delayed to protect passive readers of S3 data, and may
|
||||
/// be subject to a generation number validation step. An immediate deletion is
|
||||
/// ready to execute immediately, and is only queued up so that it can be coalesced
|
||||
/// with other deletions in flight.
|
||||
///
|
||||
/// Deferred deletions pass through three steps:
|
||||
/// - Frontend: accumulate deletion requests from Timelines, and batch them up into
|
||||
/// DeletionLists, which are persisted to S3.
|
||||
/// - Backend: accumulate deletion lists, and validate them en-masse prior to passing
|
||||
/// the keys in the list onward for actual deletion
|
||||
/// - Executor: accumulate object keys that the backend has validated for immediate
|
||||
/// deletion, and execute them in batches of 1000 keys via DeleteObjects.
|
||||
///
|
||||
/// Non-deferred deletions, such as during timeline deletion, bypass the first
|
||||
/// two stages and are passed straight into the Executor.
|
||||
///
|
||||
/// Internally, each stage is joined by a channel to the next. In S3, there is only
|
||||
/// one queue (of DeletionLists), which is written by the frontend and consumed
|
||||
/// by the backend.
|
||||
#[derive(Clone)]
|
||||
pub struct DeletionQueue {
|
||||
client: DeletionQueueClient,
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
struct FlushOp {
|
||||
tx: tokio::sync::oneshot::Sender<()>,
|
||||
}
|
||||
|
||||
impl FlushOp {
|
||||
fn fire(self) {
|
||||
if self.tx.send(()).is_err() {
|
||||
// oneshot channel closed. This is legal: a client could be destroyed while waiting for a flush.
|
||||
debug!("deletion queue flush from dropped client");
|
||||
};
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct DeletionQueueClient {
|
||||
tx: tokio::sync::mpsc::Sender<FrontendQueueMessage>,
|
||||
executor_tx: tokio::sync::mpsc::Sender<ExecutorMessage>,
|
||||
}
|
||||
|
||||
#[derive(Debug, Serialize, Deserialize)]
|
||||
struct TenantDeletionList {
|
||||
/// For each Timeline, a list of key fragments to append to the timeline remote path
|
||||
/// when reconstructing a full key
|
||||
timelines: HashMap<TimelineId, Vec<String>>,
|
||||
|
||||
/// The generation in which this deletion was emitted: note that this may not be the
|
||||
/// same as the generation of any layers being deleted. The generation of the layer
|
||||
/// has already been absorbed into the keys in `objects`
|
||||
generation: Generation,
|
||||
}
|
||||
|
||||
#[serde_as]
|
||||
#[derive(Debug, Serialize, Deserialize)]
|
||||
struct DeletionList {
|
||||
/// Serialization version, for future use
|
||||
version: u8,
|
||||
|
||||
/// Used for constructing a unique key for each deletion list we write out.
|
||||
sequence: u64,
|
||||
|
||||
/// To avoid repeating tenant/timeline IDs in every key, we store keys in
|
||||
/// nested HashMaps by TenantTimelineID. Each Tenant only appears once
|
||||
/// with one unique generation ID: if someone tries to push a second generation
|
||||
/// ID for the same tenant, we will start a new DeletionList.
|
||||
tenants: HashMap<TenantId, TenantDeletionList>,
|
||||
|
||||
/// Avoid having to walk `tenants` to calculate size
|
||||
size: usize,
|
||||
}
|
||||
|
||||
#[serde_as]
|
||||
#[derive(Debug, Serialize, Deserialize)]
|
||||
struct DeletionHeader {
|
||||
/// Serialization version, for future use
|
||||
version: u8,
|
||||
|
||||
/// Enable determining the next sequence number even if there are no deletion lists present.
|
||||
/// If there _are_ deletion lists present, then their sequence numbers take precedence over
|
||||
/// this.
|
||||
last_deleted_list_seq: u64,
|
||||
// TODO: this is where we will track a 'clean' sequence number that indicates all deletion
|
||||
// lists <= that sequence have had their generations validated with the control plane
|
||||
// and are OK to execute.
|
||||
}
|
||||
|
||||
impl DeletionHeader {
|
||||
const VERSION_LATEST: u8 = 1;
|
||||
|
||||
fn new(last_deleted_list_seq: u64) -> Self {
|
||||
Self {
|
||||
version: Self::VERSION_LATEST,
|
||||
last_deleted_list_seq,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl DeletionList {
|
||||
const VERSION_LATEST: u8 = 1;
|
||||
fn new(sequence: u64) -> Self {
|
||||
Self {
|
||||
version: Self::VERSION_LATEST,
|
||||
sequence,
|
||||
tenants: HashMap::new(),
|
||||
size: 0,
|
||||
}
|
||||
}
|
||||
|
||||
fn drain(&mut self) -> Self {
|
||||
let mut tenants = HashMap::new();
|
||||
std::mem::swap(&mut self.tenants, &mut tenants);
|
||||
let other = Self {
|
||||
version: Self::VERSION_LATEST,
|
||||
sequence: self.sequence,
|
||||
tenants,
|
||||
size: self.size,
|
||||
};
|
||||
self.size = 0;
|
||||
other
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
self.tenants.is_empty()
|
||||
}
|
||||
|
||||
fn len(&self) -> usize {
|
||||
self.size
|
||||
}
|
||||
|
||||
/// Returns true if the push was accepted, false if the caller must start a new
|
||||
/// deletion list.
|
||||
fn push(
|
||||
&mut self,
|
||||
tenant: &TenantId,
|
||||
timeline: &TimelineId,
|
||||
generation: Generation,
|
||||
objects: &mut Vec<RemotePath>,
|
||||
) -> bool {
|
||||
if objects.is_empty() {
|
||||
// Avoid inserting an empty TimelineDeletionList: this preserves the property
|
||||
// that if we have no keys, then self.objects is empty (used in Self::is_empty)
|
||||
return true;
|
||||
}
|
||||
|
||||
let tenant_entry = self
|
||||
.tenants
|
||||
.entry(*tenant)
|
||||
.or_insert_with(|| TenantDeletionList {
|
||||
timelines: HashMap::new(),
|
||||
generation: generation,
|
||||
});
|
||||
|
||||
if tenant_entry.generation != generation {
|
||||
// Only one generation per tenant per list: signal to
|
||||
// caller to start a new list.
|
||||
return false;
|
||||
}
|
||||
|
||||
let timeline_entry = tenant_entry
|
||||
.timelines
|
||||
.entry(*timeline)
|
||||
.or_insert_with(|| Vec::new());
|
||||
|
||||
let timeline_remote_path = remote_timeline_path(tenant, timeline);
|
||||
|
||||
self.size += objects.len();
|
||||
timeline_entry.extend(objects.drain(..).map(|p| {
|
||||
p.strip_prefix(&timeline_remote_path)
|
||||
.expect("Timeline paths always start with the timeline prefix")
|
||||
.to_string_lossy()
|
||||
.to_string()
|
||||
}));
|
||||
true
|
||||
}
|
||||
|
||||
fn take_paths(self) -> Vec<RemotePath> {
|
||||
let mut result = Vec::new();
|
||||
for (tenant, tenant_deletions) in self.tenants.into_iter() {
|
||||
for (timeline, timeline_layers) in tenant_deletions.timelines.into_iter() {
|
||||
let timeline_remote_path = remote_timeline_path(&tenant, &timeline);
|
||||
result.extend(
|
||||
timeline_layers
|
||||
.into_iter()
|
||||
.map(|l| timeline_remote_path.join(&PathBuf::from(l))),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
result
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Error, Debug)]
|
||||
pub enum DeletionQueueError {
|
||||
#[error("Deletion queue unavailable during shutdown")]
|
||||
ShuttingDown,
|
||||
}
|
||||
|
||||
impl DeletionQueueClient {
|
||||
async fn do_push(&self, msg: FrontendQueueMessage) -> Result<(), DeletionQueueError> {
|
||||
match self.tx.send(msg).await {
|
||||
Ok(_) => Ok(()),
|
||||
Err(e) => {
|
||||
// This shouldn't happen, we should shut down all tenants before
|
||||
// we shut down the global delete queue. If we encounter a bug like this,
|
||||
// we may leak objects as deletions won't be processed.
|
||||
error!("Deletion queue closed while pushing, shutting down? ({e})");
|
||||
Err(DeletionQueueError::ShuttingDown)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Submit a list of layers for deletion: this function will return before the deletion is
|
||||
/// persistent, but it may be executed at any time after this function enters: do not push
|
||||
/// layers until you're sure they can be deleted safely (i.e. remote metadata no longer
|
||||
/// references them).
|
||||
pub(crate) async fn push_layers(
|
||||
&self,
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
generation: Generation,
|
||||
layers: Vec<(LayerFileName, Generation)>,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
DELETION_QUEUE_SUBMITTED.inc_by(layers.len() as u64);
|
||||
self.do_push(FrontendQueueMessage::Delete(DeletionOp {
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
layers,
|
||||
generation,
|
||||
objects: Vec::new(),
|
||||
}))
|
||||
.await
|
||||
}
|
||||
|
||||
async fn do_flush(
|
||||
&self,
|
||||
msg: FrontendQueueMessage,
|
||||
rx: tokio::sync::oneshot::Receiver<()>,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
self.do_push(msg).await?;
|
||||
if rx.await.is_err() {
|
||||
// This shouldn't happen if tenants are shut down before deletion queue. If we
|
||||
// encounter a bug like this, then a flusher will incorrectly believe it has flushed
|
||||
// when it hasn't, possibly leading to leaking objects.
|
||||
error!("Deletion queue dropped flush op while client was still waiting");
|
||||
Err(DeletionQueueError::ShuttingDown)
|
||||
} else {
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// Wait until all previous deletions are persistent (either executed, or written to a DeletionList)
|
||||
pub async fn flush(&self) -> Result<(), DeletionQueueError> {
|
||||
let (tx, rx) = tokio::sync::oneshot::channel::<()>();
|
||||
self.do_flush(FrontendQueueMessage::Flush(FlushOp { tx }), rx)
|
||||
.await
|
||||
}
|
||||
|
||||
// Wait until all previous deletions are executed
|
||||
pub(crate) async fn flush_execute(&self) -> Result<(), DeletionQueueError> {
|
||||
debug!("flush_execute: flushing to deletion lists...");
|
||||
// Flush any buffered work to deletion lists
|
||||
self.flush().await?;
|
||||
|
||||
// Flush execution of deletion lists
|
||||
let (tx, rx) = tokio::sync::oneshot::channel::<()>();
|
||||
debug!("flush_execute: flushing execution...");
|
||||
self.do_flush(FrontendQueueMessage::FlushExecute(FlushOp { tx }), rx)
|
||||
.await?;
|
||||
debug!("flush_execute: finished flushing execution...");
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// This interface bypasses the persistent deletion queue, and any validation
|
||||
/// that this pageserver is still elegible to execute the deletions. It is for
|
||||
/// use in timeline deletions, where the control plane is telling us we may
|
||||
/// delete everything in the timeline.
|
||||
///
|
||||
/// DO NOT USE THIS FROM GC OR COMPACTION CODE. Use the regular `push_layers`.
|
||||
pub(crate) async fn push_immediate(
|
||||
&self,
|
||||
objects: Vec<RemotePath>,
|
||||
) -> Result<(), DeletionQueueError> {
|
||||
self.executor_tx
|
||||
.send(ExecutorMessage::Delete(objects))
|
||||
.await
|
||||
.map_err(|_| DeletionQueueError::ShuttingDown)
|
||||
}
|
||||
|
||||
/// Companion to push_immediate. When this returns Ok, all prior objects sent
|
||||
/// into push_immediate have been deleted from remote storage.
|
||||
pub(crate) async fn flush_immediate(&self) -> Result<(), DeletionQueueError> {
|
||||
let (tx, rx) = tokio::sync::oneshot::channel::<()>();
|
||||
self.executor_tx
|
||||
.send(ExecutorMessage::Flush(FlushOp { tx }))
|
||||
.await
|
||||
.map_err(|_| DeletionQueueError::ShuttingDown)?;
|
||||
|
||||
rx.await.map_err(|_| DeletionQueueError::ShuttingDown)
|
||||
}
|
||||
}
|
||||
|
||||
impl DeletionQueue {
|
||||
pub fn new_client(&self) -> DeletionQueueClient {
|
||||
self.client.clone()
|
||||
}
|
||||
|
||||
/// Caller may use the returned object to construct clients with new_client.
|
||||
/// Caller should tokio::spawn the background() members of the two worker objects returned:
|
||||
/// we don't spawn those inside new() so that the caller can use their runtime/spans of choice.
|
||||
///
|
||||
/// If remote_storage is None, then the returned workers will also be None.
|
||||
pub fn new(
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
conf: &'static PageServerConf,
|
||||
cancel: CancellationToken,
|
||||
) -> (
|
||||
Self,
|
||||
Option<FrontendQueueWorker>,
|
||||
Option<BackendQueueWorker>,
|
||||
Option<ExecutorWorker>,
|
||||
) {
|
||||
// Deep channel: it consumes deletions from all timelines and we do not want to block them
|
||||
let (tx, rx) = tokio::sync::mpsc::channel(16384);
|
||||
|
||||
// Shallow channel: it carries DeletionLists which each contain up to thousands of deletions
|
||||
let (backend_tx, backend_rx) = tokio::sync::mpsc::channel(16);
|
||||
|
||||
// Shallow channel: it carries lists of paths, and we expect the main queueing to
|
||||
// happen in the backend (persistent), not in this queue.
|
||||
let (executor_tx, executor_rx) = tokio::sync::mpsc::channel(16);
|
||||
|
||||
let remote_storage = match remote_storage {
|
||||
None => {
|
||||
return (
|
||||
Self {
|
||||
client: DeletionQueueClient { tx, executor_tx },
|
||||
},
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
)
|
||||
}
|
||||
Some(r) => r,
|
||||
};
|
||||
|
||||
(
|
||||
Self {
|
||||
client: DeletionQueueClient {
|
||||
tx,
|
||||
executor_tx: executor_tx.clone(),
|
||||
},
|
||||
},
|
||||
Some(FrontendQueueWorker::new(
|
||||
conf,
|
||||
rx,
|
||||
backend_tx,
|
||||
cancel.clone(),
|
||||
)),
|
||||
Some(BackendQueueWorker::new(
|
||||
conf,
|
||||
backend_rx,
|
||||
executor_tx,
|
||||
cancel.clone(),
|
||||
)),
|
||||
Some(ExecutorWorker::new(
|
||||
remote_storage,
|
||||
executor_rx,
|
||||
cancel.clone(),
|
||||
)),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use hex_literal::hex;
|
||||
use std::{
|
||||
io::ErrorKind,
|
||||
path::{Path, PathBuf},
|
||||
};
|
||||
use tracing::info;
|
||||
|
||||
use remote_storage::{RemoteStorageConfig, RemoteStorageKind};
|
||||
use tokio::{runtime::EnterGuard, task::JoinHandle};
|
||||
|
||||
use crate::tenant::{harness::TenantHarness, remote_timeline_client::remote_timeline_path};
|
||||
|
||||
use super::*;
|
||||
pub const TIMELINE_ID: TimelineId =
|
||||
TimelineId::from_array(hex!("11223344556677881122334455667788"));
|
||||
|
||||
struct TestSetup {
|
||||
runtime: &'static tokio::runtime::Runtime,
|
||||
_entered_runtime: EnterGuard<'static>,
|
||||
harness: TenantHarness,
|
||||
remote_fs_dir: PathBuf,
|
||||
storage: GenericRemoteStorage,
|
||||
deletion_queue: DeletionQueue,
|
||||
fe_worker: JoinHandle<()>,
|
||||
be_worker: JoinHandle<()>,
|
||||
ex_worker: JoinHandle<()>,
|
||||
}
|
||||
|
||||
impl TestSetup {
|
||||
/// Simulate a pageserver restart by destroying and recreating the deletion queue
|
||||
fn restart(&mut self) {
|
||||
let (deletion_queue, fe_worker, be_worker, ex_worker) = DeletionQueue::new(
|
||||
Some(self.storage.clone()),
|
||||
self.harness.conf,
|
||||
CancellationToken::new(),
|
||||
);
|
||||
|
||||
self.deletion_queue = deletion_queue;
|
||||
|
||||
let mut fe_worker = fe_worker.unwrap();
|
||||
let mut be_worker = be_worker.unwrap();
|
||||
let mut ex_worker = ex_worker.unwrap();
|
||||
let mut fe_worker = self
|
||||
.runtime
|
||||
.spawn(async move { fe_worker.background().await });
|
||||
let mut be_worker = self
|
||||
.runtime
|
||||
.spawn(async move { be_worker.background().await });
|
||||
let mut ex_worker = self.runtime.spawn(async move {
|
||||
drop(ex_worker.background().await);
|
||||
});
|
||||
std::mem::swap(&mut self.fe_worker, &mut fe_worker);
|
||||
std::mem::swap(&mut self.be_worker, &mut be_worker);
|
||||
std::mem::swap(&mut self.ex_worker, &mut ex_worker);
|
||||
|
||||
// Join the old workers
|
||||
self.runtime.block_on(fe_worker).unwrap();
|
||||
self.runtime.block_on(be_worker).unwrap();
|
||||
self.runtime.block_on(ex_worker).unwrap();
|
||||
}
|
||||
}
|
||||
|
||||
fn setup(test_name: &str) -> anyhow::Result<TestSetup> {
|
||||
let test_name = Box::leak(Box::new(format!("deletion_queue__{test_name}")));
|
||||
let harness = TenantHarness::create(test_name)?;
|
||||
|
||||
// We do not load() the harness: we only need its config and remote_storage
|
||||
|
||||
// Set up a GenericRemoteStorage targetting a directory
|
||||
let remote_fs_dir = harness.conf.workdir.join("remote_fs");
|
||||
std::fs::create_dir_all(remote_fs_dir)?;
|
||||
let remote_fs_dir = std::fs::canonicalize(harness.conf.workdir.join("remote_fs"))?;
|
||||
let storage_config = RemoteStorageConfig {
|
||||
max_concurrent_syncs: std::num::NonZeroUsize::new(
|
||||
remote_storage::DEFAULT_REMOTE_STORAGE_MAX_CONCURRENT_SYNCS,
|
||||
)
|
||||
.unwrap(),
|
||||
max_sync_errors: std::num::NonZeroU32::new(
|
||||
remote_storage::DEFAULT_REMOTE_STORAGE_MAX_SYNC_ERRORS,
|
||||
)
|
||||
.unwrap(),
|
||||
storage: RemoteStorageKind::LocalFs(remote_fs_dir.clone()),
|
||||
};
|
||||
let storage = GenericRemoteStorage::from_config(&storage_config).unwrap();
|
||||
|
||||
let runtime = Box::leak(Box::new(
|
||||
tokio::runtime::Builder::new_current_thread()
|
||||
.enable_all()
|
||||
.build()?,
|
||||
));
|
||||
let entered_runtime = runtime.enter();
|
||||
|
||||
let (deletion_queue, fe_worker, be_worker, ex_worker) = DeletionQueue::new(
|
||||
Some(storage.clone()),
|
||||
harness.conf,
|
||||
CancellationToken::new(),
|
||||
);
|
||||
|
||||
let mut fe_worker = fe_worker.unwrap();
|
||||
let mut be_worker = be_worker.unwrap();
|
||||
let mut ex_worker = ex_worker.unwrap();
|
||||
let fe_worker_join = runtime.spawn(async move { fe_worker.background().await });
|
||||
let be_worker_join = runtime.spawn(async move { be_worker.background().await });
|
||||
let ex_worker_join = runtime.spawn(async move {
|
||||
drop(ex_worker.background().await);
|
||||
});
|
||||
|
||||
Ok(TestSetup {
|
||||
runtime,
|
||||
_entered_runtime: entered_runtime,
|
||||
harness,
|
||||
remote_fs_dir,
|
||||
storage,
|
||||
deletion_queue,
|
||||
fe_worker: fe_worker_join,
|
||||
be_worker: be_worker_join,
|
||||
ex_worker: ex_worker_join,
|
||||
})
|
||||
}
|
||||
|
||||
// TODO: put this in a common location so that we can share with remote_timeline_client's tests
|
||||
fn assert_remote_files(expected: &[&str], remote_path: &Path) {
|
||||
let mut expected: Vec<String> = expected.iter().map(|x| String::from(*x)).collect();
|
||||
expected.sort();
|
||||
|
||||
let mut found: Vec<String> = Vec::new();
|
||||
let dir = match std::fs::read_dir(remote_path) {
|
||||
Ok(d) => d,
|
||||
Err(e) => {
|
||||
if e.kind() == ErrorKind::NotFound {
|
||||
if expected.is_empty() {
|
||||
// We are asserting prefix is empty: it is expected that the dir is missing
|
||||
return;
|
||||
} else {
|
||||
assert_eq!(expected, Vec::<String>::new());
|
||||
unreachable!();
|
||||
}
|
||||
} else {
|
||||
panic!(
|
||||
"Unexpected error listing {0}: {e}",
|
||||
remote_path.to_string_lossy()
|
||||
);
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
for entry in dir.flatten() {
|
||||
let entry_name = entry.file_name();
|
||||
let fname = entry_name.to_str().unwrap();
|
||||
found.push(String::from(fname));
|
||||
}
|
||||
found.sort();
|
||||
|
||||
assert_eq!(expected, found);
|
||||
}
|
||||
|
||||
fn assert_local_files(expected: &[&str], directory: &Path) {
|
||||
let mut dir = match std::fs::read_dir(directory) {
|
||||
Ok(d) => d,
|
||||
Err(_) => {
|
||||
assert_eq!(expected, &Vec::<String>::new());
|
||||
return;
|
||||
}
|
||||
};
|
||||
let mut found = Vec::new();
|
||||
while let Some(dentry) = dir.next() {
|
||||
let dentry = dentry.unwrap();
|
||||
let file_name = dentry.file_name();
|
||||
let file_name_str = file_name.to_string_lossy();
|
||||
found.push(file_name_str.to_string());
|
||||
}
|
||||
found.sort();
|
||||
assert_eq!(expected, found);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn deletion_queue_smoke() -> anyhow::Result<()> {
|
||||
// Basic test that the deletion queue processes the deletions we pass into it
|
||||
let ctx = setup("deletion_queue_smoke").expect("Failed test setup");
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
|
||||
let layer_file_name_1: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap();
|
||||
let tenant_id = ctx.harness.tenant_id;
|
||||
|
||||
let content: Vec<u8> = "victim1 contents".into();
|
||||
let relative_remote_path = remote_timeline_path(&tenant_id, &TIMELINE_ID);
|
||||
let remote_timeline_path = ctx.remote_fs_dir.join(relative_remote_path.get_path());
|
||||
let deletion_prefix = ctx.harness.conf.deletion_prefix();
|
||||
|
||||
// Exercise the distinction between the generation of the layers
|
||||
// we delete, and the generation of the running Tenant.
|
||||
let layer_generation = Generation::new(0xdeadbeef);
|
||||
let now_generation = Generation::new(0xfeedbeef);
|
||||
|
||||
let remote_layer_file_name_1 =
|
||||
format!("{}{}", layer_file_name_1, layer_generation.get_suffix());
|
||||
|
||||
// Inject a victim file to remote storage
|
||||
info!("Writing");
|
||||
std::fs::create_dir_all(&remote_timeline_path)?;
|
||||
std::fs::write(
|
||||
remote_timeline_path.join(remote_layer_file_name_1.clone()),
|
||||
content,
|
||||
)?;
|
||||
assert_remote_files(&[&remote_layer_file_name_1], &remote_timeline_path);
|
||||
|
||||
// File should still be there after we push it to the queue (we haven't pushed enough to flush anything)
|
||||
info!("Pushing");
|
||||
ctx.runtime.block_on(client.push_layers(
|
||||
tenant_id,
|
||||
TIMELINE_ID,
|
||||
now_generation,
|
||||
[(layer_file_name_1.clone(), layer_generation)].to_vec(),
|
||||
))?;
|
||||
assert_remote_files(&[&remote_layer_file_name_1], &remote_timeline_path);
|
||||
|
||||
assert_local_files(&[], &deletion_prefix);
|
||||
|
||||
// File should still be there after we write a deletion list (we haven't pushed enough to execute anything)
|
||||
info!("Flushing");
|
||||
ctx.runtime.block_on(client.flush())?;
|
||||
assert_remote_files(&[&remote_layer_file_name_1], &remote_timeline_path);
|
||||
assert_local_files(&["0000000000000001-01.list"], &deletion_prefix);
|
||||
|
||||
// File should go away when we execute
|
||||
info!("Flush-executing");
|
||||
ctx.runtime.block_on(client.flush_execute())?;
|
||||
assert_remote_files(&[], &remote_timeline_path);
|
||||
assert_local_files(&["header-01"], &deletion_prefix);
|
||||
|
||||
// Flushing on an empty queue should succeed immediately, and not write any lists
|
||||
info!("Flush-executing on empty");
|
||||
ctx.runtime.block_on(client.flush_execute())?;
|
||||
assert_local_files(&["header-01"], &deletion_prefix);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn deletion_queue_recovery() -> anyhow::Result<()> {
|
||||
// Basic test that the deletion queue processes the deletions we pass into it
|
||||
let mut ctx = setup("deletion_queue_recovery").expect("Failed test setup");
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
|
||||
let layer_file_name_1: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap();
|
||||
let tenant_id = ctx.harness.tenant_id;
|
||||
|
||||
let content: Vec<u8> = "victim1 contents".into();
|
||||
let relative_remote_path = remote_timeline_path(&tenant_id, &TIMELINE_ID);
|
||||
let remote_timeline_path = ctx.remote_fs_dir.join(relative_remote_path.get_path());
|
||||
let deletion_prefix = ctx.harness.conf.deletion_prefix();
|
||||
let layer_generation = Generation::new(0xdeadbeef);
|
||||
let now_generation = Generation::new(0xfeedbeef);
|
||||
let remote_layer_file_name_1 =
|
||||
format!("{}{}", layer_file_name_1, layer_generation.get_suffix());
|
||||
|
||||
// Inject a file, delete it, and flush to a deletion list
|
||||
std::fs::create_dir_all(&remote_timeline_path)?;
|
||||
std::fs::write(
|
||||
remote_timeline_path.join(remote_layer_file_name_1.clone()),
|
||||
content,
|
||||
)?;
|
||||
ctx.runtime.block_on(client.push_layers(
|
||||
tenant_id,
|
||||
TIMELINE_ID,
|
||||
now_generation,
|
||||
[(layer_file_name_1.clone(), layer_generation)].to_vec(),
|
||||
))?;
|
||||
ctx.runtime.block_on(client.flush())?;
|
||||
assert_local_files(&["0000000000000001-01.list"], &deletion_prefix);
|
||||
|
||||
// Restart the deletion queue
|
||||
drop(client);
|
||||
ctx.restart();
|
||||
let client = ctx.deletion_queue.new_client();
|
||||
|
||||
// If we have recovered the deletion list properly, then executing after restart should purge it
|
||||
info!("Flush-executing");
|
||||
ctx.runtime.block_on(client.flush_execute())?;
|
||||
assert_remote_files(&[], &remote_timeline_path);
|
||||
assert_local_files(&["header-01"], &deletion_prefix);
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// A lightweight queue which can issue ordinary DeletionQueueClient objects, but doesn't do any persistence
|
||||
/// or coalescing, and doesn't actually execute any deletions unless you call pump() to kick it.
|
||||
#[cfg(test)]
|
||||
pub mod mock {
|
||||
use tracing::info;
|
||||
|
||||
use crate::tenant::remote_timeline_client::remote_layer_path;
|
||||
|
||||
use super::*;
|
||||
use std::sync::{
|
||||
atomic::{AtomicUsize, Ordering},
|
||||
Arc,
|
||||
};
|
||||
|
||||
pub struct MockDeletionQueue {
|
||||
tx: tokio::sync::mpsc::Sender<FrontendQueueMessage>,
|
||||
executor_tx: tokio::sync::mpsc::Sender<ExecutorMessage>,
|
||||
tx_pump: tokio::sync::mpsc::Sender<FlushOp>,
|
||||
executed: Arc<AtomicUsize>,
|
||||
}
|
||||
|
||||
impl MockDeletionQueue {
|
||||
pub fn new(remote_storage: Option<GenericRemoteStorage>) -> Self {
|
||||
let (tx, mut rx) = tokio::sync::mpsc::channel(16384);
|
||||
let (tx_pump, mut rx_pump) = tokio::sync::mpsc::channel::<FlushOp>(1);
|
||||
let (executor_tx, mut executor_rx) = tokio::sync::mpsc::channel(16384);
|
||||
|
||||
let executed = Arc::new(AtomicUsize::new(0));
|
||||
let executed_bg = executed.clone();
|
||||
|
||||
tokio::spawn(async move {
|
||||
let remote_storage = match &remote_storage {
|
||||
Some(rs) => rs,
|
||||
None => {
|
||||
info!("No remote storage configured, deletion queue will not run");
|
||||
return;
|
||||
}
|
||||
};
|
||||
info!("Running mock deletion queue");
|
||||
// Each time we are asked to pump, drain the queue of deletions
|
||||
while let Some(flush_op) = rx_pump.recv().await {
|
||||
info!("Executing all pending deletions");
|
||||
|
||||
// Transform all executor messages to generic frontend messages
|
||||
while let Ok(msg) = executor_rx.try_recv() {
|
||||
match msg {
|
||||
ExecutorMessage::Delete(objects) => {
|
||||
for path in objects {
|
||||
match remote_storage.delete(&path).await {
|
||||
Ok(_) => {
|
||||
debug!("Deleted {path}");
|
||||
}
|
||||
Err(e) => {
|
||||
error!(
|
||||
"Failed to delete {path}, leaking object! ({e})"
|
||||
);
|
||||
}
|
||||
}
|
||||
executed_bg.fetch_add(1, Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
ExecutorMessage::Flush(flush_op) => {
|
||||
flush_op.fire();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
while let Ok(msg) = rx.try_recv() {
|
||||
match msg {
|
||||
FrontendQueueMessage::Delete(op) => {
|
||||
let mut objects = op.objects;
|
||||
for (layer, generation) in op.layers {
|
||||
objects.push(remote_layer_path(
|
||||
&op.tenant_id,
|
||||
&op.timeline_id,
|
||||
&layer,
|
||||
generation,
|
||||
));
|
||||
}
|
||||
|
||||
for path in objects {
|
||||
info!("Executing deletion {path}");
|
||||
match remote_storage.delete(&path).await {
|
||||
Ok(_) => {
|
||||
debug!("Deleted {path}");
|
||||
}
|
||||
Err(e) => {
|
||||
error!(
|
||||
"Failed to delete {path}, leaking object! ({e})"
|
||||
);
|
||||
}
|
||||
}
|
||||
executed_bg.fetch_add(1, Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
FrontendQueueMessage::Flush(op) => {
|
||||
op.fire();
|
||||
}
|
||||
FrontendQueueMessage::FlushExecute(op) => {
|
||||
// We have already executed all prior deletions because mock does them inline
|
||||
op.fire();
|
||||
}
|
||||
}
|
||||
info!("All pending deletions have been executed");
|
||||
}
|
||||
flush_op
|
||||
.tx
|
||||
.send(())
|
||||
.expect("Test called flush but dropped before finishing");
|
||||
}
|
||||
});
|
||||
|
||||
Self {
|
||||
tx,
|
||||
tx_pump,
|
||||
executor_tx,
|
||||
executed,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get_executed(&self) -> usize {
|
||||
self.executed.load(Ordering::Relaxed)
|
||||
}
|
||||
|
||||
pub async fn pump(&self) {
|
||||
let (tx, rx) = tokio::sync::oneshot::channel();
|
||||
self.tx_pump
|
||||
.send(FlushOp { tx })
|
||||
.await
|
||||
.expect("pump called after deletion queue loop stopped");
|
||||
rx.await
|
||||
.expect("Mock delete queue shutdown while waiting to pump");
|
||||
}
|
||||
|
||||
pub(crate) fn new_client(&self) -> DeletionQueueClient {
|
||||
DeletionQueueClient {
|
||||
tx: self.tx.clone(),
|
||||
executor_tx: self.executor_tx.clone(),
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,300 +0,0 @@
|
||||
use std::collections::HashMap;
|
||||
use std::time::Duration;
|
||||
|
||||
use futures::future::TryFutureExt;
|
||||
use pageserver_api::control_api::HexTenantId;
|
||||
use pageserver_api::control_api::{ValidateRequest, ValidateRequestTenant, ValidateResponse};
|
||||
use serde::de::DeserializeOwned;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::debug;
|
||||
use tracing::info;
|
||||
use tracing::warn;
|
||||
use utils::backoff;
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::metrics::DELETION_QUEUE_ERRORS;
|
||||
|
||||
use super::executor::ExecutorMessage;
|
||||
use super::DeletionHeader;
|
||||
use super::DeletionList;
|
||||
use super::DeletionQueueError;
|
||||
use super::FlushOp;
|
||||
|
||||
// After this length of time, execute deletions which are elegible to run,
|
||||
// even if we haven't accumulated enough for a full-sized DeleteObjects
|
||||
const EXECUTE_IDLE_DEADLINE: Duration = Duration::from_secs(60);
|
||||
|
||||
// If we have received this number of keys, proceed with attempting to execute
|
||||
const AUTOFLUSH_KEY_COUNT: usize = 16384;
|
||||
|
||||
#[derive(Debug)]
|
||||
pub(super) enum BackendQueueMessage {
|
||||
Delete(DeletionList),
|
||||
Flush(FlushOp),
|
||||
}
|
||||
pub struct BackendQueueWorker {
|
||||
conf: &'static PageServerConf,
|
||||
rx: tokio::sync::mpsc::Receiver<BackendQueueMessage>,
|
||||
tx: tokio::sync::mpsc::Sender<ExecutorMessage>,
|
||||
|
||||
// Accumulate some lists to execute in a batch.
|
||||
// The purpose of this accumulation is to implement batched validation of
|
||||
// attachment generations, when split-brain protection is implemented.
|
||||
// (see https://github.com/neondatabase/neon/pull/4919)
|
||||
pending_lists: Vec<DeletionList>,
|
||||
|
||||
// Sum of all the lengths of lists in pending_lists
|
||||
pending_key_count: usize,
|
||||
|
||||
// DeletionLists we have fully executed, which may be deleted
|
||||
// from remote storage.
|
||||
executed_lists: Vec<DeletionList>,
|
||||
|
||||
cancel: CancellationToken,
|
||||
}
|
||||
|
||||
#[derive(thiserror::Error, Debug)]
|
||||
enum ValidateCallError {
|
||||
#[error("shutdown")]
|
||||
Shutdown,
|
||||
#[error("remote: {0}")]
|
||||
Remote(reqwest::Error),
|
||||
}
|
||||
|
||||
async fn retry_http_forever<T>(
|
||||
url: &url::Url,
|
||||
request: ValidateRequest,
|
||||
cancel: CancellationToken,
|
||||
) -> Result<T, DeletionQueueError>
|
||||
where
|
||||
T: DeserializeOwned,
|
||||
{
|
||||
let client = reqwest::ClientBuilder::new()
|
||||
.build()
|
||||
.expect("Failed to construct http client");
|
||||
|
||||
let response = match backoff::retry(
|
||||
|| {
|
||||
client
|
||||
.post(url.clone())
|
||||
.json(&request)
|
||||
.send()
|
||||
.map_err(|e| ValidateCallError::Remote(e))
|
||||
},
|
||||
|_| false,
|
||||
3,
|
||||
u32::MAX,
|
||||
"calling control plane generation validation API",
|
||||
backoff::Cancel::new(cancel.clone(), || ValidateCallError::Shutdown),
|
||||
)
|
||||
.await
|
||||
{
|
||||
Err(ValidateCallError::Shutdown) => {
|
||||
return Err(DeletionQueueError::ShuttingDown);
|
||||
}
|
||||
Err(ValidateCallError::Remote(_)) => {
|
||||
panic!("We retry forever");
|
||||
}
|
||||
Ok(r) => r,
|
||||
};
|
||||
|
||||
// TODO: handle non-200 response
|
||||
// TODO: handle decode error
|
||||
Ok(response.json::<T>().await.unwrap())
|
||||
}
|
||||
|
||||
impl BackendQueueWorker {
|
||||
pub(super) fn new(
|
||||
conf: &'static PageServerConf,
|
||||
rx: tokio::sync::mpsc::Receiver<BackendQueueMessage>,
|
||||
tx: tokio::sync::mpsc::Sender<ExecutorMessage>,
|
||||
cancel: CancellationToken,
|
||||
) -> Self {
|
||||
Self {
|
||||
conf,
|
||||
rx,
|
||||
tx,
|
||||
pending_lists: Vec::new(),
|
||||
pending_key_count: 0,
|
||||
executed_lists: Vec::new(),
|
||||
cancel,
|
||||
}
|
||||
}
|
||||
|
||||
async fn cleanup_lists(&mut self) {
|
||||
debug!(
|
||||
"cleanup_lists: {0} executed lists, {1} pending lists",
|
||||
self.executed_lists.len(),
|
||||
self.pending_lists.len()
|
||||
);
|
||||
|
||||
// Lists are always pushed into the queues + executed list in sequence order, so
|
||||
// no sort is required: can find the highest sequence number by peeking at last element
|
||||
let max_executed_seq = match self.executed_lists.last() {
|
||||
Some(v) => v.sequence,
|
||||
None => {
|
||||
// No executed lists, nothing to clean up.
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
// In case this is the last list, write a header out first so that
|
||||
// we don't risk losing our knowledge of the sequence number (on replay, our
|
||||
// next sequence number is the highest list seen + 1, or read from the header
|
||||
// if there are no lists)
|
||||
let header = DeletionHeader::new(max_executed_seq);
|
||||
debug!("Writing header {:?}", header);
|
||||
let header_bytes =
|
||||
serde_json::to_vec(&header).expect("Failed to serialize deletion header");
|
||||
let header_path = self.conf.deletion_header_path();
|
||||
|
||||
if let Err(e) = tokio::fs::write(&header_path, header_bytes).await {
|
||||
warn!("Failed to upload deletion queue header: {e:#}");
|
||||
DELETION_QUEUE_ERRORS
|
||||
.with_label_values(&["put_header"])
|
||||
.inc();
|
||||
return;
|
||||
}
|
||||
|
||||
while let Some(list) = self.executed_lists.pop() {
|
||||
let list_path = self.conf.deletion_list_path(list.sequence);
|
||||
if let Err(e) = tokio::fs::remove_file(&list_path).await {
|
||||
// Unexpected: we should have permissions and nothing else should
|
||||
// be touching these files
|
||||
tracing::error!("Failed to delete {0}: {e:#}", list_path.display());
|
||||
self.executed_lists.push(list);
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn validate_lists(&mut self) -> Result<(), DeletionQueueError> {
|
||||
let control_plane_api = match &self.conf.control_plane_api {
|
||||
None => {
|
||||
// Generations are not switched on yet.
|
||||
return Ok(());
|
||||
}
|
||||
Some(api) => api,
|
||||
};
|
||||
|
||||
let validate_path = control_plane_api
|
||||
.join("validate")
|
||||
.expect("Failed to build validate path");
|
||||
|
||||
for list in &mut self.pending_lists {
|
||||
let request = ValidateRequest {
|
||||
tenants: list
|
||||
.tenants
|
||||
.iter()
|
||||
.map(|(tid, tdl)| ValidateRequestTenant {
|
||||
id: HexTenantId::new(*tid),
|
||||
gen: tdl.generation.into().expect(
|
||||
"Generation should always be valid for a Tenant doing deletions",
|
||||
),
|
||||
})
|
||||
.collect(),
|
||||
};
|
||||
|
||||
// Retry forever, we cannot make progress until we get a response
|
||||
let response: ValidateResponse =
|
||||
retry_http_forever(&validate_path, request, self.cancel.clone()).await?;
|
||||
|
||||
let tenants_valid: HashMap<_, _> = response
|
||||
.tenants
|
||||
.into_iter()
|
||||
.map(|t| (t.id.take(), t.valid))
|
||||
.collect();
|
||||
|
||||
// Filter the list based on whether the server responded valid: true.
|
||||
// If a tenant is omitted in the response, it has been deleted, and we should
|
||||
// proceed with deletion.
|
||||
list.tenants.retain(|tenant_id, _tenant| {
|
||||
let r = tenants_valid.get(tenant_id).map(|v| *v).unwrap_or(true);
|
||||
if !r {
|
||||
warn!("Dropping stale deletions for tenant {tenant_id}, objects may be leaked");
|
||||
}
|
||||
r
|
||||
});
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub async fn flush(&mut self) {
|
||||
// Issue any required generation validation calls to the control plane
|
||||
if let Err(DeletionQueueError::ShuttingDown) = self.validate_lists().await {
|
||||
warn!("Shutting down");
|
||||
return;
|
||||
}
|
||||
|
||||
// Submit all keys from pending DeletionLists into the executor
|
||||
for list in self.pending_lists.drain(..) {
|
||||
let objects = list.take_paths();
|
||||
if let Err(_e) = self.tx.send(ExecutorMessage::Delete(objects)).await {
|
||||
warn!("Shutting down");
|
||||
return;
|
||||
};
|
||||
}
|
||||
|
||||
// Flush the executor to ensure all the operations we just submitted have been executed
|
||||
let (tx, rx) = tokio::sync::oneshot::channel::<()>();
|
||||
let flush_op = FlushOp { tx };
|
||||
if let Err(_e) = self.tx.send(ExecutorMessage::Flush(flush_op)).await {
|
||||
warn!("Shutting down");
|
||||
return;
|
||||
};
|
||||
if rx.await.is_err() {
|
||||
warn!("Shutting down");
|
||||
return;
|
||||
}
|
||||
|
||||
// After flush, we are assured that all contents of the pending lists
|
||||
// are executed
|
||||
self.pending_key_count = 0;
|
||||
self.executed_lists.append(&mut self.pending_lists);
|
||||
|
||||
// Erase the lists we executed
|
||||
self.cleanup_lists().await;
|
||||
}
|
||||
|
||||
pub async fn background(&mut self) {
|
||||
// TODO: if we would like to be able to defer deletions while a Layer still has
|
||||
// refs (but it will be elegible for deletion after process ends), then we may
|
||||
// add an ephemeral part to BackendQueueMessage::Delete that tracks which keys
|
||||
// in the deletion list may not be deleted yet, with guards to block on while
|
||||
// we wait to proceed.
|
||||
|
||||
loop {
|
||||
let msg = match tokio::time::timeout(EXECUTE_IDLE_DEADLINE, self.rx.recv()).await {
|
||||
Ok(Some(m)) => m,
|
||||
Ok(None) => {
|
||||
// All queue senders closed
|
||||
info!("Shutting down");
|
||||
break;
|
||||
}
|
||||
Err(_) => {
|
||||
// Timeout, we hit deadline to execute whatever we have in hand. These functions will
|
||||
// return immediately if no work is pending
|
||||
self.flush().await;
|
||||
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
match msg {
|
||||
BackendQueueMessage::Delete(list) => {
|
||||
self.pending_key_count += list.len();
|
||||
self.pending_lists.push(list);
|
||||
|
||||
if self.pending_key_count > AUTOFLUSH_KEY_COUNT {
|
||||
self.flush().await;
|
||||
}
|
||||
}
|
||||
BackendQueueMessage::Flush(op) => {
|
||||
self.flush().await;
|
||||
op.fire();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,143 +0,0 @@
|
||||
use remote_storage::GenericRemoteStorage;
|
||||
use remote_storage::RemotePath;
|
||||
use remote_storage::MAX_KEYS_PER_DELETE;
|
||||
use std::time::Duration;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::info;
|
||||
use tracing::warn;
|
||||
|
||||
use crate::metrics::DELETION_QUEUE_ERRORS;
|
||||
use crate::metrics::DELETION_QUEUE_EXECUTED;
|
||||
|
||||
use super::DeletionQueueError;
|
||||
use super::FlushOp;
|
||||
|
||||
const AUTOFLUSH_INTERVAL: Duration = Duration::from_secs(10);
|
||||
|
||||
pub(super) enum ExecutorMessage {
|
||||
Delete(Vec<RemotePath>),
|
||||
Flush(FlushOp),
|
||||
}
|
||||
|
||||
/// Non-persistent deletion queue, for coalescing multiple object deletes into
|
||||
/// larger DeleteObjects requests.
|
||||
pub struct ExecutorWorker {
|
||||
// Accumulate up to 1000 keys for the next deletion operation
|
||||
accumulator: Vec<RemotePath>,
|
||||
|
||||
rx: tokio::sync::mpsc::Receiver<ExecutorMessage>,
|
||||
|
||||
cancel: CancellationToken,
|
||||
remote_storage: GenericRemoteStorage,
|
||||
}
|
||||
|
||||
impl ExecutorWorker {
|
||||
pub(super) fn new(
|
||||
remote_storage: GenericRemoteStorage,
|
||||
rx: tokio::sync::mpsc::Receiver<ExecutorMessage>,
|
||||
cancel: CancellationToken,
|
||||
) -> Self {
|
||||
Self {
|
||||
remote_storage,
|
||||
rx,
|
||||
cancel,
|
||||
accumulator: Vec::new(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Wrap the remote `delete_objects` with a failpoint
|
||||
pub async fn remote_delete(&self) -> Result<(), anyhow::Error> {
|
||||
fail::fail_point!("deletion-queue-before-execute", |_| {
|
||||
info!("Skipping execution, failpoint set");
|
||||
DELETION_QUEUE_ERRORS
|
||||
.with_label_values(&["failpoint"])
|
||||
.inc();
|
||||
Err(anyhow::anyhow!("failpoint hit"))
|
||||
});
|
||||
|
||||
self.remote_storage.delete_objects(&self.accumulator).await
|
||||
}
|
||||
|
||||
/// Block until everything in accumulator has been executed
|
||||
pub async fn flush(&mut self) -> Result<(), DeletionQueueError> {
|
||||
while !self.accumulator.is_empty() && !self.cancel.is_cancelled() {
|
||||
match self.remote_delete().await {
|
||||
Ok(()) => {
|
||||
// Note: we assume that the remote storage layer returns Ok(()) if some
|
||||
// or all of the deleted objects were already gone.
|
||||
DELETION_QUEUE_EXECUTED.inc_by(self.accumulator.len() as u64);
|
||||
info!(
|
||||
"Executed deletion batch {}..{}",
|
||||
self.accumulator
|
||||
.first()
|
||||
.expect("accumulator should be non-empty"),
|
||||
self.accumulator
|
||||
.last()
|
||||
.expect("accumulator should be non-empty"),
|
||||
);
|
||||
self.accumulator.clear();
|
||||
}
|
||||
Err(e) => {
|
||||
warn!("DeleteObjects request failed: {e:#}, will retry");
|
||||
DELETION_QUEUE_ERRORS.with_label_values(&["execute"]).inc();
|
||||
}
|
||||
};
|
||||
}
|
||||
if self.cancel.is_cancelled() {
|
||||
// Expose an error because we may not have actually flushed everything
|
||||
Err(DeletionQueueError::ShuttingDown)
|
||||
} else {
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn background(&mut self) -> Result<(), DeletionQueueError> {
|
||||
self.accumulator.reserve(MAX_KEYS_PER_DELETE);
|
||||
|
||||
loop {
|
||||
if self.cancel.is_cancelled() {
|
||||
return Err(DeletionQueueError::ShuttingDown);
|
||||
}
|
||||
|
||||
let msg = match tokio::time::timeout(AUTOFLUSH_INTERVAL, self.rx.recv()).await {
|
||||
Ok(Some(m)) => m,
|
||||
Ok(None) => {
|
||||
// All queue senders closed
|
||||
info!("Shutting down");
|
||||
return Err(DeletionQueueError::ShuttingDown);
|
||||
}
|
||||
Err(_) => {
|
||||
// Timeout, we hit deadline to execute whatever we have in hand. These functions will
|
||||
// return immediately if no work is pending
|
||||
self.flush().await?;
|
||||
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
match msg {
|
||||
ExecutorMessage::Delete(mut list) => {
|
||||
while !list.is_empty() || self.accumulator.len() == MAX_KEYS_PER_DELETE {
|
||||
if self.accumulator.len() == MAX_KEYS_PER_DELETE {
|
||||
self.flush().await?;
|
||||
// If we have received this number of keys, proceed with attempting to execute
|
||||
assert_eq!(self.accumulator.len(), 0);
|
||||
}
|
||||
|
||||
let available_slots = MAX_KEYS_PER_DELETE - self.accumulator.len();
|
||||
let take_count = std::cmp::min(available_slots, list.len());
|
||||
for path in list.drain(list.len() - take_count..) {
|
||||
self.accumulator.push(path);
|
||||
}
|
||||
}
|
||||
}
|
||||
ExecutorMessage::Flush(flush_op) => {
|
||||
// If flush() errors, we drop the flush_op and the caller will get
|
||||
// an error recv()'ing their oneshot channel.
|
||||
self.flush().await?;
|
||||
flush_op.fire();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,376 +0,0 @@
|
||||
use super::BackendQueueMessage;
|
||||
use super::DeletionHeader;
|
||||
use super::DeletionList;
|
||||
use super::FlushOp;
|
||||
|
||||
use std::fs::create_dir_all;
|
||||
use std::time::Duration;
|
||||
|
||||
use regex::Regex;
|
||||
use remote_storage::RemotePath;
|
||||
use tokio_util::sync::CancellationToken;
|
||||
use tracing::debug;
|
||||
use tracing::info;
|
||||
use tracing::warn;
|
||||
use utils::generation::Generation;
|
||||
use utils::id::TenantId;
|
||||
use utils::id::TimelineId;
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::metrics::DELETION_QUEUE_ERRORS;
|
||||
use crate::metrics::DELETION_QUEUE_SUBMITTED;
|
||||
use crate::tenant::remote_timeline_client::remote_layer_path;
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
|
||||
// The number of keys in a DeletionList before we will proactively persist it
|
||||
// (without reaching a flush deadline). This aims to deliver objects of the order
|
||||
// of magnitude 1MB when we are under heavy delete load.
|
||||
const DELETION_LIST_TARGET_SIZE: usize = 16384;
|
||||
|
||||
// Ordinarily, we only flush to DeletionList periodically, to bound the window during
|
||||
// which we might leak objects from not flushing a DeletionList after
|
||||
// the objects are already unlinked from timeline metadata.
|
||||
const FRONTEND_DEFAULT_TIMEOUT: Duration = Duration::from_millis(10000);
|
||||
|
||||
// If someone is waiting for a flush to DeletionList, only delay a little to accumulate
|
||||
// more objects before doing the flush.
|
||||
const FRONTEND_FLUSHING_TIMEOUT: Duration = Duration::from_millis(100);
|
||||
|
||||
#[derive(Debug)]
|
||||
pub(super) struct DeletionOp {
|
||||
pub(super) tenant_id: TenantId,
|
||||
pub(super) timeline_id: TimelineId,
|
||||
// `layers` and `objects` are both just lists of objects. `layers` is used if you do not
|
||||
// have a config object handy to project it to a remote key, and need the consuming worker
|
||||
// to do it for you.
|
||||
pub(super) layers: Vec<(LayerFileName, Generation)>,
|
||||
pub(super) objects: Vec<RemotePath>,
|
||||
|
||||
/// The _current_ generation of the Tenant attachment in which we are enqueuing
|
||||
/// this deletion.
|
||||
pub(super) generation: Generation,
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
pub(super) enum FrontendQueueMessage {
|
||||
Delete(DeletionOp),
|
||||
// Wait until all prior deletions make it into a persistent DeletionList
|
||||
Flush(FlushOp),
|
||||
// Wait until all prior deletions have been executed (i.e. objects are actually deleted)
|
||||
FlushExecute(FlushOp),
|
||||
}
|
||||
|
||||
pub struct FrontendQueueWorker {
|
||||
conf: &'static PageServerConf,
|
||||
|
||||
// Incoming frontend requests to delete some keys
|
||||
rx: tokio::sync::mpsc::Receiver<FrontendQueueMessage>,
|
||||
|
||||
// Outbound requests to the backend to execute deletion lists we have composed.
|
||||
tx: tokio::sync::mpsc::Sender<BackendQueueMessage>,
|
||||
|
||||
// The list we are currently building, contains a buffer of keys to delete
|
||||
// and our next sequence number
|
||||
pending: DeletionList,
|
||||
|
||||
// These FlushOps should fire the next time we flush
|
||||
pending_flushes: Vec<FlushOp>,
|
||||
|
||||
// Worker loop is torn down when this fires.
|
||||
cancel: CancellationToken,
|
||||
}
|
||||
|
||||
impl FrontendQueueWorker {
|
||||
pub(super) fn new(
|
||||
conf: &'static PageServerConf,
|
||||
rx: tokio::sync::mpsc::Receiver<FrontendQueueMessage>,
|
||||
tx: tokio::sync::mpsc::Sender<BackendQueueMessage>,
|
||||
cancel: CancellationToken,
|
||||
) -> Self {
|
||||
Self {
|
||||
pending: DeletionList::new(1),
|
||||
conf,
|
||||
rx,
|
||||
tx,
|
||||
pending_flushes: Vec::new(),
|
||||
cancel,
|
||||
}
|
||||
}
|
||||
async fn upload_pending_list(&mut self) -> anyhow::Result<()> {
|
||||
let path = self.conf.deletion_list_path(self.pending.sequence);
|
||||
|
||||
let bytes = serde_json::to_vec(&self.pending).expect("Failed to serialize deletion list");
|
||||
tokio::fs::write(&path, &bytes).await?;
|
||||
tokio::fs::File::open(&path).await?.sync_all().await?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Try to flush `list` to persistent storage
|
||||
///
|
||||
/// This does not return errors, because on failure to flush we do not lose
|
||||
/// any state: flushing will be retried implicitly on the next deadline
|
||||
async fn flush(&mut self) {
|
||||
if self.pending.is_empty() {
|
||||
for f in self.pending_flushes.drain(..) {
|
||||
f.fire();
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
match self.upload_pending_list().await {
|
||||
Ok(_) => {
|
||||
info!(sequence = self.pending.sequence, "Stored deletion list");
|
||||
|
||||
for f in self.pending_flushes.drain(..) {
|
||||
f.fire();
|
||||
}
|
||||
|
||||
let onward_list = self.pending.drain();
|
||||
|
||||
// We have consumed out of pending: reset it for the next incoming deletions to accumulate there
|
||||
self.pending = DeletionList::new(self.pending.sequence + 1);
|
||||
|
||||
if let Err(e) = self.tx.send(BackendQueueMessage::Delete(onward_list)).await {
|
||||
// This is allowed to fail: it will only happen if the backend worker is shut down,
|
||||
// so we can just drop this on the floor.
|
||||
info!("Deletion list dropped, this is normal during shutdown ({e:#})");
|
||||
}
|
||||
}
|
||||
Err(e) => {
|
||||
DELETION_QUEUE_ERRORS.with_label_values(&["put_list"]).inc();
|
||||
warn!(
|
||||
sequence = self.pending.sequence,
|
||||
"Failed to write deletion list to remote storage, will retry later ({e:#})"
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async fn recover(&mut self) -> Result<(), anyhow::Error> {
|
||||
// Load header: this is not required to be present, e.g. when a pageserver first runs
|
||||
let header_path = self.conf.deletion_header_path();
|
||||
|
||||
// Synchronous, but we only do it once per process lifetime so it's tolerable
|
||||
create_dir_all(&self.conf.deletion_prefix())?;
|
||||
|
||||
let header_bytes = match tokio::fs::read(&header_path).await {
|
||||
Ok(h) => Ok(Some(h)),
|
||||
Err(e) => {
|
||||
if e.kind() == std::io::ErrorKind::NotFound {
|
||||
debug!(
|
||||
"Deletion header {0} not found, first start?",
|
||||
header_path.display()
|
||||
);
|
||||
Ok(None)
|
||||
} else {
|
||||
Err(e)
|
||||
}
|
||||
}
|
||||
}?;
|
||||
|
||||
if let Some(header_bytes) = header_bytes {
|
||||
if let Some(header) = match serde_json::from_slice::<DeletionHeader>(&header_bytes) {
|
||||
Ok(h) => Some(h),
|
||||
Err(e) => {
|
||||
warn!(
|
||||
"Failed to deserialize deletion header, ignoring {0}: {e:#}",
|
||||
header_path.display()
|
||||
);
|
||||
// This should never happen unless we make a mistake with our serialization.
|
||||
// Ignoring a deletion header is not consequential for correctnes because all deletions
|
||||
// are ultimately allowed to fail: worst case we leak some objects for the scrubber to clean up.
|
||||
None
|
||||
}
|
||||
} {
|
||||
self.pending.sequence =
|
||||
std::cmp::max(self.pending.sequence, header.last_deleted_list_seq + 1);
|
||||
};
|
||||
};
|
||||
|
||||
let mut dir = match tokio::fs::read_dir(&self.conf.deletion_prefix()).await {
|
||||
Ok(d) => d,
|
||||
Err(e) => {
|
||||
warn!(
|
||||
"Failed to open deletion list directory {0}: {e:#}",
|
||||
header_path.display()
|
||||
);
|
||||
|
||||
// Give up: if we can't read the deletion list directory, we probably can't
|
||||
// write lists into it later, so the queue won't work.
|
||||
return Err(e.into());
|
||||
}
|
||||
};
|
||||
|
||||
let list_name_pattern = Regex::new("([a-zA-Z0-9]{16})-([a-zA-Z0-9]{2}).list").unwrap();
|
||||
|
||||
let mut seqs: Vec<u64> = Vec::new();
|
||||
while let Some(dentry) = dir.next_entry().await? {
|
||||
let file_name = dentry.file_name().to_owned();
|
||||
let basename = file_name.to_string_lossy();
|
||||
let seq_part = if let Some(m) = list_name_pattern.captures(&basename) {
|
||||
m.get(1)
|
||||
.expect("Non optional group should be present")
|
||||
.as_str()
|
||||
} else {
|
||||
warn!("Unexpected key in deletion queue: {basename}");
|
||||
continue;
|
||||
};
|
||||
|
||||
let seq: u64 = match u64::from_str_radix(seq_part, 16) {
|
||||
Ok(s) => s,
|
||||
Err(e) => {
|
||||
warn!("Malformed key '{basename}': {e}");
|
||||
continue;
|
||||
}
|
||||
};
|
||||
seqs.push(seq);
|
||||
}
|
||||
seqs.sort();
|
||||
|
||||
// Initialize the next sequence number in the frontend based on the maximum of the highest list we see,
|
||||
// and the last list that was deleted according to the header. Combined with writing out the header
|
||||
// prior to deletions, this guarnatees no re-use of sequence numbers.
|
||||
if let Some(max_list_seq) = seqs.last() {
|
||||
self.pending.sequence = std::cmp::max(self.pending.sequence, max_list_seq + 1);
|
||||
}
|
||||
|
||||
for s in seqs {
|
||||
let list_path = self.conf.deletion_list_path(s);
|
||||
let list_bytes = tokio::fs::read(&list_path).await?;
|
||||
|
||||
let deletion_list = match serde_json::from_slice::<DeletionList>(&list_bytes) {
|
||||
Ok(l) => l,
|
||||
Err(e) => {
|
||||
// Drop the list on the floor: any objects it referenced will be left behind
|
||||
// for scrubbing to clean up. This should never happen unless we have a serialization bug.
|
||||
warn!(sequence = s, "Failed to deserialize deletion list: {e}");
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
// We will drop out of recovery if this fails: it indicates that we are shutting down
|
||||
// or the backend has panicked
|
||||
DELETION_QUEUE_SUBMITTED.inc_by(deletion_list.len() as u64);
|
||||
self.tx
|
||||
.send(BackendQueueMessage::Delete(deletion_list))
|
||||
.await?;
|
||||
}
|
||||
|
||||
info!(next_sequence = self.pending.sequence, "Replay complete");
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// This is the front-end ingest, where we bundle up deletion requests into DeletionList
|
||||
/// and write them out, for later
|
||||
pub async fn background(&mut self) {
|
||||
info!("Started deletion frontend worker");
|
||||
|
||||
let mut recovered: bool = false;
|
||||
|
||||
while !self.cancel.is_cancelled() {
|
||||
let timeout = if self.pending_flushes.is_empty() {
|
||||
FRONTEND_DEFAULT_TIMEOUT
|
||||
} else {
|
||||
FRONTEND_FLUSHING_TIMEOUT
|
||||
};
|
||||
|
||||
let msg = match tokio::time::timeout(timeout, self.rx.recv()).await {
|
||||
Ok(Some(msg)) => msg,
|
||||
Ok(None) => {
|
||||
// Queue sender destroyed, shutting down
|
||||
break;
|
||||
}
|
||||
Err(_) => {
|
||||
// Hit deadline, flush.
|
||||
self.flush().await;
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
// On first message, do recovery. This avoids unnecessary recovery very
|
||||
// early in startup, and simplifies testing by avoiding a 404 reading the
|
||||
// header on every first pageserver startup.
|
||||
if !recovered {
|
||||
// Before accepting any input from this pageserver lifetime, recover all deletion lists that are in S3
|
||||
if let Err(e) = self.recover().await {
|
||||
// This should only happen in truly unrecoverable cases, like the recovery finding that the backend
|
||||
// queue receiver has been dropped.
|
||||
info!("Deletion queue recover aborted, deletion queue will not proceed ({e})");
|
||||
return;
|
||||
} else {
|
||||
recovered = true;
|
||||
}
|
||||
}
|
||||
|
||||
match msg {
|
||||
FrontendQueueMessage::Delete(op) => {
|
||||
debug!(
|
||||
"Delete: ingesting {0} layers, {1} other objects",
|
||||
op.layers.len(),
|
||||
op.objects.len()
|
||||
);
|
||||
|
||||
let mut layer_paths = Vec::new();
|
||||
for (layer, generation) in op.layers {
|
||||
layer_paths.push(remote_layer_path(
|
||||
&op.tenant_id,
|
||||
&op.timeline_id,
|
||||
&layer,
|
||||
generation,
|
||||
));
|
||||
}
|
||||
layer_paths.extend(op.objects);
|
||||
|
||||
if self.pending.push(
|
||||
&op.tenant_id,
|
||||
&op.timeline_id,
|
||||
op.generation,
|
||||
&mut layer_paths,
|
||||
) == false
|
||||
{
|
||||
self.flush().await;
|
||||
let retry = self.pending.push(
|
||||
&op.tenant_id,
|
||||
&op.timeline_id,
|
||||
op.generation,
|
||||
&mut layer_paths,
|
||||
);
|
||||
if retry != true {
|
||||
// Unexpeted: after we flush, we should have
|
||||
// drained self.pending, so a conflict on
|
||||
// generation numbers should be impossible.
|
||||
tracing::error!(
|
||||
"Failed to enqueue deletions, leaking objects. This is a bug."
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
FrontendQueueMessage::Flush(op) => {
|
||||
if self.pending.is_empty() {
|
||||
// Execute immediately
|
||||
debug!("Flush: No pending objects, flushing immediately");
|
||||
op.fire()
|
||||
} else {
|
||||
// Execute next time we flush
|
||||
debug!("Flush: adding to pending flush list for next deadline flush");
|
||||
self.pending_flushes.push(op);
|
||||
}
|
||||
}
|
||||
FrontendQueueMessage::FlushExecute(op) => {
|
||||
debug!("FlushExecute: passing through to backend");
|
||||
// We do not flush to a deletion list here: the client sends a Flush before the FlushExecute
|
||||
if let Err(e) = self.tx.send(BackendQueueMessage::Flush(op)).await {
|
||||
info!("Can't flush, shutting down ({e})");
|
||||
// Caller will get error when their oneshot sender was dropped.
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if self.pending.len() > DELETION_LIST_TARGET_SIZE || !self.pending_flushes.is_empty() {
|
||||
self.flush().await;
|
||||
}
|
||||
}
|
||||
info!("Deletion queue shut down.");
|
||||
}
|
||||
}
|
||||
@@ -60,7 +60,11 @@ use utils::serde_percent::Percent;
|
||||
use crate::{
|
||||
config::PageServerConf,
|
||||
task_mgr::{self, TaskKind, BACKGROUND_RUNTIME},
|
||||
tenant::{self, storage_layer::PersistentLayer, timeline::EvictionError, Timeline},
|
||||
tenant::{
|
||||
self,
|
||||
storage_layer::{AsLayerDesc, EvictionError, Layer},
|
||||
Timeline,
|
||||
},
|
||||
};
|
||||
|
||||
#[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)]
|
||||
@@ -108,7 +112,7 @@ pub fn launch_disk_usage_global_eviction_task(
|
||||
_ = background_jobs_barrier.wait() => { }
|
||||
};
|
||||
|
||||
disk_usage_eviction_task(&state, task_config, storage, &conf.tenants_path(), cancel)
|
||||
disk_usage_eviction_task(&state, task_config, &storage, &conf.tenants_path(), cancel)
|
||||
.await;
|
||||
Ok(())
|
||||
},
|
||||
@@ -121,7 +125,7 @@ pub fn launch_disk_usage_global_eviction_task(
|
||||
async fn disk_usage_eviction_task(
|
||||
state: &State,
|
||||
task_config: &DiskUsageEvictionTaskConfig,
|
||||
storage: GenericRemoteStorage,
|
||||
_storage: &GenericRemoteStorage,
|
||||
tenants_dir: &Path,
|
||||
cancel: CancellationToken,
|
||||
) {
|
||||
@@ -145,14 +149,8 @@ async fn disk_usage_eviction_task(
|
||||
let start = Instant::now();
|
||||
|
||||
async {
|
||||
let res = disk_usage_eviction_task_iteration(
|
||||
state,
|
||||
task_config,
|
||||
&storage,
|
||||
tenants_dir,
|
||||
&cancel,
|
||||
)
|
||||
.await;
|
||||
let res =
|
||||
disk_usage_eviction_task_iteration(state, task_config, tenants_dir, &cancel).await;
|
||||
|
||||
match res {
|
||||
Ok(()) => {}
|
||||
@@ -183,13 +181,12 @@ pub trait Usage: Clone + Copy + std::fmt::Debug {
|
||||
async fn disk_usage_eviction_task_iteration(
|
||||
state: &State,
|
||||
task_config: &DiskUsageEvictionTaskConfig,
|
||||
storage: &GenericRemoteStorage,
|
||||
tenants_dir: &Path,
|
||||
cancel: &CancellationToken,
|
||||
) -> anyhow::Result<()> {
|
||||
let usage_pre = filesystem_level_usage::get(tenants_dir, task_config)
|
||||
.context("get filesystem-level disk usage before evictions")?;
|
||||
let res = disk_usage_eviction_task_iteration_impl(state, storage, usage_pre, cancel).await;
|
||||
let res = disk_usage_eviction_task_iteration_impl(state, usage_pre, cancel).await;
|
||||
match res {
|
||||
Ok(outcome) => {
|
||||
debug!(?outcome, "disk_usage_eviction_iteration finished");
|
||||
@@ -273,7 +270,6 @@ struct LayerCount {
|
||||
|
||||
pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
state: &State,
|
||||
storage: &GenericRemoteStorage,
|
||||
usage_pre: U,
|
||||
cancel: &CancellationToken,
|
||||
) -> anyhow::Result<IterationOutcome<U>> {
|
||||
@@ -330,9 +326,10 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
// If we get far enough in the list that we start to evict layers that are below
|
||||
// the tenant's min-resident-size threshold, print a warning, and memorize the disk
|
||||
// usage at that point, in 'usage_planned_min_resident_size_respecting'.
|
||||
let mut batched: HashMap<_, Vec<Arc<dyn PersistentLayer>>> = HashMap::new();
|
||||
let mut batched: HashMap<_, Vec<_>> = HashMap::new();
|
||||
let mut warned = None;
|
||||
let mut usage_planned = usage_pre;
|
||||
let mut max_batch_size = 0;
|
||||
for (i, (partition, candidate)) in candidates.into_iter().enumerate() {
|
||||
if !usage_planned.has_pressure() {
|
||||
debug!(
|
||||
@@ -349,10 +346,15 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
|
||||
usage_planned.add_available_bytes(candidate.layer.layer_desc().file_size);
|
||||
|
||||
batched
|
||||
.entry(TimelineKey(candidate.timeline))
|
||||
.or_default()
|
||||
.push(candidate.layer);
|
||||
let batch = batched.entry(TimelineKey(candidate.timeline)).or_default();
|
||||
|
||||
// semaphore will later be used to limit eviction concurrency, and we can express at
|
||||
// most u32 number of permits. unlikely we would have u32::MAX layers to be evicted,
|
||||
// but fail gracefully by not making batches larger.
|
||||
if batch.len() < u32::MAX as usize {
|
||||
batch.push(candidate.layer);
|
||||
max_batch_size = max_batch_size.max(batch.len());
|
||||
}
|
||||
}
|
||||
|
||||
let usage_planned = match warned {
|
||||
@@ -369,64 +371,101 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
|
||||
// phase2: evict victims batched by timeline
|
||||
|
||||
// After the loop, `usage_assumed` is the post-eviction usage,
|
||||
// according to internal accounting.
|
||||
let mut usage_assumed = usage_pre;
|
||||
let mut evictions_failed = LayerCount::default();
|
||||
let mut js = tokio::task::JoinSet::new();
|
||||
|
||||
// ratelimit to 1k files or any higher max batch size
|
||||
let limit = Arc::new(tokio::sync::Semaphore::new(1000.max(max_batch_size)));
|
||||
|
||||
for (timeline, batch) in batched {
|
||||
let tenant_id = timeline.tenant_id;
|
||||
let timeline_id = timeline.timeline_id;
|
||||
let batch_size = batch.len();
|
||||
let batch_size =
|
||||
u32::try_from(batch.len()).expect("batch size limited to u32::MAX during partitioning");
|
||||
|
||||
// I dislike naming of `available_permits` but it means current total amount of permits
|
||||
// because permits can be added
|
||||
assert!(batch_size as usize <= limit.available_permits());
|
||||
|
||||
debug!(%timeline_id, "evicting batch for timeline");
|
||||
|
||||
async {
|
||||
let results = timeline.evict_layers(storage, &batch, cancel.clone()).await;
|
||||
let evict = {
|
||||
let limit = limit.clone();
|
||||
let cancel = cancel.clone();
|
||||
async move {
|
||||
let mut evicted_bytes = 0;
|
||||
let mut evictions_failed = LayerCount::default();
|
||||
|
||||
match results {
|
||||
Err(e) => {
|
||||
warn!("failed to evict batch: {:#}", e);
|
||||
}
|
||||
Ok(results) => {
|
||||
assert_eq!(results.len(), batch.len());
|
||||
for (result, layer) in results.into_iter().zip(batch.iter()) {
|
||||
let file_size = layer.layer_desc().file_size;
|
||||
match result {
|
||||
Some(Ok(())) => {
|
||||
usage_assumed.add_available_bytes(file_size);
|
||||
}
|
||||
Some(Err(EvictionError::CannotEvictRemoteLayer)) => {
|
||||
unreachable!("get_local_layers_for_disk_usage_eviction finds only local layers")
|
||||
}
|
||||
Some(Err(EvictionError::FileNotFound)) => {
|
||||
evictions_failed.file_sizes += file_size;
|
||||
evictions_failed.count += 1;
|
||||
}
|
||||
Some(Err(
|
||||
e @ EvictionError::LayerNotFound(_)
|
||||
| e @ EvictionError::StatFailed(_),
|
||||
)) => {
|
||||
let e = utils::error::report_compact_sources(&e);
|
||||
warn!(%layer, "failed to evict layer: {e}");
|
||||
evictions_failed.file_sizes += file_size;
|
||||
evictions_failed.count += 1;
|
||||
}
|
||||
None => {
|
||||
assert!(cancel.is_cancelled());
|
||||
return;
|
||||
let Ok(_permit) = limit.acquire_many_owned(batch_size).await else {
|
||||
// semaphore closing means cancelled
|
||||
return (evicted_bytes, evictions_failed);
|
||||
};
|
||||
|
||||
let results = timeline.evict_layers(&batch, &cancel).await;
|
||||
|
||||
match results {
|
||||
Ok(results) => {
|
||||
assert_eq!(results.len(), batch.len());
|
||||
for (result, layer) in results.into_iter().zip(batch.iter()) {
|
||||
let file_size = layer.layer_desc().file_size;
|
||||
match result {
|
||||
Some(Ok(())) => {
|
||||
evicted_bytes += file_size;
|
||||
}
|
||||
Some(Err(EvictionError::NotFound | EvictionError::Downloaded)) => {
|
||||
evictions_failed.file_sizes += file_size;
|
||||
evictions_failed.count += 1;
|
||||
}
|
||||
None => {
|
||||
assert!(cancel.is_cancelled());
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
Err(e) => {
|
||||
warn!("failed to evict batch: {:#}", e);
|
||||
}
|
||||
}
|
||||
(evicted_bytes, evictions_failed)
|
||||
}
|
||||
}
|
||||
.instrument(tracing::info_span!("evict_batch", %tenant_id, %timeline_id, batch_size))
|
||||
.await;
|
||||
.instrument(tracing::info_span!("evict_batch", %tenant_id, %timeline_id, batch_size));
|
||||
|
||||
if cancel.is_cancelled() {
|
||||
js.spawn(evict);
|
||||
|
||||
// spwaning multiple thousands of these is essentially blocking, so give already spawned a
|
||||
// chance of making progress
|
||||
tokio::task::yield_now().await;
|
||||
}
|
||||
|
||||
let join_all = async move {
|
||||
// After the evictions, `usage_assumed` is the post-eviction usage,
|
||||
// according to internal accounting.
|
||||
let mut usage_assumed = usage_pre;
|
||||
let mut evictions_failed = LayerCount::default();
|
||||
|
||||
while let Some(res) = js.join_next().await {
|
||||
match res {
|
||||
Ok((evicted_bytes, failed)) => {
|
||||
usage_assumed.add_available_bytes(evicted_bytes);
|
||||
evictions_failed.file_sizes += failed.file_sizes;
|
||||
evictions_failed.count += failed.count;
|
||||
}
|
||||
Err(je) if je.is_cancelled() => unreachable!("not used"),
|
||||
Err(je) if je.is_panic() => { /* already logged */ }
|
||||
Err(je) => tracing::error!("unknown JoinError: {je:?}"),
|
||||
}
|
||||
}
|
||||
(usage_assumed, evictions_failed)
|
||||
};
|
||||
|
||||
let (usage_assumed, evictions_failed) = tokio::select! {
|
||||
tuple = join_all => { tuple },
|
||||
_ = cancel.cancelled() => {
|
||||
// close the semaphore to stop any pending acquires
|
||||
limit.close();
|
||||
return Ok(IterationOutcome::Cancelled);
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
Ok(IterationOutcome::Finished(IterationOutcomeFinished {
|
||||
before: usage_pre,
|
||||
@@ -441,7 +480,7 @@ pub async fn disk_usage_eviction_task_iteration_impl<U: Usage>(
|
||||
#[derive(Clone)]
|
||||
struct EvictionCandidate {
|
||||
timeline: Arc<Timeline>,
|
||||
layer: Arc<dyn PersistentLayer>,
|
||||
layer: Layer,
|
||||
last_activity_ts: SystemTime,
|
||||
}
|
||||
|
||||
|
||||
@@ -52,29 +52,6 @@ paths:
|
||||
schema:
|
||||
type: object
|
||||
|
||||
/v1/deletion_queue/flush:
|
||||
parameters:
|
||||
- name: execute
|
||||
in: query
|
||||
required: false
|
||||
schema:
|
||||
type: boolean
|
||||
description:
|
||||
If true, attempt to execute deletions. If false, just flush deletions to persistent deletion lists.
|
||||
put:
|
||||
description: Execute any deletions currently enqueued
|
||||
security: []
|
||||
responses:
|
||||
"200":
|
||||
description: |
|
||||
Flush completed: if execute was true, then enqueued deletions have been completed. If execute was false,
|
||||
then enqueued deletions have been persisted to deletion lists, and may have been completed.
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: object
|
||||
|
||||
|
||||
/v1/tenant/{tenant_id}:
|
||||
parameters:
|
||||
- name: tenant_id
|
||||
@@ -406,6 +383,7 @@ paths:
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
|
||||
post:
|
||||
description: |
|
||||
Schedules attach operation to happen in the background for the given tenant.
|
||||
@@ -1042,9 +1020,6 @@ components:
|
||||
properties:
|
||||
config:
|
||||
$ref: '#/components/schemas/TenantConfig'
|
||||
generation:
|
||||
type: integer
|
||||
description: Attachment generation number.
|
||||
TenantConfigRequest:
|
||||
allOf:
|
||||
- $ref: '#/components/schemas/TenantConfig'
|
||||
|
||||
@@ -23,7 +23,6 @@ use super::models::{
|
||||
TimelineCreateRequest, TimelineGcRequest, TimelineInfo,
|
||||
};
|
||||
use crate::context::{DownloadBehavior, RequestContext};
|
||||
use crate::deletion_queue::{DeletionQueue, DeletionQueueError};
|
||||
use crate::metrics::{StorageTimeOperation, STORAGE_TIME_GLOBAL};
|
||||
use crate::pgdatadir_mapping::LsnForTimestamp;
|
||||
use crate::task_mgr::TaskKind;
|
||||
@@ -33,13 +32,11 @@ use crate::tenant::mgr::{
|
||||
};
|
||||
use crate::tenant::size::ModelInputs;
|
||||
use crate::tenant::storage_layer::LayerAccessStatsReset;
|
||||
use crate::tenant::timeline::Timeline;
|
||||
use crate::tenant::{LogicalSizeCalculationCause, PageReconstructError};
|
||||
use crate::tenant::{LogicalSizeCalculationCause, PageReconstructError, Timeline};
|
||||
use crate::{config::PageServerConf, tenant::mgr};
|
||||
use crate::{disk_usage_eviction_task, tenant};
|
||||
use utils::{
|
||||
auth::JwtAuth,
|
||||
generation::Generation,
|
||||
http::{
|
||||
endpoint::{self, attach_openapi_ui, auth_middleware, check_permission_with},
|
||||
error::{ApiError, HttpErrorBody},
|
||||
@@ -59,7 +56,6 @@ struct State {
|
||||
auth: Option<Arc<JwtAuth>>,
|
||||
allowlist_routes: Vec<Uri>,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
deletion_queue: DeletionQueue,
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
disk_usage_eviction_state: Arc<disk_usage_eviction_task::State>,
|
||||
}
|
||||
@@ -69,7 +65,6 @@ impl State {
|
||||
conf: &'static PageServerConf,
|
||||
auth: Option<Arc<JwtAuth>>,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
deletion_queue: DeletionQueue,
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
disk_usage_eviction_state: Arc<disk_usage_eviction_task::State>,
|
||||
) -> anyhow::Result<Self> {
|
||||
@@ -83,7 +78,6 @@ impl State {
|
||||
allowlist_routes,
|
||||
remote_storage,
|
||||
broker_client,
|
||||
deletion_queue,
|
||||
disk_usage_eviction_state,
|
||||
})
|
||||
}
|
||||
@@ -478,7 +472,7 @@ async fn tenant_attach_handler(
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let maybe_body: Option<TenantAttachRequest> = json_request_or_empty_body(&mut request).await?;
|
||||
let tenant_conf = match &maybe_body {
|
||||
let tenant_conf = match maybe_body {
|
||||
Some(request) => TenantConfOpt::try_from(&*request.config).map_err(ApiError::BadRequest)?,
|
||||
None => TenantConfOpt::default(),
|
||||
};
|
||||
@@ -489,30 +483,13 @@ async fn tenant_attach_handler(
|
||||
|
||||
let state = get_state(&request);
|
||||
|
||||
let generation = if state.conf.control_plane_api.is_some() {
|
||||
// If we have been configured with a control plane URI, then generations are
|
||||
// mandatory, as we will attempt to re-attach on startup.
|
||||
maybe_body
|
||||
.as_ref()
|
||||
.map(|tar| tar.generation)
|
||||
.flatten()
|
||||
.map(|g| Generation::new(g))
|
||||
.ok_or(ApiError::BadRequest(anyhow!(
|
||||
"generation attribute missing"
|
||||
)))?
|
||||
} else {
|
||||
Generation::none()
|
||||
};
|
||||
|
||||
if let Some(remote_storage) = &state.remote_storage {
|
||||
mgr::attach_tenant(
|
||||
state.conf,
|
||||
tenant_id,
|
||||
generation,
|
||||
tenant_conf,
|
||||
state.broker_client.clone(),
|
||||
remote_storage.clone(),
|
||||
&state.deletion_queue,
|
||||
&ctx,
|
||||
)
|
||||
.instrument(info_span!("tenant_attach", %tenant_id))
|
||||
@@ -575,7 +552,6 @@ async fn tenant_load_handler(
|
||||
tenant_id,
|
||||
state.broker_client.clone(),
|
||||
state.remote_storage.clone(),
|
||||
&state.deletion_queue,
|
||||
&ctx,
|
||||
)
|
||||
.instrument(info_span!("load", %tenant_id))
|
||||
@@ -891,12 +867,6 @@ async fn tenant_create_handler(
|
||||
let tenant_conf =
|
||||
TenantConfOpt::try_from(&request_data.config).map_err(ApiError::BadRequest)?;
|
||||
|
||||
// TODO: make generation mandatory here once control plane supports it.
|
||||
let generation = request_data
|
||||
.generation
|
||||
.map(|g| Generation::new(g))
|
||||
.unwrap_or(Generation::none());
|
||||
|
||||
let ctx = RequestContext::new(TaskKind::MgmtRequest, DownloadBehavior::Warn);
|
||||
|
||||
let state = get_state(&request);
|
||||
@@ -905,10 +875,8 @@ async fn tenant_create_handler(
|
||||
state.conf,
|
||||
tenant_conf,
|
||||
target_tenant_id,
|
||||
generation,
|
||||
state.broker_client.clone(),
|
||||
state.remote_storage.clone(),
|
||||
&state.deletion_queue,
|
||||
&ctx,
|
||||
)
|
||||
.instrument(info_span!("tenant_create", tenant_id = %target_tenant_id))
|
||||
@@ -1060,7 +1028,7 @@ async fn timeline_compact_handler(
|
||||
timeline
|
||||
.compact(&cancel, &ctx)
|
||||
.await
|
||||
.map_err(ApiError::InternalServerError)?;
|
||||
.map_err(|e| ApiError::InternalServerError(e.into()))?;
|
||||
json_response(StatusCode::OK, ())
|
||||
}
|
||||
.instrument(info_span!("manual_compaction", %tenant_id, %timeline_id))
|
||||
@@ -1085,7 +1053,7 @@ async fn timeline_checkpoint_handler(
|
||||
timeline
|
||||
.compact(&cancel, &ctx)
|
||||
.await
|
||||
.map_err(ApiError::InternalServerError)?;
|
||||
.map_err(|e| ApiError::InternalServerError(e.into()))?;
|
||||
|
||||
json_response(StatusCode::OK, ())
|
||||
}
|
||||
@@ -1149,48 +1117,6 @@ async fn always_panic_handler(
|
||||
json_response(StatusCode::NO_CONTENT, ())
|
||||
}
|
||||
|
||||
async fn deletion_queue_flush(
|
||||
r: Request<Body>,
|
||||
cancel: CancellationToken,
|
||||
) -> Result<Response<Body>, ApiError> {
|
||||
let state = get_state(&r);
|
||||
|
||||
if state.remote_storage.is_none() {
|
||||
// Nothing to do if remote storage is disabled.
|
||||
return json_response(StatusCode::OK, ());
|
||||
}
|
||||
|
||||
let execute = parse_query_param(&r, "execute")?.unwrap_or(false);
|
||||
|
||||
let queue_client = state.deletion_queue.new_client();
|
||||
|
||||
tokio::select! {
|
||||
flush_result = async {
|
||||
if execute {
|
||||
queue_client.flush_execute().await
|
||||
} else {
|
||||
queue_client.flush().await
|
||||
}
|
||||
} => {
|
||||
match flush_result {
|
||||
Ok(())=> {
|
||||
json_response(StatusCode::OK, ())
|
||||
},
|
||||
Err(e) => {
|
||||
match e {
|
||||
DeletionQueueError::ShuttingDown => {
|
||||
Err(ApiError::ShuttingDown)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
_ = cancel.cancelled() => {
|
||||
Err(ApiError::ShuttingDown)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async fn disk_usage_eviction_run(
|
||||
mut r: Request<Body>,
|
||||
_cancel: CancellationToken,
|
||||
@@ -1234,11 +1160,11 @@ async fn disk_usage_eviction_run(
|
||||
|
||||
let state = get_state(&r);
|
||||
|
||||
let Some(storage) = state.remote_storage.clone() else {
|
||||
if state.remote_storage.as_ref().is_none() {
|
||||
return Err(ApiError::InternalServerError(anyhow::anyhow!(
|
||||
"remote storage not configured, cannot run eviction iteration"
|
||||
)));
|
||||
};
|
||||
}
|
||||
|
||||
let state = state.disk_usage_eviction_state.clone();
|
||||
|
||||
@@ -1256,7 +1182,6 @@ async fn disk_usage_eviction_run(
|
||||
async move {
|
||||
let res = crate::disk_usage_eviction_task::disk_usage_eviction_task_iteration_impl(
|
||||
&state,
|
||||
&storage,
|
||||
usage,
|
||||
&child_cancel,
|
||||
)
|
||||
@@ -1400,7 +1325,6 @@ pub fn make_router(
|
||||
auth: Option<Arc<JwtAuth>>,
|
||||
broker_client: BrokerClientChannel,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
deletion_queue: DeletionQueue,
|
||||
disk_usage_eviction_state: Arc<disk_usage_eviction_task::State>,
|
||||
) -> anyhow::Result<RouterBuilder<hyper::Body, ApiError>> {
|
||||
let spec = include_bytes!("openapi_spec.yml");
|
||||
@@ -1430,7 +1354,6 @@ pub fn make_router(
|
||||
conf,
|
||||
auth,
|
||||
remote_storage,
|
||||
deletion_queue,
|
||||
broker_client,
|
||||
disk_usage_eviction_state,
|
||||
)
|
||||
@@ -1515,9 +1438,6 @@ pub fn make_router(
|
||||
.put("/v1/disk_usage_eviction/run", |r| {
|
||||
api_handler(r, disk_usage_eviction_run)
|
||||
})
|
||||
.put("/v1/deletion_queue/flush", |r| {
|
||||
api_handler(r, deletion_queue_flush)
|
||||
})
|
||||
.put("/v1/tenant/:tenant_id/break", |r| {
|
||||
testing_api_handler("set tenant state to broken", r, handle_tenant_break)
|
||||
})
|
||||
|
||||
@@ -3,7 +3,6 @@ pub mod basebackup;
|
||||
pub mod config;
|
||||
pub mod consumption_metrics;
|
||||
pub mod context;
|
||||
pub mod deletion_queue;
|
||||
pub mod disk_usage_eviction_task;
|
||||
pub mod http;
|
||||
pub mod import_datadir;
|
||||
|
||||
@@ -795,31 +795,6 @@ static REMOTE_TIMELINE_CLIENT_CALLS_STARTED_HIST: Lazy<HistogramVec> = Lazy::new
|
||||
.expect("failed to define a metric")
|
||||
});
|
||||
|
||||
pub(crate) static DELETION_QUEUE_SUBMITTED: Lazy<IntCounter> = Lazy::new(|| {
|
||||
register_int_counter!(
|
||||
"pageserver_deletion_queue_submitted_total",
|
||||
"Number of objects submitted for deletion"
|
||||
)
|
||||
.expect("failed to define a metric")
|
||||
});
|
||||
|
||||
pub(crate) static DELETION_QUEUE_EXECUTED: Lazy<IntCounter> = Lazy::new(|| {
|
||||
register_int_counter!(
|
||||
"pageserver_deletion_queue_executed_total",
|
||||
"Number of objects deleted"
|
||||
)
|
||||
.expect("failed to define a metric")
|
||||
});
|
||||
|
||||
pub(crate) static DELETION_QUEUE_ERRORS: Lazy<IntCounterVec> = Lazy::new(|| {
|
||||
register_int_counter_vec!(
|
||||
"pageserver_deletion_queue_errors_total",
|
||||
"Incremented on retryable remote I/O errors writing deletion lists or executing deletions.",
|
||||
&["op_kind"],
|
||||
)
|
||||
.expect("failed to define a metric")
|
||||
});
|
||||
|
||||
static REMOTE_TIMELINE_CLIENT_BYTES_STARTED_COUNTER: Lazy<IntCounterVec> = Lazy::new(|| {
|
||||
register_int_counter_vec!(
|
||||
"pageserver_remote_timeline_client_bytes_started",
|
||||
|
||||
@@ -75,7 +75,10 @@
|
||||
use std::{
|
||||
collections::{hash_map::Entry, HashMap},
|
||||
convert::TryInto,
|
||||
sync::atomic::{AtomicU64, AtomicU8, AtomicUsize, Ordering},
|
||||
sync::{
|
||||
atomic::{AtomicU64, AtomicU8, AtomicUsize, Ordering},
|
||||
RwLock, RwLockReadGuard, RwLockWriteGuard, TryLockError,
|
||||
},
|
||||
};
|
||||
|
||||
use anyhow::Context;
|
||||
@@ -159,7 +162,7 @@ struct Version {
|
||||
}
|
||||
|
||||
struct Slot {
|
||||
inner: tokio::sync::RwLock<SlotInner>,
|
||||
inner: RwLock<SlotInner>,
|
||||
usage_count: AtomicU8,
|
||||
}
|
||||
|
||||
@@ -200,11 +203,6 @@ impl Slot {
|
||||
Err(usage_count) => usage_count,
|
||||
}
|
||||
}
|
||||
|
||||
/// Sets the usage count to a specific value.
|
||||
fn set_usage_count(&self, count: u8) {
|
||||
self.usage_count.store(count, Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
|
||||
pub struct PageCache {
|
||||
@@ -217,9 +215,9 @@ pub struct PageCache {
|
||||
///
|
||||
/// If you add support for caching different kinds of objects, each object kind
|
||||
/// can have a separate mapping map, next to this field.
|
||||
materialized_page_map: std::sync::RwLock<HashMap<MaterializedPageHashKey, Vec<Version>>>,
|
||||
materialized_page_map: RwLock<HashMap<MaterializedPageHashKey, Vec<Version>>>,
|
||||
|
||||
immutable_page_map: std::sync::RwLock<HashMap<(FileId, u32), usize>>,
|
||||
immutable_page_map: RwLock<HashMap<(FileId, u32), usize>>,
|
||||
|
||||
/// The actual buffers with their metadata.
|
||||
slots: Box<[Slot]>,
|
||||
@@ -235,7 +233,7 @@ pub struct PageCache {
|
||||
/// PageReadGuard is a "lease" on a buffer, for reading. The page is kept locked
|
||||
/// until the guard is dropped.
|
||||
///
|
||||
pub struct PageReadGuard<'i>(tokio::sync::RwLockReadGuard<'i, SlotInner>);
|
||||
pub struct PageReadGuard<'i>(RwLockReadGuard<'i, SlotInner>);
|
||||
|
||||
impl std::ops::Deref for PageReadGuard<'_> {
|
||||
type Target = [u8; PAGE_SZ];
|
||||
@@ -262,10 +260,9 @@ impl AsRef<[u8; PAGE_SZ]> for PageReadGuard<'_> {
|
||||
/// to initialize.
|
||||
///
|
||||
pub struct PageWriteGuard<'i> {
|
||||
inner: tokio::sync::RwLockWriteGuard<'i, SlotInner>,
|
||||
inner: RwLockWriteGuard<'i, SlotInner>,
|
||||
|
||||
// Are the page contents currently valid?
|
||||
// Used to mark pages as invalid that are assigned but not yet filled with data.
|
||||
valid: bool,
|
||||
}
|
||||
|
||||
@@ -340,7 +337,7 @@ impl PageCache {
|
||||
/// The 'lsn' is an upper bound, this will return the latest version of
|
||||
/// the given block, but not newer than 'lsn'. Returns the actual LSN of the
|
||||
/// returned page.
|
||||
pub async fn lookup_materialized_page(
|
||||
pub fn lookup_materialized_page(
|
||||
&self,
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
@@ -360,7 +357,7 @@ impl PageCache {
|
||||
lsn,
|
||||
};
|
||||
|
||||
if let Some(guard) = self.try_lock_for_read(&mut cache_key).await {
|
||||
if let Some(guard) = self.try_lock_for_read(&mut cache_key) {
|
||||
if let CacheKey::MaterializedPage {
|
||||
hash_key: _,
|
||||
lsn: available_lsn,
|
||||
@@ -387,7 +384,7 @@ impl PageCache {
|
||||
///
|
||||
/// Store an image of the given page in the cache.
|
||||
///
|
||||
pub async fn memorize_materialized_page(
|
||||
pub fn memorize_materialized_page(
|
||||
&self,
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
@@ -404,7 +401,7 @@ impl PageCache {
|
||||
lsn,
|
||||
};
|
||||
|
||||
match self.lock_for_write(&cache_key).await? {
|
||||
match self.lock_for_write(&cache_key)? {
|
||||
WriteBufResult::Found(write_guard) => {
|
||||
// We already had it in cache. Another thread must've put it there
|
||||
// concurrently. Check that it had the same contents that we
|
||||
@@ -422,14 +419,31 @@ impl PageCache {
|
||||
|
||||
// Section 1.2: Public interface functions for working with immutable file pages.
|
||||
|
||||
pub async fn read_immutable_buf(
|
||||
&self,
|
||||
file_id: FileId,
|
||||
blkno: u32,
|
||||
) -> anyhow::Result<ReadBufResult> {
|
||||
pub fn read_immutable_buf(&self, file_id: FileId, blkno: u32) -> anyhow::Result<ReadBufResult> {
|
||||
let mut cache_key = CacheKey::ImmutableFilePage { file_id, blkno };
|
||||
|
||||
self.lock_for_read(&mut cache_key).await
|
||||
self.lock_for_read(&mut cache_key)
|
||||
}
|
||||
|
||||
/// Immediately drop all buffers belonging to given file
|
||||
pub fn drop_buffers_for_immutable(&self, drop_file_id: FileId) {
|
||||
for slot_idx in 0..self.slots.len() {
|
||||
let slot = &self.slots[slot_idx];
|
||||
|
||||
let mut inner = slot.inner.write().unwrap();
|
||||
if let Some(key) = &inner.key {
|
||||
match key {
|
||||
CacheKey::ImmutableFilePage { file_id, blkno: _ }
|
||||
if *file_id == drop_file_id =>
|
||||
{
|
||||
// remove mapping for old buffer
|
||||
self.remove_mapping(key);
|
||||
inner.key = None;
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
@@ -449,14 +463,14 @@ impl PageCache {
|
||||
///
|
||||
/// If no page is found, returns None and *cache_key is left unmodified.
|
||||
///
|
||||
async fn try_lock_for_read(&self, cache_key: &mut CacheKey) -> Option<PageReadGuard> {
|
||||
fn try_lock_for_read(&self, cache_key: &mut CacheKey) -> Option<PageReadGuard> {
|
||||
let cache_key_orig = cache_key.clone();
|
||||
if let Some(slot_idx) = self.search_mapping(cache_key) {
|
||||
// The page was found in the mapping. Lock the slot, and re-check
|
||||
// that it's still what we expected (because we released the mapping
|
||||
// lock already, another thread could have evicted the page)
|
||||
let slot = &self.slots[slot_idx];
|
||||
let inner = slot.inner.read().await;
|
||||
let inner = slot.inner.read().unwrap();
|
||||
if inner.key.as_ref() == Some(cache_key) {
|
||||
slot.inc_usage_count();
|
||||
return Some(PageReadGuard(inner));
|
||||
@@ -497,7 +511,7 @@ impl PageCache {
|
||||
/// }
|
||||
/// ```
|
||||
///
|
||||
async fn lock_for_read(&self, cache_key: &mut CacheKey) -> anyhow::Result<ReadBufResult> {
|
||||
fn lock_for_read(&self, cache_key: &mut CacheKey) -> anyhow::Result<ReadBufResult> {
|
||||
let (read_access, hit) = match cache_key {
|
||||
CacheKey::MaterializedPage { .. } => {
|
||||
unreachable!("Materialized pages use lookup_materialized_page")
|
||||
@@ -512,7 +526,7 @@ impl PageCache {
|
||||
let mut is_first_iteration = true;
|
||||
loop {
|
||||
// First check if the key already exists in the cache.
|
||||
if let Some(read_guard) = self.try_lock_for_read(cache_key).await {
|
||||
if let Some(read_guard) = self.try_lock_for_read(cache_key) {
|
||||
if is_first_iteration {
|
||||
hit.inc();
|
||||
}
|
||||
@@ -542,7 +556,7 @@ impl PageCache {
|
||||
// Make the slot ready
|
||||
let slot = &self.slots[slot_idx];
|
||||
inner.key = Some(cache_key.clone());
|
||||
slot.set_usage_count(1);
|
||||
slot.usage_count.store(1, Ordering::Relaxed);
|
||||
|
||||
return Ok(ReadBufResult::NotFound(PageWriteGuard {
|
||||
inner,
|
||||
@@ -555,13 +569,13 @@ impl PageCache {
|
||||
/// found, returns None.
|
||||
///
|
||||
/// When locking a page for writing, the search criteria is always "exact".
|
||||
async fn try_lock_for_write(&self, cache_key: &CacheKey) -> Option<PageWriteGuard> {
|
||||
fn try_lock_for_write(&self, cache_key: &CacheKey) -> Option<PageWriteGuard> {
|
||||
if let Some(slot_idx) = self.search_mapping_for_write(cache_key) {
|
||||
// The page was found in the mapping. Lock the slot, and re-check
|
||||
// that it's still what we expected (because we don't released the mapping
|
||||
// lock already, another thread could have evicted the page)
|
||||
let slot = &self.slots[slot_idx];
|
||||
let inner = slot.inner.write().await;
|
||||
let inner = slot.inner.write().unwrap();
|
||||
if inner.key.as_ref() == Some(cache_key) {
|
||||
slot.inc_usage_count();
|
||||
return Some(PageWriteGuard { inner, valid: true });
|
||||
@@ -574,10 +588,10 @@ impl PageCache {
|
||||
///
|
||||
/// Similar to lock_for_read(), but the returned buffer is write-locked and
|
||||
/// may be modified by the caller even if it's already found in the cache.
|
||||
async fn lock_for_write(&self, cache_key: &CacheKey) -> anyhow::Result<WriteBufResult> {
|
||||
fn lock_for_write(&self, cache_key: &CacheKey) -> anyhow::Result<WriteBufResult> {
|
||||
loop {
|
||||
// First check if the key already exists in the cache.
|
||||
if let Some(write_guard) = self.try_lock_for_write(cache_key).await {
|
||||
if let Some(write_guard) = self.try_lock_for_write(cache_key) {
|
||||
return Ok(WriteBufResult::Found(write_guard));
|
||||
}
|
||||
|
||||
@@ -603,7 +617,7 @@ impl PageCache {
|
||||
// Make the slot ready
|
||||
let slot = &self.slots[slot_idx];
|
||||
inner.key = Some(cache_key.clone());
|
||||
slot.set_usage_count(1);
|
||||
slot.usage_count.store(1, Ordering::Relaxed);
|
||||
|
||||
return Ok(WriteBufResult::NotFound(PageWriteGuard {
|
||||
inner,
|
||||
@@ -758,7 +772,7 @@ impl PageCache {
|
||||
/// Find a slot to evict.
|
||||
///
|
||||
/// On return, the slot is empty and write-locked.
|
||||
fn find_victim(&self) -> anyhow::Result<(usize, tokio::sync::RwLockWriteGuard<SlotInner>)> {
|
||||
fn find_victim(&self) -> anyhow::Result<(usize, RwLockWriteGuard<SlotInner>)> {
|
||||
let iter_limit = self.slots.len() * 10;
|
||||
let mut iters = 0;
|
||||
loop {
|
||||
@@ -770,7 +784,10 @@ impl PageCache {
|
||||
if slot.dec_usage_count() == 0 {
|
||||
let mut inner = match slot.inner.try_write() {
|
||||
Ok(inner) => inner,
|
||||
Err(_err) => {
|
||||
Err(TryLockError::Poisoned(err)) => {
|
||||
anyhow::bail!("buffer lock was poisoned: {err:?}")
|
||||
}
|
||||
Err(TryLockError::WouldBlock) => {
|
||||
// If we have looped through the whole buffer pool 10 times
|
||||
// and still haven't found a victim buffer, something's wrong.
|
||||
// Maybe all the buffers were in locked. That could happen in
|
||||
@@ -799,8 +816,6 @@ impl PageCache {
|
||||
fn new(num_pages: usize) -> Self {
|
||||
assert!(num_pages > 0, "page cache size must be > 0");
|
||||
|
||||
// We use Box::leak here and into_boxed_slice to avoid leaking uninitialized
|
||||
// memory that Vec's might contain.
|
||||
let page_buffer = Box::leak(vec![0u8; num_pages * PAGE_SZ].into_boxed_slice());
|
||||
|
||||
let size_metrics = &crate::metrics::PAGE_CACHE_SIZE;
|
||||
@@ -814,7 +829,7 @@ impl PageCache {
|
||||
let buf: &mut [u8; PAGE_SZ] = chunk.try_into().unwrap();
|
||||
|
||||
Slot {
|
||||
inner: tokio::sync::RwLock::new(SlotInner { key: None, buf }),
|
||||
inner: RwLock::new(SlotInner { key: None, buf }),
|
||||
usage_count: AtomicU8::new(0),
|
||||
}
|
||||
})
|
||||
|
||||
@@ -59,7 +59,6 @@ use self::timeline::EvictionTaskTenantState;
|
||||
use self::timeline::TimelineResources;
|
||||
use crate::config::PageServerConf;
|
||||
use crate::context::{DownloadBehavior, RequestContext};
|
||||
use crate::deletion_queue::DeletionQueueClient;
|
||||
use crate::import_datadir;
|
||||
use crate::is_uninit_mark;
|
||||
use crate::metrics::TENANT_ACTIVATION;
|
||||
@@ -86,7 +85,6 @@ pub use pageserver_api::models::TenantState;
|
||||
use toml_edit;
|
||||
use utils::{
|
||||
crashsafe,
|
||||
generation::Generation,
|
||||
id::{TenantId, TimelineId},
|
||||
lsn::{Lsn, RecordLsn},
|
||||
};
|
||||
@@ -121,7 +119,7 @@ mod span;
|
||||
|
||||
pub mod metadata;
|
||||
mod par_fsync;
|
||||
pub mod remote_timeline_client;
|
||||
mod remote_timeline_client;
|
||||
pub mod storage_layer;
|
||||
|
||||
pub mod config;
|
||||
@@ -135,9 +133,7 @@ pub(crate) mod timeline;
|
||||
pub mod size;
|
||||
|
||||
pub(crate) use timeline::span::debug_assert_current_span_has_tenant_and_timeline_id;
|
||||
pub use timeline::{
|
||||
LocalLayerInfoForDiskUsageEviction, LogicalSizeCalculationCause, PageReconstructError, Timeline,
|
||||
};
|
||||
pub(crate) use timeline::{LogicalSizeCalculationCause, PageReconstructError, Timeline};
|
||||
|
||||
// re-export for use in remote_timeline_client.rs
|
||||
pub use crate::tenant::metadata::save_metadata;
|
||||
@@ -158,7 +154,6 @@ pub const TENANT_DELETED_MARKER_FILE_NAME: &str = "deleted";
|
||||
pub struct TenantSharedResources {
|
||||
pub broker_client: storage_broker::BrokerClientChannel,
|
||||
pub remote_storage: Option<GenericRemoteStorage>,
|
||||
pub deletion_queue_client: DeletionQueueClient,
|
||||
}
|
||||
|
||||
///
|
||||
@@ -181,10 +176,6 @@ pub struct Tenant {
|
||||
tenant_conf: Arc<RwLock<TenantConfOpt>>,
|
||||
|
||||
tenant_id: TenantId,
|
||||
|
||||
// The remote storage generation, used to protect S3 objects from split-brain
|
||||
generation: Generation,
|
||||
|
||||
timelines: Mutex<HashMap<TimelineId, Arc<Timeline>>>,
|
||||
// This mutex prevents creation of new timelines during GC.
|
||||
// Adding yet another mutex (in addition to `timelines`) is needed because holding
|
||||
@@ -198,9 +189,6 @@ pub struct Tenant {
|
||||
// provides access to timeline data sitting in the remote storage
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
|
||||
// Access to global deletion queue for when this tenant wants to schedule a deletion
|
||||
deletion_queue_client: Option<DeletionQueueClient>,
|
||||
|
||||
/// Cached logical sizes updated updated on each [`Tenant::gather_size_inputs`].
|
||||
cached_logical_sizes: tokio::sync::Mutex<HashMap<(TimelineId, Lsn), u64>>,
|
||||
cached_synthetic_tenant_size: Arc<AtomicU64>,
|
||||
@@ -532,11 +520,9 @@ impl Tenant {
|
||||
pub(crate) fn spawn_attach(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
tenants: &'static tokio::sync::RwLock<TenantsMap>,
|
||||
remote_storage: GenericRemoteStorage,
|
||||
deletion_queue_client: DeletionQueueClient,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<Arc<Tenant>> {
|
||||
// TODO dedup with spawn_load
|
||||
@@ -550,9 +536,7 @@ impl Tenant {
|
||||
tenant_conf,
|
||||
wal_redo_manager,
|
||||
tenant_id,
|
||||
generation,
|
||||
Some(remote_storage.clone()),
|
||||
Some(deletion_queue_client),
|
||||
));
|
||||
|
||||
// Do all the hard work in the background
|
||||
@@ -662,8 +646,12 @@ impl Tenant {
|
||||
.as_ref()
|
||||
.ok_or_else(|| anyhow::anyhow!("cannot attach without remote storage"))?;
|
||||
|
||||
let remote_timeline_ids =
|
||||
remote_timeline_client::list_remote_timelines(remote_storage, self.tenant_id).await?;
|
||||
let remote_timeline_ids = remote_timeline_client::list_remote_timelines(
|
||||
remote_storage,
|
||||
self.conf,
|
||||
self.tenant_id,
|
||||
)
|
||||
.await?;
|
||||
|
||||
info!("found {} timelines", remote_timeline_ids.len());
|
||||
|
||||
@@ -675,7 +663,6 @@ impl Tenant {
|
||||
self.conf,
|
||||
self.tenant_id,
|
||||
timeline_id,
|
||||
self.generation,
|
||||
);
|
||||
part_downloads.spawn(
|
||||
async move {
|
||||
@@ -738,7 +725,6 @@ impl Tenant {
|
||||
remote_metadata,
|
||||
TimelineResources {
|
||||
remote_client: Some(remote_client),
|
||||
deletion_queue_client: self.deletion_queue_client.clone(),
|
||||
},
|
||||
ctx,
|
||||
)
|
||||
@@ -763,7 +749,6 @@ impl Tenant {
|
||||
timeline_id,
|
||||
&index_part.metadata,
|
||||
Some(remote_timeline_client),
|
||||
self.deletion_queue_client.clone(),
|
||||
None,
|
||||
)
|
||||
.await
|
||||
@@ -864,8 +849,6 @@ impl Tenant {
|
||||
TenantConfOpt::default(),
|
||||
wal_redo_manager,
|
||||
tenant_id,
|
||||
Generation::broken(),
|
||||
None,
|
||||
None,
|
||||
))
|
||||
}
|
||||
@@ -883,7 +866,6 @@ impl Tenant {
|
||||
pub(crate) fn spawn_load(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
resources: TenantSharedResources,
|
||||
init_order: Option<InitializationOrder>,
|
||||
tenants: &'static tokio::sync::RwLock<TenantsMap>,
|
||||
@@ -901,7 +883,6 @@ impl Tenant {
|
||||
|
||||
let broker_client = resources.broker_client;
|
||||
let remote_storage = resources.remote_storage;
|
||||
let deletion_queue_client = resources.deletion_queue_client;
|
||||
|
||||
let wal_redo_manager = Arc::new(PostgresRedoManager::new(conf, tenant_id));
|
||||
let tenant = Tenant::new(
|
||||
@@ -910,9 +891,7 @@ impl Tenant {
|
||||
tenant_conf,
|
||||
wal_redo_manager,
|
||||
tenant_id,
|
||||
generation,
|
||||
remote_storage.clone(),
|
||||
Some(deletion_queue_client),
|
||||
);
|
||||
let tenant = Arc::new(tenant);
|
||||
|
||||
@@ -1320,7 +1299,6 @@ impl Tenant {
|
||||
timeline_id,
|
||||
&local_metadata,
|
||||
Some(remote_client),
|
||||
self.deletion_queue_client.clone(),
|
||||
init_order,
|
||||
)
|
||||
.await
|
||||
@@ -1370,7 +1348,6 @@ impl Tenant {
|
||||
timeline_id,
|
||||
&local_metadata,
|
||||
None,
|
||||
None,
|
||||
init_order,
|
||||
)
|
||||
.await
|
||||
@@ -2295,7 +2272,6 @@ impl Tenant {
|
||||
ancestor,
|
||||
new_timeline_id,
|
||||
self.tenant_id,
|
||||
self.generation,
|
||||
Arc::clone(&self.walredo_mgr),
|
||||
resources,
|
||||
pg_version,
|
||||
@@ -2313,18 +2289,8 @@ impl Tenant {
|
||||
tenant_conf: TenantConfOpt,
|
||||
walredo_mgr: Arc<dyn WalRedoManager + Send + Sync>,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
deletion_queue_client: Option<DeletionQueueClient>,
|
||||
) -> Tenant {
|
||||
#[cfg(not(test))]
|
||||
match state {
|
||||
TenantState::Broken { .. } => {}
|
||||
_ => {
|
||||
// Non-broken tenants must be constructed with a deletion queue
|
||||
assert!(deletion_queue_client.is_some());
|
||||
}
|
||||
}
|
||||
let (state, mut rx) = watch::channel(state);
|
||||
|
||||
tokio::spawn(async move {
|
||||
@@ -2381,7 +2347,6 @@ impl Tenant {
|
||||
|
||||
Tenant {
|
||||
tenant_id,
|
||||
generation,
|
||||
conf,
|
||||
// using now here is good enough approximation to catch tenants with really long
|
||||
// activation times.
|
||||
@@ -2391,7 +2356,6 @@ impl Tenant {
|
||||
gc_cs: tokio::sync::Mutex::new(()),
|
||||
walredo_mgr,
|
||||
remote_storage,
|
||||
deletion_queue_client,
|
||||
state,
|
||||
cached_logical_sizes: tokio::sync::Mutex::new(HashMap::new()),
|
||||
cached_synthetic_tenant_size: Arc::new(AtomicU64::new(0)),
|
||||
@@ -2965,17 +2929,13 @@ impl Tenant {
|
||||
self.conf,
|
||||
self.tenant_id,
|
||||
timeline_id,
|
||||
self.generation,
|
||||
);
|
||||
Some(remote_client)
|
||||
} else {
|
||||
None
|
||||
};
|
||||
|
||||
TimelineResources {
|
||||
remote_client,
|
||||
deletion_queue_client: self.deletion_queue_client.clone(),
|
||||
}
|
||||
TimelineResources { remote_client }
|
||||
}
|
||||
|
||||
/// Creates intermediate timeline structure and its files.
|
||||
@@ -3492,7 +3452,6 @@ pub mod harness {
|
||||
pub conf: &'static PageServerConf,
|
||||
pub tenant_conf: TenantConf,
|
||||
pub tenant_id: TenantId,
|
||||
pub generation: Generation,
|
||||
}
|
||||
|
||||
static LOG_HANDLE: OnceCell<()> = OnceCell::new();
|
||||
@@ -3534,14 +3493,13 @@ pub mod harness {
|
||||
conf,
|
||||
tenant_conf,
|
||||
tenant_id,
|
||||
generation: Generation::new(0xdeadbeef),
|
||||
})
|
||||
}
|
||||
|
||||
pub async fn load(&self) -> (Arc<Tenant>, RequestContext) {
|
||||
let ctx = RequestContext::new(TaskKind::UnitTest, DownloadBehavior::Error);
|
||||
(
|
||||
self.try_load(&ctx, None, None)
|
||||
self.try_load(&ctx, None)
|
||||
.await
|
||||
.expect("failed to load test tenant"),
|
||||
ctx,
|
||||
@@ -3552,7 +3510,6 @@ pub mod harness {
|
||||
&self,
|
||||
ctx: &RequestContext,
|
||||
remote_storage: Option<remote_storage::GenericRemoteStorage>,
|
||||
deletion_queue_client: Option<DeletionQueueClient>,
|
||||
) -> anyhow::Result<Arc<Tenant>> {
|
||||
let walredo_mgr = Arc::new(TestRedoManager);
|
||||
|
||||
@@ -3562,9 +3519,7 @@ pub mod harness {
|
||||
TenantConfOpt::from(self.tenant_conf),
|
||||
walredo_mgr,
|
||||
self.tenant_id,
|
||||
self.generation,
|
||||
remote_storage,
|
||||
deletion_queue_client,
|
||||
));
|
||||
tenant
|
||||
.load(None, ctx)
|
||||
@@ -4084,6 +4039,7 @@ mod tests {
|
||||
|
||||
#[tokio::test]
|
||||
async fn delta_layer_dumping() -> anyhow::Result<()> {
|
||||
use storage_layer::AsLayerDesc;
|
||||
let (tenant, ctx) = TenantHarness::create("test_layer_dumping")?.load().await;
|
||||
let tline = tenant
|
||||
.create_test_timeline(TIMELINE_ID, Lsn(0x10), DEFAULT_PG_VERSION, &ctx)
|
||||
@@ -4091,16 +4047,18 @@ mod tests {
|
||||
make_some_layers(tline.as_ref(), Lsn(0x20)).await?;
|
||||
|
||||
let layer_map = tline.layers.read().await;
|
||||
let level0_deltas = layer_map.layer_map().get_level0_deltas()?;
|
||||
let level0_deltas = layer_map
|
||||
.layer_map()
|
||||
.get_level0_deltas()?
|
||||
.into_iter()
|
||||
.map(|desc| layer_map.get_from_desc(&desc))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
assert!(!level0_deltas.is_empty());
|
||||
|
||||
for delta in level0_deltas {
|
||||
let delta = layer_map.get_from_desc(&delta);
|
||||
// Ensure we are dumping a delta layer here
|
||||
let delta = delta.downcast_delta_layer().unwrap();
|
||||
|
||||
delta.dump(false, &ctx).await.unwrap();
|
||||
assert!(delta.layer_desc().is_delta);
|
||||
delta.dump(true, &ctx).await.unwrap();
|
||||
}
|
||||
|
||||
@@ -4129,7 +4087,7 @@ mod tests {
|
||||
std::fs::write(metadata_path, metadata_bytes)?;
|
||||
|
||||
let err = harness
|
||||
.try_load(&ctx, None, None)
|
||||
.try_load(&ctx, None)
|
||||
.await
|
||||
.err()
|
||||
.expect("should fail");
|
||||
|
||||
@@ -33,7 +33,7 @@ impl<'a> BlockCursor<'a> {
|
||||
let mut blknum = (offset / PAGE_SZ as u64) as u32;
|
||||
let mut off = (offset % PAGE_SZ as u64) as usize;
|
||||
|
||||
let mut buf = self.read_blk(blknum).await?;
|
||||
let mut buf = self.read_blk(blknum)?;
|
||||
|
||||
// peek at the first byte, to determine if it's a 1- or 4-byte length
|
||||
let first_len_byte = buf[off];
|
||||
@@ -49,7 +49,7 @@ impl<'a> BlockCursor<'a> {
|
||||
// it is split across two pages
|
||||
len_buf[..thislen].copy_from_slice(&buf[off..PAGE_SZ]);
|
||||
blknum += 1;
|
||||
buf = self.read_blk(blknum).await?;
|
||||
buf = self.read_blk(blknum)?;
|
||||
len_buf[thislen..].copy_from_slice(&buf[0..4 - thislen]);
|
||||
off = 4 - thislen;
|
||||
} else {
|
||||
@@ -70,7 +70,7 @@ impl<'a> BlockCursor<'a> {
|
||||
if page_remain == 0 {
|
||||
// continue on next page
|
||||
blknum += 1;
|
||||
buf = self.read_blk(blknum).await?;
|
||||
buf = self.read_blk(blknum)?;
|
||||
off = 0;
|
||||
page_remain = PAGE_SZ;
|
||||
}
|
||||
|
||||
@@ -39,7 +39,7 @@ pub enum BlockLease<'a> {
|
||||
PageReadGuard(PageReadGuard<'static>),
|
||||
EphemeralFileMutableTail(&'a [u8; PAGE_SZ]),
|
||||
#[cfg(test)]
|
||||
Arc(std::sync::Arc<[u8; PAGE_SZ]>),
|
||||
Rc(std::rc::Rc<[u8; PAGE_SZ]>),
|
||||
}
|
||||
|
||||
impl From<PageReadGuard<'static>> for BlockLease<'static> {
|
||||
@@ -49,9 +49,9 @@ impl From<PageReadGuard<'static>> for BlockLease<'static> {
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
impl<'a> From<std::sync::Arc<[u8; PAGE_SZ]>> for BlockLease<'a> {
|
||||
fn from(value: std::sync::Arc<[u8; PAGE_SZ]>) -> Self {
|
||||
BlockLease::Arc(value)
|
||||
impl<'a> From<std::rc::Rc<[u8; PAGE_SZ]>> for BlockLease<'a> {
|
||||
fn from(value: std::rc::Rc<[u8; PAGE_SZ]>) -> Self {
|
||||
BlockLease::Rc(value)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -63,7 +63,7 @@ impl<'a> Deref for BlockLease<'a> {
|
||||
BlockLease::PageReadGuard(v) => v.deref(),
|
||||
BlockLease::EphemeralFileMutableTail(v) => v,
|
||||
#[cfg(test)]
|
||||
BlockLease::Arc(v) => v.deref(),
|
||||
BlockLease::Rc(v) => v.deref(),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -83,13 +83,13 @@ pub(crate) enum BlockReaderRef<'a> {
|
||||
|
||||
impl<'a> BlockReaderRef<'a> {
|
||||
#[inline(always)]
|
||||
async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
use BlockReaderRef::*;
|
||||
match self {
|
||||
FileBlockReaderVirtual(r) => r.read_blk(blknum).await,
|
||||
FileBlockReaderFile(r) => r.read_blk(blknum).await,
|
||||
EphemeralFile(r) => r.read_blk(blknum).await,
|
||||
Adapter(r) => r.read_blk(blknum).await,
|
||||
FileBlockReaderVirtual(r) => r.read_blk(blknum),
|
||||
FileBlockReaderFile(r) => r.read_blk(blknum),
|
||||
EphemeralFile(r) => r.read_blk(blknum),
|
||||
Adapter(r) => r.read_blk(blknum),
|
||||
#[cfg(test)]
|
||||
TestDisk(r) => r.read_blk(blknum),
|
||||
}
|
||||
@@ -134,8 +134,8 @@ impl<'a> BlockCursor<'a> {
|
||||
/// access to the contents of the page. (For the page cache, the
|
||||
/// lease object represents a lock on the buffer.)
|
||||
#[inline(always)]
|
||||
pub async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
self.reader.read_blk(blknum).await
|
||||
pub fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
self.reader.read_blk(blknum)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -170,12 +170,11 @@ where
|
||||
/// Returns a "lease" object that can be used to
|
||||
/// access to the contents of the page. (For the page cache, the
|
||||
/// lease object represents a lock on the buffer.)
|
||||
pub async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
pub fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
let cache = page_cache::get();
|
||||
loop {
|
||||
match cache
|
||||
.read_immutable_buf(self.file_id, blknum)
|
||||
.await
|
||||
.map_err(|e| {
|
||||
std::io::Error::new(
|
||||
std::io::ErrorKind::Other,
|
||||
|
||||
@@ -262,7 +262,7 @@ where
|
||||
let block_cursor = self.reader.block_cursor();
|
||||
while let Some((node_blknum, opt_iter)) = stack.pop() {
|
||||
// Locate the node.
|
||||
let node_buf = block_cursor.read_blk(self.start_blk + node_blknum).await?;
|
||||
let node_buf = block_cursor.read_blk(self.start_blk + node_blknum)?;
|
||||
|
||||
let node = OnDiskNode::deparse(node_buf.as_ref())?;
|
||||
let prefix_len = node.prefix_len as usize;
|
||||
@@ -357,7 +357,7 @@ where
|
||||
let block_cursor = self.reader.block_cursor();
|
||||
|
||||
while let Some((blknum, path, depth, child_idx, key_off)) = stack.pop() {
|
||||
let blk = block_cursor.read_blk(self.start_blk + blknum).await?;
|
||||
let blk = block_cursor.read_blk(self.start_blk + blknum)?;
|
||||
let buf: &[u8] = blk.as_ref();
|
||||
let node = OnDiskNode::<L>::deparse(buf)?;
|
||||
|
||||
@@ -704,7 +704,7 @@ pub(crate) mod tests {
|
||||
pub(crate) fn read_blk(&self, blknum: u32) -> io::Result<BlockLease> {
|
||||
let mut buf = [0u8; PAGE_SZ];
|
||||
buf.copy_from_slice(&self.blocks[blknum as usize]);
|
||||
Ok(std::sync::Arc::new(buf).into())
|
||||
Ok(std::rc::Rc::new(buf).into())
|
||||
}
|
||||
}
|
||||
impl BlockReader for TestDisk {
|
||||
|
||||
@@ -61,14 +61,13 @@ impl EphemeralFile {
|
||||
self.len
|
||||
}
|
||||
|
||||
pub(crate) async fn read_blk(&self, blknum: u32) -> Result<BlockLease, io::Error> {
|
||||
pub(crate) fn read_blk(&self, blknum: u32) -> Result<BlockLease, io::Error> {
|
||||
let flushed_blknums = 0..self.len / PAGE_SZ as u64;
|
||||
if flushed_blknums.contains(&(blknum as u64)) {
|
||||
let cache = page_cache::get();
|
||||
loop {
|
||||
match cache
|
||||
.read_immutable_buf(self.page_cache_file_id, blknum)
|
||||
.await
|
||||
.map_err(|e| {
|
||||
std::io::Error::new(
|
||||
std::io::ErrorKind::Other,
|
||||
@@ -136,13 +135,10 @@ impl EphemeralFile {
|
||||
// Pre-warm the page cache with what we just wrote.
|
||||
// This isn't necessary for coherency/correctness, but it's how we've always done it.
|
||||
let cache = page_cache::get();
|
||||
match cache
|
||||
.read_immutable_buf(
|
||||
self.ephemeral_file.page_cache_file_id,
|
||||
self.blknum,
|
||||
)
|
||||
.await
|
||||
{
|
||||
match cache.read_immutable_buf(
|
||||
self.ephemeral_file.page_cache_file_id,
|
||||
self.blknum,
|
||||
) {
|
||||
Ok(page_cache::ReadBufResult::Found(_guard)) => {
|
||||
// This function takes &mut self, so, it shouldn't be possible to reach this point.
|
||||
unreachable!("we just wrote blknum {} and this function takes &mut self, so, no concurrent read_blk is possible", self.blknum);
|
||||
@@ -225,8 +221,9 @@ pub fn is_ephemeral_file(filename: &str) -> bool {
|
||||
|
||||
impl Drop for EphemeralFile {
|
||||
fn drop(&mut self) {
|
||||
// There might still be pages in the [`crate::page_cache`] for this file.
|
||||
// We leave them there, [`crate::page_cache::PageCache::find_victim`] will evict them when needed.
|
||||
// drop all pages from page cache
|
||||
let cache = page_cache::get();
|
||||
cache.drop_buffers_for_immutable(self.page_cache_file_id);
|
||||
|
||||
// unlink the file
|
||||
let res = std::fs::remove_file(&self.file.path);
|
||||
|
||||
@@ -639,147 +639,10 @@ impl LayerMap {
|
||||
}
|
||||
|
||||
println!("historic_layers:");
|
||||
for layer in self.iter_historic_layers() {
|
||||
layer.dump(verbose, ctx)?;
|
||||
for desc in self.iter_historic_layers() {
|
||||
desc.dump();
|
||||
}
|
||||
println!("End dump LayerMap");
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::LayerMap;
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
use std::str::FromStr;
|
||||
use std::sync::Arc;
|
||||
|
||||
mod l0_delta_layers_updated {
|
||||
|
||||
use crate::tenant::{
|
||||
storage_layer::{AsLayerDesc, PersistentLayerDesc},
|
||||
timeline::layer_manager::LayerFileManager,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
|
||||
struct LayerObject(PersistentLayerDesc);
|
||||
|
||||
impl AsLayerDesc for LayerObject {
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl LayerObject {
|
||||
fn new(desc: PersistentLayerDesc) -> Self {
|
||||
LayerObject(desc)
|
||||
}
|
||||
}
|
||||
|
||||
type TestLayerFileManager = LayerFileManager<LayerObject>;
|
||||
|
||||
#[test]
|
||||
fn for_full_range_delta() {
|
||||
// l0_delta_layers are used by compaction, and should observe all buffered updates
|
||||
l0_delta_layers_updated_scenario(
|
||||
"000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69",
|
||||
true
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn for_non_full_range_delta() {
|
||||
// has minimal uncovered areas compared to l0_delta_layers_updated_on_insert_replace_remove_for_full_range_delta
|
||||
l0_delta_layers_updated_scenario(
|
||||
"000000000000000000000000000000000001-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFE__0000000053423C21-0000000053424D69",
|
||||
// because not full range
|
||||
false
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn for_image() {
|
||||
l0_delta_layers_updated_scenario(
|
||||
"000000000000000000000000000000000000-000000000000000000000000000000010000__0000000053424D69",
|
||||
// code only checks if it is a full range layer, doesn't care about images, which must
|
||||
// mean we should in practice never have full range images
|
||||
false
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn replacing_missing_l0_is_notfound() {
|
||||
// original impl had an oversight, and L0 was an anyhow::Error. anyhow::Error should
|
||||
// however only happen for precondition failures.
|
||||
|
||||
let layer = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000053423C21-0000000053424D69";
|
||||
let layer = LayerFileName::from_str(layer).unwrap();
|
||||
let layer = PersistentLayerDesc::from(layer);
|
||||
|
||||
// same skeletan construction; see scenario below
|
||||
let not_found = Arc::new(LayerObject::new(layer.clone()));
|
||||
let new_version = Arc::new(LayerObject::new(layer));
|
||||
|
||||
// after the immutable storage state refactor, the replace operation
|
||||
// will not use layer map any more. We keep it here for consistency in test cases
|
||||
// and can remove it in the future.
|
||||
let _map = LayerMap::default();
|
||||
|
||||
let mut mapping = TestLayerFileManager::new();
|
||||
|
||||
mapping
|
||||
.replace_and_verify(not_found, new_version)
|
||||
.unwrap_err();
|
||||
}
|
||||
|
||||
fn l0_delta_layers_updated_scenario(layer_name: &str, expected_l0: bool) {
|
||||
let name = LayerFileName::from_str(layer_name).unwrap();
|
||||
let skeleton = PersistentLayerDesc::from(name);
|
||||
|
||||
let remote = Arc::new(LayerObject::new(skeleton.clone()));
|
||||
let downloaded = Arc::new(LayerObject::new(skeleton));
|
||||
|
||||
let mut map = LayerMap::default();
|
||||
let mut mapping = LayerFileManager::new();
|
||||
|
||||
// two disjoint Arcs in different lifecycle phases. even if it seems they must be the
|
||||
// same layer, we use LayerMap::compare_arced_layers as the identity of layers.
|
||||
assert_eq!(remote.layer_desc(), downloaded.layer_desc());
|
||||
|
||||
let expected_in_counts = (1, usize::from(expected_l0));
|
||||
|
||||
map.batch_update()
|
||||
.insert_historic(remote.layer_desc().clone());
|
||||
mapping.insert(remote.clone());
|
||||
assert_eq!(
|
||||
count_layer_in(&map, remote.layer_desc()),
|
||||
expected_in_counts
|
||||
);
|
||||
|
||||
mapping
|
||||
.replace_and_verify(remote, downloaded.clone())
|
||||
.expect("name derived attributes are the same");
|
||||
assert_eq!(
|
||||
count_layer_in(&map, downloaded.layer_desc()),
|
||||
expected_in_counts
|
||||
);
|
||||
|
||||
map.batch_update().remove_historic(downloaded.layer_desc());
|
||||
assert_eq!(count_layer_in(&map, downloaded.layer_desc()), (0, 0));
|
||||
}
|
||||
|
||||
fn count_layer_in(map: &LayerMap, layer: &PersistentLayerDesc) -> (usize, usize) {
|
||||
let historic = map
|
||||
.iter_historic_layers()
|
||||
.filter(|x| x.key() == layer.key())
|
||||
.count();
|
||||
let l0s = map
|
||||
.get_level0_deltas()
|
||||
.expect("why does this return a result");
|
||||
let l0 = l0s.iter().filter(|x| x.key() == layer.key()).count();
|
||||
|
||||
(historic, l0)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,13 +1,10 @@
|
||||
//! This module acts as a switchboard to access different repositories managed by this
|
||||
//! page server.
|
||||
|
||||
use hyper::StatusCode;
|
||||
use pageserver_api::control_api::{HexTenantId, ReAttachRequest, ReAttachResponse};
|
||||
use std::collections::{hash_map, HashMap};
|
||||
use std::ffi::OsStr;
|
||||
use std::path::Path;
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
use tokio::fs;
|
||||
|
||||
use anyhow::Context;
|
||||
@@ -21,7 +18,6 @@ use utils::crashsafe;
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::context::{DownloadBehavior, RequestContext};
|
||||
use crate::deletion_queue::DeletionQueue;
|
||||
use crate::task_mgr::{self, TaskKind};
|
||||
use crate::tenant::config::TenantConfOpt;
|
||||
use crate::tenant::delete::DeleteTenantFlow;
|
||||
@@ -29,7 +25,6 @@ use crate::tenant::{create_tenant_files, CreateTenantFilesMode, Tenant, TenantSt
|
||||
use crate::{InitializationOrder, IGNORED_TENANT_FILE_NAME};
|
||||
|
||||
use utils::fs_ext::PathExt;
|
||||
use utils::generation::Generation;
|
||||
use utils::id::{TenantId, TimelineId};
|
||||
|
||||
use super::delete::DeleteTenantError;
|
||||
@@ -80,78 +75,6 @@ pub async fn init_tenant_mgr(
|
||||
|
||||
let mut tenants = HashMap::new();
|
||||
|
||||
// If we are configured to use the control plane API, then it is the source of truth for what to attach
|
||||
let tenant_generations = conf
|
||||
.control_plane_api
|
||||
.as_ref()
|
||||
.map(|control_plane_api| async {
|
||||
let client = reqwest::ClientBuilder::new()
|
||||
.build()
|
||||
.expect("Failed to construct http client");
|
||||
|
||||
// FIXME: it's awkward that join() requires the base to have a trailing slash, makes
|
||||
// it easy to get a config wrong
|
||||
assert!(
|
||||
control_plane_api.as_str().ends_with("/"),
|
||||
"control plane API needs trailing slash"
|
||||
);
|
||||
|
||||
let re_attach_path = control_plane_api
|
||||
.join("re-attach")
|
||||
.expect("Failed to build re-attach path");
|
||||
let request = ReAttachRequest { node_id: conf.id };
|
||||
|
||||
// TODO: we should have been passed a cancellation token, and use it to end
|
||||
// this loop gracefully
|
||||
loop {
|
||||
let response = match client
|
||||
.post(re_attach_path.clone())
|
||||
.json(&request)
|
||||
.send()
|
||||
.await
|
||||
{
|
||||
Err(e) => Err(anyhow::Error::from(e)),
|
||||
Ok(r) => {
|
||||
if r.status() == StatusCode::OK {
|
||||
r.json::<ReAttachResponse>()
|
||||
.await
|
||||
.map_err(|e| anyhow::Error::from(e))
|
||||
} else {
|
||||
Err(anyhow::anyhow!("Unexpected status {}", r.status()))
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
match response {
|
||||
Ok(res) => {
|
||||
tracing::info!(
|
||||
"Received re-attach response with {0} tenants",
|
||||
res.tenants.len()
|
||||
);
|
||||
|
||||
// TODO: do something with it
|
||||
break res
|
||||
.tenants
|
||||
.into_iter()
|
||||
.map(|t| (t.id, t.generation))
|
||||
.collect::<HashMap<_, _>>();
|
||||
}
|
||||
Err(e) => {
|
||||
tracing::error!("Error re-attaching tenants, retrying: {e:#}");
|
||||
tokio::time::sleep(Duration::from_secs(1)).await;
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
let tenant_generations = match tenant_generations {
|
||||
Some(g) => Some(g.await),
|
||||
None => {
|
||||
info!("Control plane API not configured, tenant generations are disabled");
|
||||
None
|
||||
}
|
||||
};
|
||||
|
||||
let mut dir_entries = fs::read_dir(&tenants_dir)
|
||||
.await
|
||||
.with_context(|| format!("Failed to list tenants dir {tenants_dir:?}"))?;
|
||||
@@ -199,53 +122,9 @@ pub async fn init_tenant_mgr(
|
||||
continue;
|
||||
}
|
||||
|
||||
let tenant_id = match tenant_dir_path
|
||||
.file_name()
|
||||
.and_then(OsStr::to_str)
|
||||
.unwrap_or_default()
|
||||
.parse::<TenantId>()
|
||||
{
|
||||
Ok(id) => id,
|
||||
Err(_) => {
|
||||
warn!(
|
||||
"Invalid tenant path (garbage in our repo directory?): {0}",
|
||||
tenant_dir_path.display()
|
||||
);
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
let generation = if let Some(generations) = &tenant_generations {
|
||||
// We have a generation map: treat it as the authority for whether
|
||||
// this tenant is really attached.
|
||||
if let Some(gen) = generations.get(&HexTenantId::new(tenant_id)) {
|
||||
Generation::new(*gen)
|
||||
} else {
|
||||
info!("Detaching tenant {0}, control plane omitted it in re-attach response", tenant_id);
|
||||
if let Err(e) = fs::remove_dir_all(&tenant_dir_path).await {
|
||||
error!(
|
||||
"Failed to remove detached tenant directory '{}': {:?}",
|
||||
tenant_dir_path.display(),
|
||||
e
|
||||
);
|
||||
}
|
||||
continue;
|
||||
}
|
||||
} else {
|
||||
// Legacy mode: no generation information, any tenant present
|
||||
// on local disk may activate
|
||||
info!(
|
||||
"Starting tenant {0} in legacy mode, no generation",
|
||||
tenant_dir_path.display()
|
||||
);
|
||||
Generation::none()
|
||||
};
|
||||
|
||||
match schedule_local_tenant_processing(
|
||||
conf,
|
||||
tenant_id,
|
||||
&tenant_dir_path,
|
||||
generation,
|
||||
resources.clone(),
|
||||
Some(init_order.clone()),
|
||||
&TENANTS,
|
||||
@@ -281,9 +160,7 @@ pub async fn init_tenant_mgr(
|
||||
|
||||
pub(crate) fn schedule_local_tenant_processing(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
tenant_path: &Path,
|
||||
generation: Generation,
|
||||
resources: TenantSharedResources,
|
||||
init_order: Option<InitializationOrder>,
|
||||
tenants: &'static tokio::sync::RwLock<TenantsMap>,
|
||||
@@ -304,6 +181,15 @@ pub(crate) fn schedule_local_tenant_processing(
|
||||
"Cannot load tenant from empty directory {tenant_path:?}"
|
||||
);
|
||||
|
||||
let tenant_id = tenant_path
|
||||
.file_name()
|
||||
.and_then(OsStr::to_str)
|
||||
.unwrap_or_default()
|
||||
.parse::<TenantId>()
|
||||
.with_context(|| {
|
||||
format!("Could not parse tenant id out of the tenant dir name in path {tenant_path:?}")
|
||||
})?;
|
||||
|
||||
let tenant_ignore_mark = conf.tenant_ignore_mark_file_path(&tenant_id);
|
||||
anyhow::ensure!(
|
||||
!conf.tenant_ignore_mark_file_path(&tenant_id).exists(),
|
||||
@@ -316,11 +202,9 @@ pub(crate) fn schedule_local_tenant_processing(
|
||||
match Tenant::spawn_attach(
|
||||
conf,
|
||||
tenant_id,
|
||||
generation,
|
||||
resources.broker_client,
|
||||
tenants,
|
||||
remote_storage,
|
||||
resources.deletion_queue_client,
|
||||
ctx,
|
||||
) {
|
||||
Ok(tenant) => tenant,
|
||||
@@ -340,9 +224,7 @@ pub(crate) fn schedule_local_tenant_processing(
|
||||
} else {
|
||||
info!("tenant {tenant_id} is assumed to be loadable, starting load operation");
|
||||
// Start loading the tenant into memory. It will initially be in Loading state.
|
||||
Tenant::spawn_load(
|
||||
conf, tenant_id, generation, resources, init_order, tenants, ctx,
|
||||
)
|
||||
Tenant::spawn_load(conf, tenant_id, resources, init_order, tenants, ctx)
|
||||
};
|
||||
Ok(tenant)
|
||||
}
|
||||
@@ -465,10 +347,8 @@ pub async fn create_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_conf: TenantConfOpt,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
deletion_queue: &DeletionQueue,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<Arc<Tenant>, TenantMapInsertError> {
|
||||
tenant_map_insert(tenant_id, || {
|
||||
@@ -482,11 +362,9 @@ pub async fn create_tenant(
|
||||
let tenant_resources = TenantSharedResources {
|
||||
broker_client,
|
||||
remote_storage,
|
||||
deletion_queue_client: deletion_queue.new_client(),
|
||||
};
|
||||
let created_tenant =
|
||||
schedule_local_tenant_processing(conf, tenant_id, &tenant_directory,
|
||||
generation, tenant_resources, None, &TENANTS, ctx)?;
|
||||
schedule_local_tenant_processing(conf, &tenant_directory, tenant_resources, None, &TENANTS, ctx)?;
|
||||
// TODO: tenant object & its background loops remain, untracked in tenant map, if we fail here.
|
||||
// See https://github.com/neondatabase/neon/issues/4233
|
||||
|
||||
@@ -635,7 +513,6 @@ pub async fn load_tenant(
|
||||
tenant_id: TenantId,
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
remote_storage: Option<GenericRemoteStorage>,
|
||||
deletion_queue: &DeletionQueue,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<(), TenantMapInsertError> {
|
||||
tenant_map_insert(tenant_id, || {
|
||||
@@ -649,11 +526,8 @@ pub async fn load_tenant(
|
||||
let resources = TenantSharedResources {
|
||||
broker_client,
|
||||
remote_storage,
|
||||
deletion_queue_client: deletion_queue.new_client(),
|
||||
};
|
||||
// TODO: remove the `/load` API once generation support is complete:
|
||||
// it becomes equivalent to attaching.
|
||||
let new_tenant = schedule_local_tenant_processing(conf, tenant_id, &tenant_path, Generation::none(), resources, None, &TENANTS, ctx)
|
||||
let new_tenant = schedule_local_tenant_processing(conf, &tenant_path, resources, None, &TENANTS, ctx)
|
||||
.with_context(|| {
|
||||
format!("Failed to schedule tenant processing in path {tenant_path:?}")
|
||||
})?;
|
||||
@@ -717,11 +591,9 @@ pub async fn list_tenants() -> Result<Vec<(TenantId, TenantState)>, TenantMapLis
|
||||
pub async fn attach_tenant(
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
generation: Generation,
|
||||
tenant_conf: TenantConfOpt,
|
||||
broker_client: storage_broker::BrokerClientChannel,
|
||||
remote_storage: GenericRemoteStorage,
|
||||
deletion_queue: &DeletionQueue,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<(), TenantMapInsertError> {
|
||||
tenant_map_insert(tenant_id, || {
|
||||
@@ -739,9 +611,8 @@ pub async fn attach_tenant(
|
||||
let resources = TenantSharedResources {
|
||||
broker_client,
|
||||
remote_storage: Some(remote_storage),
|
||||
deletion_queue_client: deletion_queue.new_client(),
|
||||
};
|
||||
let attached_tenant = schedule_local_tenant_processing(conf, tenant_id, &tenant_dir, generation, resources, None, &TENANTS, ctx)?;
|
||||
let attached_tenant = schedule_local_tenant_processing(conf, &tenant_dir, resources, None, &TENANTS, ctx)?;
|
||||
// TODO: tenant object & its background loops remain, untracked in tenant map, if we fail here.
|
||||
// See https://github.com/neondatabase/neon/issues/4233
|
||||
|
||||
|
||||
@@ -56,11 +56,9 @@
|
||||
//! # Consistency
|
||||
//!
|
||||
//! To have a consistent remote structure, it's important that uploads and
|
||||
//! deletions are performed in the right order. For example:
|
||||
//! - the index file contains a list of layer files, so it must not be uploaded
|
||||
//! until all the layer files that are in its list have been successfully uploaded.
|
||||
//! - objects must be removed from the index before being deleted, and that updated
|
||||
//! index must be written to remote storage before deleting the objects from remote storage.
|
||||
//! deletions are performed in the right order. For example, the index file
|
||||
//! contains a list of layer files, so it must not be uploaded until all the
|
||||
//! layer files that are in its list have been successfully uploaded.
|
||||
//!
|
||||
//! The contract between client and its user is that the user is responsible of
|
||||
//! scheduling operations in an order that keeps the remote consistent as
|
||||
@@ -72,12 +70,10 @@
|
||||
//! correct order, and the client will parallelize the operations in a way that
|
||||
//! is safe.
|
||||
//!
|
||||
//! The caller should be careful with deletion, though:
|
||||
//! - they should not delete local files that have been scheduled for upload but
|
||||
//! not yet finished uploading. Otherwise the upload will fail. To wait for an
|
||||
//! upload to finish, use the 'wait_completion' function (more on that later.)
|
||||
//! - they should not to remote deletions via DeletionQueue without waiting for
|
||||
//! the latest metadata to upload via RemoteTimelineClient.
|
||||
//! The caller should be careful with deletion, though. They should not delete
|
||||
//! local files that have been scheduled for upload but not yet finished uploading.
|
||||
//! Otherwise the upload will fail. To wait for an upload to finish, use
|
||||
//! the 'wait_completion' function (more on that later.)
|
||||
//!
|
||||
//! All of this relies on the following invariants:
|
||||
//!
|
||||
@@ -167,8 +163,6 @@
|
||||
//! - download their remote [`IndexPart`]s
|
||||
//! - create `Timeline` struct and a `RemoteTimelineClient`
|
||||
//! - initialize the client's upload queue with its `IndexPart`
|
||||
//! - create [`RemoteLayer`](super::storage_layer::RemoteLayer) instances
|
||||
//! for layers that are referenced by `IndexPart` but not present locally
|
||||
//! - schedule uploads for layers that are only present locally.
|
||||
//! - if the remote `IndexPart`'s metadata was newer than the metadata in
|
||||
//! the local filesystem, write the remote metadata to the local filesystem
|
||||
@@ -204,11 +198,12 @@
|
||||
//! [`Tenant::timeline_init_and_sync`]: super::Tenant::timeline_init_and_sync
|
||||
//! [`Timeline::load_layer_map`]: super::Timeline::load_layer_map
|
||||
|
||||
mod delete;
|
||||
mod download;
|
||||
pub mod index;
|
||||
mod upload;
|
||||
|
||||
use anyhow::{bail, Context};
|
||||
use anyhow::Context;
|
||||
use chrono::{NaiveDateTime, Utc};
|
||||
// re-export these
|
||||
pub use download::{is_temp_download_file, list_remote_timelines};
|
||||
@@ -219,7 +214,7 @@ use utils::backoff::{
|
||||
};
|
||||
|
||||
use std::collections::{HashMap, VecDeque};
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::path::Path;
|
||||
use std::sync::atomic::{AtomicU32, Ordering};
|
||||
use std::sync::{Arc, Mutex};
|
||||
|
||||
@@ -229,7 +224,6 @@ use tracing::{debug, error, info, instrument, warn};
|
||||
use tracing::{info_span, Instrument};
|
||||
use utils::lsn::Lsn;
|
||||
|
||||
use crate::deletion_queue::DeletionQueueClient;
|
||||
use crate::metrics::{
|
||||
MeasureRemoteOp, RemoteOpFileKind, RemoteOpKind, RemoteTimelineClientMetrics,
|
||||
RemoteTimelineClientMetricsCallTrackSize, REMOTE_ONDEMAND_DOWNLOADED_BYTES,
|
||||
@@ -237,7 +231,9 @@ use crate::metrics::{
|
||||
};
|
||||
use crate::task_mgr::shutdown_token;
|
||||
use crate::tenant::debug_assert_current_span_has_tenant_and_timeline_id;
|
||||
use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
|
||||
pub(crate) use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
|
||||
use crate::tenant::storage_layer::AsLayerDesc;
|
||||
use crate::tenant::upload_queue::Delete;
|
||||
use crate::{
|
||||
config::PageServerConf,
|
||||
task_mgr,
|
||||
@@ -247,16 +243,14 @@ use crate::{
|
||||
tenant::upload_queue::{
|
||||
UploadOp, UploadQueue, UploadQueueInitialized, UploadQueueStopped, UploadTask,
|
||||
},
|
||||
tenant::TIMELINES_SEGMENT_NAME,
|
||||
};
|
||||
|
||||
use utils::id::{TenantId, TimelineId};
|
||||
|
||||
use self::index::IndexPart;
|
||||
|
||||
use super::storage_layer::LayerFileName;
|
||||
use super::storage_layer::{LayerFileName, ResidentLayer};
|
||||
use super::upload_queue::SetDeletedFlagProgress;
|
||||
use super::Generation;
|
||||
|
||||
// Occasional network issues and such can cause remote operations to fail, and
|
||||
// that's expected. If a download fails, we log it at info-level, and retry.
|
||||
@@ -320,7 +314,6 @@ pub struct RemoteTimelineClient {
|
||||
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
generation: Generation,
|
||||
|
||||
upload_queue: Mutex<UploadQueue>,
|
||||
|
||||
@@ -341,14 +334,12 @@ impl RemoteTimelineClient {
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
generation: Generation,
|
||||
) -> RemoteTimelineClient {
|
||||
RemoteTimelineClient {
|
||||
conf,
|
||||
runtime: BACKGROUND_RUNTIME.handle().to_owned(),
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
generation,
|
||||
storage_impl: remote_storage,
|
||||
upload_queue: Mutex::new(UploadQueue::Uninitialized),
|
||||
metrics: Arc::new(RemoteTimelineClientMetrics::new(&tenant_id, &timeline_id)),
|
||||
@@ -461,7 +452,6 @@ impl RemoteTimelineClient {
|
||||
&self.storage_impl,
|
||||
&self.tenant_id,
|
||||
&self.timeline_id,
|
||||
self.generation,
|
||||
)
|
||||
.measure_remote_op(
|
||||
self.tenant_id,
|
||||
@@ -607,25 +597,25 @@ impl RemoteTimelineClient {
|
||||
///
|
||||
/// Launch an upload operation in the background.
|
||||
///
|
||||
pub fn schedule_layer_file_upload(
|
||||
pub(crate) fn schedule_layer_file_upload(
|
||||
self: &Arc<Self>,
|
||||
layer_file_name: &LayerFileName,
|
||||
layer_metadata: &LayerFileMetadata,
|
||||
layer: ResidentLayer,
|
||||
) -> anyhow::Result<()> {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
let metadata = LayerFileMetadata::new(layer.layer_desc().file_size);
|
||||
|
||||
upload_queue
|
||||
.latest_files
|
||||
.insert(layer_file_name.clone(), layer_metadata.clone());
|
||||
.insert(layer.layer_desc().filename(), metadata.clone());
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
|
||||
|
||||
let op = UploadOp::UploadLayer(layer_file_name.clone(), layer_metadata.clone());
|
||||
info!("scheduled layer file upload {layer}");
|
||||
let op = UploadOp::UploadLayer(layer, metadata);
|
||||
self.calls_unfinished_metric_begin(&op);
|
||||
upload_queue.queued_operations.push_back(op);
|
||||
|
||||
info!("scheduled layer file upload {layer_file_name}");
|
||||
|
||||
// Launch the task immediately, if possible
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
Ok(())
|
||||
@@ -640,66 +630,51 @@ impl RemoteTimelineClient {
|
||||
/// deletion won't actually be performed, until any previously scheduled
|
||||
/// upload operations, and the index file upload, have completed
|
||||
/// successfully.
|
||||
pub async fn schedule_layer_file_deletion(
|
||||
pub fn schedule_layer_file_deletion(
|
||||
self: &Arc<Self>,
|
||||
names: &[LayerFileName],
|
||||
deletion_queue_client: &DeletionQueueClient,
|
||||
) -> anyhow::Result<()> {
|
||||
// Synchronous update of upload queues under mutex
|
||||
let with_generations = {
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
let mut guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut()?;
|
||||
|
||||
// Deleting layers doesn't affect the values stored in TimelineMetadata,
|
||||
// so we don't need update it. Just serialize it.
|
||||
let metadata = upload_queue.latest_metadata.clone();
|
||||
// Deleting layers doesn't affect the values stored in TimelineMetadata,
|
||||
// so we don't need update it. Just serialize it.
|
||||
let metadata = upload_queue.latest_metadata.clone();
|
||||
|
||||
// Decorate our list of names with each name's generation, dropping
|
||||
// makes that are unexpectedly missing from our metadata.
|
||||
let with_generations: Vec<_> = names
|
||||
.into_iter()
|
||||
.filter_map(|name| {
|
||||
// Remove from latest_files, learning the file's remote generation in the process
|
||||
let meta = upload_queue.latest_files.remove(name);
|
||||
|
||||
if let Some(meta) = meta {
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
|
||||
Some((name.clone(), meta.generation))
|
||||
} else {
|
||||
// This is unexpected: latest_files is meant to be kept up to
|
||||
// date. We can't delete the layer if we have forgotten what
|
||||
// generation it was in.
|
||||
warn!("Deleting layer {name} not found in latest_files list");
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect();
|
||||
// Update the remote index file, removing the to-be-deleted files from the index,
|
||||
// before deleting the actual files.
|
||||
//
|
||||
// Once we start removing files from upload_queue.latest_files, there's
|
||||
// no going back! Otherwise, some of the files would already be removed
|
||||
// from latest_files, but not yet scheduled for deletion. Use a closure
|
||||
// to syntactically forbid ? or bail! calls here.
|
||||
let no_bail_here = || {
|
||||
for name in names {
|
||||
if upload_queue.latest_files.remove(name).is_some() {
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled += 1;
|
||||
}
|
||||
}
|
||||
|
||||
if upload_queue.latest_files_changes_since_metadata_upload_scheduled > 0 {
|
||||
self.schedule_index_upload(upload_queue, metadata);
|
||||
}
|
||||
|
||||
with_generations
|
||||
// schedule the actual deletions
|
||||
for name in names {
|
||||
let op = UploadOp::Delete(Delete {
|
||||
file_kind: RemoteOpFileKind::Layer,
|
||||
layer_file_name: name.clone(),
|
||||
scheduled_from_timeline_delete: false,
|
||||
});
|
||||
self.calls_unfinished_metric_begin(&op);
|
||||
upload_queue.queued_operations.push_back(op);
|
||||
info!("scheduled layer file deletion {name}");
|
||||
}
|
||||
|
||||
// Launch the tasks immediately, if possible
|
||||
self.launch_queued_tasks(upload_queue);
|
||||
};
|
||||
|
||||
// Barrier: we must ensure all prior uploads and index writes have landed in S3
|
||||
// before emitting deletions.
|
||||
if let Err(e) = self.wait_completion().await {
|
||||
// This can only fail if upload queue is shut down: if this happens, we do
|
||||
// not emit any deletions. In this condition (remote client is shut down
|
||||
// during compaction or GC) we may leak some objects.
|
||||
bail!("Cannot complete layer file deletions during shutdown ({e})");
|
||||
}
|
||||
|
||||
// Enqueue deletions
|
||||
deletion_queue_client
|
||||
.push_layers(
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.generation,
|
||||
with_generations,
|
||||
)
|
||||
.await?;
|
||||
no_bail_here();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -785,10 +760,10 @@ impl RemoteTimelineClient {
|
||||
backoff::retry(
|
||||
|| {
|
||||
upload::upload_index_part(
|
||||
self.conf,
|
||||
&self.storage_impl,
|
||||
&self.tenant_id,
|
||||
&self.timeline_id,
|
||||
self.generation,
|
||||
&index_part_with_deleted_at,
|
||||
)
|
||||
},
|
||||
@@ -825,13 +800,12 @@ impl RemoteTimelineClient {
|
||||
/// Prerequisites: UploadQueue should be in stopped state and deleted_at should be successfuly set.
|
||||
/// The function deletes layer files one by one, then lists the prefix to see if we leaked something
|
||||
/// deletes leaked files if any and proceeds with deletion of index file at the end.
|
||||
pub(crate) async fn delete_all(
|
||||
self: &Arc<Self>,
|
||||
deletion_queue: &DeletionQueueClient,
|
||||
) -> anyhow::Result<()> {
|
||||
pub(crate) async fn delete_all(self: &Arc<Self>) -> anyhow::Result<()> {
|
||||
debug_assert_current_span_has_tenant_and_timeline_id();
|
||||
|
||||
let layers: Vec<_> = {
|
||||
let (mut receiver, deletions_queued) = {
|
||||
let mut deletions_queued = 0;
|
||||
|
||||
let mut locked = self.upload_queue.lock().unwrap();
|
||||
let stopped = locked.stopped_mut()?;
|
||||
|
||||
@@ -843,29 +817,40 @@ impl RemoteTimelineClient {
|
||||
|
||||
stopped
|
||||
.upload_queue_for_deletion
|
||||
.latest_files
|
||||
.drain()
|
||||
.map(|kv| (kv.0, kv.1.generation))
|
||||
.collect()
|
||||
.queued_operations
|
||||
.reserve(stopped.upload_queue_for_deletion.latest_files.len());
|
||||
|
||||
// schedule the actual deletions
|
||||
for name in stopped.upload_queue_for_deletion.latest_files.keys() {
|
||||
let op = UploadOp::Delete(Delete {
|
||||
file_kind: RemoteOpFileKind::Layer,
|
||||
layer_file_name: name.clone(),
|
||||
scheduled_from_timeline_delete: true,
|
||||
});
|
||||
self.calls_unfinished_metric_begin(&op);
|
||||
stopped
|
||||
.upload_queue_for_deletion
|
||||
.queued_operations
|
||||
.push_back(op);
|
||||
|
||||
info!("scheduled layer file deletion {name}");
|
||||
deletions_queued += 1;
|
||||
}
|
||||
|
||||
self.launch_queued_tasks(&mut stopped.upload_queue_for_deletion);
|
||||
|
||||
(
|
||||
self.schedule_barrier(&mut stopped.upload_queue_for_deletion),
|
||||
deletions_queued,
|
||||
)
|
||||
};
|
||||
|
||||
let layer_deletion_count = layers.len();
|
||||
|
||||
let layer_paths = layers
|
||||
.into_iter()
|
||||
.map(|(layer, generation)| {
|
||||
remote_layer_path(&self.tenant_id, &self.timeline_id, &layer, generation)
|
||||
})
|
||||
.collect();
|
||||
deletion_queue.push_immediate(layer_paths).await?;
|
||||
receiver.changed().await.context("upload queue shut down")?;
|
||||
|
||||
// Do not delete index part yet, it is needed for possible retry. If we remove it first
|
||||
// and retry will arrive to different pageserver there wont be any traces of it on remote storage
|
||||
let timeline_storage_path = remote_timeline_path(&self.tenant_id, &self.timeline_id);
|
||||
|
||||
// Execute all pending deletions, so that when we prroceed to do a list_prefixes below, we aren't
|
||||
// taking the burden of listing all the layers that we already know we should delete.
|
||||
deletion_queue.flush_immediate().await?;
|
||||
let timeline_path = self.conf.timeline_path(&self.tenant_id, &self.timeline_id);
|
||||
let timeline_storage_path = self.conf.remote_path(&timeline_path)?;
|
||||
|
||||
let remaining = backoff::retry(
|
||||
|| async {
|
||||
@@ -894,9 +879,17 @@ impl RemoteTimelineClient {
|
||||
})
|
||||
.collect();
|
||||
|
||||
let not_referenced_count = remaining.len();
|
||||
if !remaining.is_empty() {
|
||||
deletion_queue.push_immediate(remaining).await?;
|
||||
backoff::retry(
|
||||
|| async { self.storage_impl.delete_objects(&remaining).await },
|
||||
|_e| false,
|
||||
FAILED_UPLOAD_WARN_THRESHOLD,
|
||||
FAILED_REMOTE_OP_RETRIES,
|
||||
"delete_objects",
|
||||
backoff::Cancel::new(shutdown_token(), || anyhow::anyhow!("Cancelled!")),
|
||||
)
|
||||
.await
|
||||
.context("delete_objects")?;
|
||||
}
|
||||
|
||||
fail::fail_point!("timeline-delete-before-index-delete", |_| {
|
||||
@@ -907,14 +900,18 @@ impl RemoteTimelineClient {
|
||||
|
||||
let index_file_path = timeline_storage_path.join(Path::new(IndexPart::FILE_NAME));
|
||||
|
||||
debug!("enqueuing index part deletion");
|
||||
deletion_queue
|
||||
.push_immediate([index_file_path].to_vec())
|
||||
.await?;
|
||||
debug!("deleting index part");
|
||||
|
||||
// Timeline deletion is rare and we have probably emitted a reasonably number of objects: wait
|
||||
// for a flush to a persistent deletion list so that we may be sure deletion will occur.
|
||||
deletion_queue.flush_immediate().await?;
|
||||
backoff::retry(
|
||||
|| async { self.storage_impl.delete(&index_file_path).await },
|
||||
|_e| false,
|
||||
FAILED_UPLOAD_WARN_THRESHOLD,
|
||||
FAILED_REMOTE_OP_RETRIES,
|
||||
"delete_index",
|
||||
backoff::Cancel::new(shutdown_token(), || anyhow::anyhow!("Cancelled")),
|
||||
)
|
||||
.await
|
||||
.context("delete_index")?;
|
||||
|
||||
fail::fail_point!("timeline-delete-after-index-delete", |_| {
|
||||
Err(anyhow::anyhow!(
|
||||
@@ -922,7 +919,7 @@ impl RemoteTimelineClient {
|
||||
))?
|
||||
});
|
||||
|
||||
info!(prefix=%timeline_storage_path, referenced=layer_deletion_count, not_referenced=%not_referenced_count, "done deleting in timeline prefix, including index_part.json");
|
||||
info!(prefix=%timeline_storage_path, referenced=deletions_queued, not_referenced=%remaining.len(), "done deleting in timeline prefix, including index_part.json");
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -945,6 +942,10 @@ impl RemoteTimelineClient {
|
||||
// have finished.
|
||||
upload_queue.inprogress_tasks.is_empty()
|
||||
}
|
||||
UploadOp::Delete(_) => {
|
||||
// Wait for preceding uploads to finish. Concurrent deletions are OK, though.
|
||||
upload_queue.num_inprogress_deletions == upload_queue.inprogress_tasks.len()
|
||||
}
|
||||
|
||||
UploadOp::Barrier(_) => upload_queue.inprogress_tasks.is_empty(),
|
||||
};
|
||||
@@ -972,6 +973,9 @@ impl RemoteTimelineClient {
|
||||
UploadOp::UploadMetadata(_, _) => {
|
||||
upload_queue.num_inprogress_metadata_uploads += 1;
|
||||
}
|
||||
UploadOp::Delete(_) => {
|
||||
upload_queue.num_inprogress_deletions += 1;
|
||||
}
|
||||
UploadOp::Barrier(sender) => {
|
||||
sender.send_replace(());
|
||||
continue;
|
||||
@@ -1049,18 +1053,13 @@ impl RemoteTimelineClient {
|
||||
}
|
||||
|
||||
let upload_result: anyhow::Result<()> = match &task.op {
|
||||
UploadOp::UploadLayer(ref layer_file_name, ref layer_metadata) => {
|
||||
let path = self
|
||||
.conf
|
||||
.timeline_path(&self.tenant_id, &self.timeline_id)
|
||||
.join(layer_file_name.file_name());
|
||||
|
||||
UploadOp::UploadLayer(ref layer, ref layer_metadata) => {
|
||||
let path = layer.local_path();
|
||||
upload::upload_timeline_layer(
|
||||
self.conf,
|
||||
&self.storage_impl,
|
||||
&path,
|
||||
path,
|
||||
layer_metadata,
|
||||
self.generation,
|
||||
)
|
||||
.measure_remote_op(
|
||||
self.tenant_id,
|
||||
@@ -1082,10 +1081,10 @@ impl RemoteTimelineClient {
|
||||
};
|
||||
|
||||
let res = upload::upload_index_part(
|
||||
self.conf,
|
||||
&self.storage_impl,
|
||||
&self.tenant_id,
|
||||
&self.timeline_id,
|
||||
self.generation,
|
||||
index_part,
|
||||
)
|
||||
.measure_remote_op(
|
||||
@@ -1105,6 +1104,21 @@ impl RemoteTimelineClient {
|
||||
}
|
||||
res
|
||||
}
|
||||
UploadOp::Delete(delete) => {
|
||||
let path = &self
|
||||
.conf
|
||||
.timeline_path(&self.tenant_id, &self.timeline_id)
|
||||
.join(delete.layer_file_name.file_name());
|
||||
delete::delete_layer(self.conf, &self.storage_impl, path)
|
||||
.measure_remote_op(
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
delete.file_kind,
|
||||
RemoteOpKind::Delete,
|
||||
Arc::clone(&self.metrics),
|
||||
)
|
||||
.await
|
||||
}
|
||||
UploadOp::Barrier(_) => {
|
||||
// unreachable. Barrier operations are handled synchronously in
|
||||
// launch_queued_tasks
|
||||
@@ -1164,7 +1178,15 @@ impl RemoteTimelineClient {
|
||||
let mut upload_queue_guard = self.upload_queue.lock().unwrap();
|
||||
let upload_queue = match upload_queue_guard.deref_mut() {
|
||||
UploadQueue::Uninitialized => panic!("callers are responsible for ensuring this is only called on an initialized queue"),
|
||||
UploadQueue::Stopped(_) => { None }
|
||||
UploadQueue::Stopped(stopped) => {
|
||||
// Special care is needed for deletions, if it was an earlier deletion (not scheduled from deletion)
|
||||
// then stop() took care of it so we just return.
|
||||
// For deletions that come from delete_all we still want to maintain metrics, launch following tasks, etc.
|
||||
match &task.op {
|
||||
UploadOp::Delete(delete) if delete.scheduled_from_timeline_delete => Some(&mut stopped.upload_queue_for_deletion),
|
||||
_ => None
|
||||
}
|
||||
},
|
||||
UploadQueue::Initialized(qi) => { Some(qi) }
|
||||
};
|
||||
|
||||
@@ -1186,6 +1208,9 @@ impl RemoteTimelineClient {
|
||||
upload_queue.num_inprogress_metadata_uploads -= 1;
|
||||
upload_queue.last_uploaded_consistent_lsn = lsn; // XXX monotonicity check?
|
||||
}
|
||||
UploadOp::Delete(_) => {
|
||||
upload_queue.num_inprogress_deletions -= 1;
|
||||
}
|
||||
UploadOp::Barrier(_) => unreachable!(),
|
||||
};
|
||||
|
||||
@@ -1217,6 +1242,13 @@ impl RemoteTimelineClient {
|
||||
reason: "metadata uploads are tiny",
|
||||
},
|
||||
),
|
||||
UploadOp::Delete(delete) => (
|
||||
delete.file_kind,
|
||||
RemoteOpKind::Delete,
|
||||
DontTrackSize {
|
||||
reason: "should we track deletes? positive or negative sign?",
|
||||
},
|
||||
),
|
||||
UploadOp::Barrier(_) => {
|
||||
// we do not account these
|
||||
return None;
|
||||
@@ -1276,6 +1308,7 @@ impl RemoteTimelineClient {
|
||||
last_uploaded_consistent_lsn: initialized.last_uploaded_consistent_lsn,
|
||||
num_inprogress_layer_uploads: 0,
|
||||
num_inprogress_metadata_uploads: 0,
|
||||
num_inprogress_deletions: 0,
|
||||
inprogress_tasks: HashMap::default(),
|
||||
queued_operations: VecDeque::default(),
|
||||
};
|
||||
@@ -1296,7 +1329,9 @@ impl RemoteTimelineClient {
|
||||
|
||||
// consistency check
|
||||
assert_eq!(
|
||||
qi.num_inprogress_layer_uploads + qi.num_inprogress_metadata_uploads,
|
||||
qi.num_inprogress_layer_uploads
|
||||
+ qi.num_inprogress_metadata_uploads
|
||||
+ qi.num_inprogress_deletions,
|
||||
qi.inprogress_tasks.len()
|
||||
);
|
||||
|
||||
@@ -1321,84 +1356,15 @@ impl RemoteTimelineClient {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn remote_timelines_path(tenant_id: &TenantId) -> RemotePath {
|
||||
let path = format!("tenants/{tenant_id}/{TIMELINES_SEGMENT_NAME}");
|
||||
RemotePath::from_string(&path).expect("Failed to construct path")
|
||||
}
|
||||
|
||||
pub fn remote_timeline_path(tenant_id: &TenantId, timeline_id: &TimelineId) -> RemotePath {
|
||||
remote_timelines_path(tenant_id).join(&PathBuf::from(timeline_id.to_string()))
|
||||
}
|
||||
|
||||
pub fn remote_layer_path(
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
layer_file_name: &LayerFileName,
|
||||
generation: Generation,
|
||||
) -> RemotePath {
|
||||
// Generation-aware key format
|
||||
let path = format!(
|
||||
"tenants/{tenant_id}/{TIMELINES_SEGMENT_NAME}/{timeline_id}/{0}{1}",
|
||||
layer_file_name.file_name(),
|
||||
generation.get_suffix()
|
||||
);
|
||||
|
||||
RemotePath::from_string(&path).expect("Failed to construct path")
|
||||
}
|
||||
|
||||
pub fn remote_index_path(
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
generation: Generation,
|
||||
) -> RemotePath {
|
||||
RemotePath::from_string(&format!(
|
||||
"tenants/{tenant_id}/{TIMELINES_SEGMENT_NAME}/{timeline_id}/{0}{1}",
|
||||
IndexPart::FILE_NAME,
|
||||
generation.get_suffix()
|
||||
))
|
||||
.expect("Failed to construct path")
|
||||
}
|
||||
|
||||
/// Files on the remote storage are stored with paths, relative to the workdir.
|
||||
/// That path includes in itself both tenant and timeline ids, allowing to have a unique remote storage path.
|
||||
///
|
||||
/// Errors if the path provided does not start from pageserver's workdir.
|
||||
pub fn remote_path(
|
||||
conf: &PageServerConf,
|
||||
local_path: &Path,
|
||||
generation: Option<Generation>,
|
||||
) -> anyhow::Result<RemotePath> {
|
||||
let stripped = local_path
|
||||
.strip_prefix(&conf.workdir)
|
||||
.context("Failed to strip workdir prefix")?;
|
||||
|
||||
let suffixed = if let Some(generation) = generation {
|
||||
format!(
|
||||
"{0}{1}",
|
||||
stripped.to_string_lossy(),
|
||||
generation.get_suffix()
|
||||
)
|
||||
} else {
|
||||
stripped.to_string_lossy().to_string()
|
||||
};
|
||||
|
||||
RemotePath::new(&PathBuf::from(suffixed)).with_context(|| {
|
||||
format!(
|
||||
"Failed to resolve remote part of path {:?} for base {:?}",
|
||||
local_path, conf.workdir
|
||||
)
|
||||
})
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use crate::{
|
||||
context::RequestContext,
|
||||
deletion_queue::mock::MockDeletionQueue,
|
||||
tenant::{
|
||||
harness::{TenantHarness, TIMELINE_ID},
|
||||
Generation, Tenant, Timeline,
|
||||
storage_layer::Layer,
|
||||
Tenant, Timeline,
|
||||
},
|
||||
DEFAULT_PG_VERSION,
|
||||
};
|
||||
@@ -1440,11 +1406,8 @@ mod tests {
|
||||
assert_eq!(avec, bvec);
|
||||
}
|
||||
|
||||
fn assert_remote_files(expected: &[&str], remote_path: &Path, generation: Generation) {
|
||||
let mut expected: Vec<String> = expected
|
||||
.iter()
|
||||
.map(|x| format!("{}{}", x, generation.get_suffix()))
|
||||
.collect();
|
||||
fn assert_remote_files(expected: &[&str], remote_path: &Path) {
|
||||
let mut expected: Vec<String> = expected.iter().map(|x| String::from(*x)).collect();
|
||||
expected.sort();
|
||||
|
||||
let mut found: Vec<String> = Vec::new();
|
||||
@@ -1465,7 +1428,6 @@ mod tests {
|
||||
tenant_ctx: RequestContext,
|
||||
remote_fs_dir: PathBuf,
|
||||
client: Arc<RemoteTimelineClient>,
|
||||
deletion_queue: MockDeletionQueue,
|
||||
}
|
||||
|
||||
impl TestSetup {
|
||||
@@ -1496,8 +1458,6 @@ mod tests {
|
||||
storage: RemoteStorageKind::LocalFs(remote_fs_dir.clone()),
|
||||
};
|
||||
|
||||
let generation = Generation::new(0xdeadbeef);
|
||||
|
||||
let storage = GenericRemoteStorage::from_config(&storage_config).unwrap();
|
||||
|
||||
let client = Arc::new(RemoteTimelineClient {
|
||||
@@ -1505,8 +1465,7 @@ mod tests {
|
||||
runtime: tokio::runtime::Handle::current(),
|
||||
tenant_id: harness.tenant_id,
|
||||
timeline_id: TIMELINE_ID,
|
||||
generation,
|
||||
storage_impl: storage.clone(),
|
||||
storage_impl: storage,
|
||||
upload_queue: Mutex::new(UploadQueue::Uninitialized),
|
||||
metrics: Arc::new(RemoteTimelineClientMetrics::new(
|
||||
&harness.tenant_id,
|
||||
@@ -1514,8 +1473,6 @@ mod tests {
|
||||
)),
|
||||
});
|
||||
|
||||
let deletion_queue = MockDeletionQueue::new(Some(storage));
|
||||
|
||||
Ok(Self {
|
||||
harness,
|
||||
tenant,
|
||||
@@ -1523,7 +1480,6 @@ mod tests {
|
||||
tenant_ctx: ctx,
|
||||
remote_fs_dir,
|
||||
client,
|
||||
deletion_queue,
|
||||
})
|
||||
}
|
||||
}
|
||||
@@ -1548,11 +1504,10 @@ mod tests {
|
||||
let TestSetup {
|
||||
harness,
|
||||
tenant: _tenant,
|
||||
timeline: _timeline,
|
||||
timeline,
|
||||
tenant_ctx: _tenant_ctx,
|
||||
remote_fs_dir,
|
||||
client,
|
||||
deletion_queue,
|
||||
} = TestSetup::new("upload_scheduling").await.unwrap();
|
||||
|
||||
let timeline_path = harness.timeline_path(&TIMELINE_ID);
|
||||
@@ -1568,35 +1523,30 @@ mod tests {
|
||||
.init_upload_queue_for_empty_remote(&metadata)
|
||||
.unwrap();
|
||||
|
||||
let generation = Generation::new(0xdeadbeef);
|
||||
|
||||
// Create a couple of dummy files, schedule upload for them
|
||||
let layer_file_name_1: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap();
|
||||
let layer_file_name_2: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D9-00000000016B5A52".parse().unwrap();
|
||||
let layer_file_name_3: LayerFileName = "000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59DA-00000000016B5A53".parse().unwrap();
|
||||
let content_1 = dummy_contents("foo");
|
||||
let content_2 = dummy_contents("bar");
|
||||
let content_3 = dummy_contents("baz");
|
||||
|
||||
for (filename, content) in [
|
||||
(&layer_file_name_1, &content_1),
|
||||
(&layer_file_name_2, &content_2),
|
||||
(&layer_file_name_3, &content_3),
|
||||
] {
|
||||
std::fs::write(timeline_path.join(filename.file_name()), content).unwrap();
|
||||
}
|
||||
let layers = [
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap(), dummy_contents("foo")),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D9-00000000016B5A52".parse().unwrap(), dummy_contents("bar")),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59DA-00000000016B5A53".parse().unwrap(), dummy_contents("baz"))
|
||||
]
|
||||
.into_iter()
|
||||
.map(|(name, contents): (LayerFileName, Vec<u8>)| {
|
||||
std::fs::write(timeline_path.join(name.file_name()), &contents).unwrap();
|
||||
|
||||
Layer::for_resident(
|
||||
harness.conf,
|
||||
&timeline,
|
||||
name,
|
||||
LayerFileMetadata::new(contents.len() as u64),
|
||||
)
|
||||
}).collect::<Vec<_>>();
|
||||
|
||||
client
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_1,
|
||||
&LayerFileMetadata::new(content_1.len() as u64, generation),
|
||||
)
|
||||
.schedule_layer_file_upload(layers[0].clone())
|
||||
.unwrap();
|
||||
client
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_2,
|
||||
&LayerFileMetadata::new(content_2.len() as u64, generation),
|
||||
)
|
||||
.schedule_layer_file_upload(layers[1].clone())
|
||||
.unwrap();
|
||||
|
||||
// Check that they are started immediately, not queued
|
||||
@@ -1649,87 +1599,49 @@ mod tests {
|
||||
.map(|f| f.to_owned())
|
||||
.collect(),
|
||||
&[
|
||||
&layer_file_name_1.file_name(),
|
||||
&layer_file_name_2.file_name(),
|
||||
&layers[0].layer_desc().filename().file_name(),
|
||||
&layers[1].layer_desc().filename().file_name(),
|
||||
],
|
||||
);
|
||||
assert_eq!(index_part.metadata, metadata);
|
||||
|
||||
// Schedule upload and then a deletion. Check that the deletion is queued
|
||||
client
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_3,
|
||||
&LayerFileMetadata::new(content_3.len() as u64, generation),
|
||||
)
|
||||
.schedule_layer_file_upload(layers[2].clone())
|
||||
.unwrap();
|
||||
|
||||
{
|
||||
let mut guard = client.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut().unwrap();
|
||||
assert_eq!(upload_queue.queued_operations.len(), 0);
|
||||
assert_eq!(upload_queue.num_inprogress_layer_uploads, 1);
|
||||
}
|
||||
|
||||
assert_remote_files(
|
||||
&[
|
||||
&layer_file_name_1.file_name(),
|
||||
&layer_file_name_2.file_name(),
|
||||
"index_part.json",
|
||||
],
|
||||
&remote_timeline_dir,
|
||||
generation,
|
||||
);
|
||||
|
||||
client
|
||||
.schedule_layer_file_deletion(
|
||||
&[layer_file_name_1.clone()],
|
||||
&deletion_queue.new_client(),
|
||||
)
|
||||
.await
|
||||
.schedule_layer_file_deletion(&[layers[0].layer_desc().filename()])
|
||||
.unwrap();
|
||||
|
||||
{
|
||||
let mut guard = client.upload_queue.lock().unwrap();
|
||||
let upload_queue = guard.initialized_mut().unwrap();
|
||||
|
||||
// Deletion schedules upload of the index file via RemoteTimelineClient, and
|
||||
// deletion of layer files via DeletionQueue. The uploads have all been flushed
|
||||
// because schedule_layer_file_deletion does a wait_completion before pushing
|
||||
// to the deletion_queue
|
||||
assert_eq!(upload_queue.queued_operations.len(), 0);
|
||||
assert_eq!(upload_queue.inprogress_tasks.len(), 0);
|
||||
assert_eq!(upload_queue.num_inprogress_layer_uploads, 0);
|
||||
assert_eq!(
|
||||
upload_queue.latest_files_changes_since_metadata_upload_scheduled,
|
||||
0
|
||||
);
|
||||
// Deletion schedules upload of the index file, and the file deletion itself
|
||||
assert!(upload_queue.queued_operations.len() == 2);
|
||||
assert!(upload_queue.inprogress_tasks.len() == 1);
|
||||
assert!(upload_queue.num_inprogress_layer_uploads == 1);
|
||||
assert!(upload_queue.num_inprogress_deletions == 0);
|
||||
assert!(upload_queue.latest_files_changes_since_metadata_upload_scheduled == 0);
|
||||
}
|
||||
assert_remote_files(
|
||||
&[
|
||||
&layer_file_name_1.file_name(),
|
||||
&layer_file_name_2.file_name(),
|
||||
&layer_file_name_3.file_name(),
|
||||
&layers[0].layer_desc().filename().file_name(),
|
||||
&layers[1].layer_desc().filename().file_name(),
|
||||
"index_part.json",
|
||||
],
|
||||
&remote_timeline_dir,
|
||||
generation,
|
||||
);
|
||||
|
||||
// Finish uploads and deletions
|
||||
// Finish them
|
||||
client.wait_completion().await.unwrap();
|
||||
deletion_queue.pump().await;
|
||||
|
||||
// 1 layer was deleted
|
||||
assert_eq!(deletion_queue.get_executed(), 1);
|
||||
|
||||
assert_remote_files(
|
||||
&[
|
||||
&layer_file_name_2.file_name(),
|
||||
&layer_file_name_3.file_name(),
|
||||
&layers[1].layer_desc().filename().file_name(),
|
||||
&layers[2].layer_desc().filename().file_name(),
|
||||
"index_part.json",
|
||||
],
|
||||
&remote_timeline_dir,
|
||||
generation,
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1740,7 +1652,7 @@ mod tests {
|
||||
let TestSetup {
|
||||
harness,
|
||||
tenant: _tenant,
|
||||
timeline: _timeline,
|
||||
timeline,
|
||||
client,
|
||||
..
|
||||
} = TestSetup::new("metrics").await.unwrap();
|
||||
@@ -1760,6 +1672,13 @@ mod tests {
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
let layer_file_1 = Layer::for_resident(
|
||||
harness.conf,
|
||||
&timeline,
|
||||
layer_file_name_1.clone(),
|
||||
LayerFileMetadata::new(content_1.len() as u64),
|
||||
);
|
||||
|
||||
#[derive(Debug, PartialEq)]
|
||||
struct BytesStartedFinished {
|
||||
started: Option<usize>,
|
||||
@@ -1782,15 +1701,10 @@ mod tests {
|
||||
|
||||
// Test
|
||||
|
||||
let generation = Generation::new(0xdeadbeef);
|
||||
|
||||
let init = get_bytes_started_stopped();
|
||||
|
||||
client
|
||||
.schedule_layer_file_upload(
|
||||
&layer_file_name_1,
|
||||
&LayerFileMetadata::new(content_1.len() as u64, generation),
|
||||
)
|
||||
.schedule_layer_file_upload(layer_file_1.clone())
|
||||
.unwrap();
|
||||
|
||||
let pre = get_bytes_started_stopped();
|
||||
@@ -1824,23 +1738,4 @@ mod tests {
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
// #[tokio::test]
|
||||
// async fn index_part_download() {
|
||||
// let TestSetup {
|
||||
// harness,
|
||||
// tenant: _tenant,
|
||||
// timeline: _timeline,
|
||||
// client,
|
||||
// ..
|
||||
// } = TestSetup::new("index_part_download").await.unwrap();
|
||||
|
||||
// let example_index_part = IndexPart {
|
||||
// version: 3,
|
||||
// timeline_layers: HashSet::new(),
|
||||
// layer_metadata:
|
||||
|
||||
// }
|
||||
|
||||
// }
|
||||
}
|
||||
|
||||
29
pageserver/src/tenant/remote_timeline_client/delete.rs
Normal file
29
pageserver/src/tenant/remote_timeline_client/delete.rs
Normal file
@@ -0,0 +1,29 @@
|
||||
//! Helper functions to delete files from remote storage with a RemoteStorage
|
||||
use anyhow::Context;
|
||||
use std::path::Path;
|
||||
use tracing::debug;
|
||||
|
||||
use remote_storage::GenericRemoteStorage;
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
|
||||
pub(super) async fn delete_layer<'a>(
|
||||
conf: &'static PageServerConf,
|
||||
storage: &'a GenericRemoteStorage,
|
||||
local_layer_path: &'a Path,
|
||||
) -> anyhow::Result<()> {
|
||||
fail::fail_point!("before-delete-layer", |_| {
|
||||
anyhow::bail!("failpoint before-delete-layer")
|
||||
});
|
||||
debug!("Deleting layer from remote storage: {local_layer_path:?}",);
|
||||
|
||||
let path_to_delete = conf.remote_path(local_layer_path)?;
|
||||
|
||||
// We don't want to print an error if the delete failed if the file has
|
||||
// already been deleted. Thankfully, in this situation S3 already
|
||||
// does not yield an error. While OS-provided local file system APIs do yield
|
||||
// errors, we avoid them in the `LocalFs` wrapper.
|
||||
storage.delete(&path_to_delete).await.with_context(|| {
|
||||
format!("Failed to delete remote layer from storage at {path_to_delete:?}")
|
||||
})
|
||||
}
|
||||
@@ -15,16 +15,14 @@ use tokio_util::sync::CancellationToken;
|
||||
use utils::{backoff, crashsafe};
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::tenant::remote_timeline_client::{remote_layer_path, remote_timelines_path};
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
use crate::tenant::timeline::span::debug_assert_current_span_has_tenant_and_timeline_id;
|
||||
use crate::tenant::Generation;
|
||||
use remote_storage::{DownloadError, GenericRemoteStorage, RemotePath};
|
||||
use remote_storage::{DownloadError, GenericRemoteStorage};
|
||||
use utils::crashsafe::path_with_suffix_extension;
|
||||
use utils::id::{TenantId, TimelineId};
|
||||
|
||||
use super::index::{IndexPart, LayerFileMetadata};
|
||||
use super::{remote_index_path, FAILED_DOWNLOAD_WARN_THRESHOLD, FAILED_REMOTE_OP_RETRIES};
|
||||
use super::{FAILED_DOWNLOAD_WARN_THRESHOLD, FAILED_REMOTE_OP_RETRIES};
|
||||
|
||||
static MAX_DOWNLOAD_DURATION: Duration = Duration::from_secs(120);
|
||||
|
||||
@@ -43,16 +41,13 @@ pub async fn download_layer_file<'a>(
|
||||
) -> Result<u64, DownloadError> {
|
||||
debug_assert_current_span_has_tenant_and_timeline_id();
|
||||
|
||||
let local_path = conf
|
||||
.timeline_path(&tenant_id, &timeline_id)
|
||||
.join(layer_file_name.file_name());
|
||||
let timeline_path = conf.timeline_path(&tenant_id, &timeline_id);
|
||||
|
||||
let remote_path = remote_layer_path(
|
||||
&tenant_id,
|
||||
&timeline_id,
|
||||
layer_file_name,
|
||||
layer_metadata.generation,
|
||||
);
|
||||
let local_path = timeline_path.join(layer_file_name.file_name());
|
||||
|
||||
let remote_path = conf
|
||||
.remote_path(&local_path)
|
||||
.map_err(DownloadError::Other)?;
|
||||
|
||||
// Perform a rename inspired by durable_rename from file_utils.c.
|
||||
// The sequence:
|
||||
@@ -178,19 +173,21 @@ pub fn is_temp_download_file(path: &Path) -> bool {
|
||||
}
|
||||
|
||||
/// List timelines of given tenant in remote storage
|
||||
pub async fn list_remote_timelines(
|
||||
storage: &GenericRemoteStorage,
|
||||
pub async fn list_remote_timelines<'a>(
|
||||
storage: &'a GenericRemoteStorage,
|
||||
conf: &'static PageServerConf,
|
||||
tenant_id: TenantId,
|
||||
) -> anyhow::Result<HashSet<TimelineId>> {
|
||||
let remote_path = remote_timelines_path(&tenant_id);
|
||||
let tenant_path = conf.timelines_path(&tenant_id);
|
||||
let tenant_storage_path = conf.remote_path(&tenant_path)?;
|
||||
|
||||
fail::fail_point!("storage-sync-list-remote-timelines", |_| {
|
||||
anyhow::bail!("storage-sync-list-remote-timelines");
|
||||
});
|
||||
|
||||
let timelines = download_retry(
|
||||
|| storage.list_prefixes(Some(&remote_path)),
|
||||
&format!("list prefixes for {tenant_id}"),
|
||||
|| storage.list_prefixes(Some(&tenant_storage_path)),
|
||||
&format!("list prefixes for {tenant_path:?}"),
|
||||
)
|
||||
.await?;
|
||||
|
||||
@@ -224,140 +221,46 @@ pub async fn list_remote_timelines(
|
||||
Ok(timeline_ids)
|
||||
}
|
||||
|
||||
async fn do_download_index_part(
|
||||
local_path: &Path,
|
||||
storage: &GenericRemoteStorage,
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
index_generation: Generation,
|
||||
) -> Result<IndexPart, DownloadError> {
|
||||
let remote_path = remote_index_path(tenant_id, timeline_id, index_generation);
|
||||
|
||||
let index_part_bytes = download_retry(
|
||||
|| storage.download_all(&remote_path),
|
||||
&format!("download {remote_path:?}"),
|
||||
)
|
||||
.await?;
|
||||
|
||||
let index_part: IndexPart = serde_json::from_slice(&index_part_bytes)
|
||||
.with_context(|| format!("Failed to deserialize index part file into file {local_path:?}"))
|
||||
.map_err(DownloadError::Other)?;
|
||||
|
||||
Ok(index_part)
|
||||
}
|
||||
|
||||
pub(super) async fn download_index_part(
|
||||
conf: &'static PageServerConf,
|
||||
storage: &GenericRemoteStorage,
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
my_generation: Generation,
|
||||
) -> Result<IndexPart, DownloadError> {
|
||||
let local_path = conf
|
||||
let index_part_path = conf
|
||||
.metadata_path(tenant_id, timeline_id)
|
||||
.with_file_name(IndexPart::FILE_NAME);
|
||||
let part_storage_path = conf
|
||||
.remote_path(&index_part_path)
|
||||
.map_err(DownloadError::BadInput)?;
|
||||
|
||||
if my_generation.is_none() {
|
||||
// Operating without generations: just fetch the generation-less path
|
||||
return do_download_index_part(&local_path, storage, tenant_id, timeline_id, my_generation)
|
||||
.await;
|
||||
}
|
||||
let index_part_bytes = download_retry(
|
||||
|| async {
|
||||
let mut index_part_download = storage.download(&part_storage_path).await?;
|
||||
|
||||
let previous_gen = my_generation.previous();
|
||||
let r_previous =
|
||||
do_download_index_part(&local_path, storage, tenant_id, timeline_id, previous_gen).await;
|
||||
|
||||
match r_previous {
|
||||
Ok(index_part) => {
|
||||
tracing::debug!("Found index_part from previous generation {previous_gen}");
|
||||
return Ok(index_part);
|
||||
}
|
||||
Err(e) => {
|
||||
if matches!(e, DownloadError::NotFound) {
|
||||
tracing::debug!("No index_part found from previous generation {previous_gen}, falling back to listing");
|
||||
} else {
|
||||
return Err(e);
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
/// Given the key of an index, parse out the generation part of the name
|
||||
fn parse_generation(path: RemotePath) -> Option<Generation> {
|
||||
let path = path.take();
|
||||
let file_name = match path.file_name() {
|
||||
Some(f) => f,
|
||||
None => {
|
||||
// Unexpected: we should be seeing index_part.json paths only
|
||||
tracing::warn!("Malformed index key {0}", path.display());
|
||||
return None;
|
||||
}
|
||||
};
|
||||
|
||||
let file_name_str = match file_name.to_str() {
|
||||
Some(s) => s,
|
||||
None => {
|
||||
tracing::warn!("Malformed index key {0}", path.display());
|
||||
return None;
|
||||
}
|
||||
};
|
||||
|
||||
match file_name_str.split_once("-") {
|
||||
Some((_, gen_suffix)) => u32::from_str_radix(gen_suffix, 16)
|
||||
.map(|g| Generation::new(g))
|
||||
.ok(),
|
||||
None => None,
|
||||
}
|
||||
}
|
||||
|
||||
// Fallback: we did not find an index_part.json from the previous generation, so
|
||||
// we will list all the index_part objects and pick the most recent.
|
||||
let index_prefix = remote_index_path(tenant_id, timeline_id, Generation::none());
|
||||
let indices = backoff::retry(
|
||||
|| async { storage.list_files(Some(&index_prefix)).await },
|
||||
|_| false,
|
||||
FAILED_DOWNLOAD_WARN_THRESHOLD,
|
||||
FAILED_REMOTE_OP_RETRIES,
|
||||
"listing index_part files",
|
||||
// TODO: use a cancellation token (https://github.com/neondatabase/neon/issues/5066)
|
||||
backoff::Cancel::new(CancellationToken::new(), || -> anyhow::Error {
|
||||
unreachable!()
|
||||
}),
|
||||
)
|
||||
.await
|
||||
.map_err(|e| DownloadError::Other(e))?;
|
||||
|
||||
let mut generations: Vec<_> = indices
|
||||
.into_iter()
|
||||
.filter_map(|k| parse_generation(k))
|
||||
.filter(|g| g <= &my_generation)
|
||||
.collect();
|
||||
|
||||
generations.sort();
|
||||
match generations.last() {
|
||||
Some(g) => {
|
||||
tracing::debug!("Found index_part in generation {g} (my generation {my_generation})");
|
||||
do_download_index_part(&local_path, storage, tenant_id, timeline_id, *g).await
|
||||
}
|
||||
None => {
|
||||
// This is not an error: the timeline may be newly created, or we may be
|
||||
// upgrading and have no historical index_part with a generation suffix.
|
||||
// Fall back to trying to load the un-suffixed index_part.json.
|
||||
tracing::info!(
|
||||
"No index_part.json-* found when loading {}/{} in generation {}",
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
my_generation
|
||||
);
|
||||
return do_download_index_part(
|
||||
&local_path,
|
||||
storage,
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
Generation::none(),
|
||||
let mut index_part_bytes = Vec::new();
|
||||
tokio::io::copy(
|
||||
&mut index_part_download.download_stream,
|
||||
&mut index_part_bytes,
|
||||
)
|
||||
.await;
|
||||
}
|
||||
}
|
||||
.await
|
||||
.with_context(|| {
|
||||
format!("Failed to download an index part into file {index_part_path:?}")
|
||||
})
|
||||
.map_err(DownloadError::Other)?;
|
||||
Ok(index_part_bytes)
|
||||
},
|
||||
&format!("download {part_storage_path:?}"),
|
||||
)
|
||||
.await?;
|
||||
|
||||
let index_part: IndexPart = serde_json::from_slice(&index_part_bytes)
|
||||
.with_context(|| {
|
||||
format!("Failed to deserialize index part file into file {index_part_path:?}")
|
||||
})
|
||||
.map_err(DownloadError::Other)?;
|
||||
|
||||
Ok(index_part)
|
||||
}
|
||||
|
||||
/// Helper function to handle retries for a download operation.
|
||||
|
||||
@@ -12,7 +12,6 @@ use utils::bin_ser::SerializeError;
|
||||
use crate::tenant::metadata::TimelineMetadata;
|
||||
use crate::tenant::storage_layer::LayerFileName;
|
||||
use crate::tenant::upload_queue::UploadQueueInitialized;
|
||||
use crate::tenant::Generation;
|
||||
|
||||
use utils::lsn::Lsn;
|
||||
|
||||
@@ -21,28 +20,22 @@ use utils::lsn::Lsn;
|
||||
/// Fields have to be `Option`s because remote [`IndexPart`]'s can be from different version, which
|
||||
/// might have less or more metadata depending if upgrading or rolling back an upgrade.
|
||||
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||
//#[cfg_attr(test, derive(Default))]
|
||||
#[cfg_attr(test, derive(Default))]
|
||||
pub struct LayerFileMetadata {
|
||||
file_size: u64,
|
||||
|
||||
pub(crate) generation: Generation,
|
||||
}
|
||||
|
||||
impl From<&'_ IndexLayerMetadata> for LayerFileMetadata {
|
||||
fn from(other: &IndexLayerMetadata) -> Self {
|
||||
LayerFileMetadata {
|
||||
file_size: other.file_size,
|
||||
generation: other.generation,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl LayerFileMetadata {
|
||||
pub fn new(file_size: u64, generation: Generation) -> Self {
|
||||
LayerFileMetadata {
|
||||
file_size,
|
||||
generation,
|
||||
}
|
||||
pub fn new(file_size: u64) -> Self {
|
||||
LayerFileMetadata { file_size }
|
||||
}
|
||||
|
||||
pub fn file_size(&self) -> u64 {
|
||||
@@ -142,20 +135,15 @@ impl TryFrom<&UploadQueueInitialized> for IndexPart {
|
||||
}
|
||||
|
||||
/// Serialized form of [`LayerFileMetadata`].
|
||||
#[derive(Debug, PartialEq, Eq, Clone, Serialize, Deserialize)]
|
||||
#[derive(Debug, PartialEq, Eq, Clone, Serialize, Deserialize, Default)]
|
||||
pub struct IndexLayerMetadata {
|
||||
pub(super) file_size: u64,
|
||||
|
||||
#[serde(default = "Generation::none")]
|
||||
#[serde(skip_serializing_if = "Generation::is_none")]
|
||||
pub(super) generation: Generation,
|
||||
}
|
||||
|
||||
impl From<&'_ LayerFileMetadata> for IndexLayerMetadata {
|
||||
fn from(other: &'_ LayerFileMetadata) -> Self {
|
||||
IndexLayerMetadata {
|
||||
file_size: other.file_size,
|
||||
generation: other.generation,
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -184,13 +172,11 @@ mod tests {
|
||||
layer_metadata: HashMap::from([
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000001696070-00000000016960E9".parse().unwrap(), IndexLayerMetadata {
|
||||
file_size: 25600000,
|
||||
generation: Generation::none()
|
||||
}),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap(), IndexLayerMetadata {
|
||||
// serde_json should always parse this but this might be a double with jq for
|
||||
// example.
|
||||
file_size: 9007199254741001,
|
||||
generation: Generation::none()
|
||||
})
|
||||
]),
|
||||
disk_consistent_lsn: "0/16960E8".parse::<Lsn>().unwrap(),
|
||||
@@ -223,13 +209,11 @@ mod tests {
|
||||
layer_metadata: HashMap::from([
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000001696070-00000000016960E9".parse().unwrap(), IndexLayerMetadata {
|
||||
file_size: 25600000,
|
||||
generation: Generation::none()
|
||||
}),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap(), IndexLayerMetadata {
|
||||
// serde_json should always parse this but this might be a double with jq for
|
||||
// example.
|
||||
file_size: 9007199254741001,
|
||||
generation: Generation::none()
|
||||
})
|
||||
]),
|
||||
disk_consistent_lsn: "0/16960E8".parse::<Lsn>().unwrap(),
|
||||
@@ -263,13 +247,11 @@ mod tests {
|
||||
layer_metadata: HashMap::from([
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__0000000001696070-00000000016960E9".parse().unwrap(), IndexLayerMetadata {
|
||||
file_size: 25600000,
|
||||
generation: Generation::none()
|
||||
}),
|
||||
("000000000000000000000000000000000000-FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF__00000000016B59D8-00000000016B5A51".parse().unwrap(), IndexLayerMetadata {
|
||||
// serde_json should always parse this but this might be a double with jq for
|
||||
// example.
|
||||
file_size: 9007199254741001,
|
||||
generation: Generation::none()
|
||||
})
|
||||
]),
|
||||
disk_consistent_lsn: "0/16960E8".parse::<Lsn>().unwrap(),
|
||||
|
||||
@@ -5,11 +5,7 @@ use fail::fail_point;
|
||||
use std::{io::ErrorKind, path::Path};
|
||||
use tokio::fs;
|
||||
|
||||
use super::Generation;
|
||||
use crate::{
|
||||
config::PageServerConf,
|
||||
tenant::remote_timeline_client::{index::IndexPart, remote_index_path, remote_path},
|
||||
};
|
||||
use crate::{config::PageServerConf, tenant::remote_timeline_client::index::IndexPart};
|
||||
use remote_storage::GenericRemoteStorage;
|
||||
use utils::id::{TenantId, TimelineId};
|
||||
|
||||
@@ -19,10 +15,10 @@ use tracing::info;
|
||||
|
||||
/// Serializes and uploads the given index part data to the remote storage.
|
||||
pub(super) async fn upload_index_part<'a>(
|
||||
conf: &'static PageServerConf,
|
||||
storage: &'a GenericRemoteStorage,
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
generation: Generation,
|
||||
index_part: &'a IndexPart,
|
||||
) -> anyhow::Result<()> {
|
||||
tracing::trace!("uploading new index part");
|
||||
@@ -36,9 +32,13 @@ pub(super) async fn upload_index_part<'a>(
|
||||
let index_part_size = index_part_bytes.len();
|
||||
let index_part_bytes = tokio::io::BufReader::new(std::io::Cursor::new(index_part_bytes));
|
||||
|
||||
let remote_path = remote_index_path(tenant_id, timeline_id, generation);
|
||||
let index_part_path = conf
|
||||
.metadata_path(tenant_id, timeline_id)
|
||||
.with_file_name(IndexPart::FILE_NAME);
|
||||
let storage_path = conf.remote_path(&index_part_path)?;
|
||||
|
||||
storage
|
||||
.upload_storage_object(Box::new(index_part_bytes), index_part_size, &remote_path)
|
||||
.upload_storage_object(Box::new(index_part_bytes), index_part_size, &storage_path)
|
||||
.await
|
||||
.with_context(|| format!("Failed to upload index part for '{tenant_id} / {timeline_id}'"))
|
||||
}
|
||||
@@ -52,13 +52,12 @@ pub(super) async fn upload_timeline_layer<'a>(
|
||||
storage: &'a GenericRemoteStorage,
|
||||
source_path: &'a Path,
|
||||
known_metadata: &'a LayerFileMetadata,
|
||||
generation: Generation,
|
||||
) -> anyhow::Result<()> {
|
||||
fail_point!("before-upload-layer", |_| {
|
||||
bail!("failpoint before-upload-layer")
|
||||
});
|
||||
let storage_path = conf.remote_path(source_path)?;
|
||||
|
||||
let storage_path = remote_path(conf, source_path, Some(generation))?;
|
||||
let source_file_res = fs::File::open(&source_path).await;
|
||||
let source_file = match source_file_res {
|
||||
Ok(source_file) => source_file,
|
||||
@@ -68,6 +67,8 @@ pub(super) async fn upload_timeline_layer<'a>(
|
||||
// upload. However, a nonexistent file can also be indicative of
|
||||
// something worse, like when a file is scheduled for upload before
|
||||
// it has been written to disk yet.
|
||||
//
|
||||
// This is tested against `test_compaction_delete_before_upload`
|
||||
info!(path = %source_path.display(), "File to upload doesn't exist. Likely the file has been deleted and an upload is not required any more.");
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
@@ -4,26 +4,21 @@ pub mod delta_layer;
|
||||
mod filename;
|
||||
mod image_layer;
|
||||
mod inmemory_layer;
|
||||
mod layer;
|
||||
mod layer_desc;
|
||||
mod remote_layer;
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::context::{AccessStatsBehavior, RequestContext};
|
||||
use crate::repository::Key;
|
||||
use crate::task_mgr::TaskKind;
|
||||
use crate::walrecord::NeonWalRecord;
|
||||
use anyhow::Result;
|
||||
use bytes::Bytes;
|
||||
use enum_map::EnumMap;
|
||||
use enumset::EnumSet;
|
||||
use once_cell::sync::Lazy;
|
||||
use pageserver_api::models::LayerAccessKind;
|
||||
use pageserver_api::models::{
|
||||
HistoricLayerInfo, LayerResidenceEvent, LayerResidenceEventReason, LayerResidenceStatus,
|
||||
LayerAccessKind, LayerResidenceEvent, LayerResidenceEventReason, LayerResidenceStatus,
|
||||
};
|
||||
use std::ops::Range;
|
||||
use std::path::PathBuf;
|
||||
use std::sync::{Arc, Mutex};
|
||||
use std::sync::Mutex;
|
||||
use std::time::{Duration, SystemTime, UNIX_EPOCH};
|
||||
use tracing::warn;
|
||||
use utils::history_buffer::HistoryBufferWithDropCounter;
|
||||
@@ -39,7 +34,8 @@ pub use filename::{DeltaFileName, ImageFileName, LayerFileName};
|
||||
pub use image_layer::{ImageLayer, ImageLayerWriter};
|
||||
pub use inmemory_layer::InMemoryLayer;
|
||||
pub use layer_desc::{PersistentLayerDesc, PersistentLayerKey};
|
||||
pub use remote_layer::RemoteLayer;
|
||||
|
||||
pub(crate) use layer::{EvictionError, Layer, ResidentLayer};
|
||||
|
||||
pub fn range_overlaps<T>(a: &Range<T>, b: &Range<T>) -> bool
|
||||
where
|
||||
@@ -74,7 +70,7 @@ pub struct ValueReconstructState {
|
||||
pub img: Option<(Lsn, Bytes)>,
|
||||
}
|
||||
|
||||
/// Return value from Layer::get_page_reconstruct_data
|
||||
/// Return value from [`Layer::get_value_reconstruct_data`]
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
pub enum ValueReconstructResult {
|
||||
/// Got all the data needed to reconstruct the requested page
|
||||
@@ -179,26 +175,6 @@ impl LayerAccessStats {
|
||||
new
|
||||
}
|
||||
|
||||
/// Creates a clone of `self` and records `new_status` in the clone.
|
||||
///
|
||||
/// The `new_status` is not recorded in `self`.
|
||||
///
|
||||
/// See [`record_residence_event`] for why you need to do this while holding the layer map lock.
|
||||
///
|
||||
/// [`record_residence_event`]: Self::record_residence_event
|
||||
pub(crate) fn clone_for_residence_change(
|
||||
&self,
|
||||
new_status: LayerResidenceStatus,
|
||||
) -> LayerAccessStats {
|
||||
let clone = {
|
||||
let inner = self.0.lock().unwrap();
|
||||
inner.clone()
|
||||
};
|
||||
let new = LayerAccessStats(Mutex::new(clone));
|
||||
new.record_residence_event(new_status, LayerResidenceEventReason::ResidenceChange);
|
||||
new
|
||||
}
|
||||
|
||||
/// Record a change in layer residency.
|
||||
///
|
||||
/// Recording the event must happen while holding the layer map lock to
|
||||
@@ -321,95 +297,12 @@ impl LayerAccessStats {
|
||||
}
|
||||
}
|
||||
|
||||
/// Supertrait of the [`Layer`] trait that captures the bare minimum interface
|
||||
/// required by [`LayerMap`](super::layer_map::LayerMap).
|
||||
///
|
||||
/// All layers should implement a minimal `std::fmt::Debug` without tenant or
|
||||
/// timeline names, because those are known in the context of which the layers
|
||||
/// are used in (timeline).
|
||||
#[async_trait::async_trait]
|
||||
pub trait Layer: std::fmt::Debug + std::fmt::Display + Send + Sync + 'static {
|
||||
///
|
||||
/// Return data needed to reconstruct given page at LSN.
|
||||
///
|
||||
/// It is up to the caller to collect more data from previous layer and
|
||||
/// perform WAL redo, if necessary.
|
||||
///
|
||||
/// See PageReconstructResult for possible return values. The collected data
|
||||
/// is appended to reconstruct_data; the caller should pass an empty struct
|
||||
/// on first call, or a struct with a cached older image of the page if one
|
||||
/// is available. If this returns ValueReconstructResult::Continue, look up
|
||||
/// the predecessor layer and call again with the same 'reconstruct_data' to
|
||||
/// collect more data.
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_data: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<ValueReconstructResult>;
|
||||
}
|
||||
|
||||
/// Get a layer descriptor from a layer.
|
||||
pub trait AsLayerDesc {
|
||||
/// Get the layer descriptor.
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc;
|
||||
}
|
||||
|
||||
/// A Layer contains all data in a "rectangle" consisting of a range of keys and
|
||||
/// range of LSNs.
|
||||
///
|
||||
/// There are two kinds of layers, in-memory and on-disk layers. In-memory
|
||||
/// layers are used to ingest incoming WAL, and provide fast access to the
|
||||
/// recent page versions. On-disk layers are stored as files on disk, and are
|
||||
/// immutable. This trait presents the common functionality of in-memory and
|
||||
/// on-disk layers.
|
||||
///
|
||||
/// Furthermore, there are two kinds of on-disk layers: delta and image layers.
|
||||
/// A delta layer contains all modifications within a range of LSNs and keys.
|
||||
/// An image layer is a snapshot of all the data in a key-range, at a single
|
||||
/// LSN.
|
||||
pub trait PersistentLayer: Layer + AsLayerDesc {
|
||||
/// File name used for this layer, both in the pageserver's local filesystem
|
||||
/// state as well as in the remote storage.
|
||||
fn filename(&self) -> LayerFileName {
|
||||
self.layer_desc().filename()
|
||||
}
|
||||
|
||||
// Path to the layer file in the local filesystem.
|
||||
// `None` for `RemoteLayer`.
|
||||
fn local_path(&self) -> Option<PathBuf>;
|
||||
|
||||
/// Permanently remove this layer from disk.
|
||||
fn delete_resident_layer_file(&self) -> Result<()>;
|
||||
|
||||
fn downcast_remote_layer(self: Arc<Self>) -> Option<std::sync::Arc<RemoteLayer>> {
|
||||
None
|
||||
}
|
||||
|
||||
fn downcast_delta_layer(self: Arc<Self>) -> Option<std::sync::Arc<DeltaLayer>> {
|
||||
None
|
||||
}
|
||||
|
||||
fn is_remote_layer(&self) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo;
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats;
|
||||
}
|
||||
|
||||
pub fn downcast_remote_layer(
|
||||
layer: &Arc<dyn PersistentLayer>,
|
||||
) -> Option<std::sync::Arc<RemoteLayer>> {
|
||||
if layer.is_remote_layer() {
|
||||
Arc::clone(layer).downcast_remote_layer()
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
pub mod tests {
|
||||
use super::*;
|
||||
|
||||
@@ -447,19 +340,6 @@ pub mod tests {
|
||||
}
|
||||
}
|
||||
|
||||
/// Helper enum to hold a PageServerConf, or a path
|
||||
///
|
||||
/// This is used by DeltaLayer and ImageLayer. Normally, this holds a reference to the
|
||||
/// global config, and paths to layer files are constructed using the tenant/timeline
|
||||
/// path from the config. But in the 'pagectl' binary, we need to construct a Layer
|
||||
/// struct for a file on disk, without having a page server running, so that we have no
|
||||
/// config. In that case, we use the Path variant to hold the full path to the file on
|
||||
/// disk.
|
||||
enum PathOrConf {
|
||||
Path(PathBuf),
|
||||
Conf(&'static PageServerConf),
|
||||
}
|
||||
|
||||
/// Range wrapping newtype, which uses display to render Debug.
|
||||
///
|
||||
/// Useful with `Key`, which has too verbose `{:?}` for printing multiple layers.
|
||||
|
||||
@@ -34,17 +34,16 @@ use crate::repository::{Key, Value, KEY_SIZE};
|
||||
use crate::tenant::blob_io::{BlobWriter, WriteBlobWriter};
|
||||
use crate::tenant::block_io::{BlockBuf, BlockCursor, BlockLease, BlockReader, FileBlockReader};
|
||||
use crate::tenant::disk_btree::{DiskBtreeBuilder, DiskBtreeReader, VisitDirection};
|
||||
use crate::tenant::storage_layer::{
|
||||
PersistentLayer, ValueReconstructResult, ValueReconstructState,
|
||||
};
|
||||
use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState};
|
||||
use crate::tenant::Timeline;
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use crate::{walrecord, TEMP_FILE_SUFFIX};
|
||||
use crate::{DELTA_FILE_MAGIC, STORAGE_FORMAT_VERSION};
|
||||
use anyhow::{bail, ensure, Context, Result};
|
||||
use pageserver_api::models::{HistoricLayerInfo, LayerAccessKind};
|
||||
use pageserver_api::models::LayerAccessKind;
|
||||
use rand::{distributions::Alphanumeric, Rng};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::fs::{self, File};
|
||||
use std::fs::File;
|
||||
use std::io::{BufWriter, Write};
|
||||
use std::io::{Seek, SeekFrom};
|
||||
use std::ops::Range;
|
||||
@@ -60,10 +59,7 @@ use utils::{
|
||||
lsn::Lsn,
|
||||
};
|
||||
|
||||
use super::{
|
||||
AsLayerDesc, DeltaFileName, Layer, LayerAccessStats, LayerAccessStatsReset, PathOrConf,
|
||||
PersistentLayerDesc,
|
||||
};
|
||||
use super::{AsLayerDesc, LayerAccessStats, PersistentLayerDesc, ResidentLayer};
|
||||
|
||||
///
|
||||
/// Header stored in the beginning of the file
|
||||
@@ -183,20 +179,12 @@ impl DeltaKey {
|
||||
}
|
||||
}
|
||||
|
||||
/// DeltaLayer is the in-memory data structure associated with an on-disk delta
|
||||
/// file.
|
||||
///
|
||||
/// We keep a DeltaLayer in memory for each file, in the LayerMap. If a layer
|
||||
/// is in "loaded" state, we have a copy of the index in memory, in 'inner'.
|
||||
/// Otherwise the struct is just a placeholder for a file that exists on disk,
|
||||
/// and it needs to be loaded before using it in queries.
|
||||
/// This is used only from `pagectl`. Within pageserver, all layers are
|
||||
/// [`crate::tenant::storage_layer::Layer`], which can hold a [`DeltaLayerInner`].
|
||||
pub struct DeltaLayer {
|
||||
path_or_conf: PathOrConf,
|
||||
|
||||
path: PathBuf,
|
||||
pub desc: PersistentLayerDesc,
|
||||
|
||||
access_stats: LayerAccessStats,
|
||||
|
||||
inner: OnceCell<Arc<DeltaLayerInner>>,
|
||||
}
|
||||
|
||||
@@ -213,6 +201,8 @@ impl std::fmt::Debug for DeltaLayer {
|
||||
}
|
||||
}
|
||||
|
||||
/// `DeltaLayerInner` is the in-memory data structure associated with an on-disk delta
|
||||
/// file.
|
||||
pub struct DeltaLayerInner {
|
||||
// values copied from summary
|
||||
index_start_blk: u32,
|
||||
@@ -222,12 +212,6 @@ pub struct DeltaLayerInner {
|
||||
file: FileBlockReader<VirtualFile>,
|
||||
}
|
||||
|
||||
impl AsRef<DeltaLayerInner> for DeltaLayerInner {
|
||||
fn as_ref(&self) -> &DeltaLayerInner {
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
impl std::fmt::Debug for DeltaLayerInner {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.debug_struct("DeltaLayerInner")
|
||||
@@ -237,19 +221,6 @@ impl std::fmt::Debug for DeltaLayerInner {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for DeltaLayer {
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
self.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
|
||||
.await
|
||||
}
|
||||
}
|
||||
/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
|
||||
impl std::fmt::Display for DeltaLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
@@ -263,40 +234,9 @@ impl AsLayerDesc for DeltaLayer {
|
||||
}
|
||||
}
|
||||
|
||||
impl PersistentLayer for DeltaLayer {
|
||||
fn downcast_delta_layer(self: Arc<Self>) -> Option<std::sync::Arc<DeltaLayer>> {
|
||||
Some(self)
|
||||
}
|
||||
|
||||
fn local_path(&self) -> Option<PathBuf> {
|
||||
self.local_path()
|
||||
}
|
||||
|
||||
fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
self.delete_resident_layer_file()
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
self.info(reset)
|
||||
}
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats {
|
||||
self.access_stats()
|
||||
}
|
||||
}
|
||||
|
||||
impl DeltaLayer {
|
||||
pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
|
||||
println!(
|
||||
"----- delta layer for ten {} tli {} keys {}-{} lsn {}-{} size {} ----",
|
||||
self.desc.tenant_id,
|
||||
self.desc.timeline_id,
|
||||
self.desc.key_range.start,
|
||||
self.desc.key_range.end,
|
||||
self.desc.lsn_range.start,
|
||||
self.desc.lsn_range.end,
|
||||
self.desc.file_size,
|
||||
);
|
||||
self.desc.dump();
|
||||
|
||||
if !verbose {
|
||||
return Ok(());
|
||||
@@ -304,119 +244,7 @@ impl DeltaLayer {
|
||||
|
||||
let inner = self.load(LayerAccessKind::Dump, ctx).await?;
|
||||
|
||||
println!(
|
||||
"index_start_blk: {}, root {}",
|
||||
inner.index_start_blk, inner.index_root_blk
|
||||
);
|
||||
|
||||
let file = &inner.file;
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
inner.index_start_blk,
|
||||
inner.index_root_blk,
|
||||
file,
|
||||
);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
let keys = DeltaLayerInner::load_keys(&inner).await?;
|
||||
|
||||
// A subroutine to dump a single blob
|
||||
async fn dump_blob(val: ValueRef<'_>) -> Result<String> {
|
||||
let buf = val.reader.read_blob(val.blob_ref.pos()).await?;
|
||||
let val = Value::des(&buf)?;
|
||||
let desc = match val {
|
||||
Value::Image(img) => {
|
||||
format!(" img {} bytes", img.len())
|
||||
}
|
||||
Value::WalRecord(rec) => {
|
||||
let wal_desc = walrecord::describe_wal_record(&rec)?;
|
||||
format!(
|
||||
" rec {} bytes will_init: {} {}",
|
||||
buf.len(),
|
||||
rec.will_init(),
|
||||
wal_desc
|
||||
)
|
||||
}
|
||||
};
|
||||
Ok(desc)
|
||||
}
|
||||
|
||||
for entry in keys {
|
||||
let DeltaEntry { key, lsn, val, .. } = entry;
|
||||
let desc = match dump_blob(val).await {
|
||||
Ok(desc) => desc,
|
||||
Err(err) => {
|
||||
let err: anyhow::Error = err;
|
||||
format!("ERROR: {err}")
|
||||
}
|
||||
};
|
||||
println!(" key {key} at {lsn}: {desc}");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
ensure!(lsn_range.start >= self.desc.lsn_range.start);
|
||||
|
||||
ensure!(self.desc.key_range.contains(&key));
|
||||
|
||||
let inner = self
|
||||
.load(LayerAccessKind::GetValueReconstructData, ctx)
|
||||
.await?;
|
||||
inner
|
||||
.get_value_reconstruct_data(key, lsn_range, reconstruct_state)
|
||||
.await
|
||||
}
|
||||
|
||||
pub(crate) fn local_path(&self) -> Option<PathBuf> {
|
||||
Some(self.path())
|
||||
}
|
||||
|
||||
pub(crate) fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
// delete underlying file
|
||||
fs::remove_file(self.path())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
let layer_file_name = self.layer_desc().filename().file_name();
|
||||
let lsn_range = self.layer_desc().lsn_range.clone();
|
||||
|
||||
let access_stats = self.access_stats.as_api_model(reset);
|
||||
|
||||
HistoricLayerInfo::Delta {
|
||||
layer_file_name,
|
||||
layer_file_size: self.desc.file_size,
|
||||
lsn_start: lsn_range.start,
|
||||
lsn_end: lsn_range.end,
|
||||
remote: false,
|
||||
access_stats,
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn access_stats(&self) -> &LayerAccessStats {
|
||||
&self.access_stats
|
||||
}
|
||||
|
||||
fn path_for(
|
||||
path_or_conf: &PathOrConf,
|
||||
tenant_id: &TenantId,
|
||||
timeline_id: &TimelineId,
|
||||
fname: &DeltaFileName,
|
||||
) -> PathBuf {
|
||||
match path_or_conf {
|
||||
PathOrConf::Path(path) => path.clone(),
|
||||
PathOrConf::Conf(conf) => conf
|
||||
.timeline_path(tenant_id, timeline_id)
|
||||
.join(fname.to_string()),
|
||||
}
|
||||
inner.dump().await
|
||||
}
|
||||
|
||||
fn temp_path_for(
|
||||
@@ -462,52 +290,22 @@ impl DeltaLayer {
|
||||
async fn load_inner(&self) -> Result<Arc<DeltaLayerInner>> {
|
||||
let path = self.path();
|
||||
|
||||
let summary = match &self.path_or_conf {
|
||||
PathOrConf::Conf(_) => Some(Summary::from(self)),
|
||||
PathOrConf::Path(_) => None,
|
||||
};
|
||||
let loaded = DeltaLayerInner::load(&path, None)?;
|
||||
|
||||
let loaded = DeltaLayerInner::load(&path, summary).await?;
|
||||
// not production code
|
||||
|
||||
if let PathOrConf::Path(ref path) = self.path_or_conf {
|
||||
// not production code
|
||||
let actual_filename = self.path.file_name().unwrap().to_str().unwrap().to_owned();
|
||||
let expected_filename = self.layer_desc().filename().file_name();
|
||||
|
||||
let actual_filename = path.file_name().unwrap().to_str().unwrap().to_owned();
|
||||
let expected_filename = self.filename().file_name();
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
|
||||
Ok(Arc::new(loaded))
|
||||
}
|
||||
|
||||
/// Create a DeltaLayer struct representing an existing file on disk.
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
tenant_id: TenantId,
|
||||
filename: &DeltaFileName,
|
||||
file_size: u64,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> DeltaLayer {
|
||||
DeltaLayer {
|
||||
path_or_conf: PathOrConf::Conf(conf),
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
filename.key_range.clone(),
|
||||
filename.lsn_range.clone(),
|
||||
file_size,
|
||||
),
|
||||
access_stats,
|
||||
inner: OnceCell::new(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create a DeltaLayer struct representing an existing file on disk.
|
||||
///
|
||||
/// This variant is only used for debugging purposes, by the 'pagectl' binary.
|
||||
@@ -522,7 +320,7 @@ impl DeltaLayer {
|
||||
.context("get file metadata to determine size")?;
|
||||
|
||||
Ok(DeltaLayer {
|
||||
path_or_conf: PathOrConf::Path(path.to_path_buf()),
|
||||
path: path.to_path_buf(),
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
summary.tenant_id,
|
||||
summary.timeline_id,
|
||||
@@ -535,29 +333,9 @@ impl DeltaLayer {
|
||||
})
|
||||
}
|
||||
|
||||
fn layer_name(&self) -> DeltaFileName {
|
||||
self.desc.delta_file_name()
|
||||
}
|
||||
/// Path to the layer file in pageserver workdir.
|
||||
pub fn path(&self) -> PathBuf {
|
||||
Self::path_for(
|
||||
&self.path_or_conf,
|
||||
&self.desc.tenant_id,
|
||||
&self.desc.timeline_id,
|
||||
&self.layer_name(),
|
||||
)
|
||||
}
|
||||
/// Loads all keys stored in the layer. Returns key, lsn, value size and value reference.
|
||||
///
|
||||
/// The value can be obtained via the [`ValueRef::load`] function.
|
||||
pub(crate) async fn load_keys(&self, ctx: &RequestContext) -> Result<Vec<DeltaEntry<'_>>> {
|
||||
let inner = self
|
||||
.load(LayerAccessKind::KeyIter, ctx)
|
||||
.await
|
||||
.context("load delta layer keys")?;
|
||||
DeltaLayerInner::load_keys(inner)
|
||||
.await
|
||||
.context("Layer index is corrupted")
|
||||
/// Path to the layer file
|
||||
fn path(&self) -> PathBuf {
|
||||
self.path.clone()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -662,7 +440,7 @@ impl DeltaLayerWriterInner {
|
||||
///
|
||||
/// Finish writing the delta layer.
|
||||
///
|
||||
fn finish(self, key_end: Key) -> anyhow::Result<DeltaLayer> {
|
||||
fn finish(self, key_end: Key, timeline: &Arc<Timeline>) -> anyhow::Result<ResidentLayer> {
|
||||
let index_start_blk =
|
||||
((self.blob_writer.size() + PAGE_SZ as u64 - 1) / PAGE_SZ as u64) as u32;
|
||||
|
||||
@@ -708,37 +486,21 @@ impl DeltaLayerWriterInner {
|
||||
// Note: Because we opened the file in write-only mode, we cannot
|
||||
// reuse the same VirtualFile for reading later. That's why we don't
|
||||
// set inner.file here. The first read will have to re-open it.
|
||||
let layer = DeltaLayer {
|
||||
path_or_conf: PathOrConf::Conf(self.conf),
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_start..key_end,
|
||||
self.lsn_range.clone(),
|
||||
metadata.len(),
|
||||
),
|
||||
access_stats: LayerAccessStats::empty_will_record_residence_event_later(),
|
||||
inner: OnceCell::new(),
|
||||
};
|
||||
|
||||
let desc = PersistentLayerDesc::new_delta(
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_start..key_end,
|
||||
self.lsn_range.clone(),
|
||||
metadata.len(),
|
||||
);
|
||||
|
||||
// fsync the file
|
||||
file.sync_all()?;
|
||||
// Rename the file to its final name
|
||||
//
|
||||
// Note: This overwrites any existing file. There shouldn't be any.
|
||||
// FIXME: throw an error instead?
|
||||
let final_path = DeltaLayer::path_for(
|
||||
&PathOrConf::Conf(self.conf),
|
||||
&self.tenant_id,
|
||||
&self.timeline_id,
|
||||
&DeltaFileName {
|
||||
key_range: self.key_start..key_end,
|
||||
lsn_range: self.lsn_range,
|
||||
},
|
||||
);
|
||||
std::fs::rename(self.path, &final_path)?;
|
||||
|
||||
trace!("created delta layer {}", final_path.display());
|
||||
let layer = Layer::finish_creating(self.conf, timeline, desc, &self.path)?;
|
||||
|
||||
trace!("created delta layer {}", layer.local_path().display());
|
||||
|
||||
Ok(layer)
|
||||
}
|
||||
@@ -821,8 +583,12 @@ impl DeltaLayerWriter {
|
||||
///
|
||||
/// Finish writing the delta layer.
|
||||
///
|
||||
pub fn finish(mut self, key_end: Key) -> anyhow::Result<DeltaLayer> {
|
||||
self.inner.take().unwrap().finish(key_end)
|
||||
pub(crate) fn finish(
|
||||
mut self,
|
||||
key_end: Key,
|
||||
timeline: &Arc<Timeline>,
|
||||
) -> anyhow::Result<ResidentLayer> {
|
||||
self.inner.take().unwrap().finish(key_end, timeline)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -841,15 +607,12 @@ impl Drop for DeltaLayerWriter {
|
||||
}
|
||||
|
||||
impl DeltaLayerInner {
|
||||
pub(super) async fn load(
|
||||
path: &std::path::Path,
|
||||
summary: Option<Summary>,
|
||||
) -> anyhow::Result<Self> {
|
||||
pub(super) fn load(path: &std::path::Path, summary: Option<Summary>) -> anyhow::Result<Self> {
|
||||
let file = VirtualFile::open(path)
|
||||
.with_context(|| format!("Failed to open file '{}'", path.display()))?;
|
||||
let file = FileBlockReader::new(file);
|
||||
|
||||
let summary_blk = file.read_blk(0).await?;
|
||||
let summary_blk = file.read_blk(0)?;
|
||||
let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
|
||||
|
||||
if let Some(mut expected_summary) = summary {
|
||||
@@ -952,14 +715,14 @@ impl DeltaLayerInner {
|
||||
}
|
||||
}
|
||||
|
||||
pub(super) async fn load_keys<T: AsRef<DeltaLayerInner> + Clone>(
|
||||
this: &T,
|
||||
) -> Result<Vec<DeltaEntry<'_>>> {
|
||||
let dl = this.as_ref();
|
||||
let file = &dl.file;
|
||||
pub(super) async fn load_keys(&self) -> Result<Vec<DeltaEntry<'_>>> {
|
||||
let file = &self.file;
|
||||
|
||||
let tree_reader =
|
||||
DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(dl.index_start_blk, dl.index_root_blk, file);
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
self.index_start_blk,
|
||||
self.index_root_blk,
|
||||
file,
|
||||
);
|
||||
|
||||
let mut all_keys: Vec<DeltaEntry<'_>> = Vec::new();
|
||||
|
||||
@@ -972,7 +735,7 @@ impl DeltaLayerInner {
|
||||
let val_ref = ValueRef {
|
||||
blob_ref: BlobRef(value),
|
||||
reader: BlockCursor::new(crate::tenant::block_io::BlockReaderRef::Adapter(
|
||||
Adapter(dl),
|
||||
Adapter(self),
|
||||
)),
|
||||
};
|
||||
let pos = BlobRef(value).pos();
|
||||
@@ -996,10 +759,61 @@ impl DeltaLayerInner {
|
||||
if let Some(last) = all_keys.last_mut() {
|
||||
// Last key occupies all space till end of value storage,
|
||||
// which corresponds to beginning of the index
|
||||
last.size = dl.index_start_blk as u64 * PAGE_SZ as u64 - last.size;
|
||||
last.size = self.index_start_blk as u64 * PAGE_SZ as u64 - last.size;
|
||||
}
|
||||
Ok(all_keys)
|
||||
}
|
||||
|
||||
pub(super) async fn dump(&self) -> anyhow::Result<()> {
|
||||
println!(
|
||||
"index_start_blk: {}, root {}",
|
||||
self.index_start_blk, self.index_root_blk
|
||||
);
|
||||
|
||||
let file = &self.file;
|
||||
let tree_reader = DiskBtreeReader::<_, DELTA_KEY_SIZE>::new(
|
||||
self.index_start_blk,
|
||||
self.index_root_blk,
|
||||
file,
|
||||
);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
let keys = self.load_keys().await?;
|
||||
|
||||
async fn dump_blob(val: ValueRef<'_>) -> anyhow::Result<String> {
|
||||
let buf = val.reader.read_blob(val.blob_ref.pos()).await?;
|
||||
let val = Value::des(&buf)?;
|
||||
let desc = match val {
|
||||
Value::Image(img) => {
|
||||
format!(" img {} bytes", img.len())
|
||||
}
|
||||
Value::WalRecord(rec) => {
|
||||
let wal_desc = walrecord::describe_wal_record(&rec)?;
|
||||
format!(
|
||||
" rec {} bytes will_init: {} {}",
|
||||
buf.len(),
|
||||
rec.will_init(),
|
||||
wal_desc
|
||||
)
|
||||
}
|
||||
};
|
||||
Ok(desc)
|
||||
}
|
||||
|
||||
for entry in keys {
|
||||
let DeltaEntry { key, lsn, val, .. } = entry;
|
||||
let desc = match dump_blob(val).await {
|
||||
Ok(desc) => desc,
|
||||
Err(err) => {
|
||||
format!("ERROR: {err}")
|
||||
}
|
||||
};
|
||||
println!(" key {key} at {lsn}: {desc}");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// A set of data associated with a delta layer key and its value
|
||||
@@ -1031,7 +845,13 @@ impl<'a> ValueRef<'a> {
|
||||
pub(crate) struct Adapter<T>(T);
|
||||
|
||||
impl<T: AsRef<DeltaLayerInner>> Adapter<T> {
|
||||
pub(crate) async fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
self.0.as_ref().file.read_blk(blknum).await
|
||||
pub(crate) fn read_blk(&self, blknum: u32) -> Result<BlockLease, std::io::Error> {
|
||||
self.0.as_ref().file.read_blk(blknum)
|
||||
}
|
||||
}
|
||||
|
||||
impl AsRef<DeltaLayerInner> for DeltaLayerInner {
|
||||
fn as_ref(&self) -> &DeltaLayerInner {
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
@@ -31,22 +31,24 @@ use crate::tenant::blob_io::{BlobWriter, WriteBlobWriter};
|
||||
use crate::tenant::block_io::{BlockBuf, BlockReader, FileBlockReader};
|
||||
use crate::tenant::disk_btree::{DiskBtreeBuilder, DiskBtreeReader, VisitDirection};
|
||||
use crate::tenant::storage_layer::{
|
||||
LayerAccessStats, PersistentLayer, ValueReconstructResult, ValueReconstructState,
|
||||
LayerAccessStats, ValueReconstructResult, ValueReconstructState,
|
||||
};
|
||||
use crate::tenant::Timeline;
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use crate::{IMAGE_FILE_MAGIC, STORAGE_FORMAT_VERSION, TEMP_FILE_SUFFIX};
|
||||
use anyhow::{bail, ensure, Context, Result};
|
||||
use bytes::Bytes;
|
||||
use hex;
|
||||
use pageserver_api::models::{HistoricLayerInfo, LayerAccessKind};
|
||||
use pageserver_api::models::LayerAccessKind;
|
||||
use rand::{distributions::Alphanumeric, Rng};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::fs::{self, File};
|
||||
use std::fs::File;
|
||||
use std::io::Write;
|
||||
use std::io::{Seek, SeekFrom};
|
||||
use std::ops::Range;
|
||||
use std::os::unix::prelude::FileExt;
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::sync::Arc;
|
||||
use tokio::sync::OnceCell;
|
||||
use tracing::*;
|
||||
|
||||
@@ -57,7 +59,7 @@ use utils::{
|
||||
};
|
||||
|
||||
use super::filename::ImageFileName;
|
||||
use super::{AsLayerDesc, Layer, LayerAccessStatsReset, PathOrConf, PersistentLayerDesc};
|
||||
use super::{AsLayerDesc, Layer, PersistentLayerDesc, ResidentLayer};
|
||||
|
||||
///
|
||||
/// Header stored in the beginning of the file
|
||||
@@ -115,22 +117,14 @@ impl Summary {
|
||||
}
|
||||
}
|
||||
|
||||
/// ImageLayer is the in-memory data structure associated with an on-disk image
|
||||
/// file.
|
||||
///
|
||||
/// We keep an ImageLayer in memory for each file, in the LayerMap. If a layer
|
||||
/// is in "loaded" state, we have a copy of the index in memory, in 'inner'.
|
||||
/// Otherwise the struct is just a placeholder for a file that exists on disk,
|
||||
/// and it needs to be loaded before using it in queries.
|
||||
/// This is used only from `pagectl`. Within pageserver, all layers are
|
||||
/// [`crate::tenant::storage_layer::Layer`], which can hold an [`ImageLayerInner`].
|
||||
pub struct ImageLayer {
|
||||
path_or_conf: PathOrConf,
|
||||
|
||||
path: PathBuf,
|
||||
pub desc: PersistentLayerDesc,
|
||||
// This entry contains an image of all pages as of this LSN, should be the same as desc.lsn
|
||||
pub lsn: Lsn,
|
||||
|
||||
access_stats: LayerAccessStats,
|
||||
|
||||
inner: OnceCell<ImageLayerInner>,
|
||||
}
|
||||
|
||||
@@ -147,6 +141,8 @@ impl std::fmt::Debug for ImageLayer {
|
||||
}
|
||||
}
|
||||
|
||||
/// ImageLayer is the in-memory data structure associated with an on-disk image
|
||||
/// file.
|
||||
pub struct ImageLayerInner {
|
||||
// values copied from summary
|
||||
index_start_blk: u32,
|
||||
@@ -167,18 +163,22 @@ impl std::fmt::Debug for ImageLayerInner {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for ImageLayer {
|
||||
/// Look up given page in the file
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
self.get_value_reconstruct_data(key, lsn_range, reconstruct_state, ctx)
|
||||
.await
|
||||
impl ImageLayerInner {
|
||||
pub(super) async fn dump(&self) -> anyhow::Result<()> {
|
||||
let file = &self.file;
|
||||
let tree_reader =
|
||||
DiskBtreeReader::<_, KEY_SIZE>::new(self.index_start_blk, self.index_root_blk, file);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
tree_reader
|
||||
.visit(&[0u8; KEY_SIZE], VisitDirection::Forwards, |key, value| {
|
||||
println!("key: {} offset {}", hex::encode(key), value);
|
||||
true
|
||||
})
|
||||
.await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
@@ -195,120 +195,21 @@ impl AsLayerDesc for ImageLayer {
|
||||
}
|
||||
}
|
||||
|
||||
impl PersistentLayer for ImageLayer {
|
||||
fn local_path(&self) -> Option<PathBuf> {
|
||||
self.local_path()
|
||||
}
|
||||
|
||||
fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
self.delete_resident_layer_file()
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
self.info(reset)
|
||||
}
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats {
|
||||
self.access_stats()
|
||||
}
|
||||
}
|
||||
|
||||
impl ImageLayer {
|
||||
pub(crate) async fn dump(&self, verbose: bool, ctx: &RequestContext) -> Result<()> {
|
||||
println!(
|
||||
"----- image layer for ten {} tli {} key {}-{} at {} is_incremental {} size {} ----",
|
||||
self.desc.tenant_id,
|
||||
self.desc.timeline_id,
|
||||
self.desc.key_range.start,
|
||||
self.desc.key_range.end,
|
||||
self.lsn,
|
||||
self.desc.is_incremental(),
|
||||
self.desc.file_size
|
||||
);
|
||||
self.desc.dump();
|
||||
|
||||
if !verbose {
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let inner = self.load(LayerAccessKind::Dump, ctx).await?;
|
||||
let file = &inner.file;
|
||||
let tree_reader =
|
||||
DiskBtreeReader::<_, KEY_SIZE>::new(inner.index_start_blk, inner.index_root_blk, file);
|
||||
|
||||
tree_reader.dump().await?;
|
||||
|
||||
tree_reader
|
||||
.visit(&[0u8; KEY_SIZE], VisitDirection::Forwards, |key, value| {
|
||||
println!("key: {} offset {}", hex::encode(key), value);
|
||||
true
|
||||
})
|
||||
.await?;
|
||||
inner.dump().await?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_state: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> anyhow::Result<ValueReconstructResult> {
|
||||
assert!(self.desc.key_range.contains(&key));
|
||||
assert!(lsn_range.start >= self.lsn);
|
||||
assert!(lsn_range.end >= self.lsn);
|
||||
|
||||
let inner = self
|
||||
.load(LayerAccessKind::GetValueReconstructData, ctx)
|
||||
.await?;
|
||||
inner
|
||||
.get_value_reconstruct_data(key, reconstruct_state)
|
||||
.await
|
||||
// FIXME: makes no sense to dump paths
|
||||
.with_context(|| format!("read {}", self.path().display()))
|
||||
}
|
||||
|
||||
pub(crate) fn local_path(&self) -> Option<PathBuf> {
|
||||
Some(self.path())
|
||||
}
|
||||
|
||||
pub(crate) fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
// delete underlying file
|
||||
fs::remove_file(self.path())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
let layer_file_name = self.layer_desc().filename().file_name();
|
||||
let lsn_start = self.layer_desc().image_layer_lsn();
|
||||
|
||||
HistoricLayerInfo::Image {
|
||||
layer_file_name,
|
||||
layer_file_size: self.desc.file_size,
|
||||
lsn_start,
|
||||
remote: false,
|
||||
access_stats: self.access_stats.as_api_model(reset),
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn access_stats(&self) -> &LayerAccessStats {
|
||||
&self.access_stats
|
||||
}
|
||||
|
||||
fn path_for(
|
||||
path_or_conf: &PathOrConf,
|
||||
timeline_id: TimelineId,
|
||||
tenant_id: TenantId,
|
||||
fname: &ImageFileName,
|
||||
) -> PathBuf {
|
||||
match path_or_conf {
|
||||
PathOrConf::Path(path) => path.to_path_buf(),
|
||||
PathOrConf::Conf(conf) => conf
|
||||
.timeline_path(&tenant_id, &timeline_id)
|
||||
.join(fname.to_string()),
|
||||
}
|
||||
}
|
||||
|
||||
fn temp_path_for(
|
||||
conf: &PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
@@ -344,53 +245,21 @@ impl ImageLayer {
|
||||
async fn load_inner(&self) -> Result<ImageLayerInner> {
|
||||
let path = self.path();
|
||||
|
||||
let expected_summary = match &self.path_or_conf {
|
||||
PathOrConf::Conf(_) => Some(Summary::from(self)),
|
||||
PathOrConf::Path(_) => None,
|
||||
};
|
||||
let loaded = ImageLayerInner::load(&path, self.desc.image_layer_lsn(), None)?;
|
||||
|
||||
let loaded =
|
||||
ImageLayerInner::load(&path, self.desc.image_layer_lsn(), expected_summary).await?;
|
||||
// not production code
|
||||
let actual_filename = self.path.file_name().unwrap().to_str().unwrap().to_owned();
|
||||
let expected_filename = self.layer_desc().filename().file_name();
|
||||
|
||||
if let PathOrConf::Path(ref path) = self.path_or_conf {
|
||||
// not production code
|
||||
let actual_filename = path.file_name().unwrap().to_str().unwrap().to_owned();
|
||||
let expected_filename = self.filename().file_name();
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
if actual_filename != expected_filename {
|
||||
println!("warning: filename does not match what is expected from in-file summary");
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
|
||||
Ok(loaded)
|
||||
}
|
||||
|
||||
/// Create an ImageLayer struct representing an existing file on disk
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
tenant_id: TenantId,
|
||||
filename: &ImageFileName,
|
||||
file_size: u64,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> ImageLayer {
|
||||
ImageLayer {
|
||||
path_or_conf: PathOrConf::Conf(conf),
|
||||
desc: PersistentLayerDesc::new_img(
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
filename.key_range.clone(),
|
||||
filename.lsn,
|
||||
file_size,
|
||||
), // Now we assume image layer ALWAYS covers the full range. This may change in the future.
|
||||
lsn: filename.lsn,
|
||||
access_stats,
|
||||
inner: OnceCell::new(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create an ImageLayer struct representing an existing file on disk.
|
||||
///
|
||||
/// This variant is only used for debugging purposes, by the 'pagectl' binary.
|
||||
@@ -403,7 +272,7 @@ impl ImageLayer {
|
||||
.metadata()
|
||||
.context("get file metadata to determine size")?;
|
||||
Ok(ImageLayer {
|
||||
path_or_conf: PathOrConf::Path(path.to_path_buf()),
|
||||
path: path.to_path_buf(),
|
||||
desc: PersistentLayerDesc::new_img(
|
||||
summary.tenant_id,
|
||||
summary.timeline_id,
|
||||
@@ -417,23 +286,14 @@ impl ImageLayer {
|
||||
})
|
||||
}
|
||||
|
||||
fn layer_name(&self) -> ImageFileName {
|
||||
self.desc.image_file_name()
|
||||
}
|
||||
|
||||
/// Path to the layer file in pageserver workdir.
|
||||
pub fn path(&self) -> PathBuf {
|
||||
Self::path_for(
|
||||
&self.path_or_conf,
|
||||
self.desc.timeline_id,
|
||||
self.desc.tenant_id,
|
||||
&self.layer_name(),
|
||||
)
|
||||
fn path(&self) -> PathBuf {
|
||||
self.path.clone()
|
||||
}
|
||||
}
|
||||
|
||||
impl ImageLayerInner {
|
||||
pub(super) async fn load(
|
||||
pub(super) fn load(
|
||||
path: &std::path::Path,
|
||||
lsn: Lsn,
|
||||
summary: Option<Summary>,
|
||||
@@ -441,7 +301,7 @@ impl ImageLayerInner {
|
||||
let file = VirtualFile::open(path)
|
||||
.with_context(|| format!("Failed to open file '{}'", path.display()))?;
|
||||
let file = FileBlockReader::new(file);
|
||||
let summary_blk = file.read_blk(0).await?;
|
||||
let summary_blk = file.read_blk(0)?;
|
||||
let actual_summary = Summary::des_prefix(summary_blk.as_ref())?;
|
||||
|
||||
if let Some(mut expected_summary) = summary {
|
||||
@@ -583,7 +443,7 @@ impl ImageLayerWriterInner {
|
||||
///
|
||||
/// Finish writing the image layer.
|
||||
///
|
||||
fn finish(self) -> anyhow::Result<ImageLayer> {
|
||||
fn finish(self, timeline: &Arc<Timeline>) -> anyhow::Result<ResidentLayer> {
|
||||
let index_start_blk =
|
||||
((self.blob_writer.size() + PAGE_SZ as u64 - 1) / PAGE_SZ as u64) as u32;
|
||||
|
||||
@@ -625,33 +485,13 @@ impl ImageLayerWriterInner {
|
||||
// Note: Because we open the file in write-only mode, we cannot
|
||||
// reuse the same VirtualFile for reading later. That's why we don't
|
||||
// set inner.file here. The first read will have to re-open it.
|
||||
let layer = ImageLayer {
|
||||
path_or_conf: PathOrConf::Conf(self.conf),
|
||||
desc,
|
||||
lsn: self.lsn,
|
||||
access_stats: LayerAccessStats::empty_will_record_residence_event_later(),
|
||||
inner: OnceCell::new(),
|
||||
};
|
||||
|
||||
// fsync the file
|
||||
file.sync_all()?;
|
||||
|
||||
// Rename the file to its final name
|
||||
//
|
||||
// Note: This overwrites any existing file. There shouldn't be any.
|
||||
// FIXME: throw an error instead?
|
||||
let final_path = ImageLayer::path_for(
|
||||
&PathOrConf::Conf(self.conf),
|
||||
self.timeline_id,
|
||||
self.tenant_id,
|
||||
&ImageFileName {
|
||||
key_range: self.key_range.clone(),
|
||||
lsn: self.lsn,
|
||||
},
|
||||
);
|
||||
std::fs::rename(self.path, final_path)?;
|
||||
let layer = Layer::finish_creating(self.conf, timeline, desc, &self.path)?;
|
||||
|
||||
trace!("created image layer {}", layer.path().display());
|
||||
trace!("created image layer {}", layer.local_path().display());
|
||||
|
||||
Ok(layer)
|
||||
}
|
||||
@@ -717,8 +557,11 @@ impl ImageLayerWriter {
|
||||
///
|
||||
/// Finish writing the image layer.
|
||||
///
|
||||
pub fn finish(mut self) -> anyhow::Result<ImageLayer> {
|
||||
self.inner.take().unwrap().finish()
|
||||
pub(crate) fn finish(
|
||||
mut self,
|
||||
timeline: &Arc<Timeline>,
|
||||
) -> anyhow::Result<super::ResidentLayer> {
|
||||
self.inner.take().unwrap().finish(timeline)
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -10,11 +10,12 @@ use crate::repository::{Key, Value};
|
||||
use crate::tenant::block_io::BlockReader;
|
||||
use crate::tenant::ephemeral_file::EphemeralFile;
|
||||
use crate::tenant::storage_layer::{ValueReconstructResult, ValueReconstructState};
|
||||
use crate::tenant::Timeline;
|
||||
use crate::walrecord;
|
||||
use anyhow::{ensure, Result};
|
||||
use pageserver_api::models::InMemoryLayerInfo;
|
||||
use std::collections::HashMap;
|
||||
use std::sync::OnceLock;
|
||||
use std::sync::{Arc, OnceLock};
|
||||
use tracing::*;
|
||||
use utils::{
|
||||
bin_ser::BeSer,
|
||||
@@ -28,7 +29,7 @@ use std::fmt::Write as _;
|
||||
use std::ops::Range;
|
||||
use tokio::sync::RwLock;
|
||||
|
||||
use super::{DeltaLayer, DeltaLayerWriter, Layer};
|
||||
use super::{DeltaLayerWriter, ResidentLayer};
|
||||
|
||||
pub struct InMemoryLayer {
|
||||
conf: &'static PageServerConf,
|
||||
@@ -203,20 +204,6 @@ impl InMemoryLayer {
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for InMemoryLayer {
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
key: Key,
|
||||
lsn_range: Range<Lsn>,
|
||||
reconstruct_data: &mut ValueReconstructState,
|
||||
ctx: &RequestContext,
|
||||
) -> Result<ValueReconstructResult> {
|
||||
self.get_value_reconstruct_data(key, lsn_range, reconstruct_data, ctx)
|
||||
.await
|
||||
}
|
||||
}
|
||||
|
||||
impl std::fmt::Display for InMemoryLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
let end_lsn = self.end_lsn_or_max();
|
||||
@@ -225,17 +212,13 @@ impl std::fmt::Display for InMemoryLayer {
|
||||
}
|
||||
|
||||
impl InMemoryLayer {
|
||||
///
|
||||
/// Get layer size.
|
||||
///
|
||||
pub async fn size(&self) -> Result<u64> {
|
||||
let inner = self.inner.read().await;
|
||||
Ok(inner.file.len())
|
||||
}
|
||||
|
||||
///
|
||||
/// Create a new, empty, in-memory layer
|
||||
///
|
||||
pub fn create(
|
||||
conf: &'static PageServerConf,
|
||||
timeline_id: TimelineId,
|
||||
@@ -313,7 +296,7 @@ impl InMemoryLayer {
|
||||
/// Write this frozen in-memory layer to disk.
|
||||
///
|
||||
/// Returns a new delta layer with all the same data as this in-memory layer
|
||||
pub(crate) async fn write_to_disk(&self) -> Result<DeltaLayer> {
|
||||
pub(crate) async fn write_to_disk(&self, timeline: &Arc<Timeline>) -> Result<ResidentLayer> {
|
||||
// Grab the lock in read-mode. We hold it over the I/O, but because this
|
||||
// layer is not writeable anymore, no one should be trying to acquire the
|
||||
// write lock on it, so we shouldn't block anyone. There's one exception
|
||||
@@ -352,7 +335,7 @@ impl InMemoryLayer {
|
||||
}
|
||||
}
|
||||
|
||||
let delta_layer = delta_layer_writer.finish(Key::MAX)?;
|
||||
let delta_layer = delta_layer_writer.finish(Key::MAX, timeline)?;
|
||||
Ok(delta_layer)
|
||||
}
|
||||
}
|
||||
|
||||
1205
pageserver/src/tenant/storage_layer/layer.rs
Normal file
1205
pageserver/src/tenant/storage_layer/layer.rs
Normal file
File diff suppressed because it is too large
Load Diff
@@ -1,4 +1,3 @@
|
||||
use anyhow::Result;
|
||||
use core::fmt::Display;
|
||||
use std::ops::Range;
|
||||
use utils::{
|
||||
@@ -6,7 +5,7 @@ use utils::{
|
||||
lsn::Lsn,
|
||||
};
|
||||
|
||||
use crate::{context::RequestContext, repository::Key};
|
||||
use crate::repository::Key;
|
||||
|
||||
use super::{DeltaFileName, ImageFileName, LayerFileName};
|
||||
|
||||
@@ -100,6 +99,22 @@ impl PersistentLayerDesc {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn from_filename(
|
||||
tenant_id: TenantId,
|
||||
timeline_id: TimelineId,
|
||||
filename: LayerFileName,
|
||||
file_size: u64,
|
||||
) -> Self {
|
||||
match filename {
|
||||
LayerFileName::Image(i) => {
|
||||
Self::new_img(tenant_id, timeline_id, i.key_range, i.lsn, file_size)
|
||||
}
|
||||
LayerFileName::Delta(d) => {
|
||||
Self::new_delta(tenant_id, timeline_id, d.key_range, d.lsn_range, file_size)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Get the LSN that the image layer covers.
|
||||
pub fn image_layer_lsn(&self) -> Lsn {
|
||||
assert!(!self.is_delta);
|
||||
@@ -173,21 +188,31 @@ impl PersistentLayerDesc {
|
||||
self.is_delta
|
||||
}
|
||||
|
||||
pub fn dump(&self, _verbose: bool, _ctx: &RequestContext) -> Result<()> {
|
||||
println!(
|
||||
"----- layer for ten {} tli {} keys {}-{} lsn {}-{} is_delta {} is_incremental {} size {} ----",
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_range.start,
|
||||
self.key_range.end,
|
||||
self.lsn_range.start,
|
||||
self.lsn_range.end,
|
||||
self.is_delta,
|
||||
self.is_incremental(),
|
||||
self.file_size,
|
||||
);
|
||||
|
||||
Ok(())
|
||||
pub fn dump(&self) {
|
||||
if self.is_delta {
|
||||
println!(
|
||||
"----- delta layer for ten {} tli {} keys {}-{} lsn {}-{} is_incremental {} size {} ----",
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_range.start,
|
||||
self.key_range.end,
|
||||
self.lsn_range.start,
|
||||
self.lsn_range.end,
|
||||
self.is_incremental(),
|
||||
self.file_size,
|
||||
);
|
||||
} else {
|
||||
println!(
|
||||
"----- image layer for ten {} tli {} key {}-{} at {} is_incremental {} size {} ----",
|
||||
self.tenant_id,
|
||||
self.timeline_id,
|
||||
self.key_range.start,
|
||||
self.key_range.end,
|
||||
self.image_layer_lsn(),
|
||||
self.is_incremental(),
|
||||
self.file_size
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn file_size(&self) -> u64 {
|
||||
|
||||
@@ -1,216 +0,0 @@
|
||||
//! A RemoteLayer is an in-memory placeholder for a layer file that exists
|
||||
//! in remote storage.
|
||||
//!
|
||||
use crate::config::PageServerConf;
|
||||
use crate::context::RequestContext;
|
||||
use crate::repository::Key;
|
||||
use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
|
||||
use crate::tenant::storage_layer::{Layer, ValueReconstructResult, ValueReconstructState};
|
||||
use crate::tenant::timeline::layer_manager::LayerManager;
|
||||
use anyhow::{bail, Result};
|
||||
use pageserver_api::models::HistoricLayerInfo;
|
||||
use std::ops::Range;
|
||||
use std::path::PathBuf;
|
||||
use std::sync::Arc;
|
||||
|
||||
use utils::{
|
||||
id::{TenantId, TimelineId},
|
||||
lsn::Lsn,
|
||||
};
|
||||
|
||||
use super::filename::{DeltaFileName, ImageFileName};
|
||||
use super::{
|
||||
AsLayerDesc, DeltaLayer, ImageLayer, LayerAccessStats, LayerAccessStatsReset,
|
||||
LayerResidenceStatus, PersistentLayer, PersistentLayerDesc,
|
||||
};
|
||||
|
||||
/// RemoteLayer is a not yet downloaded [`ImageLayer`] or
|
||||
/// [`DeltaLayer`](super::DeltaLayer).
|
||||
///
|
||||
/// RemoteLayer might be downloaded on-demand during operations which are
|
||||
/// allowed download remote layers and during which, it gets replaced with a
|
||||
/// concrete `DeltaLayer` or `ImageLayer`.
|
||||
///
|
||||
/// See: [`crate::context::RequestContext`] for authorization to download
|
||||
pub struct RemoteLayer {
|
||||
pub desc: PersistentLayerDesc,
|
||||
|
||||
pub layer_metadata: LayerFileMetadata,
|
||||
|
||||
access_stats: LayerAccessStats,
|
||||
|
||||
pub(crate) ongoing_download: Arc<tokio::sync::Semaphore>,
|
||||
|
||||
/// Has `LayerMap::replace` failed for this (true) or not (false).
|
||||
///
|
||||
/// Used together with [`ongoing_download`] semaphore in `Timeline::download_remote_layer`.
|
||||
/// The field is used to mark a RemoteLayer permanently (until restart or ignore+load)
|
||||
/// unprocessable, because a LayerMap::replace failed.
|
||||
///
|
||||
/// It is very unlikely to accumulate these in the Timeline's LayerMap, but having this avoids
|
||||
/// a possible fast loop between `Timeline::get_reconstruct_data` and
|
||||
/// `Timeline::download_remote_layer`, which also logs.
|
||||
///
|
||||
/// [`ongoing_download`]: Self::ongoing_download
|
||||
pub(crate) download_replacement_failure: std::sync::atomic::AtomicBool,
|
||||
}
|
||||
|
||||
impl std::fmt::Debug for RemoteLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.debug_struct("RemoteLayer")
|
||||
.field("file_name", &self.desc.filename())
|
||||
.field("layer_metadata", &self.layer_metadata)
|
||||
.field("is_incremental", &self.desc.is_incremental())
|
||||
.finish()
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait::async_trait]
|
||||
impl Layer for RemoteLayer {
|
||||
async fn get_value_reconstruct_data(
|
||||
&self,
|
||||
_key: Key,
|
||||
_lsn_range: Range<Lsn>,
|
||||
_reconstruct_state: &mut ValueReconstructState,
|
||||
_ctx: &RequestContext,
|
||||
) -> Result<ValueReconstructResult> {
|
||||
bail!("layer {self} needs to be downloaded");
|
||||
}
|
||||
}
|
||||
|
||||
/// Boilerplate to implement the Layer trait, always use layer_desc for persistent layers.
|
||||
impl std::fmt::Display for RemoteLayer {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
write!(f, "{}", self.layer_desc().short_id())
|
||||
}
|
||||
}
|
||||
|
||||
impl AsLayerDesc for RemoteLayer {
|
||||
fn layer_desc(&self) -> &PersistentLayerDesc {
|
||||
&self.desc
|
||||
}
|
||||
}
|
||||
|
||||
impl PersistentLayer for RemoteLayer {
|
||||
fn local_path(&self) -> Option<PathBuf> {
|
||||
None
|
||||
}
|
||||
|
||||
fn delete_resident_layer_file(&self) -> Result<()> {
|
||||
bail!("remote layer has no layer file");
|
||||
}
|
||||
|
||||
fn downcast_remote_layer<'a>(self: Arc<Self>) -> Option<std::sync::Arc<RemoteLayer>> {
|
||||
Some(self)
|
||||
}
|
||||
|
||||
fn is_remote_layer(&self) -> bool {
|
||||
true
|
||||
}
|
||||
|
||||
fn info(&self, reset: LayerAccessStatsReset) -> HistoricLayerInfo {
|
||||
let layer_file_name = self.layer_desc().filename().file_name();
|
||||
let lsn_range = self.layer_desc().lsn_range.clone();
|
||||
|
||||
if self.desc.is_delta {
|
||||
HistoricLayerInfo::Delta {
|
||||
layer_file_name,
|
||||
layer_file_size: self.layer_metadata.file_size(),
|
||||
lsn_start: lsn_range.start,
|
||||
lsn_end: lsn_range.end,
|
||||
remote: true,
|
||||
access_stats: self.access_stats.as_api_model(reset),
|
||||
}
|
||||
} else {
|
||||
HistoricLayerInfo::Image {
|
||||
layer_file_name,
|
||||
layer_file_size: self.layer_metadata.file_size(),
|
||||
lsn_start: lsn_range.start,
|
||||
remote: true,
|
||||
access_stats: self.access_stats.as_api_model(reset),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn access_stats(&self) -> &LayerAccessStats {
|
||||
&self.access_stats
|
||||
}
|
||||
}
|
||||
|
||||
impl RemoteLayer {
|
||||
pub fn new_img(
|
||||
tenantid: TenantId,
|
||||
timelineid: TimelineId,
|
||||
fname: &ImageFileName,
|
||||
layer_metadata: &LayerFileMetadata,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> RemoteLayer {
|
||||
RemoteLayer {
|
||||
desc: PersistentLayerDesc::new_img(
|
||||
tenantid,
|
||||
timelineid,
|
||||
fname.key_range.clone(),
|
||||
fname.lsn,
|
||||
layer_metadata.file_size(),
|
||||
),
|
||||
layer_metadata: layer_metadata.clone(),
|
||||
ongoing_download: Arc::new(tokio::sync::Semaphore::new(1)),
|
||||
download_replacement_failure: std::sync::atomic::AtomicBool::default(),
|
||||
access_stats,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn new_delta(
|
||||
tenantid: TenantId,
|
||||
timelineid: TimelineId,
|
||||
fname: &DeltaFileName,
|
||||
layer_metadata: &LayerFileMetadata,
|
||||
access_stats: LayerAccessStats,
|
||||
) -> RemoteLayer {
|
||||
RemoteLayer {
|
||||
desc: PersistentLayerDesc::new_delta(
|
||||
tenantid,
|
||||
timelineid,
|
||||
fname.key_range.clone(),
|
||||
fname.lsn_range.clone(),
|
||||
layer_metadata.file_size(),
|
||||
),
|
||||
layer_metadata: layer_metadata.clone(),
|
||||
ongoing_download: Arc::new(tokio::sync::Semaphore::new(1)),
|
||||
download_replacement_failure: std::sync::atomic::AtomicBool::default(),
|
||||
access_stats,
|
||||
}
|
||||
}
|
||||
|
||||
/// Create a Layer struct representing this layer, after it has been downloaded.
|
||||
pub(crate) fn create_downloaded_layer(
|
||||
&self,
|
||||
_layer_map_lock_held_witness: &LayerManager,
|
||||
conf: &'static PageServerConf,
|
||||
file_size: u64,
|
||||
) -> Arc<dyn PersistentLayer> {
|
||||
if self.desc.is_delta {
|
||||
let fname = self.desc.delta_file_name();
|
||||
Arc::new(DeltaLayer::new(
|
||||
conf,
|
||||
self.desc.timeline_id,
|
||||
self.desc.tenant_id,
|
||||
&fname,
|
||||
file_size,
|
||||
self.access_stats
|
||||
.clone_for_residence_change(LayerResidenceStatus::Resident),
|
||||
))
|
||||
} else {
|
||||
let fname = self.desc.image_file_name();
|
||||
Arc::new(ImageLayer::new(
|
||||
conf,
|
||||
self.desc.timeline_id,
|
||||
self.desc.tenant_id,
|
||||
&fname,
|
||||
file_size,
|
||||
self.access_stats
|
||||
.clone_for_residence_change(LayerResidenceStatus::Resident),
|
||||
))
|
||||
}
|
||||
}
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -14,7 +14,6 @@ use utils::{
|
||||
|
||||
use crate::{
|
||||
config::PageServerConf,
|
||||
deletion_queue::DeletionQueueClient,
|
||||
task_mgr::{self, TaskKind},
|
||||
tenant::{
|
||||
metadata::TimelineMetadata,
|
||||
@@ -239,6 +238,15 @@ async fn delete_local_layer_files(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Removes remote layers and an index file after them.
|
||||
async fn delete_remote_layers_and_index(timeline: &Timeline) -> anyhow::Result<()> {
|
||||
if let Some(remote_client) = &timeline.remote_client {
|
||||
remote_client.delete_all().await.context("delete_all")?
|
||||
};
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// This function removs remaining traces of a timeline on disk.
|
||||
// Namely: metadata file, timeline directory, delete mark.
|
||||
// Note: io::ErrorKind::NotFound are ignored for metadata and timeline dir.
|
||||
@@ -399,7 +407,6 @@ impl DeleteTimelineFlow {
|
||||
timeline_id: TimelineId,
|
||||
local_metadata: &TimelineMetadata,
|
||||
remote_client: Option<RemoteTimelineClient>,
|
||||
deletion_queue_client: Option<DeletionQueueClient>,
|
||||
init_order: Option<&InitializationOrder>,
|
||||
) -> anyhow::Result<()> {
|
||||
// Note: here we even skip populating layer map. Timeline is essentially uninitialized.
|
||||
@@ -409,10 +416,7 @@ impl DeleteTimelineFlow {
|
||||
timeline_id,
|
||||
local_metadata,
|
||||
None, // Ancestor is not needed for deletion.
|
||||
TimelineResources {
|
||||
remote_client,
|
||||
deletion_queue_client,
|
||||
},
|
||||
TimelineResources { remote_client },
|
||||
init_order,
|
||||
// Important. We dont pass ancestor above because it can be missing.
|
||||
// Thus we need to skip the validation here.
|
||||
@@ -555,7 +559,7 @@ impl DeleteTimelineFlow {
|
||||
) -> Result<(), DeleteTimelineError> {
|
||||
delete_local_layer_files(conf, tenant.tenant_id, timeline).await?;
|
||||
|
||||
timeline.delete_all_remote().await?;
|
||||
delete_remote_layers_and_index(timeline).await?;
|
||||
|
||||
pausable_failpoint!("in_progress_delete");
|
||||
|
||||
|
||||
@@ -29,7 +29,6 @@ use crate::{
|
||||
task_mgr::{self, TaskKind, BACKGROUND_RUNTIME},
|
||||
tenant::{
|
||||
config::{EvictionPolicy, EvictionPolicyLayerAccessThreshold},
|
||||
storage_layer::PersistentLayer,
|
||||
timeline::EvictionError,
|
||||
LogicalSizeCalculationCause, Tenant,
|
||||
},
|
||||
@@ -194,15 +193,26 @@ impl Timeline {
|
||||
// NB: all the checks can be invalidated as soon as we release the layer map lock.
|
||||
// We don't want to hold the layer map lock during eviction.
|
||||
// So, we just need to deal with this.
|
||||
let candidates: Vec<Arc<dyn PersistentLayer>> = {
|
||||
let candidates: Vec<_> = {
|
||||
let guard = self.layers.read().await;
|
||||
let layers = guard.layer_map();
|
||||
let mut candidates = Vec::new();
|
||||
for hist_layer in layers.iter_historic_layers() {
|
||||
let hist_layer = guard.get_from_desc(&hist_layer);
|
||||
if hist_layer.is_remote_layer() {
|
||||
continue;
|
||||
}
|
||||
|
||||
// guard against eviction while we inspect it; it might be that eviction_task and
|
||||
// disk_usage_eviction_task both select the same layers to be evicted, and
|
||||
// seemingly free up double the space. both succeeding is of no consequence.
|
||||
let guard = match hist_layer.keep_resident().await {
|
||||
Ok(Some(l)) => l,
|
||||
Ok(None) => continue,
|
||||
Err(e) => {
|
||||
// these should not happen, but we cannot make them statically impossible right
|
||||
// now.
|
||||
tracing::warn!(layer=%hist_layer, "failed to keep the layer resident: {e:#}");
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
let last_activity_ts = hist_layer.access_stats().latest_activity().unwrap_or_else(|| {
|
||||
// We only use this fallback if there's an implementation error.
|
||||
@@ -233,7 +243,7 @@ impl Timeline {
|
||||
}
|
||||
};
|
||||
if no_activity_for > p.threshold {
|
||||
candidates.push(hist_layer)
|
||||
candidates.push(guard.drop_eviction_guard())
|
||||
}
|
||||
}
|
||||
candidates
|
||||
@@ -252,7 +262,7 @@ impl Timeline {
|
||||
};
|
||||
|
||||
let results = match self
|
||||
.evict_layer_batch(remote_client, &candidates[..], cancel.clone())
|
||||
.evict_layer_batch(remote_client, &candidates, cancel)
|
||||
.await
|
||||
{
|
||||
Err(pre_err) => {
|
||||
@@ -263,7 +273,7 @@ impl Timeline {
|
||||
Ok(results) => results,
|
||||
};
|
||||
assert_eq!(results.len(), candidates.len());
|
||||
for (l, result) in candidates.iter().zip(results) {
|
||||
for result in results {
|
||||
match result {
|
||||
None => {
|
||||
stats.skipped_for_shutdown += 1;
|
||||
@@ -271,20 +281,10 @@ impl Timeline {
|
||||
Some(Ok(())) => {
|
||||
stats.evicted += 1;
|
||||
}
|
||||
Some(Err(EvictionError::CannotEvictRemoteLayer)) => {
|
||||
stats.not_evictable += 1;
|
||||
}
|
||||
Some(Err(EvictionError::FileNotFound)) => {
|
||||
Some(Err(EvictionError::NotFound | EvictionError::Downloaded)) => {
|
||||
// compaction/gc removed the file while we were waiting on layer_removal_cs
|
||||
stats.not_evictable += 1;
|
||||
}
|
||||
Some(Err(
|
||||
e @ EvictionError::LayerNotFound(_) | e @ EvictionError::StatFailed(_),
|
||||
)) => {
|
||||
let e = utils::error::report_compact_sources(&e);
|
||||
warn!(layer = %l, "failed to evict layer: {e}");
|
||||
stats.not_evictable += 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
if stats.candidates == stats.not_evictable {
|
||||
|
||||
@@ -7,7 +7,6 @@ use crate::{
|
||||
index::{IndexPart, LayerFileMetadata},
|
||||
},
|
||||
storage_layer::LayerFileName,
|
||||
Generation,
|
||||
},
|
||||
METADATA_FILE_NAME,
|
||||
};
|
||||
@@ -105,7 +104,6 @@ pub(super) fn reconcile(
|
||||
discovered: Vec<(LayerFileName, u64)>,
|
||||
index_part: Option<&IndexPart>,
|
||||
disk_consistent_lsn: Lsn,
|
||||
generation: Generation,
|
||||
) -> Vec<(LayerFileName, Result<Decision, FutureLayer>)> {
|
||||
use Decision::*;
|
||||
|
||||
@@ -114,15 +112,7 @@ pub(super) fn reconcile(
|
||||
|
||||
let mut discovered = discovered
|
||||
.into_iter()
|
||||
.map(|(name, file_size)| {
|
||||
(
|
||||
name,
|
||||
// The generation here will be corrected to match IndexPart in the merge below, unless
|
||||
// it is not in IndexPart, in which case using our current generation makes sense
|
||||
// because it will be uploaded in this generation.
|
||||
(Some(LayerFileMetadata::new(file_size, generation)), None),
|
||||
)
|
||||
})
|
||||
.map(|(name, file_size)| (name, (Some(LayerFileMetadata::new(file_size)), None)))
|
||||
.collect::<Collected>();
|
||||
|
||||
// merge any index_part information, when available
|
||||
@@ -147,11 +137,7 @@ pub(super) fn reconcile(
|
||||
Err(FutureLayer { local })
|
||||
} else {
|
||||
Ok(match (local, remote) {
|
||||
(Some(local), Some(remote)) if local != remote => {
|
||||
assert_eq!(local.generation, remote.generation);
|
||||
|
||||
UseRemote { local, remote }
|
||||
}
|
||||
(Some(local), Some(remote)) if local != remote => UseRemote { local, remote },
|
||||
(Some(x), Some(_)) => UseLocal(x),
|
||||
(None, Some(x)) => Evicted(x),
|
||||
(Some(x), None) => NeedsUpload(x),
|
||||
|
||||
@@ -8,21 +8,19 @@ use utils::{
|
||||
|
||||
use crate::{
|
||||
config::PageServerConf,
|
||||
metrics::TimelineMetrics,
|
||||
tenant::{
|
||||
layer_map::{BatchedUpdates, LayerMap},
|
||||
storage_layer::{
|
||||
AsLayerDesc, DeltaLayer, ImageLayer, InMemoryLayer, PersistentLayer,
|
||||
PersistentLayerDesc, PersistentLayerKey,
|
||||
AsLayerDesc, InMemoryLayer, Layer, PersistentLayerDesc, PersistentLayerKey,
|
||||
ResidentLayer,
|
||||
},
|
||||
timeline::compare_arced_layers,
|
||||
},
|
||||
};
|
||||
|
||||
/// Provides semantic APIs to manipulate the layer map.
|
||||
pub(crate) struct LayerManager {
|
||||
layer_map: LayerMap,
|
||||
layer_fmgr: LayerFileManager,
|
||||
layer_fmgr: LayerFileManager<Layer>,
|
||||
}
|
||||
|
||||
/// After GC, the layer map changes will not be applied immediately. Users should manually apply the changes after
|
||||
@@ -43,7 +41,7 @@ impl LayerManager {
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc<dyn PersistentLayer> {
|
||||
pub(crate) fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Layer {
|
||||
self.layer_fmgr.get_from_desc(desc)
|
||||
}
|
||||
|
||||
@@ -55,21 +53,12 @@ impl LayerManager {
|
||||
&self.layer_map
|
||||
}
|
||||
|
||||
/// Replace layers in the layer file manager, used in evictions and layer downloads.
|
||||
pub(crate) fn replace_and_verify(
|
||||
&mut self,
|
||||
expected: Arc<dyn PersistentLayer>,
|
||||
new: Arc<dyn PersistentLayer>,
|
||||
) -> Result<()> {
|
||||
self.layer_fmgr.replace_and_verify(expected, new)
|
||||
}
|
||||
|
||||
/// Called from `load_layer_map`. Initialize the layer manager with:
|
||||
/// 1. all on-disk layers
|
||||
/// 2. next open layer (with disk disk_consistent_lsn LSN)
|
||||
pub(crate) fn initialize_local_layers(
|
||||
&mut self,
|
||||
on_disk_layers: Vec<Arc<dyn PersistentLayer>>,
|
||||
on_disk_layers: Vec<Layer>,
|
||||
next_open_layer_at: Lsn,
|
||||
) {
|
||||
let mut updates = self.layer_map.batch_update();
|
||||
@@ -164,10 +153,10 @@ impl LayerManager {
|
||||
}
|
||||
|
||||
/// Add image layers to the layer map, called from `create_image_layers`.
|
||||
pub(crate) fn track_new_image_layers(&mut self, image_layers: Vec<ImageLayer>) {
|
||||
pub(crate) fn track_new_image_layers(&mut self, image_layers: &[ResidentLayer]) {
|
||||
let mut updates = self.layer_map.batch_update();
|
||||
for layer in image_layers {
|
||||
Self::insert_historic_layer(Arc::new(layer), &mut updates, &mut self.layer_fmgr);
|
||||
Self::insert_historic_layer(layer.as_ref().clone(), &mut updates, &mut self.layer_fmgr);
|
||||
}
|
||||
updates.flush();
|
||||
}
|
||||
@@ -175,46 +164,47 @@ impl LayerManager {
|
||||
/// Flush a frozen layer and add the written delta layer to the layer map.
|
||||
pub(crate) fn finish_flush_l0_layer(
|
||||
&mut self,
|
||||
delta_layer: Option<DeltaLayer>,
|
||||
delta_layer: Option<&ResidentLayer>,
|
||||
frozen_layer_for_check: &Arc<InMemoryLayer>,
|
||||
) {
|
||||
let l = self.layer_map.frozen_layers.pop_front();
|
||||
let mut updates = self.layer_map.batch_update();
|
||||
let inmem = self
|
||||
.layer_map
|
||||
.frozen_layers
|
||||
.pop_front()
|
||||
.expect("there must be a inmem layer to flush");
|
||||
|
||||
// Only one thread may call this function at a time (for this
|
||||
// timeline). If two threads tried to flush the same frozen
|
||||
// Only one task may call this function at a time (for this
|
||||
// timeline). If two tasks tried to flush the same frozen
|
||||
// layer to disk at the same time, that would not work.
|
||||
assert!(compare_arced_layers(&l.unwrap(), frozen_layer_for_check));
|
||||
assert_eq!(Arc::as_ptr(&inmem), Arc::as_ptr(frozen_layer_for_check));
|
||||
|
||||
if let Some(delta_layer) = delta_layer {
|
||||
Self::insert_historic_layer(Arc::new(delta_layer), &mut updates, &mut self.layer_fmgr);
|
||||
if let Some(l) = delta_layer {
|
||||
let mut updates = self.layer_map.batch_update();
|
||||
Self::insert_historic_layer(l.as_ref().clone(), &mut updates, &mut self.layer_fmgr);
|
||||
updates.flush();
|
||||
}
|
||||
updates.flush();
|
||||
}
|
||||
|
||||
/// Called when compaction is completed.
|
||||
pub(crate) fn finish_compact_l0(
|
||||
&mut self,
|
||||
layer_removal_cs: Arc<tokio::sync::OwnedMutexGuard<()>>,
|
||||
compact_from: Vec<Arc<dyn PersistentLayer>>,
|
||||
compact_to: Vec<Arc<dyn PersistentLayer>>,
|
||||
metrics: &TimelineMetrics,
|
||||
layer_removal_cs: &Arc<tokio::sync::OwnedMutexGuard<()>>,
|
||||
compact_from: Vec<Layer>,
|
||||
compact_to: &[ResidentLayer],
|
||||
duplicates: &[(ResidentLayer, ResidentLayer)],
|
||||
) -> Result<()> {
|
||||
let mut updates = self.layer_map.batch_update();
|
||||
for l in compact_to {
|
||||
Self::insert_historic_layer(l, &mut updates, &mut self.layer_fmgr);
|
||||
Self::insert_historic_layer(l.as_ref().clone(), &mut updates, &mut self.layer_fmgr);
|
||||
}
|
||||
for l in compact_from {
|
||||
// NB: the layer file identified by descriptor `l` is guaranteed to be present
|
||||
// in the LayerFileManager because compaction kept holding `layer_removal_cs` the entire
|
||||
// time, even though we dropped `Timeline::layers` inbetween.
|
||||
Self::delete_historic_layer(
|
||||
layer_removal_cs.clone(),
|
||||
l,
|
||||
&mut updates,
|
||||
metrics,
|
||||
&mut self.layer_fmgr,
|
||||
)?;
|
||||
Self::delete_historic_layer(layer_removal_cs, l, &mut updates, &mut self.layer_fmgr)?;
|
||||
}
|
||||
for (old, new) in duplicates {
|
||||
self.layer_fmgr.replace(old.as_ref(), new.as_ref().clone());
|
||||
}
|
||||
updates.flush();
|
||||
Ok(())
|
||||
@@ -223,28 +213,26 @@ impl LayerManager {
|
||||
/// Called when garbage collect the timeline. Returns a guard that will apply the updates to the layer map.
|
||||
pub(crate) fn finish_gc_timeline(
|
||||
&mut self,
|
||||
layer_removal_cs: Arc<tokio::sync::OwnedMutexGuard<()>>,
|
||||
gc_layers: Vec<Arc<dyn PersistentLayer>>,
|
||||
metrics: &TimelineMetrics,
|
||||
layer_removal_cs: &Arc<tokio::sync::OwnedMutexGuard<()>>,
|
||||
gc_layers: Vec<Layer>,
|
||||
) -> Result<ApplyGcResultGuard> {
|
||||
let mut updates = self.layer_map.batch_update();
|
||||
for doomed_layer in gc_layers {
|
||||
Self::delete_historic_layer(
|
||||
layer_removal_cs.clone(),
|
||||
layer_removal_cs,
|
||||
doomed_layer,
|
||||
&mut updates,
|
||||
metrics,
|
||||
&mut self.layer_fmgr,
|
||||
)?; // FIXME: schedule succeeded deletions in timeline.rs `gc_timeline` instead of in batch?
|
||||
)?;
|
||||
}
|
||||
Ok(ApplyGcResultGuard(updates))
|
||||
}
|
||||
|
||||
/// Helper function to insert a layer into the layer map and file manager.
|
||||
fn insert_historic_layer(
|
||||
layer: Arc<dyn PersistentLayer>,
|
||||
layer: Layer,
|
||||
updates: &mut BatchedUpdates<'_>,
|
||||
mapping: &mut LayerFileManager,
|
||||
mapping: &mut LayerFileManager<Layer>,
|
||||
) {
|
||||
updates.insert_historic(layer.layer_desc().clone());
|
||||
mapping.insert(layer);
|
||||
@@ -254,17 +242,12 @@ impl LayerManager {
|
||||
/// Remote storage is not affected by this operation.
|
||||
fn delete_historic_layer(
|
||||
// we cannot remove layers otherwise, since gc and compaction will race
|
||||
_layer_removal_cs: Arc<tokio::sync::OwnedMutexGuard<()>>,
|
||||
layer: Arc<dyn PersistentLayer>,
|
||||
_layer_removal_cs: &Arc<tokio::sync::OwnedMutexGuard<()>>,
|
||||
layer: Layer,
|
||||
updates: &mut BatchedUpdates<'_>,
|
||||
metrics: &TimelineMetrics,
|
||||
mapping: &mut LayerFileManager,
|
||||
mapping: &mut LayerFileManager<Layer>,
|
||||
) -> anyhow::Result<()> {
|
||||
let desc = layer.layer_desc();
|
||||
if !layer.is_remote_layer() {
|
||||
layer.delete_resident_layer_file()?;
|
||||
metrics.resident_physical_size_gauge.sub(desc.file_size);
|
||||
}
|
||||
|
||||
// TODO Removing from the bottom of the layer map is expensive.
|
||||
// Maybe instead discard all layer map historic versions that
|
||||
@@ -272,22 +255,21 @@ impl LayerManager {
|
||||
// and mark what we can't delete yet as deleted from the layer
|
||||
// map index without actually rebuilding the index.
|
||||
updates.remove_historic(desc);
|
||||
mapping.remove(layer);
|
||||
mapping.remove(&layer);
|
||||
layer.garbage_collect_on_drop();
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn contains(&self, layer: &Arc<dyn PersistentLayer>) -> bool {
|
||||
pub(crate) fn contains(&self, layer: &Layer) -> bool {
|
||||
self.layer_fmgr.contains(layer)
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) struct LayerFileManager<T: AsLayerDesc + ?Sized = dyn PersistentLayer>(
|
||||
HashMap<PersistentLayerKey, Arc<T>>,
|
||||
);
|
||||
pub(crate) struct LayerFileManager<T>(HashMap<PersistentLayerKey, T>);
|
||||
|
||||
impl<T: AsLayerDesc + ?Sized> LayerFileManager<T> {
|
||||
fn get_from_desc(&self, desc: &PersistentLayerDesc) -> Arc<T> {
|
||||
impl<T: AsLayerDesc + Clone + PartialEq + std::fmt::Debug> LayerFileManager<T> {
|
||||
fn get_from_desc(&self, desc: &PersistentLayerDesc) -> T {
|
||||
// The assumption for the `expect()` is that all code maintains the following invariant:
|
||||
// A layer's descriptor is present in the LayerMap => the LayerFileManager contains a layer for the descriptor.
|
||||
self.0
|
||||
@@ -297,14 +279,14 @@ impl<T: AsLayerDesc + ?Sized> LayerFileManager<T> {
|
||||
.clone()
|
||||
}
|
||||
|
||||
pub(crate) fn insert(&mut self, layer: Arc<T>) {
|
||||
pub(crate) fn insert(&mut self, layer: T) {
|
||||
let present = self.0.insert(layer.layer_desc().key(), layer.clone());
|
||||
if present.is_some() && cfg!(debug_assertions) {
|
||||
panic!("overwriting a layer: {:?}", layer.layer_desc())
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn contains(&self, layer: &Arc<T>) -> bool {
|
||||
pub(crate) fn contains(&self, layer: &T) -> bool {
|
||||
self.0.contains_key(&layer.layer_desc().key())
|
||||
}
|
||||
|
||||
@@ -312,7 +294,7 @@ impl<T: AsLayerDesc + ?Sized> LayerFileManager<T> {
|
||||
Self(HashMap::new())
|
||||
}
|
||||
|
||||
pub(crate) fn remove(&mut self, layer: Arc<T>) {
|
||||
pub(crate) fn remove(&mut self, layer: &T) {
|
||||
let present = self.0.remove(&layer.layer_desc().key());
|
||||
if present.is_none() && cfg!(debug_assertions) {
|
||||
panic!(
|
||||
@@ -322,38 +304,13 @@ impl<T: AsLayerDesc + ?Sized> LayerFileManager<T> {
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn replace_and_verify(&mut self, expected: Arc<T>, new: Arc<T>) -> Result<()> {
|
||||
let key = expected.layer_desc().key();
|
||||
let other = new.layer_desc().key();
|
||||
pub(crate) fn replace(&mut self, old: &T, new: T) {
|
||||
let key = old.layer_desc().key();
|
||||
assert_eq!(key, new.layer_desc().key());
|
||||
|
||||
let expected_l0 = LayerMap::is_l0(expected.layer_desc());
|
||||
let new_l0 = LayerMap::is_l0(new.layer_desc());
|
||||
|
||||
fail::fail_point!("layermap-replace-notfound", |_| anyhow::bail!(
|
||||
"layermap-replace-notfound"
|
||||
));
|
||||
|
||||
anyhow::ensure!(
|
||||
key == other,
|
||||
"expected and new layer have different keys: {key:?} != {other:?}"
|
||||
);
|
||||
|
||||
anyhow::ensure!(
|
||||
expected_l0 == new_l0,
|
||||
"one layer is l0 while the other is not: {expected_l0} != {new_l0}"
|
||||
);
|
||||
|
||||
if let Some(layer) = self.0.get_mut(&key) {
|
||||
anyhow::ensure!(
|
||||
compare_arced_layers(&expected, layer),
|
||||
"another layer was found instead of expected, expected={expected:?}, new={new:?}",
|
||||
expected = Arc::as_ptr(&expected),
|
||||
new = Arc::as_ptr(layer),
|
||||
);
|
||||
*layer = new;
|
||||
Ok(())
|
||||
} else {
|
||||
anyhow::bail!("layer was not found");
|
||||
if let Some(existing) = self.0.get_mut(&key) {
|
||||
assert_eq!(existing, old);
|
||||
*existing = new;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -31,11 +31,10 @@ use storage_broker::Streaming;
|
||||
use tokio::select;
|
||||
use tracing::*;
|
||||
|
||||
use postgres_connection::PgConnectionConfig;
|
||||
use postgres_connection::{parse_host_port, PgConnectionConfig};
|
||||
use utils::backoff::{
|
||||
exponential_backoff, DEFAULT_BASE_BACKOFF_SECONDS, DEFAULT_MAX_BACKOFF_SECONDS,
|
||||
};
|
||||
use utils::postgres_client::wal_stream_connection_config;
|
||||
use utils::{
|
||||
id::{NodeId, TenantTimelineId},
|
||||
lsn::Lsn,
|
||||
@@ -880,6 +879,33 @@ impl ReconnectReason {
|
||||
}
|
||||
}
|
||||
|
||||
fn wal_stream_connection_config(
|
||||
TenantTimelineId {
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
}: TenantTimelineId,
|
||||
listen_pg_addr_str: &str,
|
||||
auth_token: Option<&str>,
|
||||
availability_zone: Option<&str>,
|
||||
) -> anyhow::Result<PgConnectionConfig> {
|
||||
let (host, port) =
|
||||
parse_host_port(listen_pg_addr_str).context("Unable to parse listen_pg_addr_str")?;
|
||||
let port = port.unwrap_or(5432);
|
||||
let mut connstr = PgConnectionConfig::new_host_port(host, port)
|
||||
.extend_options([
|
||||
"-c".to_owned(),
|
||||
format!("timeline_id={}", timeline_id),
|
||||
format!("tenant_id={}", tenant_id),
|
||||
])
|
||||
.set_password(auth_token.map(|s| s.to_owned()));
|
||||
|
||||
if let Some(availability_zone) = availability_zone {
|
||||
connstr = connstr.extend_options([format!("availability_zone={}", availability_zone)]);
|
||||
}
|
||||
|
||||
Ok(connstr)
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
@@ -895,7 +921,6 @@ mod tests {
|
||||
timeline: SafekeeperTimelineInfo {
|
||||
safekeeper_id: 0,
|
||||
tenant_timeline_id: None,
|
||||
term: 0,
|
||||
last_log_term: 0,
|
||||
flush_lsn: 0,
|
||||
commit_lsn,
|
||||
@@ -904,7 +929,6 @@ mod tests {
|
||||
peer_horizon_lsn: 0,
|
||||
local_start_lsn: 0,
|
||||
safekeeper_connstr: safekeeper_connstr.to_owned(),
|
||||
http_connstr: safekeeper_connstr.to_owned(),
|
||||
availability_zone: None,
|
||||
},
|
||||
latest_update,
|
||||
|
||||
@@ -1,4 +1,7 @@
|
||||
use crate::metrics::RemoteOpFileKind;
|
||||
|
||||
use super::storage_layer::LayerFileName;
|
||||
use super::storage_layer::ResidentLayer;
|
||||
use crate::tenant::metadata::TimelineMetadata;
|
||||
use crate::tenant::remote_timeline_client::index::IndexPart;
|
||||
use crate::tenant::remote_timeline_client::index::LayerFileMetadata;
|
||||
@@ -60,6 +63,7 @@ pub(crate) struct UploadQueueInitialized {
|
||||
// Breakdown of different kinds of tasks currently in-progress
|
||||
pub(crate) num_inprogress_layer_uploads: usize,
|
||||
pub(crate) num_inprogress_metadata_uploads: usize,
|
||||
pub(crate) num_inprogress_deletions: usize,
|
||||
|
||||
/// Tasks that are currently in-progress. In-progress means that a tokio Task
|
||||
/// has been launched for it. An in-progress task can be busy uploading, but it can
|
||||
@@ -117,6 +121,7 @@ impl UploadQueue {
|
||||
task_counter: 0,
|
||||
num_inprogress_layer_uploads: 0,
|
||||
num_inprogress_metadata_uploads: 0,
|
||||
num_inprogress_deletions: 0,
|
||||
inprogress_tasks: HashMap::new(),
|
||||
queued_operations: VecDeque::new(),
|
||||
};
|
||||
@@ -158,6 +163,7 @@ impl UploadQueue {
|
||||
task_counter: 0,
|
||||
num_inprogress_layer_uploads: 0,
|
||||
num_inprogress_metadata_uploads: 0,
|
||||
num_inprogress_deletions: 0,
|
||||
inprogress_tasks: HashMap::new(),
|
||||
queued_operations: VecDeque::new(),
|
||||
};
|
||||
@@ -195,14 +201,24 @@ pub(crate) struct UploadTask {
|
||||
pub(crate) op: UploadOp,
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
pub(crate) struct Delete {
|
||||
pub(crate) file_kind: RemoteOpFileKind,
|
||||
pub(crate) layer_file_name: LayerFileName,
|
||||
pub(crate) scheduled_from_timeline_delete: bool,
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
pub(crate) enum UploadOp {
|
||||
/// Upload a layer file
|
||||
UploadLayer(LayerFileName, LayerFileMetadata),
|
||||
UploadLayer(ResidentLayer, LayerFileMetadata),
|
||||
|
||||
/// Upload the metadata file
|
||||
UploadMetadata(IndexPart, Lsn),
|
||||
|
||||
/// Delete a layer file
|
||||
Delete(Delete),
|
||||
|
||||
/// Barrier. When the barrier operation is reached,
|
||||
Barrier(tokio::sync::watch::Sender<()>),
|
||||
}
|
||||
@@ -210,17 +226,16 @@ pub(crate) enum UploadOp {
|
||||
impl std::fmt::Display for UploadOp {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter) -> std::fmt::Result {
|
||||
match self {
|
||||
UploadOp::UploadLayer(path, metadata) => {
|
||||
write!(
|
||||
f,
|
||||
"UploadLayer({}, size={:?})",
|
||||
path.file_name(),
|
||||
metadata.file_size()
|
||||
)
|
||||
}
|
||||
UploadOp::UploadMetadata(_, lsn) => {
|
||||
write!(f, "UploadMetadata(lsn: {})", lsn)
|
||||
UploadOp::UploadLayer(layer, metadata) => {
|
||||
write!(f, "UploadLayer({}, size={:?})", layer, metadata.file_size())
|
||||
}
|
||||
UploadOp::UploadMetadata(_, lsn) => write!(f, "UploadMetadata(lsn: {})", lsn),
|
||||
UploadOp::Delete(delete) => write!(
|
||||
f,
|
||||
"Delete(path: {}, scheduled_from_timeline_delete: {})",
|
||||
delete.layer_file_name.file_name(),
|
||||
delete.scheduled_from_timeline_delete
|
||||
),
|
||||
UploadOp::Barrier(_) => write!(f, "Barrier"),
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
-bash: scripts/pytest: No such file or directory
|
||||
@@ -341,35 +341,21 @@ async fn start_safekeeper(conf: SafeKeeperConf) -> Result<()> {
|
||||
|
||||
let (wal_backup_launcher_tx, wal_backup_launcher_rx) = mpsc::channel(100);
|
||||
|
||||
// Load all timelines from disk to memory.
|
||||
GlobalTimelines::init(conf.clone(), wal_backup_launcher_tx)?;
|
||||
|
||||
// Keep handles to main tasks to die if any of them disappears.
|
||||
let mut tasks_handles: FuturesUnordered<BoxFuture<(String, JoinTaskRes)>> =
|
||||
FuturesUnordered::new();
|
||||
|
||||
// Start wal backup launcher before loading timelines as we'll notify it
|
||||
// through the channel about timelines which need offloading, not draining
|
||||
// the channel would cause deadlock.
|
||||
let current_thread_rt = conf
|
||||
.current_thread_runtime
|
||||
.then(|| Handle::try_current().expect("no runtime in main"));
|
||||
let conf_ = conf.clone();
|
||||
let wal_backup_handle = current_thread_rt
|
||||
.as_ref()
|
||||
.unwrap_or_else(|| WAL_BACKUP_RUNTIME.handle())
|
||||
.spawn(wal_backup::wal_backup_launcher_task_main(
|
||||
conf_,
|
||||
wal_backup_launcher_rx,
|
||||
))
|
||||
.map(|res| ("WAL backup launcher".to_owned(), res));
|
||||
tasks_handles.push(Box::pin(wal_backup_handle));
|
||||
|
||||
// Load all timelines from disk to memory.
|
||||
GlobalTimelines::init(conf.clone(), wal_backup_launcher_tx).await?;
|
||||
|
||||
let conf_ = conf.clone();
|
||||
// Run everything in current thread rt, if asked.
|
||||
if conf.current_thread_runtime {
|
||||
info!("running in current thread runtime");
|
||||
}
|
||||
let current_thread_rt = conf
|
||||
.current_thread_runtime
|
||||
.then(|| Handle::try_current().expect("no runtime in main"));
|
||||
|
||||
let wal_service_handle = current_thread_rt
|
||||
.as_ref()
|
||||
@@ -422,6 +408,17 @@ async fn start_safekeeper(conf: SafeKeeperConf) -> Result<()> {
|
||||
.map(|res| ("WAL remover".to_owned(), res));
|
||||
tasks_handles.push(Box::pin(wal_remover_handle));
|
||||
|
||||
let conf_ = conf.clone();
|
||||
let wal_backup_handle = current_thread_rt
|
||||
.as_ref()
|
||||
.unwrap_or_else(|| WAL_BACKUP_RUNTIME.handle())
|
||||
.spawn(wal_backup::wal_backup_launcher_task_main(
|
||||
conf_,
|
||||
wal_backup_launcher_rx,
|
||||
))
|
||||
.map(|res| ("WAL backup launcher".to_owned(), res));
|
||||
tasks_handles.push(Box::pin(wal_backup_handle));
|
||||
|
||||
set_build_info_metric(GIT_VERSION);
|
||||
|
||||
// TODO: update tokio-stream, convert to real async Stream with
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
//! Code to deal with safekeeper control file upgrades
|
||||
use crate::safekeeper::{
|
||||
AcceptorState, PersistedPeers, PgUuid, SafeKeeperState, ServerInfo, Term, TermHistory, TermLsn,
|
||||
AcceptorState, PersistedPeers, PgUuid, SafeKeeperState, ServerInfo, Term, TermHistory,
|
||||
TermSwitchEntry,
|
||||
};
|
||||
use anyhow::{bail, Result};
|
||||
use pq_proto::SystemId;
|
||||
@@ -144,7 +145,7 @@ pub fn upgrade_control_file(buf: &[u8], version: u32) -> Result<SafeKeeperState>
|
||||
let oldstate = SafeKeeperStateV1::des(&buf[..buf.len()])?;
|
||||
let ac = AcceptorState {
|
||||
term: oldstate.acceptor_state.term,
|
||||
term_history: TermHistory(vec![TermLsn {
|
||||
term_history: TermHistory(vec![TermSwitchEntry {
|
||||
term: oldstate.acceptor_state.epoch,
|
||||
lsn: Lsn(0),
|
||||
}]),
|
||||
|
||||
@@ -19,7 +19,6 @@ use crate::receive_wal::WalReceiverState;
|
||||
use crate::safekeeper::ServerInfo;
|
||||
use crate::safekeeper::Term;
|
||||
use crate::send_wal::WalSenderState;
|
||||
use crate::timeline::PeerInfo;
|
||||
use crate::{debug_dump, pull_timeline};
|
||||
|
||||
use crate::timelines_global_map::TimelineDeleteForceResult;
|
||||
@@ -102,7 +101,6 @@ pub struct TimelineStatus {
|
||||
pub peer_horizon_lsn: Lsn,
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
pub remote_consistent_lsn: Lsn,
|
||||
pub peers: Vec<PeerInfo>,
|
||||
pub walsenders: Vec<WalSenderState>,
|
||||
pub walreceivers: Vec<WalReceiverState>,
|
||||
}
|
||||
@@ -142,7 +140,6 @@ async fn timeline_status_handler(request: Request<Body>) -> Result<Response<Body
|
||||
term_history,
|
||||
};
|
||||
|
||||
let conf = get_conf(&request);
|
||||
// Note: we report in memory values which can be lost.
|
||||
let status = TimelineStatus {
|
||||
tenant_id: ttid.tenant_id,
|
||||
@@ -156,7 +153,6 @@ async fn timeline_status_handler(request: Request<Body>) -> Result<Response<Body
|
||||
backup_lsn: inmem.backup_lsn,
|
||||
peer_horizon_lsn: inmem.peer_horizon_lsn,
|
||||
remote_consistent_lsn: tli.get_walsenders().get_remote_consistent_lsn(),
|
||||
peers: tli.get_peers(conf).await,
|
||||
walsenders: tli.get_walsenders().get_all(),
|
||||
walreceivers: tli.get_walreceivers().get_all(),
|
||||
};
|
||||
@@ -286,14 +282,12 @@ async fn record_safekeeper_info(mut request: Request<Body>) -> Result<Response<B
|
||||
tenant_id: ttid.tenant_id.as_ref().to_owned(),
|
||||
timeline_id: ttid.timeline_id.as_ref().to_owned(),
|
||||
}),
|
||||
term: sk_info.term.unwrap_or(0),
|
||||
last_log_term: sk_info.last_log_term.unwrap_or(0),
|
||||
flush_lsn: sk_info.flush_lsn.0,
|
||||
commit_lsn: sk_info.commit_lsn.0,
|
||||
remote_consistent_lsn: sk_info.remote_consistent_lsn.0,
|
||||
peer_horizon_lsn: sk_info.peer_horizon_lsn.0,
|
||||
safekeeper_connstr: sk_info.safekeeper_connstr.unwrap_or_else(|| "".to_owned()),
|
||||
http_connstr: sk_info.http_connstr.unwrap_or_else(|| "".to_owned()),
|
||||
backup_lsn: sk_info.backup_lsn.0,
|
||||
local_start_lsn: sk_info.local_start_lsn.0,
|
||||
availability_zone: None,
|
||||
|
||||
@@ -21,7 +21,7 @@ use crate::safekeeper::{AcceptorProposerMessage, AppendResponse, ServerInfo};
|
||||
use crate::safekeeper::{
|
||||
AppendRequest, AppendRequestHeader, ProposerAcceptorMessage, ProposerElected,
|
||||
};
|
||||
use crate::safekeeper::{SafeKeeperState, Term, TermHistory, TermLsn};
|
||||
use crate::safekeeper::{SafeKeeperState, Term, TermHistory, TermSwitchEntry};
|
||||
use crate::timeline::Timeline;
|
||||
use crate::GlobalTimelines;
|
||||
use postgres_backend::PostgresBackend;
|
||||
@@ -119,7 +119,7 @@ async fn send_proposer_elected(tli: &Arc<Timeline>, term: Term, lsn: Lsn) -> any
|
||||
let history = tli.get_state().await.1.acceptor_state.term_history;
|
||||
let history = history.up_to(lsn.checked_sub(1u64).unwrap());
|
||||
let mut history_entries = history.0;
|
||||
history_entries.push(TermLsn { term, lsn });
|
||||
history_entries.push(TermSwitchEntry { term, lsn });
|
||||
let history = TermHistory(history_entries);
|
||||
|
||||
let proposer_elected_request = ProposerAcceptorMessage::Elected(ProposerElected {
|
||||
|
||||
@@ -19,7 +19,6 @@ pub mod json_ctrl;
|
||||
pub mod metrics;
|
||||
pub mod pull_timeline;
|
||||
pub mod receive_wal;
|
||||
pub mod recovery;
|
||||
pub mod remove_wal;
|
||||
pub mod safekeeper;
|
||||
pub mod send_wal;
|
||||
|
||||
@@ -227,9 +227,7 @@ async fn pull_timeline(status: TimelineStatus, host: String) -> Result<Response>
|
||||
tokio::fs::create_dir_all(conf.tenant_dir(&ttid.tenant_id)).await?;
|
||||
tokio::fs::rename(tli_dir_path, &timeline_path).await?;
|
||||
|
||||
let tli = GlobalTimelines::load_timeline(ttid)
|
||||
.await
|
||||
.context("Failed to load timeline after copy")?;
|
||||
let tli = GlobalTimelines::load_timeline(ttid).context("Failed to load timeline after copy")?;
|
||||
|
||||
info!(
|
||||
"Loaded timeline {}, flush_lsn={}",
|
||||
|
||||
@@ -1,40 +0,0 @@
|
||||
//! This module implements pulling WAL from peer safekeepers if compute can't
|
||||
//! provide it, i.e. safekeeper lags too much.
|
||||
|
||||
use std::sync::Arc;
|
||||
|
||||
use tokio::{select, time::sleep, time::Duration};
|
||||
use tracing::{info, instrument};
|
||||
|
||||
use crate::{timeline::Timeline, SafeKeeperConf};
|
||||
|
||||
/// Entrypoint for per timeline task which always runs, checking whether
|
||||
/// recovery for this safekeeper is needed and starting it if so.
|
||||
#[instrument(name = "recovery task", skip_all, fields(ttid = %tli.ttid))]
|
||||
pub async fn recovery_main(tli: Arc<Timeline>, _conf: SafeKeeperConf) {
|
||||
info!("started");
|
||||
let mut cancellation_rx = match tli.get_cancellation_rx() {
|
||||
Ok(rx) => rx,
|
||||
Err(_) => {
|
||||
info!("timeline canceled during task start");
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
select! {
|
||||
_ = recovery_main_loop(tli) => { unreachable!() }
|
||||
_ = cancellation_rx.changed() => {
|
||||
info!("stopped");
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
const CHECK_INTERVAL_MS: u64 = 2000;
|
||||
|
||||
/// Check regularly whether we need to start recovery.
|
||||
async fn recovery_main_loop(_tli: Arc<Timeline>) {
|
||||
let check_duration = Duration::from_millis(CHECK_INTERVAL_MS);
|
||||
loop {
|
||||
sleep(check_duration).await;
|
||||
}
|
||||
}
|
||||
@@ -34,33 +34,22 @@ pub const UNKNOWN_SERVER_VERSION: u32 = 0;
|
||||
|
||||
/// Consensus logical timestamp.
|
||||
pub type Term = u64;
|
||||
pub const INVALID_TERM: Term = 0;
|
||||
const INVALID_TERM: Term = 0;
|
||||
|
||||
#[derive(Debug, Clone, Copy, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct TermLsn {
|
||||
#[derive(Debug, Clone, Copy, Serialize, Deserialize)]
|
||||
pub struct TermSwitchEntry {
|
||||
pub term: Term,
|
||||
pub lsn: Lsn,
|
||||
}
|
||||
|
||||
// Creation from tuple provides less typing (e.g. for unit tests).
|
||||
impl From<(Term, Lsn)> for TermLsn {
|
||||
fn from(pair: (Term, Lsn)) -> TermLsn {
|
||||
TermLsn {
|
||||
term: pair.0,
|
||||
lsn: pair.1,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Serialize, Deserialize)]
|
||||
pub struct TermHistory(pub Vec<TermLsn>);
|
||||
pub struct TermHistory(pub Vec<TermSwitchEntry>);
|
||||
|
||||
impl TermHistory {
|
||||
pub fn empty() -> TermHistory {
|
||||
TermHistory(Vec::new())
|
||||
}
|
||||
|
||||
// Parse TermHistory as n_entries followed by TermLsn pairs
|
||||
// Parse TermHistory as n_entries followed by TermSwitchEntry pairs
|
||||
pub fn from_bytes(bytes: &mut Bytes) -> Result<TermHistory> {
|
||||
if bytes.remaining() < 4 {
|
||||
bail!("TermHistory misses len");
|
||||
@@ -71,7 +60,7 @@ impl TermHistory {
|
||||
if bytes.remaining() < 16 {
|
||||
bail!("TermHistory is incomplete");
|
||||
}
|
||||
res.push(TermLsn {
|
||||
res.push(TermSwitchEntry {
|
||||
term: bytes.get_u64_le(),
|
||||
lsn: bytes.get_u64_le().into(),
|
||||
})
|
||||
@@ -568,17 +557,12 @@ where
|
||||
.up_to(self.flush_lsn())
|
||||
}
|
||||
|
||||
/// Get current term.
|
||||
pub fn get_term(&self) -> Term {
|
||||
self.state.acceptor_state.term
|
||||
}
|
||||
|
||||
pub fn get_epoch(&self) -> Term {
|
||||
self.state.acceptor_state.get_epoch(self.flush_lsn())
|
||||
}
|
||||
|
||||
/// wal_store wrapper avoiding commit_lsn <= flush_lsn violation when we don't have WAL yet.
|
||||
pub fn flush_lsn(&self) -> Lsn {
|
||||
fn flush_lsn(&self) -> Lsn {
|
||||
max(self.wal_store.flush_lsn(), self.state.timeline_start_lsn)
|
||||
}
|
||||
|
||||
@@ -1154,7 +1138,7 @@ mod tests {
|
||||
let pem = ProposerElected {
|
||||
term: 1,
|
||||
start_streaming_at: Lsn(1),
|
||||
term_history: TermHistory(vec![TermLsn {
|
||||
term_history: TermHistory(vec![TermSwitchEntry {
|
||||
term: 1,
|
||||
lsn: Lsn(3),
|
||||
}]),
|
||||
|
||||
@@ -2,12 +2,12 @@
|
||||
//! with the "START_REPLICATION" message, and registry of walsenders.
|
||||
|
||||
use crate::handler::SafekeeperPostgresHandler;
|
||||
use crate::safekeeper::{Term, TermLsn};
|
||||
use crate::safekeeper::Term;
|
||||
use crate::timeline::Timeline;
|
||||
use crate::wal_service::ConnectionId;
|
||||
use crate::wal_storage::WalReader;
|
||||
use crate::GlobalTimelines;
|
||||
use anyhow::{bail, Context as AnyhowContext};
|
||||
use anyhow::Context as AnyhowContext;
|
||||
use bytes::Bytes;
|
||||
use parking_lot::Mutex;
|
||||
use postgres_backend::PostgresBackend;
|
||||
@@ -390,25 +390,26 @@ impl SafekeeperPostgresHandler {
|
||||
self.appname.clone(),
|
||||
));
|
||||
|
||||
// Walsender can operate in one of two modes which we select by
|
||||
// application_name: give only committed WAL (used by pageserver) or all
|
||||
// existing WAL (up to flush_lsn, used by walproposer or peer recovery).
|
||||
// The second case is always driven by a consensus leader which term
|
||||
// must generally be also supplied. However we're sloppy to do this in
|
||||
// walproposer recovery which will be removed soon. So TODO is to make
|
||||
// it not Option'al then.
|
||||
let commit_lsn_watch_rx = tli.get_commit_lsn_watch_rx();
|
||||
|
||||
// Walproposer gets special handling: safekeeper must give proposer all
|
||||
// local WAL till the end, whether committed or not (walproposer will
|
||||
// hang otherwise). That's because walproposer runs the consensus and
|
||||
// synchronizes safekeepers on the most advanced one.
|
||||
//
|
||||
// Fetching WAL without term in recovery creates a small risk of this
|
||||
// WAL getting concurrently garbaged if another compute rises which
|
||||
// collects majority and starts fixing log on this safekeeper itself.
|
||||
// That's ok as (old) proposer will never be able to commit such WAL.
|
||||
let end_watch = if self.is_walproposer_recovery() {
|
||||
EndWatch::Flush(tli.get_term_flush_lsn_watch_rx())
|
||||
// There is a small risk of this WAL getting concurrently garbaged if
|
||||
// another compute rises which collects majority and starts fixing log
|
||||
// on this safekeeper itself. That's ok as (old) proposer will never be
|
||||
// able to commit such WAL.
|
||||
let stop_pos: Option<Lsn> = if self.is_walproposer_recovery() {
|
||||
let wal_end = tli.get_flush_lsn().await;
|
||||
Some(wal_end)
|
||||
} else {
|
||||
EndWatch::Commit(tli.get_commit_lsn_watch_rx())
|
||||
None
|
||||
};
|
||||
// we don't check term here; it will be checked on first waiting/WAL reading anyway.
|
||||
let end_pos = end_watch.get();
|
||||
|
||||
// take the latest commit_lsn if don't have stop_pos
|
||||
let end_pos = stop_pos.unwrap_or(*commit_lsn_watch_rx.borrow());
|
||||
|
||||
if end_pos < start_pos {
|
||||
warn!(
|
||||
@@ -418,10 +419,8 @@ impl SafekeeperPostgresHandler {
|
||||
}
|
||||
|
||||
info!(
|
||||
"starting streaming from {:?}, available WAL ends at {}, recovery={}",
|
||||
start_pos,
|
||||
end_pos,
|
||||
matches!(end_watch, EndWatch::Flush(_))
|
||||
"starting streaming from {:?} till {:?}, available WAL ends at {}",
|
||||
start_pos, stop_pos, end_pos
|
||||
);
|
||||
|
||||
// switch to copy
|
||||
@@ -446,8 +445,9 @@ impl SafekeeperPostgresHandler {
|
||||
appname,
|
||||
start_pos,
|
||||
end_pos,
|
||||
stop_pos,
|
||||
term,
|
||||
end_watch,
|
||||
commit_lsn_watch_rx,
|
||||
ws_guard: ws_guard.clone(),
|
||||
wal_reader,
|
||||
send_buf: [0; MAX_SEND_SIZE],
|
||||
@@ -466,32 +466,6 @@ impl SafekeeperPostgresHandler {
|
||||
}
|
||||
}
|
||||
|
||||
/// Walsender streams either up to commit_lsn (normally) or flush_lsn in the
|
||||
/// given term (recovery by walproposer or peer safekeeper).
|
||||
enum EndWatch {
|
||||
Commit(Receiver<Lsn>),
|
||||
Flush(Receiver<TermLsn>),
|
||||
}
|
||||
|
||||
impl EndWatch {
|
||||
/// Get current end of WAL.
|
||||
fn get(&self) -> Lsn {
|
||||
match self {
|
||||
EndWatch::Commit(r) => *r.borrow(),
|
||||
EndWatch::Flush(r) => r.borrow().lsn,
|
||||
}
|
||||
}
|
||||
|
||||
/// Wait for the update.
|
||||
async fn changed(&mut self) -> anyhow::Result<()> {
|
||||
match self {
|
||||
EndWatch::Commit(r) => r.changed().await?,
|
||||
EndWatch::Flush(r) => r.changed().await?,
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// A half driving sending WAL.
|
||||
struct WalSender<'a, IO> {
|
||||
pgb: &'a mut PostgresBackend<IO>,
|
||||
@@ -506,12 +480,14 @@ struct WalSender<'a, IO> {
|
||||
// We send this LSN to the receiver as wal_end, so that it knows how much
|
||||
// WAL this safekeeper has. This LSN should be as fresh as possible.
|
||||
end_pos: Lsn,
|
||||
// If present, terminate after reaching this position; used by walproposer
|
||||
// in recovery.
|
||||
stop_pos: Option<Lsn>,
|
||||
/// When streaming uncommitted part, the term the client acts as the leader
|
||||
/// in. Streaming is stopped if local term changes to a different (higher)
|
||||
/// value.
|
||||
term: Option<Term>,
|
||||
/// Watch channel receiver to learn end of available WAL (and wait for its advancement).
|
||||
end_watch: EndWatch,
|
||||
commit_lsn_watch_rx: Receiver<Lsn>,
|
||||
ws_guard: Arc<WalSenderGuard>,
|
||||
wal_reader: WalReader,
|
||||
// buffer for readling WAL into to send it
|
||||
@@ -521,20 +497,29 @@ struct WalSender<'a, IO> {
|
||||
impl<IO: AsyncRead + AsyncWrite + Unpin> WalSender<'_, IO> {
|
||||
/// Send WAL until
|
||||
/// - an error occurs
|
||||
/// - receiver is caughtup and there is no computes (if streaming up to commit_lsn)
|
||||
/// - if we are streaming to walproposer, we've streamed until stop_pos
|
||||
/// (recovery finished)
|
||||
/// - receiver is caughtup and there is no computes
|
||||
///
|
||||
/// Err(CopyStreamHandlerEnd) is always returned; Result is used only for ?
|
||||
/// convenience.
|
||||
async fn run(&mut self) -> Result<(), CopyStreamHandlerEnd> {
|
||||
loop {
|
||||
// Wait for the next portion if it is not there yet, or just
|
||||
// update our end of WAL available for sending value, we
|
||||
// communicate it to the receiver.
|
||||
self.wait_wal().await?;
|
||||
assert!(
|
||||
self.end_pos > self.start_pos,
|
||||
"nothing to send after waiting for WAL"
|
||||
);
|
||||
// If we are streaming to walproposer, check it is time to stop.
|
||||
if let Some(stop_pos) = self.stop_pos {
|
||||
if self.start_pos >= stop_pos {
|
||||
// recovery finished
|
||||
return Err(CopyStreamHandlerEnd::ServerInitiated(format!(
|
||||
"ending streaming to walproposer at {}, recovery finished",
|
||||
self.start_pos
|
||||
)));
|
||||
}
|
||||
} else {
|
||||
// Wait for the next portion if it is not there yet, or just
|
||||
// update our end of WAL available for sending value, we
|
||||
// communicate it to the receiver.
|
||||
self.wait_wal().await?;
|
||||
}
|
||||
|
||||
// try to send as much as available, capped by MAX_SEND_SIZE
|
||||
let mut send_size = self
|
||||
@@ -582,7 +567,7 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> WalSender<'_, IO> {
|
||||
/// exit in the meanwhile
|
||||
async fn wait_wal(&mut self) -> Result<(), CopyStreamHandlerEnd> {
|
||||
loop {
|
||||
self.end_pos = self.end_watch.get();
|
||||
self.end_pos = *self.commit_lsn_watch_rx.borrow();
|
||||
if self.end_pos > self.start_pos {
|
||||
// We have something to send.
|
||||
trace!("got end_pos {:?}, streaming", self.end_pos);
|
||||
@@ -590,31 +575,27 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> WalSender<'_, IO> {
|
||||
}
|
||||
|
||||
// Wait for WAL to appear, now self.end_pos == self.start_pos.
|
||||
if let Some(lsn) = wait_for_lsn(&mut self.end_watch, self.term, self.start_pos).await? {
|
||||
if let Some(lsn) = wait_for_lsn(&mut self.commit_lsn_watch_rx, self.start_pos).await? {
|
||||
self.end_pos = lsn;
|
||||
trace!("got end_pos {:?}, streaming", self.end_pos);
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
// Timed out waiting for WAL, check for termination and send KA.
|
||||
// Check for termination only if we are streaming up to commit_lsn
|
||||
// (to pageserver).
|
||||
if let EndWatch::Commit(_) = self.end_watch {
|
||||
if let Some(remote_consistent_lsn) = self
|
||||
.ws_guard
|
||||
.walsenders
|
||||
.get_ws_remote_consistent_lsn(self.ws_guard.id)
|
||||
{
|
||||
if self.tli.should_walsender_stop(remote_consistent_lsn).await {
|
||||
// Terminate if there is nothing more to send.
|
||||
// Note that "ending streaming" part of the string is used by
|
||||
// pageserver to identify WalReceiverError::SuccessfulCompletion,
|
||||
// do not change this string without updating pageserver.
|
||||
return Err(CopyStreamHandlerEnd::ServerInitiated(format!(
|
||||
// Timed out waiting for WAL, check for termination and send KA
|
||||
if let Some(remote_consistent_lsn) = self
|
||||
.ws_guard
|
||||
.walsenders
|
||||
.get_ws_remote_consistent_lsn(self.ws_guard.id)
|
||||
{
|
||||
if self.tli.should_walsender_stop(remote_consistent_lsn).await {
|
||||
// Terminate if there is nothing more to send.
|
||||
// Note that "ending streaming" part of the string is used by
|
||||
// pageserver to identify WalReceiverError::SuccessfulCompletion,
|
||||
// do not change this string without updating pageserver.
|
||||
return Err(CopyStreamHandlerEnd::ServerInitiated(format!(
|
||||
"ending streaming to {:?} at {}, receiver is caughtup and there is no computes",
|
||||
self.appname, self.start_pos,
|
||||
)));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -682,32 +663,22 @@ impl<IO: AsyncRead + AsyncWrite + Unpin> ReplyReader<IO> {
|
||||
|
||||
const POLL_STATE_TIMEOUT: Duration = Duration::from_secs(1);
|
||||
|
||||
/// Wait until we have available WAL > start_pos or timeout expires. Returns
|
||||
/// - Ok(Some(end_pos)) if needed lsn is successfully observed;
|
||||
/// Wait until we have commit_lsn > lsn or timeout expires. Returns
|
||||
/// - Ok(Some(commit_lsn)) if needed lsn is successfully observed;
|
||||
/// - Ok(None) if timeout expired;
|
||||
/// - Err in case of error -- only if 1) term changed while fetching in recovery
|
||||
/// mode 2) watch channel closed, which must never happen.
|
||||
async fn wait_for_lsn(
|
||||
rx: &mut EndWatch,
|
||||
client_term: Option<Term>,
|
||||
start_pos: Lsn,
|
||||
) -> anyhow::Result<Option<Lsn>> {
|
||||
/// - Err in case of error (if watch channel is in trouble, shouldn't happen).
|
||||
async fn wait_for_lsn(rx: &mut Receiver<Lsn>, lsn: Lsn) -> anyhow::Result<Option<Lsn>> {
|
||||
let res = timeout(POLL_STATE_TIMEOUT, async move {
|
||||
let mut commit_lsn;
|
||||
loop {
|
||||
let end_pos = rx.get();
|
||||
if end_pos > start_pos {
|
||||
return Ok(end_pos);
|
||||
}
|
||||
if let EndWatch::Flush(rx) = rx {
|
||||
let curr_term = rx.borrow().term;
|
||||
if let Some(client_term) = client_term {
|
||||
if curr_term != client_term {
|
||||
bail!("term changed: requested {}, now {}", client_term, curr_term);
|
||||
}
|
||||
}
|
||||
}
|
||||
rx.changed().await?;
|
||||
commit_lsn = *rx.borrow();
|
||||
if commit_lsn > lsn {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(commit_lsn)
|
||||
})
|
||||
.await;
|
||||
|
||||
|
||||
@@ -3,11 +3,8 @@
|
||||
|
||||
use anyhow::{anyhow, bail, Result};
|
||||
use postgres_ffi::XLogSegNo;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use serde_with::serde_as;
|
||||
use tokio::fs;
|
||||
|
||||
use serde_with::DisplayFromStr;
|
||||
use std::cmp::max;
|
||||
use std::path::PathBuf;
|
||||
use std::sync::Arc;
|
||||
@@ -27,10 +24,9 @@ use storage_broker::proto::SafekeeperTimelineInfo;
|
||||
use storage_broker::proto::TenantTimelineId as ProtoTenantTimelineId;
|
||||
|
||||
use crate::receive_wal::WalReceivers;
|
||||
use crate::recovery::recovery_main;
|
||||
use crate::safekeeper::{
|
||||
AcceptorProposerMessage, ProposerAcceptorMessage, SafeKeeper, SafeKeeperState,
|
||||
SafekeeperMemState, ServerInfo, Term, TermLsn, INVALID_TERM,
|
||||
SafekeeperMemState, ServerInfo, Term,
|
||||
};
|
||||
use crate::send_wal::WalSenders;
|
||||
use crate::{control_file, safekeeper::UNKNOWN_SERVER_VERSION};
|
||||
@@ -41,25 +37,18 @@ use crate::SafeKeeperConf;
|
||||
use crate::{debug_dump, wal_storage};
|
||||
|
||||
/// Things safekeeper should know about timeline state on peers.
|
||||
#[serde_as]
|
||||
#[derive(Debug, Clone, Serialize, Deserialize)]
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct PeerInfo {
|
||||
pub sk_id: NodeId,
|
||||
/// Term of the last entry.
|
||||
_last_log_term: Term,
|
||||
/// LSN of the last record.
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
_flush_lsn: Lsn,
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
pub commit_lsn: Lsn,
|
||||
/// Since which LSN safekeeper has WAL. TODO: remove this once we fill new
|
||||
/// sk since backup_lsn.
|
||||
#[serde_as(as = "DisplayFromStr")]
|
||||
pub local_start_lsn: Lsn,
|
||||
/// When info was received. Serde annotations are not very useful but make
|
||||
/// the code compile -- we don't rely on this field externally.
|
||||
#[serde(skip)]
|
||||
#[serde(default = "Instant::now")]
|
||||
/// When info was received.
|
||||
ts: Instant,
|
||||
}
|
||||
|
||||
@@ -248,9 +237,8 @@ impl SharedState {
|
||||
tenant_id: ttid.tenant_id.as_ref().to_owned(),
|
||||
timeline_id: ttid.timeline_id.as_ref().to_owned(),
|
||||
}),
|
||||
term: self.sk.state.acceptor_state.term,
|
||||
last_log_term: self.sk.get_epoch(),
|
||||
flush_lsn: self.sk.flush_lsn().0,
|
||||
flush_lsn: self.sk.wal_store.flush_lsn().0,
|
||||
// note: this value is not flushed to control file yet and can be lost
|
||||
commit_lsn: self.sk.inmem.commit_lsn.0,
|
||||
remote_consistent_lsn: remote_consistent_lsn.0,
|
||||
@@ -259,7 +247,6 @@ impl SharedState {
|
||||
.advertise_pg_addr
|
||||
.to_owned()
|
||||
.unwrap_or(conf.listen_pg_addr.clone()),
|
||||
http_connstr: conf.listen_http_addr.to_owned(),
|
||||
backup_lsn: self.sk.inmem.backup_lsn.0,
|
||||
local_start_lsn: self.sk.state.local_start_lsn.0,
|
||||
availability_zone: conf.availability_zone.clone(),
|
||||
@@ -309,13 +296,6 @@ pub struct Timeline {
|
||||
commit_lsn_watch_tx: watch::Sender<Lsn>,
|
||||
commit_lsn_watch_rx: watch::Receiver<Lsn>,
|
||||
|
||||
/// Broadcasts (current term, flush_lsn) updates, walsender is interested in
|
||||
/// them when sending in recovery mode (to walproposer or peers). Note: this
|
||||
/// is just a notification, WAL reading should always done with lock held as
|
||||
/// term can change otherwise.
|
||||
term_flush_lsn_watch_tx: watch::Sender<TermLsn>,
|
||||
term_flush_lsn_watch_rx: watch::Receiver<TermLsn>,
|
||||
|
||||
/// Safekeeper and other state, that should remain consistent and
|
||||
/// synchronized with the disk. This is tokio mutex as we write WAL to disk
|
||||
/// while holding it, ensuring that consensus checks are in order.
|
||||
@@ -337,20 +317,16 @@ pub struct Timeline {
|
||||
impl Timeline {
|
||||
/// Load existing timeline from disk.
|
||||
pub fn load_timeline(
|
||||
conf: &SafeKeeperConf,
|
||||
conf: SafeKeeperConf,
|
||||
ttid: TenantTimelineId,
|
||||
wal_backup_launcher_tx: Sender<TenantTimelineId>,
|
||||
) -> Result<Timeline> {
|
||||
let _enter = info_span!("load_timeline", timeline = %ttid.timeline_id).entered();
|
||||
|
||||
let shared_state = SharedState::restore(conf, &ttid)?;
|
||||
let shared_state = SharedState::restore(&conf, &ttid)?;
|
||||
let rcl = shared_state.sk.state.remote_consistent_lsn;
|
||||
let (commit_lsn_watch_tx, commit_lsn_watch_rx) =
|
||||
watch::channel(shared_state.sk.state.commit_lsn);
|
||||
let (term_flush_lsn_watch_tx, term_flush_lsn_watch_rx) = watch::channel(TermLsn::from((
|
||||
shared_state.sk.get_term(),
|
||||
shared_state.sk.flush_lsn(),
|
||||
)));
|
||||
let (cancellation_tx, cancellation_rx) = watch::channel(false);
|
||||
|
||||
Ok(Timeline {
|
||||
@@ -358,8 +334,6 @@ impl Timeline {
|
||||
wal_backup_launcher_tx,
|
||||
commit_lsn_watch_tx,
|
||||
commit_lsn_watch_rx,
|
||||
term_flush_lsn_watch_tx,
|
||||
term_flush_lsn_watch_rx,
|
||||
mutex: Mutex::new(shared_state),
|
||||
walsenders: WalSenders::new(rcl),
|
||||
walreceivers: WalReceivers::new(),
|
||||
@@ -371,7 +345,7 @@ impl Timeline {
|
||||
|
||||
/// Create a new timeline, which is not yet persisted to disk.
|
||||
pub fn create_empty(
|
||||
conf: &SafeKeeperConf,
|
||||
conf: SafeKeeperConf,
|
||||
ttid: TenantTimelineId,
|
||||
wal_backup_launcher_tx: Sender<TenantTimelineId>,
|
||||
server_info: ServerInfo,
|
||||
@@ -379,8 +353,6 @@ impl Timeline {
|
||||
local_start_lsn: Lsn,
|
||||
) -> Result<Timeline> {
|
||||
let (commit_lsn_watch_tx, commit_lsn_watch_rx) = watch::channel(Lsn::INVALID);
|
||||
let (term_flush_lsn_watch_tx, term_flush_lsn_watch_rx) =
|
||||
watch::channel(TermLsn::from((INVALID_TERM, Lsn::INVALID)));
|
||||
let (cancellation_tx, cancellation_rx) = watch::channel(false);
|
||||
let state = SafeKeeperState::new(&ttid, server_info, vec![], commit_lsn, local_start_lsn);
|
||||
|
||||
@@ -389,9 +361,7 @@ impl Timeline {
|
||||
wal_backup_launcher_tx,
|
||||
commit_lsn_watch_tx,
|
||||
commit_lsn_watch_rx,
|
||||
term_flush_lsn_watch_tx,
|
||||
term_flush_lsn_watch_rx,
|
||||
mutex: Mutex::new(SharedState::create_new(conf, &ttid, state)?),
|
||||
mutex: Mutex::new(SharedState::create_new(&conf, &ttid, state)?),
|
||||
walsenders: WalSenders::new(Lsn(0)),
|
||||
walreceivers: WalReceivers::new(),
|
||||
cancellation_rx,
|
||||
@@ -400,16 +370,12 @@ impl Timeline {
|
||||
})
|
||||
}
|
||||
|
||||
/// Initialize fresh timeline on disk and start background tasks. If init
|
||||
/// Initialize fresh timeline on disk and start background tasks. If bootstrap
|
||||
/// fails, timeline is cancelled and cannot be used anymore.
|
||||
///
|
||||
/// Init is transactional, so if it fails, created files will be deleted,
|
||||
/// Bootstrap is transactional, so if it fails, created files will be deleted,
|
||||
/// and state on disk should remain unchanged.
|
||||
pub async fn init_new(
|
||||
self: &Arc<Timeline>,
|
||||
shared_state: &mut MutexGuard<'_, SharedState>,
|
||||
conf: &SafeKeeperConf,
|
||||
) -> Result<()> {
|
||||
pub async fn bootstrap(&self, shared_state: &mut MutexGuard<'_, SharedState>) -> Result<()> {
|
||||
match fs::metadata(&self.timeline_dir).await {
|
||||
Ok(_) => {
|
||||
// Timeline directory exists on disk, we should leave state unchanged
|
||||
@@ -425,7 +391,7 @@ impl Timeline {
|
||||
// Create timeline directory.
|
||||
fs::create_dir_all(&self.timeline_dir).await?;
|
||||
|
||||
// Write timeline to disk and start background tasks.
|
||||
// Write timeline to disk and TODO: start background tasks.
|
||||
if let Err(e) = shared_state.sk.persist().await {
|
||||
// Bootstrap failed, cancel timeline and remove timeline directory.
|
||||
self.cancel(shared_state);
|
||||
@@ -439,14 +405,10 @@ impl Timeline {
|
||||
|
||||
return Err(e);
|
||||
}
|
||||
self.bootstrap(conf);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Bootstrap new or existing timeline starting background stasks.
|
||||
pub fn bootstrap(self: &Arc<Timeline>, conf: &SafeKeeperConf) {
|
||||
// Start recovery task which always runs on the timeline.
|
||||
tokio::spawn(recovery_main(self.clone(), conf.clone()));
|
||||
// TODO: add more initialization steps here
|
||||
self.update_status(shared_state);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Delete timeline from disk completely, by removing timeline directory. Background
|
||||
@@ -482,16 +444,6 @@ impl Timeline {
|
||||
*self.cancellation_rx.borrow()
|
||||
}
|
||||
|
||||
/// Returns watch channel which gets value when timeline is cancelled. It is
|
||||
/// guaranteed to have not cancelled value observed (errors otherwise).
|
||||
pub fn get_cancellation_rx(&self) -> Result<watch::Receiver<bool>> {
|
||||
let rx = self.cancellation_rx.clone();
|
||||
if *rx.borrow() {
|
||||
bail!(TimelineError::Cancelled(self.ttid));
|
||||
}
|
||||
Ok(rx)
|
||||
}
|
||||
|
||||
/// Take a writing mutual exclusive lock on timeline shared_state.
|
||||
pub async fn write_shared_state(&self) -> MutexGuard<SharedState> {
|
||||
self.mutex.lock().await
|
||||
@@ -568,11 +520,6 @@ impl Timeline {
|
||||
self.commit_lsn_watch_rx.clone()
|
||||
}
|
||||
|
||||
/// Returns term_flush_lsn watch channel.
|
||||
pub fn get_term_flush_lsn_watch_rx(&self) -> watch::Receiver<TermLsn> {
|
||||
self.term_flush_lsn_watch_rx.clone()
|
||||
}
|
||||
|
||||
/// Pass arrived message to the safekeeper.
|
||||
pub async fn process_msg(
|
||||
&self,
|
||||
@@ -584,7 +531,6 @@ impl Timeline {
|
||||
|
||||
let mut rmsg: Option<AcceptorProposerMessage>;
|
||||
let commit_lsn: Lsn;
|
||||
let term_flush_lsn: TermLsn;
|
||||
{
|
||||
let mut shared_state = self.write_shared_state().await;
|
||||
rmsg = shared_state.sk.process_msg(msg).await?;
|
||||
@@ -598,11 +544,8 @@ impl Timeline {
|
||||
}
|
||||
|
||||
commit_lsn = shared_state.sk.inmem.commit_lsn;
|
||||
term_flush_lsn =
|
||||
TermLsn::from((shared_state.sk.get_term(), shared_state.sk.flush_lsn()));
|
||||
}
|
||||
self.commit_lsn_watch_tx.send(commit_lsn)?;
|
||||
self.term_flush_lsn_watch_tx.send(term_flush_lsn)?;
|
||||
Ok(rmsg)
|
||||
}
|
||||
|
||||
|
||||
@@ -11,7 +11,7 @@ use serde::Serialize;
|
||||
use std::collections::HashMap;
|
||||
use std::path::PathBuf;
|
||||
use std::str::FromStr;
|
||||
use std::sync::{Arc, Mutex};
|
||||
use std::sync::{Arc, Mutex, MutexGuard};
|
||||
use tokio::sync::mpsc::Sender;
|
||||
use tracing::*;
|
||||
use utils::id::{TenantId, TenantTimelineId, TimelineId};
|
||||
@@ -71,23 +71,19 @@ pub struct GlobalTimelines;
|
||||
|
||||
impl GlobalTimelines {
|
||||
/// Inject dependencies needed for the timeline constructors and load all timelines to memory.
|
||||
pub async fn init(
|
||||
pub fn init(
|
||||
conf: SafeKeeperConf,
|
||||
wal_backup_launcher_tx: Sender<TenantTimelineId>,
|
||||
) -> Result<()> {
|
||||
// clippy isn't smart enough to understand that drop(state) releases the
|
||||
// lock, so use explicit block
|
||||
let tenants_dir = {
|
||||
let mut state = TIMELINES_STATE.lock().unwrap();
|
||||
assert!(state.wal_backup_launcher_tx.is_none());
|
||||
state.wal_backup_launcher_tx = Some(wal_backup_launcher_tx);
|
||||
state.conf = Some(conf);
|
||||
let mut state = TIMELINES_STATE.lock().unwrap();
|
||||
assert!(state.wal_backup_launcher_tx.is_none());
|
||||
state.wal_backup_launcher_tx = Some(wal_backup_launcher_tx);
|
||||
state.conf = Some(conf);
|
||||
|
||||
// Iterate through all directories and load tenants for all directories
|
||||
// named as a valid tenant_id.
|
||||
state.get_conf().workdir.clone()
|
||||
};
|
||||
// Iterate through all directories and load tenants for all directories
|
||||
// named as a valid tenant_id.
|
||||
let mut tenant_count = 0;
|
||||
let tenants_dir = state.get_conf().workdir.clone();
|
||||
for tenants_dir_entry in std::fs::read_dir(&tenants_dir)
|
||||
.with_context(|| format!("failed to list tenants dir {}", tenants_dir.display()))?
|
||||
{
|
||||
@@ -97,7 +93,7 @@ impl GlobalTimelines {
|
||||
TenantId::from_str(tenants_dir_entry.file_name().to_str().unwrap_or(""))
|
||||
{
|
||||
tenant_count += 1;
|
||||
GlobalTimelines::load_tenant_timelines(tenant_id).await?;
|
||||
GlobalTimelines::load_tenant_timelines(&mut state, tenant_id)?;
|
||||
}
|
||||
}
|
||||
Err(e) => error!(
|
||||
@@ -112,7 +108,7 @@ impl GlobalTimelines {
|
||||
info!(
|
||||
"found {} tenants directories, successfully loaded {} timelines",
|
||||
tenant_count,
|
||||
TIMELINES_STATE.lock().unwrap().timelines.len()
|
||||
state.timelines.len()
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
@@ -120,21 +116,17 @@ impl GlobalTimelines {
|
||||
/// Loads all timelines for the given tenant to memory. Returns fs::read_dir
|
||||
/// errors if any.
|
||||
///
|
||||
/// It is async for update_status_notify sake. Since TIMELINES_STATE lock is
|
||||
/// sync and there is no important reason to make it async (it is always
|
||||
/// held for a short while) we just lock and unlock it for each timeline --
|
||||
/// this function is called during init when nothing else is running, so
|
||||
/// this is fine.
|
||||
async fn load_tenant_timelines(tenant_id: TenantId) -> Result<()> {
|
||||
let (conf, wal_backup_launcher_tx) = {
|
||||
let state = TIMELINES_STATE.lock().unwrap();
|
||||
(
|
||||
state.get_conf().clone(),
|
||||
state.wal_backup_launcher_tx.as_ref().unwrap().clone(),
|
||||
)
|
||||
};
|
||||
|
||||
let timelines_dir = conf.tenant_dir(&tenant_id);
|
||||
/// Note: This function (and all reading/loading below) is sync because
|
||||
/// timelines are loaded while holding GlobalTimelinesState lock. Which is
|
||||
/// fine as this is called only from single threaded main runtime on boot,
|
||||
/// but clippy complains anyway, and suppressing that isn't trivial as async
|
||||
/// is the keyword, ha. That only other user is pull_timeline.rs for which
|
||||
/// being blocked is not that bad, and we can do spawn_blocking.
|
||||
fn load_tenant_timelines(
|
||||
state: &mut MutexGuard<'_, GlobalTimelinesState>,
|
||||
tenant_id: TenantId,
|
||||
) -> Result<()> {
|
||||
let timelines_dir = state.get_conf().tenant_dir(&tenant_id);
|
||||
for timelines_dir_entry in std::fs::read_dir(&timelines_dir)
|
||||
.with_context(|| format!("failed to list timelines dir {}", timelines_dir.display()))?
|
||||
{
|
||||
@@ -144,16 +136,13 @@ impl GlobalTimelines {
|
||||
TimelineId::from_str(timeline_dir_entry.file_name().to_str().unwrap_or(""))
|
||||
{
|
||||
let ttid = TenantTimelineId::new(tenant_id, timeline_id);
|
||||
match Timeline::load_timeline(&conf, ttid, wal_backup_launcher_tx.clone()) {
|
||||
match Timeline::load_timeline(
|
||||
state.get_conf().clone(),
|
||||
ttid,
|
||||
state.wal_backup_launcher_tx.as_ref().unwrap().clone(),
|
||||
) {
|
||||
Ok(timeline) => {
|
||||
let tli = Arc::new(timeline);
|
||||
TIMELINES_STATE
|
||||
.lock()
|
||||
.unwrap()
|
||||
.timelines
|
||||
.insert(ttid, tli.clone());
|
||||
tli.bootstrap(&conf);
|
||||
tli.update_status_notify().await.unwrap();
|
||||
state.timelines.insert(ttid, Arc::new(timeline));
|
||||
}
|
||||
// If we can't load a timeline, it's most likely because of a corrupted
|
||||
// directory. We will log an error and won't allow to delete/recreate
|
||||
@@ -179,22 +168,18 @@ impl GlobalTimelines {
|
||||
}
|
||||
|
||||
/// Load timeline from disk to the memory.
|
||||
pub async fn load_timeline(ttid: TenantTimelineId) -> Result<Arc<Timeline>> {
|
||||
pub fn load_timeline(ttid: TenantTimelineId) -> Result<Arc<Timeline>> {
|
||||
let (conf, wal_backup_launcher_tx) = TIMELINES_STATE.lock().unwrap().get_dependencies();
|
||||
|
||||
match Timeline::load_timeline(&conf, ttid, wal_backup_launcher_tx) {
|
||||
match Timeline::load_timeline(conf, ttid, wal_backup_launcher_tx) {
|
||||
Ok(timeline) => {
|
||||
let tli = Arc::new(timeline);
|
||||
|
||||
// TODO: prevent concurrent timeline creation/loading
|
||||
TIMELINES_STATE
|
||||
.lock()
|
||||
.unwrap()
|
||||
.timelines
|
||||
.insert(ttid, tli.clone());
|
||||
|
||||
tli.bootstrap(&conf);
|
||||
|
||||
Ok(tli)
|
||||
}
|
||||
// If we can't load a timeline, it's bad. Caller will figure it out.
|
||||
@@ -232,7 +217,7 @@ impl GlobalTimelines {
|
||||
info!("creating new timeline {}", ttid);
|
||||
|
||||
let timeline = Arc::new(Timeline::create_empty(
|
||||
&conf,
|
||||
conf,
|
||||
ttid,
|
||||
wal_backup_launcher_tx,
|
||||
server_info,
|
||||
@@ -255,24 +240,23 @@ impl GlobalTimelines {
|
||||
// Write the new timeline to the disk and start background workers.
|
||||
// Bootstrap is transactional, so if it fails, the timeline will be deleted,
|
||||
// and the state on disk should remain unchanged.
|
||||
if let Err(e) = timeline.init_new(&mut shared_state, &conf).await {
|
||||
// Note: the most likely reason for init failure is that the timeline
|
||||
if let Err(e) = timeline.bootstrap(&mut shared_state).await {
|
||||
// Note: the most likely reason for bootstrap failure is that the timeline
|
||||
// directory already exists on disk. This happens when timeline is corrupted
|
||||
// and wasn't loaded from disk on startup because of that. We want to preserve
|
||||
// the timeline directory in this case, for further inspection.
|
||||
|
||||
// TODO: this is an unusual error, perhaps we should send it to sentry
|
||||
// TODO: compute will try to create timeline every second, we should add backoff
|
||||
error!("failed to init new timeline {}: {}", ttid, e);
|
||||
error!("failed to bootstrap timeline {}: {}", ttid, e);
|
||||
|
||||
// Timeline failed to init, it cannot be used. Remove it from the map.
|
||||
// Timeline failed to bootstrap, it cannot be used. Remove it from the map.
|
||||
TIMELINES_STATE.lock().unwrap().timelines.remove(&ttid);
|
||||
return Err(e);
|
||||
}
|
||||
// We are done with bootstrap, release the lock, return the timeline.
|
||||
// {} block forces release before .await
|
||||
}
|
||||
timeline.update_status_notify().await?;
|
||||
timeline.wal_backup_launcher_tx.send(timeline.ttid).await?;
|
||||
Ok(timeline)
|
||||
}
|
||||
|
||||
@@ -12,26 +12,25 @@ import psycopg2.extras
|
||||
# We call the test "flaky" if it failed at least once on the main branch in the last N=10 days.
|
||||
FLAKY_TESTS_QUERY = """
|
||||
SELECT
|
||||
DISTINCT parent_suite, suite, REGEXP_REPLACE(test, '(release|debug)-pg(\\d+)-?', '') as deparametrized_test
|
||||
DISTINCT parent_suite, suite, test
|
||||
FROM
|
||||
(
|
||||
SELECT
|
||||
reference,
|
||||
jsonb_array_elements(data -> 'children') ->> 'name' as parent_suite,
|
||||
jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') ->> 'name' as suite,
|
||||
jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'name' as test,
|
||||
jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'status' as status,
|
||||
jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') ->> 'retriesStatusChange' as retries_status_change,
|
||||
to_timestamp((jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'time' ->> 'start')::bigint / 1000)::date as timestamp
|
||||
revision,
|
||||
jsonb_array_elements(data -> 'children') -> 'name' as parent_suite,
|
||||
jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'name' as suite,
|
||||
jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'name' as test,
|
||||
jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'status' as status,
|
||||
jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'retriesStatusChange' as retries_status_change,
|
||||
to_timestamp((jsonb_array_elements(jsonb_array_elements(jsonb_array_elements(data -> 'children') -> 'children') -> 'children') -> 'time' -> 'start')::bigint / 1000)::date as timestamp
|
||||
FROM
|
||||
regress_test_results
|
||||
WHERE
|
||||
reference = 'refs/heads/main'
|
||||
) data
|
||||
WHERE
|
||||
timestamp > CURRENT_DATE - INTERVAL '%s' day
|
||||
AND (
|
||||
(status IN ('failed', 'broken') AND reference = 'refs/heads/main')
|
||||
OR retries_status_change::boolean
|
||||
)
|
||||
AND (status::text IN ('"failed"', '"broken"') OR retries_status_change::boolean)
|
||||
;
|
||||
"""
|
||||
|
||||
@@ -41,9 +40,6 @@ def main(args: argparse.Namespace):
|
||||
interval_days = args.days
|
||||
output = args.output
|
||||
|
||||
build_type = args.build_type
|
||||
pg_version = args.pg_version
|
||||
|
||||
res: DefaultDict[str, DefaultDict[str, Dict[str, bool]]]
|
||||
res = defaultdict(lambda: defaultdict(dict))
|
||||
|
||||
@@ -59,21 +55,8 @@ def main(args: argparse.Namespace):
|
||||
rows = []
|
||||
|
||||
for row in rows:
|
||||
# We don't want to automatically rerun tests in a performance suite
|
||||
if row["parent_suite"] != "test_runner.regress":
|
||||
continue
|
||||
|
||||
deparametrized_test = row["deparametrized_test"]
|
||||
dash_if_needed = "" if deparametrized_test.endswith("[]") else "-"
|
||||
parametrized_test = deparametrized_test.replace(
|
||||
"[",
|
||||
f"[{build_type}-pg{pg_version}{dash_if_needed}",
|
||||
)
|
||||
res[row["parent_suite"]][row["suite"]][parametrized_test] = True
|
||||
|
||||
logging.info(
|
||||
f"\t{row['parent_suite'].replace('.', '/')}/{row['suite']}.py::{parametrized_test}"
|
||||
)
|
||||
logging.info(f"\t{row['parent_suite'].replace('.', '/')}/{row['suite']}.py::{row['test']}")
|
||||
res[row["parent_suite"]][row["suite"]][row["test"]] = True
|
||||
|
||||
logging.info(f"saving results to {output.name}")
|
||||
json.dump(res, output, indent=2)
|
||||
@@ -94,18 +77,6 @@ if __name__ == "__main__":
|
||||
type=int,
|
||||
help="how many days to look back for flaky tests (default: 10)",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--build-type",
|
||||
required=True,
|
||||
type=str,
|
||||
help="for which build type to create list of flaky tests (debug or release)",
|
||||
)
|
||||
parser.add_argument(
|
||||
"--pg-version",
|
||||
required=True,
|
||||
type=int,
|
||||
help="for which Postgres version to create list of flaky tests (14, 15, etc.)",
|
||||
)
|
||||
parser.add_argument(
|
||||
"connstr",
|
||||
help="connection string to the test results database",
|
||||
|
||||
@@ -125,7 +125,6 @@ async fn publish(client: Option<BrokerClientChannel>, n_keys: u64) {
|
||||
tenant_id: vec![0xFF; 16],
|
||||
timeline_id: tli_from_u64(counter % n_keys),
|
||||
}),
|
||||
term: 0,
|
||||
last_log_term: 0,
|
||||
flush_lsn: counter,
|
||||
commit_lsn: 2,
|
||||
@@ -133,7 +132,6 @@ async fn publish(client: Option<BrokerClientChannel>, n_keys: u64) {
|
||||
remote_consistent_lsn: 4,
|
||||
peer_horizon_lsn: 5,
|
||||
safekeeper_connstr: "zenith-1-sk-1.local:7676".to_owned(),
|
||||
http_connstr: "zenith-1-sk-1.local:7677".to_owned(),
|
||||
local_start_lsn: 0,
|
||||
availability_zone: None,
|
||||
};
|
||||
|
||||
@@ -22,8 +22,6 @@ message SubscribeSafekeeperInfoRequest {
|
||||
message SafekeeperTimelineInfo {
|
||||
uint64 safekeeper_id = 1;
|
||||
TenantTimelineId tenant_timeline_id = 2;
|
||||
// Safekeeper term
|
||||
uint64 term = 12;
|
||||
// Term of the last entry.
|
||||
uint64 last_log_term = 3;
|
||||
// LSN of the last record.
|
||||
@@ -38,8 +36,6 @@ message SafekeeperTimelineInfo {
|
||||
uint64 local_start_lsn = 9;
|
||||
// A connection string to use for WAL receiving.
|
||||
string safekeeper_connstr = 10;
|
||||
// HTTP endpoint connection string
|
||||
string http_connstr = 13;
|
||||
// Availability zone of a safekeeper.
|
||||
optional string availability_zone = 11;
|
||||
}
|
||||
|
||||
@@ -519,7 +519,6 @@ mod tests {
|
||||
tenant_id: vec![0x00; 16],
|
||||
timeline_id,
|
||||
}),
|
||||
term: 0,
|
||||
last_log_term: 0,
|
||||
flush_lsn: 1,
|
||||
commit_lsn: 2,
|
||||
@@ -527,7 +526,6 @@ mod tests {
|
||||
remote_consistent_lsn: 4,
|
||||
peer_horizon_lsn: 5,
|
||||
safekeeper_connstr: "neon-1-sk-1.local:7676".to_owned(),
|
||||
http_connstr: "neon-1-sk-1.local:7677".to_owned(),
|
||||
local_start_lsn: 0,
|
||||
availability_zone: None,
|
||||
}
|
||||
|
||||
@@ -428,7 +428,6 @@ class NeonEnvBuilder:
|
||||
preserve_database_files: bool = False,
|
||||
initial_tenant: Optional[TenantId] = None,
|
||||
initial_timeline: Optional[TimelineId] = None,
|
||||
enable_generations: bool = False,
|
||||
):
|
||||
self.repo_dir = repo_dir
|
||||
self.rust_log_override = rust_log_override
|
||||
@@ -455,7 +454,6 @@ class NeonEnvBuilder:
|
||||
self.preserve_database_files = preserve_database_files
|
||||
self.initial_tenant = initial_tenant or TenantId.generate()
|
||||
self.initial_timeline = initial_timeline or TimelineId.generate()
|
||||
self.enable_generations = False
|
||||
|
||||
def init_configs(self) -> NeonEnv:
|
||||
# Cannot create more than one environment from one builder
|
||||
@@ -715,9 +713,6 @@ class NeonEnvBuilder:
|
||||
sk.stop(immediate=True)
|
||||
self.env.pageserver.stop(immediate=True)
|
||||
|
||||
if self.env.attachment_service is not None:
|
||||
self.env.attachment_service.stop(immediate=True)
|
||||
|
||||
cleanup_error = None
|
||||
try:
|
||||
self.cleanup_remote_storage()
|
||||
@@ -771,8 +766,6 @@ class NeonEnv:
|
||||
the tenant id
|
||||
"""
|
||||
|
||||
PAGESERVER_ID = 1
|
||||
|
||||
def __init__(self, config: NeonEnvBuilder):
|
||||
self.repo_dir = config.repo_dir
|
||||
self.rust_log_override = config.rust_log_override
|
||||
@@ -796,14 +789,6 @@ class NeonEnv:
|
||||
self.initial_tenant = config.initial_tenant
|
||||
self.initial_timeline = config.initial_timeline
|
||||
|
||||
if config.enable_generations:
|
||||
attachment_service_port = self.port_distributor.get_port()
|
||||
self.control_plane_api: Optional[str] = f"http://127.0.0.1:{attachment_service_port}"
|
||||
self.attachment_service: Optional[NeonAttachmentService] = NeonAttachmentService(self)
|
||||
else:
|
||||
self.control_plane_api = None
|
||||
self.attachment_service = None
|
||||
|
||||
# Create a config file corresponding to the options
|
||||
toml = textwrap.dedent(
|
||||
f"""
|
||||
@@ -829,7 +814,7 @@ class NeonEnv:
|
||||
toml += textwrap.dedent(
|
||||
f"""
|
||||
[pageserver]
|
||||
id={self.PAGESERVER_ID}
|
||||
id=1
|
||||
listen_pg_addr = 'localhost:{pageserver_port.pg}'
|
||||
listen_http_addr = 'localhost:{pageserver_port.http}'
|
||||
pg_auth_type = '{pg_auth_type}'
|
||||
@@ -837,13 +822,6 @@ class NeonEnv:
|
||||
"""
|
||||
)
|
||||
|
||||
if self.control_plane_api is not None:
|
||||
toml += textwrap.dedent(
|
||||
f"""
|
||||
control_plane_api = '{self.control_plane_api}'
|
||||
"""
|
||||
)
|
||||
|
||||
# Create a corresponding NeonPageserver object
|
||||
self.pageserver = NeonPageserver(
|
||||
self, port=pageserver_port, config_override=config.pageserver_config_override
|
||||
@@ -890,9 +868,6 @@ class NeonEnv:
|
||||
def start(self):
|
||||
# Start up broker, pageserver and all safekeepers
|
||||
self.broker.try_start()
|
||||
|
||||
if self.attachment_service is not None:
|
||||
self.attachment_service.start()
|
||||
self.pageserver.start()
|
||||
|
||||
for safekeeper in self.safekeepers:
|
||||
@@ -1314,16 +1289,6 @@ class NeonCli(AbstractNeonCli):
|
||||
res.check_returncode()
|
||||
return res
|
||||
|
||||
def attachment_service_start(self):
|
||||
cmd = ["attachment_service", "start"]
|
||||
return self.raw_cli(cmd)
|
||||
|
||||
def attachment_service_stop(self, immediate: bool):
|
||||
cmd = ["attachment_service", "stop"]
|
||||
if immediate:
|
||||
cmd.extend(["-m", "immediate"])
|
||||
return self.raw_cli(cmd)
|
||||
|
||||
def pageserver_start(
|
||||
self,
|
||||
overrides: Tuple[str, ...] = (),
|
||||
@@ -1505,33 +1470,6 @@ class ComputeCtl(AbstractNeonCli):
|
||||
COMMAND = "compute_ctl"
|
||||
|
||||
|
||||
class NeonAttachmentService:
|
||||
def __init__(self, env: NeonEnv):
|
||||
self.env = env
|
||||
|
||||
def start(self):
|
||||
self.env.neon_cli.attachment_service_start()
|
||||
self.running = True
|
||||
return self
|
||||
|
||||
def stop(self, immediate: bool = False) -> "NeonAttachmentService":
|
||||
if self.running:
|
||||
self.env.neon_cli.attachment_service_stop(immediate)
|
||||
self.running = False
|
||||
return self
|
||||
|
||||
def __enter__(self) -> "NeonAttachmentService":
|
||||
return self
|
||||
|
||||
def __exit__(
|
||||
self,
|
||||
exc_type: Optional[Type[BaseException]],
|
||||
exc: Optional[BaseException],
|
||||
tb: Optional[TracebackType],
|
||||
):
|
||||
self.stop(immediate=True)
|
||||
|
||||
|
||||
class NeonPageserver(PgProtocol):
|
||||
"""
|
||||
An object representing a running pageserver.
|
||||
@@ -1586,7 +1524,7 @@ class NeonPageserver(PgProtocol):
|
||||
".*wait for layer upload ops to complete.*", # .*Caused by:.*wait_completion aborted because upload queue was stopped
|
||||
".*gc_loop.*Gc failed, retrying in.*timeline is Stopping", # When gc checks timeline state after acquiring layer_removal_cs
|
||||
".*gc_loop.*Gc failed, retrying in.*: Cannot run GC iteration on inactive tenant", # Tenant::gc precondition
|
||||
".*compaction_loop.*Compaction failed, retrying in.*timeline is Stopping", # When compaction checks timeline state after acquiring layer_removal_cs
|
||||
".*compaction_loop.*Compaction failed, retrying in.*timeline or pageserver is shutting down", # When compaction checks timeline state after acquiring layer_removal_cs
|
||||
".*query handler for 'pagestream.*failed: Timeline .* was not found", # postgres reconnects while timeline_delete doesn't hold the tenant's timelines.lock()
|
||||
".*query handler for 'pagestream.*failed: Timeline .* is not active", # timeline delete in progress
|
||||
".*task iteration took longer than the configured period.*",
|
||||
@@ -1695,26 +1633,6 @@ class NeonPageserver(PgProtocol):
|
||||
|
||||
return None
|
||||
|
||||
def tenant_attach(
|
||||
self, tenant_id: TenantId, config: None | Dict[str, Any] = None, config_null: bool = False
|
||||
):
|
||||
"""
|
||||
Tenant attachment passes through here to acquire a generation number before proceeding
|
||||
to call into the pageserver HTTP client.
|
||||
"""
|
||||
if self.env.attachment_service is not None:
|
||||
response = requests.post(
|
||||
f"{self.env.control_plane_api}/attach_hook",
|
||||
json={"tenant_id": str(tenant_id), "pageserver_id": self.env.PAGESERVER_ID},
|
||||
)
|
||||
response.raise_for_status()
|
||||
generation = response.json()["gen"]
|
||||
else:
|
||||
generation = None
|
||||
|
||||
client = self.env.pageserver.http_client()
|
||||
return client.tenant_attach(tenant_id, config, config_null, generation=generation)
|
||||
|
||||
|
||||
def append_pageserver_param_overrides(
|
||||
params_to_update: List[str],
|
||||
|
||||
@@ -186,25 +186,18 @@ class PageserverHttpClient(requests.Session):
|
||||
return TenantId(new_tenant_id)
|
||||
|
||||
def tenant_attach(
|
||||
self,
|
||||
tenant_id: TenantId,
|
||||
config: None | Dict[str, Any] = None,
|
||||
config_null: bool = False,
|
||||
generation: Optional[int] = None,
|
||||
self, tenant_id: TenantId, config: None | Dict[str, Any] = None, config_null: bool = False
|
||||
):
|
||||
if config_null:
|
||||
assert config is None
|
||||
body: Any = None
|
||||
body = "null"
|
||||
else:
|
||||
# null-config is prohibited by the API
|
||||
config = config or {}
|
||||
body = {"config": config}
|
||||
if generation is not None:
|
||||
body.update({"generation": generation})
|
||||
|
||||
body = json.dumps({"config": config})
|
||||
res = self.post(
|
||||
f"http://localhost:{self.port}/v1/tenant/{tenant_id}/attach",
|
||||
data=json.dumps(body),
|
||||
data=body,
|
||||
headers={"Content-Type": "application/json"},
|
||||
)
|
||||
self.verbose_error(res)
|
||||
@@ -620,8 +613,3 @@ class PageserverHttpClient(requests.Session):
|
||||
},
|
||||
)
|
||||
self.verbose_error(res)
|
||||
|
||||
def deletion_queue_flush(self, execute: bool = False):
|
||||
self.put(
|
||||
f"http://localhost:{self.port}/v1/deletion_queue/flush?execute={'true' if execute else 'false'}"
|
||||
).raise_for_status()
|
||||
|
||||
@@ -233,19 +233,10 @@ if TYPE_CHECKING:
|
||||
|
||||
def assert_prefix_empty(neon_env_builder: "NeonEnvBuilder", prefix: Optional[str] = None):
|
||||
response = list_prefix(neon_env_builder, prefix)
|
||||
keys = response["KeyCount"]
|
||||
objects = response.get("Contents", [])
|
||||
|
||||
if keys != 0 and len(objects) == 0:
|
||||
# this has been seen in one case with mock_s3:
|
||||
# https://neon-github-public-dev.s3.amazonaws.com/reports/pr-4938/6000769714/index.html#suites/3556ed71f2d69272a7014df6dcb02317/ca01e4f4d8d9a11f
|
||||
# looking at moto impl, it might be there's a race with common prefix (sub directory) not going away with deletes
|
||||
common_prefixes = response.get("CommonPrefixes", [])
|
||||
log.warn(
|
||||
f"contradicting ListObjectsV2 response with KeyCount={keys} and Contents={objects}, CommonPrefixes={common_prefixes}"
|
||||
)
|
||||
|
||||
assert keys == 0, f"remote dir with prefix {prefix} is not empty after deletion: {objects}"
|
||||
objects = response.get("Contents")
|
||||
assert (
|
||||
response["KeyCount"] == 0
|
||||
), f"remote dir with prefix {prefix} is not empty after deletion: {objects}"
|
||||
|
||||
|
||||
def assert_prefix_not_empty(neon_env_builder: "NeonEnvBuilder", prefix: Optional[str] = None):
|
||||
|
||||
@@ -22,7 +22,7 @@ def positive_env(neon_env_builder: NeonEnvBuilder) -> NeonEnv:
|
||||
|
||||
# eviction might be the first one after an attach to access the layers
|
||||
env.pageserver.allowed_errors.append(
|
||||
".*unexpectedly on-demand downloading remote layer remote.* for task kind Eviction"
|
||||
".*unexpectedly on-demand downloading remote layer .* for task kind Eviction"
|
||||
)
|
||||
assert isinstance(env.remote_storage, LocalFsStorage)
|
||||
return env
|
||||
|
||||
@@ -15,7 +15,7 @@ def test_broken_timeline(neon_env_builder: NeonEnvBuilder):
|
||||
|
||||
env.pageserver.allowed_errors.extend(
|
||||
[
|
||||
".*Failed to load delta layer.*",
|
||||
".*layer loading failed:.*",
|
||||
".*could not find data for key.*",
|
||||
".*is not active. Current state: Broken.*",
|
||||
".*will not become active. Current state: Broken.*",
|
||||
@@ -99,7 +99,7 @@ def test_broken_timeline(neon_env_builder: NeonEnvBuilder):
|
||||
# Third timeline will also fail during basebackup, because the layer file is corrupt.
|
||||
# It will fail when we try to read (and reconstruct) a page from it, ergo the error message.
|
||||
# (We don't check layer file contents on startup, when loading the timeline)
|
||||
with pytest.raises(Exception, match="Failed to load delta layer") as err:
|
||||
with pytest.raises(Exception, match="layer loading failed:") as err:
|
||||
pg3.start()
|
||||
log.info(
|
||||
f"As expected, compute startup failed for timeline {tenant3}/{timeline3} with corrupt layers: {err}"
|
||||
|
||||
@@ -2,35 +2,137 @@ import time
|
||||
|
||||
import pytest
|
||||
from fixtures.neon_fixtures import NeonEnvBuilder, PgBin
|
||||
from fixtures.pageserver.utils import wait_for_upload_queue_empty
|
||||
from fixtures.remote_storage import LocalFsStorage, RemoteStorageKind
|
||||
from requests.exceptions import ConnectionError
|
||||
|
||||
|
||||
# Test duplicate layer detection
|
||||
#
|
||||
# This test sets fail point at the end of first compaction phase:
|
||||
# after flushing new L1 layers but before deletion of L0 layers
|
||||
# it should cause generation of duplicate L1 layer by compaction after restart.
|
||||
@pytest.mark.timeout(600)
|
||||
def test_duplicate_layers(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
|
||||
env = neon_env_builder.init_start()
|
||||
pageserver_http = env.pageserver.http_client()
|
||||
def test_compaction_duplicates_all(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
|
||||
"""
|
||||
Makes compact_level0_phase1 return input layers as the output layers with a
|
||||
failpoint as if those L0 inputs would had all been recreated when L1s were
|
||||
supposed to be created.
|
||||
"""
|
||||
neon_env_builder.enable_remote_storage(
|
||||
remote_storage_kind=RemoteStorageKind.LOCAL_FS,
|
||||
test_name="test_compaction_duplicates_all",
|
||||
)
|
||||
|
||||
# Use aggressive compaction and checkpoint settings
|
||||
tenant_id, _ = env.neon_cli.create_tenant(
|
||||
conf={
|
||||
env = neon_env_builder.init_start(
|
||||
initial_tenant_conf={
|
||||
"checkpoint_distance": f"{1024 ** 2}",
|
||||
"compaction_target_size": f"{1024 ** 2}",
|
||||
"compaction_period": "5 s",
|
||||
"compaction_period": "0 s",
|
||||
"compaction_threshold": "3",
|
||||
}
|
||||
)
|
||||
pageserver_http = env.pageserver.http_client()
|
||||
|
||||
tenant_id, timeline_id = env.initial_tenant, env.initial_timeline
|
||||
|
||||
pageserver_http.configure_failpoints(("compact-level0-phase1-return-same", "return"))
|
||||
# pageserver_http.configure_failpoints(("after-timeline-compacted-first-L1", "exit"))
|
||||
|
||||
endpoint = env.endpoints.create_start("main", tenant_id=tenant_id)
|
||||
connstr = endpoint.connstr(options="-csynchronous_commit=off")
|
||||
pg_bin.run_capture(["pgbench", "-i", "-s1", connstr])
|
||||
|
||||
time.sleep(10) # let compaction to be performed
|
||||
pageserver_http.timeline_compact(tenant_id, timeline_id)
|
||||
assert env.pageserver.log_contains("compact-level0-phase1-return-same")
|
||||
|
||||
pg_bin.run_capture(["pgbench", "-P1", "-N", "-c5", "-T200", "-Mprepared", connstr])
|
||||
|
||||
def test_duplicate_layers(neon_env_builder: NeonEnvBuilder, pg_bin: PgBin):
|
||||
"""
|
||||
This test sets fail point at the end of first compaction phase:
|
||||
after flushing new L1 layers but before deletion of L0 layers
|
||||
it should cause generation of duplicate L1 layer by compaction after restart.
|
||||
"""
|
||||
neon_env_builder.enable_remote_storage(
|
||||
remote_storage_kind=RemoteStorageKind.LOCAL_FS,
|
||||
test_name="test_duplicate_layers",
|
||||
)
|
||||
|
||||
env = neon_env_builder.init_start(
|
||||
initial_tenant_conf={
|
||||
"checkpoint_distance": f"{1024 ** 2}",
|
||||
"compaction_target_size": f"{1024 ** 2}",
|
||||
"compaction_period": "0 s",
|
||||
"compaction_threshold": "3",
|
||||
}
|
||||
)
|
||||
pageserver_http = env.pageserver.http_client()
|
||||
|
||||
tenant_id, timeline_id = env.initial_tenant, env.initial_timeline
|
||||
|
||||
pageserver_http.configure_failpoints(("after-timeline-compacted-first-L1", "exit"))
|
||||
|
||||
endpoint = env.endpoints.create_start("main", tenant_id=tenant_id)
|
||||
connstr = endpoint.connstr(options="-csynchronous_commit=off")
|
||||
pg_bin.run_capture(["pgbench", "-i", "-s1", connstr])
|
||||
|
||||
with pytest.raises(ConnectionError, match="Remote end closed connection without response"):
|
||||
pageserver_http.timeline_compact(tenant_id, timeline_id)
|
||||
|
||||
# pageserver has already exited at this point
|
||||
env.pageserver.stop()
|
||||
|
||||
# now the duplicate L1 has been created, but is not yet uploaded
|
||||
assert isinstance(env.remote_storage, LocalFsStorage)
|
||||
|
||||
# path = env.remote_storage.timeline_path(tenant_id, timeline_id)
|
||||
l1_found = None
|
||||
for path in env.timeline_dir(tenant_id, timeline_id).iterdir():
|
||||
if path.name == "metadata" or path.name.startswith("ephemeral-"):
|
||||
continue
|
||||
|
||||
if len(path.suffixes) > 0:
|
||||
# temp files
|
||||
continue
|
||||
|
||||
[key_range, lsn_range] = path.name.split("__", maxsplit=1)
|
||||
|
||||
if "-" not in lsn_range:
|
||||
# image layer
|
||||
continue
|
||||
|
||||
[key_start, key_end] = key_range.split("-", maxsplit=1)
|
||||
|
||||
if key_start == "0" * 36 and key_end == "F" * 36:
|
||||
# L0
|
||||
continue
|
||||
|
||||
assert l1_found is None, f"found multiple L1: {l1_found.name} and {path.name}"
|
||||
l1_found = path
|
||||
|
||||
assert l1_found is not None, "failed to find L1 locally"
|
||||
original_created_at = l1_found.stat()[8]
|
||||
|
||||
uploaded = env.remote_storage.timeline_path(tenant_id, timeline_id) / l1_found.name
|
||||
assert not uploaded.exists(), "to-be-overwritten should not yet be uploaded"
|
||||
|
||||
# give room for fs timestamps
|
||||
time.sleep(1)
|
||||
|
||||
env.pageserver.start()
|
||||
warning = f".*duplicated L1 layer layer={l1_found.name}"
|
||||
env.pageserver.allowed_errors.append(warning)
|
||||
|
||||
pageserver_http.timeline_compact(tenant_id, timeline_id)
|
||||
# give time for log flush
|
||||
time.sleep(1)
|
||||
|
||||
env.pageserver.log_contains(warning)
|
||||
|
||||
overwritten_at = l1_found.stat()[8]
|
||||
assert original_created_at < overwritten_at, "expected the L1 to be overwritten"
|
||||
|
||||
wait_for_upload_queue_empty(pageserver_http, tenant_id, timeline_id)
|
||||
|
||||
uploaded_at = uploaded.stat()[8]
|
||||
assert overwritten_at <= uploaded_at, "expected the L1 to finally be uploaded"
|
||||
|
||||
# why does compaction not wait for uploads? probably so that we can compact
|
||||
# faster than we can upload in some cases.
|
||||
#
|
||||
# timeline_compact should wait for uploads as well
|
||||
|
||||
@@ -256,34 +256,34 @@ def test_gc_of_remote_layers(neon_env_builder: NeonEnvBuilder):
|
||||
ps_http.evict_all_layers(tenant_id, timeline_id)
|
||||
|
||||
def ensure_resident_and_remote_size_metrics():
|
||||
log.info("ensure that all the layers are gone")
|
||||
resident_layers = list(env.timeline_dir(tenant_id, timeline_id).glob("*-*_*"))
|
||||
# we have disabled all background loops, so, this should hold
|
||||
assert len(resident_layers) == 0
|
||||
assert len(resident_layers) == 0, "ensure that all the layers are gone"
|
||||
|
||||
info = ps_http.layer_map_info(tenant_id, timeline_id)
|
||||
log.info("layer map dump: %s", info)
|
||||
|
||||
log.info("ensure that resident_physical_size metric is zero")
|
||||
resident_physical_size_metric = ps_http.get_timeline_metric(
|
||||
tenant_id, timeline_id, "pageserver_resident_physical_size"
|
||||
)
|
||||
assert resident_physical_size_metric == 0
|
||||
log.info("ensure that resident_physical_size metric corresponds to layer map dump")
|
||||
assert (
|
||||
resident_physical_size_metric == 0
|
||||
), "ensure that resident_physical_size metric is zero"
|
||||
assert resident_physical_size_metric == sum(
|
||||
[layer.layer_file_size or 0 for layer in info.historic_layers if not layer.remote]
|
||||
)
|
||||
layer.layer_file_size or 0 for layer in info.historic_layers if not layer.remote
|
||||
), "ensure that resident_physical_size metric corresponds to layer map dump"
|
||||
|
||||
log.info("ensure that remote_physical_size metric matches layer map")
|
||||
remote_physical_size_metric = ps_http.get_timeline_metric(
|
||||
tenant_id, timeline_id, "pageserver_remote_physical_size"
|
||||
)
|
||||
log.info("ensure that remote_physical_size metric corresponds to layer map dump")
|
||||
assert remote_physical_size_metric == sum(
|
||||
layer.layer_file_size or 0 for layer in info.historic_layers if layer.remote
|
||||
)
|
||||
), "ensure that remote_physical_size metric corresponds to layer map dump"
|
||||
|
||||
log.info("before runnning GC, ensure that remote_physical size is zero")
|
||||
# leaving index_part.json upload from successful compaction out will show
|
||||
# up here as a mismatch between remove_physical_size and summed up layermap
|
||||
# size
|
||||
ensure_resident_and_remote_size_metrics()
|
||||
|
||||
log.info("run GC")
|
||||
|
||||
@@ -13,13 +13,12 @@ from fixtures.neon_fixtures import (
|
||||
last_flush_lsn_upload,
|
||||
wait_for_last_flush_lsn,
|
||||
)
|
||||
from fixtures.pageserver.http import PageserverApiException, PageserverHttpClient
|
||||
from fixtures.pageserver.http import PageserverHttpClient
|
||||
from fixtures.pageserver.utils import (
|
||||
assert_tenant_state,
|
||||
wait_for_last_record_lsn,
|
||||
wait_for_upload,
|
||||
wait_for_upload_queue_empty,
|
||||
wait_until_tenant_state,
|
||||
)
|
||||
from fixtures.remote_storage import RemoteStorageKind, available_remote_storages
|
||||
from fixtures.types import Lsn
|
||||
@@ -391,7 +390,7 @@ def test_download_remote_layers_api(
|
||||
env.pageserver.start(extra_env_vars={"FAILPOINTS": "remote-storage-download-pre-rename=return"})
|
||||
env.pageserver.allowed_errors.extend(
|
||||
[
|
||||
f".*download_all_remote_layers.*{tenant_id}.*{timeline_id}.*layer download failed.*remote-storage-download-pre-rename failpoint",
|
||||
".*download failed: downloading evicted layer file failed.*",
|
||||
f".*initial size calculation.*{tenant_id}.*{timeline_id}.*Failed to calculate logical size",
|
||||
]
|
||||
)
|
||||
@@ -658,62 +657,5 @@ def test_compaction_downloads_on_demand_with_image_creation(
|
||||
assert dict(kinds_after) == {"Delta": 4, "Image": 1}
|
||||
|
||||
|
||||
@pytest.mark.parametrize("remote_storage_kind", [RemoteStorageKind.LOCAL_FS])
|
||||
def test_ondemand_download_failure_to_replace(
|
||||
neon_env_builder: NeonEnvBuilder, remote_storage_kind: RemoteStorageKind
|
||||
):
|
||||
"""
|
||||
Make sure that we fail on being unable to replace a RemoteLayer instead of for example livelocking.
|
||||
|
||||
See: https://github.com/neondatabase/neon/issues/3533
|
||||
"""
|
||||
|
||||
neon_env_builder.enable_remote_storage(
|
||||
remote_storage_kind=remote_storage_kind,
|
||||
test_name="test_ondemand_download_failure_to_replace",
|
||||
)
|
||||
|
||||
# disable gc and compaction via default tenant config because config is lost while detaching
|
||||
# so that compaction will not be the one to download the layer but the http handler is
|
||||
neon_env_builder.pageserver_config_override = (
|
||||
"""tenant_config={gc_period = "0s", compaction_period = "0s"}"""
|
||||
)
|
||||
|
||||
env = neon_env_builder.init_start()
|
||||
|
||||
tenant_id = env.initial_tenant
|
||||
timeline_id = env.initial_timeline
|
||||
assert timeline_id is not None
|
||||
|
||||
pageserver_http = env.pageserver.http_client()
|
||||
|
||||
# remove layers so that they will be redownloaded
|
||||
pageserver_http.tenant_detach(tenant_id)
|
||||
pageserver_http.tenant_attach(tenant_id)
|
||||
|
||||
wait_until_tenant_state(pageserver_http, tenant_id, "Active", 5)
|
||||
pageserver_http.configure_failpoints(("layermap-replace-notfound", "return"))
|
||||
|
||||
# requesting details with non-incremental size should trigger a download of the only layer
|
||||
# this will need to be adjusted if an index for logical sizes is ever implemented
|
||||
with pytest.raises(PageserverApiException):
|
||||
# PageserverApiException is expected because of the failpoint (timeline_detail building does something)
|
||||
# ReadTimeout can happen on our busy CI, but it should not, because there is no more busylooping
|
||||
# but should it be added back, we would wait for 15s here.
|
||||
pageserver_http.timeline_detail(tenant_id, timeline_id, True, timeout=15)
|
||||
|
||||
actual_message = ".* ERROR .*layermap-replace-notfound"
|
||||
assert env.pageserver.log_contains(actual_message) is not None
|
||||
env.pageserver.allowed_errors.append(actual_message)
|
||||
|
||||
env.pageserver.allowed_errors.append(
|
||||
".* ERROR .*Error processing HTTP request: InternalServerError\\(get local timeline info"
|
||||
)
|
||||
# this might get to run and attempt on-demand, but not always
|
||||
env.pageserver.allowed_errors.append(".* ERROR .*Task 'initial size calculation'")
|
||||
|
||||
# if the above returned, then we didn't have a livelock, and all is well
|
||||
|
||||
|
||||
def stringify(conf: Dict[str, Any]) -> Dict[str, str]:
|
||||
return dict(map(lambda x: (x[0], str(x[1])), conf.items()))
|
||||
|
||||
@@ -7,10 +7,7 @@ from fixtures.neon_fixtures import NeonEnvBuilder
|
||||
|
||||
# Test restarting page server, while safekeeper and compute node keep
|
||||
# running.
|
||||
@pytest.mark.parametrize("generations", [True, False])
|
||||
def test_pageserver_restart(neon_env_builder: NeonEnvBuilder, generations: bool):
|
||||
neon_env_builder.enable_generations = generations
|
||||
|
||||
def test_pageserver_restart(neon_env_builder: NeonEnvBuilder):
|
||||
env = neon_env_builder.init_start()
|
||||
|
||||
env.neon_cli.create_branch("test_pageserver_restart")
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user