mirror of
https://github.com/neondatabase/neon.git
synced 2026-03-31 22:20:37 +00:00
Compare commits
735 Commits
inmem_stor
...
bojan/prox
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
1c40c26313 | ||
|
|
a6ace609a7 | ||
|
|
29d72e8955 | ||
|
|
66eb2a1dd3 | ||
|
|
9424bfae22 | ||
|
|
1d90b1b205 | ||
|
|
949f8b4633 | ||
|
|
26a68612d9 | ||
|
|
850dfd02df | ||
|
|
c8a1192b53 | ||
|
|
137d616e76 | ||
|
|
917c640818 | ||
|
|
c1b3836df1 | ||
|
|
5120ba4b5f | ||
|
|
e4670a5f1e | ||
|
|
7fae894648 | ||
|
|
058123f7ef | ||
|
|
87edbd38c7 | ||
|
|
58ee5d005f | ||
|
|
468366a28f | ||
|
|
b815f5fb9f | ||
|
|
74a0942a77 | ||
|
|
1a4682a04a | ||
|
|
993b544ad0 | ||
|
|
dba1d36a4a | ||
|
|
ca81a550ef | ||
|
|
65a0b2736b | ||
|
|
cca886682b | ||
|
|
c8f47cd38e | ||
|
|
92787159f7 | ||
|
|
abb422d5de | ||
|
|
fdc15de8b2 | ||
|
|
207286f2b8 | ||
|
|
d2b896381a | ||
|
|
009f6d4ae8 | ||
|
|
1b31379456 | ||
|
|
4c64b10aec | ||
|
|
ad262a46ad | ||
|
|
ce533835e5 | ||
|
|
e5bf520b18 | ||
|
|
9512e21b9e | ||
|
|
a26d565282 | ||
|
|
a47dade622 | ||
|
|
9cce430430 | ||
|
|
4bf4bacf01 | ||
|
|
335abfcc28 | ||
|
|
afb3342e46 | ||
|
|
5563ff123f | ||
|
|
0a557b2fa9 | ||
|
|
9632c352ab | ||
|
|
328e3b4189 | ||
|
|
47f6a1f9a8 | ||
|
|
a4829712f4 | ||
|
|
d4d26f619d | ||
|
|
36481f3374 | ||
|
|
d951dd8977 | ||
|
|
ea13838be7 | ||
|
|
b51f23cdf0 | ||
|
|
3cfcdb92ed | ||
|
|
d7af965982 | ||
|
|
7c1c7702d2 | ||
|
|
6eef401602 | ||
|
|
c5b5905ed3 | ||
|
|
76b74349cb | ||
|
|
b08e340f60 | ||
|
|
a25fa29bc9 | ||
|
|
ccf3c8cc30 | ||
|
|
c45ee13b4e | ||
|
|
f1e7db9d0d | ||
|
|
fa8a6c0e94 | ||
|
|
1e8ca497e0 | ||
|
|
a504cc87ab | ||
|
|
5268bbc840 | ||
|
|
e1d770939b | ||
|
|
2866a9e82e | ||
|
|
b67cddb303 | ||
|
|
cb1d84d980 | ||
|
|
642797b69e | ||
|
|
3ed156a5b6 | ||
|
|
2d93b129a0 | ||
|
|
32c7859659 | ||
|
|
729ac38ea8 | ||
|
|
d69b0539ba | ||
|
|
ec78babad2 | ||
|
|
9350dfb215 | ||
|
|
8ac8be5206 | ||
|
|
c2927353a5 | ||
|
|
33251a9d8f | ||
|
|
c045ae7a9b | ||
|
|
602ccb7d5f | ||
|
|
5df21e1058 | ||
|
|
08135910a5 | ||
|
|
f58a22d07e | ||
|
|
cedde559b8 | ||
|
|
49d1d1ddf9 | ||
|
|
86045ac36c | ||
|
|
79f0e44a20 | ||
|
|
c44695f34b | ||
|
|
5abe2129c6 | ||
|
|
63dd7bce7e | ||
|
|
f3c73f5797 | ||
|
|
e6f2d70517 | ||
|
|
be6d1cc360 | ||
|
|
703716228e | ||
|
|
458bc0c838 | ||
|
|
39591ef627 | ||
|
|
37c440c5d3 | ||
|
|
81e94d1897 | ||
|
|
7bc1274a03 | ||
|
|
5f5a11525c | ||
|
|
e209764877 | ||
|
|
65290b2e96 | ||
|
|
127df96635 | ||
|
|
924d8d489a | ||
|
|
026eb64a83 | ||
|
|
45124856b1 | ||
|
|
38c6f6ce16 | ||
|
|
caa62eff2a | ||
|
|
d3542c34f1 | ||
|
|
7fb62fc849 | ||
|
|
9d6ae06663 | ||
|
|
06c28174c2 | ||
|
|
8af1b43074 | ||
|
|
17b7caddcb | ||
|
|
dab30c27b6 | ||
|
|
bad1dd9759 | ||
|
|
d29836d0d5 | ||
|
|
adb0b3dada | ||
|
|
5e0f39cc9e | ||
|
|
0a34a592d5 | ||
|
|
19aaa91f6d | ||
|
|
404aab9373 | ||
|
|
bc6db2c10e | ||
|
|
772d853dcf | ||
|
|
ab4d272149 | ||
|
|
f70a5cad61 | ||
|
|
7aba299dbd | ||
|
|
4b3b19f444 | ||
|
|
8ab4c8a050 | ||
|
|
7c4a653230 | ||
|
|
a3cd8f0e6d | ||
|
|
65c851a451 | ||
|
|
23cf2fa984 | ||
|
|
ce8d6ae958 | ||
|
|
384b2a91fa | ||
|
|
233c4811db | ||
|
|
2fd4c390cb | ||
|
|
5b9391b51d | ||
|
|
5a6405848d | ||
|
|
191d9d2b74 | ||
|
|
24c8dab86f | ||
|
|
55a4cf64a1 | ||
|
|
722667f189 | ||
|
|
25a515b968 | ||
|
|
1c47fbae81 | ||
|
|
8f0cd7fb9f | ||
|
|
c910132d4b | ||
|
|
70778058d9 | ||
|
|
a379b45257 | ||
|
|
24eca8d58b | ||
|
|
1e3ddd43bc | ||
|
|
989371493b | ||
|
|
f64074c609 | ||
|
|
eba897ffe7 | ||
|
|
5ef2b1baf7 | ||
|
|
f0afd08667 | ||
|
|
b494ac1ea0 | ||
|
|
a163650a99 | ||
|
|
980f5f8440 | ||
|
|
42647f606e | ||
|
|
b807570f46 | ||
|
|
114a757d1c | ||
|
|
9854ded56b | ||
|
|
fdd987c3ad | ||
|
|
da62407fce | ||
|
|
1cc181ca32 | ||
|
|
927587cec8 | ||
|
|
bcf80eaa95 | ||
|
|
f56db3da68 | ||
|
|
68aa9d2715 | ||
|
|
76777f5812 | ||
|
|
56312522f9 | ||
|
|
2d9d0658e8 | ||
|
|
3b61f364f7 | ||
|
|
90e5b6f983 | ||
|
|
75cbaafb96 | ||
|
|
5d5c2738a6 | ||
|
|
cbe155ff48 | ||
|
|
29143b018e | ||
|
|
d8a367dd32 | ||
|
|
ca60561a01 | ||
|
|
86a409a174 | ||
|
|
66242f0d0e | ||
|
|
7f78e80c51 | ||
|
|
f8f88154d5 | ||
|
|
5cff7d1de9 | ||
|
|
8f0cafd508 | ||
|
|
e0d41ac6a3 | ||
|
|
72ef59c378 | ||
|
|
673c297949 | ||
|
|
e61732ca7c | ||
|
|
cb4a8396fb | ||
|
|
c77e30116e | ||
|
|
9d369f158c | ||
|
|
6ecd442fb9 | ||
|
|
f3f059c1f8 | ||
|
|
8388e14bbd | ||
|
|
5293e183c5 | ||
|
|
93ff5f7ff0 | ||
|
|
41dce68bdd | ||
|
|
7dece8e4a0 | ||
|
|
37c85d5fd9 | ||
|
|
6094236171 | ||
|
|
bb5aba42eb | ||
|
|
450fb9eafe | ||
|
|
557e3024cd | ||
|
|
bd34d7ecfc | ||
|
|
0a8c672630 | ||
|
|
b87ab17d05 | ||
|
|
d874675955 | ||
|
|
5d37560308 | ||
|
|
7cec13d1df | ||
|
|
b7685eb6ba | ||
|
|
c7f3b4e62c | ||
|
|
5bad2deff8 | ||
|
|
d39608c367 | ||
|
|
cba4da3f4d | ||
|
|
2669d140f8 | ||
|
|
f49ad33f1b | ||
|
|
670205e17a | ||
|
|
f72d4814b1 | ||
|
|
5ecf0664cc | ||
|
|
7cae265447 | ||
|
|
5aa969a588 | ||
|
|
93cc40584d | ||
|
|
130184fee9 | ||
|
|
d47f610606 | ||
|
|
0650e51f0b | ||
|
|
737a557f09 | ||
|
|
6f7ebe6e01 | ||
|
|
70ab0d5b1f | ||
|
|
6ac76248cf | ||
|
|
b32da3b42e | ||
|
|
0ccfc62e88 | ||
|
|
b55cf773a8 | ||
|
|
43ded1c54b | ||
|
|
f8702d4625 | ||
|
|
44111e3ba3 | ||
|
|
298bc588f9 | ||
|
|
4ba521f53f | ||
|
|
431d32756b | ||
|
|
3d172d98a3 | ||
|
|
849ac791a6 | ||
|
|
de5e6a15ae | ||
|
|
0d6bf14ecb | ||
|
|
d1e79c4af3 | ||
|
|
abb2ac5246 | ||
|
|
99dbbe5f18 | ||
|
|
e7ca8ef5a8 | ||
|
|
1ce4976e36 | ||
|
|
9300107cdf | ||
|
|
9aaa02bc9a | ||
|
|
5603259c53 | ||
|
|
ce15c62f35 | ||
|
|
eaff0cd568 | ||
|
|
587935ebed | ||
|
|
07dddfed28 | ||
|
|
229dc7704f | ||
|
|
067f2ac814 | ||
|
|
865870a8e5 | ||
|
|
d19263aec8 | ||
|
|
6d742719a1 | ||
|
|
c75bc9b8b0 | ||
|
|
33007cc0bb | ||
|
|
987833e0b9 | ||
|
|
f36acf00de | ||
|
|
956fc3dec9 | ||
|
|
b38e841f2d | ||
|
|
3a0111c75e | ||
|
|
086a02ab92 | ||
|
|
7ed39655dc | ||
|
|
c6172dae47 | ||
|
|
4ba783d0af | ||
|
|
0457fe81a9 | ||
|
|
fb524dd973 | ||
|
|
8c6d2664c0 | ||
|
|
cdbbd15eb9 | ||
|
|
85f8bf97f5 | ||
|
|
83ed930bc2 | ||
|
|
071e30cc53 | ||
|
|
e6ef27637b | ||
|
|
b532470792 | ||
|
|
e0d7ecf91c | ||
|
|
edba2e9744 | ||
|
|
7e552b645f | ||
|
|
ea5900f155 | ||
|
|
28ab40c8b7 | ||
|
|
d423142623 | ||
|
|
1c0e85f9a0 | ||
|
|
5bc09074ea | ||
|
|
1fac4a3c91 | ||
|
|
1bc917324d | ||
|
|
af429fb401 | ||
|
|
710fe02d0b | ||
|
|
de87aad990 | ||
|
|
41d48719e1 | ||
|
|
d88377f9f0 | ||
|
|
ecd577c934 | ||
|
|
f43f8401ee | ||
|
|
1877bbc7cb | ||
|
|
a064ebb64c | ||
|
|
4726870e8d | ||
|
|
3bbc106c70 | ||
|
|
66eb081876 | ||
|
|
f291ab2b87 | ||
|
|
66ec135676 | ||
|
|
28af3e5008 | ||
|
|
f337d73a6c | ||
|
|
57ce541521 | ||
|
|
e14f24034f | ||
|
|
04fb0a0342 | ||
|
|
8c42dcc041 | ||
|
|
9070a4dc02 | ||
|
|
86a28458c6 | ||
|
|
c058d04250 | ||
|
|
c310932121 | ||
|
|
ff563ff080 | ||
|
|
7f9d2a7d05 | ||
|
|
13f4e173c9 | ||
|
|
85116a8375 | ||
|
|
e42c884c2b | ||
|
|
eb706bc9f4 | ||
|
|
798df756de | ||
|
|
732d13fe06 | ||
|
|
feae7f39c1 | ||
|
|
c2b468c958 | ||
|
|
e272a380b4 | ||
|
|
0dc7a3fc15 | ||
|
|
a1bc0ada59 | ||
|
|
e9b5224a8a | ||
|
|
bdd039a9ee | ||
|
|
b405eef324 | ||
|
|
ba557d126b | ||
|
|
2dde20a227 | ||
|
|
4ade0bb41c | ||
|
|
100da024b6 | ||
|
|
de744a44dd | ||
|
|
0e026371ec | ||
|
|
4b87acb1f6 | ||
|
|
43957f4401 | ||
|
|
8a4f092e82 | ||
|
|
6b6b3f68be | ||
|
|
96f1175a80 | ||
|
|
1c29de81de | ||
|
|
f658263543 | ||
|
|
64ca947722 | ||
|
|
23f4c0a742 | ||
|
|
7c5b99683c | ||
|
|
160c4aff61 | ||
|
|
6e5ca5dc5c | ||
|
|
f3445949d1 | ||
|
|
95a85312f5 | ||
|
|
934fb8592f | ||
|
|
bb239b4f69 | ||
|
|
1cd7900790 | ||
|
|
8c61c3e54e | ||
|
|
d7c9dd06f4 | ||
|
|
b9119f11bf | ||
|
|
7216f22609 | ||
|
|
bf58f7f649 | ||
|
|
3f0ebc6a40 | ||
|
|
0baf4bc796 | ||
|
|
c356030660 | ||
|
|
c4bb6d78d4 | ||
|
|
3b82e806f2 | ||
|
|
403d9779d9 | ||
|
|
b3b8f18f61 | ||
|
|
960c7d69a8 | ||
|
|
60dae0b4ac | ||
|
|
c660926a06 | ||
|
|
7fa04e2d14 | ||
|
|
db4059cd6d | ||
|
|
fdb19fdb92 | ||
|
|
53b4dc944d | ||
|
|
a03e1b3895 | ||
|
|
15f1bcc9c2 | ||
|
|
24580f2493 | ||
|
|
e3945d94fd | ||
|
|
d806c3a47e | ||
|
|
05fe39088b | ||
|
|
530d3eaf09 | ||
|
|
7e190d72a5 | ||
|
|
9c936034b6 | ||
|
|
5719f13cb2 | ||
|
|
d134a9856e | ||
|
|
664b99b5ac | ||
|
|
4256231eb7 | ||
|
|
ae27490281 | ||
|
|
fbd8ca2ff4 | ||
|
|
ec673a5d67 | ||
|
|
7fab38c51e | ||
|
|
84f7dcd052 | ||
|
|
7095a5d551 | ||
|
|
538c2a2a3e | ||
|
|
62f83869f1 | ||
|
|
69670b61c4 | ||
|
|
0a8aaa2c24 | ||
|
|
e474790400 | ||
|
|
2c99e2461a | ||
|
|
cf8e27a554 | ||
|
|
287ea2e5e3 | ||
|
|
86e14f2f1a | ||
|
|
adbae62281 | ||
|
|
3127a4a13b | ||
|
|
6d993410c9 | ||
|
|
fb05e4cb0b | ||
|
|
b0a7234759 | ||
|
|
ddf4b15ebc | ||
|
|
3065532f15 | ||
|
|
d6fc74a412 | ||
|
|
7a370394a7 | ||
|
|
0f3cf8ac94 | ||
|
|
014be8b230 | ||
|
|
08978458be | ||
|
|
2252d9faa8 | ||
|
|
22e15844ae | ||
|
|
ca9af37478 | ||
|
|
aae41e8661 | ||
|
|
8331ce865c | ||
|
|
3bac4d485d | ||
|
|
f84eaf4f05 | ||
|
|
70b08923ed | ||
|
|
c846a824de | ||
|
|
b71e3a40e2 | ||
|
|
41dfc117e7 | ||
|
|
a72707b8cb | ||
|
|
0f770967b4 | ||
|
|
bd9f4794d9 | ||
|
|
ff5cbe2694 | ||
|
|
2319e0ec8f | ||
|
|
d4e037f1e7 | ||
|
|
139936197a | ||
|
|
d4eed61f57 | ||
|
|
7db3a9e7d9 | ||
|
|
c81ee3bd5b | ||
|
|
7fb7f67bb4 | ||
|
|
86164c8b33 | ||
|
|
97c4cd4434 | ||
|
|
a4fc6da57b | ||
|
|
c934e724a8 | ||
|
|
e554f9514f | ||
|
|
d7cff8fbaf | ||
|
|
90ef661673 | ||
|
|
579b5ee944 | ||
|
|
8ebf2fe550 | ||
|
|
16d3dc821a | ||
|
|
a91eeb1c65 | ||
|
|
49c8c03465 | ||
|
|
5344ffc3de | ||
|
|
296586b7ce | ||
|
|
b7aac87ec1 | ||
|
|
ea4c3639e3 | ||
|
|
745627c8ca | ||
|
|
c2af6d98db | ||
|
|
540973eac4 | ||
|
|
ad5f16f724 | ||
|
|
1aa7218fd6 | ||
|
|
1d5abf1253 | ||
|
|
7b3fb760fa | ||
|
|
3743344e64 | ||
|
|
bbe4f39790 | ||
|
|
7dda9f2894 | ||
|
|
8de41f1d70 | ||
|
|
6984d33b4e | ||
|
|
98d4f9cea5 | ||
|
|
87bc18972f | ||
|
|
25b7d424ab | ||
|
|
a5bd306db9 | ||
|
|
0cbee4a416 | ||
|
|
91ff09151d | ||
|
|
fea5954b18 | ||
|
|
b11b0bb088 | ||
|
|
0ede933719 | ||
|
|
3ab60ce76f | ||
|
|
01ef2baef0 | ||
|
|
6a2e4bfdd9 | ||
|
|
9563336d9a | ||
|
|
4ebe643d0c | ||
|
|
dc897fb864 | ||
|
|
a2498f3e67 | ||
|
|
d150f3ce8c | ||
|
|
cff4572774 | ||
|
|
84008a2560 | ||
|
|
6b7f3bc78c | ||
|
|
a68c23448a | ||
|
|
9043f45489 | ||
|
|
6afd99c73f | ||
|
|
18b5165b22 | ||
|
|
6dc66eefb6 | ||
|
|
0aec60938a | ||
|
|
7c62a57e54 | ||
|
|
59e7ca585d | ||
|
|
3dea06b825 | ||
|
|
ab33614ab1 | ||
|
|
03dff207db | ||
|
|
6a8785379a | ||
|
|
507177b42e | ||
|
|
b79754d06e | ||
|
|
674807eee1 | ||
|
|
30c0343727 | ||
|
|
4fae115dc2 | ||
|
|
3d17255400 | ||
|
|
5488ce8834 | ||
|
|
d7313bb85c | ||
|
|
4b73ada26e | ||
|
|
b4ecae33e4 | ||
|
|
1b9e49eb60 | ||
|
|
7a03e32dd5 | ||
|
|
018a606987 | ||
|
|
26782851a9 | ||
|
|
04ee1d5977 | ||
|
|
6245702c7c | ||
|
|
9098f2159d | ||
|
|
292bdaa6a7 | ||
|
|
6f0c065743 | ||
|
|
94c50e3e90 | ||
|
|
f83108002b | ||
|
|
511873aaed | ||
|
|
eb3fd7a8da | ||
|
|
a3214e982d | ||
|
|
1e172230ce | ||
|
|
51d36b9930 | ||
|
|
d1f0b1eda4 | ||
|
|
ed4eed0a19 | ||
|
|
2cf3a70be5 | ||
|
|
6d42ea47bf | ||
|
|
b227c63edf | ||
|
|
45c09c1cdd | ||
|
|
66dcaa4e01 | ||
|
|
a7de53d4c4 | ||
|
|
fabf5ec664 | ||
|
|
c6678c5dea | ||
|
|
1686715ad0 | ||
|
|
7507f4b309 | ||
|
|
bc709561b6 | ||
|
|
0e4cbe0165 | ||
|
|
66929ad6fb | ||
|
|
c3cbb56ff8 | ||
|
|
81479b0218 | ||
|
|
3c5452da88 | ||
|
|
59c19d6e18 | ||
|
|
8c07a36fda | ||
|
|
ddd2c83c64 | ||
|
|
212920e47e | ||
|
|
291c2c9a1b | ||
|
|
d7bebd8074 | ||
|
|
5ac3cb1c72 | ||
|
|
812160ba16 | ||
|
|
91d605f781 | ||
|
|
aae39ecf57 | ||
|
|
8b3a293bb0 | ||
|
|
989ab7e883 | ||
|
|
e9d2181e17 | ||
|
|
8a05d6dde0 | ||
|
|
b45d5368b0 | ||
|
|
625abf3c52 | ||
|
|
c0ace1efff | ||
|
|
03a09b7827 | ||
|
|
63d0a865f4 | ||
|
|
5ac4a27042 | ||
|
|
7c7e89e2ea | ||
|
|
561bf2c510 | ||
|
|
98f49671c1 | ||
|
|
78963ad104 | ||
|
|
27442c3daa | ||
|
|
e29bfa09b2 | ||
|
|
b949127b06 | ||
|
|
a3f3d46016 | ||
|
|
c5fc4e6905 | ||
|
|
9dfee8a3b5 | ||
|
|
263e03f4b8 | ||
|
|
074bd3bb12 | ||
|
|
e1d8f97b9e | ||
|
|
7e7b31a626 | ||
|
|
787806285d | ||
|
|
7474cfac08 | ||
|
|
6cbc08f1fb | ||
|
|
8d3450f4c6 | ||
|
|
4902d1daa8 | ||
|
|
40c79988a8 | ||
|
|
d265b4cdd3 | ||
|
|
beaa2cd0a2 | ||
|
|
c4450907e5 | ||
|
|
de9d5e0aa4 | ||
|
|
4046530160 | ||
|
|
5998744bcc | ||
|
|
250ae643a8 | ||
|
|
3edad463fb | ||
|
|
19fcea99da | ||
|
|
f2f02a8af0 | ||
|
|
b135723994 | ||
|
|
23b5249512 | ||
|
|
41fa02f82b | ||
|
|
81dd4bc41e | ||
|
|
ad8b5c3845 | ||
|
|
dcaa2126f1 | ||
|
|
b29ca232d6 | ||
|
|
8c62b11bd5 | ||
|
|
35b60d509f | ||
|
|
d989580c1c | ||
|
|
798160544c | ||
|
|
39bb6fb19c | ||
|
|
82725725fd | ||
|
|
1c3d51ed92 | ||
|
|
04a309f562 | ||
|
|
20e6cd7724 | ||
|
|
9fed5c8fb7 | ||
|
|
4bce65ff9a | ||
|
|
3319befc30 | ||
|
|
ddb7155bbe | ||
|
|
882f549236 | ||
|
|
8d2b61f4d1 | ||
|
|
11ebcb531f | ||
|
|
a389c2ed7f | ||
|
|
e35a5aa550 | ||
|
|
45f641cabb | ||
|
|
48f4a7b886 | ||
|
|
91f72fabc9 | ||
|
|
cbeb67067c | ||
|
|
921ec390bc | ||
|
|
f37cb21305 | ||
|
|
7ee8de3725 | ||
|
|
047a05efb2 | ||
|
|
0c4ab80eac | ||
|
|
2450f82de5 | ||
|
|
5eb1738e8b | ||
|
|
6e22a8f709 | ||
|
|
f8de71eab0 | ||
|
|
8517d9696d | ||
|
|
97f9021c88 | ||
|
|
0a92b31496 | ||
|
|
6c3726913f | ||
|
|
1bfade8adc | ||
|
|
4eebe22fbb | ||
|
|
20d5e757ca | ||
|
|
70cb399d59 | ||
|
|
ce5333656f | ||
|
|
5f0fd093d7 | ||
|
|
0ee2e16b17 | ||
|
|
b607f0fd8e | ||
|
|
c99a211b01 | ||
|
|
949ac54401 | ||
|
|
e406811375 | ||
|
|
590ace104a | ||
|
|
e475f82ff1 | ||
|
|
a368642790 | ||
|
|
8c7983797b | ||
|
|
5dd9a66f9e | ||
|
|
cc877f1980 | ||
|
|
a5d57ca10b | ||
|
|
3ca3394170 | ||
|
|
e59e0ae2dc | ||
|
|
ec07acfb12 | ||
|
|
fa04096733 | ||
|
|
754892402c | ||
|
|
02b9be488b | ||
|
|
cc3ac2b74c | ||
|
|
1dc2ae6968 | ||
|
|
04ae63a5c4 | ||
|
|
b77fade7b8 | ||
|
|
56565c0f58 | ||
|
|
ed634ec320 | ||
|
|
bcaa59c0b9 | ||
|
|
cb1b4a12a6 | ||
|
|
9ff122835f | ||
|
|
f0030ae003 | ||
|
|
acc0f41985 | ||
|
|
bd7d811921 | ||
|
|
14b6796915 | ||
|
|
3f4815efa2 | ||
|
|
ec03848d2f | ||
|
|
1e6267a35f | ||
|
|
47824c5fca | ||
|
|
767590bbd5 | ||
|
|
d210ba5fdb | ||
|
|
8b656bad5f | ||
|
|
97329d4906 | ||
|
|
6a3b9b1d46 | ||
|
|
c913404739 | ||
|
|
8e42af9b1d | ||
|
|
fe17188464 | ||
|
|
51b50f5cf5 | ||
|
|
9e3fe2b4d4 | ||
|
|
eb1618f2ed | ||
|
|
791312824d | ||
|
|
a17b2a4364 | ||
|
|
c4b2bf7ebd | ||
|
|
0723d49e0b | ||
|
|
ad79ca05e9 | ||
|
|
325dd41277 | ||
|
|
7c96c638aa | ||
|
|
9838c71a47 | ||
|
|
79d9314ba6 | ||
|
|
2b33894e7b | ||
|
|
a118557331 | ||
|
|
8ec234ba78 | ||
|
|
70926adaba | ||
|
|
560f088f05 | ||
|
|
aa404b60fe | ||
|
|
1b6d99db7c | ||
|
|
605b90c6c7 | ||
|
|
6f747893be | ||
|
|
dab34c3dd6 | ||
|
|
bf45bef284 | ||
|
|
d55095ab21 | ||
|
|
a048e0c7c1 | ||
|
|
9436c4161f | ||
|
|
e74b06d999 | ||
|
|
f6705b7a7d | ||
|
|
386403dcd1 | ||
|
|
46e613f423 | ||
|
|
56da87cadc | ||
|
|
dcabe694ee | ||
|
|
842419b91f | ||
|
|
3cded20662 | ||
|
|
eb0a56eb22 | ||
|
|
8a541147e2 | ||
|
|
ed0fcfa9b7 | ||
|
|
c5509b05de | ||
|
|
befefe8d84 | ||
|
|
ad92b66eed | ||
|
|
d119f2bcce | ||
|
|
038dc6c629 | ||
|
|
bfc27bee5e | ||
|
|
19528de03e |
10
.circleci/ansible/ansible.cfg
Normal file
10
.circleci/ansible/ansible.cfg
Normal file
@@ -0,0 +1,10 @@
|
||||
[defaults]
|
||||
|
||||
localhost_warning = False
|
||||
host_key_checking = False
|
||||
timeout = 30
|
||||
|
||||
[ssh_connection]
|
||||
ssh_args = -F ./ansible.ssh.cfg
|
||||
scp_if_ssh = True
|
||||
pipelining = True
|
||||
11
.circleci/ansible/ansible.ssh.cfg
Normal file
11
.circleci/ansible/ansible.ssh.cfg
Normal file
@@ -0,0 +1,11 @@
|
||||
Host tele.zenith.tech
|
||||
User admin
|
||||
Port 3023
|
||||
StrictHostKeyChecking no
|
||||
UserKnownHostsFile /dev/null
|
||||
|
||||
Host * !tele.zenith.tech
|
||||
User admin
|
||||
StrictHostKeyChecking no
|
||||
UserKnownHostsFile /dev/null
|
||||
ProxyJump tele.zenith.tech
|
||||
174
.circleci/ansible/deploy.yaml
Normal file
174
.circleci/ansible/deploy.yaml
Normal file
@@ -0,0 +1,174 @@
|
||||
- name: Upload Zenith binaries
|
||||
hosts: pageservers:safekeepers
|
||||
gather_facts: False
|
||||
remote_user: admin
|
||||
vars:
|
||||
force_deploy: false
|
||||
|
||||
tasks:
|
||||
|
||||
- name: get latest version of Zenith binaries
|
||||
ignore_errors: true
|
||||
register: current_version_file
|
||||
set_fact:
|
||||
current_version: "{{ lookup('file', '.zenith_current_version') | trim }}"
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
|
||||
- name: set zero value for current_version
|
||||
when: current_version_file is failed
|
||||
set_fact:
|
||||
current_version: "0"
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
|
||||
- name: get deployed version from content of remote file
|
||||
ignore_errors: true
|
||||
ansible.builtin.slurp:
|
||||
src: /usr/local/.zenith_current_version
|
||||
register: remote_version_file
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
|
||||
- name: decode remote file content
|
||||
when: remote_version_file is succeeded
|
||||
set_fact:
|
||||
remote_version: "{{ remote_version_file['content'] | b64decode | trim }}"
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
|
||||
- name: set zero value for remote_version
|
||||
when: remote_version_file is failed
|
||||
set_fact:
|
||||
remote_version: "0"
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
|
||||
- name: inform about versions
|
||||
debug: msg="Version to deploy - {{ current_version }}, version on storage node - {{ remote_version }}"
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
|
||||
|
||||
- name: upload and extract Zenith binaries to /usr/local
|
||||
when: current_version > remote_version or force_deploy
|
||||
ansible.builtin.unarchive:
|
||||
owner: root
|
||||
group: root
|
||||
src: zenith_install.tar.gz
|
||||
dest: /usr/local
|
||||
become: true
|
||||
tags:
|
||||
- pageserver
|
||||
- safekeeper
|
||||
- binaries
|
||||
- putbinaries
|
||||
|
||||
- name: Deploy pageserver
|
||||
hosts: pageservers
|
||||
gather_facts: False
|
||||
remote_user: admin
|
||||
vars:
|
||||
force_deploy: false
|
||||
|
||||
tasks:
|
||||
- name: init pageserver
|
||||
when: current_version > remote_version or force_deploy
|
||||
shell:
|
||||
cmd: sudo -u pageserver /usr/local/bin/pageserver -c "pg_distrib_dir='/usr/local'" --init -D /storage/pageserver/data
|
||||
args:
|
||||
creates: "/storage/pageserver/data/tenants"
|
||||
environment:
|
||||
ZENITH_REPO_DIR: "/storage/pageserver/data"
|
||||
LD_LIBRARY_PATH: "/usr/local/lib"
|
||||
become: true
|
||||
tags:
|
||||
- pageserver
|
||||
|
||||
- name: upload systemd service definition
|
||||
when: current_version > remote_version or force_deploy
|
||||
ansible.builtin.template:
|
||||
src: systemd/pageserver.service
|
||||
dest: /etc/systemd/system/pageserver.service
|
||||
owner: root
|
||||
group: root
|
||||
mode: '0644'
|
||||
become: true
|
||||
tags:
|
||||
- pageserver
|
||||
|
||||
- name: start systemd service
|
||||
when: current_version > remote_version or force_deploy
|
||||
ansible.builtin.systemd:
|
||||
daemon_reload: yes
|
||||
name: pageserver
|
||||
enabled: yes
|
||||
state: restarted
|
||||
become: true
|
||||
tags:
|
||||
- pageserver
|
||||
|
||||
- name: post version to console
|
||||
when: (current_version > remote_version or force_deploy) and console_mgmt_base_url is defined
|
||||
shell:
|
||||
cmd: |
|
||||
INSTANCE_ID=$(curl -s http://169.254.169.254/latest/meta-data/instance-id)
|
||||
curl -sfS -d '{"version": {{ current_version }} }' -X POST {{ console_mgmt_base_url }}/api/v1/pageservers/$INSTANCE_ID
|
||||
tags:
|
||||
- pageserver
|
||||
|
||||
- name: Deploy safekeeper
|
||||
hosts: safekeepers
|
||||
gather_facts: False
|
||||
remote_user: admin
|
||||
vars:
|
||||
force_deploy: false
|
||||
|
||||
tasks:
|
||||
|
||||
# in the future safekeepers should discover pageservers byself
|
||||
# but currently use first pageserver that was discovered
|
||||
- name: set first pageserver var for safekeepers
|
||||
when: current_version > remote_version or force_deploy
|
||||
set_fact:
|
||||
first_pageserver: "{{ hostvars[groups['pageservers'][0]]['inventory_hostname'] }}"
|
||||
tags:
|
||||
- safekeeper
|
||||
|
||||
- name: upload systemd service definition
|
||||
when: current_version > remote_version or force_deploy
|
||||
ansible.builtin.template:
|
||||
src: systemd/safekeeper.service
|
||||
dest: /etc/systemd/system/safekeeper.service
|
||||
owner: root
|
||||
group: root
|
||||
mode: '0644'
|
||||
become: true
|
||||
tags:
|
||||
- safekeeper
|
||||
|
||||
- name: start systemd service
|
||||
when: current_version > remote_version or force_deploy
|
||||
ansible.builtin.systemd:
|
||||
daemon_reload: yes
|
||||
name: safekeeper
|
||||
enabled: yes
|
||||
state: restarted
|
||||
become: true
|
||||
tags:
|
||||
- safekeeper
|
||||
|
||||
- name: post version to console
|
||||
when: (current_version > remote_version or force_deploy) and console_mgmt_base_url is defined
|
||||
shell:
|
||||
cmd: |
|
||||
INSTANCE_ID=$(curl -s http://169.254.169.254/latest/meta-data/instance-id)
|
||||
curl -sfS -d '{"version": {{ current_version }} }' -X POST {{ console_mgmt_base_url }}/api/v1/safekeepers/$INSTANCE_ID
|
||||
tags:
|
||||
- safekeeper
|
||||
52
.circleci/ansible/get_binaries.sh
Executable file
52
.circleci/ansible/get_binaries.sh
Executable file
@@ -0,0 +1,52 @@
|
||||
#!/bin/bash
|
||||
|
||||
set -e
|
||||
|
||||
RELEASE=${RELEASE:-false}
|
||||
|
||||
# look at docker hub for latest tag fo zenith docker image
|
||||
if [ "${RELEASE}" = "true" ]; then
|
||||
echo "search latest relase tag"
|
||||
VERSION=$(curl -s https://registry.hub.docker.com/v1/repositories/zenithdb/zenith/tags |jq -r -S '.[].name' | grep release | sed 's/release-//g' | tail -1)
|
||||
if [ -z "${VERSION}" ]; then
|
||||
echo "no any docker tags found, exiting..."
|
||||
exit 1
|
||||
else
|
||||
TAG="release-${VERSION}"
|
||||
fi
|
||||
else
|
||||
echo "search latest dev tag"
|
||||
VERSION=$(curl -s https://registry.hub.docker.com/v1/repositories/zenithdb/zenith/tags |jq -r -S '.[].name' | grep -v release | tail -1)
|
||||
if [ -z "${VERSION}" ]; then
|
||||
echo "no any docker tags found, exiting..."
|
||||
exit 1
|
||||
else
|
||||
TAG="${VERSION}"
|
||||
fi
|
||||
fi
|
||||
|
||||
echo "found ${VERSION}"
|
||||
|
||||
# do initial cleanup
|
||||
rm -rf zenith_install postgres_install.tar.gz zenith_install.tar.gz .zenith_current_version
|
||||
mkdir zenith_install
|
||||
|
||||
# retrive binaries from docker image
|
||||
echo "getting binaries from docker image"
|
||||
docker pull --quiet zenithdb/zenith:${TAG}
|
||||
ID=$(docker create zenithdb/zenith:${TAG})
|
||||
docker cp ${ID}:/data/postgres_install.tar.gz .
|
||||
tar -xzf postgres_install.tar.gz -C zenith_install
|
||||
docker cp ${ID}:/usr/local/bin/pageserver zenith_install/bin/
|
||||
docker cp ${ID}:/usr/local/bin/safekeeper zenith_install/bin/
|
||||
docker cp ${ID}:/usr/local/bin/proxy zenith_install/bin/
|
||||
docker cp ${ID}:/usr/local/bin/postgres zenith_install/bin/
|
||||
docker rm -vf ${ID}
|
||||
|
||||
# store version to file (for ansible playbooks) and create binaries tarball
|
||||
echo ${VERSION} > zenith_install/.zenith_current_version
|
||||
echo ${VERSION} > .zenith_current_version
|
||||
tar -czf zenith_install.tar.gz -C zenith_install .
|
||||
|
||||
# do final cleaup
|
||||
rm -rf zenith_install postgres_install.tar.gz
|
||||
7
.circleci/ansible/production.hosts
Normal file
7
.circleci/ansible/production.hosts
Normal file
@@ -0,0 +1,7 @@
|
||||
[pageservers]
|
||||
zenith-1-ps-1
|
||||
|
||||
[safekeepers]
|
||||
zenith-1-sk-1
|
||||
zenith-1-sk-2
|
||||
zenith-1-sk-3
|
||||
7
.circleci/ansible/staging.hosts
Normal file
7
.circleci/ansible/staging.hosts
Normal file
@@ -0,0 +1,7 @@
|
||||
[pageservers]
|
||||
zenith-us-stage-ps-1
|
||||
|
||||
[safekeepers]
|
||||
zenith-us-stage-sk-1
|
||||
zenith-us-stage-sk-2
|
||||
zenith-us-stage-sk-3
|
||||
18
.circleci/ansible/systemd/pageserver.service
Normal file
18
.circleci/ansible/systemd/pageserver.service
Normal file
@@ -0,0 +1,18 @@
|
||||
[Unit]
|
||||
Description=Zenith pageserver
|
||||
After=network.target auditd.service
|
||||
|
||||
[Service]
|
||||
Type=simple
|
||||
User=pageserver
|
||||
Environment=RUST_BACKTRACE=1 ZENITH_REPO_DIR=/storage/pageserver LD_LIBRARY_PATH=/usr/local/lib
|
||||
ExecStart=/usr/local/bin/pageserver -c "pg_distrib_dir='/usr/local'" -c "listen_pg_addr='0.0.0.0:6400'" -c "listen_http_addr='0.0.0.0:9898'" -D /storage/pageserver/data
|
||||
ExecReload=/bin/kill -HUP $MAINPID
|
||||
KillMode=mixed
|
||||
KillSignal=SIGINT
|
||||
Restart=on-failure
|
||||
TimeoutSec=10
|
||||
LimitNOFILE=30000000
|
||||
|
||||
[Install]
|
||||
WantedBy=multi-user.target
|
||||
18
.circleci/ansible/systemd/safekeeper.service
Normal file
18
.circleci/ansible/systemd/safekeeper.service
Normal file
@@ -0,0 +1,18 @@
|
||||
[Unit]
|
||||
Description=Zenith safekeeper
|
||||
After=network.target auditd.service
|
||||
|
||||
[Service]
|
||||
Type=simple
|
||||
User=safekeeper
|
||||
Environment=RUST_BACKTRACE=1 ZENITH_REPO_DIR=/storage/safekeeper/data LD_LIBRARY_PATH=/usr/local/lib
|
||||
ExecStart=/usr/local/bin/safekeeper -l {{ inventory_hostname }}.local:6500 --listen-http {{ inventory_hostname }}.local:7676 -p {{ first_pageserver }}:6400 -D /storage/safekeeper/data
|
||||
ExecReload=/bin/kill -HUP $MAINPID
|
||||
KillMode=mixed
|
||||
KillSignal=SIGINT
|
||||
Restart=on-failure
|
||||
TimeoutSec=10
|
||||
LimitNOFILE=30000000
|
||||
|
||||
[Install]
|
||||
WantedBy=multi-user.target
|
||||
@@ -1,19 +1,34 @@
|
||||
version: 2.1
|
||||
|
||||
orbs:
|
||||
python: circleci/python@1.4.0
|
||||
|
||||
executors:
|
||||
zenith-build-executor:
|
||||
zenith-xlarge-executor:
|
||||
resource_class: xlarge
|
||||
docker:
|
||||
- image: cimg/rust:1.51.0
|
||||
# NB: when changed, do not forget to update rust image tag in all Dockerfiles
|
||||
- image: zimg/rust:1.56
|
||||
zenith-executor:
|
||||
docker:
|
||||
- image: zimg/rust:1.56
|
||||
|
||||
jobs:
|
||||
check-codestyle-rust:
|
||||
executor: zenith-xlarge-executor
|
||||
steps:
|
||||
- checkout
|
||||
- run:
|
||||
name: rustfmt
|
||||
when: always
|
||||
command: cargo fmt --all -- --check
|
||||
|
||||
# A job to build postgres
|
||||
build-postgres:
|
||||
executor: zenith-build-executor
|
||||
executor: zenith-xlarge-executor
|
||||
parameters:
|
||||
build_type:
|
||||
type: enum
|
||||
enum: ["debug", "release"]
|
||||
environment:
|
||||
BUILD_TYPE: << parameters.build_type >>
|
||||
steps:
|
||||
# Checkout the git repo (circleci doesn't have a flag to enable submodules here)
|
||||
- checkout
|
||||
@@ -22,23 +37,13 @@ jobs:
|
||||
# Note this works even though the submodule hasn't been checkout out yet.
|
||||
- run:
|
||||
name: Get postgres cache key
|
||||
command: |
|
||||
git rev-parse HEAD:vendor/postgres > /tmp/cache-key-postgres
|
||||
command: git rev-parse HEAD:vendor/postgres > /tmp/cache-key-postgres
|
||||
|
||||
- restore_cache:
|
||||
name: Restore postgres cache
|
||||
keys:
|
||||
# Restore ONLY if the rev key matches exactly
|
||||
- v03-postgres-cache-{{ checksum "/tmp/cache-key-postgres" }}
|
||||
|
||||
# FIXME We could cache our own docker container, instead of installing packages every time.
|
||||
- run:
|
||||
name: apt install dependencies
|
||||
command: |
|
||||
if [ ! -e tmp_install/bin/postgres ]; then
|
||||
sudo apt update
|
||||
sudo apt install build-essential libreadline-dev zlib1g-dev flex bison libseccomp-dev
|
||||
fi
|
||||
- v04-postgres-cache-<< parameters.build_type >>-{{ checksum "/tmp/cache-key-postgres" }}
|
||||
|
||||
# Build postgres if the restore_cache didn't find a build.
|
||||
# `make` can't figure out whether the cache is valid, since
|
||||
@@ -49,29 +54,26 @@ jobs:
|
||||
if [ ! -e tmp_install/bin/postgres ]; then
|
||||
# "depth 1" saves some time by not cloning the whole repo
|
||||
git submodule update --init --depth 1
|
||||
make postgres
|
||||
# bail out on any warnings
|
||||
COPT='-Werror' mold -run make postgres -j$(nproc)
|
||||
fi
|
||||
|
||||
- save_cache:
|
||||
name: Save postgres cache
|
||||
key: v03-postgres-cache-{{ checksum "/tmp/cache-key-postgres" }}
|
||||
key: v04-postgres-cache-<< parameters.build_type >>-{{ checksum "/tmp/cache-key-postgres" }}
|
||||
paths:
|
||||
- tmp_install
|
||||
|
||||
# A job to build zenith rust code
|
||||
build-zenith:
|
||||
executor: zenith-build-executor
|
||||
executor: zenith-xlarge-executor
|
||||
parameters:
|
||||
build_type:
|
||||
type: enum
|
||||
enum: ["debug", "release"]
|
||||
environment:
|
||||
BUILD_TYPE: << parameters.build_type >>
|
||||
steps:
|
||||
- run:
|
||||
name: apt install dependencies
|
||||
command: |
|
||||
sudo apt update
|
||||
sudo apt install libssl-dev clang
|
||||
|
||||
# Checkout the git repo (without submodules)
|
||||
- checkout
|
||||
|
||||
@@ -86,7 +88,7 @@ jobs:
|
||||
name: Restore postgres cache
|
||||
keys:
|
||||
# Restore ONLY if the rev key matches exactly
|
||||
- v03-postgres-cache-{{ checksum "/tmp/cache-key-postgres" }}
|
||||
- v04-postgres-cache-<< parameters.build_type >>-{{ checksum "/tmp/cache-key-postgres" }}
|
||||
|
||||
- restore_cache:
|
||||
name: Restore rust cache
|
||||
@@ -94,73 +96,144 @@ jobs:
|
||||
# Require an exact match. While an out of date cache might speed up the build,
|
||||
# there's no way to clean out old packages, so the cache grows every time something
|
||||
# changes.
|
||||
- v03-rust-cache-deps-<< parameters.build_type >>-{{ checksum "Cargo.lock" }}
|
||||
- v04-rust-cache-deps-<< parameters.build_type >>-{{ checksum "Cargo.lock" }}
|
||||
|
||||
# Build the rust code, including test binaries
|
||||
- run:
|
||||
name: Rust build << parameters.build_type >>
|
||||
command: |
|
||||
export CARGO_INCREMENTAL=0
|
||||
BUILD_TYPE="<< parameters.build_type >>"
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
echo "Build in debug mode"
|
||||
cargo build --bins --tests
|
||||
cov_prefix=(scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage run)
|
||||
CARGO_FLAGS=
|
||||
elif [[ $BUILD_TYPE == "release" ]]; then
|
||||
echo "Build in release mode"
|
||||
cargo build --release --bins --tests
|
||||
cov_prefix=()
|
||||
CARGO_FLAGS=--release
|
||||
fi
|
||||
|
||||
export CARGO_INCREMENTAL=0
|
||||
"${cov_prefix[@]}" mold -run cargo build $CARGO_FLAGS --bins --tests
|
||||
|
||||
- save_cache:
|
||||
name: Save rust cache
|
||||
key: v03-rust-cache-deps-<< parameters.build_type >>-{{ checksum "Cargo.lock" }}
|
||||
key: v04-rust-cache-deps-<< parameters.build_type >>-{{ checksum "Cargo.lock" }}
|
||||
paths:
|
||||
- ~/.cargo/registry
|
||||
- ~/.cargo/git
|
||||
- target
|
||||
|
||||
# Run style checks
|
||||
# has to run separately from cargo fmt section
|
||||
# since needs to run with dependencies
|
||||
- run:
|
||||
name: cargo clippy
|
||||
command: |
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
cov_prefix=(scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage run)
|
||||
elif [[ $BUILD_TYPE == "release" ]]; then
|
||||
cov_prefix=()
|
||||
fi
|
||||
|
||||
"${cov_prefix[@]}" ./run_clippy.sh
|
||||
|
||||
# Run rust unit tests
|
||||
- run: cargo test
|
||||
- run:
|
||||
name: cargo test
|
||||
command: |
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
cov_prefix=(scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage run)
|
||||
elif [[ $BUILD_TYPE == "release" ]]; then
|
||||
cov_prefix=()
|
||||
fi
|
||||
|
||||
"${cov_prefix[@]}" cargo test
|
||||
|
||||
# Install the rust binaries, for use by test jobs
|
||||
# `--locked` is required; otherwise, `cargo install` will ignore Cargo.lock.
|
||||
# FIXME: this is a really silly way to install; maybe we should just output
|
||||
# a tarball as an artifact? Or a .deb package?
|
||||
- run:
|
||||
name: cargo install
|
||||
name: Install rust binaries
|
||||
command: |
|
||||
export CARGO_INCREMENTAL=0
|
||||
BUILD_TYPE="<< parameters.build_type >>"
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
echo "Install debug mode"
|
||||
CARGO_FLAGS="--debug"
|
||||
cov_prefix=(scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage run)
|
||||
elif [[ $BUILD_TYPE == "release" ]]; then
|
||||
echo "Install release mode"
|
||||
# The default is release mode; there is no --release flag.
|
||||
CARGO_FLAGS=""
|
||||
cov_prefix=()
|
||||
fi
|
||||
|
||||
binaries=$(
|
||||
"${cov_prefix[@]}" cargo metadata --format-version=1 --no-deps |
|
||||
jq -r '.packages[].targets[] | select(.kind | index("bin")) | .name'
|
||||
)
|
||||
|
||||
test_exe_paths=$(
|
||||
"${cov_prefix[@]}" cargo test --message-format=json --no-run |
|
||||
jq -r '.executable | select(. != null)'
|
||||
)
|
||||
|
||||
mkdir -p /tmp/zenith/bin
|
||||
mkdir -p /tmp/zenith/test_bin
|
||||
mkdir -p /tmp/zenith/etc
|
||||
|
||||
# Install target binaries
|
||||
for bin in $binaries; do
|
||||
SRC=target/$BUILD_TYPE/$bin
|
||||
DST=/tmp/zenith/bin/$bin
|
||||
cp $SRC $DST
|
||||
echo $DST >> /tmp/zenith/etc/binaries.list
|
||||
done
|
||||
|
||||
# Install test executables (for code coverage)
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
for bin in $test_exe_paths; do
|
||||
SRC=$bin
|
||||
DST=/tmp/zenith/test_bin/$(basename $bin)
|
||||
cp $SRC $DST
|
||||
echo $DST >> /tmp/zenith/etc/binaries.list
|
||||
done
|
||||
fi
|
||||
cargo install $CARGO_FLAGS --locked --root /tmp/zenith --path pageserver
|
||||
cargo install $CARGO_FLAGS --locked --root /tmp/zenith --path walkeeper
|
||||
cargo install $CARGO_FLAGS --locked --root /tmp/zenith --path zenith
|
||||
|
||||
# Install the postgres binaries, for use by test jobs
|
||||
# FIXME: this is a silly way to do "install"; maybe just output a standard
|
||||
# postgres package, whatever the favored form is (tarball? .deb package?)
|
||||
# Note that pg_regress needs some build artifacts that probably aren't
|
||||
# in the usual package...?
|
||||
- run:
|
||||
name: postgres install
|
||||
name: Install postgres binaries
|
||||
command: |
|
||||
cp -a tmp_install /tmp/zenith/pg_install
|
||||
|
||||
# Save the rust output binaries for other jobs in this workflow.
|
||||
- run:
|
||||
name: Merge coverage data
|
||||
command: |
|
||||
# This will speed up workspace uploads
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage merge
|
||||
fi
|
||||
|
||||
# Save the rust binaries and coverage data for other jobs in this workflow.
|
||||
- persist_to_workspace:
|
||||
root: /tmp/zenith
|
||||
paths:
|
||||
- "*"
|
||||
|
||||
check-codestyle-python:
|
||||
executor: zenith-executor
|
||||
steps:
|
||||
- checkout
|
||||
- restore_cache:
|
||||
keys:
|
||||
- v1-python-deps-{{ checksum "poetry.lock" }}
|
||||
- run:
|
||||
name: Install deps
|
||||
command: ./scripts/pysync
|
||||
- save_cache:
|
||||
key: v1-python-deps-{{ checksum "poetry.lock" }}
|
||||
paths:
|
||||
- /home/circleci/.cache/pypoetry/virtualenvs
|
||||
- run:
|
||||
name: Run yapf to ensure code format
|
||||
when: always
|
||||
command: poetry run yapf --recursive --diff .
|
||||
- run:
|
||||
name: Run mypy to check types
|
||||
when: always
|
||||
command: poetry run mypy .
|
||||
|
||||
run-pytest:
|
||||
#description: "Run pytest"
|
||||
executor: python/default
|
||||
executor: zenith-executor
|
||||
parameters:
|
||||
# pytest args to specify the tests to run.
|
||||
#
|
||||
@@ -183,6 +256,14 @@ jobs:
|
||||
needs_postgres_source:
|
||||
type: boolean
|
||||
default: false
|
||||
run_in_parallel:
|
||||
type: boolean
|
||||
default: true
|
||||
save_perf_report:
|
||||
type: boolean
|
||||
default: false
|
||||
environment:
|
||||
BUILD_TYPE: << parameters.build_type >>
|
||||
steps:
|
||||
- attach_workspace:
|
||||
at: /tmp/zenith
|
||||
@@ -191,36 +272,82 @@ jobs:
|
||||
condition: << parameters.needs_postgres_source >>
|
||||
steps:
|
||||
- run: git submodule update --init --depth 1
|
||||
- restore_cache:
|
||||
keys:
|
||||
- v1-python-deps-{{ checksum "poetry.lock" }}
|
||||
- run:
|
||||
name: Install pipenv & deps
|
||||
working_directory: test_runner
|
||||
command: |
|
||||
pip install pipenv
|
||||
pipenv install
|
||||
name: Install deps
|
||||
command: ./scripts/pysync
|
||||
- save_cache:
|
||||
key: v1-python-deps-{{ checksum "poetry.lock" }}
|
||||
paths:
|
||||
- /home/circleci/.cache/pypoetry/virtualenvs
|
||||
- run:
|
||||
name: Run pytest
|
||||
working_directory: test_runner
|
||||
# pytest doesn't output test logs in real time, so CI job may fail with
|
||||
# `Too long with no output` error, if a test is running for a long time.
|
||||
# In that case, tests should have internal timeouts that are less than
|
||||
# no_output_timeout, specified here.
|
||||
no_output_timeout: 10m
|
||||
environment:
|
||||
- ZENITH_BIN: /tmp/zenith/bin
|
||||
- POSTGRES_DISTRIB_DIR: /tmp/zenith/pg_install
|
||||
- TEST_OUTPUT: /tmp/test_output
|
||||
# this variable will be embedded in perf test report
|
||||
# and is needed to distinguish different environments
|
||||
- PLATFORM: zenith-local-ci
|
||||
command: |
|
||||
TEST_SELECTION="<< parameters.test_selection >>"
|
||||
PERF_REPORT_DIR="$(realpath test_runner/perf-report-local)"
|
||||
rm -rf $PERF_REPORT_DIR
|
||||
|
||||
TEST_SELECTION="test_runner/<< parameters.test_selection >>"
|
||||
EXTRA_PARAMS="<< parameters.extra_params >>"
|
||||
if [ -z "$TEST_SELECTION" ]; then
|
||||
echo "test_selection must be set"
|
||||
exit 1
|
||||
fi
|
||||
if << parameters.run_in_parallel >>; then
|
||||
EXTRA_PARAMS="-n4 $EXTRA_PARAMS"
|
||||
fi
|
||||
if << parameters.save_perf_report >>; then
|
||||
if [[ $CIRCLE_BRANCH == "main" ]]; then
|
||||
mkdir -p "$PERF_REPORT_DIR"
|
||||
EXTRA_PARAMS="--out-dir $PERF_REPORT_DIR $EXTRA_PARAMS"
|
||||
fi
|
||||
fi
|
||||
|
||||
export GITHUB_SHA=$CIRCLE_SHA1
|
||||
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
cov_prefix=(scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage run)
|
||||
elif [[ $BUILD_TYPE == "release" ]]; then
|
||||
cov_prefix=()
|
||||
fi
|
||||
|
||||
# Run the tests.
|
||||
#
|
||||
# The junit.xml file allows CircleCI to display more fine-grained test information
|
||||
# in its "Tests" tab in the results page.
|
||||
# -s prevents pytest from capturing output, which helps to see
|
||||
# what's going on if the test hangs
|
||||
# --verbose prints name of each test (helpful when there are
|
||||
# multiple tests in one file)
|
||||
# -rA prints summary in the end
|
||||
pipenv run pytest --junitxml=$TEST_OUTPUT/junit.xml --tb=short -s --verbose -rA $TEST_SELECTION $EXTRA_PARAMS
|
||||
# -n4 uses four processes to run tests via pytest-xdist
|
||||
# -s is not used to prevent pytest from capturing output, because tests are running
|
||||
# in parallel and logs are mixed between different tests
|
||||
"${cov_prefix[@]}" ./scripts/pytest \
|
||||
--junitxml=$TEST_OUTPUT/junit.xml \
|
||||
--tb=short \
|
||||
--verbose \
|
||||
-m "not remote_cluster" \
|
||||
-rA $TEST_SELECTION $EXTRA_PARAMS
|
||||
|
||||
if << parameters.save_perf_report >>; then
|
||||
if [[ $CIRCLE_BRANCH == "main" ]]; then
|
||||
export REPORT_FROM="$PERF_REPORT_DIR"
|
||||
export REPORT_TO=local
|
||||
scripts/generate_and_push_perf_report.sh
|
||||
fi
|
||||
fi
|
||||
- run:
|
||||
# CircleCI artifacts are preserved one file at a time, so skipping
|
||||
# this step isn't a good idea. If you want to extract the
|
||||
@@ -229,27 +356,331 @@ jobs:
|
||||
when: always
|
||||
command: |
|
||||
du -sh /tmp/test_output/*
|
||||
find /tmp/test_output -type f ! -name "pg.log" ! -name "pageserver.log" ! -name "wal_acceptor.log" -delete
|
||||
find /tmp/test_output -type f ! -name "pg.log" ! -name "pageserver.log" ! -name "safekeeper.log" ! -name "regression.diffs" ! -name "junit.xml" ! -name "*.filediff" ! -name "*.stdout" ! -name "*.stderr" -delete
|
||||
du -sh /tmp/test_output/*
|
||||
- store_artifacts:
|
||||
path: /tmp/test_output
|
||||
# The store_test_results step tells CircleCI where to find the junit.xml file.
|
||||
- store_test_results:
|
||||
path: /tmp/test_output
|
||||
- run:
|
||||
name: Merge coverage data
|
||||
command: |
|
||||
# This will speed up workspace uploads
|
||||
if [[ $BUILD_TYPE == "debug" ]]; then
|
||||
scripts/coverage "--profraw-prefix=$CIRCLE_JOB" --dir=/tmp/zenith/coverage merge
|
||||
fi
|
||||
# Save coverage data (if any)
|
||||
- persist_to_workspace:
|
||||
root: /tmp/zenith
|
||||
paths:
|
||||
- "*"
|
||||
|
||||
coverage-report:
|
||||
executor: zenith-xlarge-executor
|
||||
steps:
|
||||
- attach_workspace:
|
||||
at: /tmp/zenith
|
||||
- checkout
|
||||
- restore_cache:
|
||||
name: Restore rust cache
|
||||
keys:
|
||||
# Require an exact match. While an out of date cache might speed up the build,
|
||||
# there's no way to clean out old packages, so the cache grows every time something
|
||||
# changes.
|
||||
- v04-rust-cache-deps-debug-{{ checksum "Cargo.lock" }}
|
||||
- run:
|
||||
name: Build coverage report
|
||||
command: |
|
||||
COMMIT_URL=https://github.com/zenithdb/zenith/commit/$CIRCLE_SHA1
|
||||
|
||||
scripts/coverage \
|
||||
--dir=/tmp/zenith/coverage report \
|
||||
--input-objects=/tmp/zenith/etc/binaries.list \
|
||||
--commit-url=$COMMIT_URL \
|
||||
--format=github
|
||||
- run:
|
||||
name: Upload coverage report
|
||||
command: |
|
||||
LOCAL_REPO=$CIRCLE_PROJECT_USERNAME/$CIRCLE_PROJECT_REPONAME
|
||||
REPORT_URL=https://zenithdb.github.io/zenith-coverage-data/$CIRCLE_SHA1
|
||||
COMMIT_URL=https://github.com/zenithdb/zenith/commit/$CIRCLE_SHA1
|
||||
|
||||
scripts/git-upload \
|
||||
--repo=https://$VIP_VAP_ACCESS_TOKEN@github.com/zenithdb/zenith-coverage-data.git \
|
||||
--message="Add code coverage for $COMMIT_URL" \
|
||||
copy /tmp/zenith/coverage/report $CIRCLE_SHA1 # COPY FROM TO_RELATIVE
|
||||
|
||||
# Add link to the coverage report to the commit
|
||||
curl -f -X POST \
|
||||
https://api.github.com/repos/$LOCAL_REPO/statuses/$CIRCLE_SHA1 \
|
||||
-H "Accept: application/vnd.github.v3+json" \
|
||||
--user "$CI_ACCESS_TOKEN" \
|
||||
--data \
|
||||
"{
|
||||
\"state\": \"success\",
|
||||
\"context\": \"zenith-coverage\",
|
||||
\"description\": \"Coverage report is ready\",
|
||||
\"target_url\": \"$REPORT_URL\"
|
||||
}"
|
||||
|
||||
# Build zenithdb/zenith:latest image and push it to Docker hub
|
||||
docker-image:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
steps:
|
||||
- checkout
|
||||
- setup_remote_docker:
|
||||
docker_layer_caching: true
|
||||
- run:
|
||||
name: Init postgres submodule
|
||||
command: git submodule update --init --depth 1
|
||||
- run:
|
||||
name: Build and push Docker image
|
||||
command: |
|
||||
echo $DOCKER_PWD | docker login -u $DOCKER_LOGIN --password-stdin
|
||||
DOCKER_TAG=$(git log --oneline|wc -l)
|
||||
docker build --build-arg GIT_VERSION=$CIRCLE_SHA1 -t zenithdb/zenith:latest . && docker push zenithdb/zenith:latest
|
||||
docker tag zenithdb/zenith:latest zenithdb/zenith:${DOCKER_TAG} && docker push zenithdb/zenith:${DOCKER_TAG}
|
||||
|
||||
# Build zenithdb/compute-node:latest image and push it to Docker hub
|
||||
docker-image-compute:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
steps:
|
||||
- checkout
|
||||
- setup_remote_docker:
|
||||
docker_layer_caching: true
|
||||
# Build zenithdb/compute-tools:latest image and push it to Docker hub
|
||||
# TODO: this should probably also use versioned tag, not just :latest.
|
||||
# XXX: but should it? We build and use it only locally now.
|
||||
- run:
|
||||
name: Build and push compute-tools Docker image
|
||||
command: |
|
||||
echo $DOCKER_PWD | docker login -u $DOCKER_LOGIN --password-stdin
|
||||
docker build -t zenithdb/compute-tools:latest -f Dockerfile.compute-tools .
|
||||
docker push zenithdb/compute-tools:latest
|
||||
- run:
|
||||
name: Init postgres submodule
|
||||
command: git submodule update --init --depth 1
|
||||
- run:
|
||||
name: Build and push compute-node Docker image
|
||||
command: |
|
||||
echo $DOCKER_PWD | docker login -u $DOCKER_LOGIN --password-stdin
|
||||
DOCKER_TAG=$(git log --oneline|wc -l)
|
||||
docker build -t zenithdb/compute-node:latest vendor/postgres && docker push zenithdb/compute-node:latest
|
||||
docker tag zenithdb/compute-node:latest zenithdb/compute-node:${DOCKER_TAG} && docker push zenithdb/compute-node:${DOCKER_TAG}
|
||||
|
||||
# Build production zenithdb/zenith:release image and push it to Docker hub
|
||||
docker-image-release:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
steps:
|
||||
- checkout
|
||||
- setup_remote_docker:
|
||||
docker_layer_caching: true
|
||||
- run:
|
||||
name: Init postgres submodule
|
||||
command: git submodule update --init --depth 1
|
||||
- run:
|
||||
name: Build and push Docker image
|
||||
command: |
|
||||
echo $DOCKER_PWD | docker login -u $DOCKER_LOGIN --password-stdin
|
||||
DOCKER_TAG="release-$(git log --oneline|wc -l)"
|
||||
docker build --build-arg GIT_VERSION=$CIRCLE_SHA1 -t zenithdb/zenith:release . && docker push zenithdb/zenith:release
|
||||
docker tag zenithdb/zenith:release zenithdb/zenith:${DOCKER_TAG} && docker push zenithdb/zenith:${DOCKER_TAG}
|
||||
|
||||
# Build production zenithdb/compute-node:release image and push it to Docker hub
|
||||
docker-image-compute-release:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
steps:
|
||||
- checkout
|
||||
- setup_remote_docker:
|
||||
docker_layer_caching: true
|
||||
# Build zenithdb/compute-tools:release image and push it to Docker hub
|
||||
# TODO: this should probably also use versioned tag, not just :latest.
|
||||
# XXX: but should it? We build and use it only locally now.
|
||||
- run:
|
||||
name: Build and push compute-tools Docker image
|
||||
command: |
|
||||
echo $DOCKER_PWD | docker login -u $DOCKER_LOGIN --password-stdin
|
||||
docker build -t zenithdb/compute-tools:release -f Dockerfile.compute-tools .
|
||||
docker push zenithdb/compute-tools:release
|
||||
- run:
|
||||
name: Init postgres submodule
|
||||
command: git submodule update --init --depth 1
|
||||
- run:
|
||||
name: Build and push compute-node Docker image
|
||||
command: |
|
||||
echo $DOCKER_PWD | docker login -u $DOCKER_LOGIN --password-stdin
|
||||
DOCKER_TAG="release-$(git log --oneline|wc -l)"
|
||||
docker build -t zenithdb/compute-node:release vendor/postgres && docker push zenithdb/compute-node:release
|
||||
docker tag zenithdb/compute-node:release zenithdb/compute-node:${DOCKER_TAG} && docker push zenithdb/compute-node:${DOCKER_TAG}
|
||||
|
||||
deploy-staging:
|
||||
docker:
|
||||
- image: cimg/python:3.10
|
||||
steps:
|
||||
- checkout
|
||||
- setup_remote_docker
|
||||
- run:
|
||||
name: Setup ansible
|
||||
command: |
|
||||
pip install --progress-bar off --user ansible boto3
|
||||
- run:
|
||||
name: Redeploy
|
||||
command: |
|
||||
cd "$(pwd)/.circleci/ansible"
|
||||
|
||||
./get_binaries.sh
|
||||
|
||||
echo "${TELEPORT_SSH_KEY}" | tr -d '\n'| base64 --decode >ssh-key
|
||||
echo "${TELEPORT_SSH_CERT}" | tr -d '\n'| base64 --decode >ssh-key-cert.pub
|
||||
chmod 0600 ssh-key
|
||||
ssh-add ssh-key
|
||||
rm -f ssh-key ssh-key-cert.pub
|
||||
|
||||
ansible-playbook deploy.yaml -i staging.hosts
|
||||
rm -f zenith_install.tar.gz .zenith_current_version
|
||||
|
||||
deploy-staging-proxy:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
environment:
|
||||
KUBECONFIG: .kubeconfig
|
||||
steps:
|
||||
- checkout
|
||||
- run:
|
||||
name: Store kubeconfig file
|
||||
command: |
|
||||
echo "${STAGING_KUBECONFIG_DATA}" | base64 --decode > ${KUBECONFIG}
|
||||
chmod 0600 ${KUBECONFIG}
|
||||
- run:
|
||||
name: Setup helm v3
|
||||
command: |
|
||||
curl -s https://raw.githubusercontent.com/helm/helm/main/scripts/get-helm-3 | bash
|
||||
helm repo add zenithdb https://zenithdb.github.io/helm-charts
|
||||
- run:
|
||||
name: Re-deploy proxy
|
||||
command: |
|
||||
DOCKER_TAG=$(git log --oneline|wc -l)
|
||||
helm upgrade zenith-proxy zenithdb/zenith-proxy --install -f .circleci/helm-values/staging.proxy.yaml --set image.tag=${DOCKER_TAG} --wait
|
||||
|
||||
|
||||
deploy-release:
|
||||
docker:
|
||||
- image: cimg/python:3.10
|
||||
steps:
|
||||
- checkout
|
||||
- setup_remote_docker
|
||||
- run:
|
||||
name: Setup ansible
|
||||
command: |
|
||||
pip install --progress-bar off --user ansible boto3
|
||||
- run:
|
||||
name: Redeploy
|
||||
command: |
|
||||
cd "$(pwd)/.circleci/ansible"
|
||||
|
||||
RELEASE=true ./get_binaries.sh
|
||||
|
||||
echo "${TELEPORT_SSH_KEY}" | tr -d '\n'| base64 --decode >ssh-key
|
||||
echo "${TELEPORT_SSH_CERT}" | tr -d '\n'| base64 --decode >ssh-key-cert.pub
|
||||
chmod 0600 ssh-key
|
||||
ssh-add ssh-key
|
||||
rm -f ssh-key ssh-key-cert.pub
|
||||
|
||||
ansible-playbook deploy.yaml -i production.hosts -e console_mgmt_base_url=http://console-release.local
|
||||
rm -f zenith_install.tar.gz .zenith_current_version
|
||||
|
||||
deploy-release-proxy:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
environment:
|
||||
KUBECONFIG: .kubeconfig
|
||||
steps:
|
||||
- checkout
|
||||
- run:
|
||||
name: Store kubeconfig file
|
||||
command: |
|
||||
echo "${PRODUCTION_KUBECONFIG_DATA}" | base64 --decode > ${KUBECONFIG}
|
||||
chmod 0600 ${KUBECONFIG}
|
||||
- run:
|
||||
name: Setup helm v3
|
||||
command: |
|
||||
curl -s https://raw.githubusercontent.com/helm/helm/main/scripts/get-helm-3 | bash
|
||||
helm repo add zenithdb https://zenithdb.github.io/helm-charts
|
||||
- run:
|
||||
name: Re-deploy proxy
|
||||
command: |
|
||||
DOCKER_TAG="release-$(git log --oneline|wc -l)"
|
||||
helm upgrade zenith-proxy zenithdb/zenith-proxy --install -f .circleci/helm-values/production.proxy.yaml --set image.tag=${DOCKER_TAG} --wait
|
||||
|
||||
# Trigger a new remote CI job
|
||||
remote-ci-trigger:
|
||||
docker:
|
||||
- image: cimg/base:2021.04
|
||||
parameters:
|
||||
remote_repo:
|
||||
type: string
|
||||
environment:
|
||||
REMOTE_REPO: << parameters.remote_repo >>
|
||||
steps:
|
||||
- run:
|
||||
name: Set PR's status to pending
|
||||
command: |
|
||||
LOCAL_REPO=$CIRCLE_PROJECT_USERNAME/$CIRCLE_PROJECT_REPONAME
|
||||
|
||||
curl -f -X POST \
|
||||
https://api.github.com/repos/$LOCAL_REPO/statuses/$CIRCLE_SHA1 \
|
||||
-H "Accept: application/vnd.github.v3+json" \
|
||||
--user "$CI_ACCESS_TOKEN" \
|
||||
--data \
|
||||
"{
|
||||
\"state\": \"pending\",
|
||||
\"context\": \"zenith-remote-ci\",
|
||||
\"description\": \"[$REMOTE_REPO] Remote CI job is about to start\"
|
||||
}"
|
||||
- run:
|
||||
name: Request a remote CI test
|
||||
command: |
|
||||
LOCAL_REPO=$CIRCLE_PROJECT_USERNAME/$CIRCLE_PROJECT_REPONAME
|
||||
|
||||
curl -f -X POST \
|
||||
https://api.github.com/repos/$REMOTE_REPO/actions/workflows/testing.yml/dispatches \
|
||||
-H "Accept: application/vnd.github.v3+json" \
|
||||
--user "$CI_ACCESS_TOKEN" \
|
||||
--data \
|
||||
"{
|
||||
\"ref\": \"main\",
|
||||
\"inputs\": {
|
||||
\"ci_job_name\": \"zenith-remote-ci\",
|
||||
\"commit_hash\": \"$CIRCLE_SHA1\",
|
||||
\"remote_repo\": \"$LOCAL_REPO\"
|
||||
}
|
||||
}"
|
||||
|
||||
workflows:
|
||||
build_and_test:
|
||||
jobs:
|
||||
- build-postgres
|
||||
- check-codestyle-rust
|
||||
- check-codestyle-python
|
||||
- build-postgres:
|
||||
name: build-postgres-<< matrix.build_type >>
|
||||
matrix:
|
||||
parameters:
|
||||
build_type: ["debug", "release"]
|
||||
- build-zenith:
|
||||
name: build-zenith-<< matrix.build_type >>
|
||||
matrix:
|
||||
parameters:
|
||||
build_type: ["debug", "release"]
|
||||
requires:
|
||||
- build-postgres
|
||||
- build-postgres-<< matrix.build_type >>
|
||||
- run-pytest:
|
||||
name: pg_regress tests << matrix.build_type >>
|
||||
name: pg_regress-tests-<< matrix.build_type >>
|
||||
context: PERF_TEST_RESULT_CONNSTR
|
||||
matrix:
|
||||
parameters:
|
||||
build_type: ["debug", "release"]
|
||||
@@ -258,10 +689,117 @@ workflows:
|
||||
requires:
|
||||
- build-zenith-<< matrix.build_type >>
|
||||
- run-pytest:
|
||||
name: other tests << matrix.build_type >>
|
||||
name: other-tests-<< matrix.build_type >>
|
||||
matrix:
|
||||
parameters:
|
||||
build_type: ["debug", "release"]
|
||||
test_selection: batch_others
|
||||
requires:
|
||||
- build-zenith-<< matrix.build_type >>
|
||||
- run-pytest:
|
||||
name: benchmarks
|
||||
context: PERF_TEST_RESULT_CONNSTR
|
||||
build_type: release
|
||||
test_selection: performance
|
||||
run_in_parallel: false
|
||||
save_perf_report: true
|
||||
requires:
|
||||
- build-zenith-release
|
||||
- coverage-report:
|
||||
# Context passes credentials for gh api
|
||||
context: CI_ACCESS_TOKEN
|
||||
requires:
|
||||
# TODO: consider adding more
|
||||
- other-tests-debug
|
||||
- docker-image:
|
||||
# Context gives an ability to login
|
||||
context: Docker Hub
|
||||
# Build image only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- main
|
||||
requires:
|
||||
- pg_regress-tests-release
|
||||
- other-tests-release
|
||||
- docker-image-compute:
|
||||
# Context gives an ability to login
|
||||
context: Docker Hub
|
||||
# Build image only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- main
|
||||
requires:
|
||||
- pg_regress-tests-release
|
||||
- other-tests-release
|
||||
- deploy-staging:
|
||||
# Context gives an ability to login
|
||||
context: Docker Hub
|
||||
# deploy only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- main
|
||||
requires:
|
||||
- docker-image
|
||||
- deploy-staging-proxy:
|
||||
# deploy only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- main
|
||||
requires:
|
||||
- docker-image
|
||||
|
||||
- docker-image-release:
|
||||
# Context gives an ability to login
|
||||
context: Docker Hub
|
||||
# Build image only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- release
|
||||
requires:
|
||||
- pg_regress-tests-release
|
||||
- other-tests-release
|
||||
- docker-image-compute-release:
|
||||
# Context gives an ability to login
|
||||
context: Docker Hub
|
||||
# Build image only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- release
|
||||
requires:
|
||||
- pg_regress-tests-release
|
||||
- other-tests-release
|
||||
- deploy-release:
|
||||
# Context gives an ability to login
|
||||
context: Docker Hub
|
||||
# deploy only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- release
|
||||
requires:
|
||||
- docker-image-release
|
||||
- deploy-release-proxy:
|
||||
# deploy only for commits to main
|
||||
filters:
|
||||
branches:
|
||||
only:
|
||||
- release
|
||||
requires:
|
||||
- docker-image-release
|
||||
- remote-ci-trigger:
|
||||
# Context passes credentials for gh api
|
||||
context: CI_ACCESS_TOKEN
|
||||
remote_repo: "zenithdb/console"
|
||||
requires:
|
||||
# XXX: Successful build doesn't mean everything is OK, but
|
||||
# the job to be triggered takes so much time to complete (~22 min)
|
||||
# that it's better not to wait for the commented-out steps
|
||||
- build-zenith-debug
|
||||
# - pg_regress-tests-release
|
||||
# - other-tests-release
|
||||
|
||||
35
.circleci/helm-values/production.proxy.yaml
Normal file
35
.circleci/helm-values/production.proxy.yaml
Normal file
@@ -0,0 +1,35 @@
|
||||
# Helm chart values for zenith-proxy.
|
||||
# This is a YAML-formatted file.
|
||||
|
||||
settings:
|
||||
authEndpoint: "https://console.zenith.tech/authenticate_proxy_request/"
|
||||
uri: "https://console.zenith.tech/psql_session/"
|
||||
|
||||
# -- Additional labels for zenith-proxy pods
|
||||
podLabels:
|
||||
zenith_service: proxy
|
||||
zenith_env: production
|
||||
zenith_region: us-west-2
|
||||
zenith_region_slug: oregon
|
||||
|
||||
service:
|
||||
annotations:
|
||||
service.beta.kubernetes.io/aws-load-balancer-type: external
|
||||
service.beta.kubernetes.io/aws-load-balancer-nlb-target-type: ip
|
||||
service.beta.kubernetes.io/aws-load-balancer-scheme: internal
|
||||
external-dns.alpha.kubernetes.io/hostname: proxy-release.local
|
||||
type: LoadBalancer
|
||||
|
||||
exposedService:
|
||||
annotations:
|
||||
service.beta.kubernetes.io/aws-load-balancer-type: external
|
||||
service.beta.kubernetes.io/aws-load-balancer-nlb-target-type: ip
|
||||
service.beta.kubernetes.io/aws-load-balancer-scheme: internet-facing
|
||||
external-dns.alpha.kubernetes.io/hostname: start.zenith.tech
|
||||
|
||||
metrics:
|
||||
enabled: true
|
||||
serviceMonitor:
|
||||
enabled: true
|
||||
selector:
|
||||
release: kube-prometheus-stack
|
||||
27
.circleci/helm-values/staging.proxy.yaml
Normal file
27
.circleci/helm-values/staging.proxy.yaml
Normal file
@@ -0,0 +1,27 @@
|
||||
# Helm chart values for zenith-proxy.
|
||||
# This is a YAML-formatted file.
|
||||
|
||||
settings:
|
||||
authEndpoint: "https://console.stage.zenith.tech/authenticate_proxy_request/"
|
||||
uri: "https://console.stage.zenith.tech/psql_session/"
|
||||
|
||||
# -- Additional labels for zenith-proxy pods
|
||||
podLabels:
|
||||
zenith_service: proxy
|
||||
zenith_env: staging
|
||||
zenith_region: us-east-1
|
||||
zenith_region_slug: virginia
|
||||
|
||||
exposedService:
|
||||
annotations:
|
||||
service.beta.kubernetes.io/aws-load-balancer-type: external
|
||||
service.beta.kubernetes.io/aws-load-balancer-nlb-target-type: ip
|
||||
service.beta.kubernetes.io/aws-load-balancer-scheme: internet-facing
|
||||
external-dns.alpha.kubernetes.io/hostname: start.stage.zenith.tech
|
||||
|
||||
metrics:
|
||||
enabled: true
|
||||
serviceMonitor:
|
||||
enabled: true
|
||||
selector:
|
||||
release: kube-prometheus-stack
|
||||
@@ -2,12 +2,17 @@
|
||||
**/__pycache__
|
||||
**/.pytest_cache
|
||||
|
||||
/target
|
||||
/tmp_check
|
||||
/tmp_install
|
||||
/tmp_check_cli
|
||||
/test_output
|
||||
/.vscode
|
||||
/.zenith
|
||||
/integration_tests/.zenith
|
||||
/Dockerfile
|
||||
.git
|
||||
target
|
||||
tmp_check
|
||||
tmp_install
|
||||
tmp_check_cli
|
||||
test_output
|
||||
.vscode
|
||||
.zenith
|
||||
integration_tests/.zenith
|
||||
.mypy_cache
|
||||
|
||||
Dockerfile
|
||||
.dockerignore
|
||||
|
||||
|
||||
103
.github/workflows/benchmarking.yml
vendored
Normal file
103
.github/workflows/benchmarking.yml
vendored
Normal file
@@ -0,0 +1,103 @@
|
||||
name: benchmarking
|
||||
|
||||
on:
|
||||
# uncomment to run on push for debugging your PR
|
||||
# push:
|
||||
# branches: [ your branch ]
|
||||
schedule:
|
||||
# * is a special character in YAML so you have to quote this string
|
||||
# ┌───────────── minute (0 - 59)
|
||||
# │ ┌───────────── hour (0 - 23)
|
||||
# │ │ ┌───────────── day of the month (1 - 31)
|
||||
# │ │ │ ┌───────────── month (1 - 12 or JAN-DEC)
|
||||
# │ │ │ │ ┌───────────── day of the week (0 - 6 or SUN-SAT)
|
||||
- cron: '36 7 * * *' # run once a day, timezone is utc
|
||||
|
||||
workflow_dispatch: # adds ability to run this manually
|
||||
|
||||
jobs:
|
||||
bench:
|
||||
# this workflow runs on self hosteed runner
|
||||
# it's environment is quite different from usual guthub runner
|
||||
# probably the most important difference is that it doesnt start from clean workspace each time
|
||||
# e g if you install system packages they are not cleaned up since you install them directly in host machine
|
||||
# not a container or something
|
||||
# See documentation for more info: https://docs.github.com/en/actions/hosting-your-own-runners/about-self-hosted-runners
|
||||
runs-on: [self-hosted, zenith-benchmarker]
|
||||
|
||||
env:
|
||||
PG_BIN: "/usr/pgsql-13/bin"
|
||||
|
||||
steps:
|
||||
- name: Checkout zenith repo
|
||||
uses: actions/checkout@v2
|
||||
|
||||
# actions/setup-python@v2 is not working correctly on self-hosted runners
|
||||
# see https://github.com/actions/setup-python/issues/162
|
||||
# and probably https://github.com/actions/setup-python/issues/162#issuecomment-865387976 in particular
|
||||
# so the simplest solution to me is to use already installed system python and spin virtualenvs for job runs.
|
||||
# there is Python 3.7.10 already installed on the machine so use it to install poetry and then use poetry's virtuealenvs
|
||||
- name: Install poetry & deps
|
||||
run: |
|
||||
python3 -m pip install --upgrade poetry wheel
|
||||
# since pip/poetry caches are reused there shouldn't be any troubles with install every time
|
||||
./scripts/pysync
|
||||
|
||||
- name: Show versions
|
||||
run: |
|
||||
echo Python
|
||||
python3 --version
|
||||
poetry run python3 --version
|
||||
echo Pipenv
|
||||
poetry --version
|
||||
echo Pgbench
|
||||
$PG_BIN/pgbench --version
|
||||
|
||||
# FIXME cluster setup is skipped due to various changes in console API
|
||||
# for now pre created cluster is used. When API gain some stability
|
||||
# after massive changes dynamic cluster setup will be revived.
|
||||
# So use pre created cluster. It needs to be started manually, but stop is automatic after 5 minutes of inactivity
|
||||
- name: Setup cluster
|
||||
env:
|
||||
BENCHMARK_CONNSTR: "${{ secrets.BENCHMARK_STAGING_CONNSTR }}"
|
||||
shell: bash
|
||||
run: |
|
||||
set -e
|
||||
|
||||
echo "Starting cluster"
|
||||
# wake up the cluster
|
||||
$PG_BIN/psql $BENCHMARK_CONNSTR -c "SELECT 1"
|
||||
|
||||
- name: Run benchmark
|
||||
# pgbench is installed system wide from official repo
|
||||
# https://download.postgresql.org/pub/repos/yum/13/redhat/rhel-7-x86_64/
|
||||
# via
|
||||
# sudo tee /etc/yum.repos.d/pgdg.repo<<EOF
|
||||
# [pgdg13]
|
||||
# name=PostgreSQL 13 for RHEL/CentOS 7 - x86_64
|
||||
# baseurl=https://download.postgresql.org/pub/repos/yum/13/redhat/rhel-7-x86_64/
|
||||
# enabled=1
|
||||
# gpgcheck=0
|
||||
# EOF
|
||||
# sudo yum makecache
|
||||
# sudo yum install postgresql13-contrib
|
||||
# actual binaries are located in /usr/pgsql-13/bin/
|
||||
env:
|
||||
TEST_PG_BENCH_TRANSACTIONS_MATRIX: "5000,10000,20000"
|
||||
TEST_PG_BENCH_SCALES_MATRIX: "10,15"
|
||||
PLATFORM: "zenith-staging"
|
||||
BENCHMARK_CONNSTR: "${{ secrets.BENCHMARK_STAGING_CONNSTR }}"
|
||||
REMOTE_ENV: "1" # indicate to test harness that we do not have zenith binaries locally
|
||||
run: |
|
||||
# just to be sure that no data was cached on self hosted runner
|
||||
# since it might generate duplicates when calling ingest_perf_test_result.py
|
||||
rm -rf perf-report-staging
|
||||
mkdir -p perf-report-staging
|
||||
./scripts/pytest test_runner/performance/ -v -m "remote_cluster" --skip-interfering-proc-check --out-dir perf-report-staging
|
||||
|
||||
- name: Submit result
|
||||
env:
|
||||
VIP_VAP_ACCESS_TOKEN: "${{ secrets.VIP_VAP_ACCESS_TOKEN }}"
|
||||
PERF_TEST_RESULT_CONNSTR: "${{ secrets.PERF_TEST_RESULT_CONNSTR }}"
|
||||
run: |
|
||||
REPORT_FROM=$(realpath perf-report-staging) REPORT_TO=staging scripts/generate_and_push_perf_report.sh
|
||||
5
.github/workflows/testing.yml
vendored
5
.github/workflows/testing.yml
vendored
@@ -64,10 +64,11 @@ jobs:
|
||||
target
|
||||
key: ${{ runner.os }}-cargo-${{ hashFiles('**/Cargo.lock') }}
|
||||
|
||||
# Use `env CARGO_INCREMENTAL=0` to mitigate https://github.com/rust-lang/rust/issues/91696 for rustc 1.57.0
|
||||
- name: Run cargo build
|
||||
run: |
|
||||
cargo build --workspace --bins --examples --tests
|
||||
env CARGO_INCREMENTAL=0 cargo build --workspace --bins --examples --tests
|
||||
|
||||
- name: Run cargo test
|
||||
run: |
|
||||
cargo test -- --nocapture --test-threads=1
|
||||
env CARGO_INCREMENTAL=0 cargo test -- --nocapture --test-threads=1
|
||||
|
||||
4
.gitignore
vendored
4
.gitignore
vendored
@@ -7,3 +7,7 @@ test_output/
|
||||
.vscode
|
||||
/.zenith
|
||||
/integration_tests/.zenith
|
||||
|
||||
# Coverage
|
||||
*.profraw
|
||||
*.profdata
|
||||
|
||||
2
.gitmodules
vendored
2
.gitmodules
vendored
@@ -1,4 +1,4 @@
|
||||
[submodule "vendor/postgres"]
|
||||
path = vendor/postgres
|
||||
url = https://github.com/libzenith/postgres
|
||||
url = https://github.com/zenithdb/postgres
|
||||
branch = main
|
||||
|
||||
10
.yapfignore
Normal file
10
.yapfignore
Normal file
@@ -0,0 +1,10 @@
|
||||
# This file is only read when `yapf` is run from this directory.
|
||||
# Hence we only top-level directories here to avoid confusion.
|
||||
# See source code for the exact file format: https://github.com/google/yapf/blob/c6077954245bc3add82dafd853a1c7305a6ebd20/yapf/yapflib/file_resources.py#L40-L43
|
||||
vendor/
|
||||
target/
|
||||
tmp_install/
|
||||
__pycache__/
|
||||
test_output/
|
||||
.zenith/
|
||||
.git/
|
||||
1889
Cargo.lock
generated
1889
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
16
Cargo.toml
16
Cargo.toml
@@ -1,15 +1,23 @@
|
||||
[workspace]
|
||||
members = [
|
||||
"pageserver",
|
||||
"walkeeper",
|
||||
"zenith",
|
||||
"compute_tools",
|
||||
"control_plane",
|
||||
"pageserver",
|
||||
"postgres_ffi",
|
||||
"zenith_utils",
|
||||
"proxy",
|
||||
"walkeeper",
|
||||
"workspace_hack",
|
||||
"zenith",
|
||||
"zenith_metrics",
|
||||
"zenith_utils",
|
||||
]
|
||||
|
||||
[profile.release]
|
||||
# This is useful for profiling and, to some extent, debug.
|
||||
# Besides, debug info should not affect the performance.
|
||||
debug = true
|
||||
|
||||
# This is only needed for proxy's tests
|
||||
# TODO: we should probably fork tokio-postgres-rustls instead
|
||||
[patch.crates-io]
|
||||
tokio-postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="2949d98df52587d562986aad155dd4e889e408b7" }
|
||||
|
||||
108
Dockerfile
108
Dockerfile
@@ -1,93 +1,63 @@
|
||||
#
|
||||
# Docker image for console integration testing.
|
||||
#
|
||||
# We may also reuse it in CI to unify installation process and as a general binaries building
|
||||
# tool for production servers.
|
||||
#
|
||||
# Dynamic linking is used for librocksdb and libstdc++ bacause librocksdb-sys calls
|
||||
# bindgen with "dynamic" feature flag. This also prevents usage of dockerhub alpine-rust
|
||||
# images which are statically linked and have guards against any dlopen. I would rather
|
||||
# prefer all static binaries so we may change the way librocksdb-sys builds or wait until
|
||||
# we will have our own storage and drop rockdb dependency.
|
||||
#
|
||||
# Cargo-chef is used to separate dependencies building from main binaries building. This
|
||||
# way `docker build` will download and install dependencies only of there are changes to
|
||||
# out Cargo.toml files.
|
||||
#
|
||||
|
||||
|
||||
#
|
||||
# build postgres separately -- this layer will be rebuilt only if one of
|
||||
# mentioned paths will get any changes
|
||||
# Build Postgres separately --- this layer will be rebuilt only if one of
|
||||
# mentioned paths will get any changes.
|
||||
#
|
||||
FROM alpine:3.13 as pg-build
|
||||
RUN apk add --update clang llvm compiler-rt compiler-rt-static lld musl-dev binutils \
|
||||
make bison flex readline-dev zlib-dev perl linux-headers
|
||||
WORKDIR zenith
|
||||
FROM zimg/rust:1.56 AS pg-build
|
||||
WORKDIR /zenith
|
||||
COPY ./vendor/postgres vendor/postgres
|
||||
COPY ./Makefile Makefile
|
||||
# Build using clang and lld
|
||||
RUN CC='clang' LD='lld' CFLAGS='-fuse-ld=lld --rtlib=compiler-rt' make postgres -j4
|
||||
|
||||
#
|
||||
# Calculate cargo dependencies.
|
||||
# This will always run, but only generate recipe.json with list of dependencies without
|
||||
# installing them.
|
||||
#
|
||||
FROM alpine:20210212 as cargo-deps-inspect
|
||||
RUN apk add --update rust cargo
|
||||
RUN cargo install cargo-chef
|
||||
WORKDIR zenith
|
||||
COPY . .
|
||||
RUN cargo chef prepare --recipe-path recipe.json
|
||||
|
||||
#
|
||||
# Build cargo dependencies.
|
||||
# This temp cantainner would be build only if recipe.json was changed.
|
||||
#
|
||||
FROM alpine:20210212 as deps-build
|
||||
RUN apk add --update rust cargo openssl-dev clang build-base
|
||||
# rust-rocksdb can be built against system-wide rocksdb -- that saves about
|
||||
# 10 minutes during build. Rocksdb apk package is in testing now, but use it
|
||||
# anyway. In case of any troubles we can download and build rocksdb here manually
|
||||
# (to cache it as a docker layer).
|
||||
RUN apk --no-cache --update --repository https://dl-cdn.alpinelinux.org/alpine/edge/testing add rocksdb-dev
|
||||
WORKDIR zenith
|
||||
COPY --from=pg-build /zenith/tmp_install/include/postgresql/server tmp_install/include/postgresql/server
|
||||
COPY --from=cargo-deps-inspect /root/.cargo/bin/cargo-chef /root/.cargo/bin/
|
||||
COPY --from=cargo-deps-inspect /zenith/recipe.json recipe.json
|
||||
RUN ROCKSDB_LIB_DIR=/usr/lib/ cargo chef cook --release --recipe-path recipe.json
|
||||
ENV BUILD_TYPE release
|
||||
RUN make -j $(getconf _NPROCESSORS_ONLN) -s postgres
|
||||
RUN rm -rf postgres_install/build
|
||||
|
||||
#
|
||||
# Build zenith binaries
|
||||
#
|
||||
FROM alpine:20210212 as build
|
||||
RUN apk add --update rust cargo openssl-dev clang build-base
|
||||
RUN apk --no-cache --update --repository https://dl-cdn.alpinelinux.org/alpine/edge/testing add rocksdb-dev
|
||||
WORKDIR zenith
|
||||
COPY . .
|
||||
# Copy cached dependencies
|
||||
# TODO: build cargo deps as separate layer. We used cargo-chef before but that was
|
||||
# net time waste in a lot of cases. Copying Cargo.lock with empty lib.rs should do the work.
|
||||
#
|
||||
FROM zimg/rust:1.56 AS build
|
||||
|
||||
ARG GIT_VERSION
|
||||
RUN if [ -z "$GIT_VERSION" ]; then echo "GIT_VERSION is reqired, use build_arg to pass it"; exit 1; fi
|
||||
|
||||
WORKDIR /zenith
|
||||
COPY --from=pg-build /zenith/tmp_install/include/postgresql/server tmp_install/include/postgresql/server
|
||||
COPY --from=deps-build /zenith/target target
|
||||
COPY --from=deps-build /root/.cargo /root/.cargo
|
||||
RUN cargo build --release
|
||||
|
||||
COPY . .
|
||||
RUN GIT_VERSION=$GIT_VERSION cargo build --release
|
||||
|
||||
#
|
||||
# Copy binaries to resulting image.
|
||||
# build-base hare to provide libstdc++ (it will also bring gcc, but leave it this way until we figure
|
||||
# out how to statically link rocksdb or avoid it at all).
|
||||
#
|
||||
FROM alpine:3.13
|
||||
RUN apk add --update openssl build-base
|
||||
RUN apk --no-cache --update --repository https://dl-cdn.alpinelinux.org/alpine/edge/testing add rocksdb
|
||||
FROM debian:bullseye-slim
|
||||
WORKDIR /data
|
||||
|
||||
RUN apt-get update && apt-get -yq install libreadline-dev libseccomp-dev openssl ca-certificates && \
|
||||
mkdir zenith_install
|
||||
|
||||
COPY --from=build /zenith/target/release/pageserver /usr/local/bin
|
||||
COPY --from=build /zenith/target/release/wal_acceptor /usr/local/bin
|
||||
COPY --from=pg-build /zenith/tmp_install /usr/local
|
||||
COPY --from=build /zenith/target/release/safekeeper /usr/local/bin
|
||||
COPY --from=build /zenith/target/release/proxy /usr/local/bin
|
||||
COPY --from=pg-build /zenith/tmp_install postgres_install
|
||||
COPY docker-entrypoint.sh /docker-entrypoint.sh
|
||||
|
||||
RUN addgroup zenith && adduser -h /data -D -G zenith zenith
|
||||
# Remove build artifacts (~ 500 MB)
|
||||
RUN rm -rf postgres_install/build && \
|
||||
# 'Install' Postgres binaries locally
|
||||
cp -r postgres_install/* /usr/local/ && \
|
||||
# Prepare an archive of Postgres binaries (should be around 11 MB)
|
||||
# and keep it inside container for an ease of deploy pipeline.
|
||||
cd postgres_install && tar -czf /data/postgres_install.tar.gz . && cd .. && \
|
||||
rm -rf postgres_install
|
||||
|
||||
RUN useradd -d /data zenith && chown -R zenith:zenith /data
|
||||
|
||||
VOLUME ["/data"]
|
||||
WORKDIR /data
|
||||
USER zenith
|
||||
EXPOSE 6400
|
||||
ENTRYPOINT ["/docker-entrypoint.sh"]
|
||||
|
||||
95
Dockerfile.alpine
Normal file
95
Dockerfile.alpine
Normal file
@@ -0,0 +1,95 @@
|
||||
#
|
||||
# Docker image for console integration testing.
|
||||
#
|
||||
# We may also reuse it in CI to unify installation process and as a general binaries building
|
||||
# tool for production servers.
|
||||
#
|
||||
# Dynamic linking is used for librocksdb and libstdc++ bacause librocksdb-sys calls
|
||||
# bindgen with "dynamic" feature flag. This also prevents usage of dockerhub alpine-rust
|
||||
# images which are statically linked and have guards against any dlopen. I would rather
|
||||
# prefer all static binaries so we may change the way librocksdb-sys builds or wait until
|
||||
# we will have our own storage and drop rockdb dependency.
|
||||
#
|
||||
# Cargo-chef is used to separate dependencies building from main binaries building. This
|
||||
# way `docker build` will download and install dependencies only of there are changes to
|
||||
# out Cargo.toml files.
|
||||
#
|
||||
|
||||
|
||||
#
|
||||
# build postgres separately -- this layer will be rebuilt only if one of
|
||||
# mentioned paths will get any changes
|
||||
#
|
||||
FROM alpine:3.13 as pg-build
|
||||
RUN apk add --update clang llvm compiler-rt compiler-rt-static lld musl-dev binutils \
|
||||
make bison flex readline-dev zlib-dev perl linux-headers libseccomp-dev
|
||||
WORKDIR zenith
|
||||
COPY ./vendor/postgres vendor/postgres
|
||||
COPY ./Makefile Makefile
|
||||
# Build using clang and lld
|
||||
RUN CC='clang' LD='lld' CFLAGS='-fuse-ld=lld --rtlib=compiler-rt' make postgres -j4
|
||||
|
||||
#
|
||||
# Calculate cargo dependencies.
|
||||
# This will always run, but only generate recipe.json with list of dependencies without
|
||||
# installing them.
|
||||
#
|
||||
FROM alpine:20210212 as cargo-deps-inspect
|
||||
RUN apk add --update rust cargo
|
||||
RUN cargo install cargo-chef
|
||||
WORKDIR zenith
|
||||
COPY . .
|
||||
RUN cargo chef prepare --recipe-path recipe.json
|
||||
|
||||
#
|
||||
# Build cargo dependencies.
|
||||
# This temp cantainner would be build only if recipe.json was changed.
|
||||
#
|
||||
FROM alpine:20210212 as deps-build
|
||||
RUN apk add --update rust cargo openssl-dev clang build-base
|
||||
# rust-rocksdb can be built against system-wide rocksdb -- that saves about
|
||||
# 10 minutes during build. Rocksdb apk package is in testing now, but use it
|
||||
# anyway. In case of any troubles we can download and build rocksdb here manually
|
||||
# (to cache it as a docker layer).
|
||||
RUN apk --no-cache --update --repository https://dl-cdn.alpinelinux.org/alpine/edge/testing add rocksdb-dev
|
||||
WORKDIR zenith
|
||||
COPY --from=pg-build /zenith/tmp_install/include/postgresql/server tmp_install/include/postgresql/server
|
||||
COPY --from=cargo-deps-inspect /root/.cargo/bin/cargo-chef /root/.cargo/bin/
|
||||
COPY --from=cargo-deps-inspect /zenith/recipe.json recipe.json
|
||||
RUN ROCKSDB_LIB_DIR=/usr/lib/ cargo chef cook --release --recipe-path recipe.json
|
||||
|
||||
#
|
||||
# Build zenith binaries
|
||||
#
|
||||
FROM alpine:20210212 as build
|
||||
RUN apk add --update rust cargo openssl-dev clang build-base
|
||||
RUN apk --no-cache --update --repository https://dl-cdn.alpinelinux.org/alpine/edge/testing add rocksdb-dev
|
||||
WORKDIR zenith
|
||||
COPY . .
|
||||
# Copy cached dependencies
|
||||
COPY --from=pg-build /zenith/tmp_install/include/postgresql/server tmp_install/include/postgresql/server
|
||||
COPY --from=deps-build /zenith/target target
|
||||
COPY --from=deps-build /root/.cargo /root/.cargo
|
||||
RUN cargo build --release
|
||||
|
||||
#
|
||||
# Copy binaries to resulting image.
|
||||
# build-base hare to provide libstdc++ (it will also bring gcc, but leave it this way until we figure
|
||||
# out how to statically link rocksdb or avoid it at all).
|
||||
#
|
||||
FROM alpine:3.13
|
||||
RUN apk add --update openssl build-base libseccomp-dev
|
||||
RUN apk --no-cache --update --repository https://dl-cdn.alpinelinux.org/alpine/edge/testing add rocksdb
|
||||
COPY --from=build /zenith/target/release/pageserver /usr/local/bin
|
||||
COPY --from=build /zenith/target/release/safekeeper /usr/local/bin
|
||||
COPY --from=build /zenith/target/release/proxy /usr/local/bin
|
||||
COPY --from=pg-build /zenith/tmp_install /usr/local
|
||||
COPY docker-entrypoint.sh /docker-entrypoint.sh
|
||||
|
||||
RUN addgroup zenith && adduser -h /data -D -G zenith zenith
|
||||
VOLUME ["/data"]
|
||||
WORKDIR /data
|
||||
USER zenith
|
||||
EXPOSE 6400
|
||||
ENTRYPOINT ["/docker-entrypoint.sh"]
|
||||
CMD ["pageserver"]
|
||||
14
Dockerfile.compute-tools
Normal file
14
Dockerfile.compute-tools
Normal file
@@ -0,0 +1,14 @@
|
||||
# First transient image to build compute_tools binaries
|
||||
# NB: keep in sync with rust image version in .circle/config.yml
|
||||
FROM rust:1.56.1-slim-buster AS rust-build
|
||||
|
||||
WORKDIR /zenith
|
||||
|
||||
COPY . .
|
||||
|
||||
RUN cargo build -p compute_tools --release
|
||||
|
||||
# Final image that only has one binary
|
||||
FROM debian:buster-slim
|
||||
|
||||
COPY --from=rust-build /zenith/target/release/zenith_ctl /usr/local/bin/zenith_ctl
|
||||
73
Makefile
73
Makefile
@@ -2,68 +2,103 @@
|
||||
UNAME_S := $(shell uname -s)
|
||||
ifeq ($(UNAME_S),Linux)
|
||||
SECCOMP = --with-libseccomp
|
||||
SECCOMP =
|
||||
else
|
||||
SECCOMP =
|
||||
endif
|
||||
|
||||
#
|
||||
# We differentiate between release / debug build types using the BUILD_TYPE
|
||||
# environment variable.
|
||||
#
|
||||
BUILD_TYPE ?= debug
|
||||
ifeq ($(BUILD_TYPE),release)
|
||||
PG_CONFIGURE_OPTS = --enable-debug
|
||||
PG_CFLAGS = -O2 -g3 $(CFLAGS)
|
||||
# Unfortunately, `--profile=...` is a nightly feature
|
||||
CARGO_BUILD_FLAGS += --release
|
||||
else ifeq ($(BUILD_TYPE),debug)
|
||||
PG_CONFIGURE_OPTS = --enable-debug --enable-cassert --enable-depend
|
||||
PG_CFLAGS = -O0 -g3 $(CFLAGS)
|
||||
else
|
||||
$(error Bad build type `$(BUILD_TYPE)', see Makefile for options)
|
||||
endif
|
||||
|
||||
# Choose whether we should be silent or verbose
|
||||
CARGO_BUILD_FLAGS += --$(if $(filter s,$(MAKEFLAGS)),quiet,verbose)
|
||||
# Fix for a corner case when make doesn't pass a jobserver
|
||||
CARGO_BUILD_FLAGS += $(filter -j1,$(MAKEFLAGS))
|
||||
|
||||
# This option has a side effect of passing make jobserver to cargo.
|
||||
# However, we shouldn't do this if `make -n` (--dry-run) has been asked.
|
||||
CARGO_CMD_PREFIX += $(if $(filter n,$(MAKEFLAGS)),,+)
|
||||
# Force cargo not to print progress bar
|
||||
CARGO_CMD_PREFIX += CARGO_TERM_PROGRESS_WHEN=never CI=1
|
||||
|
||||
#
|
||||
# Top level Makefile to build Zenith and PostgreSQL
|
||||
#
|
||||
.PHONY: all
|
||||
all: zenith postgres
|
||||
|
||||
# We don't want to run 'cargo build' in parallel with the postgres build,
|
||||
# because interleaving cargo build output with postgres build output looks
|
||||
# confusing. Also, 'cargo build' is parallel on its own, so it would be too
|
||||
# much parallelism. (Recursive invocation of postgres target still gets any
|
||||
# '-j' flag from the command line, so 'make -j' is still useful.)
|
||||
.NOTPARALLEL:
|
||||
|
||||
### Zenith Rust bits
|
||||
#
|
||||
# The 'postgres_ffi' depends on the Postgres headers.
|
||||
.PHONY: zenith
|
||||
zenith: postgres-headers
|
||||
cargo build
|
||||
+@echo "Compiling Zenith"
|
||||
$(CARGO_CMD_PREFIX) cargo build $(CARGO_BUILD_FLAGS)
|
||||
|
||||
### PostgreSQL parts
|
||||
tmp_install/build/config.status:
|
||||
+@echo "Configuring postgres build"
|
||||
mkdir -p tmp_install/build
|
||||
(cd tmp_install/build && \
|
||||
../../vendor/postgres/configure CFLAGS='-O0 -g3 $(CFLAGS)' \
|
||||
--enable-cassert \
|
||||
--enable-debug \
|
||||
--enable-depend \
|
||||
../../vendor/postgres/configure CFLAGS='$(PG_CFLAGS)' \
|
||||
$(PG_CONFIGURE_OPTS) \
|
||||
$(SECCOMP) \
|
||||
--prefix=$(abspath tmp_install) > configure.log)
|
||||
|
||||
# nicer alias for running 'configure'
|
||||
.PHONY: postgres-configure
|
||||
postgres-configure: tmp_install/build/config.status
|
||||
|
||||
# Install the PostgreSQL header files into tmp_install/include
|
||||
.PHONY: postgres-headers
|
||||
postgres-headers: postgres-configure
|
||||
+@echo "Installing PostgreSQL headers"
|
||||
$(MAKE) -C tmp_install/build/src/include MAKELEVEL=0 install
|
||||
|
||||
|
||||
# Compile and install PostgreSQL and contrib/zenith
|
||||
postgres: postgres-configure
|
||||
.PHONY: postgres
|
||||
postgres: postgres-configure \
|
||||
postgres-headers # to prevent `make install` conflicts with zenith's `postgres-headers`
|
||||
+@echo "Compiling PostgreSQL"
|
||||
$(MAKE) -C tmp_install/build MAKELEVEL=0 install
|
||||
+@echo "Compiling contrib/zenith"
|
||||
$(MAKE) -C tmp_install/build/contrib/zenith install
|
||||
+@echo "Compiling contrib/zenith_test_utils"
|
||||
$(MAKE) -C tmp_install/build/contrib/zenith_test_utils install
|
||||
|
||||
.PHONY: postgres-clean
|
||||
postgres-clean:
|
||||
$(MAKE) -C tmp_install/build MAKELEVEL=0 clean
|
||||
|
||||
# This doesn't remove the effects of 'configure'.
|
||||
.PHONY: clean
|
||||
clean:
|
||||
cd tmp_install/build && ${MAKE} clean
|
||||
cargo clean
|
||||
cd tmp_install/build && $(MAKE) clean
|
||||
$(CARGO_CMD_PREFIX) cargo clean
|
||||
|
||||
# This removes everything
|
||||
.PHONY: distclean
|
||||
distclean:
|
||||
rm -rf tmp_install
|
||||
cargo clean
|
||||
$(CARGO_CMD_PREFIX) cargo clean
|
||||
|
||||
.PHONY: postgres-configure postgres postgres-headers zenith
|
||||
.PHONY: fmt
|
||||
fmt:
|
||||
./pre-commit.py --fix-inplace
|
||||
|
||||
.PHONY: setup-pre-commit-hook
|
||||
setup-pre-commit-hook:
|
||||
ln -s -f ../../pre-commit.py .git/hooks/pre-commit
|
||||
|
||||
132
README.md
132
README.md
@@ -1,6 +1,22 @@
|
||||
# Zenith
|
||||
|
||||
Zenith substitutes PostgreSQL storage layer and redistributes data across a cluster of nodes
|
||||
Zenith is a serverless open source alternative to AWS Aurora Postgres. It separates storage and compute and substitutes PostgreSQL storage layer by redistributing data across a cluster of nodes.
|
||||
|
||||
## Architecture overview
|
||||
|
||||
A Zenith installation consists of compute nodes and Zenith storage engine.
|
||||
|
||||
Compute nodes are stateless PostgreSQL nodes, backed by Zenith storage engine.
|
||||
|
||||
Zenith storage engine consists of two major components:
|
||||
- Pageserver. Scalable storage backend for compute nodes.
|
||||
- WAL service. The service that receives WAL from compute node and ensures that it is stored durably.
|
||||
|
||||
Pageserver consists of:
|
||||
- Repository - Zenith storage implementation.
|
||||
- WAL receiver - service that receives WAL from WAL service and stores it in the repository.
|
||||
- Page service - service that communicates with compute nodes and responds with pages from the repository.
|
||||
- WAL redo - service that builds pages from base images and WAL records on Page service request.
|
||||
|
||||
## Running local installation
|
||||
|
||||
@@ -9,22 +25,19 @@ Zenith substitutes PostgreSQL storage layer and redistributes data across a clus
|
||||
On Ubuntu or Debian this set of packages should be sufficient to build the code:
|
||||
```text
|
||||
apt install build-essential libtool libreadline-dev zlib1g-dev flex bison libseccomp-dev \
|
||||
libssl-dev clang
|
||||
libssl-dev clang pkg-config libpq-dev
|
||||
```
|
||||
|
||||
[Rust] 1.48 or later is also required.
|
||||
[Rust] 1.56.1 or later is also required.
|
||||
|
||||
To run the `psql` client, install the `postgresql-client` package or modify `PATH` and `LD_LIBRARY_PATH` to include `tmp_install/bin` and `tmp_install/lib`, respectively.
|
||||
|
||||
To run the integration tests (not required to use the code), install
|
||||
Python (3.6 or higher), and install python3 packages with `pip` (called `pip3` on some systems):
|
||||
```
|
||||
pip install pytest psycopg2
|
||||
```
|
||||
To run the integration tests or Python scripts (not required to use the code), install
|
||||
Python (3.7 or higher), and install python3 packages using `./scripts/pysync` (requires poetry) in the project directory.
|
||||
|
||||
2. Build zenith and patched postgres
|
||||
```sh
|
||||
git clone --recursive https://github.com/libzenith/zenith.git
|
||||
git clone --recursive https://github.com/zenithdb/zenith.git
|
||||
cd zenith
|
||||
make -j5
|
||||
```
|
||||
@@ -34,18 +47,26 @@ make -j5
|
||||
# Create repository in .zenith with proper paths to binaries and data
|
||||
# Later that would be responsibility of a package install script
|
||||
> ./target/debug/zenith init
|
||||
<...>
|
||||
new zenith repository was created in .zenith
|
||||
initializing tenantid c03ba6b7ad4c5e9cf556f059ade44229
|
||||
created initial timeline 5b014a9e41b4b63ce1a1febc04503636 timeline.lsn 0/169C3C8
|
||||
created main branch
|
||||
pageserver init succeeded
|
||||
|
||||
# start pageserver
|
||||
# start pageserver and safekeeper
|
||||
> ./target/debug/zenith start
|
||||
Starting pageserver at '127.0.0.1:64000' in .zenith
|
||||
Starting pageserver at 'localhost:64000' in '.zenith'
|
||||
Pageserver started
|
||||
initializing for single for 7676
|
||||
Starting safekeeper at 'localhost:5454' in '.zenith/safekeepers/single'
|
||||
Safekeeper started
|
||||
|
||||
# start postgres on top on the pageserver
|
||||
# start postgres compute node
|
||||
> ./target/debug/zenith pg start main
|
||||
Starting postgres node at 'host=127.0.0.1 port=55432 user=stas'
|
||||
Starting new postgres main on main...
|
||||
Extracting base backup to create postgres instance: path=.zenith/pgdatadirs/tenants/c03ba6b7ad4c5e9cf556f059ade44229/main port=55432
|
||||
Starting postgres node at 'host=127.0.0.1 port=55432 user=zenith_admin dbname=postgres'
|
||||
waiting for server to start.... done
|
||||
server started
|
||||
|
||||
# check list of running postgres instances
|
||||
> ./target/debug/zenith pg list
|
||||
@@ -55,7 +76,7 @@ main 127.0.0.1:55432 0/1609610 running
|
||||
|
||||
4. Now it is possible to connect to postgres and run some queries:
|
||||
```text
|
||||
> psql -p55432 -h 127.0.0.1 postgres
|
||||
> psql -p55432 -h 127.0.0.1 -U zenith_admin postgres
|
||||
postgres=# CREATE TABLE t(key int primary key, value text);
|
||||
CREATE TABLE
|
||||
postgres=# insert into t values(1,1);
|
||||
@@ -85,9 +106,9 @@ waiting for server to start.... done
|
||||
|
||||
# this new postgres instance will have all the data from 'main' postgres,
|
||||
# but all modifications would not affect data in original postgres
|
||||
> psql -p55433 -h 127.0.0.1 postgres
|
||||
> psql -p55433 -h 127.0.0.1 -U zenith_admin postgres
|
||||
postgres=# select * from t;
|
||||
key | value
|
||||
key | value
|
||||
-----+-------
|
||||
1 | 1
|
||||
(1 row)
|
||||
@@ -96,72 +117,41 @@ postgres=# insert into t values(2,2);
|
||||
INSERT 0 1
|
||||
```
|
||||
|
||||
6. If you want to run tests afterwards (see below), you have to stop all the running the pageserver, safekeeper and postgres instances
|
||||
you have just started. You can stop them all with one command:
|
||||
```sh
|
||||
> ./target/debug/zenith stop
|
||||
```
|
||||
|
||||
## Running tests
|
||||
|
||||
```sh
|
||||
git clone --recursive https://github.com/libzenith/zenith.git
|
||||
git clone --recursive https://github.com/zenithdb/zenith.git
|
||||
make # builds also postgres and installs it to ./tmp_install
|
||||
cd test_runner
|
||||
pytest
|
||||
./scripts/pytest
|
||||
```
|
||||
|
||||
## Documentation
|
||||
|
||||
Now we use README files to cover design ideas and overall architecture for each module.
|
||||
And rustdoc style documentation comments.
|
||||
Now we use README files to cover design ideas and overall architecture for each module and `rustdoc` style documentation comments. See also [/docs/](/docs/) a top-level overview of all available markdown documentation.
|
||||
|
||||
To view your documentation in a browser, try running `cargo doc --no-deps --open`
|
||||
- [/docs/sourcetree.md](/docs/sourcetree.md) contains overview of source tree layout.
|
||||
|
||||
## Source tree layout
|
||||
To view your `rustdoc` documentation in a browser, try running `cargo doc --no-deps --open`
|
||||
|
||||
`/control_plane`:
|
||||
### Postgres-specific terms
|
||||
|
||||
Local control plane.
|
||||
Functions to start, cofigure and stop pageserver and postgres instances running as a local processes.
|
||||
Intended to be used in integration tests and in CLI tools for local installations.
|
||||
Due to Zenith's very close relation with PostgreSQL internals, there are numerous specific terms used.
|
||||
Same applies to certain spelling: i.e. we use MB to denote 1024 * 1024 bytes, while MiB would be technically more correct, it's inconsistent with what PostgreSQL code and its documentation use.
|
||||
|
||||
`/zenith`
|
||||
To get more familiar with this aspect, refer to:
|
||||
|
||||
Main entry point for the 'zenith' CLI utility.
|
||||
TODO: Doesn't it belong to control_plane?
|
||||
- [Zenith glossary](/docs/glossary.md)
|
||||
- [PostgreSQL glossary](https://www.postgresql.org/docs/13/glossary.html)
|
||||
- Other PostgreSQL documentation and sources (Zenith fork sources can be found [here](https://github.com/zenithdb/postgres))
|
||||
|
||||
`/postgres_ffi`:
|
||||
## Join the development
|
||||
|
||||
Utility functions for interacting with PostgreSQL file formats.
|
||||
Misc constants, copied from PostgreSQL headers.
|
||||
|
||||
`/zenith_utils`:
|
||||
|
||||
Helpers that are shared between other crates in this repository.
|
||||
|
||||
`/walkeeper`:
|
||||
|
||||
WAL safekeeper (also known as WAL acceptor). Written in Rust.
|
||||
|
||||
`/pageserver`:
|
||||
|
||||
Page Server. Written in Rust.
|
||||
|
||||
Depends on the modified 'postgres' binary for WAL redo.
|
||||
|
||||
`/vendor/postgres`:
|
||||
|
||||
PostgreSQL source tree, with the modifications needed for Zenith.
|
||||
|
||||
`/vendor/postgres/contrib/zenith`:
|
||||
|
||||
PostgreSQL extension that implements storage manager API and network communications with remote page server.
|
||||
|
||||
`/test_runner`:
|
||||
|
||||
Integration tests, written in Python using the `pytest` framework.
|
||||
|
||||
`test_runner/zenith_regress`:
|
||||
|
||||
Quick way to add new SQL regression test to integration tests set.
|
||||
|
||||
`/integration_tests`:
|
||||
|
||||
Another pack of integration tests. Written in Rust.
|
||||
|
||||
[Rust]: https://www.rust-lang.org/learn/get-started
|
||||
- Read `CONTRIBUTING.md` to learn about project code style and practices.
|
||||
- To get familiar with a source tree layout, use [/docs/sourcetree.md](/docs/sourcetree.md).
|
||||
- To learn more about PostgreSQL internals, check http://www.interdb.jp/pg/index.html
|
||||
|
||||
1
compute_tools/.dockerignore
Normal file
1
compute_tools/.dockerignore
Normal file
@@ -0,0 +1 @@
|
||||
target
|
||||
1
compute_tools/.gitignore
vendored
Normal file
1
compute_tools/.gitignore
vendored
Normal file
@@ -0,0 +1 @@
|
||||
target
|
||||
19
compute_tools/Cargo.toml
Normal file
19
compute_tools/Cargo.toml
Normal file
@@ -0,0 +1,19 @@
|
||||
[package]
|
||||
name = "compute_tools"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
|
||||
[dependencies]
|
||||
libc = "0.2"
|
||||
anyhow = "1.0"
|
||||
chrono = "0.4"
|
||||
clap = "3.0"
|
||||
env_logger = "0.9"
|
||||
hyper = { version = "0.14", features = ["full"] }
|
||||
log = { version = "0.4", features = ["std", "serde"] }
|
||||
postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="9eb0dbfbeb6a6c1b79099b9f7ae4a8c021877858" }
|
||||
regex = "1"
|
||||
serde = { version = "1.0", features = ["derive"] }
|
||||
serde_json = "1"
|
||||
tar = "0.4"
|
||||
tokio = { version = "1", features = ["macros", "rt", "rt-multi-thread"] }
|
||||
81
compute_tools/README.md
Normal file
81
compute_tools/README.md
Normal file
@@ -0,0 +1,81 @@
|
||||
# Compute node tools
|
||||
|
||||
Postgres wrapper (`zenith_ctl`) is intended to be run as a Docker entrypoint or as a `systemd`
|
||||
`ExecStart` option. It will handle all the `zenith` specifics during compute node
|
||||
initialization:
|
||||
- `zenith_ctl` accepts cluster (compute node) specification as a JSON file.
|
||||
- Every start is a fresh start, so the data directory is removed and
|
||||
initialized again on each run.
|
||||
- Next it will put configuration files into the `PGDATA` directory.
|
||||
- Sync safekeepers and get commit LSN.
|
||||
- Get `basebackup` from pageserver using the returned on the previous step LSN.
|
||||
- Try to start `postgres` and wait until it is ready to accept connections.
|
||||
- Check and alter/drop/create roles and databases.
|
||||
- Hang waiting on the `postmaster` process to exit.
|
||||
|
||||
Also `zenith_ctl` spawns two separate service threads:
|
||||
- `compute-monitor` checks the last Postgres activity timestamp and saves it
|
||||
into the shared `ComputeState`;
|
||||
- `http-endpoint` runs a Hyper HTTP API server, which serves readiness and the
|
||||
last activity requests.
|
||||
|
||||
Usage example:
|
||||
```sh
|
||||
zenith_ctl -D /var/db/postgres/compute \
|
||||
-C 'postgresql://zenith_admin@localhost/postgres' \
|
||||
-S /var/db/postgres/specs/current.json \
|
||||
-b /usr/local/bin/postgres
|
||||
```
|
||||
|
||||
## Tests
|
||||
|
||||
Cargo formatter:
|
||||
```sh
|
||||
cargo fmt
|
||||
```
|
||||
|
||||
Run tests:
|
||||
```sh
|
||||
cargo test
|
||||
```
|
||||
|
||||
Clippy linter:
|
||||
```sh
|
||||
cargo clippy --all --all-targets -- -Dwarnings -Drust-2018-idioms
|
||||
```
|
||||
|
||||
## Cross-platform compilation
|
||||
|
||||
Imaging that you are on macOS (x86) and you want a Linux GNU (`x86_64-unknown-linux-gnu` platform in `rust` terminology) executable.
|
||||
|
||||
### Using docker
|
||||
|
||||
You can use a throw-away Docker container ([rustlang/rust](https://hub.docker.com/r/rustlang/rust/) image) for doing that:
|
||||
```sh
|
||||
docker run --rm \
|
||||
-v $(pwd):/compute_tools \
|
||||
-w /compute_tools \
|
||||
-t rustlang/rust:nightly cargo build --release --target=x86_64-unknown-linux-gnu
|
||||
```
|
||||
or one-line:
|
||||
```sh
|
||||
docker run --rm -v $(pwd):/compute_tools -w /compute_tools -t rust:latest cargo build --release --target=x86_64-unknown-linux-gnu
|
||||
```
|
||||
|
||||
### Using rust native cross-compilation
|
||||
|
||||
Another way is to add `x86_64-unknown-linux-gnu` target on your host system:
|
||||
```sh
|
||||
rustup target add x86_64-unknown-linux-gnu
|
||||
```
|
||||
|
||||
Install macOS cross-compiler toolchain:
|
||||
```sh
|
||||
brew tap SergioBenitez/osxct
|
||||
brew install x86_64-unknown-linux-gnu
|
||||
```
|
||||
|
||||
And finally run `cargo build`:
|
||||
```sh
|
||||
CARGO_TARGET_X86_64_UNKNOWN_LINUX_GNU_LINKER=x86_64-unknown-linux-gnu-gcc cargo build --target=x86_64-unknown-linux-gnu --release
|
||||
```
|
||||
1
compute_tools/rustfmt.toml
Normal file
1
compute_tools/rustfmt.toml
Normal file
@@ -0,0 +1 @@
|
||||
max_width = 100
|
||||
249
compute_tools/src/bin/zenith_ctl.rs
Normal file
249
compute_tools/src/bin/zenith_ctl.rs
Normal file
@@ -0,0 +1,249 @@
|
||||
//!
|
||||
//! Postgres wrapper (`zenith_ctl`) is intended to be run as a Docker entrypoint or as a `systemd`
|
||||
//! `ExecStart` option. It will handle all the `zenith` specifics during compute node
|
||||
//! initialization:
|
||||
//! - `zenith_ctl` accepts cluster (compute node) specification as a JSON file.
|
||||
//! - Every start is a fresh start, so the data directory is removed and
|
||||
//! initialized again on each run.
|
||||
//! - Next it will put configuration files into the `PGDATA` directory.
|
||||
//! - Sync safekeepers and get commit LSN.
|
||||
//! - Get `basebackup` from pageserver using the returned on the previous step LSN.
|
||||
//! - Try to start `postgres` and wait until it is ready to accept connections.
|
||||
//! - Check and alter/drop/create roles and databases.
|
||||
//! - Hang waiting on the `postmaster` process to exit.
|
||||
//!
|
||||
//! Also `zenith_ctl` spawns two separate service threads:
|
||||
//! - `compute-monitor` checks the last Postgres activity timestamp and saves it
|
||||
//! into the shared `ComputeState`;
|
||||
//! - `http-endpoint` runs a Hyper HTTP API server, which serves readiness and the
|
||||
//! last activity requests.
|
||||
//!
|
||||
//! Usage example:
|
||||
//! ```sh
|
||||
//! zenith_ctl -D /var/db/postgres/compute \
|
||||
//! -C 'postgresql://zenith_admin@localhost/postgres' \
|
||||
//! -S /var/db/postgres/specs/current.json \
|
||||
//! -b /usr/local/bin/postgres
|
||||
//! ```
|
||||
//!
|
||||
use std::fs::File;
|
||||
use std::panic;
|
||||
use std::path::Path;
|
||||
use std::process::{exit, Command, ExitStatus};
|
||||
use std::sync::{Arc, RwLock};
|
||||
|
||||
use anyhow::{Context, Result};
|
||||
use chrono::Utc;
|
||||
use clap::Arg;
|
||||
use log::info;
|
||||
use postgres::{Client, NoTls};
|
||||
|
||||
use compute_tools::config;
|
||||
use compute_tools::http_api::launch_http_server;
|
||||
use compute_tools::logger::*;
|
||||
use compute_tools::monitor::launch_monitor;
|
||||
use compute_tools::params::*;
|
||||
use compute_tools::pg_helpers::*;
|
||||
use compute_tools::spec::*;
|
||||
use compute_tools::zenith::*;
|
||||
|
||||
/// Do all the preparations like PGDATA directory creation, configuration,
|
||||
/// safekeepers sync, basebackup, etc.
|
||||
fn prepare_pgdata(state: &Arc<RwLock<ComputeState>>) -> Result<()> {
|
||||
let state = state.read().unwrap();
|
||||
let spec = &state.spec;
|
||||
let pgdata_path = Path::new(&state.pgdata);
|
||||
let pageserver_connstr = spec
|
||||
.cluster
|
||||
.settings
|
||||
.find("zenith.page_server_connstring")
|
||||
.expect("pageserver connstr should be provided");
|
||||
let tenant = spec
|
||||
.cluster
|
||||
.settings
|
||||
.find("zenith.zenith_tenant")
|
||||
.expect("tenant id should be provided");
|
||||
let timeline = spec
|
||||
.cluster
|
||||
.settings
|
||||
.find("zenith.zenith_timeline")
|
||||
.expect("tenant id should be provided");
|
||||
|
||||
info!(
|
||||
"starting cluster #{}, operation #{}",
|
||||
spec.cluster.cluster_id,
|
||||
spec.operation_uuid.as_ref().unwrap()
|
||||
);
|
||||
|
||||
// Remove/create an empty pgdata directory and put configuration there.
|
||||
create_pgdata(&state.pgdata)?;
|
||||
config::write_postgres_conf(&pgdata_path.join("postgresql.conf"), spec)?;
|
||||
|
||||
info!("starting safekeepers syncing");
|
||||
let lsn = sync_safekeepers(&state.pgdata, &state.pgbin)
|
||||
.with_context(|| "failed to sync safekeepers")?;
|
||||
info!("safekeepers synced at LSN {}", lsn);
|
||||
|
||||
info!(
|
||||
"getting basebackup@{} from pageserver {}",
|
||||
lsn, pageserver_connstr
|
||||
);
|
||||
get_basebackup(&state.pgdata, &pageserver_connstr, &tenant, &timeline, &lsn).with_context(
|
||||
|| {
|
||||
format!(
|
||||
"failed to get basebackup@{} from pageserver {}",
|
||||
lsn, pageserver_connstr
|
||||
)
|
||||
},
|
||||
)?;
|
||||
|
||||
// Update pg_hba.conf received with basebackup.
|
||||
update_pg_hba(pgdata_path)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Start Postgres as a child process and manage DBs/roles.
|
||||
/// After that this will hang waiting on the postmaster process to exit.
|
||||
fn run_compute(state: &Arc<RwLock<ComputeState>>) -> Result<ExitStatus> {
|
||||
let read_state = state.read().unwrap();
|
||||
let pgdata_path = Path::new(&read_state.pgdata);
|
||||
|
||||
// Run postgres as a child process.
|
||||
let mut pg = Command::new(&read_state.pgbin)
|
||||
.args(&["-D", &read_state.pgdata])
|
||||
.spawn()
|
||||
.expect("cannot start postgres process");
|
||||
|
||||
// Try default Postgres port if it is not provided
|
||||
let port = read_state
|
||||
.spec
|
||||
.cluster
|
||||
.settings
|
||||
.find("port")
|
||||
.unwrap_or_else(|| "5432".to_string());
|
||||
wait_for_postgres(&port, pgdata_path)?;
|
||||
|
||||
let mut client = Client::connect(&read_state.connstr, NoTls)?;
|
||||
|
||||
handle_roles(&read_state.spec, &mut client)?;
|
||||
handle_databases(&read_state.spec, &mut client)?;
|
||||
|
||||
// 'Close' connection
|
||||
drop(client);
|
||||
|
||||
info!(
|
||||
"finished configuration of cluster #{}",
|
||||
read_state.spec.cluster.cluster_id
|
||||
);
|
||||
|
||||
// Release the read lock.
|
||||
drop(read_state);
|
||||
|
||||
// Get the write lock, update state and release the lock, so HTTP API
|
||||
// was able to serve requests, while we are blocked waiting on
|
||||
// Postgres.
|
||||
let mut state = state.write().unwrap();
|
||||
state.ready = true;
|
||||
drop(state);
|
||||
|
||||
// Wait for child postgres process basically forever. In this state Ctrl+C
|
||||
// will be propagated to postgres and it will be shut down as well.
|
||||
let ecode = pg.wait().expect("failed to wait on postgres");
|
||||
|
||||
Ok(ecode)
|
||||
}
|
||||
|
||||
fn main() -> Result<()> {
|
||||
// TODO: re-use `zenith_utils::logging` later
|
||||
init_logger(DEFAULT_LOG_LEVEL)?;
|
||||
|
||||
// Env variable is set by `cargo`
|
||||
let version: Option<&str> = option_env!("CARGO_PKG_VERSION");
|
||||
let matches = clap::App::new("zenith_ctl")
|
||||
.version(version.unwrap_or("unknown"))
|
||||
.arg(
|
||||
Arg::new("connstr")
|
||||
.short('C')
|
||||
.long("connstr")
|
||||
.value_name("DATABASE_URL")
|
||||
.required(true),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("pgdata")
|
||||
.short('D')
|
||||
.long("pgdata")
|
||||
.value_name("DATADIR")
|
||||
.required(true),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("pgbin")
|
||||
.short('b')
|
||||
.long("pgbin")
|
||||
.value_name("POSTGRES_PATH"),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("spec")
|
||||
.short('s')
|
||||
.long("spec")
|
||||
.value_name("SPEC_JSON"),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("spec-path")
|
||||
.short('S')
|
||||
.long("spec-path")
|
||||
.value_name("SPEC_PATH"),
|
||||
)
|
||||
.get_matches();
|
||||
|
||||
let pgdata = matches.value_of("pgdata").expect("PGDATA path is required");
|
||||
let connstr = matches
|
||||
.value_of("connstr")
|
||||
.expect("Postgres connection string is required");
|
||||
let spec = matches.value_of("spec");
|
||||
let spec_path = matches.value_of("spec-path");
|
||||
|
||||
// Try to use just 'postgres' if no path is provided
|
||||
let pgbin = matches.value_of("pgbin").unwrap_or("postgres");
|
||||
|
||||
let spec: ClusterSpec = match spec {
|
||||
// First, try to get cluster spec from the cli argument
|
||||
Some(json) => serde_json::from_str(json)?,
|
||||
None => {
|
||||
// Second, try to read it from the file if path is provided
|
||||
if let Some(sp) = spec_path {
|
||||
let path = Path::new(sp);
|
||||
let file = File::open(path)?;
|
||||
serde_json::from_reader(file)?
|
||||
} else {
|
||||
panic!("cluster spec should be provided via --spec or --spec-path argument");
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
let compute_state = ComputeState {
|
||||
connstr: connstr.to_string(),
|
||||
pgdata: pgdata.to_string(),
|
||||
pgbin: pgbin.to_string(),
|
||||
spec,
|
||||
ready: false,
|
||||
last_active: Utc::now(),
|
||||
};
|
||||
let compute_state = Arc::new(RwLock::new(compute_state));
|
||||
|
||||
// Launch service threads first, so we were able to serve availability
|
||||
// requests, while configuration is still in progress.
|
||||
let mut _threads = vec![
|
||||
launch_http_server(&compute_state).expect("cannot launch compute monitor thread"),
|
||||
launch_monitor(&compute_state).expect("cannot launch http endpoint thread"),
|
||||
];
|
||||
|
||||
prepare_pgdata(&compute_state)?;
|
||||
|
||||
// Run compute (Postgres) and hang waiting on it. Panic if any error happens,
|
||||
// it will help us to trigger unwind and kill postmaster as well.
|
||||
match run_compute(&compute_state) {
|
||||
Ok(ec) => exit(ec.success() as i32),
|
||||
Err(error) => panic!("cannot start compute node, error: {}", error),
|
||||
}
|
||||
}
|
||||
51
compute_tools/src/config.rs
Normal file
51
compute_tools/src/config.rs
Normal file
@@ -0,0 +1,51 @@
|
||||
use std::fs::{File, OpenOptions};
|
||||
use std::io;
|
||||
use std::io::prelude::*;
|
||||
use std::path::Path;
|
||||
|
||||
use anyhow::Result;
|
||||
|
||||
use crate::pg_helpers::PgOptionsSerialize;
|
||||
use crate::zenith::ClusterSpec;
|
||||
|
||||
/// Check that `line` is inside a text file and put it there if it is not.
|
||||
/// Create file if it doesn't exist.
|
||||
pub fn line_in_file(path: &Path, line: &str) -> Result<bool> {
|
||||
let mut file = OpenOptions::new()
|
||||
.read(true)
|
||||
.write(true)
|
||||
.create(true)
|
||||
.append(false)
|
||||
.open(path)?;
|
||||
let buf = io::BufReader::new(&file);
|
||||
let mut count: usize = 0;
|
||||
|
||||
for l in buf.lines() {
|
||||
if l? == line {
|
||||
return Ok(false);
|
||||
}
|
||||
count = 1;
|
||||
}
|
||||
|
||||
write!(file, "{}{}", "\n".repeat(count), line)?;
|
||||
Ok(true)
|
||||
}
|
||||
|
||||
/// Create or completely rewrite configuration file specified by `path`
|
||||
pub fn write_postgres_conf(path: &Path, spec: &ClusterSpec) -> Result<()> {
|
||||
// File::create() destroys the file content if it exists.
|
||||
let mut postgres_conf = File::create(path)?;
|
||||
|
||||
write_zenith_managed_block(&mut postgres_conf, &spec.cluster.settings.as_pg_settings())?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// Write Postgres config block wrapped with generated comment section
|
||||
fn write_zenith_managed_block(file: &mut File, buf: &str) -> Result<()> {
|
||||
writeln!(file, "# Managed by Zenith: begin")?;
|
||||
writeln!(file, "{}", buf)?;
|
||||
writeln!(file, "# Managed by Zenith: end")?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
73
compute_tools/src/http_api.rs
Normal file
73
compute_tools/src/http_api.rs
Normal file
@@ -0,0 +1,73 @@
|
||||
use std::convert::Infallible;
|
||||
use std::net::SocketAddr;
|
||||
use std::sync::{Arc, RwLock};
|
||||
use std::thread;
|
||||
|
||||
use anyhow::Result;
|
||||
use hyper::service::{make_service_fn, service_fn};
|
||||
use hyper::{Body, Method, Request, Response, Server, StatusCode};
|
||||
use log::{error, info};
|
||||
|
||||
use crate::zenith::*;
|
||||
|
||||
// Service function to handle all available routes.
|
||||
fn routes(req: Request<Body>, state: Arc<RwLock<ComputeState>>) -> Response<Body> {
|
||||
match (req.method(), req.uri().path()) {
|
||||
// Timestamp of the last Postgres activity in the plain text.
|
||||
(&Method::GET, "/last_activity") => {
|
||||
info!("serving /last_active GET request");
|
||||
let state = state.read().unwrap();
|
||||
|
||||
// Use RFC3339 format for consistency.
|
||||
Response::new(Body::from(state.last_active.to_rfc3339()))
|
||||
}
|
||||
|
||||
// Has compute setup process finished? -> true/false
|
||||
(&Method::GET, "/ready") => {
|
||||
info!("serving /ready GET request");
|
||||
let state = state.read().unwrap();
|
||||
Response::new(Body::from(format!("{}", state.ready)))
|
||||
}
|
||||
|
||||
// Return the `404 Not Found` for any other routes.
|
||||
_ => {
|
||||
let mut not_found = Response::new(Body::from("404 Not Found"));
|
||||
*not_found.status_mut() = StatusCode::NOT_FOUND;
|
||||
not_found
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Main Hyper HTTP server function that runs it and blocks waiting on it forever.
|
||||
#[tokio::main]
|
||||
async fn serve(state: Arc<RwLock<ComputeState>>) {
|
||||
let addr = SocketAddr::from(([0, 0, 0, 0], 3080));
|
||||
|
||||
let make_service = make_service_fn(move |_conn| {
|
||||
let state = state.clone();
|
||||
async move {
|
||||
Ok::<_, Infallible>(service_fn(move |req: Request<Body>| {
|
||||
let state = state.clone();
|
||||
async move { Ok::<_, Infallible>(routes(req, state)) }
|
||||
}))
|
||||
}
|
||||
});
|
||||
|
||||
info!("starting HTTP server on {}", addr);
|
||||
|
||||
let server = Server::bind(&addr).serve(make_service);
|
||||
|
||||
// Run this server forever
|
||||
if let Err(e) = server.await {
|
||||
error!("server error: {}", e);
|
||||
}
|
||||
}
|
||||
|
||||
/// Launch a separate Hyper HTTP API server thread and return its `JoinHandle`.
|
||||
pub fn launch_http_server(state: &Arc<RwLock<ComputeState>>) -> Result<thread::JoinHandle<()>> {
|
||||
let state = Arc::clone(state);
|
||||
|
||||
Ok(thread::Builder::new()
|
||||
.name("http-endpoint".into())
|
||||
.spawn(move || serve(state))?)
|
||||
}
|
||||
13
compute_tools/src/lib.rs
Normal file
13
compute_tools/src/lib.rs
Normal file
@@ -0,0 +1,13 @@
|
||||
//!
|
||||
//! Various tools and helpers to handle cluster / compute node (Postgres)
|
||||
//! configuration.
|
||||
//!
|
||||
pub mod config;
|
||||
pub mod http_api;
|
||||
#[macro_use]
|
||||
pub mod logger;
|
||||
pub mod monitor;
|
||||
pub mod params;
|
||||
pub mod pg_helpers;
|
||||
pub mod spec;
|
||||
pub mod zenith;
|
||||
43
compute_tools/src/logger.rs
Normal file
43
compute_tools/src/logger.rs
Normal file
@@ -0,0 +1,43 @@
|
||||
use std::io::Write;
|
||||
|
||||
use anyhow::Result;
|
||||
use chrono::Utc;
|
||||
use env_logger::{Builder, Env};
|
||||
|
||||
macro_rules! info_println {
|
||||
($($tts:tt)*) => {
|
||||
if log_enabled!(Level::Info) {
|
||||
println!($($tts)*);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
macro_rules! info_print {
|
||||
($($tts:tt)*) => {
|
||||
if log_enabled!(Level::Info) {
|
||||
print!($($tts)*);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Initialize `env_logger` using either `default_level` or
|
||||
/// `RUST_LOG` environment variable as default log level.
|
||||
pub fn init_logger(default_level: &str) -> Result<()> {
|
||||
let env = Env::default().filter_or("RUST_LOG", default_level);
|
||||
|
||||
Builder::from_env(env)
|
||||
.format(|buf, record| {
|
||||
let thread_handle = std::thread::current();
|
||||
writeln!(
|
||||
buf,
|
||||
"{} [{}] {}: {}",
|
||||
Utc::now().format("%Y-%m-%d %H:%M:%S%.3f %Z"),
|
||||
thread_handle.name().unwrap_or("main"),
|
||||
record.level(),
|
||||
record.args()
|
||||
)
|
||||
})
|
||||
.init();
|
||||
|
||||
Ok(())
|
||||
}
|
||||
109
compute_tools/src/monitor.rs
Normal file
109
compute_tools/src/monitor.rs
Normal file
@@ -0,0 +1,109 @@
|
||||
use std::sync::{Arc, RwLock};
|
||||
use std::{thread, time};
|
||||
|
||||
use anyhow::Result;
|
||||
use chrono::{DateTime, Utc};
|
||||
use log::{debug, info};
|
||||
use postgres::{Client, NoTls};
|
||||
|
||||
use crate::zenith::ComputeState;
|
||||
|
||||
const MONITOR_CHECK_INTERVAL: u64 = 500; // milliseconds
|
||||
|
||||
// Spin in a loop and figure out the last activity time in the Postgres.
|
||||
// Then update it in the shared state. This function never errors out.
|
||||
// XXX: the only expected panic is at `RwLock` unwrap().
|
||||
fn watch_compute_activity(state: &Arc<RwLock<ComputeState>>) {
|
||||
// Suppose that `connstr` doesn't change
|
||||
let connstr = state.read().unwrap().connstr.clone();
|
||||
// Define `client` outside of the loop to reuse existing connection if it's active.
|
||||
let mut client = Client::connect(&connstr, NoTls);
|
||||
let timeout = time::Duration::from_millis(MONITOR_CHECK_INTERVAL);
|
||||
|
||||
info!("watching Postgres activity at {}", connstr);
|
||||
|
||||
loop {
|
||||
// Should be outside of the write lock to allow others to read while we sleep.
|
||||
thread::sleep(timeout);
|
||||
|
||||
match &mut client {
|
||||
Ok(cli) => {
|
||||
if cli.is_closed() {
|
||||
info!("connection to postgres closed, trying to reconnect");
|
||||
|
||||
// Connection is closed, reconnect and try again.
|
||||
client = Client::connect(&connstr, NoTls);
|
||||
continue;
|
||||
}
|
||||
|
||||
// Get all running client backends except ourself, use RFC3339 DateTime format.
|
||||
let backends = cli
|
||||
.query(
|
||||
"SELECT state, to_char(state_change, 'YYYY-MM-DD\"T\"HH24:MI:SS.US\"Z\"') AS state_change
|
||||
FROM pg_stat_activity
|
||||
WHERE backend_type = 'client backend'
|
||||
AND pid != pg_backend_pid()
|
||||
AND usename != 'zenith_admin';", // XXX: find a better way to filter other monitors?
|
||||
&[],
|
||||
);
|
||||
let mut last_active = state.read().unwrap().last_active;
|
||||
|
||||
if let Ok(backs) = backends {
|
||||
let mut idle_backs: Vec<DateTime<Utc>> = vec![];
|
||||
|
||||
for b in backs.into_iter() {
|
||||
let state: String = b.get("state");
|
||||
let change: String = b.get("state_change");
|
||||
|
||||
if state == "idle" {
|
||||
let change = DateTime::parse_from_rfc3339(&change);
|
||||
match change {
|
||||
Ok(t) => idle_backs.push(t.with_timezone(&Utc)),
|
||||
Err(e) => {
|
||||
info!("cannot parse backend state_change DateTime: {}", e);
|
||||
continue;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Found non-idle backend, so the last activity is NOW.
|
||||
// Save it and exit the for loop. Also clear the idle backend
|
||||
// `state_change` timestamps array as it doesn't matter now.
|
||||
last_active = Utc::now();
|
||||
idle_backs.clear();
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Sort idle backend `state_change` timestamps. The last one corresponds
|
||||
// to the last activity.
|
||||
idle_backs.sort();
|
||||
if let Some(last) = idle_backs.last() {
|
||||
last_active = *last;
|
||||
}
|
||||
}
|
||||
|
||||
// Update the last activity in the shared state if we got a more recent one.
|
||||
let mut state = state.write().unwrap();
|
||||
if last_active > state.last_active {
|
||||
state.last_active = last_active;
|
||||
debug!("set the last compute activity time to: {}", last_active);
|
||||
}
|
||||
}
|
||||
Err(e) => {
|
||||
info!("cannot connect to postgres: {}, retrying", e);
|
||||
|
||||
// Establish a new connection and try again.
|
||||
client = Client::connect(&connstr, NoTls);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Launch a separate compute monitor thread and return its `JoinHandle`.
|
||||
pub fn launch_monitor(state: &Arc<RwLock<ComputeState>>) -> Result<thread::JoinHandle<()>> {
|
||||
let state = Arc::clone(state);
|
||||
|
||||
Ok(thread::Builder::new()
|
||||
.name("compute-monitor".into())
|
||||
.spawn(move || watch_compute_activity(&state))?)
|
||||
}
|
||||
3
compute_tools/src/params.rs
Normal file
3
compute_tools/src/params.rs
Normal file
@@ -0,0 +1,3 @@
|
||||
pub const DEFAULT_LOG_LEVEL: &str = "info";
|
||||
pub const DEFAULT_CONNSTRING: &str = "host=localhost user=postgres";
|
||||
pub const PG_HBA_ALL_MD5: &str = "host\tall\t\tall\t\t0.0.0.0/0\t\tmd5";
|
||||
264
compute_tools/src/pg_helpers.rs
Normal file
264
compute_tools/src/pg_helpers.rs
Normal file
@@ -0,0 +1,264 @@
|
||||
use std::net::{SocketAddr, TcpStream};
|
||||
use std::os::unix::fs::PermissionsExt;
|
||||
use std::path::Path;
|
||||
use std::process::Command;
|
||||
use std::str::FromStr;
|
||||
use std::{fs, thread, time};
|
||||
|
||||
use anyhow::{bail, Result};
|
||||
use postgres::{Client, Transaction};
|
||||
use serde::Deserialize;
|
||||
|
||||
const POSTGRES_WAIT_TIMEOUT: u64 = 60 * 1000; // milliseconds
|
||||
|
||||
/// Rust representation of Postgres role info with only those fields
|
||||
/// that matter for us.
|
||||
#[derive(Clone, Deserialize)]
|
||||
pub struct Role {
|
||||
pub name: PgIdent,
|
||||
pub encrypted_password: Option<String>,
|
||||
pub options: GenericOptions,
|
||||
}
|
||||
|
||||
/// Rust representation of Postgres database info with only those fields
|
||||
/// that matter for us.
|
||||
#[derive(Clone, Deserialize)]
|
||||
pub struct Database {
|
||||
pub name: PgIdent,
|
||||
pub owner: PgIdent,
|
||||
pub options: GenericOptions,
|
||||
}
|
||||
|
||||
/// Common type representing both SQL statement params with or without value,
|
||||
/// like `LOGIN` or `OWNER username` in the `CREATE/ALTER ROLE`, and config
|
||||
/// options like `wal_level = logical`.
|
||||
#[derive(Clone, Deserialize)]
|
||||
pub struct GenericOption {
|
||||
pub name: String,
|
||||
pub value: Option<String>,
|
||||
pub vartype: String,
|
||||
}
|
||||
|
||||
/// Optional collection of `GenericOption`'s. Type alias allows us to
|
||||
/// declare a `trait` on it.
|
||||
pub type GenericOptions = Option<Vec<GenericOption>>;
|
||||
|
||||
impl GenericOption {
|
||||
/// Represent `GenericOption` as SQL statement parameter.
|
||||
pub fn to_pg_option(&self) -> String {
|
||||
if let Some(val) = &self.value {
|
||||
match self.vartype.as_ref() {
|
||||
"string" => format!("{} '{}'", self.name, val),
|
||||
_ => format!("{} {}", self.name, val),
|
||||
}
|
||||
} else {
|
||||
self.name.to_owned()
|
||||
}
|
||||
}
|
||||
|
||||
/// Represent `GenericOption` as configuration option.
|
||||
pub fn to_pg_setting(&self) -> String {
|
||||
if let Some(val) = &self.value {
|
||||
match self.vartype.as_ref() {
|
||||
"string" => format!("{} = '{}'", self.name, val),
|
||||
_ => format!("{} = {}", self.name, val),
|
||||
}
|
||||
} else {
|
||||
self.name.to_owned()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub trait PgOptionsSerialize {
|
||||
fn as_pg_options(&self) -> String;
|
||||
fn as_pg_settings(&self) -> String;
|
||||
}
|
||||
|
||||
impl PgOptionsSerialize for GenericOptions {
|
||||
/// Serialize an optional collection of `GenericOption`'s to
|
||||
/// Postgres SQL statement arguments.
|
||||
fn as_pg_options(&self) -> String {
|
||||
if let Some(ops) = &self {
|
||||
ops.iter()
|
||||
.map(|op| op.to_pg_option())
|
||||
.collect::<Vec<String>>()
|
||||
.join(" ")
|
||||
} else {
|
||||
"".to_string()
|
||||
}
|
||||
}
|
||||
|
||||
/// Serialize an optional collection of `GenericOption`'s to
|
||||
/// `postgresql.conf` compatible format.
|
||||
fn as_pg_settings(&self) -> String {
|
||||
if let Some(ops) = &self {
|
||||
ops.iter()
|
||||
.map(|op| op.to_pg_setting())
|
||||
.collect::<Vec<String>>()
|
||||
.join("\n")
|
||||
} else {
|
||||
"".to_string()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub trait GenericOptionsSearch {
|
||||
fn find(&self, name: &str) -> Option<String>;
|
||||
}
|
||||
|
||||
impl GenericOptionsSearch for GenericOptions {
|
||||
/// Lookup option by name
|
||||
fn find(&self, name: &str) -> Option<String> {
|
||||
match &self {
|
||||
Some(ops) => {
|
||||
let op = ops.iter().find(|s| s.name == name);
|
||||
match op {
|
||||
Some(op) => op.value.clone(),
|
||||
None => None,
|
||||
}
|
||||
}
|
||||
None => None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl Role {
|
||||
/// Serialize a list of role parameters into a Postgres-acceptable
|
||||
/// string of arguments.
|
||||
pub fn to_pg_options(&self) -> String {
|
||||
// XXX: consider putting LOGIN as a default option somewhere higher, e.g. in Rails.
|
||||
// For now we do not use generic `options` for roles. Once used, add
|
||||
// `self.options.as_pg_options()` somewhere here.
|
||||
let mut params: String = "LOGIN".to_string();
|
||||
|
||||
if let Some(pass) = &self.encrypted_password {
|
||||
params.push_str(&format!(" PASSWORD 'md5{}'", pass));
|
||||
} else {
|
||||
params.push_str(" PASSWORD NULL");
|
||||
}
|
||||
|
||||
params
|
||||
}
|
||||
}
|
||||
|
||||
impl Database {
|
||||
/// Serialize a list of database parameters into a Postgres-acceptable
|
||||
/// string of arguments.
|
||||
/// NB: `TEMPLATE` is actually also an identifier, but so far we only need
|
||||
/// to use `template0` and `template1`, so it is not a problem. Yet in the future
|
||||
/// it may require a proper quoting too.
|
||||
pub fn to_pg_options(&self) -> String {
|
||||
let mut params: String = self.options.as_pg_options();
|
||||
params.push_str(&format!(" OWNER {}", &self.owner.quote()));
|
||||
|
||||
params
|
||||
}
|
||||
}
|
||||
|
||||
/// String type alias representing Postgres identifier and
|
||||
/// intended to be used for DB / role names.
|
||||
pub type PgIdent = String;
|
||||
|
||||
/// Generic trait used to provide quoting for strings used in the
|
||||
/// Postgres SQL queries. Currently used only to implement quoting
|
||||
/// of identifiers, but could be used for literals in the future.
|
||||
pub trait PgQuote {
|
||||
fn quote(&self) -> String;
|
||||
}
|
||||
|
||||
impl PgQuote for PgIdent {
|
||||
/// This is intended to mimic Postgres quote_ident(), but for simplicity it
|
||||
/// always quotes provided string with `""` and escapes every `"`. Not idempotent,
|
||||
/// i.e. if string is already escaped it will be escaped again.
|
||||
fn quote(&self) -> String {
|
||||
let result = format!("\"{}\"", self.replace('"', "\"\""));
|
||||
result
|
||||
}
|
||||
}
|
||||
|
||||
/// Build a list of existing Postgres roles
|
||||
pub fn get_existing_roles(xact: &mut Transaction<'_>) -> Result<Vec<Role>> {
|
||||
let postgres_roles = xact
|
||||
.query("SELECT rolname, rolpassword FROM pg_catalog.pg_authid", &[])?
|
||||
.iter()
|
||||
.map(|row| Role {
|
||||
name: row.get("rolname"),
|
||||
encrypted_password: row.get("rolpassword"),
|
||||
options: None,
|
||||
})
|
||||
.collect();
|
||||
|
||||
Ok(postgres_roles)
|
||||
}
|
||||
|
||||
/// Build a list of existing Postgres databases
|
||||
pub fn get_existing_dbs(client: &mut Client) -> Result<Vec<Database>> {
|
||||
let postgres_dbs = client
|
||||
.query(
|
||||
"SELECT datname, datdba::regrole::text as owner
|
||||
FROM pg_catalog.pg_database;",
|
||||
&[],
|
||||
)?
|
||||
.iter()
|
||||
.map(|row| Database {
|
||||
name: row.get("datname"),
|
||||
owner: row.get("owner"),
|
||||
options: None,
|
||||
})
|
||||
.collect();
|
||||
|
||||
Ok(postgres_dbs)
|
||||
}
|
||||
|
||||
/// Wait for Postgres to become ready to accept connections:
|
||||
/// - state should be `ready` in the `pgdata/postmaster.pid`
|
||||
/// - and we should be able to connect to 127.0.0.1:5432
|
||||
pub fn wait_for_postgres(port: &str, pgdata: &Path) -> Result<()> {
|
||||
let pid_path = pgdata.join("postmaster.pid");
|
||||
let mut slept: u64 = 0; // ms
|
||||
let pause = time::Duration::from_millis(100);
|
||||
|
||||
let timeout = time::Duration::from_millis(200);
|
||||
let addr = SocketAddr::from_str(&format!("127.0.0.1:{}", port)).unwrap();
|
||||
|
||||
loop {
|
||||
// Sleep POSTGRES_WAIT_TIMEOUT at max (a bit longer actually if consider a TCP timeout,
|
||||
// but postgres starts listening almost immediately, even if it is not really
|
||||
// ready to accept connections).
|
||||
if slept >= POSTGRES_WAIT_TIMEOUT {
|
||||
bail!("timed out while waiting for Postgres to start");
|
||||
}
|
||||
|
||||
if pid_path.exists() {
|
||||
// XXX: dumb and the simplest way to get the last line in a text file
|
||||
// TODO: better use `.lines().last()` later
|
||||
let stdout = Command::new("tail")
|
||||
.args(&["-n1", pid_path.to_str().unwrap()])
|
||||
.output()?
|
||||
.stdout;
|
||||
let status = String::from_utf8(stdout)?;
|
||||
let can_connect = TcpStream::connect_timeout(&addr, timeout).is_ok();
|
||||
|
||||
// Now Postgres is ready to accept connections
|
||||
if status.trim() == "ready" && can_connect {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
thread::sleep(pause);
|
||||
slept += 100;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Remove `pgdata` directory and create it again with right permissions.
|
||||
pub fn create_pgdata(pgdata: &str) -> Result<()> {
|
||||
// Ignore removal error, likely it is a 'No such file or directory (os error 2)'.
|
||||
// If it is something different then create_dir() will error out anyway.
|
||||
let _ok = fs::remove_dir_all(pgdata);
|
||||
fs::create_dir(pgdata)?;
|
||||
fs::set_permissions(pgdata, fs::Permissions::from_mode(0o700))?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
246
compute_tools/src/spec.rs
Normal file
246
compute_tools/src/spec.rs
Normal file
@@ -0,0 +1,246 @@
|
||||
use std::path::Path;
|
||||
|
||||
use anyhow::Result;
|
||||
use log::{info, log_enabled, warn, Level};
|
||||
use postgres::Client;
|
||||
|
||||
use crate::config;
|
||||
use crate::params::PG_HBA_ALL_MD5;
|
||||
use crate::pg_helpers::*;
|
||||
use crate::zenith::ClusterSpec;
|
||||
|
||||
/// It takes cluster specification and does the following:
|
||||
/// - Serialize cluster config and put it into `postgresql.conf` completely rewriting the file.
|
||||
/// - Update `pg_hba.conf` to allow external connections.
|
||||
pub fn handle_configuration(spec: &ClusterSpec, pgdata_path: &Path) -> Result<()> {
|
||||
// File `postgresql.conf` is no longer included into `basebackup`, so just
|
||||
// always write all config into it creating new file.
|
||||
config::write_postgres_conf(&pgdata_path.join("postgresql.conf"), spec)?;
|
||||
|
||||
update_pg_hba(pgdata_path)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Check `pg_hba.conf` and update if needed to allow external connections.
|
||||
pub fn update_pg_hba(pgdata_path: &Path) -> Result<()> {
|
||||
// XXX: consider making it a part of spec.json
|
||||
info!("checking pg_hba.conf");
|
||||
let pghba_path = pgdata_path.join("pg_hba.conf");
|
||||
|
||||
if config::line_in_file(&pghba_path, PG_HBA_ALL_MD5)? {
|
||||
info!("updated pg_hba.conf to allow external connections");
|
||||
} else {
|
||||
info!("pg_hba.conf is up-to-date");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Given a cluster spec json and open transaction it handles roles creation,
|
||||
/// deletion and update.
|
||||
pub fn handle_roles(spec: &ClusterSpec, client: &mut Client) -> Result<()> {
|
||||
let mut xact = client.transaction()?;
|
||||
let existing_roles: Vec<Role> = get_existing_roles(&mut xact)?;
|
||||
|
||||
// Print a list of existing Postgres roles (only in debug mode)
|
||||
info!("postgres roles:");
|
||||
for r in &existing_roles {
|
||||
info_println!(
|
||||
"{} - {}:{}",
|
||||
" ".repeat(27 + 5),
|
||||
r.name,
|
||||
if r.encrypted_password.is_some() {
|
||||
"[FILTERED]"
|
||||
} else {
|
||||
"(null)"
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
// Process delta operations first
|
||||
if let Some(ops) = &spec.delta_operations {
|
||||
info!("processing delta operations on roles");
|
||||
for op in ops {
|
||||
match op.action.as_ref() {
|
||||
// We do not check either role exists or not,
|
||||
// Postgres will take care of it for us
|
||||
"delete_role" => {
|
||||
let query: String = format!("DROP ROLE IF EXISTS {}", &op.name.quote());
|
||||
|
||||
warn!("deleting role '{}'", &op.name);
|
||||
xact.execute(query.as_str(), &[])?;
|
||||
}
|
||||
// Renaming role drops its password, since tole name is
|
||||
// used as a salt there. It is important that this role
|
||||
// is recorded with a new `name` in the `roles` list.
|
||||
// Follow up roles update will set the new password.
|
||||
"rename_role" => {
|
||||
let new_name = op.new_name.as_ref().unwrap();
|
||||
|
||||
// XXX: with a limited number of roles it is fine, but consider making it a HashMap
|
||||
if existing_roles.iter().any(|r| r.name == op.name) {
|
||||
let query: String = format!(
|
||||
"ALTER ROLE {} RENAME TO {}",
|
||||
op.name.quote(),
|
||||
new_name.quote()
|
||||
);
|
||||
|
||||
warn!("renaming role '{}' to '{}'", op.name, new_name);
|
||||
xact.execute(query.as_str(), &[])?;
|
||||
}
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Refresh Postgres roles info to handle possible roles renaming
|
||||
let existing_roles: Vec<Role> = get_existing_roles(&mut xact)?;
|
||||
|
||||
info!("cluster spec roles:");
|
||||
for role in &spec.cluster.roles {
|
||||
let name = &role.name;
|
||||
|
||||
info_print!(
|
||||
"{} - {}:{}",
|
||||
" ".repeat(27 + 5),
|
||||
name,
|
||||
if role.encrypted_password.is_some() {
|
||||
"[FILTERED]"
|
||||
} else {
|
||||
"(null)"
|
||||
}
|
||||
);
|
||||
|
||||
// XXX: with a limited number of roles it is fine, but consider making it a HashMap
|
||||
let pg_role = existing_roles.iter().find(|r| r.name == *name);
|
||||
|
||||
if let Some(r) = pg_role {
|
||||
let mut update_role = false;
|
||||
|
||||
if (r.encrypted_password.is_none() && role.encrypted_password.is_some())
|
||||
|| (r.encrypted_password.is_some() && role.encrypted_password.is_none())
|
||||
{
|
||||
update_role = true;
|
||||
} else if let Some(pg_pwd) = &r.encrypted_password {
|
||||
// Check whether password changed or not (trim 'md5:' prefix first)
|
||||
update_role = pg_pwd[3..] != *role.encrypted_password.as_ref().unwrap();
|
||||
}
|
||||
|
||||
if update_role {
|
||||
let mut query: String = format!("ALTER ROLE {} ", name.quote());
|
||||
info_print!(" -> update");
|
||||
|
||||
query.push_str(&role.to_pg_options());
|
||||
xact.execute(query.as_str(), &[])?;
|
||||
}
|
||||
} else {
|
||||
info!("role name {}", &name);
|
||||
let mut query: String = format!("CREATE ROLE {} ", name.quote());
|
||||
info!("role create query {}", &query);
|
||||
info_print!(" -> create");
|
||||
|
||||
query.push_str(&role.to_pg_options());
|
||||
xact.execute(query.as_str(), &[])?;
|
||||
}
|
||||
|
||||
info_print!("\n");
|
||||
}
|
||||
|
||||
xact.commit()?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// It follows mostly the same logic as `handle_roles()` excepting that we
|
||||
/// does not use an explicit transactions block, since major database operations
|
||||
/// like `CREATE DATABASE` and `DROP DATABASE` do not support it. Statement-level
|
||||
/// atomicity should be enough here due to the order of operations and various checks,
|
||||
/// which together provide us idempotency.
|
||||
pub fn handle_databases(spec: &ClusterSpec, client: &mut Client) -> Result<()> {
|
||||
let existing_dbs: Vec<Database> = get_existing_dbs(client)?;
|
||||
|
||||
// Print a list of existing Postgres databases (only in debug mode)
|
||||
info!("postgres databases:");
|
||||
for r in &existing_dbs {
|
||||
info_println!("{} - {}:{}", " ".repeat(27 + 5), r.name, r.owner);
|
||||
}
|
||||
|
||||
// Process delta operations first
|
||||
if let Some(ops) = &spec.delta_operations {
|
||||
info!("processing delta operations on databases");
|
||||
for op in ops {
|
||||
match op.action.as_ref() {
|
||||
// We do not check either DB exists or not,
|
||||
// Postgres will take care of it for us
|
||||
"delete_db" => {
|
||||
let query: String = format!("DROP DATABASE IF EXISTS {}", &op.name.quote());
|
||||
|
||||
warn!("deleting database '{}'", &op.name);
|
||||
client.execute(query.as_str(), &[])?;
|
||||
}
|
||||
"rename_db" => {
|
||||
let new_name = op.new_name.as_ref().unwrap();
|
||||
|
||||
// XXX: with a limited number of roles it is fine, but consider making it a HashMap
|
||||
if existing_dbs.iter().any(|r| r.name == op.name) {
|
||||
let query: String = format!(
|
||||
"ALTER DATABASE {} RENAME TO {}",
|
||||
op.name.quote(),
|
||||
new_name.quote()
|
||||
);
|
||||
|
||||
warn!("renaming database '{}' to '{}'", op.name, new_name);
|
||||
client.execute(query.as_str(), &[])?;
|
||||
}
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Refresh Postgres databases info to handle possible renames
|
||||
let existing_dbs: Vec<Database> = get_existing_dbs(client)?;
|
||||
|
||||
info!("cluster spec databases:");
|
||||
for db in &spec.cluster.databases {
|
||||
let name = &db.name;
|
||||
|
||||
info_print!("{} - {}:{}", " ".repeat(27 + 5), db.name, db.owner);
|
||||
|
||||
// XXX: with a limited number of databases it is fine, but consider making it a HashMap
|
||||
let pg_db = existing_dbs.iter().find(|r| r.name == *name);
|
||||
|
||||
if let Some(r) = pg_db {
|
||||
// XXX: db owner name is returned as quoted string from Postgres,
|
||||
// when quoting is needed.
|
||||
let new_owner = if r.owner.starts_with('"') {
|
||||
db.owner.quote()
|
||||
} else {
|
||||
db.owner.clone()
|
||||
};
|
||||
|
||||
if new_owner != r.owner {
|
||||
let query: String = format!(
|
||||
"ALTER DATABASE {} OWNER TO {}",
|
||||
name.quote(),
|
||||
db.owner.quote()
|
||||
);
|
||||
info_print!(" -> update");
|
||||
|
||||
client.execute(query.as_str(), &[])?;
|
||||
}
|
||||
} else {
|
||||
let mut query: String = format!("CREATE DATABASE {} ", name.quote());
|
||||
info_print!(" -> create");
|
||||
|
||||
query.push_str(&db.to_pg_options());
|
||||
client.execute(query.as_str(), &[])?;
|
||||
}
|
||||
|
||||
info_print!("\n");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
109
compute_tools/src/zenith.rs
Normal file
109
compute_tools/src/zenith.rs
Normal file
@@ -0,0 +1,109 @@
|
||||
use std::process::{Command, Stdio};
|
||||
|
||||
use anyhow::Result;
|
||||
use chrono::{DateTime, Utc};
|
||||
use postgres::{Client, NoTls};
|
||||
use serde::Deserialize;
|
||||
|
||||
use crate::pg_helpers::*;
|
||||
|
||||
/// Compute node state shared across several `zenith_ctl` threads.
|
||||
/// Should be used under `RwLock` to allow HTTP API server to serve
|
||||
/// status requests, while configuration is in progress.
|
||||
pub struct ComputeState {
|
||||
pub connstr: String,
|
||||
pub pgdata: String,
|
||||
pub pgbin: String,
|
||||
pub spec: ClusterSpec,
|
||||
/// Compute setup process has finished
|
||||
pub ready: bool,
|
||||
/// Timestamp of the last Postgres activity
|
||||
pub last_active: DateTime<Utc>,
|
||||
}
|
||||
|
||||
/// Cluster spec or configuration represented as an optional number of
|
||||
/// delta operations + final cluster state description.
|
||||
#[derive(Clone, Deserialize)]
|
||||
pub struct ClusterSpec {
|
||||
pub format_version: f32,
|
||||
pub timestamp: String,
|
||||
pub operation_uuid: Option<String>,
|
||||
/// Expected cluster state at the end of transition process.
|
||||
pub cluster: Cluster,
|
||||
pub delta_operations: Option<Vec<DeltaOp>>,
|
||||
}
|
||||
|
||||
/// Cluster state seen from the perspective of the external tools
|
||||
/// like Rails web console.
|
||||
#[derive(Clone, Deserialize)]
|
||||
pub struct Cluster {
|
||||
pub cluster_id: String,
|
||||
pub name: String,
|
||||
pub state: Option<String>,
|
||||
pub roles: Vec<Role>,
|
||||
pub databases: Vec<Database>,
|
||||
pub settings: GenericOptions,
|
||||
}
|
||||
|
||||
/// Single cluster state changing operation that could not be represented as
|
||||
/// a static `Cluster` structure. For example:
|
||||
/// - DROP DATABASE
|
||||
/// - DROP ROLE
|
||||
/// - ALTER ROLE name RENAME TO new_name
|
||||
/// - ALTER DATABASE name RENAME TO new_name
|
||||
#[derive(Clone, Deserialize)]
|
||||
pub struct DeltaOp {
|
||||
pub action: String,
|
||||
pub name: PgIdent,
|
||||
pub new_name: Option<PgIdent>,
|
||||
}
|
||||
|
||||
/// Get basebackup from the libpq connection to pageserver using `connstr` and
|
||||
/// unarchive it to `pgdata` directory overriding all its previous content.
|
||||
pub fn get_basebackup(
|
||||
pgdata: &str,
|
||||
connstr: &str,
|
||||
tenant: &str,
|
||||
timeline: &str,
|
||||
lsn: &str,
|
||||
) -> Result<()> {
|
||||
let mut client = Client::connect(connstr, NoTls)?;
|
||||
let basebackup_cmd = match lsn {
|
||||
"0/0" => format!("basebackup {} {}", tenant, timeline), // First start of the compute
|
||||
_ => format!("basebackup {} {} {}", tenant, timeline, lsn),
|
||||
};
|
||||
let copyreader = client.copy_out(basebackup_cmd.as_str())?;
|
||||
let mut ar = tar::Archive::new(copyreader);
|
||||
|
||||
ar.unpack(&pgdata)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Run `postgres` in a special mode with `--sync-safekeepers` argument
|
||||
/// and return the reported LSN back to the caller.
|
||||
pub fn sync_safekeepers(pgdata: &str, pgbin: &str) -> Result<String> {
|
||||
let sync_handle = Command::new(&pgbin)
|
||||
.args(&["--sync-safekeepers"])
|
||||
.env("PGDATA", &pgdata) // we cannot use -D in this mode
|
||||
.stdout(Stdio::piped())
|
||||
.spawn()
|
||||
.expect("postgres --sync-safekeepers failed to start");
|
||||
|
||||
// `postgres --sync-safekeepers` will print all log output to stderr and
|
||||
// final LSN to stdout. So we pipe only stdout, while stderr will be automatically
|
||||
// redirected to the caller output.
|
||||
let sync_output = sync_handle
|
||||
.wait_with_output()
|
||||
.expect("postgres --sync-safekeepers failed");
|
||||
if !sync_output.status.success() {
|
||||
anyhow::bail!(
|
||||
"postgres --sync-safekeepers exited with non-zero status: {}",
|
||||
sync_output.status,
|
||||
);
|
||||
}
|
||||
|
||||
let lsn = String::from(String::from_utf8(sync_output.stdout)?.trim());
|
||||
|
||||
Ok(lsn)
|
||||
}
|
||||
205
compute_tools/tests/cluster_spec.json
Normal file
205
compute_tools/tests/cluster_spec.json
Normal file
@@ -0,0 +1,205 @@
|
||||
{
|
||||
"format_version": 1.0,
|
||||
|
||||
"timestamp": "2021-05-23T18:25:43.511Z",
|
||||
"operation_uuid": "0f657b36-4b0f-4a2d-9c2e-1dcd615e7d8b",
|
||||
|
||||
"cluster": {
|
||||
"cluster_id": "test-cluster-42",
|
||||
"name": "Zenith Test",
|
||||
"state": "restarted",
|
||||
"roles": [
|
||||
{
|
||||
"name": "postgres",
|
||||
"encrypted_password": "6b1d16b78004bbd51fa06af9eda75972",
|
||||
"options": null
|
||||
},
|
||||
{
|
||||
"name": "alexk",
|
||||
"encrypted_password": null,
|
||||
"options": null
|
||||
},
|
||||
{
|
||||
"name": "zenith \"new\"",
|
||||
"encrypted_password": "5b1d16b78004bbd51fa06af9eda75972",
|
||||
"options": null
|
||||
},
|
||||
{
|
||||
"name": "zen",
|
||||
"encrypted_password": "9b1d16b78004bbd51fa06af9eda75972"
|
||||
},
|
||||
{
|
||||
"name": "\"name\";\\n select 1;",
|
||||
"encrypted_password": "5b1d16b78004bbd51fa06af9eda75972"
|
||||
},
|
||||
{
|
||||
"name": "MyRole",
|
||||
"encrypted_password": "5b1d16b78004bbd51fa06af9eda75972"
|
||||
}
|
||||
],
|
||||
"databases": [
|
||||
{
|
||||
"name": "DB2",
|
||||
"owner": "alexk",
|
||||
"options": [
|
||||
{
|
||||
"name": "LC_COLLATE",
|
||||
"value": "C",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "LC_CTYPE",
|
||||
"value": "C",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "TEMPLATE",
|
||||
"value": "template0",
|
||||
"vartype": "enum"
|
||||
}
|
||||
]
|
||||
},
|
||||
{
|
||||
"name": "zenith",
|
||||
"owner": "MyRole"
|
||||
},
|
||||
{
|
||||
"name": "zen",
|
||||
"owner": "zen"
|
||||
}
|
||||
],
|
||||
"settings": [
|
||||
{
|
||||
"name": "fsync",
|
||||
"value": "off",
|
||||
"vartype": "bool"
|
||||
},
|
||||
{
|
||||
"name": "wal_level",
|
||||
"value": "replica",
|
||||
"vartype": "enum"
|
||||
},
|
||||
{
|
||||
"name": "hot_standby",
|
||||
"value": "on",
|
||||
"vartype": "bool"
|
||||
},
|
||||
{
|
||||
"name": "wal_acceptors",
|
||||
"value": "127.0.0.1:6502,127.0.0.1:6503,127.0.0.1:6501",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "wal_log_hints",
|
||||
"value": "on",
|
||||
"vartype": "bool"
|
||||
},
|
||||
{
|
||||
"name": "log_connections",
|
||||
"value": "on",
|
||||
"vartype": "bool"
|
||||
},
|
||||
{
|
||||
"name": "shared_buffers",
|
||||
"value": "32768",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "port",
|
||||
"value": "55432",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "max_connections",
|
||||
"value": "100",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "max_wal_senders",
|
||||
"value": "10",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "listen_addresses",
|
||||
"value": "0.0.0.0",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "wal_sender_timeout",
|
||||
"value": "0",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "password_encryption",
|
||||
"value": "md5",
|
||||
"vartype": "enum"
|
||||
},
|
||||
{
|
||||
"name": "maintenance_work_mem",
|
||||
"value": "65536",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "max_parallel_workers",
|
||||
"value": "8",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "max_worker_processes",
|
||||
"value": "8",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "zenith.zenith_tenant",
|
||||
"value": "b0554b632bd4d547a63b86c3630317e8",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "max_replication_slots",
|
||||
"value": "10",
|
||||
"vartype": "integer"
|
||||
},
|
||||
{
|
||||
"name": "zenith.zenith_timeline",
|
||||
"value": "2414a61ffc94e428f14b5758fe308e13",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "shared_preload_libraries",
|
||||
"value": "zenith",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "synchronous_standby_names",
|
||||
"value": "walproposer",
|
||||
"vartype": "string"
|
||||
},
|
||||
{
|
||||
"name": "zenith.page_server_connstring",
|
||||
"value": "host=127.0.0.1 port=6400",
|
||||
"vartype": "string"
|
||||
}
|
||||
]
|
||||
},
|
||||
|
||||
"delta_operations": [
|
||||
{
|
||||
"action": "delete_db",
|
||||
"name": "zenith_test"
|
||||
},
|
||||
{
|
||||
"action": "rename_db",
|
||||
"name": "DB",
|
||||
"new_name": "DB2"
|
||||
},
|
||||
{
|
||||
"action": "delete_role",
|
||||
"name": "zenith2"
|
||||
},
|
||||
{
|
||||
"action": "rename_role",
|
||||
"name": "zenith new",
|
||||
"new_name": "zenith \"new\""
|
||||
}
|
||||
]
|
||||
}
|
||||
48
compute_tools/tests/config_test.rs
Normal file
48
compute_tools/tests/config_test.rs
Normal file
@@ -0,0 +1,48 @@
|
||||
#[cfg(test)]
|
||||
mod config_tests {
|
||||
|
||||
use std::fs::{remove_file, File};
|
||||
use std::io::{Read, Write};
|
||||
use std::path::Path;
|
||||
|
||||
use compute_tools::config::*;
|
||||
|
||||
fn write_test_file(path: &Path, content: &str) {
|
||||
let mut file = File::create(path).unwrap();
|
||||
file.write_all(content.as_bytes()).unwrap();
|
||||
}
|
||||
|
||||
fn check_file_content(path: &Path, expected_content: &str) {
|
||||
let mut file = File::open(path).unwrap();
|
||||
let mut content = String::new();
|
||||
|
||||
file.read_to_string(&mut content).unwrap();
|
||||
assert_eq!(content, expected_content);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_line_in_file() {
|
||||
let path = Path::new("./tests/tmp/config_test.txt");
|
||||
write_test_file(path, "line1\nline2.1\t line2.2\nline3");
|
||||
|
||||
let line = "line2.1\t line2.2";
|
||||
let result = line_in_file(path, line).unwrap();
|
||||
assert!(!result);
|
||||
check_file_content(path, "line1\nline2.1\t line2.2\nline3");
|
||||
|
||||
let line = "line4";
|
||||
let result = line_in_file(path, line).unwrap();
|
||||
assert!(result);
|
||||
check_file_content(path, "line1\nline2.1\t line2.2\nline3\nline4");
|
||||
|
||||
remove_file(path).unwrap();
|
||||
|
||||
let path = Path::new("./tests/tmp/new_config_test.txt");
|
||||
let line = "line4";
|
||||
let result = line_in_file(path, line).unwrap();
|
||||
assert!(result);
|
||||
check_file_content(path, "line4");
|
||||
|
||||
remove_file(path).unwrap();
|
||||
}
|
||||
}
|
||||
41
compute_tools/tests/pg_helpers_tests.rs
Normal file
41
compute_tools/tests/pg_helpers_tests.rs
Normal file
@@ -0,0 +1,41 @@
|
||||
#[cfg(test)]
|
||||
mod pg_helpers_tests {
|
||||
|
||||
use std::fs::File;
|
||||
|
||||
use compute_tools::pg_helpers::*;
|
||||
use compute_tools::zenith::ClusterSpec;
|
||||
|
||||
#[test]
|
||||
fn params_serialize() {
|
||||
let file = File::open("tests/cluster_spec.json").unwrap();
|
||||
let spec: ClusterSpec = serde_json::from_reader(file).unwrap();
|
||||
|
||||
assert_eq!(
|
||||
spec.cluster.databases.first().unwrap().to_pg_options(),
|
||||
"LC_COLLATE 'C' LC_CTYPE 'C' TEMPLATE template0 OWNER \"alexk\""
|
||||
);
|
||||
assert_eq!(
|
||||
spec.cluster.roles.first().unwrap().to_pg_options(),
|
||||
"LOGIN PASSWORD 'md56b1d16b78004bbd51fa06af9eda75972'"
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn settings_serialize() {
|
||||
let file = File::open("tests/cluster_spec.json").unwrap();
|
||||
let spec: ClusterSpec = serde_json::from_reader(file).unwrap();
|
||||
|
||||
assert_eq!(
|
||||
spec.cluster.settings.as_pg_settings(),
|
||||
"fsync = off\nwal_level = replica\nhot_standby = on\nwal_acceptors = '127.0.0.1:6502,127.0.0.1:6503,127.0.0.1:6501'\nwal_log_hints = on\nlog_connections = on\nshared_buffers = 32768\nport = 55432\nmax_connections = 100\nmax_wal_senders = 10\nlisten_addresses = '0.0.0.0'\nwal_sender_timeout = 0\npassword_encryption = md5\nmaintenance_work_mem = 65536\nmax_parallel_workers = 8\nmax_worker_processes = 8\nzenith.zenith_tenant = 'b0554b632bd4d547a63b86c3630317e8'\nmax_replication_slots = 10\nzenith.zenith_timeline = '2414a61ffc94e428f14b5758fe308e13'\nshared_preload_libraries = 'zenith'\nsynchronous_standby_names = 'walproposer'\nzenith.page_server_connstring = 'host=127.0.0.1 port=6400'"
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn quote_ident() {
|
||||
let ident: PgIdent = PgIdent::from("\"name\";\\n select 1;");
|
||||
|
||||
assert_eq!(ident.quote(), "\"\"\"name\"\";\\n select 1;\"");
|
||||
}
|
||||
}
|
||||
1
compute_tools/tests/tmp/.gitignore
vendored
Normal file
1
compute_tools/tests/tmp/.gitignore
vendored
Normal file
@@ -0,0 +1 @@
|
||||
**/*
|
||||
@@ -1,27 +1,21 @@
|
||||
[package]
|
||||
name = "control_plane"
|
||||
version = "0.1.0"
|
||||
authors = ["Stas Kelvich <stas@zenith.tech>"]
|
||||
edition = "2018"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
edition = "2021"
|
||||
|
||||
[dependencies]
|
||||
rand = "0.8.3"
|
||||
tar = "0.4.33"
|
||||
postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="9eb0dbfbeb6a6c1b79099b9f7ae4a8c021877858" }
|
||||
postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="2949d98df52587d562986aad155dd4e889e408b7" }
|
||||
serde = { version = "1.0", features = ["derive"] }
|
||||
serde_json = "1"
|
||||
toml = "0.5"
|
||||
lazy_static = "1.4"
|
||||
regex = "1"
|
||||
anyhow = "1.0"
|
||||
bytes = "1.0.1"
|
||||
nix = "0.20"
|
||||
thiserror = "1"
|
||||
nix = "0.23"
|
||||
url = "2.2.2"
|
||||
reqwest = { version = "0.11", default-features = false, features = ["blocking", "json", "rustls-tls"] }
|
||||
|
||||
pageserver = { path = "../pageserver" }
|
||||
walkeeper = { path = "../walkeeper" }
|
||||
postgres_ffi = { path = "../postgres_ffi" }
|
||||
zenith_utils = { path = "../zenith_utils" }
|
||||
workspace_hack = { path = "../workspace_hack" }
|
||||
|
||||
20
control_plane/safekeepers.conf
Normal file
20
control_plane/safekeepers.conf
Normal file
@@ -0,0 +1,20 @@
|
||||
# Page server and three safekeepers.
|
||||
[pageserver]
|
||||
listen_pg_addr = '127.0.0.1:64000'
|
||||
listen_http_addr = '127.0.0.1:9898'
|
||||
auth_type = 'Trust'
|
||||
|
||||
[[safekeepers]]
|
||||
id = 1
|
||||
pg_port = 5454
|
||||
http_port = 7676
|
||||
|
||||
[[safekeepers]]
|
||||
id = 2
|
||||
pg_port = 5455
|
||||
http_port = 7677
|
||||
|
||||
[[safekeepers]]
|
||||
id = 3
|
||||
pg_port = 5456
|
||||
http_port = 7678
|
||||
11
control_plane/simple.conf
Normal file
11
control_plane/simple.conf
Normal file
@@ -0,0 +1,11 @@
|
||||
# Minimal zenith environment with one safekeeper. This is equivalent to the built-in
|
||||
# defaults that you get with no --config
|
||||
[pageserver]
|
||||
listen_pg_addr = '127.0.0.1:64000'
|
||||
listen_http_addr = '127.0.0.1:9898'
|
||||
auth_type = 'Trust'
|
||||
|
||||
[[safekeepers]]
|
||||
id = 1
|
||||
pg_port = 5454
|
||||
http_port = 7676
|
||||
@@ -1,24 +1,24 @@
|
||||
use std::collections::BTreeMap;
|
||||
use std::fs::{self, File};
|
||||
use std::io::Write;
|
||||
use std::net::SocketAddr;
|
||||
use std::net::TcpStream;
|
||||
use std::os::unix::fs::PermissionsExt;
|
||||
use std::process::Command;
|
||||
use std::path::PathBuf;
|
||||
use std::process::{Command, Stdio};
|
||||
use std::str::FromStr;
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
use std::{collections::BTreeMap, path::PathBuf};
|
||||
use std::{
|
||||
fs::{self, OpenOptions},
|
||||
io::Read,
|
||||
};
|
||||
|
||||
use anyhow::{Context, Result};
|
||||
use lazy_static::lazy_static;
|
||||
use regex::Regex;
|
||||
use zenith_utils::connstring::connection_host_port;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use zenith_utils::postgres_backend::AuthType;
|
||||
use zenith_utils::zid::ZTenantId;
|
||||
use zenith_utils::zid::ZTimelineId;
|
||||
|
||||
use crate::local_env::LocalEnv;
|
||||
use pageserver::ZTimelineId;
|
||||
|
||||
use crate::postgresql_conf::PostgresConf;
|
||||
use crate::storage::PageServerNode;
|
||||
|
||||
//
|
||||
@@ -27,27 +27,34 @@ use crate::storage::PageServerNode;
|
||||
pub struct ComputeControlPlane {
|
||||
base_port: u16,
|
||||
pageserver: Arc<PageServerNode>,
|
||||
pub nodes: BTreeMap<String, Arc<PostgresNode>>,
|
||||
pub nodes: BTreeMap<(ZTenantId, String), Arc<PostgresNode>>,
|
||||
env: LocalEnv,
|
||||
}
|
||||
|
||||
impl ComputeControlPlane {
|
||||
// Load current nodes with ports from data directories on disk
|
||||
// Directory structure has the following layout:
|
||||
// pgdatadirs
|
||||
// |- tenants
|
||||
// | |- <tenant_id>
|
||||
// | | |- <branch name>
|
||||
pub fn load(env: LocalEnv) -> Result<ComputeControlPlane> {
|
||||
// TODO: since pageserver do not have config file yet we believe here that
|
||||
// it is running on default port. Change that when pageserver will have config.
|
||||
let pageserver = Arc::new(PageServerNode::from_env(&env));
|
||||
|
||||
let mut nodes = BTreeMap::default();
|
||||
let pgdatadirspath = &env.pg_data_dirs_path();
|
||||
let nodes: Result<BTreeMap<_, _>> = fs::read_dir(&pgdatadirspath)
|
||||
|
||||
for tenant_dir in fs::read_dir(&pgdatadirspath)
|
||||
.with_context(|| format!("failed to list {}", pgdatadirspath.display()))?
|
||||
.into_iter()
|
||||
.map(|f| {
|
||||
PostgresNode::from_dir_entry(f?, &env, &pageserver)
|
||||
.map(|node| (node.name.clone(), Arc::new(node)))
|
||||
})
|
||||
.collect();
|
||||
let nodes = nodes?;
|
||||
{
|
||||
let tenant_dir = tenant_dir?;
|
||||
for timeline_dir in fs::read_dir(tenant_dir.path())
|
||||
.with_context(|| format!("failed to list {}", tenant_dir.path().display()))?
|
||||
{
|
||||
let node = PostgresNode::from_dir_entry(timeline_dir?, &env, &pageserver)?;
|
||||
nodes.insert((node.tenantid, node.name.clone()), Arc::new(node));
|
||||
}
|
||||
}
|
||||
|
||||
Ok(ComputeControlPlane {
|
||||
base_port: 55431,
|
||||
@@ -66,56 +73,58 @@ impl ComputeControlPlane {
|
||||
.unwrap_or(self.base_port)
|
||||
}
|
||||
|
||||
pub fn local(local_env: &LocalEnv, pageserver: &Arc<PageServerNode>) -> ComputeControlPlane {
|
||||
ComputeControlPlane {
|
||||
base_port: 65431,
|
||||
pageserver: Arc::clone(pageserver),
|
||||
nodes: BTreeMap::new(),
|
||||
env: local_env.clone(),
|
||||
}
|
||||
// FIXME: see also parse_point_in_time in branches.rs.
|
||||
fn parse_point_in_time(
|
||||
&self,
|
||||
tenantid: ZTenantId,
|
||||
s: &str,
|
||||
) -> Result<(ZTimelineId, Option<Lsn>)> {
|
||||
let mut strings = s.split('@');
|
||||
let name = strings.next().unwrap();
|
||||
|
||||
let lsn = strings
|
||||
.next()
|
||||
.map(Lsn::from_str)
|
||||
.transpose()
|
||||
.context("invalid LSN in point-in-time specification")?;
|
||||
|
||||
// Resolve the timeline ID, given the human-readable branch name
|
||||
let timeline_id = self
|
||||
.pageserver
|
||||
.branch_get_by_name(&tenantid, name)?
|
||||
.timeline_id;
|
||||
|
||||
Ok((timeline_id, lsn))
|
||||
}
|
||||
|
||||
/// Connect to a page server, get base backup, and untar it to initialize a
|
||||
/// new data directory
|
||||
pub fn new_from_page_server(
|
||||
pub fn new_node(
|
||||
&mut self,
|
||||
is_test: bool,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
name: &str,
|
||||
timeline_spec: &str,
|
||||
port: Option<u16>,
|
||||
) -> Result<Arc<PostgresNode>> {
|
||||
// Resolve the human-readable timeline spec into timeline ID and LSN
|
||||
let (timelineid, lsn) = self.parse_point_in_time(tenantid, timeline_spec)?;
|
||||
|
||||
let port = port.unwrap_or_else(|| self.get_port());
|
||||
let node = Arc::new(PostgresNode {
|
||||
name: name.to_owned(),
|
||||
address: SocketAddr::new("127.0.0.1".parse().unwrap(), self.get_port()),
|
||||
address: SocketAddr::new("127.0.0.1".parse().unwrap(), port),
|
||||
env: self.env.clone(),
|
||||
pageserver: Arc::clone(&self.pageserver),
|
||||
is_test,
|
||||
is_test: false,
|
||||
timelineid,
|
||||
lsn,
|
||||
tenantid,
|
||||
uses_wal_proposer: false,
|
||||
});
|
||||
|
||||
node.init_from_page_server()?;
|
||||
self.nodes.insert(node.name.clone(), Arc::clone(&node));
|
||||
node.create_pgdata()?;
|
||||
node.setup_pg_conf(self.env.pageserver.auth_type)?;
|
||||
|
||||
Ok(node)
|
||||
}
|
||||
|
||||
pub fn new_node(&mut self, branch_name: &str) -> Result<Arc<PostgresNode>> {
|
||||
let timeline_id = self.pageserver.branch_get_by_name(branch_name)?.timeline_id;
|
||||
|
||||
let node = self.new_from_page_server(false, timeline_id, branch_name)?;
|
||||
|
||||
// Configure the node to stream WAL directly to the pageserver
|
||||
node.append_conf(
|
||||
"postgresql.conf",
|
||||
format!(
|
||||
concat!(
|
||||
"shared_preload_libraries = zenith\n",
|
||||
"synchronous_standby_names = 'pageserver'\n", // TODO: add a new function arg?
|
||||
"zenith.callmemaybe_connstring = '{}'\n", // FIXME escaping
|
||||
),
|
||||
node.connstr()
|
||||
)
|
||||
.as_str(),
|
||||
)?;
|
||||
self.nodes
|
||||
.insert((tenantid, node.name.clone()), Arc::clone(&node));
|
||||
|
||||
Ok(node)
|
||||
}
|
||||
@@ -123,6 +132,7 @@ impl ComputeControlPlane {
|
||||
|
||||
///////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
#[derive(Debug)]
|
||||
pub struct PostgresNode {
|
||||
pub address: SocketAddr,
|
||||
name: String,
|
||||
@@ -130,6 +140,9 @@ pub struct PostgresNode {
|
||||
pageserver: Arc<PageServerNode>,
|
||||
is_test: bool,
|
||||
pub timelineid: ZTimelineId,
|
||||
pub lsn: Option<Lsn>, // if it's a read-only node. None for primary
|
||||
pub tenantid: ZTenantId,
|
||||
uses_wal_proposer: bool,
|
||||
}
|
||||
|
||||
impl PostgresNode {
|
||||
@@ -145,56 +158,28 @@ impl PostgresNode {
|
||||
);
|
||||
}
|
||||
|
||||
lazy_static! {
|
||||
static ref CONF_PORT_RE: Regex = Regex::new(r"(?m)^\s*port\s*=\s*(\d+)\s*$").unwrap();
|
||||
static ref CONF_TIMELINE_RE: Regex =
|
||||
Regex::new(r"(?m)^\s*zenith.zenith_timeline\s*=\s*'(\w+)'\s*$").unwrap();
|
||||
}
|
||||
|
||||
// parse data directory name
|
||||
let fname = entry.file_name();
|
||||
let name = fname.to_str().unwrap().to_string();
|
||||
|
||||
// find out tcp port in config file
|
||||
// Read config file into memory
|
||||
let cfg_path = entry.path().join("postgresql.conf");
|
||||
let config = fs::read_to_string(cfg_path.clone()).with_context(|| {
|
||||
format!(
|
||||
"failed to read config file in {}",
|
||||
cfg_path.to_str().unwrap()
|
||||
)
|
||||
})?;
|
||||
let cfg_path_str = cfg_path.to_string_lossy();
|
||||
let mut conf_file = File::open(&cfg_path)
|
||||
.with_context(|| format!("failed to open config file in {}", cfg_path_str))?;
|
||||
let conf = PostgresConf::read(&mut conf_file)
|
||||
.with_context(|| format!("failed to read config file in {}", cfg_path_str))?;
|
||||
|
||||
// parse port
|
||||
let err_msg = format!(
|
||||
"failed to find port definition in config file {}",
|
||||
cfg_path.to_str().unwrap()
|
||||
);
|
||||
let port: u16 = CONF_PORT_RE
|
||||
.captures(config.as_str())
|
||||
.ok_or_else(|| anyhow::Error::msg(err_msg.clone() + " 1"))?
|
||||
.iter()
|
||||
.last()
|
||||
.ok_or_else(|| anyhow::Error::msg(err_msg.clone() + " 2"))?
|
||||
.ok_or_else(|| anyhow::Error::msg(err_msg.clone() + " 3"))?
|
||||
.as_str()
|
||||
.parse()
|
||||
.with_context(|| err_msg)?;
|
||||
// Read a few options from the config file
|
||||
let context = format!("in config file {}", cfg_path_str);
|
||||
let port: u16 = conf.parse_field("port", &context)?;
|
||||
let timelineid: ZTimelineId = conf.parse_field("zenith.zenith_timeline", &context)?;
|
||||
let tenantid: ZTenantId = conf.parse_field("zenith.zenith_tenant", &context)?;
|
||||
let uses_wal_proposer = conf.get("wal_acceptors").is_some();
|
||||
|
||||
// parse timeline
|
||||
let err_msg = format!(
|
||||
"failed to find timeline definition in config file {}",
|
||||
cfg_path.to_str().unwrap()
|
||||
);
|
||||
let timelineid: ZTimelineId = CONF_TIMELINE_RE
|
||||
.captures(config.as_str())
|
||||
.ok_or_else(|| anyhow::Error::msg(err_msg.clone() + " 1"))?
|
||||
.iter()
|
||||
.last()
|
||||
.ok_or_else(|| anyhow::Error::msg(err_msg.clone() + " 2"))?
|
||||
.ok_or_else(|| anyhow::Error::msg(err_msg.clone() + " 3"))?
|
||||
.as_str()
|
||||
.parse()
|
||||
.with_context(|| err_msg)?;
|
||||
// parse recovery_target_lsn, if any
|
||||
let recovery_target_lsn: Option<Lsn> =
|
||||
conf.parse_field_optional("recovery_target_lsn", &context)?;
|
||||
|
||||
// ok now
|
||||
Ok(PostgresNode {
|
||||
@@ -204,112 +189,226 @@ impl PostgresNode {
|
||||
pageserver: Arc::clone(pageserver),
|
||||
is_test: false,
|
||||
timelineid,
|
||||
lsn: recovery_target_lsn,
|
||||
tenantid,
|
||||
uses_wal_proposer,
|
||||
})
|
||||
}
|
||||
|
||||
fn sync_safekeepers(&self, auth_token: &Option<String>) -> Result<Lsn> {
|
||||
let pg_path = self.env.pg_bin_dir().join("postgres");
|
||||
let mut cmd = Command::new(&pg_path);
|
||||
|
||||
cmd.arg("--sync-safekeepers")
|
||||
.env_clear()
|
||||
.env("LD_LIBRARY_PATH", self.env.pg_lib_dir().to_str().unwrap())
|
||||
.env("DYLD_LIBRARY_PATH", self.env.pg_lib_dir().to_str().unwrap())
|
||||
.env("PGDATA", self.pgdata().to_str().unwrap())
|
||||
.stdout(Stdio::piped())
|
||||
// Comment this to avoid capturing stderr (useful if command hangs)
|
||||
.stderr(Stdio::piped());
|
||||
|
||||
if let Some(token) = auth_token {
|
||||
cmd.env("ZENITH_AUTH_TOKEN", token);
|
||||
}
|
||||
|
||||
let sync_handle = cmd
|
||||
.spawn()
|
||||
.expect("postgres --sync-safekeepers failed to start");
|
||||
|
||||
let sync_output = sync_handle
|
||||
.wait_with_output()
|
||||
.expect("postgres --sync-safekeepers failed");
|
||||
if !sync_output.status.success() {
|
||||
anyhow::bail!(
|
||||
"sync-safekeepers failed: '{}'",
|
||||
String::from_utf8_lossy(&sync_output.stderr)
|
||||
);
|
||||
}
|
||||
|
||||
let lsn = Lsn::from_str(std::str::from_utf8(&sync_output.stdout)?.trim())?;
|
||||
println!("Safekeepers synced on {}", lsn);
|
||||
Ok(lsn)
|
||||
}
|
||||
|
||||
/// Get basebackup from the pageserver as a tar archive and extract it
|
||||
/// to the `self.pgdata()` directory.
|
||||
fn do_basebackup(&self, lsn: Option<Lsn>) -> Result<()> {
|
||||
println!(
|
||||
"Extracting base backup to create postgres instance: path={} port={}",
|
||||
self.pgdata().display(),
|
||||
self.address.port()
|
||||
);
|
||||
|
||||
let sql = if let Some(lsn) = lsn {
|
||||
format!("basebackup {} {} {}", self.tenantid, self.timelineid, lsn)
|
||||
} else {
|
||||
format!("basebackup {} {}", self.tenantid, self.timelineid)
|
||||
};
|
||||
|
||||
let mut client = self
|
||||
.pageserver
|
||||
.page_server_psql_client()
|
||||
.context("connecting to page server failed")?;
|
||||
|
||||
let copyreader = client
|
||||
.copy_out(sql.as_str())
|
||||
.context("page server 'basebackup' command failed")?;
|
||||
|
||||
// Read the archive directly from the `CopyOutReader`
|
||||
tar::Archive::new(copyreader)
|
||||
.unpack(&self.pgdata())
|
||||
.context("extracting base backup failed")?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn create_pgdata(&self) -> Result<()> {
|
||||
fs::create_dir_all(&self.pgdata()).with_context(|| {
|
||||
format!(
|
||||
"could not create data directory {}",
|
||||
self.pgdata().display()
|
||||
)
|
||||
})?;
|
||||
fs::set_permissions(self.pgdata().as_path(), fs::Permissions::from_mode(0o700))
|
||||
.with_context(|| {
|
||||
format!(
|
||||
"could not set permissions in data directory {}",
|
||||
self.pgdata().display()
|
||||
)
|
||||
})
|
||||
}
|
||||
|
||||
// Connect to a page server, get base backup, and untar it to initialize a
|
||||
// new data directory
|
||||
pub fn init_from_page_server(&self) -> Result<()> {
|
||||
let pgdata = self.pgdata();
|
||||
|
||||
println!(
|
||||
"Extracting base backup to create postgres instance: path={} port={}",
|
||||
pgdata.display(),
|
||||
self.address.port()
|
||||
);
|
||||
|
||||
// initialize data directory
|
||||
if self.is_test {
|
||||
fs::remove_dir_all(&pgdata).ok();
|
||||
}
|
||||
|
||||
let sql = format!("basebackup {}", self.timelineid);
|
||||
let mut client = self
|
||||
.pageserver
|
||||
.page_server_psql_client()
|
||||
.with_context(|| "connecting to page server failed")?;
|
||||
|
||||
fs::create_dir_all(&pgdata)
|
||||
.with_context(|| format!("could not create data directory {}", pgdata.display()))?;
|
||||
fs::set_permissions(pgdata.as_path(), fs::Permissions::from_mode(0o700)).with_context(
|
||||
|| {
|
||||
format!(
|
||||
"could not set permissions in data directory {}",
|
||||
pgdata.display()
|
||||
)
|
||||
},
|
||||
)?;
|
||||
|
||||
// FIXME: The compute node should be able to stream the WAL it needs from the WAL safekeepers or archive.
|
||||
// But that's not implemented yet. For now, 'pg_wal' is included in the base backup tarball that
|
||||
// we receive from the Page Server, so we don't need to create the empty 'pg_wal' directory here.
|
||||
//fs::create_dir_all(pgdata.join("pg_wal"))?;
|
||||
|
||||
let mut copyreader = client
|
||||
.copy_out(sql.as_str())
|
||||
.with_context(|| "page server 'basebackup' command failed")?;
|
||||
|
||||
// FIXME: Currently, we slurp the whole tarball into memory, and then extract it,
|
||||
// but we really should do this:
|
||||
//let mut ar = tar::Archive::new(copyreader);
|
||||
let mut buf = vec![];
|
||||
copyreader
|
||||
.read_to_end(&mut buf)
|
||||
.with_context(|| "reading base backup from page server failed")?;
|
||||
let mut ar = tar::Archive::new(buf.as_slice());
|
||||
ar.unpack(&pgdata)
|
||||
.with_context(|| "extracting page backup failed")?;
|
||||
|
||||
fn setup_pg_conf(&self, auth_type: AuthType) -> Result<()> {
|
||||
let mut conf = PostgresConf::new();
|
||||
conf.append("max_wal_senders", "10");
|
||||
// wal_log_hints is mandatory when running against pageserver (see gh issue#192)
|
||||
// TODO: is it possible to check wal_log_hints at pageserver side via XLOG_PARAMETER_CHANGE?
|
||||
self.append_conf(
|
||||
"postgresql.conf",
|
||||
&format!(
|
||||
"max_wal_senders = 10\n\
|
||||
wal_log_hints = on\n\
|
||||
max_replication_slots = 10\n\
|
||||
hot_standby = on\n\
|
||||
shared_buffers = 1MB\n\
|
||||
fsync = off\n\
|
||||
max_connections = 100\n\
|
||||
wal_sender_timeout = 0\n\
|
||||
wal_level = replica\n\
|
||||
listen_addresses = '{address}'\n\
|
||||
port = {port}\n",
|
||||
address = self.address.ip(),
|
||||
port = self.address.port()
|
||||
),
|
||||
)?;
|
||||
conf.append("wal_log_hints", "on");
|
||||
conf.append("max_replication_slots", "10");
|
||||
conf.append("hot_standby", "on");
|
||||
conf.append("shared_buffers", "1MB");
|
||||
conf.append("fsync", "off");
|
||||
conf.append("max_connections", "100");
|
||||
conf.append("wal_level", "replica");
|
||||
// wal_sender_timeout is the maximum time to wait for WAL replication.
|
||||
// It also defines how often the walreciever will send a feedback message to the wal sender.
|
||||
conf.append("wal_sender_timeout", "5s");
|
||||
conf.append("listen_addresses", &self.address.ip().to_string());
|
||||
conf.append("port", &self.address.port().to_string());
|
||||
|
||||
// Never clean up old WAL. TODO: We should use a replication
|
||||
// slot or something proper, to prevent the compute node
|
||||
// from removing WAL that hasn't been streamed to the safekeepr or
|
||||
// page server yet. But this will do for now.
|
||||
self.append_conf("postgresql.conf", "wal_keep_size='10TB'\n")?;
|
||||
// from removing WAL that hasn't been streamed to the safekeeper or
|
||||
// page server yet. (gh issue #349)
|
||||
conf.append("wal_keep_size", "10TB");
|
||||
|
||||
// Connect it to the page server.
|
||||
// Configure the node to fetch pages from pageserver
|
||||
let pageserver_connstr = {
|
||||
let (host, port) = connection_host_port(&self.pageserver.pg_connection_config);
|
||||
|
||||
// Configure that node to take pages from pageserver
|
||||
let (host, port) = connection_host_port(&self.pageserver.connection_config());
|
||||
self.append_conf(
|
||||
"postgresql.conf",
|
||||
&format!(
|
||||
"shared_preload_libraries = zenith \n\
|
||||
zenith.page_server_connstring = 'host={} port={}'\n\
|
||||
zenith.zenith_timeline='{}'\n",
|
||||
host,
|
||||
port,
|
||||
self.timelineid
|
||||
),
|
||||
)?;
|
||||
// Set up authentication
|
||||
//
|
||||
// $ZENITH_AUTH_TOKEN will be replaced with value from environment
|
||||
// variable during compute pg startup. It is done this way because
|
||||
// otherwise user will be able to retrieve the value using SHOW
|
||||
// command or pg_settings
|
||||
let password = if let AuthType::ZenithJWT = auth_type {
|
||||
"$ZENITH_AUTH_TOKEN"
|
||||
} else {
|
||||
""
|
||||
};
|
||||
// NOTE avoiding spaces in connection string, because it is less error prone if we forward it somewhere.
|
||||
// Also note that not all parameters are supported here. Because in compute we substitute $ZENITH_AUTH_TOKEN
|
||||
// We parse this string and build it back with token from env var, and for simplicity rebuild
|
||||
// uses only needed variables namely host, port, user, password.
|
||||
format!("postgresql://no_user:{}@{}:{}", password, host, port)
|
||||
};
|
||||
conf.append("shared_preload_libraries", "zenith");
|
||||
conf.append_line("");
|
||||
conf.append("zenith.page_server_connstring", &pageserver_connstr);
|
||||
conf.append("zenith.zenith_tenant", &self.tenantid.to_string());
|
||||
conf.append("zenith.zenith_timeline", &self.timelineid.to_string());
|
||||
if let Some(lsn) = self.lsn {
|
||||
conf.append("recovery_target_lsn", &lsn.to_string());
|
||||
}
|
||||
|
||||
conf.append_line("");
|
||||
// Configure backpressure
|
||||
// - Replication write lag depends on how fast the walreceiver can process incoming WAL.
|
||||
// This lag determines latency of get_page_at_lsn. Speed of applying WAL is about 10MB/sec,
|
||||
// so to avoid expiration of 1 minute timeout, this lag should not be larger than 600MB.
|
||||
// Actually latency should be much smaller (better if < 1sec). But we assume that recently
|
||||
// updates pages are not requested from pageserver.
|
||||
// - Replication flush lag depends on speed of persisting data by checkpointer (creation of
|
||||
// delta/image layers) and advancing disk_consistent_lsn. Safekeepers are able to
|
||||
// remove/archive WAL only beyond disk_consistent_lsn. Too large a lag can cause long
|
||||
// recovery time (in case of pageserver crash) and disk space overflow at safekeepers.
|
||||
// - Replication apply lag depends on speed of uploading changes to S3 by uploader thread.
|
||||
// To be able to restore database in case of pageserver node crash, safekeeper should not
|
||||
// remove WAL beyond this point. Too large lag can cause space exhaustion in safekeepers
|
||||
// (if they are not able to upload WAL to S3).
|
||||
conf.append("max_replication_write_lag", "500MB");
|
||||
conf.append("max_replication_flush_lag", "10GB");
|
||||
|
||||
if !self.env.safekeepers.is_empty() {
|
||||
// Configure the node to connect to the safekeepers
|
||||
conf.append("synchronous_standby_names", "walproposer");
|
||||
|
||||
let wal_acceptors = self
|
||||
.env
|
||||
.safekeepers
|
||||
.iter()
|
||||
.map(|sk| format!("localhost:{}", sk.pg_port))
|
||||
.collect::<Vec<String>>()
|
||||
.join(",");
|
||||
conf.append("wal_acceptors", &wal_acceptors);
|
||||
} else {
|
||||
// We only use setup without safekeepers for tests,
|
||||
// and don't care about data durability on pageserver,
|
||||
// so set more relaxed synchronous_commit.
|
||||
conf.append("synchronous_commit", "remote_write");
|
||||
|
||||
// Configure the node to stream WAL directly to the pageserver
|
||||
// This isn't really a supported configuration, but can be useful for
|
||||
// testing.
|
||||
conf.append("synchronous_standby_names", "pageserver");
|
||||
conf.append("zenith.callmemaybe_connstring", &self.connstr());
|
||||
}
|
||||
|
||||
let mut file = File::create(self.pgdata().join("postgresql.conf"))?;
|
||||
file.write_all(conf.to_string().as_bytes())?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn load_basebackup(&self, auth_token: &Option<String>) -> Result<()> {
|
||||
let backup_lsn = if let Some(lsn) = self.lsn {
|
||||
Some(lsn)
|
||||
} else if self.uses_wal_proposer {
|
||||
// LSN 0 means that it is bootstrap and we need to download just
|
||||
// latest data from the pageserver. That is a bit clumsy but whole bootstrap
|
||||
// procedure evolves quite actively right now, so let's think about it again
|
||||
// when things would be more stable (TODO).
|
||||
let lsn = self.sync_safekeepers(auth_token)?;
|
||||
if lsn == Lsn(0) {
|
||||
None
|
||||
} else {
|
||||
Some(lsn)
|
||||
}
|
||||
} else {
|
||||
None
|
||||
};
|
||||
|
||||
self.do_basebackup(backup_lsn)?;
|
||||
|
||||
fs::create_dir_all(self.pgdata().join("pg_wal"))?;
|
||||
fs::create_dir_all(self.pgdata().join("pg_wal").join("archive_status"))?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn pgdata(&self) -> PathBuf {
|
||||
self.env.pg_data_dir(&self.name)
|
||||
self.env.pg_data_dir(&self.tenantid, &self.name)
|
||||
}
|
||||
|
||||
pub fn status(&self) -> &str {
|
||||
@@ -325,69 +424,101 @@ impl PostgresNode {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn append_conf(&self, config: &str, opts: &str) -> Result<()> {
|
||||
OpenOptions::new()
|
||||
.append(true)
|
||||
.open(self.pgdata().join(config).to_str().unwrap())?
|
||||
.write_all(opts.as_bytes())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn pg_ctl(&self, args: &[&str]) -> Result<()> {
|
||||
fn pg_ctl(&self, args: &[&str], auth_token: &Option<String>) -> Result<()> {
|
||||
let pg_ctl_path = self.env.pg_bin_dir().join("pg_ctl");
|
||||
let mut cmd = Command::new(pg_ctl_path);
|
||||
cmd.args(
|
||||
[
|
||||
&[
|
||||
"-D",
|
||||
self.pgdata().to_str().unwrap(),
|
||||
"-l",
|
||||
self.pgdata().join("pg.log").to_str().unwrap(),
|
||||
"-w", //wait till pg_ctl actually does what was asked
|
||||
],
|
||||
args,
|
||||
]
|
||||
.concat(),
|
||||
)
|
||||
.env_clear()
|
||||
.env("LD_LIBRARY_PATH", self.env.pg_lib_dir().to_str().unwrap())
|
||||
.env("DYLD_LIBRARY_PATH", self.env.pg_lib_dir().to_str().unwrap());
|
||||
if let Some(token) = auth_token {
|
||||
cmd.env("ZENITH_AUTH_TOKEN", token);
|
||||
}
|
||||
let pg_ctl = cmd.status().context("pg_ctl failed")?;
|
||||
|
||||
let pg_ctl = Command::new(pg_ctl_path)
|
||||
.args(
|
||||
[
|
||||
&[
|
||||
"-D",
|
||||
self.pgdata().to_str().unwrap(),
|
||||
"-l",
|
||||
self.pgdata().join("pg.log").to_str().unwrap(),
|
||||
"-w", //wait till pg_ctl actually does what was asked
|
||||
],
|
||||
args,
|
||||
]
|
||||
.concat(),
|
||||
)
|
||||
.env_clear()
|
||||
.env("LD_LIBRARY_PATH", self.env.pg_lib_dir().to_str().unwrap())
|
||||
.env("DYLD_LIBRARY_PATH", self.env.pg_lib_dir().to_str().unwrap())
|
||||
.status()
|
||||
.with_context(|| "pg_ctl failed")?;
|
||||
if !pg_ctl.success() {
|
||||
anyhow::bail!("pg_ctl failed");
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn start(&self) -> Result<()> {
|
||||
pub fn start(&self, auth_token: &Option<String>) -> Result<()> {
|
||||
// Bail if the node already running.
|
||||
if self.status() == "running" {
|
||||
anyhow::bail!("The node is already running");
|
||||
}
|
||||
|
||||
// 1. We always start compute node from scratch, so
|
||||
// if old dir exists, preserve 'postgresql.conf' and drop the directory
|
||||
let postgresql_conf_path = self.pgdata().join("postgresql.conf");
|
||||
let postgresql_conf = fs::read(&postgresql_conf_path).with_context(|| {
|
||||
format!(
|
||||
"failed to read config file in {}",
|
||||
postgresql_conf_path.to_str().unwrap()
|
||||
)
|
||||
})?;
|
||||
fs::remove_dir_all(&self.pgdata())?;
|
||||
self.create_pgdata()?;
|
||||
|
||||
// 2. Bring back config files
|
||||
fs::write(&postgresql_conf_path, postgresql_conf)?;
|
||||
|
||||
// 3. Load basebackup
|
||||
self.load_basebackup(auth_token)?;
|
||||
|
||||
if self.lsn.is_some() {
|
||||
File::create(self.pgdata().join("standby.signal"))?;
|
||||
}
|
||||
|
||||
// 4. Finally start the compute node postgres
|
||||
println!("Starting postgres node at '{}'", self.connstr());
|
||||
self.pg_ctl(&["start"])
|
||||
self.pg_ctl(&["start"], auth_token)
|
||||
}
|
||||
|
||||
pub fn restart(&self) -> Result<()> {
|
||||
self.pg_ctl(&["restart"])
|
||||
pub fn restart(&self, auth_token: &Option<String>) -> Result<()> {
|
||||
self.pg_ctl(&["restart"], auth_token)
|
||||
}
|
||||
|
||||
pub fn stop(&self, destroy: bool) -> Result<()> {
|
||||
self.pg_ctl(&["-m", "immediate", "stop"])?;
|
||||
// If we are going to destroy data directory,
|
||||
// use immediate shutdown mode, otherwise,
|
||||
// shutdown gracefully to leave the data directory sane.
|
||||
//
|
||||
// Compute node always starts from scratch, so stop
|
||||
// without destroy only used for testing and debugging.
|
||||
//
|
||||
if destroy {
|
||||
self.pg_ctl(&["-m", "immediate", "stop"], &None)?;
|
||||
println!(
|
||||
"Destroying postgres data directory '{}'",
|
||||
self.pgdata().to_str().unwrap()
|
||||
);
|
||||
fs::remove_dir_all(&self.pgdata())?;
|
||||
} else {
|
||||
self.pg_ctl(&["stop"], &None)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn connstr(&self) -> String {
|
||||
format!(
|
||||
"host={} port={} user={}",
|
||||
"host={} port={} user={} dbname={}",
|
||||
self.address.ip(),
|
||||
self.address.port(),
|
||||
self.whoami()
|
||||
"zenith_admin",
|
||||
"postgres"
|
||||
)
|
||||
}
|
||||
|
||||
@@ -397,9 +528,7 @@ impl PostgresNode {
|
||||
.output()
|
||||
.expect("failed to execute whoami");
|
||||
|
||||
if !output.status.success() {
|
||||
panic!("whoami failed");
|
||||
}
|
||||
assert!(output.status.success(), "whoami failed");
|
||||
|
||||
String::from_utf8(output.stdout).unwrap().trim().to_string()
|
||||
}
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
//
|
||||
// Local control plane.
|
||||
//
|
||||
// Can start, cofigure and stop postgres instances running as a local processes.
|
||||
// Can start, configure and stop postgres instances running as a local processes.
|
||||
//
|
||||
// Intended to be used in integration tests and in CLI tools for
|
||||
// local installations.
|
||||
@@ -9,9 +9,12 @@
|
||||
use anyhow::{anyhow, bail, Context, Result};
|
||||
use std::fs;
|
||||
use std::path::Path;
|
||||
use std::process::Command;
|
||||
|
||||
pub mod compute;
|
||||
pub mod local_env;
|
||||
pub mod postgresql_conf;
|
||||
pub mod safekeeper;
|
||||
pub mod storage;
|
||||
|
||||
/// Read a PID file
|
||||
@@ -29,3 +32,19 @@ pub fn read_pidfile(pidfile: &Path) -> Result<i32> {
|
||||
}
|
||||
Ok(pid)
|
||||
}
|
||||
|
||||
fn fill_rust_env_vars(cmd: &mut Command) -> &mut Command {
|
||||
let cmd = cmd.env_clear().env("RUST_BACKTRACE", "1");
|
||||
|
||||
let var = "LLVM_PROFILE_FILE";
|
||||
if let Some(val) = std::env::var_os(var) {
|
||||
cmd.env(var, val);
|
||||
}
|
||||
|
||||
const RUST_LOG_KEY: &str = "RUST_LOG";
|
||||
if let Ok(rust_log_value) = std::env::var(RUST_LOG_KEY) {
|
||||
cmd.env(RUST_LOG_KEY, rust_log_value)
|
||||
} else {
|
||||
cmd
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,39 +1,111 @@
|
||||
//
|
||||
// This module is responsible for locating and loading paths in a local setup.
|
||||
//
|
||||
// Now it also provides init method which acts like a stub for proper installation
|
||||
// script which will use local paths.
|
||||
//
|
||||
use anyhow::{anyhow, Result};
|
||||
//! This module is responsible for locating and loading paths in a local setup.
|
||||
//!
|
||||
//! Now it also provides init method which acts like a stub for proper installation
|
||||
//! script which will use local paths.
|
||||
|
||||
use anyhow::{bail, Context};
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::env;
|
||||
use std::fmt::Write;
|
||||
use std::fs;
|
||||
use std::path::PathBuf;
|
||||
use std::{collections::BTreeMap, env};
|
||||
use url::Url;
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::process::{Command, Stdio};
|
||||
use zenith_utils::auth::{encode_from_key_file, Claims, Scope};
|
||||
use zenith_utils::postgres_backend::AuthType;
|
||||
use zenith_utils::zid::{HexZTenantId, ZNodeId, ZTenantId};
|
||||
|
||||
pub type Remotes = BTreeMap<String, String>;
|
||||
use crate::safekeeper::SafekeeperNode;
|
||||
|
||||
//
|
||||
// This data structures represent deserialized zenith CLI config
|
||||
// This data structures represents zenith CLI config
|
||||
//
|
||||
#[derive(Serialize, Deserialize, Clone)]
|
||||
// It is deserialized from the .zenith/config file, or the config file passed
|
||||
// to 'zenith init --config=<path>' option. See control_plane/simple.conf for
|
||||
// an example.
|
||||
//
|
||||
#[derive(Serialize, Deserialize, Clone, Debug)]
|
||||
pub struct LocalEnv {
|
||||
// Pageserver connection strings
|
||||
pub pageserver_connstring: String,
|
||||
|
||||
// Base directory for both pageserver and compute nodes
|
||||
// Base directory for all the nodes (the pageserver, safekeepers and
|
||||
// compute nodes).
|
||||
//
|
||||
// This is not stored in the config file. Rather, this is the path where the
|
||||
// config file itself is. It is read from the ZENITH_REPO_DIR env variable or
|
||||
// '.zenith' if not given.
|
||||
#[serde(skip)]
|
||||
pub base_data_dir: PathBuf,
|
||||
|
||||
// Path to postgres distribution. It's expected that "bin", "include",
|
||||
// "lib", "share" from postgres distribution are there. If at some point
|
||||
// in time we will be able to run against vanilla postgres we may split that
|
||||
// to four separate paths and match OS-specific installation layout.
|
||||
#[serde(default)]
|
||||
pub pg_distrib_dir: PathBuf,
|
||||
|
||||
// Path to pageserver binary. Empty for remote pageserver.
|
||||
pub zenith_distrib_dir: Option<PathBuf>,
|
||||
// Path to pageserver binary.
|
||||
#[serde(default)]
|
||||
pub zenith_distrib_dir: PathBuf,
|
||||
|
||||
pub remotes: Remotes,
|
||||
// Default tenant ID to use with the 'zenith' command line utility, when
|
||||
// --tenantid is not explicitly specified.
|
||||
#[serde(default)]
|
||||
pub default_tenantid: Option<HexZTenantId>,
|
||||
|
||||
// used to issue tokens during e.g pg start
|
||||
#[serde(default)]
|
||||
pub private_key_path: PathBuf,
|
||||
|
||||
pub pageserver: PageServerConf,
|
||||
|
||||
#[serde(default)]
|
||||
pub safekeepers: Vec<SafekeeperConf>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize, Clone, Debug)]
|
||||
#[serde(default)]
|
||||
pub struct PageServerConf {
|
||||
// node id
|
||||
pub id: ZNodeId,
|
||||
// Pageserver connection settings
|
||||
pub listen_pg_addr: String,
|
||||
pub listen_http_addr: String,
|
||||
|
||||
// used to determine which auth type is used
|
||||
pub auth_type: AuthType,
|
||||
|
||||
// jwt auth token used for communication with pageserver
|
||||
pub auth_token: String,
|
||||
}
|
||||
|
||||
impl Default for PageServerConf {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
id: ZNodeId(0),
|
||||
listen_pg_addr: String::new(),
|
||||
listen_http_addr: String::new(),
|
||||
auth_type: AuthType::Trust,
|
||||
auth_token: String::new(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize, Clone, Debug)]
|
||||
#[serde(default)]
|
||||
pub struct SafekeeperConf {
|
||||
pub id: ZNodeId,
|
||||
pub pg_port: u16,
|
||||
pub http_port: u16,
|
||||
pub sync: bool,
|
||||
}
|
||||
|
||||
impl Default for SafekeeperConf {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
id: ZNodeId(0),
|
||||
pg_port: 0,
|
||||
http_port: 0,
|
||||
sync: true,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl LocalEnv {
|
||||
@@ -45,26 +117,212 @@ impl LocalEnv {
|
||||
self.pg_distrib_dir.join("lib")
|
||||
}
|
||||
|
||||
pub fn pageserver_bin(&self) -> Result<PathBuf> {
|
||||
Ok(self
|
||||
.zenith_distrib_dir
|
||||
.as_ref()
|
||||
.ok_or_else(|| anyhow!("Can not manage remote pageserver"))?
|
||||
.join("pageserver"))
|
||||
pub fn pageserver_bin(&self) -> anyhow::Result<PathBuf> {
|
||||
Ok(self.zenith_distrib_dir.join("pageserver"))
|
||||
}
|
||||
|
||||
pub fn safekeeper_bin(&self) -> anyhow::Result<PathBuf> {
|
||||
Ok(self.zenith_distrib_dir.join("safekeeper"))
|
||||
}
|
||||
|
||||
pub fn pg_data_dirs_path(&self) -> PathBuf {
|
||||
self.base_data_dir.join("pgdatadirs")
|
||||
self.base_data_dir.join("pgdatadirs").join("tenants")
|
||||
}
|
||||
|
||||
pub fn pg_data_dir(&self, name: &str) -> PathBuf {
|
||||
self.pg_data_dirs_path().join(name)
|
||||
pub fn pg_data_dir(&self, tenantid: &ZTenantId, branch_name: &str) -> PathBuf {
|
||||
self.pg_data_dirs_path()
|
||||
.join(tenantid.to_string())
|
||||
.join(branch_name)
|
||||
}
|
||||
|
||||
// TODO: move pageserver files into ./pageserver
|
||||
pub fn pageserver_data_dir(&self) -> PathBuf {
|
||||
self.base_data_dir.clone()
|
||||
}
|
||||
|
||||
pub fn safekeeper_data_dir(&self, data_dir_name: &str) -> PathBuf {
|
||||
self.base_data_dir.join("safekeepers").join(data_dir_name)
|
||||
}
|
||||
|
||||
/// Create a LocalEnv from a config file.
|
||||
///
|
||||
/// Unlike 'load_config', this function fills in any defaults that are missing
|
||||
/// from the config file.
|
||||
pub fn create_config(toml: &str) -> anyhow::Result<Self> {
|
||||
let mut env: LocalEnv = toml::from_str(toml)?;
|
||||
|
||||
// Find postgres binaries.
|
||||
// Follow POSTGRES_DISTRIB_DIR if set, otherwise look in "tmp_install".
|
||||
if env.pg_distrib_dir == Path::new("") {
|
||||
if let Some(postgres_bin) = env::var_os("POSTGRES_DISTRIB_DIR") {
|
||||
env.pg_distrib_dir = postgres_bin.into();
|
||||
} else {
|
||||
let cwd = env::current_dir()?;
|
||||
env.pg_distrib_dir = cwd.join("tmp_install")
|
||||
}
|
||||
}
|
||||
if !env.pg_distrib_dir.join("bin/postgres").exists() {
|
||||
bail!(
|
||||
"Can't find postgres binary at {}",
|
||||
env.pg_distrib_dir.display()
|
||||
);
|
||||
}
|
||||
|
||||
// Find zenith binaries.
|
||||
if env.zenith_distrib_dir == Path::new("") {
|
||||
env.zenith_distrib_dir = env::current_exe()?.parent().unwrap().to_owned();
|
||||
}
|
||||
for binary in ["pageserver", "safekeeper"] {
|
||||
if !env.zenith_distrib_dir.join(binary).exists() {
|
||||
bail!(
|
||||
"Can't find binary '{}' in zenith distrib dir '{}'",
|
||||
binary,
|
||||
env.zenith_distrib_dir.display()
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
// If no initial tenant ID was given, generate it.
|
||||
if env.default_tenantid.is_none() {
|
||||
env.default_tenantid = Some(HexZTenantId::from(ZTenantId::generate()));
|
||||
}
|
||||
|
||||
env.base_data_dir = base_path();
|
||||
|
||||
Ok(env)
|
||||
}
|
||||
|
||||
/// Locate and load config
|
||||
pub fn load_config() -> anyhow::Result<Self> {
|
||||
let repopath = base_path();
|
||||
|
||||
if !repopath.exists() {
|
||||
bail!(
|
||||
"Zenith config is not found in {}. You need to run 'zenith init' first",
|
||||
repopath.to_str().unwrap()
|
||||
);
|
||||
}
|
||||
|
||||
// TODO: check that it looks like a zenith repository
|
||||
|
||||
// load and parse file
|
||||
let config = fs::read_to_string(repopath.join("config"))?;
|
||||
let mut env: LocalEnv = toml::from_str(config.as_str())?;
|
||||
|
||||
env.base_data_dir = repopath;
|
||||
|
||||
Ok(env)
|
||||
}
|
||||
|
||||
// this function is used only for testing purposes in CLI e g generate tokens during init
|
||||
pub fn generate_auth_token(&self, claims: &Claims) -> anyhow::Result<String> {
|
||||
let private_key_path = if self.private_key_path.is_absolute() {
|
||||
self.private_key_path.to_path_buf()
|
||||
} else {
|
||||
self.base_data_dir.join(&self.private_key_path)
|
||||
};
|
||||
|
||||
let key_data = fs::read(private_key_path)?;
|
||||
encode_from_key_file(claims, &key_data)
|
||||
}
|
||||
|
||||
//
|
||||
// Initialize a new Zenith repository
|
||||
//
|
||||
pub fn init(&mut self) -> anyhow::Result<()> {
|
||||
// check if config already exists
|
||||
let base_path = &self.base_data_dir;
|
||||
if base_path == Path::new("") {
|
||||
bail!("repository base path is missing");
|
||||
}
|
||||
if base_path.exists() {
|
||||
bail!(
|
||||
"directory '{}' already exists. Perhaps already initialized?",
|
||||
base_path.to_str().unwrap()
|
||||
);
|
||||
}
|
||||
|
||||
fs::create_dir(&base_path)?;
|
||||
|
||||
// generate keys for jwt
|
||||
// openssl genrsa -out private_key.pem 2048
|
||||
let private_key_path;
|
||||
if self.private_key_path == PathBuf::new() {
|
||||
private_key_path = base_path.join("auth_private_key.pem");
|
||||
let keygen_output = Command::new("openssl")
|
||||
.arg("genrsa")
|
||||
.args(&["-out", private_key_path.to_str().unwrap()])
|
||||
.arg("2048")
|
||||
.stdout(Stdio::null())
|
||||
.output()
|
||||
.context("failed to generate auth private key")?;
|
||||
if !keygen_output.status.success() {
|
||||
bail!(
|
||||
"openssl failed: '{}'",
|
||||
String::from_utf8_lossy(&keygen_output.stderr)
|
||||
);
|
||||
}
|
||||
self.private_key_path = PathBuf::from("auth_private_key.pem");
|
||||
|
||||
let public_key_path = base_path.join("auth_public_key.pem");
|
||||
// openssl rsa -in private_key.pem -pubout -outform PEM -out public_key.pem
|
||||
let keygen_output = Command::new("openssl")
|
||||
.arg("rsa")
|
||||
.args(&["-in", private_key_path.to_str().unwrap()])
|
||||
.arg("-pubout")
|
||||
.args(&["-outform", "PEM"])
|
||||
.args(&["-out", public_key_path.to_str().unwrap()])
|
||||
.stdout(Stdio::null())
|
||||
.output()
|
||||
.context("failed to generate auth private key")?;
|
||||
if !keygen_output.status.success() {
|
||||
bail!(
|
||||
"openssl failed: '{}'",
|
||||
String::from_utf8_lossy(&keygen_output.stderr)
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
self.pageserver.auth_token =
|
||||
self.generate_auth_token(&Claims::new(None, Scope::PageServerApi))?;
|
||||
|
||||
fs::create_dir_all(self.pg_data_dirs_path())?;
|
||||
|
||||
for safekeeper in &self.safekeepers {
|
||||
fs::create_dir_all(SafekeeperNode::datadir_path_by_id(self, safekeeper.id))?;
|
||||
}
|
||||
|
||||
let mut conf_content = String::new();
|
||||
|
||||
// Currently, the user first passes a config file with 'zenith init --config=<path>'
|
||||
// We read that in, in `create_config`, and fill any missing defaults. Then it's saved
|
||||
// to .zenith/config. TODO: We lose any formatting and comments along the way, which is
|
||||
// a bit sad.
|
||||
write!(
|
||||
&mut conf_content,
|
||||
r#"# This file describes a locale deployment of the page server
|
||||
# and safekeeeper node. It is read by the 'zenith' command-line
|
||||
# utility.
|
||||
"#
|
||||
)?;
|
||||
|
||||
// Convert the LocalEnv to a toml file.
|
||||
//
|
||||
// This could be as simple as this:
|
||||
//
|
||||
// conf_content += &toml::to_string_pretty(env)?;
|
||||
//
|
||||
// But it results in a "values must be emitted before tables". I'm not sure
|
||||
// why, AFAICS the table, i.e. 'safekeepers: Vec<SafekeeperConf>' is last.
|
||||
// Maybe rust reorders the fields to squeeze avoid padding or something?
|
||||
// In any case, converting to toml::Value first, and serializing that, works.
|
||||
// See https://github.com/alexcrichton/toml-rs/issues/142
|
||||
conf_content += &toml::to_string_pretty(&toml::Value::try_from(&self)?)?;
|
||||
|
||||
fs::write(base_path.join("config"), conf_content)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
fn base_path() -> PathBuf {
|
||||
@@ -73,94 +331,3 @@ fn base_path() -> PathBuf {
|
||||
None => ".zenith".into(),
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Initialize a new Zenith repository
|
||||
//
|
||||
pub fn init(remote_pageserver: Option<&str>) -> Result<()> {
|
||||
// check if config already exists
|
||||
let base_path = base_path();
|
||||
if base_path.exists() {
|
||||
anyhow::bail!(
|
||||
"{} already exists. Perhaps already initialized?",
|
||||
base_path.to_str().unwrap()
|
||||
);
|
||||
}
|
||||
|
||||
// ok, now check that expected binaries are present
|
||||
|
||||
// Find postgres binaries. Follow POSTGRES_DISTRIB_DIR if set, otherwise look in "tmp_install".
|
||||
let pg_distrib_dir: PathBuf = {
|
||||
if let Some(postgres_bin) = env::var_os("POSTGRES_DISTRIB_DIR") {
|
||||
postgres_bin.into()
|
||||
} else {
|
||||
let cwd = env::current_dir()?;
|
||||
cwd.join("tmp_install")
|
||||
}
|
||||
};
|
||||
if !pg_distrib_dir.join("bin/postgres").exists() {
|
||||
anyhow::bail!("Can't find postgres binary at {:?}", pg_distrib_dir);
|
||||
}
|
||||
|
||||
fs::create_dir(&base_path)?;
|
||||
fs::create_dir(base_path.join("pgdatadirs"))?;
|
||||
|
||||
let conf = if let Some(addr) = remote_pageserver {
|
||||
// check that addr is parsable
|
||||
let _uri = Url::parse(addr).map_err(|e| anyhow!("{}: {}", addr, e))?;
|
||||
|
||||
LocalEnv {
|
||||
pageserver_connstring: format!("postgresql://{}/", addr),
|
||||
pg_distrib_dir,
|
||||
zenith_distrib_dir: None,
|
||||
base_data_dir: base_path,
|
||||
remotes: BTreeMap::default(),
|
||||
}
|
||||
} else {
|
||||
// Find zenith binaries.
|
||||
let zenith_distrib_dir = env::current_exe()?.parent().unwrap().to_owned();
|
||||
if !zenith_distrib_dir.join("pageserver").exists() {
|
||||
anyhow::bail!("Can't find pageserver binary.",);
|
||||
}
|
||||
|
||||
LocalEnv {
|
||||
pageserver_connstring: "postgresql://127.0.0.1:6400".to_string(),
|
||||
pg_distrib_dir,
|
||||
zenith_distrib_dir: Some(zenith_distrib_dir),
|
||||
base_data_dir: base_path,
|
||||
remotes: BTreeMap::default(),
|
||||
}
|
||||
};
|
||||
|
||||
let toml = toml::to_string_pretty(&conf)?;
|
||||
fs::write(conf.base_data_dir.join("config"), toml)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// Locate and load config
|
||||
pub fn load_config() -> Result<LocalEnv> {
|
||||
let repopath = base_path();
|
||||
|
||||
if !repopath.exists() {
|
||||
anyhow::bail!(
|
||||
"Zenith config is not found in {}. You need to run 'zenith init' first",
|
||||
repopath.to_str().unwrap()
|
||||
);
|
||||
}
|
||||
|
||||
// TODO: check that it looks like a zenith repository
|
||||
|
||||
// load and parse file
|
||||
let config = fs::read_to_string(repopath.join("config"))?;
|
||||
toml::from_str(config.as_str()).map_err(|e| e.into())
|
||||
}
|
||||
|
||||
// Save config. We use that to change set of remotes from CLI itself.
|
||||
pub fn save_config(conf: &LocalEnv) -> Result<()> {
|
||||
let config_path = base_path().join("config");
|
||||
let conf_str = toml::to_string_pretty(conf)?;
|
||||
|
||||
fs::write(config_path, conf_str)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
228
control_plane/src/postgresql_conf.rs
Normal file
228
control_plane/src/postgresql_conf.rs
Normal file
@@ -0,0 +1,228 @@
|
||||
///
|
||||
/// Module for parsing postgresql.conf file.
|
||||
///
|
||||
/// NOTE: This doesn't implement the full, correct postgresql.conf syntax. Just
|
||||
/// enough to extract a few settings we need in Zenith, assuming you don't do
|
||||
/// funny stuff like include-directives or funny escaping.
|
||||
use anyhow::{bail, Context, Result};
|
||||
use lazy_static::lazy_static;
|
||||
use regex::Regex;
|
||||
use std::collections::HashMap;
|
||||
use std::fmt;
|
||||
use std::io::BufRead;
|
||||
use std::str::FromStr;
|
||||
|
||||
/// In-memory representation of a postgresql.conf file
|
||||
#[derive(Default)]
|
||||
pub struct PostgresConf {
|
||||
lines: Vec<String>,
|
||||
hash: HashMap<String, String>,
|
||||
}
|
||||
|
||||
lazy_static! {
|
||||
static ref CONF_LINE_RE: Regex = Regex::new(r"^((?:\w|\.)+)\s*=\s*(\S+)$").unwrap();
|
||||
}
|
||||
|
||||
impl PostgresConf {
|
||||
pub fn new() -> PostgresConf {
|
||||
PostgresConf::default()
|
||||
}
|
||||
|
||||
/// Read file into memory
|
||||
pub fn read(read: impl std::io::Read) -> Result<PostgresConf> {
|
||||
let mut result = Self::new();
|
||||
|
||||
for line in std::io::BufReader::new(read).lines() {
|
||||
let line = line?;
|
||||
|
||||
// Store each line in a vector, in original format
|
||||
result.lines.push(line.clone());
|
||||
|
||||
// Also parse each line and insert key=value lines into a hash map.
|
||||
//
|
||||
// FIXME: This doesn't match exactly the flex/bison grammar in PostgreSQL.
|
||||
// But it's close enough for our usage.
|
||||
let line = line.trim();
|
||||
if line.starts_with('#') {
|
||||
// comment, ignore
|
||||
continue;
|
||||
} else if let Some(caps) = CONF_LINE_RE.captures(line) {
|
||||
let name = caps.get(1).unwrap().as_str();
|
||||
let raw_val = caps.get(2).unwrap().as_str();
|
||||
|
||||
if let Ok(val) = deescape_str(raw_val) {
|
||||
// Note: if there's already an entry in the hash map for
|
||||
// this key, this will replace it. That's the behavior what
|
||||
// we want; when PostgreSQL reads the file, each line
|
||||
// overrides any previous value for the same setting.
|
||||
result.hash.insert(name.to_string(), val.to_string());
|
||||
}
|
||||
}
|
||||
}
|
||||
Ok(result)
|
||||
}
|
||||
|
||||
/// Return the current value of 'option'
|
||||
pub fn get(&self, option: &str) -> Option<&str> {
|
||||
self.hash.get(option).map(|x| x.as_ref())
|
||||
}
|
||||
|
||||
/// Return the current value of a field, parsed to the right datatype.
|
||||
///
|
||||
/// This calls the FromStr::parse() function on the value of the field. If
|
||||
/// the field does not exist, or parsing fails, returns an error.
|
||||
///
|
||||
pub fn parse_field<T>(&self, field_name: &str, context: &str) -> Result<T>
|
||||
where
|
||||
T: FromStr,
|
||||
<T as FromStr>::Err: std::error::Error + Send + Sync + 'static,
|
||||
{
|
||||
self.get(field_name)
|
||||
.with_context(|| format!("could not find '{}' option {}", field_name, context))?
|
||||
.parse::<T>()
|
||||
.with_context(|| format!("could not parse '{}' option {}", field_name, context))
|
||||
}
|
||||
|
||||
pub fn parse_field_optional<T>(&self, field_name: &str, context: &str) -> Result<Option<T>>
|
||||
where
|
||||
T: FromStr,
|
||||
<T as FromStr>::Err: std::error::Error + Send + Sync + 'static,
|
||||
{
|
||||
if let Some(val) = self.get(field_name) {
|
||||
let result = val
|
||||
.parse::<T>()
|
||||
.with_context(|| format!("could not parse '{}' option {}", field_name, context))?;
|
||||
|
||||
Ok(Some(result))
|
||||
} else {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Note: if you call this multiple times for the same option, the config
|
||||
/// file will a line for each call. It would be nice to have a function
|
||||
/// to change an existing line, but that's a TODO.
|
||||
///
|
||||
pub fn append(&mut self, option: &str, value: &str) {
|
||||
self.lines
|
||||
.push(format!("{}={}\n", option, escape_str(value)));
|
||||
self.hash.insert(option.to_string(), value.to_string());
|
||||
}
|
||||
|
||||
/// Append an arbitrary non-setting line to the config file
|
||||
pub fn append_line(&mut self, line: &str) {
|
||||
self.lines.push(line.to_string());
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for PostgresConf {
|
||||
/// Return the whole configuration file as a string
|
||||
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
|
||||
for line in self.lines.iter() {
|
||||
f.write_str(line)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// Escape a value for putting in postgresql.conf.
|
||||
fn escape_str(s: &str) -> String {
|
||||
// If the string doesn't contain anything that needs quoting or escaping, return it
|
||||
// as it is.
|
||||
//
|
||||
// The first part of the regex, before the '|', matches the INTEGER rule in the
|
||||
// PostgreSQL flex grammar (guc-file.l). It matches plain integers like "123" and
|
||||
// "-123", and also accepts units like "10MB". The second part of the regex matches
|
||||
// the UNQUOTED_STRING rule, and accepts strings that contain a single word, beginning
|
||||
// with a letter. That covers words like "off" or "posix". Everything else is quoted.
|
||||
//
|
||||
// This regex is a bit more conservative than the rules in guc-file.l, so we quote some
|
||||
// strings that PostgreSQL would accept without quoting, but that's OK.
|
||||
lazy_static! {
|
||||
static ref UNQUOTED_RE: Regex =
|
||||
Regex::new(r"(^[-+]?[0-9]+[a-zA-Z]*$)|(^[a-zA-Z][a-zA-Z0-9]*$)").unwrap();
|
||||
}
|
||||
if UNQUOTED_RE.is_match(s) {
|
||||
s.to_string()
|
||||
} else {
|
||||
// Otherwise escape and quote it
|
||||
let s = s
|
||||
.replace('\\', "\\\\")
|
||||
.replace('\n', "\\n")
|
||||
.replace('\'', "''");
|
||||
|
||||
"\'".to_owned() + &s + "\'"
|
||||
}
|
||||
}
|
||||
|
||||
/// De-escape a possibly-quoted value.
|
||||
///
|
||||
/// See `DeescapeQuotedString` function in PostgreSQL sources for how PostgreSQL
|
||||
/// does this.
|
||||
fn deescape_str(s: &str) -> Result<String> {
|
||||
// If the string has a quote at the beginning and end, strip them out.
|
||||
if s.len() >= 2 && s.starts_with('\'') && s.ends_with('\'') {
|
||||
let mut result = String::new();
|
||||
|
||||
let mut iter = s[1..(s.len() - 1)].chars().peekable();
|
||||
while let Some(c) = iter.next() {
|
||||
let newc = if c == '\\' {
|
||||
match iter.next() {
|
||||
Some('b') => '\x08',
|
||||
Some('f') => '\x0c',
|
||||
Some('n') => '\n',
|
||||
Some('r') => '\r',
|
||||
Some('t') => '\t',
|
||||
Some('0'..='7') => {
|
||||
// TODO
|
||||
bail!("octal escapes not supported");
|
||||
}
|
||||
Some(n) => n,
|
||||
None => break,
|
||||
}
|
||||
} else if c == '\'' && iter.peek() == Some(&'\'') {
|
||||
// doubled quote becomes just one quote
|
||||
iter.next().unwrap()
|
||||
} else {
|
||||
c
|
||||
};
|
||||
|
||||
result.push(newc);
|
||||
}
|
||||
Ok(result)
|
||||
} else {
|
||||
Ok(s.to_string())
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_postgresql_conf_escapes() -> Result<()> {
|
||||
assert_eq!(escape_str("foo bar"), "'foo bar'");
|
||||
// these don't need to be quoted
|
||||
assert_eq!(escape_str("foo"), "foo");
|
||||
assert_eq!(escape_str("123"), "123");
|
||||
assert_eq!(escape_str("+123"), "+123");
|
||||
assert_eq!(escape_str("-10"), "-10");
|
||||
assert_eq!(escape_str("1foo"), "1foo");
|
||||
assert_eq!(escape_str("foo1"), "foo1");
|
||||
assert_eq!(escape_str("10MB"), "10MB");
|
||||
assert_eq!(escape_str("-10kB"), "-10kB");
|
||||
|
||||
// these need quoting and/or escaping
|
||||
assert_eq!(escape_str("foo bar"), "'foo bar'");
|
||||
assert_eq!(escape_str("fo'o"), "'fo''o'");
|
||||
assert_eq!(escape_str("fo\no"), "'fo\\no'");
|
||||
assert_eq!(escape_str("fo\\o"), "'fo\\\\o'");
|
||||
assert_eq!(escape_str("10 cats"), "'10 cats'");
|
||||
|
||||
// Test de-escaping
|
||||
assert_eq!(deescape_str(&escape_str("foo"))?, "foo");
|
||||
assert_eq!(deescape_str(&escape_str("fo'o\nba\\r"))?, "fo'o\nba\\r");
|
||||
assert_eq!(deescape_str("'\\b\\f\\n\\r\\t'")?, "\x08\x0c\n\r\t");
|
||||
|
||||
// octal-escapes are currently not supported
|
||||
assert!(deescape_str("'foo\\7\\07\\007'").is_err());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
264
control_plane/src/safekeeper.rs
Normal file
264
control_plane/src/safekeeper.rs
Normal file
@@ -0,0 +1,264 @@
|
||||
use std::io::Write;
|
||||
use std::net::TcpStream;
|
||||
use std::path::PathBuf;
|
||||
use std::process::Command;
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
use std::{io, result, thread};
|
||||
|
||||
use anyhow::bail;
|
||||
use nix::errno::Errno;
|
||||
use nix::sys::signal::{kill, Signal};
|
||||
use nix::unistd::Pid;
|
||||
use postgres::Config;
|
||||
use reqwest::blocking::{Client, RequestBuilder, Response};
|
||||
use reqwest::{IntoUrl, Method};
|
||||
use thiserror::Error;
|
||||
use zenith_utils::http::error::HttpErrorBody;
|
||||
use zenith_utils::zid::ZNodeId;
|
||||
|
||||
use crate::local_env::{LocalEnv, SafekeeperConf};
|
||||
use crate::storage::PageServerNode;
|
||||
use crate::{fill_rust_env_vars, read_pidfile};
|
||||
use zenith_utils::connstring::connection_address;
|
||||
|
||||
#[derive(Error, Debug)]
|
||||
pub enum SafekeeperHttpError {
|
||||
#[error("Reqwest error: {0}")]
|
||||
Transport(#[from] reqwest::Error),
|
||||
|
||||
#[error("Error: {0}")]
|
||||
Response(String),
|
||||
}
|
||||
|
||||
type Result<T> = result::Result<T, SafekeeperHttpError>;
|
||||
|
||||
pub trait ResponseErrorMessageExt: Sized {
|
||||
fn error_from_body(self) -> Result<Self>;
|
||||
}
|
||||
|
||||
impl ResponseErrorMessageExt for Response {
|
||||
fn error_from_body(self) -> Result<Self> {
|
||||
let status = self.status();
|
||||
if !(status.is_client_error() || status.is_server_error()) {
|
||||
return Ok(self);
|
||||
}
|
||||
|
||||
// reqwest do not export it's error construction utility functions, so lets craft the message ourselves
|
||||
let url = self.url().to_owned();
|
||||
Err(SafekeeperHttpError::Response(
|
||||
match self.json::<HttpErrorBody>() {
|
||||
Ok(err_body) => format!("Error: {}", err_body.msg),
|
||||
Err(_) => format!("Http error ({}) at {}.", status.as_u16(), url),
|
||||
},
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Control routines for safekeeper.
|
||||
//
|
||||
// Used in CLI and tests.
|
||||
//
|
||||
#[derive(Debug)]
|
||||
pub struct SafekeeperNode {
|
||||
pub id: ZNodeId,
|
||||
|
||||
pub conf: SafekeeperConf,
|
||||
|
||||
pub pg_connection_config: Config,
|
||||
pub env: LocalEnv,
|
||||
pub http_client: Client,
|
||||
pub http_base_url: String,
|
||||
|
||||
pub pageserver: Arc<PageServerNode>,
|
||||
}
|
||||
|
||||
impl SafekeeperNode {
|
||||
pub fn from_env(env: &LocalEnv, conf: &SafekeeperConf) -> SafekeeperNode {
|
||||
let pageserver = Arc::new(PageServerNode::from_env(env));
|
||||
|
||||
println!("initializing for sk {} for {}", conf.id, conf.http_port);
|
||||
|
||||
SafekeeperNode {
|
||||
id: conf.id,
|
||||
conf: conf.clone(),
|
||||
pg_connection_config: Self::safekeeper_connection_config(conf.pg_port),
|
||||
env: env.clone(),
|
||||
http_client: Client::new(),
|
||||
http_base_url: format!("http://127.0.0.1:{}/v1", conf.http_port),
|
||||
pageserver,
|
||||
}
|
||||
}
|
||||
|
||||
/// Construct libpq connection string for connecting to this safekeeper.
|
||||
fn safekeeper_connection_config(port: u16) -> Config {
|
||||
// TODO safekeeper authentication not implemented yet
|
||||
format!("postgresql://no_user@127.0.0.1:{}/no_db", port)
|
||||
.parse()
|
||||
.unwrap()
|
||||
}
|
||||
|
||||
pub fn datadir_path_by_id(env: &LocalEnv, sk_id: ZNodeId) -> PathBuf {
|
||||
env.safekeeper_data_dir(format!("sk{}", sk_id).as_ref())
|
||||
}
|
||||
|
||||
pub fn datadir_path(&self) -> PathBuf {
|
||||
SafekeeperNode::datadir_path_by_id(&self.env, self.id)
|
||||
}
|
||||
|
||||
pub fn pid_file(&self) -> PathBuf {
|
||||
self.datadir_path().join("safekeeper.pid")
|
||||
}
|
||||
|
||||
pub fn start(&self) -> anyhow::Result<()> {
|
||||
print!(
|
||||
"Starting safekeeper at '{}' in '{}'",
|
||||
connection_address(&self.pg_connection_config),
|
||||
self.datadir_path().display()
|
||||
);
|
||||
io::stdout().flush().unwrap();
|
||||
|
||||
let listen_pg = format!("127.0.0.1:{}", self.conf.pg_port);
|
||||
let listen_http = format!("127.0.0.1:{}", self.conf.http_port);
|
||||
|
||||
let mut cmd = Command::new(self.env.safekeeper_bin()?);
|
||||
fill_rust_env_vars(
|
||||
cmd.args(&["-D", self.datadir_path().to_str().unwrap()])
|
||||
.args(&["--id", self.id.to_string().as_ref()])
|
||||
.args(&["--listen-pg", &listen_pg])
|
||||
.args(&["--listen-http", &listen_http])
|
||||
.args(&["--recall", "1 second"])
|
||||
.arg("--daemonize"),
|
||||
);
|
||||
if !self.conf.sync {
|
||||
cmd.arg("--no-sync");
|
||||
}
|
||||
|
||||
if !cmd.status()?.success() {
|
||||
bail!(
|
||||
"Safekeeper failed to start. See '{}' for details.",
|
||||
self.datadir_path().join("safekeeper.log").display()
|
||||
);
|
||||
}
|
||||
|
||||
// It takes a while for the safekeeper to start up. Wait until it is
|
||||
// open for business.
|
||||
const RETRIES: i8 = 15;
|
||||
for retries in 1..RETRIES {
|
||||
match self.check_status() {
|
||||
Ok(_) => {
|
||||
println!("\nSafekeeper started");
|
||||
return Ok(());
|
||||
}
|
||||
Err(err) => {
|
||||
match err {
|
||||
SafekeeperHttpError::Transport(err) => {
|
||||
if err.is_connect() && retries < 5 {
|
||||
print!(".");
|
||||
io::stdout().flush().unwrap();
|
||||
} else {
|
||||
if retries == 5 {
|
||||
println!() // put a line break after dots for second message
|
||||
}
|
||||
println!(
|
||||
"Safekeeper not responding yet, err {} retrying ({})...",
|
||||
err, retries
|
||||
);
|
||||
}
|
||||
}
|
||||
SafekeeperHttpError::Response(msg) => {
|
||||
bail!("safekeeper failed to start: {} ", msg)
|
||||
}
|
||||
}
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
}
|
||||
}
|
||||
bail!("safekeeper failed to start in {} seconds", RETRIES);
|
||||
}
|
||||
|
||||
///
|
||||
/// Stop the server.
|
||||
///
|
||||
/// If 'immediate' is true, we use SIGQUIT, killing the process immediately.
|
||||
/// Otherwise we use SIGTERM, triggering a clean shutdown
|
||||
///
|
||||
/// If the server is not running, returns success
|
||||
///
|
||||
pub fn stop(&self, immediate: bool) -> anyhow::Result<()> {
|
||||
let pid_file = self.pid_file();
|
||||
if !pid_file.exists() {
|
||||
println!("Safekeeper {} is already stopped", self.id);
|
||||
return Ok(());
|
||||
}
|
||||
let pid = read_pidfile(&pid_file)?;
|
||||
let pid = Pid::from_raw(pid);
|
||||
|
||||
let sig = if immediate {
|
||||
println!("Stop safekeeper immediately");
|
||||
Signal::SIGQUIT
|
||||
} else {
|
||||
println!("Stop safekeeper gracefully");
|
||||
Signal::SIGTERM
|
||||
};
|
||||
match kill(pid, sig) {
|
||||
Ok(_) => (),
|
||||
Err(Errno::ESRCH) => {
|
||||
println!(
|
||||
"Safekeeper with pid {} does not exist, but a PID file was found",
|
||||
pid
|
||||
);
|
||||
return Ok(());
|
||||
}
|
||||
Err(err) => bail!(
|
||||
"Failed to send signal to safekeeper with pid {}: {}",
|
||||
pid,
|
||||
err.desc()
|
||||
),
|
||||
}
|
||||
|
||||
let address = connection_address(&self.pg_connection_config);
|
||||
|
||||
// TODO Remove this "timeout" and handle it on caller side instead.
|
||||
// Shutting down may take a long time,
|
||||
// if safekeeper flushes a lot of data
|
||||
for _ in 0..100 {
|
||||
if let Err(_e) = TcpStream::connect(&address) {
|
||||
println!("Safekeeper stopped receiving connections");
|
||||
|
||||
//Now check status
|
||||
match self.check_status() {
|
||||
Ok(_) => {
|
||||
println!("Safekeeper status is OK. Wait a bit.");
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
Err(err) => {
|
||||
println!("Safekeeper status is: {}", err);
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
} else {
|
||||
println!("Safekeeper still receives connections");
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
}
|
||||
|
||||
bail!("Failed to stop safekeeper with pid {}", pid);
|
||||
}
|
||||
|
||||
fn http_request<U: IntoUrl>(&self, method: Method, url: U) -> RequestBuilder {
|
||||
// TODO: authentication
|
||||
//if self.env.auth_type == AuthType::ZenithJWT {
|
||||
// builder = builder.bearer_auth(&self.env.safekeeper_auth_token)
|
||||
//}
|
||||
self.http_client.request(method, url)
|
||||
}
|
||||
|
||||
pub fn check_status(&self) -> Result<()> {
|
||||
self.http_request(Method::GET, format!("{}/{}", self.http_base_url, "status"))
|
||||
.send()?
|
||||
.error_from_body()?;
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
@@ -1,71 +1,155 @@
|
||||
use std::collections::HashMap;
|
||||
use std::net::{TcpStream};
|
||||
use std::io::Write;
|
||||
use std::net::TcpStream;
|
||||
use std::path::PathBuf;
|
||||
use std::process::Command;
|
||||
use std::thread;
|
||||
use std::time::Duration;
|
||||
use std::{io, result, thread};
|
||||
|
||||
use anyhow::{anyhow, bail, Result};
|
||||
use anyhow::bail;
|
||||
use nix::errno::Errno;
|
||||
use nix::sys::signal::{kill, Signal};
|
||||
use nix::unistd::Pid;
|
||||
use pageserver::http::models::{BranchCreateRequest, TenantCreateRequest};
|
||||
use postgres::{Config, NoTls};
|
||||
use reqwest::blocking::{Client, RequestBuilder, Response};
|
||||
use reqwest::{IntoUrl, Method};
|
||||
use thiserror::Error;
|
||||
use zenith_utils::http::error::HttpErrorBody;
|
||||
use zenith_utils::postgres_backend::AuthType;
|
||||
use zenith_utils::zid::ZTenantId;
|
||||
|
||||
use crate::local_env::LocalEnv;
|
||||
use crate::read_pidfile;
|
||||
use zenith_utils::connstring::connection_address;
|
||||
use crate::{fill_rust_env_vars, read_pidfile};
|
||||
use pageserver::branches::BranchInfo;
|
||||
use pageserver::tenant_mgr::TenantInfo;
|
||||
use zenith_utils::connstring::connection_address;
|
||||
|
||||
#[derive(Error, Debug)]
|
||||
pub enum PageserverHttpError {
|
||||
#[error("Reqwest error: {0}")]
|
||||
Transport(#[from] reqwest::Error),
|
||||
|
||||
#[error("Error: {0}")]
|
||||
Response(String),
|
||||
}
|
||||
|
||||
type Result<T> = result::Result<T, PageserverHttpError>;
|
||||
|
||||
pub trait ResponseErrorMessageExt: Sized {
|
||||
fn error_from_body(self) -> Result<Self>;
|
||||
}
|
||||
|
||||
impl ResponseErrorMessageExt for Response {
|
||||
fn error_from_body(self) -> Result<Self> {
|
||||
let status = self.status();
|
||||
if !(status.is_client_error() || status.is_server_error()) {
|
||||
return Ok(self);
|
||||
}
|
||||
|
||||
// reqwest do not export it's error construction utility functions, so lets craft the message ourselves
|
||||
let url = self.url().to_owned();
|
||||
Err(PageserverHttpError::Response(
|
||||
match self.json::<HttpErrorBody>() {
|
||||
Ok(err_body) => format!("Error: {}", err_body.msg),
|
||||
Err(_) => format!("Http error ({}) at {}.", status.as_u16(), url),
|
||||
},
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Control routines for pageserver.
|
||||
//
|
||||
// Used in CLI and tests.
|
||||
//
|
||||
#[derive(Debug)]
|
||||
pub struct PageServerNode {
|
||||
pub kill_on_exit: bool,
|
||||
pub connection_config: Option<Config>,
|
||||
pub pg_connection_config: Config,
|
||||
pub env: LocalEnv,
|
||||
pub http_client: Client,
|
||||
pub http_base_url: String,
|
||||
}
|
||||
|
||||
impl PageServerNode {
|
||||
pub fn from_env(env: &LocalEnv) -> PageServerNode {
|
||||
PageServerNode {
|
||||
kill_on_exit: false,
|
||||
connection_config: None, // default
|
||||
let password = if env.pageserver.auth_type == AuthType::ZenithJWT {
|
||||
&env.pageserver.auth_token
|
||||
} else {
|
||||
""
|
||||
};
|
||||
|
||||
Self {
|
||||
pg_connection_config: Self::pageserver_connection_config(
|
||||
password,
|
||||
&env.pageserver.listen_pg_addr,
|
||||
),
|
||||
env: env.clone(),
|
||||
http_client: Client::new(),
|
||||
http_base_url: format!("http://{}/v1", env.pageserver.listen_http_addr),
|
||||
}
|
||||
}
|
||||
|
||||
fn default_config() -> Config {
|
||||
"postgresql://no_user@localhost:64000/no_db".parse().unwrap()
|
||||
/// Construct libpq connection string for connecting to the pageserver.
|
||||
fn pageserver_connection_config(password: &str, listen_addr: &str) -> Config {
|
||||
format!("postgresql://no_user:{}@{}/no_db", password, listen_addr)
|
||||
.parse()
|
||||
.unwrap()
|
||||
}
|
||||
|
||||
pub fn connection_config(&self) -> Config {
|
||||
match &self.connection_config {
|
||||
Some(config) => config.clone(),
|
||||
None => Self::default_config(),
|
||||
}
|
||||
}
|
||||
|
||||
pub fn init(&self) -> Result<()> {
|
||||
pub fn init(
|
||||
&self,
|
||||
create_tenant: Option<&str>,
|
||||
config_overrides: &[&str],
|
||||
) -> anyhow::Result<()> {
|
||||
let mut cmd = Command::new(self.env.pageserver_bin()?);
|
||||
let status = cmd
|
||||
.args(&[
|
||||
"--init",
|
||||
"-D",
|
||||
self.env.base_data_dir.to_str().unwrap(),
|
||||
"--postgres-distrib",
|
||||
self.env.pg_distrib_dir.to_str().unwrap(),
|
||||
])
|
||||
.env_clear()
|
||||
.env("RUST_BACKTRACE", "1")
|
||||
|
||||
let id = format!("id={}", self.env.pageserver.id);
|
||||
|
||||
// FIXME: the paths should be shell-escaped to handle paths with spaces, quotas etc.
|
||||
let base_data_dir_param = self.env.base_data_dir.display().to_string();
|
||||
let pg_distrib_dir_param =
|
||||
format!("pg_distrib_dir='{}'", self.env.pg_distrib_dir.display());
|
||||
let authg_type_param = format!("auth_type='{}'", self.env.pageserver.auth_type);
|
||||
let listen_http_addr_param = format!(
|
||||
"listen_http_addr='{}'",
|
||||
self.env.pageserver.listen_http_addr
|
||||
);
|
||||
let listen_pg_addr_param =
|
||||
format!("listen_pg_addr='{}'", self.env.pageserver.listen_pg_addr);
|
||||
let mut args = Vec::with_capacity(20);
|
||||
|
||||
args.push("--init");
|
||||
args.extend(["-D", &base_data_dir_param]);
|
||||
args.extend(["-c", &pg_distrib_dir_param]);
|
||||
args.extend(["-c", &authg_type_param]);
|
||||
args.extend(["-c", &listen_http_addr_param]);
|
||||
args.extend(["-c", &listen_pg_addr_param]);
|
||||
args.extend(["-c", &id]);
|
||||
|
||||
for config_override in config_overrides {
|
||||
args.extend(["-c", config_override]);
|
||||
}
|
||||
|
||||
if self.env.pageserver.auth_type != AuthType::Trust {
|
||||
args.extend([
|
||||
"-c",
|
||||
"auth_validation_public_key_path='auth_public_key.pem'",
|
||||
]);
|
||||
}
|
||||
|
||||
if let Some(tenantid) = create_tenant {
|
||||
args.extend(["--create-tenant", tenantid])
|
||||
}
|
||||
|
||||
let status = fill_rust_env_vars(cmd.args(args))
|
||||
.status()
|
||||
.expect("pageserver init failed");
|
||||
|
||||
if status.success() {
|
||||
Ok(())
|
||||
} else {
|
||||
Err(anyhow!("pageserver init failed"))
|
||||
if !status.success() {
|
||||
bail!("pageserver init failed");
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn repo_path(&self) -> PathBuf {
|
||||
@@ -76,18 +160,24 @@ impl PageServerNode {
|
||||
self.repo_path().join("pageserver.pid")
|
||||
}
|
||||
|
||||
pub fn start(&self) -> Result<()> {
|
||||
println!(
|
||||
"Starting pageserver at '{}' in {}",
|
||||
connection_address(&self.connection_config()),
|
||||
pub fn start(&self, config_overrides: &[&str]) -> anyhow::Result<()> {
|
||||
print!(
|
||||
"Starting pageserver at '{}' in '{}'",
|
||||
connection_address(&self.pg_connection_config),
|
||||
self.repo_path().display()
|
||||
);
|
||||
io::stdout().flush().unwrap();
|
||||
|
||||
let mut cmd = Command::new(self.env.pageserver_bin()?);
|
||||
cmd.args(&["-D", self.repo_path().to_str().unwrap()])
|
||||
.arg("-d")
|
||||
.env_clear()
|
||||
.env("RUST_BACKTRACE", "1");
|
||||
|
||||
let repo_path = self.repo_path();
|
||||
let mut args = vec!["-D", repo_path.to_str().unwrap()];
|
||||
|
||||
for config_override in config_overrides {
|
||||
args.extend(["-c", config_override]);
|
||||
}
|
||||
|
||||
fill_rust_env_vars(cmd.args(&args).arg("--daemonize"));
|
||||
|
||||
if !cmd.status()?.success() {
|
||||
bail!(
|
||||
@@ -98,116 +188,194 @@ impl PageServerNode {
|
||||
|
||||
// It takes a while for the page server to start up. Wait until it is
|
||||
// open for business.
|
||||
for retries in 1..15 {
|
||||
let client = self.page_server_psql_client();
|
||||
if client.is_ok() {
|
||||
break;
|
||||
} else {
|
||||
println!("Pageserver not responding yet, retrying ({})...", retries);
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
const RETRIES: i8 = 15;
|
||||
for retries in 1..RETRIES {
|
||||
match self.check_status() {
|
||||
Ok(_) => {
|
||||
println!("\nPageserver started");
|
||||
return Ok(());
|
||||
}
|
||||
Err(err) => {
|
||||
match err {
|
||||
PageserverHttpError::Transport(err) => {
|
||||
if err.is_connect() && retries < 5 {
|
||||
print!(".");
|
||||
io::stdout().flush().unwrap();
|
||||
} else {
|
||||
if retries == 5 {
|
||||
println!() // put a line break after dots for second message
|
||||
}
|
||||
println!(
|
||||
"Pageserver not responding yet, err {} retrying ({})...",
|
||||
err, retries
|
||||
);
|
||||
}
|
||||
}
|
||||
PageserverHttpError::Response(msg) => {
|
||||
bail!("pageserver failed to start: {} ", msg)
|
||||
}
|
||||
}
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
println!("Pageserver started");
|
||||
|
||||
Ok(())
|
||||
bail!("pageserver failed to start in {} seconds", RETRIES);
|
||||
}
|
||||
|
||||
pub fn stop(&self) -> Result<()> {
|
||||
let pid = read_pidfile(&self.pid_file())?;
|
||||
let pid = Pid::from_raw(pid);
|
||||
if kill(pid, Signal::SIGTERM).is_err() {
|
||||
bail!("Failed to kill pageserver with pid {}", pid);
|
||||
///
|
||||
/// Stop the server.
|
||||
///
|
||||
/// If 'immediate' is true, we use SIGQUIT, killing the process immediately.
|
||||
/// Otherwise we use SIGTERM, triggering a clean shutdown
|
||||
///
|
||||
/// If the server is not running, returns success
|
||||
///
|
||||
pub fn stop(&self, immediate: bool) -> anyhow::Result<()> {
|
||||
let pid_file = self.pid_file();
|
||||
if !pid_file.exists() {
|
||||
println!("Pageserver is already stopped");
|
||||
return Ok(());
|
||||
}
|
||||
let pid = Pid::from_raw(read_pidfile(&pid_file)?);
|
||||
|
||||
// wait for pageserver stop
|
||||
let address = connection_address(&self.connection_config());
|
||||
for _ in 0..5 {
|
||||
let stream = TcpStream::connect(&address);
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
if let Err(_e) = stream {
|
||||
println!("Pageserver stopped");
|
||||
let sig = if immediate {
|
||||
println!("Stop pageserver immediately");
|
||||
Signal::SIGQUIT
|
||||
} else {
|
||||
println!("Stop pageserver gracefully");
|
||||
Signal::SIGTERM
|
||||
};
|
||||
match kill(pid, sig) {
|
||||
Ok(_) => (),
|
||||
Err(Errno::ESRCH) => {
|
||||
println!(
|
||||
"Pageserver with pid {} does not exist, but a PID file was found",
|
||||
pid
|
||||
);
|
||||
return Ok(());
|
||||
}
|
||||
println!("Stopping pageserver on {}", address);
|
||||
Err(err) => bail!(
|
||||
"Failed to send signal to pageserver with pid {}: {}",
|
||||
pid,
|
||||
err.desc()
|
||||
),
|
||||
}
|
||||
|
||||
let address = connection_address(&self.pg_connection_config);
|
||||
|
||||
// TODO Remove this "timeout" and handle it on caller side instead.
|
||||
// Shutting down may take a long time,
|
||||
// if pageserver checkpoints a lot of data
|
||||
for _ in 0..100 {
|
||||
if let Err(_e) = TcpStream::connect(&address) {
|
||||
println!("Pageserver stopped receiving connections");
|
||||
|
||||
//Now check status
|
||||
match self.check_status() {
|
||||
Ok(_) => {
|
||||
println!("Pageserver status is OK. Wait a bit.");
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
Err(err) => {
|
||||
println!("Pageserver status is: {}", err);
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
} else {
|
||||
println!("Pageserver still receives connections");
|
||||
thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
}
|
||||
|
||||
bail!("Failed to stop pageserver with pid {}", pid);
|
||||
}
|
||||
|
||||
pub fn page_server_psql(&self, sql: &str) -> Vec<postgres::SimpleQueryMessage> {
|
||||
let mut client = self.connection_config().connect(NoTls).unwrap();
|
||||
let mut client = self.pg_connection_config.connect(NoTls).unwrap();
|
||||
|
||||
println!("Pageserver query: '{}'", sql);
|
||||
client.simple_query(sql).unwrap()
|
||||
}
|
||||
|
||||
pub fn page_server_psql_client(&self) -> Result<postgres::Client, postgres::Error> {
|
||||
self.connection_config().connect(NoTls)
|
||||
pub fn page_server_psql_client(&self) -> result::Result<postgres::Client, postgres::Error> {
|
||||
self.pg_connection_config.connect(NoTls)
|
||||
}
|
||||
|
||||
pub fn branches_list(&self) -> Result<Vec<BranchInfo>> {
|
||||
let mut client = self.page_server_psql_client()?;
|
||||
let query_result = client.simple_query("branch_list")?;
|
||||
let branches_json = query_result
|
||||
.first()
|
||||
.map(|msg| match msg {
|
||||
postgres::SimpleQueryMessage::Row(row) => row.get(0),
|
||||
_ => None,
|
||||
})
|
||||
.flatten()
|
||||
.ok_or_else(|| anyhow!("missing branches"))?;
|
||||
|
||||
let res: Vec<BranchInfo> = serde_json::from_str(branches_json)?;
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
pub fn branch_create(&self, name: &str, startpoint: &str) -> Result<BranchInfo> {
|
||||
let mut client = self.page_server_psql_client()?;
|
||||
let query_result =
|
||||
client.simple_query(format!("branch_create {} {}", name, startpoint).as_str())?;
|
||||
|
||||
let branch_json = query_result
|
||||
.first()
|
||||
.map(|msg| match msg {
|
||||
postgres::SimpleQueryMessage::Row(row) => row.get(0),
|
||||
_ => None,
|
||||
})
|
||||
.flatten()
|
||||
.ok_or_else(|| anyhow!("missing branch"))?;
|
||||
|
||||
let res: BranchInfo = serde_json::from_str(branch_json).map_err(|e| {
|
||||
anyhow!(
|
||||
"failed to parse branch_create response: {}: {}",
|
||||
branch_json,
|
||||
e
|
||||
)
|
||||
})?;
|
||||
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
// TODO: make this a separate request type and avoid loading all the branches
|
||||
pub fn branch_get_by_name(&self, name: &str) -> Result<BranchInfo> {
|
||||
let branch_infos = self.branches_list()?;
|
||||
let branche_by_name: Result<HashMap<String, BranchInfo>> = branch_infos
|
||||
.into_iter()
|
||||
.map(|branch_info| Ok((branch_info.name.clone(), branch_info)))
|
||||
.collect();
|
||||
let branche_by_name = branche_by_name?;
|
||||
|
||||
let branch = branche_by_name
|
||||
.get(name)
|
||||
.ok_or_else(|| anyhow!("Branch {} not found", name))?;
|
||||
|
||||
Ok(branch.clone())
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for PageServerNode {
|
||||
fn drop(&mut self) {
|
||||
if self.kill_on_exit {
|
||||
let _ = self.stop();
|
||||
fn http_request<U: IntoUrl>(&self, method: Method, url: U) -> RequestBuilder {
|
||||
let mut builder = self.http_client.request(method, url);
|
||||
if self.env.pageserver.auth_type == AuthType::ZenithJWT {
|
||||
builder = builder.bearer_auth(&self.env.pageserver.auth_token)
|
||||
}
|
||||
builder
|
||||
}
|
||||
|
||||
pub fn check_status(&self) -> Result<()> {
|
||||
self.http_request(Method::GET, format!("{}/{}", self.http_base_url, "status"))
|
||||
.send()?
|
||||
.error_from_body()?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn tenant_list(&self) -> Result<Vec<TenantInfo>> {
|
||||
Ok(self
|
||||
.http_request(Method::GET, format!("{}/{}", self.http_base_url, "tenant"))
|
||||
.send()?
|
||||
.error_from_body()?
|
||||
.json()?)
|
||||
}
|
||||
|
||||
pub fn tenant_create(&self, tenantid: ZTenantId) -> Result<()> {
|
||||
Ok(self
|
||||
.http_request(Method::POST, format!("{}/{}", self.http_base_url, "tenant"))
|
||||
.json(&TenantCreateRequest {
|
||||
tenant_id: tenantid,
|
||||
})
|
||||
.send()?
|
||||
.error_from_body()?
|
||||
.json()?)
|
||||
}
|
||||
|
||||
pub fn branch_list(&self, tenantid: &ZTenantId) -> Result<Vec<BranchInfo>> {
|
||||
Ok(self
|
||||
.http_request(
|
||||
Method::GET,
|
||||
format!("{}/branch/{}", self.http_base_url, tenantid),
|
||||
)
|
||||
.send()?
|
||||
.error_from_body()?
|
||||
.json()?)
|
||||
}
|
||||
|
||||
pub fn branch_create(
|
||||
&self,
|
||||
branch_name: &str,
|
||||
startpoint: &str,
|
||||
tenantid: &ZTenantId,
|
||||
) -> Result<BranchInfo> {
|
||||
Ok(self
|
||||
.http_request(Method::POST, format!("{}/branch", self.http_base_url))
|
||||
.json(&BranchCreateRequest {
|
||||
tenant_id: tenantid.to_owned(),
|
||||
name: branch_name.to_owned(),
|
||||
start_point: startpoint.to_owned(),
|
||||
})
|
||||
.send()?
|
||||
.error_from_body()?
|
||||
.json()?)
|
||||
}
|
||||
|
||||
pub fn branch_get_by_name(
|
||||
&self,
|
||||
tenantid: &ZTenantId,
|
||||
branch_name: &str,
|
||||
) -> Result<BranchInfo> {
|
||||
Ok(self
|
||||
.http_request(
|
||||
Method::GET,
|
||||
format!("{}/branch/{}/{}", self.http_base_url, tenantid, branch_name),
|
||||
)
|
||||
.send()?
|
||||
.error_for_status()?
|
||||
.json()?)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,11 +1,13 @@
|
||||
#!/bin/sh
|
||||
set -eux
|
||||
|
||||
if [ "$1" = 'pageserver' ]; then
|
||||
if [ ! -d "/data/timelines" ]; then
|
||||
if [ ! -d "/data/tenants" ]; then
|
||||
echo "Initializing pageserver data directory"
|
||||
pageserver --init -D /data --postgres-distrib /usr/local
|
||||
pageserver --init -D /data -c "pg_distrib_dir='/usr/local'" -c "id=10"
|
||||
fi
|
||||
echo "Staring pageserver at 0.0.0.0:6400"
|
||||
pageserver -l 0.0.0.0:6400 -D /data
|
||||
pageserver -c "listen_pg_addr='0.0.0.0:6400'" -c "listen_http_addr='0.0.0.0:9898'" -D /data
|
||||
else
|
||||
"$@"
|
||||
fi
|
||||
|
||||
14
docs/README.md
Normal file
14
docs/README.md
Normal file
@@ -0,0 +1,14 @@
|
||||
# Zenith documentation
|
||||
|
||||
## Table of contents
|
||||
|
||||
- [authentication.md](authentication.md) — pageserver JWT authentication.
|
||||
- [docker.md](docker.md) — Docker images and building pipeline.
|
||||
- [glossary.md](glossary.md) — Glossary of all the terms used in codebase.
|
||||
- [multitenancy.md](multitenancy.md) — how multitenancy is organized in the pageserver and Zenith CLI.
|
||||
- [sourcetree.md](sourcetree.md) — Overview of the source tree layeout.
|
||||
- [pageserver/README](/pageserver/README) — pageserver overview.
|
||||
- [postgres_ffi/README](/postgres_ffi/README) — Postgres FFI overview.
|
||||
- [test_runner/README.md](/test_runner/README.md) — tests infrastructure overview.
|
||||
- [walkeeper/README](/walkeeper/README) — WAL service overview.
|
||||
- [core_changes.md](core_changes.md) - Description of Zenith changes in Postgres core
|
||||
30
docs/authentication.md
Normal file
30
docs/authentication.md
Normal file
@@ -0,0 +1,30 @@
|
||||
## Authentication
|
||||
|
||||
### Overview
|
||||
|
||||
Current state of authentication includes usage of JWT tokens in communication between compute and pageserver and between CLI and pageserver. JWT token is signed using RSA keys. CLI generates a key pair during call to `zenith init`. Using following openssl commands:
|
||||
|
||||
```bash
|
||||
openssl genrsa -out private_key.pem 2048
|
||||
openssl rsa -in private_key.pem -pubout -outform PEM -out public_key.pem
|
||||
```
|
||||
|
||||
CLI also generates signed token and saves it in the config for later access to pageserver. Now authentication is optional. Pageserver has two variables in config: `auth_validation_public_key_path` and `auth_type`, so when auth type present and set to `ZenithJWT` pageserver will require authentication for connections. Actual JWT is passed in password field of connection string. There is a caveat for psql, it silently truncates passwords to 100 symbols, so to correctly pass JWT via psql you have to either use PGPASSWORD environment variable, or store password in psql config file.
|
||||
|
||||
Currently there is no authentication between compute and safekeepers, because this communication layer is under heavy refactoring. After this refactoring support for authentication will be added there too. Now safekeeper supports "hardcoded" token passed via environment variable to be able to use callmemaybe command in pageserver.
|
||||
|
||||
Compute uses token passed via environment variable to communicate to pageserver and in the future to the safekeeper too.
|
||||
|
||||
JWT authentication now supports two scopes: tenant and pageserverapi. Tenant scope is intended for use in tenant related api calls, e.g. create_branch. Compute launched for particular tenant also uses this scope. Scope pageserver api is intended to be used by console to manage pageserver. For now we have only one management operation - create tenant.
|
||||
|
||||
Examples for token generation in python:
|
||||
|
||||
```python
|
||||
# generate pageserverapi token
|
||||
management_token = jwt.encode({"scope": "pageserverapi"}, auth_keys.priv, algorithm="RS256")
|
||||
|
||||
# generate tenant token
|
||||
tenant_token = jwt.encode({"scope": "tenant", "tenant_id": ps.initial_tenant}, auth_keys.priv, algorithm="RS256")
|
||||
```
|
||||
|
||||
Utility functions to work with jwts in rust are located in zenith_utils/src/auth.rs
|
||||
202
docs/core_changes.md
Normal file
202
docs/core_changes.md
Normal file
@@ -0,0 +1,202 @@
|
||||
1. Add t_cid to XLOG record
|
||||
- Why?
|
||||
The cmin/cmax on a heap page is a real bummer. I don't see any other way to fix that than bite the bullet and modify the WAL-logging routine to include the cmin/cmax.
|
||||
|
||||
To recap, the problem is that the XLOG_HEAP_INSERT record does not include the command id of the inserted row. And same with deletion/update. So in the primary, a row is inserted with current xmin + cmin. But in the replica, the cmin is always set to 1. That works, because the command id is only relevant to the inserting transaction itself. After commit/abort, no one cares abut it anymore.
|
||||
|
||||
- Alternatives?
|
||||
I don't know
|
||||
|
||||
2. Add PD_WAL_LOGGED.
|
||||
- Why?
|
||||
Postgres sometimes writes data to the page before it is wal-logged. If such page ais swapped out, we will loose this change. The problem is currently solved by setting PD_WAL_LOGGED bit in page header. When page without this bit set is written to the SMGR, then it is forced to be written to the WAL as FPI using log_newpage_copy() function.
|
||||
|
||||
There was wrong assumption that it can happen only during construction of some exotic indexes (like gist). It is not true. The same situation can happen with COPY,VACUUM and when record hint bits are set.
|
||||
|
||||
- Discussion:
|
||||
https://discord.com/channels/869525774699462656/882681420986851359
|
||||
|
||||
- Alternatives:
|
||||
Do not store this flag in page header, but associate this bit with shared buffer. Logically it is more correct but in practice we will get not advantages: neither in space, neither in CPU overhead.
|
||||
|
||||
|
||||
3. XLogReadBufferForRedo not always loads and pins requested buffer. So we need to add extra checks that buffer is really pinned. Also do not use BufferGetBlockNumber for buffer returned by XLogReadBufferForRedo.
|
||||
- Why?
|
||||
XLogReadBufferForRedo is not pinning pages which are not requested by wal-redo. It is specific only for wal-redo Postgres.
|
||||
|
||||
- Alternatives?
|
||||
No
|
||||
|
||||
|
||||
4. Eliminate reporting of some warnings related with hint bits, for example
|
||||
"page is not marked all-visible but visibility map bit is set in relation".
|
||||
- Why?
|
||||
Hint bit may be not WAL logged.
|
||||
|
||||
- Alternative?
|
||||
Always wal log any page changes.
|
||||
|
||||
|
||||
5. Maintain last written LSN.
|
||||
- Why?
|
||||
When compute node requests page from page server, we need to specify LSN. Ideally it should be LSN
|
||||
of WAL record performing last update of this pages. But we do not know it, because we do not have page.
|
||||
We can use current WAL flush position, but in this case there is high probability that page server
|
||||
will be blocked until this peace of WAL is delivered.
|
||||
As better approximation we can keep max LSN of written page. It will be better to take in account LSNs only of evicted pages,
|
||||
but SMGR API doesn't provide such knowledge.
|
||||
|
||||
- Alternatives?
|
||||
Maintain map of LSNs of evicted pages.
|
||||
|
||||
|
||||
6. Launching Postgres without WAL.
|
||||
- Why?
|
||||
According to Zenith architecture compute node is stateless. So when we are launching
|
||||
compute node, we need to provide some dummy PG_DATADIR. Relation pages
|
||||
can be requested on demand from page server. But Postgres still need some non-relational data:
|
||||
control and configuration files, SLRUs,...
|
||||
It is currently implemented using basebackup (do not mix with pg_basebackup) which is created
|
||||
by pageserver. It includes in this tarball config/control files, SLRUs and required directories.
|
||||
As far as pageserver do not have original (non-scattered) WAL segments, it includes in
|
||||
this tarball dummy WAL segment which contains only SHUTDOWN_CHECKPOINT record at the beginning of segment,
|
||||
which redo field points to the end of wal. It allows to load checkpoint record in more or less
|
||||
standard way with minimal changes of Postgres, but then some special handling is needed,
|
||||
including restoring previous record position from zenith.signal file.
|
||||
Also we have to correctly initialize header of last WAL page (pointed by checkpoint.redo)
|
||||
to pass checks performed by XLogReader.
|
||||
|
||||
- Alternatives?
|
||||
We may not include fake WAL segment in tarball at all and modify xlog.c to load checkpoint record
|
||||
in special way. But it may only increase number of changes in xlog.c
|
||||
|
||||
7. Add redo_read_buffer_filter callback to XLogReadBufferForRedoExtended
|
||||
- Why?
|
||||
We need a way in wal-redo Postgres to ignore pages which are not requested by pageserver.
|
||||
So wal-redo Postgres reconstructs only requested page and for all other returns BLK_DONE
|
||||
which means that recovery for them is not needed.
|
||||
|
||||
- Alternatives?
|
||||
No
|
||||
|
||||
8. Enforce WAL logging of sequence updates.
|
||||
- Why?
|
||||
Due to performance reasons Postgres don't want to log each fetching of a value from a sequence,
|
||||
so we pre-log a few fetches in advance. In the event of crash we can lose
|
||||
(skip over) as many values as we pre-logged.
|
||||
But it doesn't work with Zenith because page with sequence value can be evicted from buffer cache
|
||||
and we will get a gap in sequence values even without crash.
|
||||
|
||||
- Alternatives:
|
||||
Do not try to preserve sequential order but avoid performance penalty.
|
||||
|
||||
|
||||
9. Treat unlogged tables as normal (permanent) tables.
|
||||
- Why?
|
||||
Unlogged tables are not transient, so them have to survive node restart (unlike temporary tables).
|
||||
But as far as compute node is stateless, we need to persist their data to storage node.
|
||||
And it can only be done through the WAL.
|
||||
|
||||
- Alternatives?
|
||||
* Store unlogged tables locally (violates requirement of stateless compute nodes).
|
||||
* Prohibit unlogged tables at all.
|
||||
|
||||
|
||||
10. Support start Postgres in wal-redo mode
|
||||
- Why?
|
||||
To be able to apply WAL record and reconstruct pages at page server.
|
||||
|
||||
- Alternatives?
|
||||
* Rewrite redo handlers in Rust
|
||||
* Do not reconstruct pages at page server at all and do it at compute node.
|
||||
|
||||
|
||||
11. WAL proposer
|
||||
- Why?
|
||||
WAL proposer is communicating with safekeeper and ensures WAL durability by quorum writes.
|
||||
It is currently implemented as patch to standard WAL sender.
|
||||
|
||||
- Alternatives?
|
||||
Can be moved to extension if some extra callbacks will be added to wal sender code.
|
||||
|
||||
|
||||
12. Secure Computing BPF API wrapper.
|
||||
- Why?
|
||||
Pageserver delegates complex WAL decoding duties to Postgres,
|
||||
which means that the latter might fall victim to carefully designed
|
||||
malicious WAL records and start doing harmful things to the system.
|
||||
To prevent this, it has been decided to limit possible interactions
|
||||
with the outside world using the Secure Computing BPF mode.
|
||||
|
||||
- Alternatives:
|
||||
* Rewrite redo handlers in Rust.
|
||||
* Add more checks to guarantee correctness of WAL records.
|
||||
* Move seccomp.c to extension
|
||||
* Many other discussed approaches to neutralize incorrect WAL records vulnerabilities.
|
||||
|
||||
|
||||
13. Callbacks for replica feedbacks
|
||||
- Why?
|
||||
Allowing waproposer to interact with walsender code.
|
||||
|
||||
- Alternatives
|
||||
Copy walsender code to walproposer.
|
||||
|
||||
|
||||
14. Support multiple SMGR implementations.
|
||||
- Why?
|
||||
Postgres provides abstract API for storage manager but it has only one implementation
|
||||
and provides no way to replace it with custom storage manager.
|
||||
|
||||
- Alternatives?
|
||||
None.
|
||||
|
||||
|
||||
15. Calculate database size as sum of all database relations.
|
||||
- Why?
|
||||
Postgres is calculating database size by traversing data directory
|
||||
but as far as Zenith compute node is stateless we can not do it.
|
||||
|
||||
- Alternatives?
|
||||
Send this request directly to pageserver and calculate real (physical) size
|
||||
of Zenith representation of database/timeline, rather than sum logical size of all relations.
|
||||
|
||||
|
||||
-----------------------------------------------
|
||||
Not currently committed but proposed:
|
||||
|
||||
1. Disable ring buffer buffer manager strategies
|
||||
- Why?
|
||||
Postgres tries to avoid cache flushing by bulk operations (copy, seqscan, vacuum,...).
|
||||
Even if there are free space in buffer cache, pages may be evicted.
|
||||
Negative effect of it can be somehow compensated by file system cache, but in case of Zenith
|
||||
cost of requesting page from page server is much higher.
|
||||
|
||||
- Alternatives?
|
||||
Instead of just prohibiting ring buffer we may try to implement more flexible eviction policy,
|
||||
for example copy evicted page from ring buffer to some other buffer if there is free space
|
||||
in buffer cache.
|
||||
|
||||
2. Disable marking page as dirty when hint bits are set.
|
||||
- Why?
|
||||
Postgres has to modify page twice: first time when some tuple is updated and second time when
|
||||
hint bits are set. Wal logging hint bits updates requires FPI which significantly increase size of WAL.
|
||||
|
||||
- Alternatives?
|
||||
Add special WAL record for setting page hints.
|
||||
|
||||
3. Prefetching
|
||||
- Why?
|
||||
As far as pages in Zenith are loaded on demand, to reduce node startup time
|
||||
and also sppedup some massive queries we need some mechanism for bulk loading to
|
||||
reduce page request round-trip overhead.
|
||||
|
||||
Currently Postgres is supporting prefetching only for bitmap scan.
|
||||
In Zenith we also use prefetch for sequential and index scan. For sequential scan we prefetch
|
||||
some number of following pages. For index scan we prefetch pages of heap relation addressed by TIDs.
|
||||
|
||||
4. Prewarming.
|
||||
- Why?
|
||||
Short downtime (or, in other words, fast compute node restart time) is one of the key feature of Zenith.
|
||||
But overhead of request-response round-trip for loading pages on demand can make started node warm-up quite slow.
|
||||
We can capture state of compute node buffer cache and send bulk request for this pages at startup.
|
||||
20
docs/docker.md
Normal file
20
docs/docker.md
Normal file
@@ -0,0 +1,20 @@
|
||||
# Docker images of Zenith
|
||||
|
||||
## Images
|
||||
|
||||
Currently we build two main images:
|
||||
|
||||
- [zenithdb/zenith](https://hub.docker.com/repository/docker/zenithdb/zenith) — image with pre-built `pageserver`, `safekeeper` and `proxy` binaries and all the required runtime dependencies. Built from [/Dockerfile](/Dockerfile).
|
||||
- [zenithdb/compute-node](https://hub.docker.com/repository/docker/zenithdb/compute-node) — compute node image with pre-built Postgres binaries from [zenithdb/postgres](https://github.com/zenithdb/postgres).
|
||||
|
||||
And additional intermediate images:
|
||||
|
||||
- [zenithdb/compute-tools](https://hub.docker.com/repository/docker/zenithdb/compute-tools) — compute node configuration management tools.
|
||||
|
||||
## Building pipeline
|
||||
|
||||
1. Image `zenithdb/compute-tools` is re-built automatically.
|
||||
|
||||
2. Image `zenithdb/compute-node` is built independently in the [zenithdb/postgres](https://github.com/zenithdb/postgres) repo.
|
||||
|
||||
3. Image `zenithdb/zenith` is built in this repo after a successful `release` tests run and pushed to Docker Hub automatically.
|
||||
261
docs/glossary.md
Normal file
261
docs/glossary.md
Normal file
@@ -0,0 +1,261 @@
|
||||
# Glossary
|
||||
|
||||
### Authentication
|
||||
|
||||
### Backpresssure
|
||||
|
||||
Backpressure is used to limit the lag between pageserver and compute node or WAL service.
|
||||
|
||||
If compute node or WAL service run far ahead of Page Server,
|
||||
the time of serving page requests increases. This may lead to timeout errors.
|
||||
|
||||
To tune backpressure limits use `max_replication_write_lag`, `max_replication_flush_lag` and `max_replication_apply_lag` settings.
|
||||
When lag between current LSN (pg_current_wal_flush_lsn() at compute node) and minimal write/flush/apply position of replica exceeds the limit
|
||||
backends performing writes are blocked until the replica is caught up.
|
||||
### Base image (page image)
|
||||
|
||||
### Basebackup
|
||||
|
||||
A tarball with files needed to bootstrap a compute node[] and a corresponding command to create it.
|
||||
NOTE:It has nothing to do with PostgreSQL pg_basebackup.
|
||||
|
||||
### Branch
|
||||
|
||||
We can create branch at certain LSN using `zenith branch` command.
|
||||
Each Branch lives in a corresponding timeline[] and has an ancestor[].
|
||||
|
||||
|
||||
### Checkpoint (PostgreSQL)
|
||||
|
||||
NOTE: This is an overloaded term.
|
||||
|
||||
A checkpoint record in the WAL marks a point in the WAL sequence at which it is guaranteed that all data files have been updated with all information from shared memory modified before that checkpoint;
|
||||
|
||||
### Checkpoint (Layered repository)
|
||||
|
||||
NOTE: This is an overloaded term.
|
||||
|
||||
Whenever enough WAL has been accumulated in memory, the page server []
|
||||
writes out the changes from in-memory layers into new layer files[]. This process
|
||||
is called "checkpointing". The page server only creates layer files for
|
||||
relations that have been modified since the last checkpoint.
|
||||
|
||||
Configuration parameter `checkpoint_distance` defines the distance
|
||||
from current LSN to perform checkpoint of in-memory layers.
|
||||
Default is `DEFAULT_CHECKPOINT_DISTANCE`.
|
||||
Set this parameter to `0` to force checkpoint of every layer.
|
||||
|
||||
Configuration parameter `checkpoint_period` defines the interval between checkpoint iterations.
|
||||
Default is `DEFAULT_CHECKPOINT_PERIOD`.
|
||||
### Compute node
|
||||
|
||||
Stateless Postgres node that stores data in pageserver.
|
||||
|
||||
### Garbage collection
|
||||
|
||||
The process of removing old on-disk layers that are not needed by any timeline anymore.
|
||||
### Fork
|
||||
|
||||
Each of the separate segmented file sets in which a relation is stored. The main fork is where the actual data resides. There also exist two secondary forks for metadata: the free space map and the visibility map.
|
||||
Each PostgreSQL fork is considered a separate relish.
|
||||
|
||||
### Layer
|
||||
|
||||
A layer contains data needed to reconstruct any page versions within the
|
||||
layer's Segment and range of LSNs.
|
||||
|
||||
There are two kinds of layers, in-memory and on-disk layers. In-memory
|
||||
layers are used to ingest incoming WAL, and provide fast access
|
||||
to the recent page versions. On-disk layers are stored as files on disk, and
|
||||
are immutable. See pageserver/src/layered_repository/README.md for more.
|
||||
|
||||
### Layer file (on-disk layer)
|
||||
|
||||
Layered repository on-disk format is based on immutable files. The
|
||||
files are called "layer files". Each file corresponds to one RELISH_SEG_SIZE
|
||||
segment of a PostgreSQL relation fork. There are two kinds of layer
|
||||
files: image files and delta files. An image file contains a
|
||||
"snapshot" of the segment at a particular LSN, and a delta file
|
||||
contains WAL records applicable to the segment, in a range of LSNs.
|
||||
|
||||
### Layer map
|
||||
|
||||
The layer map tracks what layers exist for all the relishes in a timeline.
|
||||
### Layered repository
|
||||
|
||||
Zenith repository implementation that keeps data in layers.
|
||||
### LSN
|
||||
|
||||
The Log Sequence Number (LSN) is a unique identifier of the WAL record[] in the WAL log.
|
||||
The insert position is a byte offset into the logs, increasing monotonically with each new record.
|
||||
Internally, an LSN is a 64-bit integer, representing a byte position in the write-ahead log stream.
|
||||
It is printed as two hexadecimal numbers of up to 8 digits each, separated by a slash.
|
||||
Check also [PostgreSQL doc about pg_lsn type](https://www.postgresql.org/docs/devel/datatype-pg-lsn.html)
|
||||
Values can be compared to calculate the volume of WAL data that separates them, so they are used to measure the progress of replication and recovery.
|
||||
|
||||
In postgres and Zenith lsns are used to describe certain points in WAL handling.
|
||||
|
||||
PostgreSQL LSNs and functions to monitor them:
|
||||
* `pg_current_wal_insert_lsn()` - Returns the current write-ahead log insert location.
|
||||
* `pg_current_wal_lsn()` - Returns the current write-ahead log write location.
|
||||
* `pg_current_wal_flush_lsn()` - Returns the current write-ahead log flush location.
|
||||
* `pg_last_wal_receive_lsn()` - Returns the last write-ahead log location that has been received and synced to disk by streaming replication. While streaming replication is in progress this will increase monotonically.
|
||||
* `pg_last_wal_replay_lsn ()` - Returns the last write-ahead log location that has been replayed during recovery. If recovery is still in progress this will increase monotonically.
|
||||
[source PostgreSQL documentation](https://www.postgresql.org/docs/devel/functions-admin.html):
|
||||
|
||||
Zenith safekeeper LSNs. For more check [walkeeper/README_PROTO.md](/walkeeper/README_PROTO.md)
|
||||
* `CommitLSN`: position in WAL confirmed by quorum safekeepers.
|
||||
* `RestartLSN`: position in WAL confirmed by all safekeepers.
|
||||
* `FlushLSN`: part of WAL persisted to the disk by safekeeper.
|
||||
* `VCL`: the largerst LSN for which we can guarantee availablity of all prior records.
|
||||
|
||||
Zenith pageserver LSNs:
|
||||
* `last_record_lsn` - the end of last processed WAL record.
|
||||
* `disk_consistent_lsn` - data is known to be fully flushed and fsync'd to local disk on pageserver up to this LSN.
|
||||
* `remote_consistent_lsn` - The last LSN that is synced to remote storage and is guaranteed to survive pageserver crash.
|
||||
TODO: use this name consistently in remote storage code. Now `disk_consistent_lsn` is used and meaning depends on the context.
|
||||
* `ancestor_lsn` - LSN of the branch point (the LSN at which this branch was created)
|
||||
|
||||
TODO: add table that describes mapping between PostgreSQL (compute), safekeeper and pageserver LSNs.
|
||||
### Page (block)
|
||||
|
||||
The basic structure used to store relation data. All pages are of the same size.
|
||||
This is the unit of data exchange between compute node and pageserver.
|
||||
|
||||
### Pageserver
|
||||
|
||||
Zenith storage engine: repositories + wal receiver + page service + wal redo.
|
||||
|
||||
### Page service
|
||||
|
||||
The Page Service listens for GetPage@LSN requests from the Compute Nodes,
|
||||
and responds with pages from the repository.
|
||||
|
||||
|
||||
### PITR (Point-in-time-recovery)
|
||||
|
||||
PostgreSQL's ability to restore up to a specified LSN.
|
||||
|
||||
### Primary node
|
||||
|
||||
|
||||
### Proxy
|
||||
|
||||
Postgres protocol proxy/router.
|
||||
This service listens psql port, can check auth via external service
|
||||
and create new databases and accounts (control plane API in our case).
|
||||
|
||||
### Relation
|
||||
|
||||
The generic term in PostgreSQL for all objects in a database that have a name and a list of attributes defined in a specific order.
|
||||
|
||||
### Relish
|
||||
|
||||
We call each relation and other file that is stored in the
|
||||
repository a "relish". It comes from "rel"-ish, as in "kind of a
|
||||
rel", because it covers relations as well as other things that are
|
||||
not relations, but are treated similarly for the purposes of the
|
||||
storage layer.
|
||||
|
||||
### Replication slot
|
||||
|
||||
|
||||
### Replica node
|
||||
|
||||
|
||||
### Repository
|
||||
|
||||
Repository stores multiple timelines, forked off from the same initial call to 'initdb'
|
||||
and has associated WAL redo service.
|
||||
One repository corresponds to one Tenant.
|
||||
|
||||
### Retention policy
|
||||
|
||||
How much history do we need to keep around for PITR and read-only nodes?
|
||||
|
||||
### Segment (PostgreSQL)
|
||||
|
||||
NOTE: This is an overloaded term.
|
||||
|
||||
A physical file that stores data for a given relation. File segments are
|
||||
limited in size by a compile-time setting (1 gigabyte by default), so if a
|
||||
relation exceeds that size, it is split into multiple segments.
|
||||
|
||||
### Segment (Layered Repository)
|
||||
|
||||
NOTE: This is an overloaded term.
|
||||
|
||||
Segment is a RELISH_SEG_SIZE slice of relish (identified by a SegmentTag).
|
||||
|
||||
### SLRU
|
||||
|
||||
SLRUs include pg_clog, pg_multixact/members, and
|
||||
pg_multixact/offsets. There are other SLRUs in PostgreSQL, but
|
||||
they don't need to be stored permanently (e.g. pg_subtrans),
|
||||
or we do not support them in zenith yet (pg_commit_ts).
|
||||
Each SLRU segment is considered a separate relish[].
|
||||
|
||||
### Tenant (Multitenancy)
|
||||
Tenant represents a single customer, interacting with Zenith.
|
||||
Wal redo[] activity, timelines[], layers[] are managed for each tenant independently.
|
||||
One pageserver[] can serve multiple tenants at once.
|
||||
One safekeeper
|
||||
|
||||
See `docs/multitenancy.md` for more.
|
||||
|
||||
### Timeline
|
||||
|
||||
Timeline accepts page changes and serves get_page_at_lsn() and
|
||||
get_rel_size() requests. The term "timeline" is used internally
|
||||
in the system, but to users they are exposed as "branches", with
|
||||
human-friendly names.
|
||||
|
||||
NOTE: this has nothing to do with PostgreSQL WAL timelines.
|
||||
|
||||
### XLOG
|
||||
|
||||
PostgreSQL alias for WAL[].
|
||||
|
||||
### WAL (Write-ahead log)
|
||||
|
||||
The journal that keeps track of the changes in the database cluster as user- and system-invoked operations take place. It comprises many individual WAL records[] written sequentially to WAL files[].
|
||||
|
||||
### WAL acceptor, WAL proposer
|
||||
|
||||
In the context of the consensus algorithm, the Postgres
|
||||
compute node is also known as the WAL proposer, and the safekeeper is also known
|
||||
as the acceptor. Those are the standard terms in the Paxos algorithm.
|
||||
|
||||
### WAL receiver (WAL decoder)
|
||||
|
||||
The WAL receiver connects to the external WAL safekeeping service (or
|
||||
directly to the primary) using PostgreSQL physical streaming
|
||||
replication, and continuously receives WAL. It decodes the WAL records,
|
||||
and stores them to the repository.
|
||||
|
||||
We keep one WAL receiver active per timeline.
|
||||
|
||||
### WAL record
|
||||
|
||||
A low-level description of an individual data change.
|
||||
|
||||
### WAL redo
|
||||
|
||||
A service that runs PostgreSQL in a special wal_redo mode
|
||||
to apply given WAL records over an old page image and return new page image.
|
||||
|
||||
### WAL safekeeper
|
||||
|
||||
One node that participates in the quorum. All the safekeepers
|
||||
together form the WAL service.
|
||||
|
||||
### WAL segment (WAL file)
|
||||
|
||||
Also known as WAL segment or WAL segment file. Each of the sequentially-numbered files that provide storage space for WAL. The files are all of the same predefined size and are written in sequential order, interspersing changes as they occur in multiple simultaneous sessions.
|
||||
|
||||
### WAL service
|
||||
|
||||
The service as whole that ensures that WAL is stored durably.
|
||||
|
||||
### Web console
|
||||
|
||||
59
docs/multitenancy.md
Normal file
59
docs/multitenancy.md
Normal file
@@ -0,0 +1,59 @@
|
||||
## Multitenancy
|
||||
|
||||
### Overview
|
||||
|
||||
Zenith supports multitenancy. One pageserver can serve multiple tenants at once. Tenants can be managed via zenith CLI. During page server setup tenant can be created using ```zenith init --create-tenant``` Also tenants can be added into the system on the fly without pageserver restart. This can be done using the following cli command: ```zenith tenant create``` Tenants use random identifiers which can be represented as a 32 symbols hexadecimal string. So zenith tenant create accepts desired tenant id as an optional argument. The concept of timelines/branches is working independently per tenant.
|
||||
|
||||
### Tenants in other commands
|
||||
|
||||
By default during `zenith init` new tenant is created on the pageserver. Newly created tenant's id is saved to cli config, so other commands can use it automatically if no direct arugment `--tenantid=<tenantid>` is provided. So generally tenantid more frequently appears in internal pageserver interface. Its commands take tenantid argument to distinguish to which tenant operation should be applied. CLI support creation of new tenants.
|
||||
|
||||
Examples for cli:
|
||||
|
||||
```sh
|
||||
zenith tenant list
|
||||
|
||||
zenith tenant create // generates new id
|
||||
|
||||
zenith tenant create ee6016ec31116c1b7c33dfdfca38892f
|
||||
|
||||
zenith pg create main // default tenant from zenith init
|
||||
|
||||
zenith pg create main --tenantid=ee6016ec31116c1b7c33dfdfca38892f
|
||||
|
||||
zenith branch --tenantid=ee6016ec31116c1b7c33dfdfca38892f
|
||||
```
|
||||
|
||||
### Data layout
|
||||
|
||||
On the page server tenants introduce one level of indirection, so data directory structured the following way:
|
||||
```
|
||||
<pageserver working directory>
|
||||
├── pageserver.log
|
||||
├── pageserver.pid
|
||||
├── pageserver.toml
|
||||
└── tenants
|
||||
├── 537cffa58a4fa557e49e19951b5a9d6b
|
||||
├── de182bc61fb11a5a6b390a8aed3a804a
|
||||
└── ee6016ec31116c1b7c33dfdfca38891f
|
||||
```
|
||||
Wal redo activity and timelines are managed for each tenant independently.
|
||||
|
||||
For local environment used for example in tests there also new level of indirection for tenants. It touches `pgdatadirs` directory. Now it contains `tenants` subdirectory so the structure looks the following way:
|
||||
|
||||
```
|
||||
pgdatadirs
|
||||
└── tenants
|
||||
├── de182bc61fb11a5a6b390a8aed3a804a
|
||||
│ └── main
|
||||
└── ee6016ec31116c1b7c33dfdfca38892f
|
||||
└── main
|
||||
```
|
||||
|
||||
### Changes to postgres
|
||||
|
||||
Tenant id is passed to postgres via GUC the same way as the timeline. Tenant id is added to commands issued to pageserver, namely: pagestream, callmemaybe. Tenant id is also exists in ServerInfo structure, this is needed to pass the value to wal receiver to be able to forward it to the pageserver.
|
||||
|
||||
### Safety
|
||||
|
||||
For now particular tenant can only appear on a particular pageserver. Set of safekeepers are also pinned to particular (tenantid, timeline) pair so there can only be one writer for particular (tenantid, timeline).
|
||||
22
docs/pageserver-tenant-migration.md
Normal file
22
docs/pageserver-tenant-migration.md
Normal file
@@ -0,0 +1,22 @@
|
||||
## Pageserver tenant migration
|
||||
|
||||
### Overview
|
||||
|
||||
This feature allows to migrate a timeline from one pageserver to another by utilizing remote storage capability.
|
||||
|
||||
### Migration process
|
||||
|
||||
Pageserver implements two new http handlers: timeline attach and timeline detach.
|
||||
Timeline migration is performed in a following way:
|
||||
1. Timeline attach is called on a target pageserver. This asks pageserver to download latest checkpoint uploaded to s3.
|
||||
2. For now it is necessary to manually initialize replication stream via callmemaybe call so target pageserver initializes replication from safekeeper (it is desired to avoid this and initialize replication directly in attach handler, but this requires some refactoring (probably [#997](https://github.com/zenithdb/zenith/issues/997)/[#1049](https://github.com/zenithdb/zenith/issues/1049))
|
||||
3. Replication state can be tracked via timeline detail pageserver call.
|
||||
4. Compute node should be restarted with new pageserver connection string. Issue with multiple compute nodes for one timeline is handled on the safekeeper consensus level. So this is not a problem here.Currently responsibility for rescheduling the compute with updated config lies on external coordinator (console).
|
||||
5. Timeline is detached from old pageserver. On disk data is removed.
|
||||
|
||||
|
||||
### Implementation details
|
||||
|
||||
Now safekeeper needs to track which pageserver it is replicating to. This introduces complications into replication code:
|
||||
* We need to distinguish different pageservers (now this is done by connection string which is imperfect and is covered here: https://github.com/zenithdb/zenith/issues/1105). Callmemaybe subscription management also needs to track that (this is already implemented).
|
||||
* We need to track which pageserver is the primary. This is needed to avoid reconnections to non primary pageservers. Because we shouldn't reconnect to them when they decide to stop their walreceiver. I e this can appear when there is a load on the compute and we are trying to detach timeline from old pageserver. In this case callmemaybe will try to reconnect to it because replication termination condition is not met (page server with active compute could never catch up to the latest lsn, so there is always some wal tail)
|
||||
180
docs/settings.md
Normal file
180
docs/settings.md
Normal file
@@ -0,0 +1,180 @@
|
||||
## Pageserver
|
||||
|
||||
Pageserver is mainly configured via a `pageserver.toml` config file.
|
||||
If there's no such file during `init` phase of the server, it creates the file itself. Without 'init', the file is read.
|
||||
|
||||
There's a possibility to pass an arbitrary config value to the pageserver binary as an argument: such values override
|
||||
the values in the config file, if any are specified for the same key and get into the final config during init phase.
|
||||
|
||||
|
||||
### Config example
|
||||
|
||||
```toml
|
||||
# Initial configuration file created by 'pageserver --init'
|
||||
|
||||
listen_pg_addr = '127.0.0.1:64000'
|
||||
listen_http_addr = '127.0.0.1:9898'
|
||||
|
||||
checkpoint_distance = '268435456' # in bytes
|
||||
checkpoint_period = '1 s'
|
||||
|
||||
gc_period = '100 s'
|
||||
gc_horizon = '67108864'
|
||||
|
||||
max_file_descriptors = '100'
|
||||
|
||||
# initial superuser role name to use when creating a new tenant
|
||||
initial_superuser_name = 'zenith_admin'
|
||||
|
||||
# [remote_storage]
|
||||
```
|
||||
|
||||
The config above shows default values for all basic pageserver settings.
|
||||
Pageserver uses default values for all files that are missing in the config, so it's not a hard error to leave the config blank.
|
||||
Yet, it validates the config values it can (e.g. postgres install dir) and errors if the validation fails, refusing to start.
|
||||
|
||||
Note the `[remote_storage]` section: it's a [table](https://toml.io/en/v1.0.0#table) in TOML specification and
|
||||
|
||||
* either has to be placed in the config after the table-less values such as `initial_superuser_name = 'zenith_admin'`
|
||||
|
||||
* or can be placed anywhere if rewritten in identical form as [inline table](https://toml.io/en/v1.0.0#inline-table): `remote_storage = {foo = 2}`
|
||||
|
||||
### Config values
|
||||
|
||||
All values can be passed as an argument to the pageserver binary, using the `-c` parameter and specified as a valid TOML string. All tables should be passed in the inline form.
|
||||
|
||||
Example: `${PAGESERVER_BIN} -c "checkpoint_period = '100 s'" -c "remote_storage={local_path='/some/local/path/'}"`
|
||||
|
||||
Note that TOML distinguishes between strings and integers, the former require single or double quotes around them.
|
||||
|
||||
#### checkpoint_distance
|
||||
|
||||
`checkpoint_distance` is the amount of incoming WAL that is held in
|
||||
the open layer, before it's flushed to local disk. It puts an upper
|
||||
bound on how much WAL needs to be re-processed after a pageserver
|
||||
crash. It is a soft limit, the pageserver can momentarily go above it,
|
||||
but it will trigger a checkpoint operation to get it back below the
|
||||
limit.
|
||||
|
||||
`checkpoint_distance` also determines how much WAL needs to be kept
|
||||
durable in the safekeeper. The safekeeper must have capacity to hold
|
||||
this much WAL, with some headroom, otherwise you can get stuck in a
|
||||
situation where the safekeeper is full and stops accepting new WAL,
|
||||
but the pageserver is not flushing out and releasing the space in the
|
||||
safekeeper because it hasn't reached checkpoint_distance yet.
|
||||
|
||||
`checkpoint_distance` also controls how often the WAL is uploaded to
|
||||
S3.
|
||||
|
||||
The unit is # of bytes.
|
||||
|
||||
#### checkpoint_period
|
||||
|
||||
The pageserver checks whether `checkpoint_distance` has been reached
|
||||
every `checkpoint_period` seconds. Default is 1 s, which should be
|
||||
fine.
|
||||
|
||||
#### gc_horizon
|
||||
|
||||
`gz_horizon` determines how much history is retained, to allow
|
||||
branching and read replicas at an older point in time. The unit is #
|
||||
of bytes of WAL. Page versions older than this are garbage collected
|
||||
away.
|
||||
|
||||
#### gc_period
|
||||
|
||||
Interval at which garbage collection is triggered. Default is 100 s.
|
||||
|
||||
#### initial_superuser_name
|
||||
|
||||
Name of the initial superuser role, passed to initdb when a new tenant
|
||||
is initialized. It doesn't affect anything after initialization. The
|
||||
default is Note: The default is 'zenith_admin', and the console
|
||||
depends on that, so if you change it, bad things will happen.
|
||||
|
||||
#### page_cache_size
|
||||
|
||||
Size of the page cache, to hold materialized page versions. Unit is
|
||||
number of 8 kB blocks. The default is 8192, which means 64 MB.
|
||||
|
||||
#### max_file_descriptors
|
||||
|
||||
Max number of file descriptors to hold open concurrently for accessing
|
||||
layer files. This should be kept well below the process/container/OS
|
||||
limit (see `ulimit -n`), as the pageserver also needs file descriptors
|
||||
for other files and for sockets for incoming connections.
|
||||
|
||||
#### pg_distrib_dir
|
||||
|
||||
A directory with Postgres installation to use during pageserver activities.
|
||||
Inside that dir, a `bin/postgres` binary should be present.
|
||||
|
||||
The default distrib dir is `./tmp_install/`.
|
||||
|
||||
#### workdir (-D)
|
||||
|
||||
A directory in the file system, where pageserver will store its files.
|
||||
The default is `./.zenith/`.
|
||||
|
||||
This parameter has a special CLI alias (`-D`) and can not be overridden with regular `-c` way.
|
||||
|
||||
##### Remote storage
|
||||
|
||||
There's a way to automatically back up and restore some of the pageserver's data from working dir to the remote storage.
|
||||
The backup system is disabled by default and can be enabled for either of the currently available storages:
|
||||
|
||||
###### Local FS storage
|
||||
|
||||
Pageserver can back up and restore some of its workdir contents to another directory.
|
||||
For that, only a path to that directory needs to be specified as a parameter:
|
||||
|
||||
```toml
|
||||
[remote_storage]
|
||||
local_path = '/some/local/path/'
|
||||
```
|
||||
|
||||
###### S3 storage
|
||||
|
||||
Pageserver can back up and restore some of its workdir contents to S3.
|
||||
Full set of S3 credentials is needed for that as parameters.
|
||||
Configuration example:
|
||||
|
||||
```toml
|
||||
[remote_storage]
|
||||
# Name of the bucket to connect to
|
||||
bucket_name = 'some-sample-bucket'
|
||||
|
||||
# Name of the region where the bucket is located at
|
||||
bucket_region = 'eu-north-1'
|
||||
|
||||
# A "subfolder" in the bucket, to use the same bucket separately by multiple pageservers at once.
|
||||
# Optional, pageserver uses entire bucket if the prefix is not specified.
|
||||
prefix_in_bucket = '/some/prefix/'
|
||||
|
||||
# Access key to connect to the bucket ("login" part of the credentials)
|
||||
access_key_id = 'SOMEKEYAAAAASADSAH*#'
|
||||
|
||||
# Secret access key to connect to the bucket ("password" part of the credentials)
|
||||
secret_access_key = 'SOMEsEcReTsd292v'
|
||||
```
|
||||
|
||||
###### General remote storage configuration
|
||||
|
||||
Pagesever allows only one remote storage configured concurrently and errors if parameters from multiple different remote configurations are used.
|
||||
No default values are used for the remote storage configuration parameters.
|
||||
|
||||
Besides, there are parameters common for all types of remote storage that can be configured, those have defaults:
|
||||
|
||||
```toml
|
||||
[remote_storage]
|
||||
# Max number of concurrent connections to open for uploading to or downloading from the remote storage.
|
||||
max_concurrent_sync = 100
|
||||
|
||||
# Max number of errors a single task can have before it's considered failed and not attempted to run anymore.
|
||||
max_sync_errors = 10
|
||||
```
|
||||
|
||||
|
||||
## safekeeper
|
||||
|
||||
TODO
|
||||
126
docs/sourcetree.md
Normal file
126
docs/sourcetree.md
Normal file
@@ -0,0 +1,126 @@
|
||||
## Source tree layout
|
||||
|
||||
Below you will find a brief overview of each subdir in the source tree in alphabetical order.
|
||||
|
||||
`/control_plane`:
|
||||
|
||||
Local control plane.
|
||||
Functions to start, configure and stop pageserver and postgres instances running as a local processes.
|
||||
Intended to be used in integration tests and in CLI tools for local installations.
|
||||
|
||||
`/docs`:
|
||||
|
||||
Documentaion of the Zenith features and concepts.
|
||||
Now it is mostly dev documentation.
|
||||
|
||||
`/monitoring`:
|
||||
|
||||
TODO
|
||||
|
||||
`/pageserver`:
|
||||
|
||||
Zenith storage service.
|
||||
The pageserver has a few different duties:
|
||||
|
||||
- Store and manage the data.
|
||||
- Generate a tarball with files needed to bootstrap ComputeNode.
|
||||
- Respond to GetPage@LSN requests from the Compute Nodes.
|
||||
- Receive WAL from the WAL service and decode it.
|
||||
- Replay WAL that's applicable to the chunks that the Page Server maintains
|
||||
|
||||
For more detailed info, see `/pageserver/README`
|
||||
|
||||
`/postgres_ffi`:
|
||||
|
||||
Utility functions for interacting with PostgreSQL file formats.
|
||||
Misc constants, copied from PostgreSQL headers.
|
||||
|
||||
`/proxy`:
|
||||
|
||||
Postgres protocol proxy/router.
|
||||
This service listens psql port, can check auth via external service
|
||||
and create new databases and accounts (control plane API in our case).
|
||||
|
||||
`/test_runner`:
|
||||
|
||||
Integration tests, written in Python using the `pytest` framework.
|
||||
|
||||
`/vendor/postgres`:
|
||||
|
||||
PostgreSQL source tree, with the modifications needed for Zenith.
|
||||
|
||||
`/vendor/postgres/contrib/zenith`:
|
||||
|
||||
PostgreSQL extension that implements storage manager API and network communications with remote page server.
|
||||
|
||||
`/vendor/postgres/contrib/zenith_test_utils`:
|
||||
|
||||
PostgreSQL extension that contains functions needed for testing and debugging.
|
||||
|
||||
`/walkeeper`:
|
||||
|
||||
The zenith WAL service that receives WAL from a primary compute nodes and streams it to the pageserver.
|
||||
It acts as a holding area and redistribution center for recently generated WAL.
|
||||
|
||||
For more detailed info, see `/walkeeper/README`
|
||||
|
||||
`/workspace_hack`:
|
||||
The workspace_hack crate exists only to pin down some dependencies.
|
||||
|
||||
`/zenith`
|
||||
|
||||
Main entry point for the 'zenith' CLI utility.
|
||||
TODO: Doesn't it belong to control_plane?
|
||||
|
||||
`/zenith_metrics`:
|
||||
|
||||
Helpers for exposing Prometheus metrics from the server.
|
||||
|
||||
`/zenith_utils`:
|
||||
|
||||
Helpers that are shared between other crates in this repository.
|
||||
|
||||
## Using Python
|
||||
Note that Debian/Ubuntu Python packages are stale, as it commonly happens,
|
||||
so manual installation of dependencies is not recommended.
|
||||
|
||||
A single virtual environment with all dependencies is described in the single `Pipfile`.
|
||||
|
||||
### Prerequisites
|
||||
- Install Python 3.7 (the minimal supported version) or greater.
|
||||
- Our setup with poetry should work with newer python versions too. So feel free to open an issue with a `c/test-runner` label if something doesnt work as expected.
|
||||
- If you have some trouble with other version you can resolve it by installing Python 3.7 separately, via pyenv or via system package manager e.g.:
|
||||
```bash
|
||||
# In Ubuntu
|
||||
sudo add-apt-repository ppa:deadsnakes/ppa
|
||||
sudo apt update
|
||||
sudo apt install python3.7
|
||||
```
|
||||
- Install `poetry`
|
||||
- Exact version of `poetry` is not important, see installation instructions available at poetry's [website](https://python-poetry.org/docs/#installation)`.
|
||||
- Install dependencies via `./scripts/pysync`. Note that CI uses Python 3.7 so if you have different version some linting tools can yield different result locally vs in the CI.
|
||||
|
||||
Run `poetry shell` to activate the virtual environment.
|
||||
Alternatively, use `poetry run` to run a single command in the venv, e.g. `poetry run pytest`.
|
||||
|
||||
### Obligatory checks
|
||||
We force code formatting via `yapf` and type hints via `mypy`.
|
||||
Run the following commands in the repository's root (next to `setup.cfg`):
|
||||
|
||||
```bash
|
||||
poetry run yapf -ri . # All code is reformatted
|
||||
poetry run mypy . # Ensure there are no typing errors
|
||||
```
|
||||
|
||||
**WARNING**: do not run `mypy` from a directory other than the root of the repository.
|
||||
Otherwise it will not find its configuration.
|
||||
|
||||
Also consider:
|
||||
|
||||
* Running `flake8` (or a linter of your choice, e.g. `pycodestyle`) and fixing possible defects, if any.
|
||||
* Adding more type hints to your code to avoid `Any`.
|
||||
|
||||
### Changing dependencies
|
||||
To add new package or change an existing one you can use `poetry add` or `poetry update` or edit `pyproject.toml` manually. Do not forget to run `poetry lock` in the latter case.
|
||||
|
||||
More details are available in poetry's [documentation](https://python-poetry.org/docs/).
|
||||
25
monitoring/docker-compose.yml
Normal file
25
monitoring/docker-compose.yml
Normal file
@@ -0,0 +1,25 @@
|
||||
version: "3"
|
||||
services:
|
||||
|
||||
prometheus:
|
||||
container_name: prometheus
|
||||
image: prom/prometheus:latest
|
||||
volumes:
|
||||
- ./prometheus.yaml:/etc/prometheus/prometheus.yml
|
||||
# ports:
|
||||
# - "9090:9090"
|
||||
# TODO: find a proper portable solution
|
||||
network_mode: "host"
|
||||
|
||||
grafana:
|
||||
image: grafana/grafana:latest
|
||||
volumes:
|
||||
- ./grafana.yaml:/etc/grafana/provisioning/datasources/datasources.yaml
|
||||
environment:
|
||||
- GF_AUTH_ANONYMOUS_ENABLED=true
|
||||
- GF_AUTH_ANONYMOUS_ORG_ROLE=Admin
|
||||
- GF_AUTH_DISABLE_LOGIN_FORM=true
|
||||
# ports:
|
||||
# - "3000:3000"
|
||||
# TODO: find a proper portable solution
|
||||
network_mode: "host"
|
||||
12
monitoring/grafana.yaml
Normal file
12
monitoring/grafana.yaml
Normal file
@@ -0,0 +1,12 @@
|
||||
apiVersion: 1
|
||||
|
||||
datasources:
|
||||
- name: Prometheus
|
||||
type: prometheus
|
||||
access: proxy
|
||||
orgId: 1
|
||||
url: http://localhost:9090
|
||||
basicAuth: false
|
||||
isDefault: false
|
||||
version: 1
|
||||
editable: false
|
||||
5
monitoring/prometheus.yaml
Normal file
5
monitoring/prometheus.yaml
Normal file
@@ -0,0 +1,5 @@
|
||||
scrape_configs:
|
||||
- job_name: 'default'
|
||||
scrape_interval: 10s
|
||||
static_configs:
|
||||
- targets: ['localhost:9898']
|
||||
@@ -1,49 +1,56 @@
|
||||
[package]
|
||||
name = "pageserver"
|
||||
version = "0.1.0"
|
||||
authors = ["Stas Kelvich <stas@zenith.tech>"]
|
||||
edition = "2018"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
edition = "2021"
|
||||
|
||||
[dependencies]
|
||||
bookfile = { git = "https://github.com/zenithdb/bookfile.git", branch="generic-readext" }
|
||||
chrono = "0.4.19"
|
||||
rand = "0.8.3"
|
||||
regex = "1.4.5"
|
||||
bytes = { version = "1.0.1", features = ['serde'] }
|
||||
byteorder = "1.4.3"
|
||||
futures = "0.3.13"
|
||||
hyper = "0.14"
|
||||
lazy_static = "1.4.0"
|
||||
slog-stdlog = "4.1.0"
|
||||
slog-async = "2.6.0"
|
||||
slog-scope = "4.4.0"
|
||||
slog-term = "2.8.0"
|
||||
slog = "2.7.0"
|
||||
log = "0.4.14"
|
||||
clap = "2.33.0"
|
||||
termion = "1.5.6"
|
||||
tui = "0.14.0"
|
||||
clap = "3.0"
|
||||
daemonize = "0.4.1"
|
||||
rust-s3 = { version = "0.27.0-rc4", features = ["no-verify-ssl"] }
|
||||
tokio = { version = "1.3.0", features = ["full"] }
|
||||
tokio-stream = { version = "0.1.4" }
|
||||
postgres-types = { git = "https://github.com/zenithdb/rust-postgres.git", rev="9eb0dbfbeb6a6c1b79099b9f7ae4a8c021877858" }
|
||||
postgres-protocol = { git = "https://github.com/zenithdb/rust-postgres.git", rev="9eb0dbfbeb6a6c1b79099b9f7ae4a8c021877858" }
|
||||
postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="9eb0dbfbeb6a6c1b79099b9f7ae4a8c021877858" }
|
||||
# by default rust-rocksdb tries to build a lot of compression algos. Use lz4 only for now as it is simplest dependency.
|
||||
rocksdb = { version = "0.16.0", features = ["lz4"], default-features = false }
|
||||
anyhow = "1.0"
|
||||
tokio = { version = "1.11", features = ["process", "sync", "macros", "fs", "rt", "io-util", "time"] }
|
||||
postgres-types = { git = "https://github.com/zenithdb/rust-postgres.git", rev="2949d98df52587d562986aad155dd4e889e408b7" }
|
||||
postgres-protocol = { git = "https://github.com/zenithdb/rust-postgres.git", rev="2949d98df52587d562986aad155dd4e889e408b7" }
|
||||
postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="2949d98df52587d562986aad155dd4e889e408b7" }
|
||||
tokio-postgres = { git = "https://github.com/zenithdb/rust-postgres.git", rev="2949d98df52587d562986aad155dd4e889e408b7" }
|
||||
tokio-stream = "0.1.8"
|
||||
anyhow = { version = "1.0", features = ["backtrace"] }
|
||||
crc32c = "0.6.0"
|
||||
walkdir = "2"
|
||||
thiserror = "1.0"
|
||||
hex = "0.4.3"
|
||||
hex = { version = "0.4.3", features = ["serde"] }
|
||||
tar = "0.4.33"
|
||||
parse_duration = "2.1.1"
|
||||
humantime = "2.1.0"
|
||||
serde = { version = "1.0", features = ["derive"] }
|
||||
serde_json = "1"
|
||||
fs_extra = "1.2.0"
|
||||
toml = "0.5"
|
||||
toml_edit = { version = "0.13", features = ["easy"] }
|
||||
scopeguard = "1.1.0"
|
||||
async-trait = "0.1"
|
||||
const_format = "0.2.21"
|
||||
tracing = "0.1.27"
|
||||
tracing-futures = "0.2"
|
||||
signal-hook = "0.3.10"
|
||||
url = "2"
|
||||
nix = "0.23"
|
||||
once_cell = "1.8.0"
|
||||
crossbeam-utils = "0.8.5"
|
||||
fail = "0.5.0"
|
||||
|
||||
rust-s3 = { version = "0.28", default-features = false, features = ["no-verify-ssl", "tokio-rustls-tls"] }
|
||||
async-compression = {version = "0.3", features = ["zstd", "tokio"]}
|
||||
|
||||
postgres_ffi = { path = "../postgres_ffi" }
|
||||
zenith_metrics = { path = "../zenith_metrics" }
|
||||
zenith_utils = { path = "../zenith_utils" }
|
||||
workspace_hack = { path = "../workspace_hack" }
|
||||
|
||||
[dev-dependencies]
|
||||
hex-literal = "0.3"
|
||||
tempfile = "3.2"
|
||||
|
||||
@@ -1,129 +0,0 @@
|
||||
## Page server architecture
|
||||
|
||||
The Page Server is responsible for all operations on a number of
|
||||
"chunks" of relation data. A chunk corresponds to a PostgreSQL
|
||||
relation segment (i.e. one max. 1 GB file in the data directory), but
|
||||
it holds all the different versions of every page in the segment that
|
||||
are still needed by the system.
|
||||
|
||||
Currently we do not specifically organize data in chunks.
|
||||
All page images and corresponding WAL records are stored as entries in a key-value storage,
|
||||
where StorageKey is a zenith_timeline_id + BufferTag + LSN.
|
||||
|
||||
|
||||
The Page Server has a few different duties:
|
||||
|
||||
- Respond to GetPage@LSN requests from the Compute Nodes
|
||||
- Receive WAL from WAL safekeeper
|
||||
- Replay WAL that's applicable to the chunks that the Page Server maintains
|
||||
- Backup to S3
|
||||
|
||||
|
||||
The Page Server consists of multiple threads that operate on a shared
|
||||
cache of page versions:
|
||||
|
||||
|
||||
| WAL
|
||||
V
|
||||
+--------------+
|
||||
| |
|
||||
| WAL receiver |
|
||||
| |
|
||||
+--------------+
|
||||
+----+
|
||||
+---------+ .......... | |
|
||||
| | . . | |
|
||||
GetPage@LSN | | . backup . -------> | S3 |
|
||||
-------------> | Page | page cache . . | |
|
||||
| Service | .......... | |
|
||||
page | | +----+
|
||||
<------------- | |
|
||||
+---------+
|
||||
|
||||
...................................
|
||||
. .
|
||||
. Garbage Collection / Compaction .
|
||||
...................................
|
||||
|
||||
Legend:
|
||||
|
||||
+--+
|
||||
| | A thread or multi-threaded service
|
||||
+--+
|
||||
|
||||
....
|
||||
. . Component that we will need, but doesn't exist at the moment. A TODO.
|
||||
....
|
||||
|
||||
---> Data flow
|
||||
<---
|
||||
|
||||
|
||||
Page Service
|
||||
------------
|
||||
|
||||
The Page Service listens for GetPage@LSN requests from the Compute Nodes,
|
||||
and responds with pages from the page cache.
|
||||
|
||||
|
||||
WAL Receiver
|
||||
------------
|
||||
|
||||
The WAL receiver connects to the external WAL safekeeping service (or
|
||||
directly to the primary) using PostgreSQL physical streaming
|
||||
replication, and continuously receives WAL. It decodes the WAL records,
|
||||
and stores them to the page cache.
|
||||
|
||||
|
||||
Page Cache
|
||||
----------
|
||||
|
||||
The Page Cache is a switchboard to access different Repositories.
|
||||
|
||||
#### Repository
|
||||
Repository corresponds to one .zenith directory.
|
||||
Repository is needed to manage Timelines.
|
||||
|
||||
#### Timeline
|
||||
Timeline is a page cache workhorse that accepts page changes
|
||||
and serves get_page_at_lsn() and get_rel_size() requests.
|
||||
Note: this has nothing to do with PostgreSQL WAL timeline.
|
||||
|
||||
#### Branch
|
||||
We can create branch at certain LSN.
|
||||
Each Branch lives in a corresponding timeline and has an ancestor.
|
||||
|
||||
To get full snapshot of data at certain moment we need to traverse timeline and its ancestors.
|
||||
|
||||
#### ObjectRepository
|
||||
ObjectRepository implements Repository and has associated ObjectStore and WAL redo service.
|
||||
|
||||
#### ObjectStore
|
||||
ObjectStore is an interface for key-value store for page images and wal records.
|
||||
Currently it has one implementation - RocksDB.
|
||||
|
||||
#### WAL redo service
|
||||
WAL redo service - service that runs PostgreSQL in a special wal_redo mode
|
||||
to apply given WAL records over an old page image and return new page image.
|
||||
|
||||
|
||||
TODO: Garbage Collection / Compaction
|
||||
-------------------------------------
|
||||
|
||||
Periodically, the Garbage Collection / Compaction thread runs
|
||||
and applies pending WAL records, and removes old page versions that
|
||||
are no longer needed.
|
||||
|
||||
|
||||
TODO: Backup service
|
||||
--------------------
|
||||
|
||||
The backup service is responsible for periodically pushing the chunks to S3.
|
||||
|
||||
TODO: How/when do restore from S3? Whenever we get a GetPage@LSN request for
|
||||
a chunk we don't currently have? Or when an external Control Plane tells us?
|
||||
|
||||
TODO: Sharding
|
||||
--------------------
|
||||
|
||||
We should be able to run multiple Page Servers that handle sharded data.
|
||||
167
pageserver/README.md
Normal file
167
pageserver/README.md
Normal file
@@ -0,0 +1,167 @@
|
||||
## Page server architecture
|
||||
|
||||
The Page Server has a few different duties:
|
||||
|
||||
- Respond to GetPage@LSN requests from the Compute Nodes
|
||||
- Receive WAL from WAL safekeeper
|
||||
- Replay WAL that's applicable to the chunks that the Page Server maintains
|
||||
- Backup to S3
|
||||
|
||||
S3 is the main fault-tolerant storage of all data, as there are no Page Server
|
||||
replicas. We use a separate fault-tolerant WAL service to reduce latency. It
|
||||
keeps track of WAL records which are not synced to S3 yet.
|
||||
|
||||
The Page Server consists of multiple threads that operate on a shared
|
||||
repository of page versions:
|
||||
|
||||
| WAL
|
||||
V
|
||||
+--------------+
|
||||
| |
|
||||
| WAL receiver |
|
||||
| |
|
||||
+--------------+
|
||||
+----+
|
||||
+---------+ .......... | |
|
||||
| | . . | |
|
||||
GetPage@LSN | | . backup . -------> | S3 |
|
||||
-------------> | Page | repository . . | |
|
||||
| Service | .......... | |
|
||||
page | | +----+
|
||||
<------------- | |
|
||||
+---------+ +--------------------+
|
||||
| Checkpointing / |
|
||||
| Garbage collection |
|
||||
+--------------------+
|
||||
|
||||
Legend:
|
||||
|
||||
+--+
|
||||
| | A thread or multi-threaded service
|
||||
+--+
|
||||
|
||||
....
|
||||
. . Component at its early development phase.
|
||||
....
|
||||
|
||||
---> Data flow
|
||||
<---
|
||||
|
||||
|
||||
Page Service
|
||||
------------
|
||||
|
||||
The Page Service listens for GetPage@LSN requests from the Compute Nodes,
|
||||
and responds with pages from the repository.
|
||||
|
||||
|
||||
WAL Receiver
|
||||
------------
|
||||
|
||||
The WAL receiver connects to the external WAL safekeeping service (or
|
||||
directly to the primary) using PostgreSQL physical streaming
|
||||
replication, and continuously receives WAL. It decodes the WAL records,
|
||||
and stores them to the repository.
|
||||
|
||||
|
||||
Repository
|
||||
----------
|
||||
|
||||
The repository stores all the page versions, or WAL records needed to
|
||||
reconstruct them. Each tenant has a separate Repository, which is
|
||||
stored in the .zenith/tenants/<tenantid> directory.
|
||||
|
||||
Repository is an abstract trait, defined in `repository.rs`. It is
|
||||
implemented by the LayeredRepository object in
|
||||
`layered_repository.rs`. There is only that one implementation of the
|
||||
Repository trait, but it's still a useful abstraction that keeps the
|
||||
interface for the low-level storage functionality clean. The layered
|
||||
storage format is described in layered_repository/README.md.
|
||||
|
||||
Each repository consists of multiple Timelines. Timeline is a
|
||||
workhorse that accepts page changes from the WAL, and serves
|
||||
get_page_at_lsn() and get_rel_size() requests. Note: this has nothing
|
||||
to do with PostgreSQL WAL timeline. The term "timeline" is mostly
|
||||
interchangeable with "branch", there is a one-to-one mapping from
|
||||
branch to timeline. A timeline has a unique ID within the tenant,
|
||||
represented as 16-byte hex string that never changes, whereas a
|
||||
branch is a user-given name for a timeline.
|
||||
|
||||
Each repository also has a WAL redo manager associated with it, see
|
||||
`walredo.rs`. The WAL redo manager is used to replay PostgreSQL WAL
|
||||
records, whenever we need to reconstruct a page version from WAL to
|
||||
satisfy a GetPage@LSN request, or to avoid accumulating too much WAL
|
||||
for a page. The WAL redo manager uses a Postgres process running in
|
||||
special zenith wal-redo mode to do the actual WAL redo, and
|
||||
communicates with the process using a pipe.
|
||||
|
||||
|
||||
Checkpointing / Garbage Collection
|
||||
----------------------------------
|
||||
|
||||
Periodically, the checkpointer thread wakes up and performs housekeeping
|
||||
duties on the repository. It has two duties:
|
||||
|
||||
### Checkpointing
|
||||
|
||||
Flush WAL that has accumulated in memory to disk, so that the old WAL
|
||||
can be truncated away in the WAL safekeepers. Also, to free up memory
|
||||
for receiving new WAL. This process is called "checkpointing". It's
|
||||
similar to checkpointing in PostgreSQL or other DBMSs, but in the page
|
||||
server, checkpointing happens on a per-segment basis.
|
||||
|
||||
### Garbage collection
|
||||
|
||||
Remove old on-disk layer files that are no longer needed according to the
|
||||
PITR retention policy
|
||||
|
||||
|
||||
### Backup service
|
||||
|
||||
The backup service, responsible for storing pageserver recovery data externally.
|
||||
|
||||
Currently, pageserver stores its files in a filesystem directory it's pointed to.
|
||||
That working directory could be rather ephemeral for such cases as "a pageserver pod running in k8s with no persistent volumes attached".
|
||||
Therefore, the server interacts with external, more reliable storage to back up and restore its state.
|
||||
|
||||
The code for storage support is extensible and can support arbitrary ones as long as they implement a certain Rust trait.
|
||||
There are the following implementations present:
|
||||
* local filesystem — to use in tests mainly
|
||||
* AWS S3 - to use in production
|
||||
|
||||
Implementation details are covered in the [backup readme](./src/remote_storage/README.md) and corresponding Rust file docs, parameters documentation can be found at [settings docs](../docs/settings.md).
|
||||
|
||||
The backup service is disabled by default and can be enabled to interact with a single remote storage.
|
||||
|
||||
CLI examples:
|
||||
* Local FS: `${PAGESERVER_BIN} -c "remote_storage={local_path='/some/local/path/'}"`
|
||||
* AWS S3 : `${PAGESERVER_BIN} -c "remote_storage={bucket_name='some-sample-bucket',bucket_region='eu-north-1', prefix_in_bucket='/test_prefix/',access_key_id='SOMEKEYAAAAASADSAH*#',secret_access_key='SOMEsEcReTsd292v'}"`
|
||||
|
||||
For Amazon AWS S3, a key id and secret access key could be located in `~/.aws/credentials` if awscli was ever configured to work with the desired bucket, on the AWS Settings page for a certain user. Also note, that the bucket names does not contain any protocols when used on AWS.
|
||||
For local S3 installations, refer to the their documentation for name format and credentials.
|
||||
|
||||
Similar to other pageserver settings, toml config file can be used to configure either of the storages as backup targets.
|
||||
Required sections are:
|
||||
|
||||
```toml
|
||||
[remote_storage]
|
||||
local_path = '/Users/someonetoignore/Downloads/tmp_dir/'
|
||||
```
|
||||
|
||||
or
|
||||
|
||||
```toml
|
||||
[remote_storage]
|
||||
bucket_name = 'some-sample-bucket'
|
||||
bucket_region = 'eu-north-1'
|
||||
prefix_in_bucket = '/test_prefix/'
|
||||
access_key_id = 'SOMEKEYAAAAASADSAH*#'
|
||||
secret_access_key = 'SOMEsEcReTsd292v'
|
||||
```
|
||||
|
||||
Also, `AWS_SECRET_ACCESS_KEY` and `AWS_ACCESS_KEY_ID` variables can be used to specify the credentials instead of any of the ways above.
|
||||
|
||||
TODO: Sharding
|
||||
--------------------
|
||||
|
||||
We should be able to run multiple Page Servers that handle sharded data.
|
||||
@@ -4,22 +4,24 @@
|
||||
//! TODO: this module has nothing to do with PostgreSQL pg_basebackup.
|
||||
//! It could use a better name.
|
||||
//!
|
||||
//! Stateless Postgres compute node is launched by sending tarball which contains non-relational data (multixacts, clog, filenodemaps, twophase files)
|
||||
//! and generate pg_control and dummy segment of WAL. This module is responsible for creation of such tarball from snapshot directory and
|
||||
//! data stored in object storage.
|
||||
//! Stateless Postgres compute node is launched by sending a tarball
|
||||
//! which contains non-relational data (multixacts, clog, filenodemaps, twophase files),
|
||||
//! generated pg_control and dummy segment of WAL.
|
||||
//! This module is responsible for creation of such tarball
|
||||
//! from data stored in object storage.
|
||||
//!
|
||||
use crate::ZTimelineId;
|
||||
use anyhow::{Context, Result};
|
||||
use bytes::{BufMut, BytesMut};
|
||||
use log::*;
|
||||
use std::fmt::Write as FmtWrite;
|
||||
use std::io;
|
||||
use std::io::Write;
|
||||
use std::sync::Arc;
|
||||
use std::time::SystemTime;
|
||||
use tar::{Builder, Header};
|
||||
use walkdir::WalkDir;
|
||||
use tar::{Builder, EntryType, Header};
|
||||
|
||||
use crate::object_key::*;
|
||||
use crate::relish::*;
|
||||
use crate::repository::Timeline;
|
||||
use postgres_ffi::relfile_utils::*;
|
||||
use postgres_ffi::xlog_utils::*;
|
||||
use postgres_ffi::*;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
@@ -30,89 +32,105 @@ use zenith_utils::lsn::Lsn;
|
||||
pub struct Basebackup<'a> {
|
||||
ar: Builder<&'a mut dyn Write>,
|
||||
timeline: &'a Arc<dyn Timeline>,
|
||||
lsn: Lsn,
|
||||
snappath: String,
|
||||
slru_buf: [u8; pg_constants::SLRU_SEG_SIZE],
|
||||
slru_segno: u32,
|
||||
slru_path: &'static str,
|
||||
pub lsn: Lsn,
|
||||
prev_record_lsn: Lsn,
|
||||
}
|
||||
|
||||
// Create basebackup with non-rel data in it. Omit relational data.
|
||||
//
|
||||
// Currently we use empty lsn in two cases:
|
||||
// * During the basebackup right after timeline creation
|
||||
// * When working without safekeepers. In this situation it is important to match the lsn
|
||||
// we are taking basebackup on with the lsn that is used in pageserver's walreceiver
|
||||
// to start the replication.
|
||||
impl<'a> Basebackup<'a> {
|
||||
pub fn new(
|
||||
write: &'a mut dyn Write,
|
||||
timelineid: ZTimelineId,
|
||||
timeline: &'a Arc<dyn Timeline>,
|
||||
lsn: Lsn,
|
||||
snapshot_lsn: Lsn,
|
||||
) -> Basebackup<'a> {
|
||||
Basebackup {
|
||||
req_lsn: Option<Lsn>,
|
||||
) -> Result<Basebackup<'a>> {
|
||||
// Compute postgres doesn't have any previous WAL files, but the first
|
||||
// record that it's going to write needs to include the LSN of the
|
||||
// previous record (xl_prev). We include prev_record_lsn in the
|
||||
// "zenith.signal" file, so that postgres can read it during startup.
|
||||
//
|
||||
// We don't keep full history of record boundaries in the page server,
|
||||
// however, only the predecessor of the latest record on each
|
||||
// timeline. So we can only provide prev_record_lsn when you take a
|
||||
// base backup at the end of the timeline, i.e. at last_record_lsn.
|
||||
// Even at the end of the timeline, we sometimes don't have a valid
|
||||
// prev_lsn value; that happens if the timeline was just branched from
|
||||
// an old LSN and it doesn't have any WAL of its own yet. We will set
|
||||
// prev_lsn to Lsn(0) if we cannot provide the correct value.
|
||||
let (backup_prev, backup_lsn) = if let Some(req_lsn) = req_lsn {
|
||||
// Backup was requested at a particular LSN. Wait for it to arrive.
|
||||
timeline.wait_lsn(req_lsn)?;
|
||||
|
||||
// If the requested point is the end of the timeline, we can
|
||||
// provide prev_lsn. (get_last_record_rlsn() might return it as
|
||||
// zero, though, if no WAL has been generated on this timeline
|
||||
// yet.)
|
||||
let end_of_timeline = timeline.get_last_record_rlsn();
|
||||
if req_lsn == end_of_timeline.last {
|
||||
(end_of_timeline.prev, req_lsn)
|
||||
} else {
|
||||
(Lsn(0), req_lsn)
|
||||
}
|
||||
} else {
|
||||
// Backup was requested at end of the timeline.
|
||||
let end_of_timeline = timeline.get_last_record_rlsn();
|
||||
(end_of_timeline.prev, end_of_timeline.last)
|
||||
};
|
||||
|
||||
info!(
|
||||
"taking basebackup lsn={}, prev_lsn={}",
|
||||
backup_lsn, backup_prev
|
||||
);
|
||||
|
||||
Ok(Basebackup {
|
||||
ar: Builder::new(write),
|
||||
timeline,
|
||||
lsn,
|
||||
snappath: format!("timelines/{}/snapshots/{:016X}", timelineid, snapshot_lsn.0),
|
||||
slru_path: "",
|
||||
slru_segno: u32::MAX,
|
||||
slru_buf: [0u8; pg_constants::SLRU_SEG_SIZE],
|
||||
}
|
||||
lsn: backup_lsn,
|
||||
prev_record_lsn: backup_prev,
|
||||
})
|
||||
}
|
||||
|
||||
pub fn send_tarball(&mut self) -> anyhow::Result<()> {
|
||||
debug!("sending tarball of snapshot in {}", self.snappath);
|
||||
for entry in WalkDir::new(&self.snappath) {
|
||||
let entry = entry?;
|
||||
let fullpath = entry.path();
|
||||
let relpath = entry.path().strip_prefix(&self.snappath).unwrap();
|
||||
// Create pgdata subdirs structure
|
||||
for dir in pg_constants::PGDATA_SUBDIRS.iter() {
|
||||
let header = new_tar_header_dir(*dir)?;
|
||||
self.ar.append(&header, &mut io::empty())?;
|
||||
}
|
||||
|
||||
if relpath.to_str().unwrap() == "" {
|
||||
continue;
|
||||
}
|
||||
|
||||
if entry.file_type().is_dir() {
|
||||
trace!(
|
||||
"sending dir {} as {}",
|
||||
fullpath.display(),
|
||||
relpath.display()
|
||||
);
|
||||
self.ar.append_dir(relpath, fullpath)?;
|
||||
} else if entry.file_type().is_symlink() {
|
||||
error!("ignoring symlink in snapshot dir");
|
||||
} else if entry.file_type().is_file() {
|
||||
if !is_rel_file_path(relpath.to_str().unwrap()) {
|
||||
if entry.file_name() != "pg_filenode.map" // this files will be generated from object storage
|
||||
&& !relpath.starts_with("pg_xact/")
|
||||
&& !relpath.starts_with("pg_multixact/")
|
||||
{
|
||||
trace!("sending {}", relpath.display());
|
||||
self.ar.append_path_with_name(fullpath, relpath)?;
|
||||
}
|
||||
} else {
|
||||
// relation pages are loaded on demand and should not be included in tarball
|
||||
trace!("not sending {}", relpath.display());
|
||||
}
|
||||
// Send empty config files.
|
||||
for filepath in pg_constants::PGDATA_SPECIAL_FILES.iter() {
|
||||
if *filepath == "pg_hba.conf" {
|
||||
let data = pg_constants::PG_HBA.as_bytes();
|
||||
let header = new_tar_header(filepath, data.len() as u64)?;
|
||||
self.ar.append(&header, data)?;
|
||||
} else {
|
||||
error!("unknown file type: {}", fullpath.display());
|
||||
let header = new_tar_header(filepath, 0)?;
|
||||
self.ar.append(&header, &mut io::empty())?;
|
||||
}
|
||||
}
|
||||
|
||||
// Generate non-relational files.
|
||||
// Iteration is sorted order: all objects of the same time are grouped and traversed
|
||||
// in key ascending order. For example all pg_xact records precede pg_multixact records and are sorted by block number.
|
||||
// It allows to easily construct SLRU segments (32 blocks).
|
||||
// Gather non-relational files from object storage pages.
|
||||
for obj in self.timeline.list_nonrels(self.lsn)? {
|
||||
match obj {
|
||||
ObjectTag::Clog(slru) => self.add_slru_segment("pg_xact", &obj, slru.blknum)?,
|
||||
ObjectTag::MultiXactMembers(slru) => {
|
||||
self.add_slru_segment("pg_multixact/members", &obj, slru.blknum)?
|
||||
RelishTag::Slru { slru, segno } => {
|
||||
self.add_slru_segment(slru, segno)?;
|
||||
}
|
||||
ObjectTag::MultiXactOffsets(slru) => {
|
||||
self.add_slru_segment("pg_multixact/offsets", &obj, slru.blknum)?
|
||||
RelishTag::FileNodeMap { spcnode, dbnode } => {
|
||||
self.add_relmap_file(spcnode, dbnode)?;
|
||||
}
|
||||
RelishTag::TwoPhase { xid } => {
|
||||
self.add_twophase_file(xid)?;
|
||||
}
|
||||
ObjectTag::FileNodeMap(db) => self.add_relmap_file(&obj, &db)?,
|
||||
ObjectTag::TwoPhase(prepare) => self.add_twophase_file(&obj, prepare.xid)?,
|
||||
_ => {}
|
||||
}
|
||||
}
|
||||
self.finish_slru_segment()?; // write last non-completed SLRU segment (if any)
|
||||
|
||||
// Generate pg_control and bootstrap WAL segment.
|
||||
self.add_pgcontrol_file()?;
|
||||
self.ar.finish()?;
|
||||
debug!("all tarred up!");
|
||||
@@ -120,66 +138,77 @@ impl<'a> Basebackup<'a> {
|
||||
}
|
||||
|
||||
//
|
||||
// Generate SRLU segment files from repository. Path identifiers SLRU kind (pg_xact, pg_multixact/members, ...).
|
||||
// Intiallly pass is empty string.
|
||||
// Generate SLRU segment files from repository.
|
||||
//
|
||||
fn add_slru_segment(
|
||||
&mut self,
|
||||
path: &'static str,
|
||||
tag: &ObjectTag,
|
||||
page: u32,
|
||||
) -> anyhow::Result<()> {
|
||||
let img = self.timeline.get_page_at_lsn_nowait(*tag, self.lsn)?;
|
||||
// Zero length image indicates truncated segment: just skip it
|
||||
if !img.is_empty() {
|
||||
assert!(img.len() == pg_constants::BLCKSZ as usize);
|
||||
let segno = page / pg_constants::SLRU_PAGES_PER_SEGMENT;
|
||||
if self.slru_path != "" && (self.slru_segno != segno || self.slru_path != path) {
|
||||
// Switch to new segment: save old one
|
||||
let segname = format!("{}/{:>04X}", self.slru_path, self.slru_segno);
|
||||
let header = new_tar_header(&segname, pg_constants::SLRU_SEG_SIZE as u64)?;
|
||||
self.ar.append(&header, &self.slru_buf[..])?;
|
||||
self.slru_buf = [0u8; pg_constants::SLRU_SEG_SIZE]; // reinitialize segment buffer
|
||||
}
|
||||
self.slru_segno = segno;
|
||||
self.slru_path = path;
|
||||
let offs_start = (page % pg_constants::SLRU_PAGES_PER_SEGMENT) as usize
|
||||
* pg_constants::BLCKSZ as usize;
|
||||
let offs_end = offs_start + pg_constants::BLCKSZ as usize;
|
||||
self.slru_buf[offs_start..offs_end].copy_from_slice(&img);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
fn add_slru_segment(&mut self, slru: SlruKind, segno: u32) -> anyhow::Result<()> {
|
||||
let seg_size = self
|
||||
.timeline
|
||||
.get_relish_size(RelishTag::Slru { slru, segno }, self.lsn)?;
|
||||
|
||||
//
|
||||
// We flush SLRU segments to the tarball once them are completed.
|
||||
// This method is used to flush last (may be incompleted) segment.
|
||||
//
|
||||
fn finish_slru_segment(&mut self) -> anyhow::Result<()> {
|
||||
if self.slru_path != "" {
|
||||
// is there is some incompleted segment
|
||||
let segname = format!("{}/{:>04X}", self.slru_path, self.slru_segno);
|
||||
let header = new_tar_header(&segname, pg_constants::SLRU_SEG_SIZE as u64)?;
|
||||
self.ar.append(&header, &self.slru_buf[..])?;
|
||||
if seg_size == None {
|
||||
trace!(
|
||||
"SLRU segment {}/{:>04X} was truncated",
|
||||
slru.to_str(),
|
||||
segno
|
||||
);
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let nblocks = seg_size.unwrap();
|
||||
|
||||
let mut slru_buf: Vec<u8> =
|
||||
Vec::with_capacity(nblocks as usize * pg_constants::BLCKSZ as usize);
|
||||
for blknum in 0..nblocks {
|
||||
let img =
|
||||
self.timeline
|
||||
.get_page_at_lsn(RelishTag::Slru { slru, segno }, blknum, self.lsn)?;
|
||||
assert!(img.len() == pg_constants::BLCKSZ as usize);
|
||||
|
||||
slru_buf.extend_from_slice(&img);
|
||||
}
|
||||
|
||||
let segname = format!("{}/{:>04X}", slru.to_str(), segno);
|
||||
let header = new_tar_header(&segname, slru_buf.len() as u64)?;
|
||||
self.ar.append(&header, slru_buf.as_slice())?;
|
||||
|
||||
trace!("Added to basebackup slru {} relsize {}", segname, nblocks);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
//
|
||||
// Extract pg_filenode.map files from repository
|
||||
// Along with them also send PG_VERSION for each database.
|
||||
//
|
||||
fn add_relmap_file(&mut self, tag: &ObjectTag, db: &DatabaseTag) -> anyhow::Result<()> {
|
||||
let img = self.timeline.get_page_at_lsn_nowait(*tag, self.lsn)?;
|
||||
info!("add_relmap_file {:?}", db);
|
||||
let path = if db.spcnode == pg_constants::GLOBALTABLESPACE_OID {
|
||||
fn add_relmap_file(&mut self, spcnode: u32, dbnode: u32) -> anyhow::Result<()> {
|
||||
let img = self.timeline.get_page_at_lsn(
|
||||
RelishTag::FileNodeMap { spcnode, dbnode },
|
||||
0,
|
||||
self.lsn,
|
||||
)?;
|
||||
let path = if spcnode == pg_constants::GLOBALTABLESPACE_OID {
|
||||
let version_bytes = pg_constants::PG_MAJORVERSION.as_bytes();
|
||||
let header = new_tar_header("PG_VERSION", version_bytes.len() as u64)?;
|
||||
self.ar.append(&header, version_bytes)?;
|
||||
|
||||
let header = new_tar_header("global/PG_VERSION", version_bytes.len() as u64)?;
|
||||
self.ar.append(&header, version_bytes)?;
|
||||
|
||||
String::from("global/pg_filenode.map") // filenode map for global tablespace
|
||||
} else {
|
||||
// User defined tablespaces are not supported
|
||||
assert!(db.spcnode == pg_constants::DEFAULTTABLESPACE_OID);
|
||||
let src_path = format!("{}/base/1/PG_VERSION", self.snappath);
|
||||
let dst_path = format!("base/{}/PG_VERSION", db.dbnode);
|
||||
self.ar.append_path_with_name(&src_path, &dst_path)?;
|
||||
format!("base/{}/pg_filenode.map", db.dbnode)
|
||||
assert!(spcnode == pg_constants::DEFAULTTABLESPACE_OID);
|
||||
|
||||
// Append dir path for each database
|
||||
let path = format!("base/{}", dbnode);
|
||||
let header = new_tar_header_dir(&path)?;
|
||||
self.ar.append(&header, &mut io::empty())?;
|
||||
|
||||
let dst_path = format!("base/{}/PG_VERSION", dbnode);
|
||||
let version_bytes = pg_constants::PG_MAJORVERSION.as_bytes();
|
||||
let header = new_tar_header(&dst_path, version_bytes.len() as u64)?;
|
||||
self.ar.append(&header, version_bytes)?;
|
||||
|
||||
format!("base/{}/pg_filenode.map", dbnode)
|
||||
};
|
||||
assert!(img.len() == 512);
|
||||
let header = new_tar_header(&path, img.len() as u64)?;
|
||||
@@ -190,57 +219,66 @@ impl<'a> Basebackup<'a> {
|
||||
//
|
||||
// Extract twophase state files
|
||||
//
|
||||
fn add_twophase_file(&mut self, tag: &ObjectTag, xid: TransactionId) -> anyhow::Result<()> {
|
||||
// Include in tarball two-phase files only of in-progress transactions
|
||||
if self.timeline.get_tx_status(xid, self.lsn)?
|
||||
== pg_constants::TRANSACTION_STATUS_IN_PROGRESS
|
||||
{
|
||||
let img = self.timeline.get_page_at_lsn_nowait(*tag, self.lsn)?;
|
||||
let mut buf = BytesMut::new();
|
||||
buf.extend_from_slice(&img[..]);
|
||||
let crc = crc32c::crc32c(&img[..]);
|
||||
buf.put_u32_le(crc);
|
||||
let path = format!("pg_twophase/{:>08X}", xid);
|
||||
let header = new_tar_header(&path, buf.len() as u64)?;
|
||||
self.ar.append(&header, &buf[..])?;
|
||||
}
|
||||
fn add_twophase_file(&mut self, xid: TransactionId) -> anyhow::Result<()> {
|
||||
let img = self
|
||||
.timeline
|
||||
.get_page_at_lsn(RelishTag::TwoPhase { xid }, 0, self.lsn)?;
|
||||
|
||||
let mut buf = BytesMut::new();
|
||||
buf.extend_from_slice(&img[..]);
|
||||
let crc = crc32c::crc32c(&img[..]);
|
||||
buf.put_u32_le(crc);
|
||||
let path = format!("pg_twophase/{:>08X}", xid);
|
||||
let header = new_tar_header(&path, buf.len() as u64)?;
|
||||
self.ar.append(&header, &buf[..])?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
//
|
||||
// Add generated pg_control file
|
||||
// Add generated pg_control file and bootstrap WAL segment.
|
||||
// Also send zenith.signal file with extra bootstrap data.
|
||||
//
|
||||
fn add_pgcontrol_file(&mut self) -> anyhow::Result<()> {
|
||||
let checkpoint_bytes = self
|
||||
.timeline
|
||||
.get_page_at_lsn_nowait(ObjectTag::Checkpoint, self.lsn)?;
|
||||
.get_page_at_lsn(RelishTag::Checkpoint, 0, self.lsn)
|
||||
.context("failed to get checkpoint bytes")?;
|
||||
let pg_control_bytes = self
|
||||
.timeline
|
||||
.get_page_at_lsn_nowait(ObjectTag::ControlFile, self.lsn)?;
|
||||
.get_page_at_lsn(RelishTag::ControlFile, 0, self.lsn)
|
||||
.context("failed get control bytes")?;
|
||||
let mut pg_control = ControlFileData::decode(&pg_control_bytes)?;
|
||||
let mut checkpoint = CheckPoint::decode(&checkpoint_bytes)?;
|
||||
|
||||
// Generate new pg_control and WAL needed for bootstrap
|
||||
let checkpoint_segno = self.lsn.segment_number(pg_constants::WAL_SEGMENT_SIZE);
|
||||
let checkpoint_lsn = XLogSegNoOffsetToRecPtr(
|
||||
checkpoint_segno,
|
||||
XLOG_SIZE_OF_XLOG_LONG_PHD as u32,
|
||||
pg_constants::WAL_SEGMENT_SIZE,
|
||||
);
|
||||
checkpoint.redo = self.lsn.0 + self.lsn.calc_padding(8u32);
|
||||
// Generate new pg_control needed for bootstrap
|
||||
checkpoint.redo = normalize_lsn(self.lsn, pg_constants::WAL_SEGMENT_SIZE).0;
|
||||
|
||||
//reset some fields we don't want to preserve
|
||||
//TODO Check this.
|
||||
//We may need to determine the value from twophase data.
|
||||
checkpoint.oldestActiveXid = 0;
|
||||
|
||||
//save new values in pg_control
|
||||
pg_control.checkPoint = checkpoint_lsn;
|
||||
pg_control.checkPoint = 0;
|
||||
pg_control.checkPointCopy = checkpoint;
|
||||
info!("pg_control.state = {}", pg_control.state);
|
||||
pg_control.state = pg_constants::DB_SHUTDOWNED;
|
||||
|
||||
// add zenith.signal file
|
||||
self.ar
|
||||
.append(&new_tar_header("zenith.signal", 0)?, &b""[..])?;
|
||||
let mut zenith_signal = String::new();
|
||||
if self.prev_record_lsn == Lsn(0) {
|
||||
if self.lsn == self.timeline.get_ancestor_lsn() {
|
||||
write!(zenith_signal, "PREV LSN: none")?;
|
||||
} else {
|
||||
write!(zenith_signal, "PREV LSN: invalid")?;
|
||||
}
|
||||
} else {
|
||||
write!(zenith_signal, "PREV LSN: {}", self.prev_record_lsn)?;
|
||||
}
|
||||
self.ar.append(
|
||||
&new_tar_header("zenith.signal", zenith_signal.len() as u64)?,
|
||||
zenith_signal.as_bytes(),
|
||||
)?;
|
||||
|
||||
//send pg_control
|
||||
let pg_control_bytes = pg_control.encode();
|
||||
@@ -248,73 +286,17 @@ impl<'a> Basebackup<'a> {
|
||||
self.ar.append(&header, &pg_control_bytes[..])?;
|
||||
|
||||
//send wal segment
|
||||
let wal_file_name = XLogFileName(
|
||||
1, // FIXME: always use Postgres timeline 1
|
||||
checkpoint_segno,
|
||||
pg_constants::WAL_SEGMENT_SIZE,
|
||||
);
|
||||
let segno = self.lsn.segment_number(pg_constants::WAL_SEGMENT_SIZE);
|
||||
let wal_file_name = XLogFileName(PG_TLI, segno, pg_constants::WAL_SEGMENT_SIZE);
|
||||
let wal_file_path = format!("pg_wal/{}", wal_file_name);
|
||||
let header = new_tar_header(&wal_file_path, pg_constants::WAL_SEGMENT_SIZE as u64)?;
|
||||
let wal_seg = generate_wal_segment(&pg_control);
|
||||
let wal_seg = generate_wal_segment(segno, pg_control.system_identifier);
|
||||
assert!(wal_seg.len() == pg_constants::WAL_SEGMENT_SIZE);
|
||||
self.ar.append(&header, &wal_seg[..])?;
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Parse a path, relative to the root of PostgreSQL data directory, as
|
||||
/// a PostgreSQL relation data file.
|
||||
///
|
||||
fn parse_rel_file_path(path: &str) -> Result<(), FilePathError> {
|
||||
/*
|
||||
* Relation data files can be in one of the following directories:
|
||||
*
|
||||
* global/
|
||||
* shared relations
|
||||
*
|
||||
* base/<db oid>/
|
||||
* regular relations, default tablespace
|
||||
*
|
||||
* pg_tblspc/<tblspc oid>/<tblspc version>/
|
||||
* within a non-default tablespace (the name of the directory
|
||||
* depends on version)
|
||||
*
|
||||
* And the relation data files themselves have a filename like:
|
||||
*
|
||||
* <oid>.<segment number>
|
||||
*/
|
||||
if let Some(fname) = path.strip_prefix("global/") {
|
||||
let (_relnode, _forknum, _segno) = parse_relfilename(fname)?;
|
||||
|
||||
Ok(())
|
||||
} else if let Some(dbpath) = path.strip_prefix("base/") {
|
||||
let mut s = dbpath.split('/');
|
||||
let dbnode_str = s.next().ok_or(FilePathError::InvalidFileName)?;
|
||||
let _dbnode = dbnode_str.parse::<u32>()?;
|
||||
let fname = s.next().ok_or(FilePathError::InvalidFileName)?;
|
||||
if s.next().is_some() {
|
||||
return Err(FilePathError::InvalidFileName);
|
||||
};
|
||||
|
||||
let (_relnode, _forknum, _segno) = parse_relfilename(fname)?;
|
||||
|
||||
Ok(())
|
||||
} else if path.strip_prefix("pg_tblspc/").is_some() {
|
||||
// TODO
|
||||
error!("tablespaces not implemented yet");
|
||||
Err(FilePathError::InvalidFileName)
|
||||
} else {
|
||||
Err(FilePathError::InvalidFileName)
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Check if it is relational file
|
||||
//
|
||||
fn is_rel_file_path(path: &str) -> bool {
|
||||
parse_rel_file_path(path).is_ok()
|
||||
}
|
||||
|
||||
//
|
||||
// Create new tarball entry header
|
||||
//
|
||||
@@ -333,3 +315,20 @@ fn new_tar_header(path: &str, size: u64) -> anyhow::Result<Header> {
|
||||
header.set_cksum();
|
||||
Ok(header)
|
||||
}
|
||||
|
||||
fn new_tar_header_dir(path: &str) -> anyhow::Result<Header> {
|
||||
let mut header = Header::new_gnu();
|
||||
header.set_size(0);
|
||||
header.set_path(path)?;
|
||||
header.set_mode(0o755); // -rw-------
|
||||
header.set_entry_type(EntryType::dir());
|
||||
header.set_mtime(
|
||||
// use currenttime as last modified time
|
||||
SystemTime::now()
|
||||
.duration_since(SystemTime::UNIX_EPOCH)
|
||||
.unwrap()
|
||||
.as_secs(),
|
||||
);
|
||||
header.set_cksum();
|
||||
Ok(header)
|
||||
}
|
||||
|
||||
31
pageserver/src/bin/dump_layerfile.rs
Normal file
31
pageserver/src/bin/dump_layerfile.rs
Normal file
@@ -0,0 +1,31 @@
|
||||
//! Main entry point for the dump_layerfile executable
|
||||
//!
|
||||
//! A handy tool for debugging, that's all.
|
||||
use anyhow::Result;
|
||||
use clap::{App, Arg};
|
||||
use pageserver::layered_repository::dump_layerfile_from_path;
|
||||
use pageserver::virtual_file;
|
||||
use std::path::PathBuf;
|
||||
use zenith_utils::GIT_VERSION;
|
||||
|
||||
fn main() -> Result<()> {
|
||||
let arg_matches = App::new("Zenith dump_layerfile utility")
|
||||
.about("Dump contents of one layer file, for debugging")
|
||||
.version(GIT_VERSION)
|
||||
.arg(
|
||||
Arg::new("path")
|
||||
.help("Path to file to dump")
|
||||
.required(true)
|
||||
.index(1),
|
||||
)
|
||||
.get_matches();
|
||||
|
||||
let path = PathBuf::from(arg_matches.value_of("path").unwrap());
|
||||
|
||||
// Basic initialization of things that don't change after startup
|
||||
virtual_file::init(10);
|
||||
|
||||
dump_layerfile_from_path(&path)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,258 +1,188 @@
|
||||
//
|
||||
// Main entry point for the Page Server executable
|
||||
//
|
||||
//! Main entry point for the Page Server executable.
|
||||
|
||||
use log::*;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::{
|
||||
env,
|
||||
fs::{File, OpenOptions},
|
||||
io,
|
||||
net::TcpListener,
|
||||
path::{Path, PathBuf},
|
||||
process::exit,
|
||||
thread,
|
||||
time::Duration,
|
||||
};
|
||||
use std::{env, path::Path, str::FromStr};
|
||||
use tracing::*;
|
||||
use zenith_utils::{auth::JwtAuth, logging, postgres_backend::AuthType, tcp_listener, GIT_VERSION};
|
||||
|
||||
use anyhow::{Context, Result};
|
||||
use clap::{App, Arg, ArgMatches};
|
||||
use anyhow::{bail, Context, Result};
|
||||
|
||||
use clap::{App, Arg};
|
||||
use daemonize::Daemonize;
|
||||
|
||||
use slog::{Drain, FnValue};
|
||||
|
||||
use pageserver::{branches, page_cache, page_service, tui, PageServerConf};
|
||||
|
||||
const DEFAULT_LISTEN_ADDR: &str = "127.0.0.1:64000";
|
||||
|
||||
const DEFAULT_GC_HORIZON: u64 = 64 * 1024 * 1024;
|
||||
const DEFAULT_GC_PERIOD: Duration = Duration::from_secs(10);
|
||||
|
||||
/// String arguments that can be declared via CLI or config file
|
||||
#[derive(Serialize, Deserialize)]
|
||||
struct CfgFileParams {
|
||||
listen_addr: Option<String>,
|
||||
gc_horizon: Option<String>,
|
||||
gc_period: Option<String>,
|
||||
pg_distrib_dir: Option<String>,
|
||||
}
|
||||
|
||||
impl CfgFileParams {
|
||||
/// Extract string arguments from CLI
|
||||
fn from_args(arg_matches: &ArgMatches) -> Self {
|
||||
let get_arg = |arg_name: &str| -> Option<String> {
|
||||
arg_matches.value_of(arg_name).map(str::to_owned)
|
||||
};
|
||||
|
||||
Self {
|
||||
listen_addr: get_arg("listen"),
|
||||
gc_horizon: get_arg("gc_horizon"),
|
||||
gc_period: get_arg("gc_period"),
|
||||
pg_distrib_dir: get_arg("postgres-distrib"),
|
||||
}
|
||||
}
|
||||
|
||||
/// Fill missing values in `self` with `other`
|
||||
fn or(self, other: CfgFileParams) -> Self {
|
||||
// TODO cleaner way to do this
|
||||
Self {
|
||||
listen_addr: self.listen_addr.or(other.listen_addr),
|
||||
gc_horizon: self.gc_horizon.or(other.gc_horizon),
|
||||
gc_period: self.gc_period.or(other.gc_period),
|
||||
pg_distrib_dir: self.pg_distrib_dir.or(other.pg_distrib_dir),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create a PageServerConf from these string parameters
|
||||
fn try_into_config(&self) -> Result<PageServerConf> {
|
||||
let listen_addr = match self.listen_addr.as_ref() {
|
||||
Some(addr) => addr.clone(),
|
||||
None => DEFAULT_LISTEN_ADDR.to_owned(),
|
||||
};
|
||||
|
||||
let gc_horizon: u64 = match self.gc_horizon.as_ref() {
|
||||
Some(horizon_str) => horizon_str.parse()?,
|
||||
None => DEFAULT_GC_HORIZON,
|
||||
};
|
||||
|
||||
let gc_period: Duration = match self.gc_period.as_ref() {
|
||||
Some(period_str) => parse_duration::parse(period_str)?,
|
||||
None => DEFAULT_GC_PERIOD,
|
||||
};
|
||||
|
||||
let pg_distrib_dir = match self.pg_distrib_dir.as_ref() {
|
||||
Some(pg_distrib_dir_str) => PathBuf::from(pg_distrib_dir_str),
|
||||
None => env::current_dir()?.join("tmp_install"),
|
||||
};
|
||||
|
||||
if !pg_distrib_dir.join("bin/postgres").exists() {
|
||||
anyhow::bail!("Can't find postgres binary at {:?}", pg_distrib_dir);
|
||||
}
|
||||
|
||||
Ok(PageServerConf {
|
||||
daemonize: false,
|
||||
interactive: false,
|
||||
|
||||
listen_addr,
|
||||
gc_horizon,
|
||||
gc_period,
|
||||
|
||||
workdir: PathBuf::from("."),
|
||||
|
||||
pg_distrib_dir,
|
||||
})
|
||||
}
|
||||
}
|
||||
use pageserver::{
|
||||
branches,
|
||||
config::{defaults::*, PageServerConf},
|
||||
http, page_cache, page_service, remote_storage, tenant_mgr, thread_mgr,
|
||||
thread_mgr::ThreadKind,
|
||||
virtual_file, LOG_FILE_NAME,
|
||||
};
|
||||
use zenith_utils::http::endpoint;
|
||||
use zenith_utils::postgres_backend;
|
||||
use zenith_utils::shutdown::exit_now;
|
||||
use zenith_utils::signals::{self, Signal};
|
||||
|
||||
fn main() -> Result<()> {
|
||||
zenith_metrics::set_common_metrics_prefix("pageserver");
|
||||
let arg_matches = App::new("Zenith page server")
|
||||
.about("Materializes WAL stream to pages and serves them to the postgres")
|
||||
.version(GIT_VERSION)
|
||||
.arg(
|
||||
Arg::with_name("listen")
|
||||
.short("l")
|
||||
.long("listen")
|
||||
.takes_value(true)
|
||||
.help("listen for incoming page requests on ip:port (default: 127.0.0.1:5430)"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("interactive")
|
||||
.short("i")
|
||||
.long("interactive")
|
||||
.takes_value(false)
|
||||
.help("Interactive mode"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("daemonize")
|
||||
.short("d")
|
||||
Arg::new("daemonize")
|
||||
.short('d')
|
||||
.long("daemonize")
|
||||
.takes_value(false)
|
||||
.help("Run in the background"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("init")
|
||||
Arg::new("init")
|
||||
.long("init")
|
||||
.takes_value(false)
|
||||
.help("Initialize pageserver repo"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("gc_horizon")
|
||||
.long("gc_horizon")
|
||||
.takes_value(true)
|
||||
.help("Distance from current LSN to perform all wal records cleanup"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("gc_period")
|
||||
.long("gc_period")
|
||||
.takes_value(true)
|
||||
.help("Interval between garbage collector iterations"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("workdir")
|
||||
.short("D")
|
||||
Arg::new("workdir")
|
||||
.short('D')
|
||||
.long("workdir")
|
||||
.takes_value(true)
|
||||
.help("Working directory for the pageserver"),
|
||||
)
|
||||
.arg(
|
||||
Arg::with_name("postgres-distrib")
|
||||
.long("postgres-distrib")
|
||||
Arg::new("create-tenant")
|
||||
.long("create-tenant")
|
||||
.takes_value(true)
|
||||
.help("Postgres distribution directory"),
|
||||
.help("Create tenant during init")
|
||||
.requires("init"),
|
||||
)
|
||||
// See `settings.md` for more details on the extra configuration patameters pageserver can process
|
||||
.arg(
|
||||
Arg::new("config-override")
|
||||
.short('c')
|
||||
.takes_value(true)
|
||||
.number_of_values(1)
|
||||
.multiple_occurrences(true)
|
||||
.help("Additional configuration overrides of the ones from the toml config file (or new ones to add there).
|
||||
Any option has to be a valid toml document, example: `-c=\"foo='hey'\"` `-c=\"foo={value=1}\"`"),
|
||||
)
|
||||
.get_matches();
|
||||
|
||||
let workdir = Path::new(arg_matches.value_of("workdir").unwrap_or(".zenith"));
|
||||
let cfg_file_path = workdir.canonicalize()?.join("pageserver.toml");
|
||||
|
||||
let args_params = CfgFileParams::from_args(&arg_matches);
|
||||
let workdir = workdir
|
||||
.canonicalize()
|
||||
.with_context(|| format!("Error opening workdir '{}'", workdir.display()))?;
|
||||
let cfg_file_path = workdir.join("pageserver.toml");
|
||||
|
||||
let init = arg_matches.is_present("init");
|
||||
let params = if init {
|
||||
let create_tenant = arg_matches.value_of("create-tenant");
|
||||
|
||||
// Set CWD to workdir for non-daemon modes
|
||||
env::set_current_dir(&workdir).with_context(|| {
|
||||
format!(
|
||||
"Failed to set application's current dir to '{}'",
|
||||
workdir.display()
|
||||
)
|
||||
})?;
|
||||
|
||||
let daemonize = arg_matches.is_present("daemonize");
|
||||
if init && daemonize {
|
||||
bail!("--daemonize cannot be used with --init")
|
||||
}
|
||||
|
||||
let mut toml = if init {
|
||||
// We're initializing the repo, so there's no config file yet
|
||||
args_params
|
||||
DEFAULT_CONFIG_FILE
|
||||
.parse::<toml_edit::Document>()
|
||||
.expect("could not parse built-in config file")
|
||||
} else {
|
||||
// Supplement the CLI arguments with the config file
|
||||
let cfg_file_contents = std::fs::read_to_string(&cfg_file_path)?;
|
||||
let file_params: CfgFileParams = toml::from_str(&cfg_file_contents)?;
|
||||
args_params.or(file_params)
|
||||
let cfg_file_contents = std::fs::read_to_string(&cfg_file_path)
|
||||
.with_context(|| format!("No pageserver config at '{}'", cfg_file_path.display()))?;
|
||||
cfg_file_contents
|
||||
.parse::<toml_edit::Document>()
|
||||
.with_context(|| {
|
||||
format!(
|
||||
"Failed to read '{}' as pageserver config",
|
||||
cfg_file_path.display()
|
||||
)
|
||||
})?
|
||||
};
|
||||
|
||||
// Ensure the config is valid, even if just init-ing
|
||||
let mut conf = params.try_into_config()?;
|
||||
// Process any extra options given with -c
|
||||
if let Some(values) = arg_matches.values_of("config-override") {
|
||||
for option_line in values {
|
||||
let doc = toml_edit::Document::from_str(option_line).with_context(|| {
|
||||
format!(
|
||||
"Option '{}' could not be parsed as a toml document",
|
||||
option_line
|
||||
)
|
||||
})?;
|
||||
|
||||
conf.daemonize = arg_matches.is_present("daemonize");
|
||||
conf.interactive = arg_matches.is_present("interactive");
|
||||
|
||||
if init && (conf.daemonize || conf.interactive) {
|
||||
eprintln!("--daemonize and --interactive may not be used with --init");
|
||||
exit(1);
|
||||
}
|
||||
|
||||
if conf.daemonize && conf.interactive {
|
||||
eprintln!("--daemonize is not allowed with --interactive: choose one");
|
||||
exit(1);
|
||||
for (key, item) in doc.iter() {
|
||||
if key == "id" {
|
||||
anyhow::ensure!(
|
||||
init,
|
||||
"node id can only be set during pageserver init and cannot be overridden"
|
||||
);
|
||||
}
|
||||
toml.insert(key, item.clone());
|
||||
}
|
||||
}
|
||||
}
|
||||
trace!("Resulting toml: {}", toml);
|
||||
let conf = PageServerConf::parse_and_validate(&toml, &workdir)
|
||||
.context("Failed to parse pageserver configuration")?;
|
||||
|
||||
// The configuration is all set up now. Turn it into a 'static
|
||||
// that can be freely stored in structs and passed across threads
|
||||
// as a ref.
|
||||
let conf: &'static PageServerConf = Box::leak(Box::new(conf));
|
||||
|
||||
// Basic initialization of things that don't change after startup
|
||||
virtual_file::init(conf.max_file_descriptors);
|
||||
|
||||
page_cache::init(conf);
|
||||
|
||||
// Create repo and exit if init was requested
|
||||
if init {
|
||||
branches::init_repo(conf, &workdir)?;
|
||||
|
||||
branches::init_pageserver(conf, create_tenant).context("Failed to init pageserver")?;
|
||||
// write the config file
|
||||
let cfg_file_contents = toml::to_string_pretty(¶ms)?;
|
||||
std::fs::write(&cfg_file_path, cfg_file_contents)?;
|
||||
|
||||
return Ok(());
|
||||
std::fs::write(&cfg_file_path, toml.to_string()).with_context(|| {
|
||||
format!(
|
||||
"Failed to initialize pageserver config at '{}'",
|
||||
cfg_file_path.display()
|
||||
)
|
||||
})?;
|
||||
Ok(())
|
||||
} else {
|
||||
start_pageserver(conf, daemonize).context("Failed to start pageserver")
|
||||
}
|
||||
|
||||
// Set CWD to workdir for non-daemon modes
|
||||
env::set_current_dir(&workdir)?;
|
||||
|
||||
start_pageserver(conf)
|
||||
}
|
||||
|
||||
fn start_pageserver(conf: &'static PageServerConf) -> Result<()> {
|
||||
let log_filename = "pageserver.log";
|
||||
// Don't open the same file for output multiple times;
|
||||
// the different fds could overwrite each other's output.
|
||||
let log_file = OpenOptions::new()
|
||||
.create(true)
|
||||
.append(true)
|
||||
.open(&log_filename)
|
||||
.with_context(|| format!("failed to open {:?}", &log_filename))?;
|
||||
|
||||
fn start_pageserver(conf: &'static PageServerConf, daemonize: bool) -> Result<()> {
|
||||
// Initialize logger
|
||||
let logger_file = log_file.try_clone().unwrap();
|
||||
let _scope_guard = init_logging(&conf, logger_file)?;
|
||||
let _log_guard = slog_stdlog::init()?;
|
||||
let log_file = logging::init(LOG_FILE_NAME, daemonize)?;
|
||||
|
||||
// Note: this `info!(...)` macro comes from `log` crate
|
||||
info!("standard logging redirected to slog");
|
||||
|
||||
let tui_thread = if conf.interactive {
|
||||
// Initialize the UI
|
||||
Some(
|
||||
thread::Builder::new()
|
||||
.name("UI thread".into())
|
||||
.spawn(|| {
|
||||
let _ = tui::ui_main();
|
||||
})
|
||||
.unwrap(),
|
||||
)
|
||||
} else {
|
||||
None
|
||||
};
|
||||
info!("version: {}", GIT_VERSION);
|
||||
|
||||
// TODO: Check that it looks like a valid repository before going further
|
||||
|
||||
if conf.daemonize {
|
||||
// bind sockets before daemonizing so we report errors early and do not return until we are listening
|
||||
info!(
|
||||
"Starting pageserver http handler on {}",
|
||||
conf.listen_http_addr
|
||||
);
|
||||
let http_listener = tcp_listener::bind(conf.listen_http_addr.clone())?;
|
||||
|
||||
info!(
|
||||
"Starting pageserver pg protocol handler on {}",
|
||||
conf.listen_pg_addr
|
||||
);
|
||||
let pageserver_listener = tcp_listener::bind(conf.listen_pg_addr.clone())?;
|
||||
|
||||
// NB: Don't spawn any threads before daemonizing!
|
||||
if daemonize {
|
||||
info!("daemonizing...");
|
||||
|
||||
// There should'n be any logging to stdin/stdout. Redirect it to the main log so
|
||||
// There shouldn't be any logging to stdin/stdout. Redirect it to the main log so
|
||||
// that we will see any accidental manual fprintf's or backtraces.
|
||||
let stdout = log_file.try_clone().unwrap();
|
||||
let stderr = log_file;
|
||||
@@ -263,85 +193,104 @@ fn start_pageserver(conf: &'static PageServerConf) -> Result<()> {
|
||||
.stdout(stdout)
|
||||
.stderr(stderr);
|
||||
|
||||
match daemonize.start() {
|
||||
// XXX: The parent process should exit abruptly right after
|
||||
// it has spawned a child to prevent coverage machinery from
|
||||
// dumping stats into a `profraw` file now owned by the child.
|
||||
// Otherwise, the coverage data will be damaged.
|
||||
match daemonize.exit_action(|| exit_now(0)).start() {
|
||||
Ok(_) => info!("Success, daemonized"),
|
||||
Err(e) => error!("Error, {}", e),
|
||||
Err(err) => error!(%err, "could not daemonize"),
|
||||
}
|
||||
}
|
||||
|
||||
// Check that we can bind to address before further initialization
|
||||
info!("Starting pageserver on {}", conf.listen_addr);
|
||||
let pageserver_listener = TcpListener::bind(conf.listen_addr.clone())?;
|
||||
let signals = signals::install_shutdown_handlers()?;
|
||||
let sync_startup = remote_storage::start_local_timeline_sync(conf)
|
||||
.context("Failed to set up local files sync with external storage")?;
|
||||
|
||||
// Initialize page cache, this will spawn walredo_thread
|
||||
page_cache::init(conf);
|
||||
// Initialize tenant manager.
|
||||
tenant_mgr::set_timeline_states(conf, sync_startup.initial_timeline_states);
|
||||
|
||||
// Spawn a thread to listen for connections. It will spawn further threads
|
||||
// initialize authentication for incoming connections
|
||||
let auth = match &conf.auth_type {
|
||||
AuthType::Trust | AuthType::MD5 => None,
|
||||
AuthType::ZenithJWT => {
|
||||
// unwrap is ok because check is performed when creating config, so path is set and file exists
|
||||
let key_path = conf.auth_validation_public_key_path.as_ref().unwrap();
|
||||
Some(JwtAuth::from_key_path(key_path)?.into())
|
||||
}
|
||||
};
|
||||
info!("Using auth: {:#?}", conf.auth_type);
|
||||
|
||||
// Spawn a new thread for the http endpoint
|
||||
// bind before launching separate thread so the error reported before startup exits
|
||||
let auth_cloned = auth.clone();
|
||||
thread_mgr::spawn(
|
||||
ThreadKind::HttpEndpointListener,
|
||||
None,
|
||||
None,
|
||||
"http_endpoint_thread",
|
||||
move || {
|
||||
let router = http::make_router(conf, auth_cloned);
|
||||
endpoint::serve_thread_main(router, http_listener, thread_mgr::shutdown_watcher())
|
||||
},
|
||||
)?;
|
||||
|
||||
// Spawn a thread to listen for libpq connections. It will spawn further threads
|
||||
// for each connection.
|
||||
let page_service_thread = thread::Builder::new()
|
||||
.name("Page Service thread".into())
|
||||
.spawn(move || page_service::thread_main(conf, pageserver_listener))?;
|
||||
thread_mgr::spawn(
|
||||
ThreadKind::LibpqEndpointListener,
|
||||
None,
|
||||
None,
|
||||
"libpq endpoint thread",
|
||||
move || page_service::thread_main(conf, auth, pageserver_listener, conf.auth_type),
|
||||
)?;
|
||||
|
||||
if let Some(tui_thread) = tui_thread {
|
||||
// The TUI thread exits when the user asks to Quit.
|
||||
tui_thread.join().unwrap();
|
||||
} else {
|
||||
page_service_thread
|
||||
.join()
|
||||
.expect("Page service thread has panicked")?
|
||||
}
|
||||
signals.handle(|signal| match signal {
|
||||
Signal::Quit => {
|
||||
info!(
|
||||
"Got {}. Terminating in immediate shutdown mode",
|
||||
signal.name()
|
||||
);
|
||||
std::process::exit(111);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
Signal::Interrupt | Signal::Terminate => {
|
||||
info!(
|
||||
"Got {}. Terminating gracefully in fast shutdown mode",
|
||||
signal.name()
|
||||
);
|
||||
shutdown_pageserver();
|
||||
unreachable!()
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
fn init_logging(
|
||||
conf: &PageServerConf,
|
||||
log_file: File,
|
||||
) -> Result<slog_scope::GlobalLoggerGuard, io::Error> {
|
||||
if conf.interactive {
|
||||
Ok(tui::init_logging())
|
||||
} else if conf.daemonize {
|
||||
let decorator = slog_term::PlainSyncDecorator::new(log_file);
|
||||
let drain = slog_term::FullFormat::new(decorator).build();
|
||||
let drain = slog::Filter::new(drain, |record: &slog::Record| {
|
||||
if record.level().is_at_least(slog::Level::Info) {
|
||||
return true;
|
||||
}
|
||||
false
|
||||
});
|
||||
let drain = std::sync::Mutex::new(drain).fuse();
|
||||
let logger = slog::Logger::root(
|
||||
drain,
|
||||
slog::o!(
|
||||
"location" =>
|
||||
FnValue(move |record| {
|
||||
format!("{}, {}:{}",
|
||||
record.module(),
|
||||
record.file(),
|
||||
record.line()
|
||||
)
|
||||
}
|
||||
)
|
||||
),
|
||||
);
|
||||
Ok(slog_scope::set_global_logger(logger))
|
||||
} else {
|
||||
let decorator = slog_term::TermDecorator::new().build();
|
||||
let drain = slog_term::FullFormat::new(decorator).build().fuse();
|
||||
let drain = slog_async::Async::new(drain).chan_size(1000).build().fuse();
|
||||
let drain = slog::Filter::new(drain, |record: &slog::Record| {
|
||||
if record.level().is_at_least(slog::Level::Info) {
|
||||
return true;
|
||||
}
|
||||
if record.level().is_at_least(slog::Level::Debug)
|
||||
&& record.module().starts_with("pageserver")
|
||||
{
|
||||
return true;
|
||||
}
|
||||
false
|
||||
})
|
||||
.fuse();
|
||||
let logger = slog::Logger::root(drain, slog::o!());
|
||||
Ok(slog_scope::set_global_logger(logger))
|
||||
}
|
||||
fn shutdown_pageserver() {
|
||||
// Shut down the libpq endpoint thread. This prevents new connections from
|
||||
// being accepted.
|
||||
thread_mgr::shutdown_threads(Some(ThreadKind::LibpqEndpointListener), None, None);
|
||||
|
||||
// Shut down any page service threads.
|
||||
postgres_backend::set_pgbackend_shutdown_requested();
|
||||
thread_mgr::shutdown_threads(Some(ThreadKind::PageRequestHandler), None, None);
|
||||
|
||||
// Shut down all the tenants. This flushes everything to disk and kills
|
||||
// the checkpoint and GC threads.
|
||||
tenant_mgr::shutdown_all_tenants();
|
||||
|
||||
// Stop syncing with remote storage.
|
||||
//
|
||||
// FIXME: Does this wait for the sync thread to finish syncing what's queued up?
|
||||
// Should it?
|
||||
thread_mgr::shutdown_threads(Some(ThreadKind::StorageSync), None, None);
|
||||
|
||||
// Shut down the HTTP endpoint last, so that you can still check the server's
|
||||
// status while it's shutting down.
|
||||
thread_mgr::shutdown_threads(Some(ThreadKind::HttpEndpointListener), None, None);
|
||||
|
||||
// There should be nothing left, but let's be sure
|
||||
thread_mgr::shutdown_threads(None, None, None);
|
||||
|
||||
info!("Shut down successfully completed");
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
334
pageserver/src/bin/pageserver_zst.rs
Normal file
334
pageserver/src/bin/pageserver_zst.rs
Normal file
@@ -0,0 +1,334 @@
|
||||
//! A CLI helper to deal with remote storage (S3, usually) blobs as archives.
|
||||
//! See [`compression`] for more details about the archives.
|
||||
|
||||
use std::{collections::BTreeSet, path::Path};
|
||||
|
||||
use anyhow::{bail, ensure, Context};
|
||||
use clap::{App, Arg};
|
||||
use pageserver::{
|
||||
layered_repository::metadata::{TimelineMetadata, METADATA_FILE_NAME},
|
||||
remote_storage::compression,
|
||||
};
|
||||
use tokio::{fs, io};
|
||||
use zenith_utils::GIT_VERSION;
|
||||
|
||||
const LIST_SUBCOMMAND: &str = "list";
|
||||
const ARCHIVE_ARG_NAME: &str = "archive";
|
||||
|
||||
const EXTRACT_SUBCOMMAND: &str = "extract";
|
||||
const TARGET_DIRECTORY_ARG_NAME: &str = "target_directory";
|
||||
|
||||
const CREATE_SUBCOMMAND: &str = "create";
|
||||
const SOURCE_DIRECTORY_ARG_NAME: &str = "source_directory";
|
||||
|
||||
#[tokio::main(flavor = "current_thread")]
|
||||
async fn main() -> anyhow::Result<()> {
|
||||
let arg_matches = App::new("pageserver zst blob [un]compressor utility")
|
||||
.version(GIT_VERSION)
|
||||
.subcommands(vec![
|
||||
App::new(LIST_SUBCOMMAND)
|
||||
.about("List the archive contents")
|
||||
.arg(
|
||||
Arg::new(ARCHIVE_ARG_NAME)
|
||||
.required(true)
|
||||
.takes_value(true)
|
||||
.help("An archive to list the contents of"),
|
||||
),
|
||||
App::new(EXTRACT_SUBCOMMAND)
|
||||
.about("Extracts the archive into the directory")
|
||||
.arg(
|
||||
Arg::new(ARCHIVE_ARG_NAME)
|
||||
.required(true)
|
||||
.takes_value(true)
|
||||
.help("An archive to extract"),
|
||||
)
|
||||
.arg(
|
||||
Arg::new(TARGET_DIRECTORY_ARG_NAME)
|
||||
.required(false)
|
||||
.takes_value(true)
|
||||
.help("A directory to extract the archive into. Optional, will use the current directory if not specified"),
|
||||
),
|
||||
App::new(CREATE_SUBCOMMAND)
|
||||
.about("Creates an archive with the contents of a directory (only the first level files are taken, metadata file has to be present in the same directory)")
|
||||
.arg(
|
||||
Arg::new(SOURCE_DIRECTORY_ARG_NAME)
|
||||
.required(true)
|
||||
.takes_value(true)
|
||||
.help("A directory to use for creating the archive"),
|
||||
)
|
||||
.arg(
|
||||
Arg::new(TARGET_DIRECTORY_ARG_NAME)
|
||||
.required(false)
|
||||
.takes_value(true)
|
||||
.help("A directory to create the archive in. Optional, will use the current directory if not specified"),
|
||||
),
|
||||
])
|
||||
.get_matches();
|
||||
|
||||
let subcommand_name = match arg_matches.subcommand_name() {
|
||||
Some(name) => name,
|
||||
None => bail!("No subcommand specified"),
|
||||
};
|
||||
|
||||
let subcommand_matches = match arg_matches.subcommand_matches(subcommand_name) {
|
||||
Some(matches) => matches,
|
||||
None => bail!(
|
||||
"No subcommand arguments were recognized for subcommand '{}'",
|
||||
subcommand_name
|
||||
),
|
||||
};
|
||||
|
||||
let target_dir = Path::new(
|
||||
subcommand_matches
|
||||
.value_of(TARGET_DIRECTORY_ARG_NAME)
|
||||
.unwrap_or("./"),
|
||||
);
|
||||
|
||||
match subcommand_name {
|
||||
LIST_SUBCOMMAND => {
|
||||
let archive = match subcommand_matches.value_of(ARCHIVE_ARG_NAME) {
|
||||
Some(archive) => Path::new(archive),
|
||||
None => bail!("No '{}' argument is specified", ARCHIVE_ARG_NAME),
|
||||
};
|
||||
list_archive(archive).await
|
||||
}
|
||||
EXTRACT_SUBCOMMAND => {
|
||||
let archive = match subcommand_matches.value_of(ARCHIVE_ARG_NAME) {
|
||||
Some(archive) => Path::new(archive),
|
||||
None => bail!("No '{}' argument is specified", ARCHIVE_ARG_NAME),
|
||||
};
|
||||
extract_archive(archive, target_dir).await
|
||||
}
|
||||
CREATE_SUBCOMMAND => {
|
||||
let source_dir = match subcommand_matches.value_of(SOURCE_DIRECTORY_ARG_NAME) {
|
||||
Some(source) => Path::new(source),
|
||||
None => bail!("No '{}' argument is specified", SOURCE_DIRECTORY_ARG_NAME),
|
||||
};
|
||||
create_archive(source_dir, target_dir).await
|
||||
}
|
||||
unknown => bail!("Unknown subcommand {}", unknown),
|
||||
}
|
||||
}
|
||||
|
||||
async fn list_archive(archive: &Path) -> anyhow::Result<()> {
|
||||
let archive = archive.canonicalize().with_context(|| {
|
||||
format!(
|
||||
"Failed to get the absolute path for the archive path '{}'",
|
||||
archive.display()
|
||||
)
|
||||
})?;
|
||||
ensure!(
|
||||
archive.is_file(),
|
||||
"Path '{}' is not an archive file",
|
||||
archive.display()
|
||||
);
|
||||
println!("Listing an archive at path '{}'", archive.display());
|
||||
let archive_name = match archive.file_name().and_then(|name| name.to_str()) {
|
||||
Some(name) => name,
|
||||
None => bail!(
|
||||
"Failed to get the archive name from the path '{}'",
|
||||
archive.display()
|
||||
),
|
||||
};
|
||||
|
||||
let archive_bytes = fs::read(&archive)
|
||||
.await
|
||||
.context("Failed to read the archive bytes")?;
|
||||
|
||||
let header = compression::read_archive_header(archive_name, &mut archive_bytes.as_slice())
|
||||
.await
|
||||
.context("Failed to read the archive header")?;
|
||||
|
||||
let empty_path = Path::new("");
|
||||
println!("-------------------------------");
|
||||
|
||||
let longest_path_in_archive = header
|
||||
.files
|
||||
.iter()
|
||||
.filter_map(|file| Some(file.subpath.as_path(empty_path).to_str()?.len()))
|
||||
.max()
|
||||
.unwrap_or_default()
|
||||
.max(METADATA_FILE_NAME.len());
|
||||
|
||||
for regular_file in &header.files {
|
||||
println!(
|
||||
"File: {:width$} uncompressed size: {} bytes",
|
||||
regular_file.subpath.as_path(empty_path).display(),
|
||||
regular_file.size,
|
||||
width = longest_path_in_archive,
|
||||
)
|
||||
}
|
||||
println!(
|
||||
"File: {:width$} uncompressed size: {} bytes",
|
||||
METADATA_FILE_NAME,
|
||||
header.metadata_file_size,
|
||||
width = longest_path_in_archive,
|
||||
);
|
||||
println!("-------------------------------");
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn extract_archive(archive: &Path, target_dir: &Path) -> anyhow::Result<()> {
|
||||
let archive = archive.canonicalize().with_context(|| {
|
||||
format!(
|
||||
"Failed to get the absolute path for the archive path '{}'",
|
||||
archive.display()
|
||||
)
|
||||
})?;
|
||||
ensure!(
|
||||
archive.is_file(),
|
||||
"Path '{}' is not an archive file",
|
||||
archive.display()
|
||||
);
|
||||
let archive_name = match archive.file_name().and_then(|name| name.to_str()) {
|
||||
Some(name) => name,
|
||||
None => bail!(
|
||||
"Failed to get the archive name from the path '{}'",
|
||||
archive.display()
|
||||
),
|
||||
};
|
||||
|
||||
if !target_dir.exists() {
|
||||
fs::create_dir_all(target_dir).await.with_context(|| {
|
||||
format!(
|
||||
"Failed to create the target dir at path '{}'",
|
||||
target_dir.display()
|
||||
)
|
||||
})?;
|
||||
}
|
||||
let target_dir = target_dir.canonicalize().with_context(|| {
|
||||
format!(
|
||||
"Failed to get the absolute path for the target dir path '{}'",
|
||||
target_dir.display()
|
||||
)
|
||||
})?;
|
||||
ensure!(
|
||||
target_dir.is_dir(),
|
||||
"Path '{}' is not a directory",
|
||||
target_dir.display()
|
||||
);
|
||||
let mut dir_contents = fs::read_dir(&target_dir)
|
||||
.await
|
||||
.context("Failed to list the target directory contents")?;
|
||||
let dir_entry = dir_contents
|
||||
.next_entry()
|
||||
.await
|
||||
.context("Failed to list the target directory contents")?;
|
||||
ensure!(
|
||||
dir_entry.is_none(),
|
||||
"Target directory '{}' is not empty",
|
||||
target_dir.display()
|
||||
);
|
||||
|
||||
println!(
|
||||
"Extracting an archive at path '{}' into directory '{}'",
|
||||
archive.display(),
|
||||
target_dir.display()
|
||||
);
|
||||
|
||||
let mut archive_file = fs::File::open(&archive).await.with_context(|| {
|
||||
format!(
|
||||
"Failed to get the archive name from the path '{}'",
|
||||
archive.display()
|
||||
)
|
||||
})?;
|
||||
let header = compression::read_archive_header(archive_name, &mut archive_file)
|
||||
.await
|
||||
.context("Failed to read the archive header")?;
|
||||
compression::uncompress_with_header(&BTreeSet::new(), &target_dir, header, &mut archive_file)
|
||||
.await
|
||||
.context("Failed to extract the archive")
|
||||
}
|
||||
|
||||
async fn create_archive(source_dir: &Path, target_dir: &Path) -> anyhow::Result<()> {
|
||||
let source_dir = source_dir.canonicalize().with_context(|| {
|
||||
format!(
|
||||
"Failed to get the absolute path for the source dir path '{}'",
|
||||
source_dir.display()
|
||||
)
|
||||
})?;
|
||||
ensure!(
|
||||
source_dir.is_dir(),
|
||||
"Path '{}' is not a directory",
|
||||
source_dir.display()
|
||||
);
|
||||
|
||||
if !target_dir.exists() {
|
||||
fs::create_dir_all(target_dir).await.with_context(|| {
|
||||
format!(
|
||||
"Failed to create the target dir at path '{}'",
|
||||
target_dir.display()
|
||||
)
|
||||
})?;
|
||||
}
|
||||
let target_dir = target_dir.canonicalize().with_context(|| {
|
||||
format!(
|
||||
"Failed to get the absolute path for the target dir path '{}'",
|
||||
target_dir.display()
|
||||
)
|
||||
})?;
|
||||
ensure!(
|
||||
target_dir.is_dir(),
|
||||
"Path '{}' is not a directory",
|
||||
target_dir.display()
|
||||
);
|
||||
|
||||
println!(
|
||||
"Compressing directory '{}' and creating resulting archive in directory '{}'",
|
||||
source_dir.display(),
|
||||
target_dir.display()
|
||||
);
|
||||
|
||||
let mut metadata_file_contents = None;
|
||||
let mut files_co_archive = Vec::new();
|
||||
|
||||
let mut source_dir_contents = fs::read_dir(&source_dir)
|
||||
.await
|
||||
.context("Failed to read the source directory contents")?;
|
||||
|
||||
while let Some(source_dir_entry) = source_dir_contents
|
||||
.next_entry()
|
||||
.await
|
||||
.context("Failed to read a source dir entry")?
|
||||
{
|
||||
let entry_path = source_dir_entry.path();
|
||||
if entry_path.is_file() {
|
||||
if entry_path.file_name().and_then(|name| name.to_str()) == Some(METADATA_FILE_NAME) {
|
||||
let metadata_bytes = fs::read(entry_path)
|
||||
.await
|
||||
.context("Failed to read metata file bytes in the source dir")?;
|
||||
metadata_file_contents = Some(
|
||||
TimelineMetadata::from_bytes(&metadata_bytes)
|
||||
.context("Failed to parse metata file contents in the source dir")?,
|
||||
);
|
||||
} else {
|
||||
files_co_archive.push(entry_path);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let metadata = match metadata_file_contents {
|
||||
Some(metadata) => metadata,
|
||||
None => bail!(
|
||||
"No metadata file found in the source dir '{}', cannot create the archive",
|
||||
source_dir.display()
|
||||
),
|
||||
};
|
||||
|
||||
let _ = compression::archive_files_as_stream(
|
||||
&source_dir,
|
||||
files_co_archive.iter(),
|
||||
&metadata,
|
||||
move |mut archive_streamer, archive_name| async move {
|
||||
let archive_target = target_dir.join(&archive_name);
|
||||
let mut archive_file = fs::File::create(&archive_target).await?;
|
||||
io::copy(&mut archive_streamer, &mut archive_file).await?;
|
||||
Ok(archive_target)
|
||||
},
|
||||
)
|
||||
.await
|
||||
.context("Failed to create an archive")?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
72
pageserver/src/bin/update_metadata.rs
Normal file
72
pageserver/src/bin/update_metadata.rs
Normal file
@@ -0,0 +1,72 @@
|
||||
//! Main entry point for the edit_metadata executable
|
||||
//!
|
||||
//! A handy tool for debugging, that's all.
|
||||
use anyhow::Result;
|
||||
use clap::{App, Arg};
|
||||
use pageserver::layered_repository::metadata::TimelineMetadata;
|
||||
use std::path::PathBuf;
|
||||
use std::str::FromStr;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use zenith_utils::GIT_VERSION;
|
||||
|
||||
fn main() -> Result<()> {
|
||||
let arg_matches = App::new("Zenith update metadata utility")
|
||||
.about("Dump or update metadata file")
|
||||
.version(GIT_VERSION)
|
||||
.arg(
|
||||
Arg::new("path")
|
||||
.help("Path to metadata file")
|
||||
.required(true),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("disk_lsn")
|
||||
.short('d')
|
||||
.long("disk_lsn")
|
||||
.takes_value(true)
|
||||
.help("Replace disk constistent lsn"),
|
||||
)
|
||||
.arg(
|
||||
Arg::new("prev_lsn")
|
||||
.short('p')
|
||||
.long("prev_lsn")
|
||||
.takes_value(true)
|
||||
.help("Previous record LSN"),
|
||||
)
|
||||
.get_matches();
|
||||
|
||||
let path = PathBuf::from(arg_matches.value_of("path").unwrap());
|
||||
let metadata_bytes = std::fs::read(&path)?;
|
||||
let mut meta = TimelineMetadata::from_bytes(&metadata_bytes)?;
|
||||
println!("Current metadata:\n{:?}", &meta);
|
||||
|
||||
let mut update_meta = false;
|
||||
|
||||
if let Some(disk_lsn) = arg_matches.value_of("disk_lsn") {
|
||||
meta = TimelineMetadata::new(
|
||||
Lsn::from_str(disk_lsn)?,
|
||||
meta.prev_record_lsn(),
|
||||
meta.ancestor_timeline(),
|
||||
meta.ancestor_lsn(),
|
||||
meta.latest_gc_cutoff_lsn(),
|
||||
meta.initdb_lsn(),
|
||||
);
|
||||
update_meta = true;
|
||||
}
|
||||
|
||||
if let Some(prev_lsn) = arg_matches.value_of("prev_lsn") {
|
||||
meta = TimelineMetadata::new(
|
||||
meta.disk_consistent_lsn(),
|
||||
Some(Lsn::from_str(prev_lsn)?),
|
||||
meta.ancestor_timeline(),
|
||||
meta.ancestor_lsn(),
|
||||
meta.latest_gc_cutoff_lsn(),
|
||||
meta.initdb_lsn(),
|
||||
);
|
||||
update_meta = true;
|
||||
}
|
||||
if update_meta {
|
||||
let metadata_bytes = meta.to_bytes()?;
|
||||
std::fs::write(&path, &metadata_bytes)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
@@ -4,33 +4,91 @@
|
||||
// TODO: move all paths construction to conf impl
|
||||
//
|
||||
|
||||
use anyhow::{anyhow, bail, Context, Result};
|
||||
use fs::File;
|
||||
use postgres_ffi::{pg_constants, xlog_utils, ControlFileData};
|
||||
use rand::Rng;
|
||||
use anyhow::{bail, Context, Result};
|
||||
use postgres_ffi::ControlFileData;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::env;
|
||||
use std::io::{Read, Write};
|
||||
use std::{
|
||||
collections::HashMap,
|
||||
fs, io,
|
||||
path::{Path, PathBuf},
|
||||
fs,
|
||||
path::Path,
|
||||
process::{Command, Stdio},
|
||||
str::FromStr,
|
||||
sync::Arc,
|
||||
};
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use tracing::*;
|
||||
|
||||
use crate::page_cache;
|
||||
use crate::restore_local_repo;
|
||||
use crate::{repository::Repository, PageServerConf, ZTimelineId};
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use zenith_utils::zid::{ZTenantId, ZTimelineId};
|
||||
use zenith_utils::{crashsafe_dir, logging};
|
||||
|
||||
use crate::walredo::WalRedoManager;
|
||||
use crate::CheckpointConfig;
|
||||
use crate::{config::PageServerConf, repository::Repository};
|
||||
use crate::{import_datadir, LOG_FILE_NAME};
|
||||
use crate::{repository::RepositoryTimeline, tenant_mgr};
|
||||
|
||||
#[derive(Serialize, Deserialize, Clone)]
|
||||
pub struct BranchInfo {
|
||||
pub name: String,
|
||||
#[serde(with = "hex")]
|
||||
pub timeline_id: ZTimelineId,
|
||||
pub latest_valid_lsn: Option<Lsn>,
|
||||
pub latest_valid_lsn: Lsn,
|
||||
pub ancestor_id: Option<String>,
|
||||
pub ancestor_lsn: Option<String>,
|
||||
pub current_logical_size: usize,
|
||||
pub current_logical_size_non_incremental: Option<usize>,
|
||||
}
|
||||
|
||||
impl BranchInfo {
|
||||
pub fn from_path<T: AsRef<Path>>(
|
||||
path: T,
|
||||
repo: &Arc<dyn Repository>,
|
||||
include_non_incremental_logical_size: bool,
|
||||
) -> Result<Self> {
|
||||
let path = path.as_ref();
|
||||
let name = path.file_name().unwrap().to_string_lossy().to_string();
|
||||
let timeline_id = std::fs::read_to_string(path)
|
||||
.with_context(|| {
|
||||
format!(
|
||||
"Failed to read branch file contents at path '{}'",
|
||||
path.display()
|
||||
)
|
||||
})?
|
||||
.parse::<ZTimelineId>()?;
|
||||
|
||||
let timeline = match repo.get_timeline(timeline_id)? {
|
||||
RepositoryTimeline::Local(local_entry) => local_entry,
|
||||
RepositoryTimeline::Remote { .. } => {
|
||||
bail!("Timeline {} is remote, no branches to display", timeline_id)
|
||||
}
|
||||
};
|
||||
|
||||
// we use ancestor lsn zero if we don't have an ancestor, so turn this into an option based on timeline id
|
||||
let (ancestor_id, ancestor_lsn) = match timeline.get_ancestor_timeline_id() {
|
||||
Some(ancestor_id) => (
|
||||
Some(ancestor_id.to_string()),
|
||||
Some(timeline.get_ancestor_lsn().to_string()),
|
||||
),
|
||||
None => (None, None),
|
||||
};
|
||||
|
||||
// non incremental size calculation can be heavy, so let it be optional
|
||||
// needed for tests to check size calculation
|
||||
let current_logical_size_non_incremental = include_non_incremental_logical_size
|
||||
.then(|| {
|
||||
timeline.get_current_logical_size_non_incremental(timeline.get_last_record_lsn())
|
||||
})
|
||||
.transpose()?;
|
||||
|
||||
Ok(BranchInfo {
|
||||
name,
|
||||
timeline_id,
|
||||
latest_valid_lsn: timeline.get_last_record_lsn(),
|
||||
ancestor_id,
|
||||
ancestor_lsn,
|
||||
current_logical_size: timeline.get_current_logical_size(),
|
||||
current_logical_size_non_incremental,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
@@ -39,238 +97,262 @@ pub struct PointInTime {
|
||||
pub lsn: Lsn,
|
||||
}
|
||||
|
||||
pub fn init_repo(conf: &'static PageServerConf, repo_dir: &Path) -> Result<()> {
|
||||
pub fn init_pageserver(conf: &'static PageServerConf, create_tenant: Option<&str>) -> Result<()> {
|
||||
// Initialize logger
|
||||
// use true as daemonize parameter because otherwise we pollute zenith cli output with a few pages long output of info messages
|
||||
let _log_file = logging::init(LOG_FILE_NAME, true)?;
|
||||
|
||||
// We don't use the real WAL redo manager, because we don't want to spawn the WAL redo
|
||||
// process during repository initialization.
|
||||
//
|
||||
// FIXME: That caused trouble, because the WAL redo manager spawned a thread that launched
|
||||
// initdb in the background, and it kept running even after the "zenith init" had exited.
|
||||
// In tests, we started the page server immediately after that, so that initdb was still
|
||||
// running in the background, and we failed to run initdb again in the same directory. This
|
||||
// has been solved for the rapid init+start case now, but the general race condition remains
|
||||
// if you restart the server quickly. The WAL redo manager doesn't use a separate thread
|
||||
// anymore, but I think that could still happen.
|
||||
let dummy_redo_mgr = Arc::new(crate::walredo::DummyRedoManager {});
|
||||
|
||||
if let Some(tenantid) = create_tenant {
|
||||
let tenantid = ZTenantId::from_str(tenantid)?;
|
||||
println!("initializing tenantid {}", tenantid);
|
||||
create_repo(conf, tenantid, dummy_redo_mgr).context("failed to create repo")?;
|
||||
}
|
||||
crashsafe_dir::create_dir_all(conf.tenants_path())?;
|
||||
|
||||
println!("pageserver init succeeded");
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn create_repo(
|
||||
conf: &'static PageServerConf,
|
||||
tenantid: ZTenantId,
|
||||
wal_redo_manager: Arc<dyn WalRedoManager + Send + Sync>,
|
||||
) -> Result<Arc<dyn Repository>> {
|
||||
let repo_dir = conf.tenant_path(&tenantid);
|
||||
if repo_dir.exists() {
|
||||
bail!("repo for {} already exists", tenantid)
|
||||
}
|
||||
|
||||
// top-level dir may exist if we are creating it through CLI
|
||||
fs::create_dir_all(repo_dir)
|
||||
crashsafe_dir::create_dir_all(&repo_dir)
|
||||
.with_context(|| format!("could not create directory {}", repo_dir.display()))?;
|
||||
|
||||
env::set_current_dir(repo_dir)?;
|
||||
crashsafe_dir::create_dir(conf.timelines_path(&tenantid))?;
|
||||
crashsafe_dir::create_dir_all(conf.branches_path(&tenantid))?;
|
||||
crashsafe_dir::create_dir_all(conf.tags_path(&tenantid))?;
|
||||
|
||||
fs::create_dir(std::path::Path::new("timelines"))?;
|
||||
fs::create_dir(std::path::Path::new("refs"))?;
|
||||
fs::create_dir(std::path::Path::new("refs").join("branches"))?;
|
||||
fs::create_dir(std::path::Path::new("refs").join("tags"))?;
|
||||
info!("created directory structure in {}", repo_dir.display());
|
||||
|
||||
println!("created directory structure in {}", repo_dir.display());
|
||||
// create a new timeline directory
|
||||
let timeline_id = ZTimelineId::generate();
|
||||
let timelinedir = conf.timeline_path(&timeline_id, &tenantid);
|
||||
|
||||
// Run initdb
|
||||
//
|
||||
// We create the cluster temporarily in a "tmp" directory inside the repository,
|
||||
// and move it to the right location from there.
|
||||
let tmppath = std::path::Path::new("tmp");
|
||||
crashsafe_dir::create_dir(&timelinedir)?;
|
||||
|
||||
print!("running initdb... ");
|
||||
io::stdout().flush()?;
|
||||
let repo = Arc::new(crate::layered_repository::LayeredRepository::new(
|
||||
conf,
|
||||
wal_redo_manager,
|
||||
tenantid,
|
||||
conf.remote_storage_config.is_some(),
|
||||
));
|
||||
|
||||
// Load data into pageserver
|
||||
// TODO To implement zenith import we need to
|
||||
// move data loading out of create_repo()
|
||||
bootstrap_timeline(conf, tenantid, timeline_id, repo.as_ref())?;
|
||||
|
||||
Ok(repo)
|
||||
}
|
||||
|
||||
// Returns checkpoint LSN from controlfile
|
||||
fn get_lsn_from_controlfile(path: &Path) -> Result<Lsn> {
|
||||
// Read control file to extract the LSN
|
||||
let controlfile_path = path.join("global").join("pg_control");
|
||||
let controlfile = ControlFileData::decode(&fs::read(controlfile_path)?)?;
|
||||
let lsn = controlfile.checkPoint;
|
||||
|
||||
Ok(Lsn(lsn))
|
||||
}
|
||||
|
||||
// Create the cluster temporarily in 'initdbpath' directory inside the repository
|
||||
// to get bootstrap data for timeline initialization.
|
||||
//
|
||||
fn run_initdb(conf: &'static PageServerConf, initdbpath: &Path) -> Result<()> {
|
||||
info!("running initdb in {}... ", initdbpath.display());
|
||||
|
||||
let initdb_path = conf.pg_bin_dir().join("initdb");
|
||||
let initdb_otput = Command::new(initdb_path)
|
||||
.args(&["-D", tmppath.to_str().unwrap()])
|
||||
let initdb_output = Command::new(initdb_path)
|
||||
.args(&["-D", initdbpath.to_str().unwrap()])
|
||||
.args(&["-U", &conf.superuser])
|
||||
.args(&["-E", "utf8"])
|
||||
.arg("--no-instructions")
|
||||
// This is only used for a temporary installation that is deleted shortly after,
|
||||
// so no need to fsync it
|
||||
.arg("--no-sync")
|
||||
.env_clear()
|
||||
.env("LD_LIBRARY_PATH", conf.pg_lib_dir().to_str().unwrap())
|
||||
.env("DYLD_LIBRARY_PATH", conf.pg_lib_dir().to_str().unwrap())
|
||||
.stdout(Stdio::null())
|
||||
.output()
|
||||
.with_context(|| "failed to execute initdb")?;
|
||||
if !initdb_otput.status.success() {
|
||||
.context("failed to execute initdb")?;
|
||||
if !initdb_output.status.success() {
|
||||
anyhow::bail!(
|
||||
"initdb failed: '{}'",
|
||||
String::from_utf8_lossy(&initdb_otput.stderr)
|
||||
String::from_utf8_lossy(&initdb_output.stderr)
|
||||
);
|
||||
}
|
||||
println!("initdb succeeded");
|
||||
|
||||
// Read control file to extract the LSN and system id
|
||||
let controlfile_path = tmppath.join("global").join("pg_control");
|
||||
let controlfile = ControlFileData::decode(&fs::read(controlfile_path)?)?;
|
||||
// let systemid = controlfile.system_identifier;
|
||||
let lsn = controlfile.checkPoint;
|
||||
let lsnstr = format!("{:016X}", lsn);
|
||||
|
||||
// Bootstrap the repository by loading the newly-initdb'd cluster into 'main' branch.
|
||||
let tli = create_timeline(conf, None)?;
|
||||
let timelinedir = conf.timeline_path(tli);
|
||||
|
||||
// We don't use page_cache here, because we don't want to spawn the WAL redo thread during
|
||||
// repository initialization.
|
||||
//
|
||||
// FIXME: That caused trouble, because the WAL redo thread launched initdb in the background,
|
||||
// and it kept running even after the "zenith init" had exited. In tests, we started the
|
||||
// page server immediately after that, so that initdb was still running in the background,
|
||||
// and we failed to run initdb again in the same directory. This has been solved for the
|
||||
// rapid init+start case now, but the general race condition remains if you restart the
|
||||
// server quickly.
|
||||
//let storage = crate::rocksdb_storage::RocksObjectStore::create(conf)?;
|
||||
let storage = crate::inmem_storage::InmemObjectStore::create(conf)?;
|
||||
|
||||
let repo = crate::object_repository::ObjectRepository::new(
|
||||
conf,
|
||||
std::sync::Arc::new(storage),
|
||||
std::sync::Arc::new(crate::walredo::DummyRedoManager {}),
|
||||
);
|
||||
let timeline = repo.create_empty_timeline(tli, Lsn(lsn))?;
|
||||
|
||||
restore_local_repo::import_timeline_from_postgres_datadir(&tmppath, &*timeline, Lsn(lsn))?;
|
||||
|
||||
// Move the initial WAL file
|
||||
fs::rename(
|
||||
tmppath.join("pg_wal").join("000000010000000000000001"),
|
||||
timelinedir
|
||||
.join("wal")
|
||||
.join("000000010000000000000001.partial"),
|
||||
)?;
|
||||
println!("created initial timeline {}", tli);
|
||||
|
||||
let data = tli.to_string();
|
||||
fs::write(conf.branch_path("main"), data)?;
|
||||
println!("created main branch");
|
||||
|
||||
// Remove pg_wal
|
||||
fs::remove_dir_all(tmppath.join("pg_wal"))?;
|
||||
|
||||
// Move the data directory as an initial base backup.
|
||||
// FIXME: It would be enough to only copy the non-relation files here, the relation
|
||||
// data was already loaded into the repository.
|
||||
let target = timelinedir.join("snapshots").join(&lsnstr);
|
||||
fs::rename(tmppath, &target)?;
|
||||
|
||||
println!(
|
||||
"new zenith repository was created in {}",
|
||||
repo_dir.display()
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn get_branches(conf: &PageServerConf) -> Result<Vec<BranchInfo>> {
|
||||
let repo = page_cache::get_repository();
|
||||
//
|
||||
// - run initdb to init temporary instance and get bootstrap data
|
||||
// - after initialization complete, remove the temp dir.
|
||||
//
|
||||
fn bootstrap_timeline(
|
||||
conf: &'static PageServerConf,
|
||||
tenantid: ZTenantId,
|
||||
tli: ZTimelineId,
|
||||
repo: &dyn Repository,
|
||||
) -> Result<()> {
|
||||
let _enter = info_span!("bootstrapping", timeline = %tli, tenant = %tenantid).entered();
|
||||
|
||||
let initdb_path = conf.tenant_path(&tenantid).join("tmp");
|
||||
|
||||
// Init temporarily repo to get bootstrap data
|
||||
run_initdb(conf, &initdb_path)?;
|
||||
let pgdata_path = initdb_path;
|
||||
|
||||
let lsn = get_lsn_from_controlfile(&pgdata_path)?.align();
|
||||
|
||||
// Import the contents of the data directory at the initial checkpoint
|
||||
// LSN, and any WAL after that.
|
||||
// Initdb lsn will be equal to last_record_lsn which will be set after import.
|
||||
// Because we know it upfront avoid having an option or dummy zero value by passing it to create_empty_timeline.
|
||||
let timeline = repo.create_empty_timeline(tli, lsn)?;
|
||||
import_datadir::import_timeline_from_postgres_datadir(
|
||||
&pgdata_path,
|
||||
timeline.writer().as_ref(),
|
||||
lsn,
|
||||
)?;
|
||||
timeline.checkpoint(CheckpointConfig::Forced)?;
|
||||
|
||||
println!(
|
||||
"created initial timeline {} timeline.lsn {}",
|
||||
tli,
|
||||
timeline.get_last_record_lsn()
|
||||
);
|
||||
|
||||
let data = tli.to_string();
|
||||
fs::write(conf.branch_path("main", &tenantid), data)?;
|
||||
println!("created main branch");
|
||||
|
||||
// Remove temp dir. We don't need it anymore
|
||||
fs::remove_dir_all(pgdata_path)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn get_branches(
|
||||
conf: &PageServerConf,
|
||||
tenantid: &ZTenantId,
|
||||
include_non_incremental_logical_size: bool,
|
||||
) -> Result<Vec<BranchInfo>> {
|
||||
let repo = tenant_mgr::get_repository_for_tenant(*tenantid)?;
|
||||
|
||||
// Each branch has a corresponding record (text file) in the refs/branches
|
||||
// with timeline_id.
|
||||
let branches_dir = std::path::Path::new("refs").join("branches");
|
||||
let branches_dir = conf.branches_path(tenantid);
|
||||
|
||||
std::fs::read_dir(&branches_dir)?
|
||||
std::fs::read_dir(&branches_dir)
|
||||
.with_context(|| {
|
||||
format!(
|
||||
"Found no branches directory '{}' for tenant {}",
|
||||
branches_dir.display(),
|
||||
tenantid
|
||||
)
|
||||
})?
|
||||
.map(|dir_entry_res| {
|
||||
let dir_entry = dir_entry_res?;
|
||||
let name = dir_entry.file_name().to_str().unwrap().to_string();
|
||||
let timeline_id = std::fs::read_to_string(dir_entry.path())?.parse::<ZTimelineId>()?;
|
||||
|
||||
let latest_valid_lsn = repo
|
||||
.get_timeline(timeline_id)
|
||||
.map(|timeline| timeline.get_last_valid_lsn())
|
||||
.ok();
|
||||
|
||||
let ancestor_path = conf.ancestor_path(timeline_id);
|
||||
let mut ancestor_id: Option<String> = None;
|
||||
let mut ancestor_lsn: Option<String> = None;
|
||||
|
||||
if ancestor_path.exists() {
|
||||
let ancestor = std::fs::read_to_string(ancestor_path)?;
|
||||
let mut strings = ancestor.split('@');
|
||||
|
||||
ancestor_id = Some(
|
||||
strings
|
||||
.next()
|
||||
.with_context(|| "wrong branch ancestor point in time format")?
|
||||
.to_owned(),
|
||||
);
|
||||
ancestor_lsn = Some(
|
||||
strings
|
||||
.next()
|
||||
.with_context(|| "wrong branch ancestor point in time format")?
|
||||
.to_owned(),
|
||||
);
|
||||
}
|
||||
|
||||
Ok(BranchInfo {
|
||||
name,
|
||||
timeline_id,
|
||||
latest_valid_lsn,
|
||||
ancestor_id,
|
||||
ancestor_lsn,
|
||||
})
|
||||
let dir_entry = dir_entry_res.with_context(|| {
|
||||
format!(
|
||||
"Failed to list branches directory '{}' content for tenant {}",
|
||||
branches_dir.display(),
|
||||
tenantid
|
||||
)
|
||||
})?;
|
||||
BranchInfo::from_path(
|
||||
dir_entry.path(),
|
||||
&repo,
|
||||
include_non_incremental_logical_size,
|
||||
)
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
pub(crate) fn get_system_id(conf: &PageServerConf) -> Result<u64> {
|
||||
// let branches = get_branches();
|
||||
|
||||
let branches_dir = std::path::Path::new("refs").join("branches");
|
||||
let branches = std::fs::read_dir(&branches_dir)?
|
||||
.map(|dir_entry_res| {
|
||||
let dir_entry = dir_entry_res?;
|
||||
let name = dir_entry.file_name().to_str().unwrap().to_string();
|
||||
let timeline_id = std::fs::read_to_string(dir_entry.path())?.parse::<ZTimelineId>()?;
|
||||
Ok((name, timeline_id))
|
||||
})
|
||||
.collect::<Result<HashMap<String, ZTimelineId>>>()?;
|
||||
|
||||
let main_tli = branches
|
||||
.get("main")
|
||||
.ok_or_else(|| anyhow!("Branch main not found"))?;
|
||||
|
||||
let (_, main_snap_dir) = find_latest_snapshot(conf, *main_tli)?;
|
||||
let controlfile_path = main_snap_dir.join("global").join("pg_control");
|
||||
let controlfile = ControlFileData::decode(&fs::read(controlfile_path)?)?;
|
||||
Ok(controlfile.system_identifier)
|
||||
}
|
||||
|
||||
pub(crate) fn create_branch(
|
||||
conf: &PageServerConf,
|
||||
branchname: &str,
|
||||
startpoint_str: &str,
|
||||
tenantid: &ZTenantId,
|
||||
) -> Result<BranchInfo> {
|
||||
let repo = page_cache::get_repository();
|
||||
let repo = tenant_mgr::get_repository_for_tenant(*tenantid)?;
|
||||
|
||||
if conf.branch_path(&branchname).exists() {
|
||||
if conf.branch_path(branchname, tenantid).exists() {
|
||||
anyhow::bail!("branch {} already exists", branchname);
|
||||
}
|
||||
|
||||
let mut startpoint = parse_point_in_time(conf, startpoint_str)?;
|
||||
|
||||
let mut startpoint = parse_point_in_time(conf, startpoint_str, tenantid)?;
|
||||
let timeline = repo
|
||||
.get_timeline(startpoint.timelineid)?
|
||||
.local_timeline()
|
||||
.context("Cannot branch off the timeline that's not present locally")?;
|
||||
if startpoint.lsn == Lsn(0) {
|
||||
// Find end of WAL on the old timeline
|
||||
let end_of_wal = repo
|
||||
.get_timeline(startpoint.timelineid)?
|
||||
.get_last_record_lsn();
|
||||
println!("branching at end of WAL: {}", end_of_wal);
|
||||
let end_of_wal = timeline.get_last_record_lsn();
|
||||
info!("branching at end of WAL: {}", end_of_wal);
|
||||
startpoint.lsn = end_of_wal;
|
||||
} else {
|
||||
// Wait for the WAL to arrive and be processed on the parent branch up
|
||||
// to the requested branch point. The repository code itself doesn't
|
||||
// require it, but if we start to receive WAL on the new timeline,
|
||||
// decoding the new WAL might need to look up previous pages, relation
|
||||
// sizes etc. and that would get confused if the previous page versions
|
||||
// are not in the repository yet.
|
||||
timeline.wait_lsn(startpoint.lsn)?;
|
||||
}
|
||||
startpoint.lsn = startpoint.lsn.align();
|
||||
if timeline.get_ancestor_lsn() > startpoint.lsn {
|
||||
// can we safely just branch from the ancestor instead?
|
||||
anyhow::bail!(
|
||||
"invalid startpoint {} for the branch {}: less than timeline ancestor lsn {:?}",
|
||||
startpoint.lsn,
|
||||
branchname,
|
||||
timeline.get_ancestor_lsn()
|
||||
);
|
||||
}
|
||||
|
||||
// create a new timeline directory for it
|
||||
let newtli = create_timeline(conf, Some(startpoint))?;
|
||||
let newtimelinedir = conf.timeline_path(newtli);
|
||||
let new_timeline_id = ZTimelineId::generate();
|
||||
|
||||
// Let the Repository backend do its initialization
|
||||
repo.branch_timeline(startpoint.timelineid, newtli, startpoint.lsn)?;
|
||||
|
||||
// Copy the latest snapshot (TODO: before the startpoint) and all WAL
|
||||
// TODO: be smarter and avoid the copying...
|
||||
let (_maxsnapshot, oldsnapshotdir) = find_latest_snapshot(conf, startpoint.timelineid)?;
|
||||
let copy_opts = fs_extra::dir::CopyOptions::new();
|
||||
fs_extra::dir::copy(oldsnapshotdir, newtimelinedir.join("snapshots"), ©_opts)?;
|
||||
|
||||
let oldtimelinedir = conf.timeline_path(startpoint.timelineid);
|
||||
copy_wal(
|
||||
&oldtimelinedir.join("wal"),
|
||||
&newtimelinedir.join("wal"),
|
||||
startpoint.lsn,
|
||||
pg_constants::WAL_SEGMENT_SIZE,
|
||||
)?;
|
||||
// Forward entire timeline creation routine to repository
|
||||
// backend, so it can do all needed initialization
|
||||
repo.branch_timeline(startpoint.timelineid, new_timeline_id, startpoint.lsn)?;
|
||||
|
||||
// Remember the human-readable branch name for the new timeline.
|
||||
// FIXME: there's a race condition, if you create a branch with the same
|
||||
// name concurrently.
|
||||
let data = newtli.to_string();
|
||||
fs::write(conf.branch_path(&branchname), data)?;
|
||||
let data = new_timeline_id.to_string();
|
||||
fs::write(conf.branch_path(branchname, tenantid), data)?;
|
||||
|
||||
Ok(BranchInfo {
|
||||
name: branchname.to_string(),
|
||||
timeline_id: newtli,
|
||||
latest_valid_lsn: Some(startpoint.lsn),
|
||||
ancestor_id: None,
|
||||
ancestor_lsn: None,
|
||||
timeline_id: new_timeline_id,
|
||||
latest_valid_lsn: startpoint.lsn,
|
||||
ancestor_id: Some(startpoint.timelineid.to_string()),
|
||||
ancestor_lsn: Some(startpoint.lsn.to_string()),
|
||||
current_logical_size: 0,
|
||||
current_logical_size_non_incremental: Some(0),
|
||||
})
|
||||
}
|
||||
|
||||
@@ -293,36 +375,37 @@ pub(crate) fn create_branch(
|
||||
// mytag
|
||||
//
|
||||
//
|
||||
fn parse_point_in_time(conf: &PageServerConf, s: &str) -> Result<PointInTime> {
|
||||
fn parse_point_in_time(
|
||||
conf: &PageServerConf,
|
||||
s: &str,
|
||||
tenantid: &ZTenantId,
|
||||
) -> Result<PointInTime> {
|
||||
let mut strings = s.split('@');
|
||||
let name = strings.next().unwrap();
|
||||
|
||||
let lsn: Option<Lsn>;
|
||||
if let Some(lsnstr) = strings.next() {
|
||||
lsn = Some(
|
||||
Lsn::from_str(lsnstr).with_context(|| "invalid LSN in point-in-time specification")?,
|
||||
);
|
||||
} else {
|
||||
lsn = None
|
||||
}
|
||||
let lsn = strings
|
||||
.next()
|
||||
.map(Lsn::from_str)
|
||||
.transpose()
|
||||
.context("invalid LSN in point-in-time specification")?;
|
||||
|
||||
// Check if it's a tag
|
||||
if lsn.is_none() {
|
||||
let tagpath = conf.tag_path(name);
|
||||
let tagpath = conf.tag_path(name, tenantid);
|
||||
if tagpath.exists() {
|
||||
let pointstr = fs::read_to_string(tagpath)?;
|
||||
|
||||
return parse_point_in_time(conf, &pointstr);
|
||||
return parse_point_in_time(conf, &pointstr, tenantid);
|
||||
}
|
||||
}
|
||||
|
||||
// Check if it's a branch
|
||||
// Check if it's branch @ LSN
|
||||
let branchpath = conf.branch_path(name);
|
||||
let branchpath = conf.branch_path(name, tenantid);
|
||||
if branchpath.exists() {
|
||||
let pointstr = fs::read_to_string(branchpath)?;
|
||||
|
||||
let mut result = parse_point_in_time(conf, &pointstr)?;
|
||||
let mut result = parse_point_in_time(conf, &pointstr, tenantid)?;
|
||||
|
||||
result.lsn = lsn.unwrap_or(Lsn(0));
|
||||
return Ok(result);
|
||||
@@ -331,7 +414,7 @@ fn parse_point_in_time(conf: &PageServerConf, s: &str) -> Result<PointInTime> {
|
||||
// Check if it's a timelineid
|
||||
// Check if it's timelineid @ LSN
|
||||
if let Ok(timelineid) = ZTimelineId::from_str(name) {
|
||||
let tlipath = conf.timeline_path(timelineid);
|
||||
let tlipath = conf.timeline_path(&timelineid, tenantid);
|
||||
if tlipath.exists() {
|
||||
return Ok(PointInTime {
|
||||
timelineid,
|
||||
@@ -342,92 +425,3 @@ fn parse_point_in_time(conf: &PageServerConf, s: &str) -> Result<PointInTime> {
|
||||
|
||||
bail!("could not parse point-in-time {}", s);
|
||||
}
|
||||
|
||||
fn create_timeline(conf: &PageServerConf, ancestor: Option<PointInTime>) -> Result<ZTimelineId> {
|
||||
// Create initial timeline
|
||||
let mut tli_buf = [0u8; 16];
|
||||
rand::thread_rng().fill(&mut tli_buf);
|
||||
let timelineid = ZTimelineId::from(tli_buf);
|
||||
|
||||
let timelinedir = conf.timeline_path(timelineid);
|
||||
|
||||
fs::create_dir(&timelinedir)?;
|
||||
fs::create_dir(&timelinedir.join("snapshots"))?;
|
||||
fs::create_dir(&timelinedir.join("wal"))?;
|
||||
|
||||
if let Some(ancestor) = ancestor {
|
||||
let data = format!("{}@{}", ancestor.timelineid, ancestor.lsn);
|
||||
fs::write(timelinedir.join("ancestor"), data)?;
|
||||
}
|
||||
|
||||
Ok(timelineid)
|
||||
}
|
||||
|
||||
///
|
||||
/// Copy all WAL segments from one directory to another, up to given LSN.
|
||||
///
|
||||
/// If the given LSN is in the middle of a segment, the last segment containing it
|
||||
/// is written out as .partial, and padded with zeros.
|
||||
///
|
||||
fn copy_wal(src_dir: &Path, dst_dir: &Path, upto: Lsn, wal_seg_size: usize) -> Result<()> {
|
||||
let last_segno = upto.segment_number(wal_seg_size);
|
||||
let last_segoff = upto.segment_offset(wal_seg_size);
|
||||
|
||||
for entry in fs::read_dir(src_dir).unwrap().flatten() {
|
||||
let entry_name = entry.file_name();
|
||||
let fname = entry_name.to_str().unwrap();
|
||||
|
||||
// Check if the filename looks like an xlog file, or a .partial file.
|
||||
if !xlog_utils::IsXLogFileName(fname) && !xlog_utils::IsPartialXLogFileName(fname) {
|
||||
continue;
|
||||
}
|
||||
let (segno, _tli) = xlog_utils::XLogFromFileName(fname, wal_seg_size as usize);
|
||||
|
||||
let copylen;
|
||||
let mut dst_fname = PathBuf::from(fname);
|
||||
if segno > last_segno {
|
||||
// future segment, skip
|
||||
continue;
|
||||
} else if segno < last_segno {
|
||||
copylen = wal_seg_size;
|
||||
dst_fname.set_extension("");
|
||||
} else {
|
||||
copylen = last_segoff;
|
||||
dst_fname.set_extension("partial");
|
||||
}
|
||||
|
||||
let src_file = File::open(entry.path())?;
|
||||
let mut dst_file = File::create(dst_dir.join(&dst_fname))?;
|
||||
std::io::copy(&mut src_file.take(copylen as u64), &mut dst_file)?;
|
||||
|
||||
if copylen < wal_seg_size {
|
||||
std::io::copy(
|
||||
&mut std::io::repeat(0).take((wal_seg_size - copylen) as u64),
|
||||
&mut dst_file,
|
||||
)?;
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// Find the latest snapshot for a timeline
|
||||
fn find_latest_snapshot(conf: &PageServerConf, timeline: ZTimelineId) -> Result<(Lsn, PathBuf)> {
|
||||
let snapshotsdir = conf.snapshots_path(timeline);
|
||||
let paths = fs::read_dir(&snapshotsdir)?;
|
||||
let mut maxsnapshot = Lsn(0);
|
||||
let mut snapshotdir: Option<PathBuf> = None;
|
||||
for path in paths {
|
||||
let path = path?;
|
||||
let filename = path.file_name().to_str().unwrap().to_owned();
|
||||
if let Ok(lsn) = Lsn::from_hex(&filename) {
|
||||
maxsnapshot = std::cmp::max(lsn, maxsnapshot);
|
||||
snapshotdir = Some(path.path());
|
||||
}
|
||||
}
|
||||
if maxsnapshot == Lsn(0) {
|
||||
// TODO: check ancestor timeline
|
||||
anyhow::bail!("no snapshot found in {}", snapshotsdir.display());
|
||||
}
|
||||
|
||||
Ok((maxsnapshot, snapshotdir.unwrap()))
|
||||
}
|
||||
|
||||
898
pageserver/src/config.rs
Normal file
898
pageserver/src/config.rs
Normal file
@@ -0,0 +1,898 @@
|
||||
//! Functions for handling page server configuration options
|
||||
//!
|
||||
//! Configuration options can be set in the pageserver.toml configuration
|
||||
//! file, or on the command line.
|
||||
//! See also `settings.md` for better description on every parameter.
|
||||
|
||||
use anyhow::{bail, ensure, Context, Result};
|
||||
use toml_edit;
|
||||
use toml_edit::{Document, Item};
|
||||
use zenith_utils::postgres_backend::AuthType;
|
||||
use zenith_utils::zid::{ZNodeId, ZTenantId, ZTimelineId};
|
||||
|
||||
use std::convert::TryInto;
|
||||
use std::env;
|
||||
use std::num::{NonZeroU32, NonZeroUsize};
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::str::FromStr;
|
||||
use std::time::Duration;
|
||||
|
||||
use crate::layered_repository::TIMELINES_SEGMENT_NAME;
|
||||
|
||||
pub mod defaults {
|
||||
use const_format::formatcp;
|
||||
|
||||
pub const DEFAULT_PG_LISTEN_PORT: u16 = 64000;
|
||||
pub const DEFAULT_PG_LISTEN_ADDR: &str = formatcp!("127.0.0.1:{DEFAULT_PG_LISTEN_PORT}");
|
||||
pub const DEFAULT_HTTP_LISTEN_PORT: u16 = 9898;
|
||||
pub const DEFAULT_HTTP_LISTEN_ADDR: &str = formatcp!("127.0.0.1:{DEFAULT_HTTP_LISTEN_PORT}");
|
||||
|
||||
// FIXME: This current value is very low. I would imagine something like 1 GB or 10 GB
|
||||
// would be more appropriate. But a low value forces the code to be exercised more,
|
||||
// which is good for now to trigger bugs.
|
||||
pub const DEFAULT_CHECKPOINT_DISTANCE: u64 = 256 * 1024 * 1024;
|
||||
pub const DEFAULT_CHECKPOINT_PERIOD: &str = "1 s";
|
||||
|
||||
pub const DEFAULT_GC_HORIZON: u64 = 64 * 1024 * 1024;
|
||||
pub const DEFAULT_GC_PERIOD: &str = "100 s";
|
||||
|
||||
pub const DEFAULT_WAIT_LSN_TIMEOUT: &str = "60 s";
|
||||
pub const DEFAULT_WAL_REDO_TIMEOUT: &str = "60 s";
|
||||
|
||||
pub const DEFAULT_SUPERUSER: &str = "zenith_admin";
|
||||
pub const DEFAULT_REMOTE_STORAGE_MAX_CONCURRENT_SYNC: usize = 100;
|
||||
pub const DEFAULT_REMOTE_STORAGE_MAX_SYNC_ERRORS: u32 = 10;
|
||||
|
||||
pub const DEFAULT_PAGE_CACHE_SIZE: usize = 8192;
|
||||
pub const DEFAULT_MAX_FILE_DESCRIPTORS: usize = 100;
|
||||
|
||||
///
|
||||
/// Default built-in configuration file.
|
||||
///
|
||||
pub const DEFAULT_CONFIG_FILE: &str = formatcp!(
|
||||
r###"
|
||||
# Initial configuration file created by 'pageserver --init'
|
||||
|
||||
#listen_pg_addr = '{DEFAULT_PG_LISTEN_ADDR}'
|
||||
#listen_http_addr = '{DEFAULT_HTTP_LISTEN_ADDR}'
|
||||
|
||||
#checkpoint_distance = {DEFAULT_CHECKPOINT_DISTANCE} # in bytes
|
||||
#checkpoint_period = '{DEFAULT_CHECKPOINT_PERIOD}'
|
||||
|
||||
#gc_period = '{DEFAULT_GC_PERIOD}'
|
||||
#gc_horizon = {DEFAULT_GC_HORIZON}
|
||||
|
||||
#wait_lsn_timeout = '{DEFAULT_WAIT_LSN_TIMEOUT}'
|
||||
#wal_redo_timeout = '{DEFAULT_WAL_REDO_TIMEOUT}'
|
||||
|
||||
#max_file_descriptors = {DEFAULT_MAX_FILE_DESCRIPTORS}
|
||||
|
||||
# initial superuser role name to use when creating a new tenant
|
||||
#initial_superuser_name = '{DEFAULT_SUPERUSER}'
|
||||
|
||||
# [remote_storage]
|
||||
|
||||
"###
|
||||
);
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, PartialEq, Eq)]
|
||||
pub struct PageServerConf {
|
||||
// Identifier of that particular pageserver so e g safekeepers
|
||||
// can safely distinguish different pageservers
|
||||
pub id: ZNodeId,
|
||||
|
||||
/// Example (default): 127.0.0.1:64000
|
||||
pub listen_pg_addr: String,
|
||||
/// Example (default): 127.0.0.1:9898
|
||||
pub listen_http_addr: String,
|
||||
|
||||
// Flush out an inmemory layer, if it's holding WAL older than this
|
||||
// This puts a backstop on how much WAL needs to be re-digested if the
|
||||
// page server crashes.
|
||||
pub checkpoint_distance: u64,
|
||||
pub checkpoint_period: Duration,
|
||||
|
||||
pub gc_horizon: u64,
|
||||
pub gc_period: Duration,
|
||||
|
||||
// Timeout when waiting for WAL receiver to catch up to an LSN given in a GetPage@LSN call.
|
||||
pub wait_lsn_timeout: Duration,
|
||||
// How long to wait for WAL redo to complete.
|
||||
pub wal_redo_timeout: Duration,
|
||||
|
||||
pub superuser: String,
|
||||
|
||||
pub page_cache_size: usize,
|
||||
pub max_file_descriptors: usize,
|
||||
|
||||
// Repository directory, relative to current working directory.
|
||||
// Normally, the page server changes the current working directory
|
||||
// to the repository, and 'workdir' is always '.'. But we don't do
|
||||
// that during unit testing, because the current directory is global
|
||||
// to the process but different unit tests work on different
|
||||
// repositories.
|
||||
pub workdir: PathBuf,
|
||||
|
||||
pub pg_distrib_dir: PathBuf,
|
||||
|
||||
pub auth_type: AuthType,
|
||||
|
||||
pub auth_validation_public_key_path: Option<PathBuf>,
|
||||
pub remote_storage_config: Option<RemoteStorageConfig>,
|
||||
}
|
||||
|
||||
// use dedicated enum for builder to better indicate the intention
|
||||
// and avoid possible confusion with nested options
|
||||
pub enum BuilderValue<T> {
|
||||
Set(T),
|
||||
NotSet,
|
||||
}
|
||||
|
||||
impl<T> BuilderValue<T> {
|
||||
pub fn ok_or<E>(self, err: E) -> Result<T, E> {
|
||||
match self {
|
||||
Self::Set(v) => Ok(v),
|
||||
Self::NotSet => Err(err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// needed to simplify config construction
|
||||
struct PageServerConfigBuilder {
|
||||
listen_pg_addr: BuilderValue<String>,
|
||||
|
||||
listen_http_addr: BuilderValue<String>,
|
||||
|
||||
checkpoint_distance: BuilderValue<u64>,
|
||||
checkpoint_period: BuilderValue<Duration>,
|
||||
|
||||
gc_horizon: BuilderValue<u64>,
|
||||
gc_period: BuilderValue<Duration>,
|
||||
|
||||
wait_lsn_timeout: BuilderValue<Duration>,
|
||||
wal_redo_timeout: BuilderValue<Duration>,
|
||||
|
||||
superuser: BuilderValue<String>,
|
||||
|
||||
page_cache_size: BuilderValue<usize>,
|
||||
max_file_descriptors: BuilderValue<usize>,
|
||||
|
||||
workdir: BuilderValue<PathBuf>,
|
||||
|
||||
pg_distrib_dir: BuilderValue<PathBuf>,
|
||||
|
||||
auth_type: BuilderValue<AuthType>,
|
||||
|
||||
//
|
||||
auth_validation_public_key_path: BuilderValue<Option<PathBuf>>,
|
||||
remote_storage_config: BuilderValue<Option<RemoteStorageConfig>>,
|
||||
|
||||
id: BuilderValue<ZNodeId>,
|
||||
}
|
||||
|
||||
impl Default for PageServerConfigBuilder {
|
||||
fn default() -> Self {
|
||||
use self::BuilderValue::*;
|
||||
use defaults::*;
|
||||
Self {
|
||||
listen_pg_addr: Set(DEFAULT_PG_LISTEN_ADDR.to_string()),
|
||||
listen_http_addr: Set(DEFAULT_HTTP_LISTEN_ADDR.to_string()),
|
||||
checkpoint_distance: Set(DEFAULT_CHECKPOINT_DISTANCE),
|
||||
checkpoint_period: Set(humantime::parse_duration(DEFAULT_CHECKPOINT_PERIOD)
|
||||
.expect("cannot parse default checkpoint period")),
|
||||
gc_horizon: Set(DEFAULT_GC_HORIZON),
|
||||
gc_period: Set(humantime::parse_duration(DEFAULT_GC_PERIOD)
|
||||
.expect("cannot parse default gc period")),
|
||||
wait_lsn_timeout: Set(humantime::parse_duration(DEFAULT_WAIT_LSN_TIMEOUT)
|
||||
.expect("cannot parse default wait lsn timeout")),
|
||||
wal_redo_timeout: Set(humantime::parse_duration(DEFAULT_WAL_REDO_TIMEOUT)
|
||||
.expect("cannot parse default wal redo timeout")),
|
||||
superuser: Set(DEFAULT_SUPERUSER.to_string()),
|
||||
page_cache_size: Set(DEFAULT_PAGE_CACHE_SIZE),
|
||||
max_file_descriptors: Set(DEFAULT_MAX_FILE_DESCRIPTORS),
|
||||
workdir: Set(PathBuf::new()),
|
||||
pg_distrib_dir: Set(env::current_dir()
|
||||
.expect("cannot access current directory")
|
||||
.join("tmp_install")),
|
||||
auth_type: Set(AuthType::Trust),
|
||||
auth_validation_public_key_path: Set(None),
|
||||
remote_storage_config: Set(None),
|
||||
id: NotSet,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl PageServerConfigBuilder {
|
||||
pub fn listen_pg_addr(&mut self, listen_pg_addr: String) {
|
||||
self.listen_pg_addr = BuilderValue::Set(listen_pg_addr)
|
||||
}
|
||||
|
||||
pub fn listen_http_addr(&mut self, listen_http_addr: String) {
|
||||
self.listen_http_addr = BuilderValue::Set(listen_http_addr)
|
||||
}
|
||||
|
||||
pub fn checkpoint_distance(&mut self, checkpoint_distance: u64) {
|
||||
self.checkpoint_distance = BuilderValue::Set(checkpoint_distance)
|
||||
}
|
||||
|
||||
pub fn checkpoint_period(&mut self, checkpoint_period: Duration) {
|
||||
self.checkpoint_period = BuilderValue::Set(checkpoint_period)
|
||||
}
|
||||
|
||||
pub fn gc_horizon(&mut self, gc_horizon: u64) {
|
||||
self.gc_horizon = BuilderValue::Set(gc_horizon)
|
||||
}
|
||||
|
||||
pub fn gc_period(&mut self, gc_period: Duration) {
|
||||
self.gc_period = BuilderValue::Set(gc_period)
|
||||
}
|
||||
|
||||
pub fn wait_lsn_timeout(&mut self, wait_lsn_timeout: Duration) {
|
||||
self.wait_lsn_timeout = BuilderValue::Set(wait_lsn_timeout)
|
||||
}
|
||||
|
||||
pub fn wal_redo_timeout(&mut self, wal_redo_timeout: Duration) {
|
||||
self.wal_redo_timeout = BuilderValue::Set(wal_redo_timeout)
|
||||
}
|
||||
|
||||
pub fn superuser(&mut self, superuser: String) {
|
||||
self.superuser = BuilderValue::Set(superuser)
|
||||
}
|
||||
|
||||
pub fn page_cache_size(&mut self, page_cache_size: usize) {
|
||||
self.page_cache_size = BuilderValue::Set(page_cache_size)
|
||||
}
|
||||
|
||||
pub fn max_file_descriptors(&mut self, max_file_descriptors: usize) {
|
||||
self.max_file_descriptors = BuilderValue::Set(max_file_descriptors)
|
||||
}
|
||||
|
||||
pub fn workdir(&mut self, workdir: PathBuf) {
|
||||
self.workdir = BuilderValue::Set(workdir)
|
||||
}
|
||||
|
||||
pub fn pg_distrib_dir(&mut self, pg_distrib_dir: PathBuf) {
|
||||
self.pg_distrib_dir = BuilderValue::Set(pg_distrib_dir)
|
||||
}
|
||||
|
||||
pub fn auth_type(&mut self, auth_type: AuthType) {
|
||||
self.auth_type = BuilderValue::Set(auth_type)
|
||||
}
|
||||
|
||||
pub fn auth_validation_public_key_path(
|
||||
&mut self,
|
||||
auth_validation_public_key_path: Option<PathBuf>,
|
||||
) {
|
||||
self.auth_validation_public_key_path = BuilderValue::Set(auth_validation_public_key_path)
|
||||
}
|
||||
|
||||
pub fn remote_storage_config(&mut self, remote_storage_config: Option<RemoteStorageConfig>) {
|
||||
self.remote_storage_config = BuilderValue::Set(remote_storage_config)
|
||||
}
|
||||
|
||||
pub fn id(&mut self, node_id: ZNodeId) {
|
||||
self.id = BuilderValue::Set(node_id)
|
||||
}
|
||||
|
||||
pub fn build(self) -> Result<PageServerConf> {
|
||||
Ok(PageServerConf {
|
||||
listen_pg_addr: self
|
||||
.listen_pg_addr
|
||||
.ok_or(anyhow::anyhow!("missing listen_pg_addr"))?,
|
||||
listen_http_addr: self
|
||||
.listen_http_addr
|
||||
.ok_or(anyhow::anyhow!("missing listen_http_addr"))?,
|
||||
checkpoint_distance: self
|
||||
.checkpoint_distance
|
||||
.ok_or(anyhow::anyhow!("missing checkpoint_distance"))?,
|
||||
checkpoint_period: self
|
||||
.checkpoint_period
|
||||
.ok_or(anyhow::anyhow!("missing checkpoint_period"))?,
|
||||
gc_horizon: self
|
||||
.gc_horizon
|
||||
.ok_or(anyhow::anyhow!("missing gc_horizon"))?,
|
||||
gc_period: self.gc_period.ok_or(anyhow::anyhow!("missing gc_period"))?,
|
||||
wait_lsn_timeout: self
|
||||
.wait_lsn_timeout
|
||||
.ok_or(anyhow::anyhow!("missing wait_lsn_timeout"))?,
|
||||
wal_redo_timeout: self
|
||||
.wal_redo_timeout
|
||||
.ok_or(anyhow::anyhow!("missing wal_redo_timeout"))?,
|
||||
superuser: self.superuser.ok_or(anyhow::anyhow!("missing superuser"))?,
|
||||
page_cache_size: self
|
||||
.page_cache_size
|
||||
.ok_or(anyhow::anyhow!("missing page_cache_size"))?,
|
||||
max_file_descriptors: self
|
||||
.max_file_descriptors
|
||||
.ok_or(anyhow::anyhow!("missing max_file_descriptors"))?,
|
||||
workdir: self.workdir.ok_or(anyhow::anyhow!("missing workdir"))?,
|
||||
pg_distrib_dir: self
|
||||
.pg_distrib_dir
|
||||
.ok_or(anyhow::anyhow!("missing pg_distrib_dir"))?,
|
||||
auth_type: self.auth_type.ok_or(anyhow::anyhow!("missing auth_type"))?,
|
||||
auth_validation_public_key_path: self
|
||||
.auth_validation_public_key_path
|
||||
.ok_or(anyhow::anyhow!("missing auth_validation_public_key_path"))?,
|
||||
remote_storage_config: self
|
||||
.remote_storage_config
|
||||
.ok_or(anyhow::anyhow!("missing remote_storage_config"))?,
|
||||
id: self.id.ok_or(anyhow::anyhow!("missing id"))?,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
/// External backup storage configuration, enough for creating a client for that storage.
|
||||
#[derive(Debug, Clone, PartialEq, Eq)]
|
||||
pub struct RemoteStorageConfig {
|
||||
/// Max allowed number of concurrent sync operations between pageserver and the remote storage.
|
||||
pub max_concurrent_sync: NonZeroUsize,
|
||||
/// Max allowed errors before the sync task is considered failed and evicted.
|
||||
pub max_sync_errors: NonZeroU32,
|
||||
/// The storage connection configuration.
|
||||
pub storage: RemoteStorageKind,
|
||||
}
|
||||
|
||||
/// A kind of a remote storage to connect to, with its connection configuration.
|
||||
#[derive(Debug, Clone, PartialEq, Eq)]
|
||||
pub enum RemoteStorageKind {
|
||||
/// Storage based on local file system.
|
||||
/// Specify a root folder to place all stored relish data into.
|
||||
LocalFs(PathBuf),
|
||||
/// AWS S3 based storage, storing all relishes into the root
|
||||
/// of the S3 bucket from the config.
|
||||
AwsS3(S3Config),
|
||||
}
|
||||
|
||||
/// AWS S3 bucket coordinates and access credentials to manage the bucket contents (read and write).
|
||||
#[derive(Clone, PartialEq, Eq)]
|
||||
pub struct S3Config {
|
||||
/// Name of the bucket to connect to.
|
||||
pub bucket_name: String,
|
||||
/// The region where the bucket is located at.
|
||||
pub bucket_region: String,
|
||||
/// A "subfolder" in the bucket, to use the same bucket separately by multiple pageservers at once.
|
||||
pub prefix_in_bucket: Option<String>,
|
||||
/// "Login" to use when connecting to bucket.
|
||||
/// Can be empty for cases like AWS k8s IAM
|
||||
/// where we can allow certain pods to connect
|
||||
/// to the bucket directly without any credentials.
|
||||
pub access_key_id: Option<String>,
|
||||
/// "Password" to use when connecting to bucket.
|
||||
pub secret_access_key: Option<String>,
|
||||
/// A base URL to send S3 requests to.
|
||||
/// By default, the endpoint is derived from a region name, assuming it's
|
||||
/// an AWS S3 region name, erroring on wrong region name.
|
||||
/// Endpoint provides a way to support other S3 flavors and their regions.
|
||||
///
|
||||
/// Example: `http://127.0.0.1:5000`
|
||||
pub endpoint: Option<String>,
|
||||
}
|
||||
|
||||
impl std::fmt::Debug for S3Config {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
f.debug_struct("S3Config")
|
||||
.field("bucket_name", &self.bucket_name)
|
||||
.field("bucket_region", &self.bucket_region)
|
||||
.field("prefix_in_bucket", &self.prefix_in_bucket)
|
||||
.finish()
|
||||
}
|
||||
}
|
||||
|
||||
impl PageServerConf {
|
||||
//
|
||||
// Repository paths, relative to workdir.
|
||||
//
|
||||
|
||||
pub fn tenants_path(&self) -> PathBuf {
|
||||
self.workdir.join("tenants")
|
||||
}
|
||||
|
||||
pub fn tenant_path(&self, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.tenants_path().join(tenantid.to_string())
|
||||
}
|
||||
|
||||
pub fn tags_path(&self, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.tenant_path(tenantid).join("refs").join("tags")
|
||||
}
|
||||
|
||||
pub fn tag_path(&self, tag_name: &str, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.tags_path(tenantid).join(tag_name)
|
||||
}
|
||||
|
||||
pub fn branches_path(&self, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.tenant_path(tenantid).join("refs").join("branches")
|
||||
}
|
||||
|
||||
pub fn branch_path(&self, branch_name: &str, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.branches_path(tenantid).join(branch_name)
|
||||
}
|
||||
|
||||
pub fn timelines_path(&self, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.tenant_path(tenantid).join(TIMELINES_SEGMENT_NAME)
|
||||
}
|
||||
|
||||
pub fn timeline_path(&self, timelineid: &ZTimelineId, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.timelines_path(tenantid).join(timelineid.to_string())
|
||||
}
|
||||
|
||||
pub fn ancestor_path(&self, timelineid: &ZTimelineId, tenantid: &ZTenantId) -> PathBuf {
|
||||
self.timeline_path(timelineid, tenantid).join("ancestor")
|
||||
}
|
||||
|
||||
//
|
||||
// Postgres distribution paths
|
||||
//
|
||||
|
||||
pub fn pg_bin_dir(&self) -> PathBuf {
|
||||
self.pg_distrib_dir.join("bin")
|
||||
}
|
||||
|
||||
pub fn pg_lib_dir(&self) -> PathBuf {
|
||||
self.pg_distrib_dir.join("lib")
|
||||
}
|
||||
|
||||
/// Parse a configuration file (pageserver.toml) into a PageServerConf struct,
|
||||
/// validating the input and failing on errors.
|
||||
///
|
||||
/// This leaves any options not present in the file in the built-in defaults.
|
||||
pub fn parse_and_validate(toml: &Document, workdir: &Path) -> Result<Self> {
|
||||
let mut builder = PageServerConfigBuilder::default();
|
||||
builder.workdir(workdir.to_owned());
|
||||
|
||||
for (key, item) in toml.iter() {
|
||||
match key {
|
||||
"listen_pg_addr" => builder.listen_pg_addr(parse_toml_string(key, item)?),
|
||||
"listen_http_addr" => builder.listen_http_addr(parse_toml_string(key, item)?),
|
||||
"checkpoint_distance" => builder.checkpoint_distance(parse_toml_u64(key, item)?),
|
||||
"checkpoint_period" => builder.checkpoint_period(parse_toml_duration(key, item)?),
|
||||
"gc_horizon" => builder.gc_horizon(parse_toml_u64(key, item)?),
|
||||
"gc_period" => builder.gc_period(parse_toml_duration(key, item)?),
|
||||
"wait_lsn_timeout" => builder.wait_lsn_timeout(parse_toml_duration(key, item)?),
|
||||
"wal_redo_timeout" => builder.wal_redo_timeout(parse_toml_duration(key, item)?),
|
||||
"initial_superuser_name" => builder.superuser(parse_toml_string(key, item)?),
|
||||
"page_cache_size" => builder.page_cache_size(parse_toml_u64(key, item)? as usize),
|
||||
"max_file_descriptors" => {
|
||||
builder.max_file_descriptors(parse_toml_u64(key, item)? as usize)
|
||||
}
|
||||
"pg_distrib_dir" => {
|
||||
builder.pg_distrib_dir(PathBuf::from(parse_toml_string(key, item)?))
|
||||
}
|
||||
"auth_validation_public_key_path" => builder.auth_validation_public_key_path(Some(
|
||||
PathBuf::from(parse_toml_string(key, item)?),
|
||||
)),
|
||||
"auth_type" => builder.auth_type(parse_toml_auth_type(key, item)?),
|
||||
"remote_storage" => {
|
||||
builder.remote_storage_config(Some(Self::parse_remote_storage_config(item)?))
|
||||
}
|
||||
"id" => builder.id(ZNodeId(parse_toml_u64(key, item)?)),
|
||||
_ => bail!("unrecognized pageserver option '{}'", key),
|
||||
}
|
||||
}
|
||||
|
||||
let mut conf = builder.build().context("invalid config")?;
|
||||
|
||||
if conf.auth_type == AuthType::ZenithJWT {
|
||||
let auth_validation_public_key_path = conf
|
||||
.auth_validation_public_key_path
|
||||
.get_or_insert_with(|| workdir.join("auth_public_key.pem"));
|
||||
ensure!(
|
||||
auth_validation_public_key_path.exists(),
|
||||
format!(
|
||||
"Can't find auth_validation_public_key at '{}'",
|
||||
auth_validation_public_key_path.display()
|
||||
)
|
||||
);
|
||||
}
|
||||
|
||||
if !conf.pg_distrib_dir.join("bin/postgres").exists() {
|
||||
bail!(
|
||||
"Can't find postgres binary at {}",
|
||||
conf.pg_distrib_dir.display()
|
||||
);
|
||||
}
|
||||
|
||||
Ok(conf)
|
||||
}
|
||||
|
||||
/// subroutine of parse_config(), to parse the `[remote_storage]` table.
|
||||
fn parse_remote_storage_config(toml: &toml_edit::Item) -> anyhow::Result<RemoteStorageConfig> {
|
||||
let local_path = toml.get("local_path");
|
||||
let bucket_name = toml.get("bucket_name");
|
||||
let bucket_region = toml.get("bucket_region");
|
||||
|
||||
let max_concurrent_sync: NonZeroUsize = if let Some(s) = toml.get("max_concurrent_sync") {
|
||||
parse_toml_u64("max_concurrent_sync", s)
|
||||
.and_then(|toml_u64| {
|
||||
toml_u64.try_into().with_context(|| {
|
||||
format!("'max_concurrent_sync' value {} is too large", toml_u64)
|
||||
})
|
||||
})
|
||||
.ok()
|
||||
.and_then(NonZeroUsize::new)
|
||||
.context("'max_concurrent_sync' must be a non-zero positive integer")?
|
||||
} else {
|
||||
NonZeroUsize::new(defaults::DEFAULT_REMOTE_STORAGE_MAX_CONCURRENT_SYNC).unwrap()
|
||||
};
|
||||
let max_sync_errors: NonZeroU32 = if let Some(s) = toml.get("max_sync_errors") {
|
||||
parse_toml_u64("max_sync_errors", s)
|
||||
.and_then(|toml_u64| {
|
||||
toml_u64.try_into().with_context(|| {
|
||||
format!("'max_sync_errors' value {} is too large", toml_u64)
|
||||
})
|
||||
})
|
||||
.ok()
|
||||
.and_then(NonZeroU32::new)
|
||||
.context("'max_sync_errors' must be a non-zero positive integer")?
|
||||
} else {
|
||||
NonZeroU32::new(defaults::DEFAULT_REMOTE_STORAGE_MAX_SYNC_ERRORS).unwrap()
|
||||
};
|
||||
|
||||
let storage = match (local_path, bucket_name, bucket_region) {
|
||||
(None, None, None) => bail!("no 'local_path' nor 'bucket_name' option"),
|
||||
(_, Some(_), None) => {
|
||||
bail!("'bucket_region' option is mandatory if 'bucket_name' is given ")
|
||||
}
|
||||
(_, None, Some(_)) => {
|
||||
bail!("'bucket_name' option is mandatory if 'bucket_region' is given ")
|
||||
}
|
||||
(None, Some(bucket_name), Some(bucket_region)) => RemoteStorageKind::AwsS3(S3Config {
|
||||
bucket_name: parse_toml_string("bucket_name", bucket_name)?,
|
||||
bucket_region: parse_toml_string("bucket_region", bucket_region)?,
|
||||
access_key_id: toml
|
||||
.get("access_key_id")
|
||||
.map(|access_key_id| parse_toml_string("access_key_id", access_key_id))
|
||||
.transpose()?,
|
||||
secret_access_key: toml
|
||||
.get("secret_access_key")
|
||||
.map(|secret_access_key| {
|
||||
parse_toml_string("secret_access_key", secret_access_key)
|
||||
})
|
||||
.transpose()?,
|
||||
prefix_in_bucket: toml
|
||||
.get("prefix_in_bucket")
|
||||
.map(|prefix_in_bucket| parse_toml_string("prefix_in_bucket", prefix_in_bucket))
|
||||
.transpose()?,
|
||||
endpoint: toml
|
||||
.get("endpoint")
|
||||
.map(|endpoint| parse_toml_string("endpoint", endpoint))
|
||||
.transpose()?,
|
||||
}),
|
||||
(Some(local_path), None, None) => RemoteStorageKind::LocalFs(PathBuf::from(
|
||||
parse_toml_string("local_path", local_path)?,
|
||||
)),
|
||||
(Some(_), Some(_), _) => bail!("local_path and bucket_name are mutually exclusive"),
|
||||
};
|
||||
|
||||
Ok(RemoteStorageConfig {
|
||||
max_concurrent_sync,
|
||||
max_sync_errors,
|
||||
storage,
|
||||
})
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
pub fn test_repo_dir(test_name: &str) -> PathBuf {
|
||||
PathBuf::from(format!("../tmp_check/test_{}", test_name))
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
pub fn dummy_conf(repo_dir: PathBuf) -> Self {
|
||||
PageServerConf {
|
||||
id: ZNodeId(0),
|
||||
checkpoint_distance: defaults::DEFAULT_CHECKPOINT_DISTANCE,
|
||||
checkpoint_period: Duration::from_secs(10),
|
||||
gc_horizon: defaults::DEFAULT_GC_HORIZON,
|
||||
gc_period: Duration::from_secs(10),
|
||||
wait_lsn_timeout: Duration::from_secs(60),
|
||||
wal_redo_timeout: Duration::from_secs(60),
|
||||
page_cache_size: defaults::DEFAULT_PAGE_CACHE_SIZE,
|
||||
max_file_descriptors: defaults::DEFAULT_MAX_FILE_DESCRIPTORS,
|
||||
listen_pg_addr: defaults::DEFAULT_PG_LISTEN_ADDR.to_string(),
|
||||
listen_http_addr: defaults::DEFAULT_HTTP_LISTEN_ADDR.to_string(),
|
||||
superuser: "zenith_admin".to_string(),
|
||||
workdir: repo_dir,
|
||||
pg_distrib_dir: PathBuf::new(),
|
||||
auth_type: AuthType::Trust,
|
||||
auth_validation_public_key_path: None,
|
||||
remote_storage_config: None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Helper functions to parse a toml Item
|
||||
|
||||
fn parse_toml_string(name: &str, item: &Item) -> Result<String> {
|
||||
let s = item
|
||||
.as_str()
|
||||
.with_context(|| format!("configure option {} is not a string", name))?;
|
||||
Ok(s.to_string())
|
||||
}
|
||||
|
||||
fn parse_toml_u64(name: &str, item: &Item) -> Result<u64> {
|
||||
// A toml integer is signed, so it cannot represent the full range of an u64. That's OK
|
||||
// for our use, though.
|
||||
let i: i64 = item
|
||||
.as_integer()
|
||||
.with_context(|| format!("configure option {} is not an integer", name))?;
|
||||
if i < 0 {
|
||||
bail!("configure option {} cannot be negative", name);
|
||||
}
|
||||
Ok(i as u64)
|
||||
}
|
||||
|
||||
fn parse_toml_duration(name: &str, item: &Item) -> Result<Duration> {
|
||||
let s = item
|
||||
.as_str()
|
||||
.with_context(|| format!("configure option {} is not a string", name))?;
|
||||
|
||||
Ok(humantime::parse_duration(s)?)
|
||||
}
|
||||
|
||||
fn parse_toml_auth_type(name: &str, item: &Item) -> Result<AuthType> {
|
||||
let v = item
|
||||
.as_str()
|
||||
.with_context(|| format!("configure option {} is not a string", name))?;
|
||||
AuthType::from_str(v)
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use std::fs;
|
||||
|
||||
use tempfile::{tempdir, TempDir};
|
||||
|
||||
use super::*;
|
||||
|
||||
const ALL_BASE_VALUES_TOML: &str = r#"
|
||||
# Initial configuration file created by 'pageserver --init'
|
||||
|
||||
listen_pg_addr = '127.0.0.1:64000'
|
||||
listen_http_addr = '127.0.0.1:9898'
|
||||
|
||||
checkpoint_distance = 111 # in bytes
|
||||
checkpoint_period = '111 s'
|
||||
|
||||
gc_period = '222 s'
|
||||
gc_horizon = 222
|
||||
|
||||
wait_lsn_timeout = '111 s'
|
||||
wal_redo_timeout = '111 s'
|
||||
|
||||
page_cache_size = 444
|
||||
max_file_descriptors = 333
|
||||
|
||||
# initial superuser role name to use when creating a new tenant
|
||||
initial_superuser_name = 'zzzz'
|
||||
id = 10
|
||||
|
||||
"#;
|
||||
|
||||
#[test]
|
||||
fn parse_defaults() -> anyhow::Result<()> {
|
||||
let tempdir = tempdir()?;
|
||||
let (workdir, pg_distrib_dir) = prepare_fs(&tempdir)?;
|
||||
// we have to create dummy pathes to overcome the validation errors
|
||||
let config_string = format!("pg_distrib_dir='{}'\nid=10", pg_distrib_dir.display());
|
||||
let toml = config_string.parse()?;
|
||||
|
||||
let parsed_config =
|
||||
PageServerConf::parse_and_validate(&toml, &workdir).unwrap_or_else(|e| {
|
||||
panic!("Failed to parse config '{}', reason: {}", config_string, e)
|
||||
});
|
||||
|
||||
assert_eq!(
|
||||
parsed_config,
|
||||
PageServerConf {
|
||||
id: ZNodeId(10),
|
||||
listen_pg_addr: defaults::DEFAULT_PG_LISTEN_ADDR.to_string(),
|
||||
listen_http_addr: defaults::DEFAULT_HTTP_LISTEN_ADDR.to_string(),
|
||||
checkpoint_distance: defaults::DEFAULT_CHECKPOINT_DISTANCE,
|
||||
checkpoint_period: humantime::parse_duration(defaults::DEFAULT_CHECKPOINT_PERIOD)?,
|
||||
gc_horizon: defaults::DEFAULT_GC_HORIZON,
|
||||
gc_period: humantime::parse_duration(defaults::DEFAULT_GC_PERIOD)?,
|
||||
wait_lsn_timeout: humantime::parse_duration(defaults::DEFAULT_WAIT_LSN_TIMEOUT)?,
|
||||
wal_redo_timeout: humantime::parse_duration(defaults::DEFAULT_WAL_REDO_TIMEOUT)?,
|
||||
superuser: defaults::DEFAULT_SUPERUSER.to_string(),
|
||||
page_cache_size: defaults::DEFAULT_PAGE_CACHE_SIZE,
|
||||
max_file_descriptors: defaults::DEFAULT_MAX_FILE_DESCRIPTORS,
|
||||
workdir,
|
||||
pg_distrib_dir,
|
||||
auth_type: AuthType::Trust,
|
||||
auth_validation_public_key_path: None,
|
||||
remote_storage_config: None,
|
||||
},
|
||||
"Correct defaults should be used when no config values are provided"
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn parse_basic_config() -> anyhow::Result<()> {
|
||||
let tempdir = tempdir()?;
|
||||
let (workdir, pg_distrib_dir) = prepare_fs(&tempdir)?;
|
||||
|
||||
let config_string = format!(
|
||||
"{}pg_distrib_dir='{}'",
|
||||
ALL_BASE_VALUES_TOML,
|
||||
pg_distrib_dir.display()
|
||||
);
|
||||
let toml = config_string.parse()?;
|
||||
|
||||
let parsed_config =
|
||||
PageServerConf::parse_and_validate(&toml, &workdir).unwrap_or_else(|e| {
|
||||
panic!("Failed to parse config '{}', reason: {}", config_string, e)
|
||||
});
|
||||
|
||||
assert_eq!(
|
||||
parsed_config,
|
||||
PageServerConf {
|
||||
id: ZNodeId(10),
|
||||
listen_pg_addr: "127.0.0.1:64000".to_string(),
|
||||
listen_http_addr: "127.0.0.1:9898".to_string(),
|
||||
checkpoint_distance: 111,
|
||||
checkpoint_period: Duration::from_secs(111),
|
||||
gc_horizon: 222,
|
||||
gc_period: Duration::from_secs(222),
|
||||
wait_lsn_timeout: Duration::from_secs(111),
|
||||
wal_redo_timeout: Duration::from_secs(111),
|
||||
superuser: "zzzz".to_string(),
|
||||
page_cache_size: 444,
|
||||
max_file_descriptors: 333,
|
||||
workdir,
|
||||
pg_distrib_dir,
|
||||
auth_type: AuthType::Trust,
|
||||
auth_validation_public_key_path: None,
|
||||
remote_storage_config: None,
|
||||
},
|
||||
"Should be able to parse all basic config values correctly"
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn parse_remote_fs_storage_config() -> anyhow::Result<()> {
|
||||
let tempdir = tempdir()?;
|
||||
let (workdir, pg_distrib_dir) = prepare_fs(&tempdir)?;
|
||||
|
||||
let local_storage_path = tempdir.path().join("local_remote_storage");
|
||||
|
||||
let identical_toml_declarations = &[
|
||||
format!(
|
||||
r#"[remote_storage]
|
||||
local_path = '{}'"#,
|
||||
local_storage_path.display()
|
||||
),
|
||||
format!(
|
||||
"remote_storage={{local_path='{}'}}",
|
||||
local_storage_path.display()
|
||||
),
|
||||
];
|
||||
|
||||
for remote_storage_config_str in identical_toml_declarations {
|
||||
let config_string = format!(
|
||||
r#"{}
|
||||
pg_distrib_dir='{}'
|
||||
|
||||
{}"#,
|
||||
ALL_BASE_VALUES_TOML,
|
||||
pg_distrib_dir.display(),
|
||||
remote_storage_config_str,
|
||||
);
|
||||
|
||||
let toml = config_string.parse()?;
|
||||
|
||||
let parsed_remote_storage_config = PageServerConf::parse_and_validate(&toml, &workdir)
|
||||
.unwrap_or_else(|e| {
|
||||
panic!("Failed to parse config '{}', reason: {}", config_string, e)
|
||||
})
|
||||
.remote_storage_config
|
||||
.expect("Should have remote storage config for the local FS");
|
||||
|
||||
assert_eq!(
|
||||
parsed_remote_storage_config,
|
||||
RemoteStorageConfig {
|
||||
max_concurrent_sync: NonZeroUsize::new(
|
||||
defaults::DEFAULT_REMOTE_STORAGE_MAX_CONCURRENT_SYNC
|
||||
)
|
||||
.unwrap(),
|
||||
max_sync_errors: NonZeroU32::new(defaults::DEFAULT_REMOTE_STORAGE_MAX_SYNC_ERRORS)
|
||||
.unwrap(),
|
||||
storage: RemoteStorageKind::LocalFs(local_storage_path.clone()),
|
||||
},
|
||||
"Remote storage config should correctly parse the local FS config and fill other storage defaults"
|
||||
);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn parse_remote_s3_storage_config() -> anyhow::Result<()> {
|
||||
let tempdir = tempdir()?;
|
||||
let (workdir, pg_distrib_dir) = prepare_fs(&tempdir)?;
|
||||
|
||||
let bucket_name = "some-sample-bucket".to_string();
|
||||
let bucket_region = "eu-north-1".to_string();
|
||||
let prefix_in_bucket = "test_prefix".to_string();
|
||||
let access_key_id = "SOMEKEYAAAAASADSAH*#".to_string();
|
||||
let secret_access_key = "SOMEsEcReTsd292v".to_string();
|
||||
let endpoint = "http://localhost:5000".to_string();
|
||||
let max_concurrent_sync = NonZeroUsize::new(111).unwrap();
|
||||
let max_sync_errors = NonZeroU32::new(222).unwrap();
|
||||
|
||||
let identical_toml_declarations = &[
|
||||
format!(
|
||||
r#"[remote_storage]
|
||||
max_concurrent_sync = {}
|
||||
max_sync_errors = {}
|
||||
bucket_name = '{}'
|
||||
bucket_region = '{}'
|
||||
prefix_in_bucket = '{}'
|
||||
access_key_id = '{}'
|
||||
secret_access_key = '{}'
|
||||
endpoint = '{}'"#,
|
||||
max_concurrent_sync, max_sync_errors, bucket_name, bucket_region, prefix_in_bucket, access_key_id, secret_access_key, endpoint
|
||||
),
|
||||
format!(
|
||||
"remote_storage={{max_concurrent_sync={}, max_sync_errors={}, bucket_name='{}', bucket_region='{}', prefix_in_bucket='{}', access_key_id='{}', secret_access_key='{}', endpoint='{}'}}",
|
||||
max_concurrent_sync, max_sync_errors, bucket_name, bucket_region, prefix_in_bucket, access_key_id, secret_access_key, endpoint
|
||||
),
|
||||
];
|
||||
|
||||
for remote_storage_config_str in identical_toml_declarations {
|
||||
let config_string = format!(
|
||||
r#"{}
|
||||
pg_distrib_dir='{}'
|
||||
|
||||
{}"#,
|
||||
ALL_BASE_VALUES_TOML,
|
||||
pg_distrib_dir.display(),
|
||||
remote_storage_config_str,
|
||||
);
|
||||
|
||||
let toml = config_string.parse()?;
|
||||
|
||||
let parsed_remote_storage_config = PageServerConf::parse_and_validate(&toml, &workdir)
|
||||
.unwrap_or_else(|e| {
|
||||
panic!("Failed to parse config '{}', reason: {}", config_string, e)
|
||||
})
|
||||
.remote_storage_config
|
||||
.expect("Should have remote storage config for S3");
|
||||
|
||||
assert_eq!(
|
||||
parsed_remote_storage_config,
|
||||
RemoteStorageConfig {
|
||||
max_concurrent_sync,
|
||||
max_sync_errors,
|
||||
storage: RemoteStorageKind::AwsS3(S3Config {
|
||||
bucket_name: bucket_name.clone(),
|
||||
bucket_region: bucket_region.clone(),
|
||||
access_key_id: Some(access_key_id.clone()),
|
||||
secret_access_key: Some(secret_access_key.clone()),
|
||||
prefix_in_bucket: Some(prefix_in_bucket.clone()),
|
||||
endpoint: Some(endpoint.clone())
|
||||
}),
|
||||
},
|
||||
"Remote storage config should correctly parse the S3 config"
|
||||
);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn prepare_fs(tempdir: &TempDir) -> anyhow::Result<(PathBuf, PathBuf)> {
|
||||
let tempdir_path = tempdir.path();
|
||||
|
||||
let workdir = tempdir_path.join("workdir");
|
||||
fs::create_dir_all(&workdir)?;
|
||||
|
||||
let pg_distrib_dir = tempdir_path.join("pg_distrib");
|
||||
fs::create_dir_all(&pg_distrib_dir)?;
|
||||
let postgres_bin_dir = pg_distrib_dir.join("bin");
|
||||
fs::create_dir_all(&postgres_bin_dir)?;
|
||||
fs::write(postgres_bin_dir.join("postgres"), "I'm postgres, trust me")?;
|
||||
|
||||
Ok((workdir, pg_distrib_dir))
|
||||
}
|
||||
}
|
||||
3
pageserver/src/http/mod.rs
Normal file
3
pageserver/src/http/mod.rs
Normal file
@@ -0,0 +1,3 @@
|
||||
pub mod models;
|
||||
pub mod routes;
|
||||
pub use routes::make_router;
|
||||
23
pageserver/src/http/models.rs
Normal file
23
pageserver/src/http/models.rs
Normal file
@@ -0,0 +1,23 @@
|
||||
use serde::{Deserialize, Serialize};
|
||||
|
||||
use crate::ZTenantId;
|
||||
use zenith_utils::zid::ZNodeId;
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct BranchCreateRequest {
|
||||
#[serde(with = "hex")]
|
||||
pub tenant_id: ZTenantId,
|
||||
pub name: String,
|
||||
pub start_point: String,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
pub struct TenantCreateRequest {
|
||||
#[serde(with = "hex")]
|
||||
pub tenant_id: ZTenantId,
|
||||
}
|
||||
|
||||
#[derive(Serialize)]
|
||||
pub struct StatusResponse {
|
||||
pub id: ZNodeId,
|
||||
}
|
||||
438
pageserver/src/http/openapi_spec.yml
Normal file
438
pageserver/src/http/openapi_spec.yml
Normal file
@@ -0,0 +1,438 @@
|
||||
openapi: "3.0.2"
|
||||
info:
|
||||
title: Page Server API
|
||||
version: "1.0"
|
||||
servers:
|
||||
- url: ""
|
||||
paths:
|
||||
/v1/status:
|
||||
description: Healthcheck endpoint
|
||||
get:
|
||||
description: Healthcheck
|
||||
security: []
|
||||
responses:
|
||||
"200":
|
||||
description: OK
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: object
|
||||
required:
|
||||
- id
|
||||
properties:
|
||||
id:
|
||||
type: integer
|
||||
/v1/timeline/{tenant_id}:
|
||||
parameters:
|
||||
- name: tenant_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
get:
|
||||
description: List tenant timelines
|
||||
responses:
|
||||
"200":
|
||||
description: array of brief timeline descriptions
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: array
|
||||
items:
|
||||
# currently, just a timeline id string, but when remote index gets to be accessed
|
||||
# remote/local timeline field would be added at least
|
||||
type: string
|
||||
"400":
|
||||
description: Error when no tenant id found in path
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
/v1/timeline/{tenant_id}/{timeline_id}:
|
||||
parameters:
|
||||
- name: tenant_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
- name: timeline_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
get:
|
||||
description: Get timeline info for tenant's remote timeline
|
||||
responses:
|
||||
"200":
|
||||
description: TimelineInfo
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/TimelineInfo"
|
||||
"400":
|
||||
description: Error when no tenant id found in path or no branch name
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
/v1/branch/{tenant_id}:
|
||||
parameters:
|
||||
- name: tenant_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
- name: include-non-incremental-logical-size
|
||||
in: query
|
||||
schema:
|
||||
type: string
|
||||
description: Controls calculation of current_logical_size_non_incremental
|
||||
get:
|
||||
description: Get branches for tenant
|
||||
responses:
|
||||
"200":
|
||||
description: BranchInfo
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: array
|
||||
items:
|
||||
$ref: "#/components/schemas/BranchInfo"
|
||||
"400":
|
||||
description: Error when no tenant id found in path
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
/v1/branch/{tenant_id}/{branch_name}:
|
||||
parameters:
|
||||
- name: tenant_id
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
format: hex
|
||||
- name: branch_name
|
||||
in: path
|
||||
required: true
|
||||
schema:
|
||||
type: string
|
||||
- name: include-non-incremental-logical-size
|
||||
in: query
|
||||
schema:
|
||||
type: string
|
||||
description: Controls calculation of current_logical_size_non_incremental
|
||||
get:
|
||||
description: Get branches for tenant
|
||||
responses:
|
||||
"200":
|
||||
description: BranchInfo
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/BranchInfo"
|
||||
"400":
|
||||
description: Error when no tenant id found in path or no branch name
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
/v1/branch/:
|
||||
post:
|
||||
description: Create branch
|
||||
requestBody:
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: object
|
||||
required:
|
||||
- "tenant_id"
|
||||
- "name"
|
||||
- "start_point"
|
||||
properties:
|
||||
tenant_id:
|
||||
type: string
|
||||
format: hex
|
||||
name:
|
||||
type: string
|
||||
start_point:
|
||||
type: string
|
||||
responses:
|
||||
"201":
|
||||
description: BranchInfo
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/BranchInfo"
|
||||
"400":
|
||||
description: Malformed branch create request
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
/v1/tenant/:
|
||||
get:
|
||||
description: Get tenants list
|
||||
responses:
|
||||
"200":
|
||||
description: TenantInfo
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: array
|
||||
items:
|
||||
$ref: "#/components/schemas/TenantInfo"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
post:
|
||||
description: Create tenant
|
||||
requestBody:
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: object
|
||||
required:
|
||||
- "tenant_id"
|
||||
properties:
|
||||
tenant_id:
|
||||
type: string
|
||||
format: hex
|
||||
responses:
|
||||
"201":
|
||||
description: CREATED
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
type: array
|
||||
items:
|
||||
type: string
|
||||
"400":
|
||||
description: Malformed tenant create request
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
"401":
|
||||
description: Unauthorized Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/UnauthorizedError"
|
||||
"403":
|
||||
description: Forbidden Error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/ForbiddenError"
|
||||
"500":
|
||||
description: Generic operation error
|
||||
content:
|
||||
application/json:
|
||||
schema:
|
||||
$ref: "#/components/schemas/Error"
|
||||
|
||||
components:
|
||||
securitySchemes:
|
||||
JWT:
|
||||
type: http
|
||||
scheme: bearer
|
||||
bearerFormat: JWT
|
||||
schemas:
|
||||
TenantInfo:
|
||||
type: object
|
||||
required:
|
||||
- id
|
||||
- state
|
||||
properties:
|
||||
id:
|
||||
type: string
|
||||
state:
|
||||
type: string
|
||||
BranchInfo:
|
||||
type: object
|
||||
required:
|
||||
- name
|
||||
- timeline_id
|
||||
- latest_valid_lsn
|
||||
- current_logical_size
|
||||
properties:
|
||||
name:
|
||||
type: string
|
||||
timeline_id:
|
||||
type: string
|
||||
format: hex
|
||||
ancestor_id:
|
||||
type: string
|
||||
format: hex
|
||||
ancestor_lsn:
|
||||
type: string
|
||||
current_logical_size:
|
||||
type: integer
|
||||
current_logical_size_non_incremental:
|
||||
type: integer
|
||||
latest_valid_lsn:
|
||||
type: integer
|
||||
TimelineInfo:
|
||||
type: object
|
||||
required:
|
||||
- timeline_id
|
||||
- tenant_id
|
||||
- last_record_lsn
|
||||
- prev_record_lsn
|
||||
- start_lsn
|
||||
- disk_consistent_lsn
|
||||
properties:
|
||||
timeline_id:
|
||||
type: string
|
||||
format: hex
|
||||
tenant_id:
|
||||
type: string
|
||||
format: hex
|
||||
ancestor_timeline_id:
|
||||
type: string
|
||||
format: hex
|
||||
last_record_lsn:
|
||||
type: string
|
||||
prev_record_lsn:
|
||||
type: string
|
||||
start_lsn:
|
||||
type: string
|
||||
disk_consistent_lsn:
|
||||
type: string
|
||||
timeline_state:
|
||||
type: string
|
||||
|
||||
Error:
|
||||
type: object
|
||||
required:
|
||||
- msg
|
||||
properties:
|
||||
msg:
|
||||
type: string
|
||||
UnauthorizedError:
|
||||
type: object
|
||||
required:
|
||||
- msg
|
||||
properties:
|
||||
msg:
|
||||
type: string
|
||||
ForbiddenError:
|
||||
type: object
|
||||
required:
|
||||
- msg
|
||||
properties:
|
||||
msg:
|
||||
type: string
|
||||
|
||||
security:
|
||||
- JWT: []
|
||||
378
pageserver/src/http/routes.rs
Normal file
378
pageserver/src/http/routes.rs
Normal file
@@ -0,0 +1,378 @@
|
||||
use std::sync::Arc;
|
||||
|
||||
use anyhow::{Context, Result};
|
||||
use hyper::StatusCode;
|
||||
use hyper::{Body, Request, Response, Uri};
|
||||
use serde::Serialize;
|
||||
use tracing::*;
|
||||
use zenith_utils::auth::JwtAuth;
|
||||
use zenith_utils::http::endpoint::attach_openapi_ui;
|
||||
use zenith_utils::http::endpoint::auth_middleware;
|
||||
use zenith_utils::http::endpoint::check_permission;
|
||||
use zenith_utils::http::error::ApiError;
|
||||
use zenith_utils::http::{
|
||||
endpoint,
|
||||
error::HttpErrorBody,
|
||||
json::{json_request, json_response},
|
||||
request::get_request_param,
|
||||
request::parse_request_param,
|
||||
};
|
||||
use zenith_utils::http::{RequestExt, RouterBuilder};
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use zenith_utils::zid::HexZTimelineId;
|
||||
use zenith_utils::zid::ZTimelineId;
|
||||
|
||||
use super::models::BranchCreateRequest;
|
||||
use super::models::StatusResponse;
|
||||
use super::models::TenantCreateRequest;
|
||||
use crate::branches::BranchInfo;
|
||||
use crate::repository::RepositoryTimeline;
|
||||
use crate::repository::TimelineSyncState;
|
||||
use crate::{branches, config::PageServerConf, tenant_mgr, ZTenantId};
|
||||
|
||||
#[derive(Debug)]
|
||||
struct State {
|
||||
conf: &'static PageServerConf,
|
||||
auth: Option<Arc<JwtAuth>>,
|
||||
allowlist_routes: Vec<Uri>,
|
||||
}
|
||||
|
||||
impl State {
|
||||
fn new(conf: &'static PageServerConf, auth: Option<Arc<JwtAuth>>) -> Self {
|
||||
let allowlist_routes = ["/v1/status", "/v1/doc", "/swagger.yml"]
|
||||
.iter()
|
||||
.map(|v| v.parse().unwrap())
|
||||
.collect::<Vec<_>>();
|
||||
Self {
|
||||
conf,
|
||||
auth,
|
||||
allowlist_routes,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
fn get_state(request: &Request<Body>) -> &State {
|
||||
request
|
||||
.data::<Arc<State>>()
|
||||
.expect("unknown state type")
|
||||
.as_ref()
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
fn get_config(request: &Request<Body>) -> &'static PageServerConf {
|
||||
get_state(request).conf
|
||||
}
|
||||
|
||||
// healthcheck handler
|
||||
async fn status_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let config = get_config(&request);
|
||||
Ok(json_response(
|
||||
StatusCode::OK,
|
||||
StatusResponse { id: config.id },
|
||||
)?)
|
||||
}
|
||||
|
||||
async fn branch_create_handler(mut request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let request_data: BranchCreateRequest = json_request(&mut request).await?;
|
||||
|
||||
check_permission(&request, Some(request_data.tenant_id))?;
|
||||
|
||||
let response_data = tokio::task::spawn_blocking(move || {
|
||||
let _enter = info_span!("/branch_create", name = %request_data.name, tenant = %request_data.tenant_id, startpoint=%request_data.start_point).entered();
|
||||
branches::create_branch(
|
||||
get_config(&request),
|
||||
&request_data.name,
|
||||
&request_data.start_point,
|
||||
&request_data.tenant_id,
|
||||
)
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
Ok(json_response(StatusCode::CREATED, response_data)?)
|
||||
}
|
||||
|
||||
// Gate non incremental logical size calculation behind a flag
|
||||
// after pgbench -i -s100 calculation took 28ms so if multiplied by the number of timelines
|
||||
// and tenants it can take noticeable amount of time. Also the value currently used only in tests
|
||||
fn get_include_non_incremental_logical_size(request: &Request<Body>) -> bool {
|
||||
request
|
||||
.uri()
|
||||
.query()
|
||||
.map(|v| {
|
||||
url::form_urlencoded::parse(v.as_bytes())
|
||||
.into_owned()
|
||||
.any(|(param, _)| param == "include-non-incremental-logical-size")
|
||||
})
|
||||
.unwrap_or(false)
|
||||
}
|
||||
|
||||
async fn branch_list_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let tenantid: ZTenantId = parse_request_param(&request, "tenant_id")?;
|
||||
|
||||
let include_non_incremental_logical_size = get_include_non_incremental_logical_size(&request);
|
||||
|
||||
check_permission(&request, Some(tenantid))?;
|
||||
|
||||
let response_data = tokio::task::spawn_blocking(move || {
|
||||
let _enter = info_span!("branch_list", tenant = %tenantid).entered();
|
||||
crate::branches::get_branches(
|
||||
get_config(&request),
|
||||
&tenantid,
|
||||
include_non_incremental_logical_size,
|
||||
)
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
Ok(json_response(StatusCode::OK, response_data)?)
|
||||
}
|
||||
|
||||
async fn branch_detail_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let tenantid: ZTenantId = parse_request_param(&request, "tenant_id")?;
|
||||
let branch_name: String = get_request_param(&request, "branch_name")?.to_string();
|
||||
let conf = get_state(&request).conf;
|
||||
let path = conf.branch_path(&branch_name, &tenantid);
|
||||
|
||||
let include_non_incremental_logical_size = get_include_non_incremental_logical_size(&request);
|
||||
|
||||
let response_data = tokio::task::spawn_blocking(move || {
|
||||
let _enter = info_span!("branch_detail", tenant = %tenantid, branch=%branch_name).entered();
|
||||
let repo = tenant_mgr::get_repository_for_tenant(tenantid)?;
|
||||
BranchInfo::from_path(path, &repo, include_non_incremental_logical_size)
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
|
||||
Ok(json_response(StatusCode::OK, response_data)?)
|
||||
}
|
||||
|
||||
async fn timeline_list_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let tenant_id: ZTenantId = parse_request_param(&request, "tenant_id")?;
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let conf = get_state(&request).conf;
|
||||
let timelines_dir = conf.timelines_path(&tenant_id);
|
||||
|
||||
let mut timelines_dir_contents =
|
||||
tokio::fs::read_dir(&timelines_dir).await.with_context(|| {
|
||||
format!(
|
||||
"Failed to list timelines dir '{}' contents",
|
||||
timelines_dir.display()
|
||||
)
|
||||
})?;
|
||||
|
||||
let mut local_timelines = Vec::new();
|
||||
while let Some(entry) = timelines_dir_contents.next_entry().await.with_context(|| {
|
||||
format!(
|
||||
"Failed to list timelines dir '{}' contents",
|
||||
timelines_dir.display()
|
||||
)
|
||||
})? {
|
||||
let entry_path = entry.path();
|
||||
let entry_type = entry.file_type().await.with_context(|| {
|
||||
format!(
|
||||
"Failed to get file type of timeline dirs' entry '{}'",
|
||||
entry_path.display()
|
||||
)
|
||||
})?;
|
||||
|
||||
if entry_type.is_dir() {
|
||||
match entry.file_name().to_string_lossy().parse::<ZTimelineId>() {
|
||||
Ok(timeline_id) => local_timelines.push(timeline_id.to_string()),
|
||||
Err(e) => error!(
|
||||
"Failed to get parse timeline id from timeline dirs' entry '{}': {}",
|
||||
entry_path.display(),
|
||||
e
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Ok(json_response(StatusCode::OK, local_timelines)?)
|
||||
}
|
||||
|
||||
#[derive(Debug, Serialize)]
|
||||
#[serde(tag = "type")]
|
||||
enum TimelineInfo {
|
||||
Local {
|
||||
#[serde(with = "hex")]
|
||||
timeline_id: ZTimelineId,
|
||||
#[serde(with = "hex")]
|
||||
tenant_id: ZTenantId,
|
||||
ancestor_timeline_id: Option<HexZTimelineId>,
|
||||
last_record_lsn: Lsn,
|
||||
prev_record_lsn: Lsn,
|
||||
disk_consistent_lsn: Lsn,
|
||||
timeline_state: Option<TimelineSyncState>,
|
||||
},
|
||||
Remote {
|
||||
#[serde(with = "hex")]
|
||||
timeline_id: ZTimelineId,
|
||||
#[serde(with = "hex")]
|
||||
tenant_id: ZTenantId,
|
||||
},
|
||||
}
|
||||
|
||||
async fn timeline_detail_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let tenant_id: ZTenantId = parse_request_param(&request, "tenant_id")?;
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let timeline_id: ZTimelineId = parse_request_param(&request, "timeline_id")?;
|
||||
|
||||
let response_data = tokio::task::spawn_blocking(move || {
|
||||
let _enter =
|
||||
info_span!("timeline_detail_handler", tenant = %tenant_id, timeline = %timeline_id)
|
||||
.entered();
|
||||
let repo = tenant_mgr::get_repository_for_tenant(tenant_id)?;
|
||||
Ok::<_, anyhow::Error>(match repo.get_timeline(timeline_id)?.local_timeline() {
|
||||
None => TimelineInfo::Remote {
|
||||
timeline_id,
|
||||
tenant_id,
|
||||
},
|
||||
Some(timeline) => TimelineInfo::Local {
|
||||
timeline_id,
|
||||
tenant_id,
|
||||
ancestor_timeline_id: timeline
|
||||
.get_ancestor_timeline_id()
|
||||
.map(HexZTimelineId::from),
|
||||
disk_consistent_lsn: timeline.get_disk_consistent_lsn(),
|
||||
last_record_lsn: timeline.get_last_record_lsn(),
|
||||
prev_record_lsn: timeline.get_prev_record_lsn(),
|
||||
timeline_state: repo.get_timeline_state(timeline_id),
|
||||
},
|
||||
})
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
|
||||
Ok(json_response(StatusCode::OK, response_data)?)
|
||||
}
|
||||
|
||||
async fn timeline_attach_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let tenant_id: ZTenantId = parse_request_param(&request, "tenant_id")?;
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let timeline_id: ZTimelineId = parse_request_param(&request, "timeline_id")?;
|
||||
|
||||
tokio::task::spawn_blocking(move || {
|
||||
let _enter =
|
||||
info_span!("timeline_attach_handler", tenant = %tenant_id, timeline = %timeline_id)
|
||||
.entered();
|
||||
let repo = tenant_mgr::get_repository_for_tenant(tenant_id)?;
|
||||
match repo.get_timeline(timeline_id)? {
|
||||
RepositoryTimeline::Local(_) => {
|
||||
anyhow::bail!("Timeline with id {} is already local", timeline_id)
|
||||
}
|
||||
RepositoryTimeline::Remote {
|
||||
id: _,
|
||||
disk_consistent_lsn: _,
|
||||
} => {
|
||||
// FIXME (rodionov) get timeline already schedules timeline for download, and duplicate tasks can cause errors
|
||||
// first should be fixed in https://github.com/zenithdb/zenith/issues/997
|
||||
// TODO (rodionov) change timeline state to awaits download (incapsulate it somewhere in the repo)
|
||||
// TODO (rodionov) can we safely request replication on the timeline before sync is completed? (can be implemented on top of the #997)
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
|
||||
Ok(json_response(StatusCode::ACCEPTED, ())?)
|
||||
}
|
||||
|
||||
async fn timeline_detach_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
let tenant_id: ZTenantId = parse_request_param(&request, "tenant_id")?;
|
||||
check_permission(&request, Some(tenant_id))?;
|
||||
|
||||
let timeline_id: ZTimelineId = parse_request_param(&request, "timeline_id")?;
|
||||
|
||||
tokio::task::spawn_blocking(move || {
|
||||
let _enter =
|
||||
info_span!("timeline_detach_handler", tenant = %tenant_id, timeline = %timeline_id)
|
||||
.entered();
|
||||
let repo = tenant_mgr::get_repository_for_tenant(tenant_id)?;
|
||||
repo.detach_timeline(timeline_id)
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
|
||||
Ok(json_response(StatusCode::OK, ())?)
|
||||
}
|
||||
|
||||
async fn tenant_list_handler(request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
// check for management permission
|
||||
check_permission(&request, None)?;
|
||||
|
||||
let response_data = tokio::task::spawn_blocking(move || {
|
||||
let _enter = info_span!("tenant_list").entered();
|
||||
crate::tenant_mgr::list_tenants()
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
|
||||
Ok(json_response(StatusCode::OK, response_data)?)
|
||||
}
|
||||
|
||||
async fn tenant_create_handler(mut request: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
// check for management permission
|
||||
check_permission(&request, None)?;
|
||||
|
||||
let request_data: TenantCreateRequest = json_request(&mut request).await?;
|
||||
|
||||
tokio::task::spawn_blocking(move || {
|
||||
let _enter = info_span!("tenant_create", tenant = %request_data.tenant_id).entered();
|
||||
tenant_mgr::create_repository_for_tenant(get_config(&request), request_data.tenant_id)
|
||||
})
|
||||
.await
|
||||
.map_err(ApiError::from_err)??;
|
||||
Ok(json_response(StatusCode::CREATED, ())?)
|
||||
}
|
||||
|
||||
async fn handler_404(_: Request<Body>) -> Result<Response<Body>, ApiError> {
|
||||
json_response(
|
||||
StatusCode::NOT_FOUND,
|
||||
HttpErrorBody::from_msg("page not found".to_owned()),
|
||||
)
|
||||
}
|
||||
|
||||
pub fn make_router(
|
||||
conf: &'static PageServerConf,
|
||||
auth: Option<Arc<JwtAuth>>,
|
||||
) -> RouterBuilder<hyper::Body, ApiError> {
|
||||
let spec = include_bytes!("openapi_spec.yml");
|
||||
let mut router = attach_openapi_ui(endpoint::make_router(), spec, "/swagger.yml", "/v1/doc");
|
||||
if auth.is_some() {
|
||||
router = router.middleware(auth_middleware(|request| {
|
||||
let state = get_state(request);
|
||||
if state.allowlist_routes.contains(request.uri()) {
|
||||
None
|
||||
} else {
|
||||
state.auth.as_deref()
|
||||
}
|
||||
}))
|
||||
}
|
||||
|
||||
router
|
||||
.data(Arc::new(State::new(conf, auth)))
|
||||
.get("/v1/status", status_handler)
|
||||
.get("/v1/timeline/:tenant_id", timeline_list_handler)
|
||||
.get(
|
||||
"/v1/timeline/:tenant_id/:timeline_id",
|
||||
timeline_detail_handler,
|
||||
)
|
||||
.post(
|
||||
"/v1/timeline/:tenant_id/:timeline_id/attach",
|
||||
timeline_attach_handler,
|
||||
)
|
||||
.post(
|
||||
"/v1/timeline/:tenant_id/:timeline_id/detach",
|
||||
timeline_detach_handler,
|
||||
)
|
||||
.get("/v1/branch/:tenant_id", branch_list_handler)
|
||||
.get("/v1/branch/:tenant_id/:branch_name", branch_detail_handler)
|
||||
.post("/v1/branch", branch_create_handler)
|
||||
.get("/v1/tenant", tenant_list_handler)
|
||||
.post("/v1/tenant", tenant_create_handler)
|
||||
.any(handler_404)
|
||||
}
|
||||
380
pageserver/src/import_datadir.rs
Normal file
380
pageserver/src/import_datadir.rs
Normal file
@@ -0,0 +1,380 @@
|
||||
//!
|
||||
//! Import data and WAL from a PostgreSQL data directory and WAL segments into
|
||||
//! a zenith Timeline.
|
||||
//!
|
||||
use std::fs;
|
||||
use std::fs::File;
|
||||
use std::io::{Read, Seek, SeekFrom};
|
||||
use std::path::{Path, PathBuf};
|
||||
|
||||
use anyhow::{bail, ensure, Context, Result};
|
||||
use bytes::Bytes;
|
||||
use tracing::*;
|
||||
|
||||
use crate::relish::*;
|
||||
use crate::repository::*;
|
||||
use crate::walingest::WalIngest;
|
||||
use postgres_ffi::relfile_utils::*;
|
||||
use postgres_ffi::waldecoder::*;
|
||||
use postgres_ffi::xlog_utils::*;
|
||||
use postgres_ffi::Oid;
|
||||
use postgres_ffi::{pg_constants, ControlFileData, DBState_DB_SHUTDOWNED};
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
///
|
||||
/// Import all relation data pages from local disk into the repository.
|
||||
///
|
||||
/// This is currently only used to import a cluster freshly created by initdb.
|
||||
/// The code that deals with the checkpoint would not work right if the
|
||||
/// cluster was not shut down cleanly.
|
||||
pub fn import_timeline_from_postgres_datadir(
|
||||
path: &Path,
|
||||
writer: &dyn TimelineWriter,
|
||||
lsn: Lsn,
|
||||
) -> Result<()> {
|
||||
let mut pg_control: Option<ControlFileData> = None;
|
||||
|
||||
// Scan 'global'
|
||||
for direntry in fs::read_dir(path.join("global"))? {
|
||||
let direntry = direntry?;
|
||||
match direntry.file_name().to_str() {
|
||||
None => continue,
|
||||
|
||||
Some("pg_control") => {
|
||||
pg_control = Some(import_control_file(writer, lsn, &direntry.path())?);
|
||||
}
|
||||
Some("pg_filenode.map") => import_nonrel_file(
|
||||
writer,
|
||||
lsn,
|
||||
RelishTag::FileNodeMap {
|
||||
spcnode: pg_constants::GLOBALTABLESPACE_OID,
|
||||
dbnode: 0,
|
||||
},
|
||||
&direntry.path(),
|
||||
)?,
|
||||
|
||||
// Load any relation files into the page server
|
||||
_ => import_relfile(
|
||||
&direntry.path(),
|
||||
writer,
|
||||
lsn,
|
||||
pg_constants::GLOBALTABLESPACE_OID,
|
||||
0,
|
||||
)?,
|
||||
}
|
||||
}
|
||||
|
||||
// Scan 'base'. It contains database dirs, the database OID is the filename.
|
||||
// E.g. 'base/12345', where 12345 is the database OID.
|
||||
for direntry in fs::read_dir(path.join("base"))? {
|
||||
let direntry = direntry?;
|
||||
|
||||
//skip all temporary files
|
||||
if direntry.file_name().to_str().unwrap() == "pgsql_tmp" {
|
||||
continue;
|
||||
}
|
||||
|
||||
let dboid = direntry.file_name().to_str().unwrap().parse::<u32>()?;
|
||||
|
||||
for direntry in fs::read_dir(direntry.path())? {
|
||||
let direntry = direntry?;
|
||||
match direntry.file_name().to_str() {
|
||||
None => continue,
|
||||
|
||||
Some("PG_VERSION") => continue,
|
||||
Some("pg_filenode.map") => import_nonrel_file(
|
||||
writer,
|
||||
lsn,
|
||||
RelishTag::FileNodeMap {
|
||||
spcnode: pg_constants::DEFAULTTABLESPACE_OID,
|
||||
dbnode: dboid,
|
||||
},
|
||||
&direntry.path(),
|
||||
)?,
|
||||
|
||||
// Load any relation files into the page server
|
||||
_ => import_relfile(
|
||||
&direntry.path(),
|
||||
writer,
|
||||
lsn,
|
||||
pg_constants::DEFAULTTABLESPACE_OID,
|
||||
dboid,
|
||||
)?,
|
||||
}
|
||||
}
|
||||
}
|
||||
for entry in fs::read_dir(path.join("pg_xact"))? {
|
||||
let entry = entry?;
|
||||
import_slru_file(writer, lsn, SlruKind::Clog, &entry.path())?;
|
||||
}
|
||||
for entry in fs::read_dir(path.join("pg_multixact").join("members"))? {
|
||||
let entry = entry?;
|
||||
import_slru_file(writer, lsn, SlruKind::MultiXactMembers, &entry.path())?;
|
||||
}
|
||||
for entry in fs::read_dir(path.join("pg_multixact").join("offsets"))? {
|
||||
let entry = entry?;
|
||||
import_slru_file(writer, lsn, SlruKind::MultiXactOffsets, &entry.path())?;
|
||||
}
|
||||
for entry in fs::read_dir(path.join("pg_twophase"))? {
|
||||
let entry = entry?;
|
||||
let xid = u32::from_str_radix(entry.path().to_str().unwrap(), 16)?;
|
||||
import_nonrel_file(writer, lsn, RelishTag::TwoPhase { xid }, &entry.path())?;
|
||||
}
|
||||
// TODO: Scan pg_tblspc
|
||||
|
||||
// We're done importing all the data files.
|
||||
writer.advance_last_record_lsn(lsn);
|
||||
|
||||
// We expect the Postgres server to be shut down cleanly.
|
||||
let pg_control = pg_control.context("pg_control file not found")?;
|
||||
ensure!(
|
||||
pg_control.state == DBState_DB_SHUTDOWNED,
|
||||
"Postgres cluster was not shut down cleanly"
|
||||
);
|
||||
ensure!(
|
||||
pg_control.checkPointCopy.redo == lsn.0,
|
||||
"unexpected checkpoint REDO pointer"
|
||||
);
|
||||
|
||||
// Import WAL. This is needed even when starting from a shutdown checkpoint, because
|
||||
// this reads the checkpoint record itself, advancing the tip of the timeline to
|
||||
// *after* the checkpoint record. And crucially, it initializes the 'prev_lsn'.
|
||||
import_wal(
|
||||
&path.join("pg_wal"),
|
||||
writer,
|
||||
Lsn(pg_control.checkPointCopy.redo),
|
||||
lsn,
|
||||
)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// subroutine of import_timeline_from_postgres_datadir(), to load one relation file.
|
||||
fn import_relfile(
|
||||
path: &Path,
|
||||
timeline: &dyn TimelineWriter,
|
||||
lsn: Lsn,
|
||||
spcoid: Oid,
|
||||
dboid: Oid,
|
||||
) -> Result<()> {
|
||||
// Does it look like a relation file?
|
||||
trace!("importing rel file {}", path.display());
|
||||
|
||||
let p = parse_relfilename(path.file_name().unwrap().to_str().unwrap());
|
||||
if let Err(e) = p {
|
||||
warn!("unrecognized file in postgres datadir: {:?} ({})", path, e);
|
||||
return Err(e.into());
|
||||
}
|
||||
let (relnode, forknum, segno) = p.unwrap();
|
||||
|
||||
let mut file = File::open(path)?;
|
||||
let mut buf: [u8; 8192] = [0u8; 8192];
|
||||
|
||||
let mut blknum: u32 = segno * (1024 * 1024 * 1024 / pg_constants::BLCKSZ as u32);
|
||||
loop {
|
||||
let r = file.read_exact(&mut buf);
|
||||
match r {
|
||||
Ok(_) => {
|
||||
let rel = RelTag {
|
||||
spcnode: spcoid,
|
||||
dbnode: dboid,
|
||||
relnode,
|
||||
forknum,
|
||||
};
|
||||
let tag = RelishTag::Relation(rel);
|
||||
timeline.put_page_image(tag, blknum, lsn, Bytes::copy_from_slice(&buf))?;
|
||||
}
|
||||
|
||||
// TODO: UnexpectedEof is expected
|
||||
Err(err) => match err.kind() {
|
||||
std::io::ErrorKind::UnexpectedEof => {
|
||||
// reached EOF. That's expected.
|
||||
// FIXME: maybe check that we read the full length of the file?
|
||||
break;
|
||||
}
|
||||
_ => {
|
||||
bail!("error reading file {}: {:#}", path.display(), err);
|
||||
}
|
||||
},
|
||||
};
|
||||
blknum += 1;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
///
|
||||
/// Import a "non-blocky" file into the repository
|
||||
///
|
||||
/// This is used for small files like the control file, twophase files etc. that
|
||||
/// are just slurped into the repository as one blob.
|
||||
///
|
||||
fn import_nonrel_file(
|
||||
timeline: &dyn TimelineWriter,
|
||||
lsn: Lsn,
|
||||
tag: RelishTag,
|
||||
path: &Path,
|
||||
) -> Result<()> {
|
||||
let mut file = File::open(path)?;
|
||||
let mut buffer = Vec::new();
|
||||
// read the whole file
|
||||
file.read_to_end(&mut buffer)?;
|
||||
|
||||
trace!("importing non-rel file {}", path.display());
|
||||
|
||||
timeline.put_page_image(tag, 0, lsn, Bytes::copy_from_slice(&buffer[..]))?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
///
|
||||
/// Import pg_control file into the repository.
|
||||
///
|
||||
/// The control file is imported as is, but we also extract the checkpoint record
|
||||
/// from it and store it separated.
|
||||
fn import_control_file(
|
||||
timeline: &dyn TimelineWriter,
|
||||
lsn: Lsn,
|
||||
path: &Path,
|
||||
) -> Result<ControlFileData> {
|
||||
let mut file = File::open(path)?;
|
||||
let mut buffer = Vec::new();
|
||||
// read the whole file
|
||||
file.read_to_end(&mut buffer)?;
|
||||
|
||||
trace!("importing control file {}", path.display());
|
||||
|
||||
// Import it as ControlFile
|
||||
timeline.put_page_image(
|
||||
RelishTag::ControlFile,
|
||||
0,
|
||||
lsn,
|
||||
Bytes::copy_from_slice(&buffer[..]),
|
||||
)?;
|
||||
|
||||
// Extract the checkpoint record and import it separately.
|
||||
let pg_control = ControlFileData::decode(&buffer)?;
|
||||
let checkpoint_bytes = pg_control.checkPointCopy.encode();
|
||||
timeline.put_page_image(RelishTag::Checkpoint, 0, lsn, checkpoint_bytes)?;
|
||||
|
||||
Ok(pg_control)
|
||||
}
|
||||
|
||||
///
|
||||
/// Import an SLRU segment file
|
||||
///
|
||||
fn import_slru_file(
|
||||
timeline: &dyn TimelineWriter,
|
||||
lsn: Lsn,
|
||||
slru: SlruKind,
|
||||
path: &Path,
|
||||
) -> Result<()> {
|
||||
// Does it look like an SLRU file?
|
||||
let mut file = File::open(path)?;
|
||||
let mut buf: [u8; 8192] = [0u8; 8192];
|
||||
let segno = u32::from_str_radix(path.file_name().unwrap().to_str().unwrap(), 16)?;
|
||||
|
||||
trace!("importing slru file {}", path.display());
|
||||
|
||||
let mut rpageno = 0;
|
||||
loop {
|
||||
let r = file.read_exact(&mut buf);
|
||||
match r {
|
||||
Ok(_) => {
|
||||
timeline.put_page_image(
|
||||
RelishTag::Slru { slru, segno },
|
||||
rpageno,
|
||||
lsn,
|
||||
Bytes::copy_from_slice(&buf),
|
||||
)?;
|
||||
}
|
||||
|
||||
// TODO: UnexpectedEof is expected
|
||||
Err(err) => match err.kind() {
|
||||
std::io::ErrorKind::UnexpectedEof => {
|
||||
// reached EOF. That's expected.
|
||||
// FIXME: maybe check that we read the full length of the file?
|
||||
break;
|
||||
}
|
||||
_ => {
|
||||
bail!("error reading file {}: {:#}", path.display(), err);
|
||||
}
|
||||
},
|
||||
};
|
||||
rpageno += 1;
|
||||
|
||||
// TODO: Check that the file isn't unexpectedly large, not larger than SLRU_PAGES_PER_SEGMENT pages
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Scan PostgreSQL WAL files in given directory and load all records between
|
||||
/// 'startpoint' and 'endpoint' into the repository.
|
||||
fn import_wal(
|
||||
walpath: &Path,
|
||||
writer: &dyn TimelineWriter,
|
||||
startpoint: Lsn,
|
||||
endpoint: Lsn,
|
||||
) -> Result<()> {
|
||||
let mut waldecoder = WalStreamDecoder::new(startpoint);
|
||||
|
||||
let mut segno = startpoint.segment_number(pg_constants::WAL_SEGMENT_SIZE);
|
||||
let mut offset = startpoint.segment_offset(pg_constants::WAL_SEGMENT_SIZE);
|
||||
let mut last_lsn = startpoint;
|
||||
|
||||
let mut walingest = WalIngest::new(writer.deref(), startpoint)?;
|
||||
|
||||
while last_lsn <= endpoint {
|
||||
// FIXME: assume postgresql tli 1 for now
|
||||
let filename = XLogFileName(1, segno, pg_constants::WAL_SEGMENT_SIZE);
|
||||
let mut buf = Vec::new();
|
||||
|
||||
// Read local file
|
||||
let mut path = walpath.join(&filename);
|
||||
|
||||
// It could be as .partial
|
||||
if !PathBuf::from(&path).exists() {
|
||||
path = walpath.join(filename + ".partial");
|
||||
}
|
||||
|
||||
// Slurp the WAL file
|
||||
let mut file = File::open(&path)?;
|
||||
|
||||
if offset > 0 {
|
||||
file.seek(SeekFrom::Start(offset as u64))?;
|
||||
}
|
||||
|
||||
let nread = file.read_to_end(&mut buf)?;
|
||||
if nread != pg_constants::WAL_SEGMENT_SIZE - offset as usize {
|
||||
// Maybe allow this for .partial files?
|
||||
error!("read only {} bytes from WAL file", nread);
|
||||
}
|
||||
|
||||
waldecoder.feed_bytes(&buf);
|
||||
|
||||
let mut nrecords = 0;
|
||||
while last_lsn <= endpoint {
|
||||
if let Some((lsn, recdata)) = waldecoder.poll_decode()? {
|
||||
walingest.ingest_record(writer, recdata, lsn)?;
|
||||
last_lsn = lsn;
|
||||
|
||||
nrecords += 1;
|
||||
|
||||
trace!("imported record at {} (end {})", lsn, endpoint);
|
||||
}
|
||||
}
|
||||
|
||||
debug!("imported {} records up to {}", nrecords, last_lsn);
|
||||
|
||||
segno += 1;
|
||||
offset = 0;
|
||||
}
|
||||
|
||||
if last_lsn != startpoint {
|
||||
debug!("reached end of WAL at {}", last_lsn);
|
||||
} else {
|
||||
info!("no WAL to import at {}", last_lsn);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,349 +0,0 @@
|
||||
//!
|
||||
//! An implementation of the ObjectStore interface, backed by BTreeMap
|
||||
//!
|
||||
use crate::object_key::*;
|
||||
use crate::object_store::ObjectStore;
|
||||
use crate::repository::RelTag;
|
||||
use crate::PageServerConf;
|
||||
use crate::ZTimelineId;
|
||||
use anyhow::{bail, Result};
|
||||
use std::collections::{BTreeMap,HashSet};
|
||||
use std::sync::RwLock;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use std::ops::Bound::*;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use zenith_utils::bin_ser::BeSer;
|
||||
use std::io::prelude::*;
|
||||
use std::fs::File;
|
||||
|
||||
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord, Deserialize, Serialize)]
|
||||
pub struct StorageKey {
|
||||
obj_key: ObjectKey,
|
||||
lsn: Lsn,
|
||||
}
|
||||
|
||||
impl StorageKey {
|
||||
/// The first key for a given timeline
|
||||
fn timeline_start(timeline: ZTimelineId) -> Self {
|
||||
Self {
|
||||
obj_key: ObjectKey {
|
||||
timeline,
|
||||
tag: ObjectTag::FirstTag,
|
||||
},
|
||||
lsn: Lsn(0),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub struct InmemObjectStore {
|
||||
conf: &'static PageServerConf,
|
||||
db: RwLock<BTreeMap<StorageKey, Vec<u8>>>,
|
||||
}
|
||||
|
||||
impl ObjectStore for InmemObjectStore {
|
||||
fn get(&self, key: &ObjectKey, lsn: Lsn) -> Result<Vec<u8>> {
|
||||
let db = self.db.read().unwrap();
|
||||
let val = db.get(&StorageKey {
|
||||
obj_key: key.clone(),
|
||||
lsn,
|
||||
});
|
||||
if let Some(val) = val {
|
||||
Ok(val.clone())
|
||||
} else {
|
||||
bail!("could not find page {:?}", key);
|
||||
}
|
||||
}
|
||||
|
||||
fn get_next_key(&self, key: &ObjectKey) -> Result<Option<ObjectKey>> {
|
||||
let search_key = StorageKey {
|
||||
obj_key: key.clone(),
|
||||
lsn: Lsn(0),
|
||||
};
|
||||
let db = self.db.read().unwrap();
|
||||
for pair in db.range(&search_key..) {
|
||||
let key = pair.0;
|
||||
return Ok(Some(key.obj_key.clone()));
|
||||
}
|
||||
Ok(None)
|
||||
}
|
||||
|
||||
fn put(&self, key: &ObjectKey, lsn: Lsn, value: &[u8]) -> Result<()> {
|
||||
let mut db = self.db.write().unwrap();
|
||||
db.insert(
|
||||
StorageKey {
|
||||
obj_key: key.clone(),
|
||||
lsn,
|
||||
},
|
||||
value.to_vec(),
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn unlink(&self, key: &ObjectKey, lsn: Lsn) -> Result<()> {
|
||||
let mut db = self.db.write().unwrap();
|
||||
db.remove(&StorageKey {
|
||||
obj_key: key.clone(),
|
||||
lsn,
|
||||
});
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Iterate through page versions of given page, starting from the given LSN.
|
||||
/// The versions are walked in descending LSN order.
|
||||
fn object_versions<'a>(
|
||||
&'a self,
|
||||
key: &ObjectKey,
|
||||
lsn: Lsn,
|
||||
) -> Result<Box<dyn Iterator<Item = (Lsn, Vec<u8>)> + 'a>> {
|
||||
let from = StorageKey {
|
||||
obj_key: key.clone(),
|
||||
lsn: Lsn(0),
|
||||
};
|
||||
let till = StorageKey {
|
||||
obj_key: key.clone(),
|
||||
lsn,
|
||||
};
|
||||
let db = self.db.read().unwrap();
|
||||
let versions: Vec<(Lsn, Vec<u8>)> = db.range(from..=till).map(|pair|(pair.0.lsn, pair.1.clone())).collect();
|
||||
Ok(Box::new(InmemObjectVersionIter::new(versions)))
|
||||
}
|
||||
|
||||
/// Iterate through all timeline objects
|
||||
fn list_objects<'a>(
|
||||
&'a self,
|
||||
timeline: ZTimelineId,
|
||||
nonrel_only: bool,
|
||||
lsn: Lsn,
|
||||
) -> Result<Box<dyn Iterator<Item = ObjectTag> + 'a>> {
|
||||
let curr_key = StorageKey::timeline_start(timeline);
|
||||
|
||||
Ok(Box::new(InmemObjectIter {
|
||||
store: &self,
|
||||
curr_key,
|
||||
timeline,
|
||||
nonrel_only,
|
||||
lsn,
|
||||
}))
|
||||
}
|
||||
|
||||
/// Get a list of all distinct relations in given tablespace and database.
|
||||
///
|
||||
/// TODO: This implementation is very inefficient, it scans
|
||||
/// through all entries in the given database. In practice, this
|
||||
/// is used for CREATE DATABASE, and usually the template database is small.
|
||||
/// But if it's not, this will be slow.
|
||||
fn list_rels(
|
||||
&self,
|
||||
timelineid: ZTimelineId,
|
||||
spcnode: u32,
|
||||
dbnode: u32,
|
||||
lsn: Lsn,
|
||||
) -> Result<HashSet<RelTag>> {
|
||||
// FIXME: This scans everything. Very slow
|
||||
|
||||
let mut rels: HashSet<RelTag> = HashSet::new();
|
||||
|
||||
let mut search_rel_tag = RelTag {
|
||||
spcnode,
|
||||
dbnode,
|
||||
relnode: 0,
|
||||
forknum: 0u8,
|
||||
};
|
||||
let db = self.db.read().unwrap();
|
||||
'outer: loop {
|
||||
let search_key = StorageKey {
|
||||
obj_key: ObjectKey {
|
||||
timeline: timelineid,
|
||||
tag: ObjectTag::RelationMetadata(search_rel_tag),
|
||||
},
|
||||
lsn: Lsn(0),
|
||||
};
|
||||
for pair in db.range(&search_key..) {
|
||||
let key = pair.0;
|
||||
|
||||
if let ObjectTag::RelationMetadata(rel_tag) = key.obj_key.tag {
|
||||
if spcnode != 0 && rel_tag.spcnode != spcnode
|
||||
|| dbnode != 0 && rel_tag.dbnode != dbnode
|
||||
{
|
||||
break 'outer;
|
||||
}
|
||||
if key.lsn <= lsn {
|
||||
// visible in this snapshot
|
||||
rels.insert(rel_tag);
|
||||
}
|
||||
search_rel_tag = rel_tag;
|
||||
// skip to next relation
|
||||
// FIXME: What if relnode is u32::MAX ?
|
||||
search_rel_tag.relnode += 1;
|
||||
continue 'outer;
|
||||
} else {
|
||||
// no more relation metadata entries
|
||||
break 'outer;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Ok(rels)
|
||||
}
|
||||
|
||||
/// Iterate through versions of all objects in a timeline.
|
||||
///
|
||||
/// Returns objects in increasing key-version order.
|
||||
/// Returns all versions up to and including the specified LSN.
|
||||
fn objects<'a>(
|
||||
&'a self,
|
||||
timeline: ZTimelineId,
|
||||
lsn: Lsn,
|
||||
) -> Result<Box<dyn Iterator<Item = Result<(ObjectTag, Lsn, Vec<u8>)>> + 'a>> {
|
||||
let curr_key = StorageKey::timeline_start(timeline);
|
||||
|
||||
Ok(Box::new(InmemObjects {
|
||||
store: &self,
|
||||
curr_key,
|
||||
timeline,
|
||||
lsn,
|
||||
}))
|
||||
}
|
||||
|
||||
fn compact(&self) {
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for InmemObjectStore {
|
||||
fn drop(&mut self) {
|
||||
let path = self.conf.workdir.join("objstore.dmp");
|
||||
let mut f = File::create(path).unwrap();
|
||||
f.write(&self.db.ser().unwrap()).unwrap();
|
||||
}
|
||||
}
|
||||
|
||||
impl InmemObjectStore {
|
||||
pub fn open(conf: &'static PageServerConf) -> Result<InmemObjectStore> {
|
||||
let path = conf.workdir.join("objstore.dmp");
|
||||
let mut f = File::open(path)?;
|
||||
let mut buffer = Vec::new();
|
||||
// read the whole file
|
||||
f.read_to_end(&mut buffer)?;
|
||||
let db = RwLock::new(BTreeMap::des(&buffer)?);
|
||||
Ok(InmemObjectStore {
|
||||
conf: conf,
|
||||
db
|
||||
})
|
||||
}
|
||||
|
||||
pub fn create(conf: &'static PageServerConf) -> Result<InmemObjectStore> {
|
||||
Ok(InmemObjectStore {
|
||||
conf: conf,
|
||||
db: RwLock::new(BTreeMap::new()),
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Iterator for `object_versions`. Returns all page versions of a given block, in
|
||||
/// reverse LSN order.
|
||||
///
|
||||
struct InmemObjectVersionIter {
|
||||
versions: Vec<(Lsn, Vec<u8>)>,
|
||||
curr: usize,
|
||||
}
|
||||
impl InmemObjectVersionIter {
|
||||
fn new(versions: Vec<(Lsn, Vec<u8>)>) -> InmemObjectVersionIter {
|
||||
let curr = versions.len();
|
||||
InmemObjectVersionIter {
|
||||
versions,
|
||||
curr
|
||||
}
|
||||
}
|
||||
}
|
||||
impl Iterator for InmemObjectVersionIter {
|
||||
type Item = (Lsn, Vec<u8>);
|
||||
|
||||
fn next(&mut self) -> std::option::Option<Self::Item> {
|
||||
if self.curr == 0 {
|
||||
None
|
||||
} else {
|
||||
self.curr -= 1;
|
||||
Some(self.versions[self.curr].clone())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
struct InmemObjects<'r> {
|
||||
store: &'r InmemObjectStore,
|
||||
curr_key: StorageKey,
|
||||
timeline: ZTimelineId,
|
||||
lsn: Lsn,
|
||||
}
|
||||
|
||||
impl<'r> Iterator for InmemObjects<'r> {
|
||||
// TODO consider returning Box<[u8]>
|
||||
type Item = Result<(ObjectTag, Lsn, Vec<u8>)>;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
self.next_result().transpose()
|
||||
}
|
||||
}
|
||||
|
||||
impl<'r> InmemObjects<'r> {
|
||||
fn next_result(&mut self) -> Result<Option<(ObjectTag, Lsn, Vec<u8>)>> {
|
||||
let db = self.store.db.read().unwrap();
|
||||
for pair in db.range((Excluded(&self.curr_key),Unbounded)) {
|
||||
let key = pair.0;
|
||||
if key.obj_key.timeline != self.timeline {
|
||||
return Ok(None);
|
||||
}
|
||||
if key.lsn > self.lsn {
|
||||
// TODO can speed up by seeking iterator
|
||||
continue;
|
||||
}
|
||||
self.curr_key = key.clone();
|
||||
let value = pair.1.clone();
|
||||
return Ok(Some((key.obj_key.tag, key.lsn, value)));
|
||||
}
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Iterator for `list_objects`. Returns all objects preceeding specified LSN
|
||||
///
|
||||
struct InmemObjectIter<'a> {
|
||||
store: &'a InmemObjectStore,
|
||||
curr_key: StorageKey,
|
||||
timeline: ZTimelineId,
|
||||
nonrel_only: bool,
|
||||
lsn: Lsn,
|
||||
}
|
||||
|
||||
impl<'a> Iterator for InmemObjectIter<'a> {
|
||||
type Item = ObjectTag;
|
||||
|
||||
fn next(&mut self) -> std::option::Option<Self::Item> {
|
||||
let db = self.store.db.read().unwrap();
|
||||
'outer: loop {
|
||||
for pair in db.range((Excluded(&self.curr_key),Unbounded)) {
|
||||
let key = pair.0;
|
||||
if key.obj_key.timeline != self.timeline {
|
||||
return None;
|
||||
}
|
||||
self.curr_key = key.clone();
|
||||
self.curr_key.lsn = Lsn(u64::MAX); // next seek should skip all versions
|
||||
if key.lsn <= self.lsn {
|
||||
// visible in this snapshot
|
||||
if self.nonrel_only {
|
||||
match key.obj_key.tag {
|
||||
ObjectTag::RelationMetadata(_) => return None,
|
||||
ObjectTag::RelationBuffer(_) => return None,
|
||||
_ => return Some(key.obj_key.tag),
|
||||
}
|
||||
} else {
|
||||
return Some(key.obj_key.tag);
|
||||
}
|
||||
}
|
||||
continue 'outer;
|
||||
}
|
||||
return None;
|
||||
}
|
||||
}
|
||||
}
|
||||
2502
pageserver/src/layered_repository.rs
Normal file
2502
pageserver/src/layered_repository.rs
Normal file
File diff suppressed because it is too large
Load Diff
489
pageserver/src/layered_repository/README.md
Normal file
489
pageserver/src/layered_repository/README.md
Normal file
@@ -0,0 +1,489 @@
|
||||
# Overview
|
||||
|
||||
The on-disk format is based on immutable files. The page server receives a
|
||||
stream of incoming WAL, parses the WAL records to determine which pages they
|
||||
apply to, and accumulates the incoming changes in memory. Every now and then,
|
||||
the accumulated changes are written out to new immutable files. This process is
|
||||
called checkpointing. Old versions of on-disk files that are not needed by any
|
||||
timeline are removed by GC process.
|
||||
|
||||
The main responsibility of the Page Server is to process the incoming WAL, and
|
||||
reprocess it into a format that allows reasonably quick access to any page
|
||||
version.
|
||||
|
||||
The incoming WAL contains updates to arbitrary pages in the system. The
|
||||
distribution depends on the workload: the updates could be totally random, or
|
||||
there could be a long stream of updates to a single relation when data is bulk
|
||||
loaded, for example, or something in between. The page server slices the
|
||||
incoming WAL per relation and page, and packages the sliced WAL into
|
||||
suitably-sized "layer files". The layer files contain all the history of the
|
||||
database, back to some reasonable retention period. This system replaces the
|
||||
base backups and the WAL archive used in a traditional PostgreSQL
|
||||
installation. The layer files are immutable, they are not modified in-place
|
||||
after creation. New layer files are created for new incoming WAL, and old layer
|
||||
files are removed when they are no longer needed. We could also replace layer
|
||||
files with new files that contain the same information, merging small files for
|
||||
example, but that hasn't been implemented yet.
|
||||
|
||||
|
||||
Cloud Storage Page Server Safekeeper
|
||||
Local disk Memory WAL
|
||||
|
||||
|AAAA| |AAAA|AAAA| |AA
|
||||
|BBBB| |BBBB|BBBB| |
|
||||
|CCCC|CCCC| <---- |CCCC|CCCC|CCCC| <--- |CC <---- ADEBAABED
|
||||
|DDDD|DDDD| |DDDD|DDDD| |DDD
|
||||
|EEEE| |EEEE|EEEE|EEEE| |E
|
||||
|
||||
|
||||
In this illustration, WAL is received as a stream from the Safekeeper, from the
|
||||
right. It is immediately captured by the page server and stored quickly in
|
||||
memory. The page server memory can be thought of as a quick "reorder buffer",
|
||||
used to hold the incoming WAL and reorder it so that we keep the WAL records for
|
||||
the same page and relation close to each other.
|
||||
|
||||
From the page server memory, whenever enough WAL has been accumulated for one
|
||||
relation segment, it is moved to local disk, as a new layer file, and the memory
|
||||
is released.
|
||||
|
||||
From the local disk, the layers are further copied to Cloud Storage, for
|
||||
long-term archival. After a layer has been copied to Cloud Storage, it can be
|
||||
removed from local disk, although we currently keep everything locally for fast
|
||||
access. If a layer is needed that isn't found locally, it is fetched from Cloud
|
||||
Storage and stored in local disk.
|
||||
|
||||
# Terms used in layered repository
|
||||
|
||||
- Relish - one PostgreSQL relation or similarly treated file.
|
||||
- Segment - one slice of a Relish that is stored in a LayeredTimeline.
|
||||
- Layer - specific version of a relish Segment in a range of LSNs.
|
||||
|
||||
# Layer map
|
||||
|
||||
The LayerMap tracks what layers exist for all the relishes in a timeline.
|
||||
|
||||
LayerMap consists of two data structures:
|
||||
- segs - All the layers keyed by segment tag
|
||||
- open_layers - data structure that hold all open layers ordered by oldest_pending_lsn for quick access during checkpointing. oldest_pending_lsn is the LSN of the oldest page version stored in this layer.
|
||||
|
||||
All operations that update InMemory Layers should update both structures to keep them up-to-date.
|
||||
|
||||
- LayeredTimeline - implements Timeline interface.
|
||||
|
||||
All methods of LayeredTimeline are aware of its ancestors and return data taking them into account.
|
||||
TODO: Are there any exceptions to this?
|
||||
For example, timeline.list_rels(lsn) will return all segments that are visible in this timeline at the LSN,
|
||||
including ones that were not modified in this timeline and thus don't have a layer in the timeline's LayerMap.
|
||||
|
||||
|
||||
# Different kinds of layers
|
||||
|
||||
A layer can be in different states:
|
||||
|
||||
- Open - a layer where new WAL records can be appended to.
|
||||
- Closed - a layer that is read-only, no new WAL records can be appended to it
|
||||
- Historic: synonym for closed
|
||||
- InMemory: A layer that needs to be rebuilt from WAL on pageserver start.
|
||||
To avoid OOM errors, InMemory layers can be spilled to disk into ephemeral file.
|
||||
- OnDisk: A layer that is stored on disk. If its end-LSN is older than
|
||||
disk_consistent_lsn, it is known to be fully flushed and fsync'd to local disk.
|
||||
- Frozen layer: an in-memory layer that is Closed.
|
||||
|
||||
TODO: Clarify the difference between Closed, Historic and Frozen.
|
||||
|
||||
There are two kinds of OnDisk layers:
|
||||
- ImageLayer represents an image or a snapshot of a 10 MB relish segment, at one particular LSN.
|
||||
- DeltaLayer represents a collection of WAL records or page images in a range of LSNs, for one
|
||||
relish segment.
|
||||
|
||||
Dropped segments are always represented on disk by DeltaLayer.
|
||||
|
||||
# Layer life cycle
|
||||
|
||||
LSN range defined by start_lsn and end_lsn:
|
||||
- start_lsn is inclusive.
|
||||
- end_lsn is exclusive.
|
||||
|
||||
For an open in-memory layer, the end_lsn is MAX_LSN. For a frozen in-memory
|
||||
layer or a delta layer, it is a valid end bound. An image layer represents
|
||||
snapshot at one LSN, so end_lsn is always the snapshot LSN + 1
|
||||
|
||||
Every layer starts its life as an Open In-Memory layer. When the page server
|
||||
receives the first WAL record for a segment, it creates a new In-Memory layer
|
||||
for it, and puts it to the layer map. Later, the layer is old enough, its
|
||||
contents are written to disk, as On-Disk layers. This process is called
|
||||
"evicting" a layer.
|
||||
|
||||
Layer eviction is a two-step process: First, the layer is marked as closed, so
|
||||
that it no longer accepts new WAL records, and the layer map is updated
|
||||
accordingly. If a new WAL record for that segment arrives after this step, a new
|
||||
Open layer is created to hold it. After this first step, the layer is a Closed
|
||||
InMemory state. This first step is called "freezing" the layer.
|
||||
|
||||
In the second step, new Delta and Image layers are created, containing all the
|
||||
data in the Frozen InMemory layer. When the new layers are ready, the original
|
||||
frozen layer is replaced with the new layers in the layer map, and the original
|
||||
frozen layer is dropped, releasing the memory.
|
||||
|
||||
# Layer files (On-disk layers)
|
||||
|
||||
The files are called "layer files". Each layer file corresponds
|
||||
to one RELISH_SEG_SIZE slice of a PostgreSQL relation fork or
|
||||
non-rel file in a range of LSNs. The layer files
|
||||
for each timeline are stored in the timeline's subdirectory under
|
||||
.zenith/tenants/<tenantid>/timelines.
|
||||
|
||||
There are two kind of layer file: base images, and deltas. A base
|
||||
image file contains a layer of a segment as it was at one LSN,
|
||||
whereas a delta file contains modifications to a segment - mostly in
|
||||
the form of WAL records - in a range of LSN
|
||||
|
||||
base image file:
|
||||
|
||||
rel_<spcnode>_<dbnode>_<relnode>_<forknum>_<segno>_<start LSN>
|
||||
|
||||
delta file:
|
||||
|
||||
rel_<spcnode>_<dbnode>_<relnode>_<forknum>_<segno>_<start LSN>_<end LSN>
|
||||
|
||||
For example:
|
||||
|
||||
rel_1663_13990_2609_0_10_000000000169C348
|
||||
rel_1663_13990_2609_0_10_000000000169C348_0000000001702000
|
||||
|
||||
In addition to the relations, with "rel_*" prefix, we use the same
|
||||
format for storing various smaller files from the PostgreSQL data
|
||||
directory. They will use different suffixes and the naming scheme up
|
||||
to the LSNs vary. The Zenith source code uses the term "relish" to
|
||||
mean "a relation, or other file that's treated like a relation in the
|
||||
storage" For example, a base image of a CLOG segment would be named
|
||||
like this:
|
||||
|
||||
pg_xact_0000_0_00000000198B06B0
|
||||
|
||||
There is no difference in how the relation and non-relation files are
|
||||
managed, except that the first part of file names is different.
|
||||
Internally, the relations and non-relation files that are managed in
|
||||
the versioned store are together called "relishes".
|
||||
|
||||
If a file has been dropped, the last layer file for it is created
|
||||
with the _DROPPED suffix, e.g.
|
||||
|
||||
rel_1663_13990_2609_0_10_000000000169C348_0000000001702000_DROPPED
|
||||
|
||||
|
||||
## Notation used in this document
|
||||
|
||||
The full path of a delta file looks like this:
|
||||
|
||||
.zenith/tenants/941ddc8604413b88b3d208bddf90396c/timelines/4af489b06af8eed9e27a841775616962/rel_1663_13990_2609_0_10_000000000169C348_0000000001702000
|
||||
|
||||
For simplicity, the examples below use a simplified notation for the
|
||||
paths. The tenant ID is left out, the timeline ID is replaced with
|
||||
the human-readable branch name, and spcnode+dbnode+relnode+forkum+segno
|
||||
with a human-readable table name. The LSNs are also shorter. For
|
||||
example, a base image file at LSN 100 and a delta file between 100-200
|
||||
for 'orders' table on 'main' branch is represented like this:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
|
||||
|
||||
# Creating layer files
|
||||
|
||||
Let's start with a simple example with a system that contains one
|
||||
branch called 'main' and two tables, 'orders' and 'customers'. The end
|
||||
of WAL is currently at LSN 250. In this starting situation, you would
|
||||
have these files on disk:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/customers_100
|
||||
main/customers_100_200
|
||||
main/customers_200
|
||||
|
||||
In addition to those files, the recent changes between LSN 200 and the
|
||||
end of WAL at 250 are kept in memory. If the page server crashes, the
|
||||
latest records between 200-250 need to be re-read from the WAL.
|
||||
|
||||
Whenever enough WAL has been accumulated in memory, the page server
|
||||
writes out the changes in memory into new layer files. This process
|
||||
is called "checkpointing" (not to be confused with the PostgreSQL
|
||||
checkpoints, that's a different thing). The page server only creates
|
||||
layer files for relations that have been modified since the last
|
||||
checkpoint. For example, if the current end of WAL is at LSN 450, and
|
||||
the last checkpoint happened at LSN 400 but there hasn't been any
|
||||
recent changes to 'customers' table, you would have these files on
|
||||
disk:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
main/customers_100
|
||||
main/customers_100_200
|
||||
main/customers_200
|
||||
|
||||
If the customers table is modified later, a new file is created for it
|
||||
at the next checkpoint. The new file will cover the "gap" from the
|
||||
last layer file, so the LSN ranges are always contiguous:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
main/customers_100
|
||||
main/customers_100_200
|
||||
main/customers_200
|
||||
main/customers_200_500
|
||||
main/customers_500
|
||||
|
||||
## Reading page versions
|
||||
|
||||
Whenever a GetPage@LSN request comes in from the compute node, the
|
||||
page server needs to reconstruct the requested page, as it was at the
|
||||
requested LSN. To do that, the page server first checks the recent
|
||||
in-memory layer; if the requested page version is found there, it can
|
||||
be returned immediatedly without looking at the files on
|
||||
disk. Otherwise the page server needs to locate the layer file that
|
||||
contains the requested page version.
|
||||
|
||||
For example, if a request comes in for table 'orders' at LSN 250, the
|
||||
page server would load the 'main/orders_200_300' file into memory, and
|
||||
reconstruct and return the requested page from it, as it was at
|
||||
LSN 250. Because the layer file consists of a full image of the
|
||||
relation at the start LSN and the WAL, reconstructing the page
|
||||
involves replaying any WAL records applicable to the page between LSNs
|
||||
200-250, starting from the base image at LSN 200.
|
||||
|
||||
# Multiple branches
|
||||
|
||||
Imagine that a child branch is created at LSN 250:
|
||||
|
||||
@250
|
||||
----main--+-------------------------->
|
||||
\
|
||||
+---child-------------->
|
||||
|
||||
|
||||
Then, the 'orders' table is updated differently on the 'main' and
|
||||
'child' branches. You now have this situation on disk:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
main/customers_100
|
||||
main/customers_100_200
|
||||
main/customers_200
|
||||
child/orders_250_300
|
||||
child/orders_300
|
||||
child/orders_300_400
|
||||
child/orders_400
|
||||
|
||||
Because the 'customers' table hasn't been modified on the child
|
||||
branch, there is no file for it there. If you request a page for it on
|
||||
the 'child' branch, the page server will not find any layer file
|
||||
for it in the 'child' directory, so it will recurse to look into the
|
||||
parent 'main' branch instead.
|
||||
|
||||
From the 'child' branch's point of view, the history for each relation
|
||||
is linear, and the request's LSN identifies unambiguously which file
|
||||
you need to look at. For example, the history for the 'orders' table
|
||||
on the 'main' branch consists of these files:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
|
||||
And from the 'child' branch's point of view, it consists of these
|
||||
files:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
child/orders_250_300
|
||||
child/orders_300
|
||||
child/orders_300_400
|
||||
child/orders_400
|
||||
|
||||
The branch metadata includes the point where the child branch was
|
||||
created, LSN 250. If a page request comes with LSN 275, we read the
|
||||
page version from the 'child/orders_250_300' file. We might also
|
||||
need to reconstruct the page version as it was at LSN 250, in order
|
||||
to replay the WAL up to LSN 275, using 'main/orders_200_300' and
|
||||
'main/orders_200'. The page versions between 250-300 in the
|
||||
'main/orders_200_300' file are ignored when operating on the child
|
||||
branch.
|
||||
|
||||
Note: It doesn't make any difference if the child branch is created
|
||||
when the end of the main branch was at LSN 250, or later when the tip of
|
||||
the main branch had already moved on. The latter case, creating a
|
||||
branch at a historic LSN, is how we support PITR in Zenith.
|
||||
|
||||
|
||||
# Garbage collection
|
||||
|
||||
In this scheme, we keep creating new layer files over time. We also
|
||||
need a mechanism to remove old files that are no longer needed,
|
||||
because disk space isn't infinite.
|
||||
|
||||
What files are still needed? Currently, the page server supports PITR
|
||||
and branching from any branch at any LSN that is "recent enough" from
|
||||
the tip of the branch. "Recent enough" is defined as an LSN horizon,
|
||||
which by default is 64 MB. (See DEFAULT_GC_HORIZON). For this
|
||||
example, let's assume that the LSN horizon is 150 units.
|
||||
|
||||
Let's look at the single branch scenario again. Imagine that the end
|
||||
of the branch is LSN 525, so that the GC horizon is currently at
|
||||
525-150 = 375
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
main/orders_400_500
|
||||
main/orders_500
|
||||
main/customers_100
|
||||
main/customers_100_200
|
||||
main/customers_200
|
||||
|
||||
We can remove the following files because the end LSNs of those files are
|
||||
older than GC horizon 375, and there are more recent layer files for the
|
||||
table:
|
||||
|
||||
main/orders_100 DELETE
|
||||
main/orders_100_200 DELETE
|
||||
main/orders_200 DELETE
|
||||
main/orders_200_300 DELETE
|
||||
main/orders_300 STILL NEEDED BY orders_300_400
|
||||
main/orders_300_400 KEEP, NEWER THAN GC HORIZON
|
||||
main/orders_400 ..
|
||||
main/orders_400_500 ..
|
||||
main/orders_500 ..
|
||||
main/customers_100 DELETE
|
||||
main/customers_100_200 DELETE
|
||||
main/customers_200 KEEP, NO NEWER VERSION
|
||||
|
||||
'main/customers_100_200' is old enough, but it cannot be
|
||||
removed because there is no newer layer file for the table.
|
||||
|
||||
Things get slightly more complicated with multiple branches. All of
|
||||
the above still holds, but in addition to recent files we must also
|
||||
retain older shapshot files that are still needed by child branches.
|
||||
For example, if child branch is created at LSN 150, and the 'customers'
|
||||
table is updated on the branch, you would have these files:
|
||||
|
||||
main/orders_100 KEEP, NEEDED BY child BRANCH
|
||||
main/orders_100_200 KEEP, NEEDED BY child BRANCH
|
||||
main/orders_200 DELETE
|
||||
main/orders_200_300 DELETE
|
||||
main/orders_300 KEEP, NEWER THAN GC HORIZON
|
||||
main/orders_300_400 KEEP, NEWER THAN GC HORIZON
|
||||
main/orders_400 KEEP, NEWER THAN GC HORIZON
|
||||
main/orders_400_500 KEEP, NEWER THAN GC HORIZON
|
||||
main/orders_500 KEEP, NEWER THAN GC HORIZON
|
||||
main/customers_100 DELETE
|
||||
main/customers_100_200 DELETE
|
||||
main/customers_200 KEEP, NO NEWER VERSION
|
||||
child/customers_150_300 DELETE
|
||||
child/customers_300 KEEP, NO NEWER VERSION
|
||||
|
||||
In this situation, 'main/orders_100' and 'main/orders_100_200' cannot
|
||||
be removed, even though they are older than the GC horizon, because
|
||||
they are still needed by the child branch. 'main/orders_200'
|
||||
and 'main/orders_200_300' can still be removed.
|
||||
|
||||
If 'orders' is modified later on the 'child' branch, we will create a
|
||||
new base image and delta file for it on the child:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
main/orders_400_500
|
||||
main/orders_500
|
||||
main/customers_200
|
||||
child/customers_300
|
||||
child/orders_150_400
|
||||
child/orders_400
|
||||
|
||||
After this, the 'main/orders_100' and 'main/orders_100_200' file could
|
||||
be removed. It is no longer needed by the child branch, because there
|
||||
is a newer layer file there. TODO: This optimization hasn't been
|
||||
implemented! The GC algorithm will currently keep the file on the
|
||||
'main' branch anyway, for as long as the child branch exists.
|
||||
|
||||
TODO:
|
||||
Describe GC and checkpoint interval settings.
|
||||
|
||||
# TODO: On LSN ranges
|
||||
|
||||
In principle, each relation can be checkpointed separately, i.e. the
|
||||
LSN ranges of the files don't need to line up. So this would be legal:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
main/customers_150
|
||||
main/customers_150_250
|
||||
main/customers_250
|
||||
main/customers_250_500
|
||||
main/customers_500
|
||||
|
||||
However, the code currently always checkpoints all relations together.
|
||||
So that situation doesn't arise in practice.
|
||||
|
||||
It would also be OK to have overlapping LSN ranges for the same relation:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
main/orders_250_350
|
||||
main/orders_350
|
||||
main/orders_300_400
|
||||
main/orders_400
|
||||
|
||||
The code that reads the layer files should cope with this, but this
|
||||
situation doesn't arise either, because the checkpointing code never
|
||||
does that. It could be useful, however, as a transient state when
|
||||
garbage collecting around branch points, or explicit recovery
|
||||
points. For example, if we start with this:
|
||||
|
||||
main/orders_100
|
||||
main/orders_100_200
|
||||
main/orders_200
|
||||
main/orders_200_300
|
||||
main/orders_300
|
||||
|
||||
And there is a branch or explicit recovery point at LSN 150, we could
|
||||
replace 'main/orders_100_200' with 'main/orders_150' to keep a
|
||||
layer only at that exact point that's still needed, removing the
|
||||
other page versions around it. But such compaction has not been
|
||||
implemented yet.
|
||||
704
pageserver/src/layered_repository/delta_layer.rs
Normal file
704
pageserver/src/layered_repository/delta_layer.rs
Normal file
@@ -0,0 +1,704 @@
|
||||
//!
|
||||
//! A DeltaLayer represents a collection of WAL records or page images in a range of
|
||||
//! LSNs, for one segment. It is stored on a file on disk.
|
||||
//!
|
||||
//! Usually a delta layer only contains differences - in the form of WAL records against
|
||||
//! a base LSN. However, if a segment is newly created, by creating a new relation or
|
||||
//! extending an old one, there might be no base image. In that case, all the entries in
|
||||
//! the delta layer must be page images or WAL records with the 'will_init' flag set, so
|
||||
//! that they can be replayed without referring to an older page version. Also in some
|
||||
//! circumstances, the predecessor layer might actually be another delta layer. That
|
||||
//! can happen when you create a new branch in the middle of a delta layer, and the WAL
|
||||
//! records on the new branch are put in a new delta layer.
|
||||
//!
|
||||
//! When a delta file needs to be accessed, we slurp the metadata and segsize chapters
|
||||
//! into memory, into the DeltaLayerInner struct. See load() and unload() functions.
|
||||
//! To access a page/WAL record, we search `page_version_metas` for the block # and LSN.
|
||||
//! The byte ranges in the metadata can be used to find the page/WAL record in
|
||||
//! PAGE_VERSIONS_CHAPTER.
|
||||
//!
|
||||
//! On disk, the delta files are stored in timelines/<timelineid> directory.
|
||||
//! Currently, there are no subdirectories, and each delta file is named like this:
|
||||
//!
|
||||
//! <spcnode>_<dbnode>_<relnode>_<forknum>_<segno>_<start LSN>_<end LSN>
|
||||
//!
|
||||
//! For example:
|
||||
//!
|
||||
//! 1663_13990_2609_0_5_000000000169C348_000000000169C349
|
||||
//!
|
||||
//! If a relation is dropped, we add a '_DROPPED' to the end of the filename to indicate that.
|
||||
//! So the above example would become:
|
||||
//!
|
||||
//! 1663_13990_2609_0_5_000000000169C348_000000000169C349_DROPPED
|
||||
//!
|
||||
//! The end LSN indicates when it was dropped in that case, we don't store it in the
|
||||
//! file contents in any way.
|
||||
//!
|
||||
//! A detlta file is constructed using the 'bookfile' crate. Each file consists of two
|
||||
//! parts: the page versions and the segment sizes. They are stored as separate chapters.
|
||||
//!
|
||||
use crate::config::PageServerConf;
|
||||
use crate::layered_repository::filename::{DeltaFileName, PathOrConf};
|
||||
use crate::layered_repository::storage_layer::{
|
||||
Layer, PageReconstructData, PageReconstructResult, PageVersion, SegmentBlk, SegmentTag,
|
||||
RELISH_SEG_SIZE,
|
||||
};
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use crate::walrecord;
|
||||
use crate::{ZTenantId, ZTimelineId};
|
||||
use anyhow::{bail, ensure, Result};
|
||||
use log::*;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use zenith_utils::vec_map::VecMap;
|
||||
// avoid binding to Write (conflicts with std::io::Write)
|
||||
// while being able to use std::fmt::Write's methods
|
||||
use std::fmt::Write as _;
|
||||
use std::fs;
|
||||
use std::io::{BufWriter, Write};
|
||||
use std::ops::Bound::Included;
|
||||
use std::os::unix::fs::FileExt;
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::sync::{Mutex, MutexGuard};
|
||||
|
||||
use bookfile::{Book, BookWriter, BoundedReader, ChapterWriter};
|
||||
|
||||
use zenith_utils::bin_ser::BeSer;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
// Magic constant to identify a Zenith delta file
|
||||
pub const DELTA_FILE_MAGIC: u32 = 0x5A616E01;
|
||||
|
||||
/// Mapping from (block #, lsn) -> page/WAL record
|
||||
/// byte ranges in PAGE_VERSIONS_CHAPTER
|
||||
static PAGE_VERSION_METAS_CHAPTER: u64 = 1;
|
||||
/// Page/WAL bytes - cannot be interpreted
|
||||
/// without PAGE_VERSION_METAS_CHAPTER
|
||||
static PAGE_VERSIONS_CHAPTER: u64 = 2;
|
||||
static SEG_SIZES_CHAPTER: u64 = 3;
|
||||
|
||||
/// Contains the [`Summary`] struct
|
||||
static SUMMARY_CHAPTER: u64 = 4;
|
||||
|
||||
#[derive(Debug, Serialize, Deserialize, PartialEq, Eq)]
|
||||
struct Summary {
|
||||
tenantid: ZTenantId,
|
||||
timelineid: ZTimelineId,
|
||||
seg: SegmentTag,
|
||||
|
||||
start_lsn: Lsn,
|
||||
end_lsn: Lsn,
|
||||
|
||||
dropped: bool,
|
||||
}
|
||||
|
||||
impl From<&DeltaLayer> for Summary {
|
||||
fn from(layer: &DeltaLayer) -> Self {
|
||||
Self {
|
||||
tenantid: layer.tenantid,
|
||||
timelineid: layer.timelineid,
|
||||
seg: layer.seg,
|
||||
|
||||
start_lsn: layer.start_lsn,
|
||||
end_lsn: layer.end_lsn,
|
||||
|
||||
dropped: layer.dropped,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize)]
|
||||
struct BlobRange {
|
||||
offset: u64,
|
||||
size: usize,
|
||||
}
|
||||
|
||||
fn read_blob<F: FileExt>(reader: &BoundedReader<&'_ F>, range: &BlobRange) -> Result<Vec<u8>> {
|
||||
let mut buf = vec![0u8; range.size];
|
||||
reader.read_exact_at(&mut buf, range.offset)?;
|
||||
Ok(buf)
|
||||
}
|
||||
|
||||
///
|
||||
/// DeltaLayer is the in-memory data structure associated with an
|
||||
/// on-disk delta file. We keep a DeltaLayer in memory for each
|
||||
/// file, in the LayerMap. If a layer is in "loaded" state, we have a
|
||||
/// copy of the file in memory, in 'inner'. Otherwise the struct is
|
||||
/// just a placeholder for a file that exists on disk, and it needs to
|
||||
/// be loaded before using it in queries.
|
||||
///
|
||||
pub struct DeltaLayer {
|
||||
path_or_conf: PathOrConf,
|
||||
|
||||
pub tenantid: ZTenantId,
|
||||
pub timelineid: ZTimelineId,
|
||||
pub seg: SegmentTag,
|
||||
|
||||
//
|
||||
// This entry contains all the changes from 'start_lsn' to 'end_lsn'. The
|
||||
// start is inclusive, and end is exclusive.
|
||||
//
|
||||
pub start_lsn: Lsn,
|
||||
pub end_lsn: Lsn,
|
||||
|
||||
dropped: bool,
|
||||
|
||||
inner: Mutex<DeltaLayerInner>,
|
||||
}
|
||||
|
||||
pub struct DeltaLayerInner {
|
||||
/// If false, the 'page_version_metas' and 'seg_sizes' have not been
|
||||
/// loaded into memory yet.
|
||||
loaded: bool,
|
||||
|
||||
book: Option<Book<VirtualFile>>,
|
||||
|
||||
/// All versions of all pages in the file are are kept here.
|
||||
/// Indexed by block number and LSN.
|
||||
page_version_metas: VecMap<(SegmentBlk, Lsn), BlobRange>,
|
||||
|
||||
/// `seg_sizes` tracks the size of the segment at different points in time.
|
||||
seg_sizes: VecMap<Lsn, SegmentBlk>,
|
||||
}
|
||||
|
||||
impl DeltaLayerInner {
|
||||
fn get_seg_size(&self, lsn: Lsn) -> Result<SegmentBlk> {
|
||||
// Scan the VecMap backwards, starting from the given entry.
|
||||
let slice = self
|
||||
.seg_sizes
|
||||
.slice_range((Included(&Lsn(0)), Included(&lsn)));
|
||||
if let Some((_entry_lsn, entry)) = slice.last() {
|
||||
Ok(*entry)
|
||||
} else {
|
||||
bail!("could not find seg size in delta layer")
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl Layer for DeltaLayer {
|
||||
fn get_tenant_id(&self) -> ZTenantId {
|
||||
self.tenantid
|
||||
}
|
||||
|
||||
fn get_timeline_id(&self) -> ZTimelineId {
|
||||
self.timelineid
|
||||
}
|
||||
|
||||
fn get_seg_tag(&self) -> SegmentTag {
|
||||
self.seg
|
||||
}
|
||||
|
||||
fn is_dropped(&self) -> bool {
|
||||
self.dropped
|
||||
}
|
||||
|
||||
fn get_start_lsn(&self) -> Lsn {
|
||||
self.start_lsn
|
||||
}
|
||||
|
||||
fn get_end_lsn(&self) -> Lsn {
|
||||
self.end_lsn
|
||||
}
|
||||
|
||||
fn filename(&self) -> PathBuf {
|
||||
PathBuf::from(self.layer_name().to_string())
|
||||
}
|
||||
|
||||
/// Look up given page in the cache.
|
||||
fn get_page_reconstruct_data(
|
||||
&self,
|
||||
blknum: SegmentBlk,
|
||||
lsn: Lsn,
|
||||
reconstruct_data: &mut PageReconstructData,
|
||||
) -> Result<PageReconstructResult> {
|
||||
let mut need_image = true;
|
||||
|
||||
assert!((0..RELISH_SEG_SIZE).contains(&blknum));
|
||||
|
||||
match &reconstruct_data.page_img {
|
||||
Some((cached_lsn, _)) if &self.end_lsn <= cached_lsn => {
|
||||
return Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
|
||||
{
|
||||
// Open the file and lock the metadata in memory
|
||||
let inner = self.load()?;
|
||||
let page_version_reader = inner
|
||||
.book
|
||||
.as_ref()
|
||||
.expect("should be loaded in load call above")
|
||||
.chapter_reader(PAGE_VERSIONS_CHAPTER)?;
|
||||
|
||||
// Scan the metadata VecMap backwards, starting from the given entry.
|
||||
let minkey = (blknum, Lsn(0));
|
||||
let maxkey = (blknum, lsn);
|
||||
let iter = inner
|
||||
.page_version_metas
|
||||
.slice_range((Included(&minkey), Included(&maxkey)))
|
||||
.iter()
|
||||
.rev();
|
||||
for ((_blknum, pv_lsn), blob_range) in iter {
|
||||
match &reconstruct_data.page_img {
|
||||
Some((cached_lsn, _)) if pv_lsn <= cached_lsn => {
|
||||
return Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
|
||||
let pv = PageVersion::des(&read_blob(&page_version_reader, blob_range)?)?;
|
||||
|
||||
match pv {
|
||||
PageVersion::Page(img) => {
|
||||
// Found a page image, return it
|
||||
reconstruct_data.page_img = Some((*pv_lsn, img));
|
||||
need_image = false;
|
||||
break;
|
||||
}
|
||||
PageVersion::Wal(rec) => {
|
||||
let will_init = rec.will_init();
|
||||
reconstruct_data.records.push((*pv_lsn, rec));
|
||||
if will_init {
|
||||
// This WAL record initializes the page, so no need to go further back
|
||||
need_image = false;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// If we didn't find any records for this, check if the request is beyond EOF
|
||||
if need_image
|
||||
&& reconstruct_data.records.is_empty()
|
||||
&& self.seg.rel.is_blocky()
|
||||
&& blknum >= inner.get_seg_size(lsn)?
|
||||
{
|
||||
return Ok(PageReconstructResult::Missing(self.start_lsn));
|
||||
}
|
||||
|
||||
// release metadata lock and close the file
|
||||
}
|
||||
|
||||
// If an older page image is needed to reconstruct the page, let the
|
||||
// caller know.
|
||||
if need_image {
|
||||
Ok(PageReconstructResult::Continue(Lsn(self.start_lsn.0 - 1)))
|
||||
} else {
|
||||
Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
}
|
||||
|
||||
/// Get size of the relation at given LSN
|
||||
fn get_seg_size(&self, lsn: Lsn) -> Result<SegmentBlk> {
|
||||
assert!(lsn >= self.start_lsn);
|
||||
ensure!(
|
||||
self.seg.rel.is_blocky(),
|
||||
"get_seg_size() called on a non-blocky rel"
|
||||
);
|
||||
|
||||
let inner = self.load()?;
|
||||
inner.get_seg_size(lsn)
|
||||
}
|
||||
|
||||
/// Does this segment exist at given LSN?
|
||||
fn get_seg_exists(&self, lsn: Lsn) -> Result<bool> {
|
||||
// Is the requested LSN after the rel was dropped?
|
||||
if self.dropped && lsn >= self.end_lsn {
|
||||
return Ok(false);
|
||||
}
|
||||
|
||||
// Otherwise, it exists.
|
||||
Ok(true)
|
||||
}
|
||||
|
||||
///
|
||||
/// Release most of the memory used by this layer. If it's accessed again later,
|
||||
/// it will need to be loaded back.
|
||||
///
|
||||
fn unload(&self) -> Result<()> {
|
||||
let mut inner = self.inner.lock().unwrap();
|
||||
inner.page_version_metas = VecMap::default();
|
||||
inner.seg_sizes = VecMap::default();
|
||||
inner.loaded = false;
|
||||
|
||||
// Note: we keep the Book open. Is that a good idea? The virtual file
|
||||
// machinery has its own rules for closing the file descriptor if it's not
|
||||
// needed, but the Book struct uses up some memory, too.
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn delete(&self) -> Result<()> {
|
||||
// delete underlying file
|
||||
fs::remove_file(self.path())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn is_incremental(&self) -> bool {
|
||||
true
|
||||
}
|
||||
|
||||
fn is_in_memory(&self) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
/// debugging function to print out the contents of the layer
|
||||
fn dump(&self) -> Result<()> {
|
||||
println!(
|
||||
"----- delta layer for ten {} tli {} seg {} {}-{} ----",
|
||||
self.tenantid, self.timelineid, self.seg, self.start_lsn, self.end_lsn
|
||||
);
|
||||
|
||||
println!("--- seg sizes ---");
|
||||
let inner = self.load()?;
|
||||
for (k, v) in inner.seg_sizes.as_slice() {
|
||||
println!(" {}: {}", k, v);
|
||||
}
|
||||
println!("--- page versions ---");
|
||||
|
||||
let path = self.path();
|
||||
let file = std::fs::File::open(&path)?;
|
||||
let book = Book::new(file)?;
|
||||
|
||||
let chapter = book.chapter_reader(PAGE_VERSIONS_CHAPTER)?;
|
||||
for ((blk, lsn), blob_range) in inner.page_version_metas.as_slice() {
|
||||
let mut desc = String::new();
|
||||
|
||||
let buf = read_blob(&chapter, blob_range)?;
|
||||
let pv = PageVersion::des(&buf)?;
|
||||
|
||||
match pv {
|
||||
PageVersion::Page(img) => {
|
||||
write!(&mut desc, " img {} bytes", img.len())?;
|
||||
}
|
||||
PageVersion::Wal(rec) => {
|
||||
let wal_desc = walrecord::describe_wal_record(&rec);
|
||||
write!(
|
||||
&mut desc,
|
||||
" rec {} bytes will_init: {} {}",
|
||||
blob_range.size,
|
||||
rec.will_init(),
|
||||
wal_desc
|
||||
)?;
|
||||
}
|
||||
}
|
||||
|
||||
println!(" blk {} at {}: {}", blk, lsn, desc);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl DeltaLayer {
|
||||
fn path_for(
|
||||
path_or_conf: &PathOrConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
fname: &DeltaFileName,
|
||||
) -> PathBuf {
|
||||
match path_or_conf {
|
||||
PathOrConf::Path(path) => path.clone(),
|
||||
PathOrConf::Conf(conf) => conf
|
||||
.timeline_path(&timelineid, &tenantid)
|
||||
.join(fname.to_string()),
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Load the contents of the file into memory
|
||||
///
|
||||
fn load(&self) -> Result<MutexGuard<DeltaLayerInner>> {
|
||||
// quick exit if already loaded
|
||||
let mut inner = self.inner.lock().unwrap();
|
||||
|
||||
if inner.loaded {
|
||||
return Ok(inner);
|
||||
}
|
||||
|
||||
let path = self.path();
|
||||
|
||||
// Open the file if it's not open already.
|
||||
if inner.book.is_none() {
|
||||
let file = VirtualFile::open(&path)?;
|
||||
inner.book = Some(Book::new(file)?);
|
||||
}
|
||||
let book = inner.book.as_ref().unwrap();
|
||||
|
||||
match &self.path_or_conf {
|
||||
PathOrConf::Conf(_) => {
|
||||
let chapter = book.read_chapter(SUMMARY_CHAPTER)?;
|
||||
let actual_summary = Summary::des(&chapter)?;
|
||||
|
||||
let expected_summary = Summary::from(self);
|
||||
|
||||
if actual_summary != expected_summary {
|
||||
bail!("in-file summary does not match expected summary. actual = {:?} expected = {:?}", actual_summary, expected_summary);
|
||||
}
|
||||
}
|
||||
PathOrConf::Path(path) => {
|
||||
let actual_filename = Path::new(path.file_name().unwrap());
|
||||
let expected_filename = self.filename();
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!(
|
||||
"warning: filename does not match what is expected from in-file summary"
|
||||
);
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let chapter = book.read_chapter(PAGE_VERSION_METAS_CHAPTER)?;
|
||||
let page_version_metas = VecMap::des(&chapter)?;
|
||||
|
||||
let chapter = book.read_chapter(SEG_SIZES_CHAPTER)?;
|
||||
let seg_sizes = VecMap::des(&chapter)?;
|
||||
|
||||
debug!("loaded from {}", &path.display());
|
||||
|
||||
inner.page_version_metas = page_version_metas;
|
||||
inner.seg_sizes = seg_sizes;
|
||||
inner.loaded = true;
|
||||
|
||||
Ok(inner)
|
||||
}
|
||||
|
||||
/// Create a DeltaLayer struct representing an existing file on disk.
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
filename: &DeltaFileName,
|
||||
) -> DeltaLayer {
|
||||
DeltaLayer {
|
||||
path_or_conf: PathOrConf::Conf(conf),
|
||||
timelineid,
|
||||
tenantid,
|
||||
seg: filename.seg,
|
||||
start_lsn: filename.start_lsn,
|
||||
end_lsn: filename.end_lsn,
|
||||
dropped: filename.dropped,
|
||||
inner: Mutex::new(DeltaLayerInner {
|
||||
loaded: false,
|
||||
book: None,
|
||||
page_version_metas: VecMap::default(),
|
||||
seg_sizes: VecMap::default(),
|
||||
}),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create a DeltaLayer struct representing an existing file on disk.
|
||||
///
|
||||
/// This variant is only used for debugging purposes, by the 'dump_layerfile' binary.
|
||||
pub fn new_for_path<F>(path: &Path, book: &Book<F>) -> Result<Self>
|
||||
where
|
||||
F: std::os::unix::prelude::FileExt,
|
||||
{
|
||||
let chapter = book.read_chapter(SUMMARY_CHAPTER)?;
|
||||
let summary = Summary::des(&chapter)?;
|
||||
|
||||
Ok(DeltaLayer {
|
||||
path_or_conf: PathOrConf::Path(path.to_path_buf()),
|
||||
timelineid: summary.timelineid,
|
||||
tenantid: summary.tenantid,
|
||||
seg: summary.seg,
|
||||
start_lsn: summary.start_lsn,
|
||||
end_lsn: summary.end_lsn,
|
||||
dropped: summary.dropped,
|
||||
inner: Mutex::new(DeltaLayerInner {
|
||||
loaded: false,
|
||||
book: None,
|
||||
page_version_metas: VecMap::default(),
|
||||
seg_sizes: VecMap::default(),
|
||||
}),
|
||||
})
|
||||
}
|
||||
|
||||
fn layer_name(&self) -> DeltaFileName {
|
||||
DeltaFileName {
|
||||
seg: self.seg,
|
||||
start_lsn: self.start_lsn,
|
||||
end_lsn: self.end_lsn,
|
||||
dropped: self.dropped,
|
||||
}
|
||||
}
|
||||
|
||||
/// Path to the layer file in pageserver workdir.
|
||||
pub fn path(&self) -> PathBuf {
|
||||
Self::path_for(
|
||||
&self.path_or_conf,
|
||||
self.timelineid,
|
||||
self.tenantid,
|
||||
&self.layer_name(),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
/// A builder object for constructing a new delta layer.
|
||||
///
|
||||
/// Usage:
|
||||
///
|
||||
/// 1. Create the DeltaLayerWriter by calling DeltaLayerWriter::new(...)
|
||||
///
|
||||
/// 2. Write the contents by calling `put_page_version` for every page
|
||||
/// version to store in the layer.
|
||||
///
|
||||
/// 3. Call `finish`.
|
||||
///
|
||||
pub struct DeltaLayerWriter {
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
seg: SegmentTag,
|
||||
start_lsn: Lsn,
|
||||
end_lsn: Lsn,
|
||||
dropped: bool,
|
||||
|
||||
page_version_writer: ChapterWriter<BufWriter<VirtualFile>>,
|
||||
pv_offset: u64,
|
||||
|
||||
page_version_metas: VecMap<(SegmentBlk, Lsn), BlobRange>,
|
||||
}
|
||||
|
||||
impl DeltaLayerWriter {
|
||||
///
|
||||
/// Start building a new delta layer.
|
||||
///
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
seg: SegmentTag,
|
||||
start_lsn: Lsn,
|
||||
end_lsn: Lsn,
|
||||
dropped: bool,
|
||||
) -> Result<DeltaLayerWriter> {
|
||||
// Create the file
|
||||
//
|
||||
// Note: This overwrites any existing file. There shouldn't be any.
|
||||
// FIXME: throw an error instead?
|
||||
let path = DeltaLayer::path_for(
|
||||
&PathOrConf::Conf(conf),
|
||||
timelineid,
|
||||
tenantid,
|
||||
&DeltaFileName {
|
||||
seg,
|
||||
start_lsn,
|
||||
end_lsn,
|
||||
dropped,
|
||||
},
|
||||
);
|
||||
let file = VirtualFile::create(&path)?;
|
||||
let buf_writer = BufWriter::new(file);
|
||||
let book = BookWriter::new(buf_writer, DELTA_FILE_MAGIC)?;
|
||||
|
||||
// Open the page-versions chapter for writing. The calls to
|
||||
// `put_page_version` will use this to write the contents.
|
||||
let page_version_writer = book.new_chapter(PAGE_VERSIONS_CHAPTER);
|
||||
|
||||
Ok(DeltaLayerWriter {
|
||||
conf,
|
||||
timelineid,
|
||||
tenantid,
|
||||
seg,
|
||||
start_lsn,
|
||||
end_lsn,
|
||||
dropped,
|
||||
page_version_writer,
|
||||
page_version_metas: VecMap::default(),
|
||||
pv_offset: 0,
|
||||
})
|
||||
}
|
||||
|
||||
///
|
||||
/// Append a page version to the file.
|
||||
///
|
||||
/// 'buf' is a serialized PageVersion.
|
||||
/// The page versions must be appended in blknum, lsn order.
|
||||
///
|
||||
pub fn put_page_version(&mut self, blknum: SegmentBlk, lsn: Lsn, buf: &[u8]) -> Result<()> {
|
||||
// Remember the offset and size metadata. The metadata is written
|
||||
// to a separate chapter, in `finish`.
|
||||
let blob_range = BlobRange {
|
||||
offset: self.pv_offset,
|
||||
size: buf.len(),
|
||||
};
|
||||
self.page_version_metas
|
||||
.append((blknum, lsn), blob_range)
|
||||
.unwrap();
|
||||
|
||||
// write the page version
|
||||
self.page_version_writer.write_all(buf)?;
|
||||
self.pv_offset += buf.len() as u64;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
///
|
||||
/// Finish writing the delta layer.
|
||||
///
|
||||
/// 'seg_sizes' is a list of size changes to store with the actual data.
|
||||
///
|
||||
pub fn finish(self, seg_sizes: VecMap<Lsn, SegmentBlk>) -> Result<DeltaLayer> {
|
||||
// Close the page-versions chapter
|
||||
let book = self.page_version_writer.close()?;
|
||||
|
||||
// Write out page versions metadata
|
||||
let mut chapter = book.new_chapter(PAGE_VERSION_METAS_CHAPTER);
|
||||
let buf = VecMap::ser(&self.page_version_metas)?;
|
||||
chapter.write_all(&buf)?;
|
||||
let book = chapter.close()?;
|
||||
|
||||
if self.seg.rel.is_blocky() {
|
||||
assert!(!seg_sizes.is_empty());
|
||||
}
|
||||
|
||||
// and seg_sizes to separate chapter
|
||||
let mut chapter = book.new_chapter(SEG_SIZES_CHAPTER);
|
||||
let buf = VecMap::ser(&seg_sizes)?;
|
||||
chapter.write_all(&buf)?;
|
||||
let book = chapter.close()?;
|
||||
|
||||
let mut chapter = book.new_chapter(SUMMARY_CHAPTER);
|
||||
let summary = Summary {
|
||||
tenantid: self.tenantid,
|
||||
timelineid: self.timelineid,
|
||||
seg: self.seg,
|
||||
|
||||
start_lsn: self.start_lsn,
|
||||
end_lsn: self.end_lsn,
|
||||
|
||||
dropped: self.dropped,
|
||||
};
|
||||
Summary::ser_into(&summary, &mut chapter)?;
|
||||
let book = chapter.close()?;
|
||||
|
||||
// This flushes the underlying 'buf_writer'.
|
||||
book.close()?;
|
||||
|
||||
// Note: Because we opened the file in write-only mode, we cannot
|
||||
// reuse the same VirtualFile for reading later. That's why we don't
|
||||
// set inner.book here. The first read will have to re-open it.
|
||||
let layer = DeltaLayer {
|
||||
path_or_conf: PathOrConf::Conf(self.conf),
|
||||
tenantid: self.tenantid,
|
||||
timelineid: self.timelineid,
|
||||
seg: self.seg,
|
||||
start_lsn: self.start_lsn,
|
||||
end_lsn: self.end_lsn,
|
||||
dropped: self.dropped,
|
||||
inner: Mutex::new(DeltaLayerInner {
|
||||
loaded: false,
|
||||
book: None,
|
||||
page_version_metas: VecMap::default(),
|
||||
seg_sizes: VecMap::default(),
|
||||
}),
|
||||
};
|
||||
|
||||
trace!("created delta layer {}", &layer.path().display());
|
||||
|
||||
Ok(layer)
|
||||
}
|
||||
}
|
||||
310
pageserver/src/layered_repository/ephemeral_file.rs
Normal file
310
pageserver/src/layered_repository/ephemeral_file.rs
Normal file
@@ -0,0 +1,310 @@
|
||||
//! Implementation of append-only file data structure
|
||||
//! used to keep in-memory layers spilled on disk.
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
use crate::page_cache;
|
||||
use crate::page_cache::PAGE_SZ;
|
||||
use crate::page_cache::{ReadBufResult, WriteBufResult};
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use lazy_static::lazy_static;
|
||||
use std::cmp::min;
|
||||
use std::collections::HashMap;
|
||||
use std::fs::OpenOptions;
|
||||
use std::io::{Error, ErrorKind, Seek, SeekFrom, Write};
|
||||
use std::ops::DerefMut;
|
||||
use std::path::PathBuf;
|
||||
use std::sync::{Arc, RwLock};
|
||||
use zenith_utils::zid::ZTenantId;
|
||||
use zenith_utils::zid::ZTimelineId;
|
||||
|
||||
use std::os::unix::fs::FileExt;
|
||||
|
||||
lazy_static! {
|
||||
///
|
||||
/// This is the global cache of file descriptors (File objects).
|
||||
///
|
||||
static ref EPHEMERAL_FILES: RwLock<EphemeralFiles> = RwLock::new(EphemeralFiles {
|
||||
next_file_id: 1,
|
||||
files: HashMap::new(),
|
||||
});
|
||||
}
|
||||
|
||||
pub struct EphemeralFiles {
|
||||
next_file_id: u64,
|
||||
|
||||
files: HashMap<u64, Arc<VirtualFile>>,
|
||||
}
|
||||
|
||||
pub struct EphemeralFile {
|
||||
file_id: u64,
|
||||
_tenantid: ZTenantId,
|
||||
_timelineid: ZTimelineId,
|
||||
file: Arc<VirtualFile>,
|
||||
|
||||
pos: u64,
|
||||
}
|
||||
|
||||
impl EphemeralFile {
|
||||
pub fn create(
|
||||
conf: &PageServerConf,
|
||||
tenantid: ZTenantId,
|
||||
timelineid: ZTimelineId,
|
||||
) -> Result<EphemeralFile, std::io::Error> {
|
||||
let mut l = EPHEMERAL_FILES.write().unwrap();
|
||||
let file_id = l.next_file_id;
|
||||
l.next_file_id += 1;
|
||||
|
||||
let filename = conf
|
||||
.timeline_path(&timelineid, &tenantid)
|
||||
.join(PathBuf::from(format!("ephemeral-{}", file_id)));
|
||||
|
||||
let file = VirtualFile::open_with_options(
|
||||
&filename,
|
||||
OpenOptions::new().read(true).write(true).create(true),
|
||||
)?;
|
||||
let file_rc = Arc::new(file);
|
||||
l.files.insert(file_id, file_rc.clone());
|
||||
|
||||
Ok(EphemeralFile {
|
||||
file_id,
|
||||
_tenantid: tenantid,
|
||||
_timelineid: timelineid,
|
||||
file: file_rc,
|
||||
pos: 0,
|
||||
})
|
||||
}
|
||||
|
||||
pub fn fill_buffer(&self, buf: &mut [u8], blkno: u32) -> Result<(), Error> {
|
||||
let mut off = 0;
|
||||
while off < PAGE_SZ {
|
||||
let n = self
|
||||
.file
|
||||
.read_at(&mut buf[off..], blkno as u64 * PAGE_SZ as u64 + off as u64)?;
|
||||
|
||||
if n == 0 {
|
||||
// Reached EOF. Fill the rest of the buffer with zeros.
|
||||
const ZERO_BUF: [u8; PAGE_SZ] = [0u8; PAGE_SZ];
|
||||
|
||||
buf[off..].copy_from_slice(&ZERO_BUF[off..]);
|
||||
break;
|
||||
}
|
||||
|
||||
off += n as usize;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// Does the given filename look like an ephemeral file?
|
||||
pub fn is_ephemeral_file(filename: &str) -> bool {
|
||||
if let Some(rest) = filename.strip_prefix("ephemeral-") {
|
||||
rest.parse::<u32>().is_ok()
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
impl FileExt for EphemeralFile {
|
||||
fn read_at(&self, dstbuf: &mut [u8], offset: u64) -> Result<usize, Error> {
|
||||
// Look up the right page
|
||||
let blkno = (offset / PAGE_SZ as u64) as u32;
|
||||
let off = offset as usize % PAGE_SZ;
|
||||
let len = min(PAGE_SZ - off, dstbuf.len());
|
||||
|
||||
let read_guard;
|
||||
let mut write_guard;
|
||||
|
||||
let cache = page_cache::get();
|
||||
let buf = match cache.read_ephemeral_buf(self.file_id, blkno) {
|
||||
ReadBufResult::Found(guard) => {
|
||||
read_guard = guard;
|
||||
read_guard.as_ref()
|
||||
}
|
||||
ReadBufResult::NotFound(guard) => {
|
||||
// Read the page from disk into the buffer
|
||||
write_guard = guard;
|
||||
self.fill_buffer(write_guard.deref_mut(), blkno)?;
|
||||
write_guard.mark_valid();
|
||||
|
||||
// And then fall through to read the requested slice from the
|
||||
// buffer.
|
||||
write_guard.as_ref()
|
||||
}
|
||||
};
|
||||
|
||||
dstbuf[0..len].copy_from_slice(&buf[off..(off + len)]);
|
||||
Ok(len)
|
||||
}
|
||||
|
||||
fn write_at(&self, srcbuf: &[u8], offset: u64) -> Result<usize, Error> {
|
||||
// Look up the right page
|
||||
let blkno = (offset / PAGE_SZ as u64) as u32;
|
||||
let off = offset as usize % PAGE_SZ;
|
||||
let len = min(PAGE_SZ - off, srcbuf.len());
|
||||
|
||||
let mut write_guard;
|
||||
let cache = page_cache::get();
|
||||
let buf = match cache.write_ephemeral_buf(self.file_id, blkno) {
|
||||
WriteBufResult::Found(guard) => {
|
||||
write_guard = guard;
|
||||
write_guard.deref_mut()
|
||||
}
|
||||
WriteBufResult::NotFound(guard) => {
|
||||
// Read the page from disk into the buffer
|
||||
// TODO: if we're overwriting the whole page, no need to read it in first
|
||||
write_guard = guard;
|
||||
self.fill_buffer(write_guard.deref_mut(), blkno)?;
|
||||
write_guard.mark_valid();
|
||||
|
||||
// And then fall through to modify it.
|
||||
write_guard.deref_mut()
|
||||
}
|
||||
};
|
||||
|
||||
buf[off..(off + len)].copy_from_slice(&srcbuf[0..len]);
|
||||
write_guard.mark_dirty();
|
||||
Ok(len)
|
||||
}
|
||||
}
|
||||
|
||||
impl Write for EphemeralFile {
|
||||
fn write(&mut self, buf: &[u8]) -> Result<usize, Error> {
|
||||
let n = self.write_at(buf, self.pos)?;
|
||||
self.pos += n as u64;
|
||||
Ok(n)
|
||||
}
|
||||
|
||||
fn flush(&mut self) -> Result<(), std::io::Error> {
|
||||
// we don't need to flush data:
|
||||
// * we either write input bytes or not, not keeping any intermediate data buffered
|
||||
// * rust unix file `flush` impl does not flush things either, returning `Ok(())`
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl Seek for EphemeralFile {
|
||||
fn seek(&mut self, pos: SeekFrom) -> Result<u64, Error> {
|
||||
match pos {
|
||||
SeekFrom::Start(offset) => {
|
||||
self.pos = offset;
|
||||
}
|
||||
SeekFrom::End(_offset) => {
|
||||
return Err(Error::new(
|
||||
ErrorKind::Other,
|
||||
"SeekFrom::End not supported by EphemeralFile",
|
||||
));
|
||||
}
|
||||
SeekFrom::Current(offset) => {
|
||||
let pos = self.pos as i128 + offset as i128;
|
||||
if pos < 0 {
|
||||
return Err(Error::new(
|
||||
ErrorKind::InvalidInput,
|
||||
"offset would be negative",
|
||||
));
|
||||
}
|
||||
if pos > u64::MAX as i128 {
|
||||
return Err(Error::new(ErrorKind::InvalidInput, "offset overflow"));
|
||||
}
|
||||
self.pos = pos as u64;
|
||||
}
|
||||
}
|
||||
Ok(self.pos)
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for EphemeralFile {
|
||||
fn drop(&mut self) {
|
||||
// drop all pages from page cache
|
||||
let cache = page_cache::get();
|
||||
cache.drop_buffers_for_ephemeral(self.file_id);
|
||||
|
||||
// remove entry from the hash map
|
||||
EPHEMERAL_FILES.write().unwrap().files.remove(&self.file_id);
|
||||
|
||||
// unlink file
|
||||
// FIXME: print error
|
||||
let _ = std::fs::remove_file(&self.file.path);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn writeback(file_id: u64, blkno: u32, buf: &[u8]) -> Result<(), std::io::Error> {
|
||||
if let Some(file) = EPHEMERAL_FILES.read().unwrap().files.get(&file_id) {
|
||||
file.write_all_at(buf, blkno as u64 * PAGE_SZ as u64)?;
|
||||
Ok(())
|
||||
} else {
|
||||
Err(std::io::Error::new(
|
||||
ErrorKind::Other,
|
||||
"could not write back page, not found in ephemeral files hash",
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use rand::seq::SliceRandom;
|
||||
use rand::thread_rng;
|
||||
use std::fs;
|
||||
use std::str::FromStr;
|
||||
|
||||
fn repo_harness(
|
||||
test_name: &str,
|
||||
) -> Result<(&'static PageServerConf, ZTenantId, ZTimelineId), Error> {
|
||||
let repo_dir = PageServerConf::test_repo_dir(test_name);
|
||||
let _ = fs::remove_dir_all(&repo_dir);
|
||||
let conf = PageServerConf::dummy_conf(repo_dir);
|
||||
// Make a static copy of the config. This can never be free'd, but that's
|
||||
// OK in a test.
|
||||
let conf: &'static PageServerConf = Box::leak(Box::new(conf));
|
||||
|
||||
let tenantid = ZTenantId::from_str("11000000000000000000000000000000").unwrap();
|
||||
let timelineid = ZTimelineId::from_str("22000000000000000000000000000000").unwrap();
|
||||
fs::create_dir_all(conf.timeline_path(&timelineid, &tenantid))?;
|
||||
|
||||
Ok((conf, tenantid, timelineid))
|
||||
}
|
||||
|
||||
// Helper function to slurp contents of a file, starting at the current position,
|
||||
// into a string
|
||||
fn read_string(efile: &EphemeralFile, offset: u64, len: usize) -> Result<String, Error> {
|
||||
let mut buf = Vec::new();
|
||||
buf.resize(len, 0u8);
|
||||
|
||||
efile.read_exact_at(&mut buf, offset)?;
|
||||
|
||||
Ok(String::from_utf8_lossy(&buf)
|
||||
.trim_end_matches('\0')
|
||||
.to_string())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_ephemeral_files() -> Result<(), Error> {
|
||||
let (conf, tenantid, timelineid) = repo_harness("ephemeral_files")?;
|
||||
|
||||
let mut file_a = EphemeralFile::create(conf, tenantid, timelineid)?;
|
||||
|
||||
file_a.write_all(b"foo")?;
|
||||
assert_eq!("foo", read_string(&file_a, 0, 20)?);
|
||||
|
||||
file_a.write_all(b"bar")?;
|
||||
assert_eq!("foobar", read_string(&file_a, 0, 20)?);
|
||||
|
||||
// Open a lot of files, enough to cause some page evictions.
|
||||
let mut efiles = Vec::new();
|
||||
for fileno in 0..100 {
|
||||
let mut efile = EphemeralFile::create(conf, tenantid, timelineid)?;
|
||||
efile.write_all(format!("file {}", fileno).as_bytes())?;
|
||||
assert_eq!(format!("file {}", fileno), read_string(&efile, 0, 10)?);
|
||||
efiles.push((fileno, efile));
|
||||
}
|
||||
|
||||
// Check that all the files can still be read from. Use them in random order for
|
||||
// good measure.
|
||||
efiles.as_mut_slice().shuffle(&mut thread_rng());
|
||||
for (fileno, efile) in efiles.iter_mut() {
|
||||
assert_eq!(format!("file {}", fileno), read_string(efile, 0, 10)?);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
279
pageserver/src/layered_repository/filename.rs
Normal file
279
pageserver/src/layered_repository/filename.rs
Normal file
@@ -0,0 +1,279 @@
|
||||
//!
|
||||
//! Helper functions for dealing with filenames of the image and delta layer files.
|
||||
//!
|
||||
use crate::config::PageServerConf;
|
||||
use crate::layered_repository::storage_layer::SegmentTag;
|
||||
use crate::relish::*;
|
||||
use std::fmt;
|
||||
use std::path::PathBuf;
|
||||
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
// Note: LayeredTimeline::load_layer_map() relies on this sort order
|
||||
#[derive(Debug, PartialEq, Eq, PartialOrd, Ord, Clone)]
|
||||
pub struct DeltaFileName {
|
||||
pub seg: SegmentTag,
|
||||
pub start_lsn: Lsn,
|
||||
pub end_lsn: Lsn,
|
||||
pub dropped: bool,
|
||||
}
|
||||
|
||||
/// Represents the filename of a DeltaLayer
|
||||
///
|
||||
/// <spcnode>_<dbnode>_<relnode>_<forknum>_<seg>_<start LSN>_<end LSN>
|
||||
///
|
||||
/// or if it was dropped:
|
||||
///
|
||||
/// <spcnode>_<dbnode>_<relnode>_<forknum>_<seg>_<start LSN>_<end LSN>_DROPPED
|
||||
///
|
||||
impl DeltaFileName {
|
||||
///
|
||||
/// Parse a string as a delta file name. Returns None if the filename does not
|
||||
/// match the expected pattern.
|
||||
///
|
||||
pub fn parse_str(fname: &str) -> Option<Self> {
|
||||
let rel;
|
||||
let mut parts;
|
||||
if let Some(rest) = fname.strip_prefix("rel_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Relation(RelTag {
|
||||
spcnode: parts.next()?.parse::<u32>().ok()?,
|
||||
dbnode: parts.next()?.parse::<u32>().ok()?,
|
||||
relnode: parts.next()?.parse::<u32>().ok()?,
|
||||
forknum: parts.next()?.parse::<u8>().ok()?,
|
||||
});
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_xact_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Slru {
|
||||
slru: SlruKind::Clog,
|
||||
segno: u32::from_str_radix(parts.next()?, 16).ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_multixact_members_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactMembers,
|
||||
segno: u32::from_str_radix(parts.next()?, 16).ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_multixact_offsets_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactOffsets,
|
||||
segno: u32::from_str_radix(parts.next()?, 16).ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_filenodemap_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::FileNodeMap {
|
||||
spcnode: parts.next()?.parse::<u32>().ok()?,
|
||||
dbnode: parts.next()?.parse::<u32>().ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_twophase_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::TwoPhase {
|
||||
xid: parts.next()?.parse::<u32>().ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_control_checkpoint_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Checkpoint;
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_control_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::ControlFile;
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
|
||||
let segno = parts.next()?.parse::<u32>().ok()?;
|
||||
|
||||
let seg = SegmentTag { rel, segno };
|
||||
|
||||
let start_lsn = Lsn::from_hex(parts.next()?).ok()?;
|
||||
let end_lsn = Lsn::from_hex(parts.next()?).ok()?;
|
||||
|
||||
let mut dropped = false;
|
||||
if let Some(suffix) = parts.next() {
|
||||
if suffix == "DROPPED" {
|
||||
dropped = true;
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
if parts.next().is_some() {
|
||||
return None;
|
||||
}
|
||||
|
||||
Some(DeltaFileName {
|
||||
seg,
|
||||
start_lsn,
|
||||
end_lsn,
|
||||
dropped,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for DeltaFileName {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
let basename = match self.seg.rel {
|
||||
RelishTag::Relation(reltag) => format!(
|
||||
"rel_{}_{}_{}_{}",
|
||||
reltag.spcnode, reltag.dbnode, reltag.relnode, reltag.forknum
|
||||
),
|
||||
RelishTag::Slru {
|
||||
slru: SlruKind::Clog,
|
||||
segno,
|
||||
} => format!("pg_xact_{:04X}", segno),
|
||||
RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactMembers,
|
||||
segno,
|
||||
} => format!("pg_multixact_members_{:04X}", segno),
|
||||
RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactOffsets,
|
||||
segno,
|
||||
} => format!("pg_multixact_offsets_{:04X}", segno),
|
||||
RelishTag::FileNodeMap { spcnode, dbnode } => {
|
||||
format!("pg_filenodemap_{}_{}", spcnode, dbnode)
|
||||
}
|
||||
RelishTag::TwoPhase { xid } => format!("pg_twophase_{}", xid),
|
||||
RelishTag::Checkpoint => "pg_control_checkpoint".to_string(),
|
||||
RelishTag::ControlFile => "pg_control".to_string(),
|
||||
};
|
||||
|
||||
write!(
|
||||
f,
|
||||
"{}_{}_{:016X}_{:016X}{}",
|
||||
basename,
|
||||
self.seg.segno,
|
||||
u64::from(self.start_lsn),
|
||||
u64::from(self.end_lsn),
|
||||
if self.dropped { "_DROPPED" } else { "" }
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, PartialEq, Eq, PartialOrd, Ord, Clone)]
|
||||
pub struct ImageFileName {
|
||||
pub seg: SegmentTag,
|
||||
pub lsn: Lsn,
|
||||
}
|
||||
|
||||
///
|
||||
/// Represents the filename of an ImageLayer
|
||||
///
|
||||
/// <spcnode>_<dbnode>_<relnode>_<forknum>_<seg>_<LSN>
|
||||
///
|
||||
impl ImageFileName {
|
||||
///
|
||||
/// Parse a string as an image file name. Returns None if the filename does not
|
||||
/// match the expected pattern.
|
||||
///
|
||||
pub fn parse_str(fname: &str) -> Option<Self> {
|
||||
let rel;
|
||||
let mut parts;
|
||||
if let Some(rest) = fname.strip_prefix("rel_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Relation(RelTag {
|
||||
spcnode: parts.next()?.parse::<u32>().ok()?,
|
||||
dbnode: parts.next()?.parse::<u32>().ok()?,
|
||||
relnode: parts.next()?.parse::<u32>().ok()?,
|
||||
forknum: parts.next()?.parse::<u8>().ok()?,
|
||||
});
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_xact_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Slru {
|
||||
slru: SlruKind::Clog,
|
||||
segno: u32::from_str_radix(parts.next()?, 16).ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_multixact_members_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactMembers,
|
||||
segno: u32::from_str_radix(parts.next()?, 16).ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_multixact_offsets_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactOffsets,
|
||||
segno: u32::from_str_radix(parts.next()?, 16).ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_filenodemap_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::FileNodeMap {
|
||||
spcnode: parts.next()?.parse::<u32>().ok()?,
|
||||
dbnode: parts.next()?.parse::<u32>().ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_twophase_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::TwoPhase {
|
||||
xid: parts.next()?.parse::<u32>().ok()?,
|
||||
};
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_control_checkpoint_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::Checkpoint;
|
||||
} else if let Some(rest) = fname.strip_prefix("pg_control_") {
|
||||
parts = rest.split('_');
|
||||
rel = RelishTag::ControlFile;
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
|
||||
let segno = parts.next()?.parse::<u32>().ok()?;
|
||||
|
||||
let seg = SegmentTag { rel, segno };
|
||||
|
||||
let lsn = Lsn::from_hex(parts.next()?).ok()?;
|
||||
|
||||
if parts.next().is_some() {
|
||||
return None;
|
||||
}
|
||||
|
||||
Some(ImageFileName { seg, lsn })
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for ImageFileName {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
let basename = match self.seg.rel {
|
||||
RelishTag::Relation(reltag) => format!(
|
||||
"rel_{}_{}_{}_{}",
|
||||
reltag.spcnode, reltag.dbnode, reltag.relnode, reltag.forknum
|
||||
),
|
||||
RelishTag::Slru {
|
||||
slru: SlruKind::Clog,
|
||||
segno,
|
||||
} => format!("pg_xact_{:04X}", segno),
|
||||
RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactMembers,
|
||||
segno,
|
||||
} => format!("pg_multixact_members_{:04X}", segno),
|
||||
RelishTag::Slru {
|
||||
slru: SlruKind::MultiXactOffsets,
|
||||
segno,
|
||||
} => format!("pg_multixact_offsets_{:04X}", segno),
|
||||
RelishTag::FileNodeMap { spcnode, dbnode } => {
|
||||
format!("pg_filenodemap_{}_{}", spcnode, dbnode)
|
||||
}
|
||||
RelishTag::TwoPhase { xid } => format!("pg_twophase_{}", xid),
|
||||
RelishTag::Checkpoint => "pg_control_checkpoint".to_string(),
|
||||
RelishTag::ControlFile => "pg_control".to_string(),
|
||||
};
|
||||
|
||||
write!(
|
||||
f,
|
||||
"{}_{}_{:016X}",
|
||||
basename,
|
||||
self.seg.segno,
|
||||
u64::from(self.lsn),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
/// Helper enum to hold a PageServerConf, or a path
|
||||
///
|
||||
/// This is used by DeltaLayer and ImageLayer. Normally, this holds a reference to the
|
||||
/// global config, and paths to layer files are constructed using the tenant/timeline
|
||||
/// path from the config. But in the 'dump_layerfile' binary, we need to construct a Layer
|
||||
/// struct for a file on disk, without having a page server running, so that we have no
|
||||
/// config. In that case, we use the Path variant to hold the full path to the file on
|
||||
/// disk.
|
||||
pub enum PathOrConf {
|
||||
Path(PathBuf),
|
||||
Conf(&'static PageServerConf),
|
||||
}
|
||||
142
pageserver/src/layered_repository/global_layer_map.rs
Normal file
142
pageserver/src/layered_repository/global_layer_map.rs
Normal file
@@ -0,0 +1,142 @@
|
||||
//!
|
||||
//! Global registry of open layers.
|
||||
//!
|
||||
//! Whenever a new in-memory layer is created to hold incoming WAL, it is registered
|
||||
//! in [`GLOBAL_LAYER_MAP`], so that we can keep track of the total number of
|
||||
//! in-memory layers in the system, and know when we need to evict some to release
|
||||
//! memory.
|
||||
//!
|
||||
//! Each layer is assigned a unique ID when it's registered in the global registry.
|
||||
//! The ID can be used to relocate the layer later, without having to hold locks.
|
||||
//!
|
||||
|
||||
use std::sync::atomic::{AtomicU8, Ordering};
|
||||
use std::sync::{Arc, RwLock};
|
||||
|
||||
use super::inmemory_layer::InMemoryLayer;
|
||||
|
||||
use lazy_static::lazy_static;
|
||||
|
||||
const MAX_USAGE_COUNT: u8 = 5;
|
||||
|
||||
lazy_static! {
|
||||
pub static ref GLOBAL_LAYER_MAP: RwLock<InMemoryLayers> =
|
||||
RwLock::new(InMemoryLayers::default());
|
||||
}
|
||||
|
||||
// TODO these types can probably be smaller
|
||||
#[derive(PartialEq, Eq, Clone, Copy)]
|
||||
pub struct LayerId {
|
||||
index: usize,
|
||||
tag: u64, // to avoid ABA problem
|
||||
}
|
||||
|
||||
enum SlotData {
|
||||
Occupied(Arc<InMemoryLayer>),
|
||||
/// Vacant slots form a linked list, the value is the index
|
||||
/// of the next vacant slot in the list.
|
||||
Vacant(Option<usize>),
|
||||
}
|
||||
|
||||
struct Slot {
|
||||
tag: u64,
|
||||
data: SlotData,
|
||||
usage_count: AtomicU8, // for clock algorithm
|
||||
}
|
||||
|
||||
#[derive(Default)]
|
||||
pub struct InMemoryLayers {
|
||||
slots: Vec<Slot>,
|
||||
num_occupied: usize,
|
||||
|
||||
// Head of free-slot list.
|
||||
next_empty_slot_idx: Option<usize>,
|
||||
}
|
||||
|
||||
impl InMemoryLayers {
|
||||
pub fn insert(&mut self, layer: Arc<InMemoryLayer>) -> LayerId {
|
||||
let slot_idx = match self.next_empty_slot_idx {
|
||||
Some(slot_idx) => slot_idx,
|
||||
None => {
|
||||
let idx = self.slots.len();
|
||||
self.slots.push(Slot {
|
||||
tag: 0,
|
||||
data: SlotData::Vacant(None),
|
||||
usage_count: AtomicU8::new(0),
|
||||
});
|
||||
idx
|
||||
}
|
||||
};
|
||||
let slots_len = self.slots.len();
|
||||
|
||||
let slot = &mut self.slots[slot_idx];
|
||||
|
||||
match slot.data {
|
||||
SlotData::Occupied(_) => {
|
||||
panic!("an occupied slot was in the free list");
|
||||
}
|
||||
SlotData::Vacant(next_empty_slot_idx) => {
|
||||
self.next_empty_slot_idx = next_empty_slot_idx;
|
||||
}
|
||||
}
|
||||
|
||||
slot.data = SlotData::Occupied(layer);
|
||||
slot.usage_count.store(1, Ordering::Relaxed);
|
||||
|
||||
self.num_occupied += 1;
|
||||
assert!(self.num_occupied <= slots_len);
|
||||
|
||||
LayerId {
|
||||
index: slot_idx,
|
||||
tag: slot.tag,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get(&self, layer_id: &LayerId) -> Option<Arc<InMemoryLayer>> {
|
||||
let slot = self.slots.get(layer_id.index)?; // TODO should out of bounds indexes just panic?
|
||||
if slot.tag != layer_id.tag {
|
||||
return None;
|
||||
}
|
||||
|
||||
if let SlotData::Occupied(layer) = &slot.data {
|
||||
let _ = slot.usage_count.fetch_update(
|
||||
Ordering::Relaxed,
|
||||
Ordering::Relaxed,
|
||||
|old_usage_count| {
|
||||
if old_usage_count < MAX_USAGE_COUNT {
|
||||
Some(old_usage_count + 1)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
},
|
||||
);
|
||||
Some(Arc::clone(layer))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
// TODO this won't be a public API in the future
|
||||
pub fn remove(&mut self, layer_id: &LayerId) {
|
||||
let slot = &mut self.slots[layer_id.index];
|
||||
|
||||
if slot.tag != layer_id.tag {
|
||||
return;
|
||||
}
|
||||
|
||||
match &slot.data {
|
||||
SlotData::Occupied(_layer) => {
|
||||
// TODO evict the layer
|
||||
}
|
||||
SlotData::Vacant(_) => unimplemented!(),
|
||||
}
|
||||
|
||||
slot.data = SlotData::Vacant(self.next_empty_slot_idx);
|
||||
self.next_empty_slot_idx = Some(layer_id.index);
|
||||
|
||||
assert!(self.num_occupied > 0);
|
||||
self.num_occupied -= 1;
|
||||
|
||||
slot.tag = slot.tag.wrapping_add(1);
|
||||
}
|
||||
}
|
||||
534
pageserver/src/layered_repository/image_layer.rs
Normal file
534
pageserver/src/layered_repository/image_layer.rs
Normal file
@@ -0,0 +1,534 @@
|
||||
//! An ImageLayer represents an image or a snapshot of a segment at one particular LSN.
|
||||
//! It is stored in a file on disk.
|
||||
//!
|
||||
//! On disk, the image files are stored in timelines/<timelineid> directory.
|
||||
//! Currently, there are no subdirectories, and each image layer file is named like this:
|
||||
//!
|
||||
//! Note that segno is
|
||||
//! <spcnode>_<dbnode>_<relnode>_<forknum>_<segno>_<LSN>
|
||||
//!
|
||||
//! For example:
|
||||
//!
|
||||
//! 1663_13990_2609_0_5_000000000169C348
|
||||
//!
|
||||
//! An image file is constructed using the 'bookfile' crate.
|
||||
//!
|
||||
//! Only metadata is loaded into memory by the load function.
|
||||
//! When images are needed, they are read directly from disk.
|
||||
//!
|
||||
//! For blocky relishes, the images are stored in BLOCKY_IMAGES_CHAPTER.
|
||||
//! All the images are required to be BLOCK_SIZE, which allows for random access.
|
||||
//!
|
||||
//! For non-blocky relishes, the image can be found in NONBLOCKY_IMAGE_CHAPTER.
|
||||
//!
|
||||
use crate::config::PageServerConf;
|
||||
use crate::layered_repository::filename::{ImageFileName, PathOrConf};
|
||||
use crate::layered_repository::storage_layer::{
|
||||
Layer, PageReconstructData, PageReconstructResult, SegmentBlk, SegmentTag,
|
||||
};
|
||||
use crate::layered_repository::RELISH_SEG_SIZE;
|
||||
use crate::virtual_file::VirtualFile;
|
||||
use crate::{ZTenantId, ZTimelineId};
|
||||
use anyhow::{anyhow, bail, ensure, Context, Result};
|
||||
use bytes::Bytes;
|
||||
use log::*;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::convert::TryInto;
|
||||
use std::fs;
|
||||
use std::io::{BufWriter, Write};
|
||||
use std::path::{Path, PathBuf};
|
||||
use std::sync::{Mutex, MutexGuard};
|
||||
|
||||
use bookfile::{Book, BookWriter, ChapterWriter};
|
||||
|
||||
use zenith_utils::bin_ser::BeSer;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
// Magic constant to identify a Zenith segment image file
|
||||
pub const IMAGE_FILE_MAGIC: u32 = 0x5A616E01 + 1;
|
||||
|
||||
/// Contains each block in block # order
|
||||
const BLOCKY_IMAGES_CHAPTER: u64 = 1;
|
||||
const NONBLOCKY_IMAGE_CHAPTER: u64 = 2;
|
||||
|
||||
/// Contains the [`Summary`] struct
|
||||
const SUMMARY_CHAPTER: u64 = 3;
|
||||
|
||||
#[derive(Debug, Serialize, Deserialize, PartialEq, Eq)]
|
||||
struct Summary {
|
||||
tenantid: ZTenantId,
|
||||
timelineid: ZTimelineId,
|
||||
seg: SegmentTag,
|
||||
|
||||
lsn: Lsn,
|
||||
}
|
||||
|
||||
impl From<&ImageLayer> for Summary {
|
||||
fn from(layer: &ImageLayer) -> Self {
|
||||
Self {
|
||||
tenantid: layer.tenantid,
|
||||
timelineid: layer.timelineid,
|
||||
seg: layer.seg,
|
||||
|
||||
lsn: layer.lsn,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
const BLOCK_SIZE: usize = 8192;
|
||||
|
||||
///
|
||||
/// ImageLayer is the in-memory data structure associated with an on-disk image
|
||||
/// file. We keep an ImageLayer in memory for each file, in the LayerMap. If a
|
||||
/// layer is in "loaded" state, we have a copy of the file in memory, in 'inner'.
|
||||
/// Otherwise the struct is just a placeholder for a file that exists on disk,
|
||||
/// and it needs to be loaded before using it in queries.
|
||||
///
|
||||
pub struct ImageLayer {
|
||||
path_or_conf: PathOrConf,
|
||||
pub tenantid: ZTenantId,
|
||||
pub timelineid: ZTimelineId,
|
||||
pub seg: SegmentTag,
|
||||
|
||||
// This entry contains an image of all pages as of this LSN
|
||||
pub lsn: Lsn,
|
||||
|
||||
inner: Mutex<ImageLayerInner>,
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
enum ImageType {
|
||||
Blocky { num_blocks: SegmentBlk },
|
||||
NonBlocky,
|
||||
}
|
||||
|
||||
pub struct ImageLayerInner {
|
||||
/// If None, the 'image_type' has not been loaded into memory yet.
|
||||
book: Option<Book<VirtualFile>>,
|
||||
|
||||
/// Derived from filename and bookfile chapter metadata
|
||||
image_type: ImageType,
|
||||
}
|
||||
|
||||
impl Layer for ImageLayer {
|
||||
fn filename(&self) -> PathBuf {
|
||||
PathBuf::from(self.layer_name().to_string())
|
||||
}
|
||||
|
||||
fn get_tenant_id(&self) -> ZTenantId {
|
||||
self.tenantid
|
||||
}
|
||||
|
||||
fn get_timeline_id(&self) -> ZTimelineId {
|
||||
self.timelineid
|
||||
}
|
||||
|
||||
fn get_seg_tag(&self) -> SegmentTag {
|
||||
self.seg
|
||||
}
|
||||
|
||||
fn is_dropped(&self) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
fn get_start_lsn(&self) -> Lsn {
|
||||
self.lsn
|
||||
}
|
||||
|
||||
fn get_end_lsn(&self) -> Lsn {
|
||||
// End-bound is exclusive
|
||||
self.lsn + 1
|
||||
}
|
||||
|
||||
/// Look up given page in the file
|
||||
fn get_page_reconstruct_data(
|
||||
&self,
|
||||
blknum: SegmentBlk,
|
||||
lsn: Lsn,
|
||||
reconstruct_data: &mut PageReconstructData,
|
||||
) -> Result<PageReconstructResult> {
|
||||
assert!((0..RELISH_SEG_SIZE).contains(&blknum));
|
||||
assert!(lsn >= self.lsn);
|
||||
|
||||
match reconstruct_data.page_img {
|
||||
Some((cached_lsn, _)) if self.lsn <= cached_lsn => {
|
||||
return Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
|
||||
let inner = self.load()?;
|
||||
|
||||
let buf = match &inner.image_type {
|
||||
ImageType::Blocky { num_blocks } => {
|
||||
// Check if the request is beyond EOF
|
||||
if blknum >= *num_blocks {
|
||||
return Ok(PageReconstructResult::Missing(lsn));
|
||||
}
|
||||
|
||||
let mut buf = vec![0u8; BLOCK_SIZE];
|
||||
let offset = BLOCK_SIZE as u64 * blknum as u64;
|
||||
|
||||
let chapter = inner
|
||||
.book
|
||||
.as_ref()
|
||||
.unwrap()
|
||||
.chapter_reader(BLOCKY_IMAGES_CHAPTER)?;
|
||||
|
||||
chapter.read_exact_at(&mut buf, offset).with_context(|| {
|
||||
format!(
|
||||
"failed to read page from data file {} at offset {}",
|
||||
self.filename().display(),
|
||||
offset
|
||||
)
|
||||
})?;
|
||||
|
||||
buf
|
||||
}
|
||||
ImageType::NonBlocky => {
|
||||
ensure!(blknum == 0);
|
||||
inner
|
||||
.book
|
||||
.as_ref()
|
||||
.unwrap()
|
||||
.read_chapter(NONBLOCKY_IMAGE_CHAPTER)?
|
||||
.into_vec()
|
||||
}
|
||||
};
|
||||
|
||||
reconstruct_data.page_img = Some((self.lsn, Bytes::from(buf)));
|
||||
Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
|
||||
/// Get size of the segment
|
||||
fn get_seg_size(&self, _lsn: Lsn) -> Result<SegmentBlk> {
|
||||
let inner = self.load()?;
|
||||
match inner.image_type {
|
||||
ImageType::Blocky { num_blocks } => Ok(num_blocks),
|
||||
ImageType::NonBlocky => Err(anyhow!("get_seg_size called for non-blocky segment")),
|
||||
}
|
||||
}
|
||||
|
||||
/// Does this segment exist at given LSN?
|
||||
fn get_seg_exists(&self, _lsn: Lsn) -> Result<bool> {
|
||||
Ok(true)
|
||||
}
|
||||
|
||||
fn unload(&self) -> Result<()> {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn delete(&self) -> Result<()> {
|
||||
// delete underlying file
|
||||
fs::remove_file(self.path())?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn is_incremental(&self) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
fn is_in_memory(&self) -> bool {
|
||||
false
|
||||
}
|
||||
|
||||
/// debugging function to print out the contents of the layer
|
||||
fn dump(&self) -> Result<()> {
|
||||
println!(
|
||||
"----- image layer for ten {} tli {} seg {} at {} ----",
|
||||
self.tenantid, self.timelineid, self.seg, self.lsn
|
||||
);
|
||||
|
||||
let inner = self.load()?;
|
||||
|
||||
match inner.image_type {
|
||||
ImageType::Blocky { num_blocks } => println!("({}) blocks ", num_blocks),
|
||||
ImageType::NonBlocky => {
|
||||
let chapter = inner
|
||||
.book
|
||||
.as_ref()
|
||||
.unwrap()
|
||||
.read_chapter(NONBLOCKY_IMAGE_CHAPTER)?;
|
||||
println!("non-blocky ({} bytes)", chapter.len());
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl ImageLayer {
|
||||
fn path_for(
|
||||
path_or_conf: &PathOrConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
fname: &ImageFileName,
|
||||
) -> PathBuf {
|
||||
match path_or_conf {
|
||||
PathOrConf::Path(path) => path.to_path_buf(),
|
||||
PathOrConf::Conf(conf) => conf
|
||||
.timeline_path(&timelineid, &tenantid)
|
||||
.join(fname.to_string()),
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Load the contents of the file into memory
|
||||
///
|
||||
fn load(&self) -> Result<MutexGuard<ImageLayerInner>> {
|
||||
// quick exit if already loaded
|
||||
let mut inner = self.inner.lock().unwrap();
|
||||
|
||||
if inner.book.is_some() {
|
||||
return Ok(inner);
|
||||
}
|
||||
|
||||
let path = self.path();
|
||||
let file = VirtualFile::open(&path)
|
||||
.with_context(|| format!("Failed to open virtual file '{}'", path.display()))?;
|
||||
let book = Book::new(file).with_context(|| {
|
||||
format!(
|
||||
"Failed to open virtual file '{}' as a bookfile",
|
||||
path.display()
|
||||
)
|
||||
})?;
|
||||
|
||||
match &self.path_or_conf {
|
||||
PathOrConf::Conf(_) => {
|
||||
let chapter = book.read_chapter(SUMMARY_CHAPTER)?;
|
||||
let actual_summary = Summary::des(&chapter)?;
|
||||
|
||||
let expected_summary = Summary::from(self);
|
||||
|
||||
if actual_summary != expected_summary {
|
||||
bail!("in-file summary does not match expected summary. actual = {:?} expected = {:?}", actual_summary, expected_summary);
|
||||
}
|
||||
}
|
||||
PathOrConf::Path(path) => {
|
||||
let actual_filename = Path::new(path.file_name().unwrap());
|
||||
let expected_filename = self.filename();
|
||||
|
||||
if actual_filename != expected_filename {
|
||||
println!(
|
||||
"warning: filename does not match what is expected from in-file summary"
|
||||
);
|
||||
println!("actual: {:?}", actual_filename);
|
||||
println!("expected: {:?}", expected_filename);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let image_type = if self.seg.rel.is_blocky() {
|
||||
let chapter = book.chapter_reader(BLOCKY_IMAGES_CHAPTER)?;
|
||||
let images_len = chapter.len();
|
||||
ensure!(images_len % BLOCK_SIZE as u64 == 0);
|
||||
let num_blocks: SegmentBlk = (images_len / BLOCK_SIZE as u64).try_into()?;
|
||||
ImageType::Blocky { num_blocks }
|
||||
} else {
|
||||
let _chapter = book.chapter_reader(NONBLOCKY_IMAGE_CHAPTER)?;
|
||||
ImageType::NonBlocky
|
||||
};
|
||||
|
||||
debug!("loaded from {}", &path.display());
|
||||
|
||||
*inner = ImageLayerInner {
|
||||
book: Some(book),
|
||||
image_type,
|
||||
};
|
||||
|
||||
Ok(inner)
|
||||
}
|
||||
|
||||
/// Create an ImageLayer struct representing an existing file on disk
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
filename: &ImageFileName,
|
||||
) -> ImageLayer {
|
||||
ImageLayer {
|
||||
path_or_conf: PathOrConf::Conf(conf),
|
||||
timelineid,
|
||||
tenantid,
|
||||
seg: filename.seg,
|
||||
lsn: filename.lsn,
|
||||
inner: Mutex::new(ImageLayerInner {
|
||||
book: None,
|
||||
image_type: ImageType::Blocky { num_blocks: 0 },
|
||||
}),
|
||||
}
|
||||
}
|
||||
|
||||
/// Create an ImageLayer struct representing an existing file on disk.
|
||||
///
|
||||
/// This variant is only used for debugging purposes, by the 'dump_layerfile' binary.
|
||||
pub fn new_for_path<F>(path: &Path, book: &Book<F>) -> Result<ImageLayer>
|
||||
where
|
||||
F: std::os::unix::prelude::FileExt,
|
||||
{
|
||||
let chapter = book.read_chapter(SUMMARY_CHAPTER)?;
|
||||
let summary = Summary::des(&chapter)?;
|
||||
|
||||
Ok(ImageLayer {
|
||||
path_or_conf: PathOrConf::Path(path.to_path_buf()),
|
||||
timelineid: summary.timelineid,
|
||||
tenantid: summary.tenantid,
|
||||
seg: summary.seg,
|
||||
lsn: summary.lsn,
|
||||
inner: Mutex::new(ImageLayerInner {
|
||||
book: None,
|
||||
image_type: ImageType::Blocky { num_blocks: 0 },
|
||||
}),
|
||||
})
|
||||
}
|
||||
|
||||
fn layer_name(&self) -> ImageFileName {
|
||||
ImageFileName {
|
||||
seg: self.seg,
|
||||
lsn: self.lsn,
|
||||
}
|
||||
}
|
||||
|
||||
/// Path to the layer file in pageserver workdir.
|
||||
pub fn path(&self) -> PathBuf {
|
||||
Self::path_for(
|
||||
&self.path_or_conf,
|
||||
self.timelineid,
|
||||
self.tenantid,
|
||||
&self.layer_name(),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
/// A builder object for constructing a new image layer.
|
||||
///
|
||||
/// Usage:
|
||||
///
|
||||
/// 1. Create the ImageLayerWriter by calling ImageLayerWriter::new(...)
|
||||
///
|
||||
/// 2. Write the contents by calling `put_page_image` for every page
|
||||
/// in the segment.
|
||||
///
|
||||
/// 3. Call `finish`.
|
||||
///
|
||||
pub struct ImageLayerWriter {
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
seg: SegmentTag,
|
||||
lsn: Lsn,
|
||||
|
||||
num_blocks: SegmentBlk,
|
||||
|
||||
page_image_writer: ChapterWriter<BufWriter<VirtualFile>>,
|
||||
num_blocks_written: SegmentBlk,
|
||||
}
|
||||
|
||||
impl ImageLayerWriter {
|
||||
pub fn new(
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
seg: SegmentTag,
|
||||
lsn: Lsn,
|
||||
num_blocks: SegmentBlk,
|
||||
) -> Result<ImageLayerWriter> {
|
||||
// Create the file
|
||||
//
|
||||
// Note: This overwrites any existing file. There shouldn't be any.
|
||||
// FIXME: throw an error instead?
|
||||
let path = ImageLayer::path_for(
|
||||
&PathOrConf::Conf(conf),
|
||||
timelineid,
|
||||
tenantid,
|
||||
&ImageFileName { seg, lsn },
|
||||
);
|
||||
let file = VirtualFile::create(&path)?;
|
||||
let buf_writer = BufWriter::new(file);
|
||||
let book = BookWriter::new(buf_writer, IMAGE_FILE_MAGIC)?;
|
||||
|
||||
// Open the page-images chapter for writing. The calls to
|
||||
// `put_page_image` will use this to write the contents.
|
||||
let chapter = if seg.rel.is_blocky() {
|
||||
book.new_chapter(BLOCKY_IMAGES_CHAPTER)
|
||||
} else {
|
||||
assert_eq!(num_blocks, 1);
|
||||
book.new_chapter(NONBLOCKY_IMAGE_CHAPTER)
|
||||
};
|
||||
|
||||
let writer = ImageLayerWriter {
|
||||
conf,
|
||||
timelineid,
|
||||
tenantid,
|
||||
seg,
|
||||
lsn,
|
||||
num_blocks,
|
||||
page_image_writer: chapter,
|
||||
num_blocks_written: 0,
|
||||
};
|
||||
|
||||
Ok(writer)
|
||||
}
|
||||
|
||||
///
|
||||
/// Write next page image to the file.
|
||||
///
|
||||
/// The page versions must be appended in blknum order.
|
||||
///
|
||||
pub fn put_page_image(&mut self, block_bytes: &[u8]) -> Result<()> {
|
||||
assert!(self.num_blocks_written < self.num_blocks);
|
||||
if self.seg.rel.is_blocky() {
|
||||
assert_eq!(block_bytes.len(), BLOCK_SIZE);
|
||||
}
|
||||
self.page_image_writer.write_all(block_bytes)?;
|
||||
self.num_blocks_written += 1;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn finish(self) -> Result<ImageLayer> {
|
||||
// Check that the `put_page_image' was called for every block.
|
||||
assert!(self.num_blocks_written == self.num_blocks);
|
||||
|
||||
// Close the page-images chapter
|
||||
let book = self.page_image_writer.close()?;
|
||||
|
||||
// Write out the summary chapter
|
||||
let image_type = if self.seg.rel.is_blocky() {
|
||||
ImageType::Blocky {
|
||||
num_blocks: self.num_blocks,
|
||||
}
|
||||
} else {
|
||||
ImageType::NonBlocky
|
||||
};
|
||||
let mut chapter = book.new_chapter(SUMMARY_CHAPTER);
|
||||
let summary = Summary {
|
||||
tenantid: self.tenantid,
|
||||
timelineid: self.timelineid,
|
||||
seg: self.seg,
|
||||
lsn: self.lsn,
|
||||
};
|
||||
Summary::ser_into(&summary, &mut chapter)?;
|
||||
let book = chapter.close()?;
|
||||
|
||||
// This flushes the underlying 'buf_writer'.
|
||||
book.close()?;
|
||||
|
||||
// Note: Because we open the file in write-only mode, we cannot
|
||||
// reuse the same VirtualFile for reading later. That's why we don't
|
||||
// set inner.book here. The first read will have to re-open it.
|
||||
let layer = ImageLayer {
|
||||
path_or_conf: PathOrConf::Conf(self.conf),
|
||||
timelineid: self.timelineid,
|
||||
tenantid: self.tenantid,
|
||||
seg: self.seg,
|
||||
lsn: self.lsn,
|
||||
inner: Mutex::new(ImageLayerInner {
|
||||
book: None,
|
||||
image_type,
|
||||
}),
|
||||
};
|
||||
trace!("created image layer {}", layer.path().display());
|
||||
|
||||
Ok(layer)
|
||||
}
|
||||
}
|
||||
804
pageserver/src/layered_repository/inmemory_layer.rs
Normal file
804
pageserver/src/layered_repository/inmemory_layer.rs
Normal file
@@ -0,0 +1,804 @@
|
||||
//! An in-memory layer stores recently received PageVersions.
|
||||
//! The page versions are held in a BTreeMap. To avoid OOM errors, the map size is limited
|
||||
//! and layers can be spilled to disk into ephemeral files.
|
||||
//!
|
||||
//! And there's another BTreeMap to track the size of the relation.
|
||||
//!
|
||||
use crate::config::PageServerConf;
|
||||
use crate::layered_repository::delta_layer::{DeltaLayer, DeltaLayerWriter};
|
||||
use crate::layered_repository::ephemeral_file::EphemeralFile;
|
||||
use crate::layered_repository::filename::DeltaFileName;
|
||||
use crate::layered_repository::image_layer::{ImageLayer, ImageLayerWriter};
|
||||
use crate::layered_repository::storage_layer::{
|
||||
Layer, PageReconstructData, PageReconstructResult, PageVersion, SegmentBlk, SegmentTag,
|
||||
RELISH_SEG_SIZE,
|
||||
};
|
||||
use crate::layered_repository::LayeredTimeline;
|
||||
use crate::layered_repository::ZERO_PAGE;
|
||||
use crate::repository::ZenithWalRecord;
|
||||
use crate::{ZTenantId, ZTimelineId};
|
||||
use anyhow::{ensure, Result};
|
||||
use bytes::Bytes;
|
||||
use log::*;
|
||||
use std::collections::HashMap;
|
||||
use std::io::Seek;
|
||||
use std::os::unix::fs::FileExt;
|
||||
use std::path::PathBuf;
|
||||
use std::sync::{Arc, RwLock};
|
||||
use zenith_utils::bin_ser::BeSer;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
use zenith_utils::vec_map::VecMap;
|
||||
|
||||
pub struct InMemoryLayer {
|
||||
conf: &'static PageServerConf,
|
||||
tenantid: ZTenantId,
|
||||
timelineid: ZTimelineId,
|
||||
seg: SegmentTag,
|
||||
|
||||
///
|
||||
/// This layer contains all the changes from 'start_lsn'. The
|
||||
/// start is inclusive.
|
||||
///
|
||||
start_lsn: Lsn,
|
||||
|
||||
///
|
||||
/// LSN of the oldest page version stored in this layer.
|
||||
///
|
||||
/// This is different from 'start_lsn' in that we enforce that the 'start_lsn'
|
||||
/// of a layer always matches the 'end_lsn' of its predecessor, even if there
|
||||
/// are no page versions until at a later LSN. That way you can detect any
|
||||
/// missing layer files more easily. 'oldest_lsn' is the first page version
|
||||
/// actually stored in this layer. In the range between 'start_lsn' and
|
||||
/// 'oldest_lsn', there are no changes to the segment.
|
||||
/// 'oldest_lsn' is used to adjust 'disk_consistent_lsn' and that is why it should
|
||||
/// point to the beginning of WAL record. This is the other difference with 'start_lsn'
|
||||
/// which points to end of WAL record. This is why 'oldest_lsn' can be smaller than 'start_lsn'.
|
||||
///
|
||||
oldest_lsn: Lsn,
|
||||
|
||||
/// The above fields never change. The parts that do change are in 'inner',
|
||||
/// and protected by mutex.
|
||||
inner: RwLock<InMemoryLayerInner>,
|
||||
|
||||
/// Predecessor layer might be needed?
|
||||
incremental: bool,
|
||||
}
|
||||
|
||||
pub struct InMemoryLayerInner {
|
||||
/// Frozen layers have an exclusive end LSN.
|
||||
/// Writes are only allowed when this is None
|
||||
end_lsn: Option<Lsn>,
|
||||
|
||||
/// If this relation was dropped, remember when that happened.
|
||||
/// The drop LSN is recorded in [`end_lsn`].
|
||||
dropped: bool,
|
||||
|
||||
/// The PageVersion structs are stored in a serialized format in this file.
|
||||
/// Each serialized PageVersion is preceded by a 'u32' length field.
|
||||
/// 'page_versions' map stores offsets into this file.
|
||||
file: EphemeralFile,
|
||||
|
||||
/// Metadata about all versions of all pages in the layer is kept
|
||||
/// here. Indexed by block number and LSN. The value is an offset
|
||||
/// into the ephemeral file where the page version is stored.
|
||||
page_versions: HashMap<SegmentBlk, VecMap<Lsn, u64>>,
|
||||
|
||||
///
|
||||
/// `seg_sizes` tracks the size of the segment at different points in time.
|
||||
///
|
||||
/// For a blocky rel, there is always one entry, at the layer's start_lsn,
|
||||
/// so that determining the size never depends on the predecessor layer. For
|
||||
/// a non-blocky rel, 'seg_sizes' is not used and is always empty.
|
||||
///
|
||||
seg_sizes: VecMap<Lsn, SegmentBlk>,
|
||||
|
||||
///
|
||||
/// LSN of the newest page version stored in this layer.
|
||||
///
|
||||
/// The difference between 'end_lsn' and 'latest_lsn' is the same as between
|
||||
/// 'start_lsn' and 'oldest_lsn'. See comments in 'oldest_lsn'.
|
||||
///
|
||||
latest_lsn: Lsn,
|
||||
}
|
||||
|
||||
impl InMemoryLayerInner {
|
||||
fn assert_writeable(&self) {
|
||||
assert!(self.end_lsn.is_none());
|
||||
}
|
||||
|
||||
fn get_seg_size(&self, lsn: Lsn) -> SegmentBlk {
|
||||
// Scan the BTreeMap backwards, starting from the given entry.
|
||||
let slice = self.seg_sizes.slice_range(..=lsn);
|
||||
|
||||
// We make sure there is always at least one entry
|
||||
if let Some((_entry_lsn, entry)) = slice.last() {
|
||||
*entry
|
||||
} else {
|
||||
panic!("could not find seg size in in-memory layer");
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Read a page version from the ephemeral file.
|
||||
///
|
||||
fn read_pv(&self, off: u64) -> Result<PageVersion> {
|
||||
let mut buf = Vec::new();
|
||||
self.read_pv_bytes(off, &mut buf)?;
|
||||
Ok(PageVersion::des(&buf)?)
|
||||
}
|
||||
|
||||
///
|
||||
/// Read a page version from the ephemeral file, as raw bytes, at
|
||||
/// the given offset. The bytes are read into 'buf', which is
|
||||
/// expanded if necessary. Returns the size of the page version.
|
||||
///
|
||||
fn read_pv_bytes(&self, off: u64, buf: &mut Vec<u8>) -> Result<usize> {
|
||||
// read length
|
||||
let mut lenbuf = [0u8; 4];
|
||||
self.file.read_exact_at(&mut lenbuf, off)?;
|
||||
let len = u32::from_ne_bytes(lenbuf) as usize;
|
||||
|
||||
if buf.len() < len {
|
||||
buf.resize(len, 0);
|
||||
}
|
||||
self.file.read_exact_at(&mut buf[0..len], off + 4)?;
|
||||
Ok(len)
|
||||
}
|
||||
|
||||
fn write_pv(&mut self, pv: &PageVersion) -> Result<u64> {
|
||||
// remember starting position
|
||||
let pos = self.file.stream_position()?;
|
||||
|
||||
// make room for the 'length' field by writing zeros as a placeholder.
|
||||
self.file.seek(std::io::SeekFrom::Start(pos + 4)).unwrap();
|
||||
|
||||
pv.ser_into(&mut self.file).unwrap();
|
||||
|
||||
// write the 'length' field.
|
||||
let len = self.file.stream_position()? - pos - 4;
|
||||
let lenbuf = u32::to_ne_bytes(len as u32);
|
||||
self.file.write_all_at(&lenbuf, pos)?;
|
||||
|
||||
Ok(pos)
|
||||
}
|
||||
}
|
||||
|
||||
impl Layer for InMemoryLayer {
|
||||
// An in-memory layer can be spilled to disk into ephemeral file,
|
||||
// This function is used only for debugging, so we don't need to be very precise.
|
||||
// Construct a filename as if it was a delta layer.
|
||||
fn filename(&self) -> PathBuf {
|
||||
let inner = self.inner.read().unwrap();
|
||||
|
||||
let end_lsn = if let Some(drop_lsn) = inner.end_lsn {
|
||||
drop_lsn
|
||||
} else {
|
||||
Lsn(u64::MAX)
|
||||
};
|
||||
|
||||
let delta_filename = DeltaFileName {
|
||||
seg: self.seg,
|
||||
start_lsn: self.start_lsn,
|
||||
end_lsn,
|
||||
dropped: inner.dropped,
|
||||
}
|
||||
.to_string();
|
||||
|
||||
PathBuf::from(format!("inmem-{}", delta_filename))
|
||||
}
|
||||
|
||||
fn get_tenant_id(&self) -> ZTenantId {
|
||||
self.tenantid
|
||||
}
|
||||
|
||||
fn get_timeline_id(&self) -> ZTimelineId {
|
||||
self.timelineid
|
||||
}
|
||||
|
||||
fn get_seg_tag(&self) -> SegmentTag {
|
||||
self.seg
|
||||
}
|
||||
|
||||
fn get_start_lsn(&self) -> Lsn {
|
||||
self.start_lsn
|
||||
}
|
||||
|
||||
fn get_end_lsn(&self) -> Lsn {
|
||||
let inner = self.inner.read().unwrap();
|
||||
|
||||
if let Some(end_lsn) = inner.end_lsn {
|
||||
end_lsn
|
||||
} else {
|
||||
Lsn(u64::MAX)
|
||||
}
|
||||
}
|
||||
|
||||
fn is_dropped(&self) -> bool {
|
||||
let inner = self.inner.read().unwrap();
|
||||
inner.dropped
|
||||
}
|
||||
|
||||
/// Look up given page in the cache.
|
||||
fn get_page_reconstruct_data(
|
||||
&self,
|
||||
blknum: SegmentBlk,
|
||||
lsn: Lsn,
|
||||
reconstruct_data: &mut PageReconstructData,
|
||||
) -> Result<PageReconstructResult> {
|
||||
let mut need_image = true;
|
||||
|
||||
assert!((0..RELISH_SEG_SIZE).contains(&blknum));
|
||||
|
||||
{
|
||||
let inner = self.inner.read().unwrap();
|
||||
|
||||
// Scan the page versions backwards, starting from `lsn`.
|
||||
if let Some(vec_map) = inner.page_versions.get(&blknum) {
|
||||
let slice = vec_map.slice_range(..=lsn);
|
||||
for (entry_lsn, pos) in slice.iter().rev() {
|
||||
match &reconstruct_data.page_img {
|
||||
Some((cached_lsn, _)) if entry_lsn <= cached_lsn => {
|
||||
return Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
|
||||
let pv = inner.read_pv(*pos)?;
|
||||
match pv {
|
||||
PageVersion::Page(img) => {
|
||||
reconstruct_data.page_img = Some((*entry_lsn, img));
|
||||
need_image = false;
|
||||
break;
|
||||
}
|
||||
PageVersion::Wal(rec) => {
|
||||
reconstruct_data.records.push((*entry_lsn, rec.clone()));
|
||||
if rec.will_init() {
|
||||
// This WAL record initializes the page, so no need to go further back
|
||||
need_image = false;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// If we didn't find any records for this, check if the request is beyond EOF
|
||||
if need_image
|
||||
&& reconstruct_data.records.is_empty()
|
||||
&& self.seg.rel.is_blocky()
|
||||
&& blknum >= self.get_seg_size(lsn)?
|
||||
{
|
||||
return Ok(PageReconstructResult::Missing(self.start_lsn));
|
||||
}
|
||||
|
||||
// release lock on 'inner'
|
||||
}
|
||||
|
||||
// If an older page image is needed to reconstruct the page, let the
|
||||
// caller know
|
||||
if need_image {
|
||||
if self.incremental {
|
||||
Ok(PageReconstructResult::Continue(Lsn(self.start_lsn.0 - 1)))
|
||||
} else {
|
||||
Ok(PageReconstructResult::Missing(self.start_lsn))
|
||||
}
|
||||
} else {
|
||||
Ok(PageReconstructResult::Complete)
|
||||
}
|
||||
}
|
||||
|
||||
/// Get size of the relation at given LSN
|
||||
fn get_seg_size(&self, lsn: Lsn) -> Result<SegmentBlk> {
|
||||
assert!(lsn >= self.start_lsn);
|
||||
ensure!(
|
||||
self.seg.rel.is_blocky(),
|
||||
"get_seg_size() called on a non-blocky rel"
|
||||
);
|
||||
|
||||
let inner = self.inner.read().unwrap();
|
||||
Ok(inner.get_seg_size(lsn))
|
||||
}
|
||||
|
||||
/// Does this segment exist at given LSN?
|
||||
fn get_seg_exists(&self, lsn: Lsn) -> Result<bool> {
|
||||
let inner = self.inner.read().unwrap();
|
||||
|
||||
// If the segment created after requested LSN,
|
||||
// it doesn't exist in the layer. But we shouldn't
|
||||
// have requested it in the first place.
|
||||
assert!(lsn >= self.start_lsn);
|
||||
|
||||
// Is the requested LSN after the segment was dropped?
|
||||
if inner.dropped {
|
||||
if let Some(end_lsn) = inner.end_lsn {
|
||||
if lsn >= end_lsn {
|
||||
return Ok(false);
|
||||
}
|
||||
} else {
|
||||
panic!("dropped in-memory layer with no end LSN");
|
||||
}
|
||||
}
|
||||
|
||||
// Otherwise, it exists
|
||||
Ok(true)
|
||||
}
|
||||
|
||||
/// Cannot unload anything in an in-memory layer, since there's no backing
|
||||
/// store. To release memory used by an in-memory layer, use 'freeze' to turn
|
||||
/// it into an on-disk layer.
|
||||
fn unload(&self) -> Result<()> {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Nothing to do here. When you drop the last reference to the layer, it will
|
||||
/// be deallocated.
|
||||
fn delete(&self) -> Result<()> {
|
||||
panic!("can't delete an InMemoryLayer")
|
||||
}
|
||||
|
||||
fn is_incremental(&self) -> bool {
|
||||
self.incremental
|
||||
}
|
||||
|
||||
fn is_in_memory(&self) -> bool {
|
||||
true
|
||||
}
|
||||
|
||||
/// debugging function to print out the contents of the layer
|
||||
fn dump(&self) -> Result<()> {
|
||||
let inner = self.inner.read().unwrap();
|
||||
|
||||
let end_str = inner
|
||||
.end_lsn
|
||||
.as_ref()
|
||||
.map(Lsn::to_string)
|
||||
.unwrap_or_default();
|
||||
|
||||
println!(
|
||||
"----- in-memory layer for tli {} seg {} {}-{} {} ----",
|
||||
self.timelineid, self.seg, self.start_lsn, end_str, inner.dropped,
|
||||
);
|
||||
|
||||
for (k, v) in inner.seg_sizes.as_slice() {
|
||||
println!("seg_sizes {}: {}", k, v);
|
||||
}
|
||||
|
||||
// List the blocks in order
|
||||
let mut page_versions: Vec<(&SegmentBlk, &VecMap<Lsn, u64>)> =
|
||||
inner.page_versions.iter().collect();
|
||||
page_versions.sort_by_key(|k| k.0);
|
||||
|
||||
for (blknum, versions) in page_versions {
|
||||
for (lsn, off) in versions.as_slice() {
|
||||
let pv = inner.read_pv(*off);
|
||||
let pv_description = match pv {
|
||||
Ok(PageVersion::Page(_img)) => "page",
|
||||
Ok(PageVersion::Wal(_rec)) => "wal",
|
||||
Err(_err) => "INVALID",
|
||||
};
|
||||
|
||||
println!("blk {} at {}: {}\n", blknum, lsn, pv_description);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// A result of an inmemory layer data being written to disk.
|
||||
pub struct LayersOnDisk {
|
||||
pub delta_layers: Vec<DeltaLayer>,
|
||||
pub image_layers: Vec<ImageLayer>,
|
||||
}
|
||||
|
||||
impl InMemoryLayer {
|
||||
/// Return the oldest page version that's stored in this layer
|
||||
pub fn get_oldest_lsn(&self) -> Lsn {
|
||||
self.oldest_lsn
|
||||
}
|
||||
|
||||
pub fn get_latest_lsn(&self) -> Lsn {
|
||||
let inner = self.inner.read().unwrap();
|
||||
inner.latest_lsn
|
||||
}
|
||||
|
||||
///
|
||||
/// Create a new, empty, in-memory layer
|
||||
///
|
||||
pub fn create(
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
seg: SegmentTag,
|
||||
start_lsn: Lsn,
|
||||
oldest_lsn: Lsn,
|
||||
) -> Result<InMemoryLayer> {
|
||||
trace!(
|
||||
"initializing new empty InMemoryLayer for writing {} on timeline {} at {}",
|
||||
seg,
|
||||
timelineid,
|
||||
start_lsn
|
||||
);
|
||||
|
||||
// The segment is initially empty, so initialize 'seg_sizes' with 0.
|
||||
let mut seg_sizes = VecMap::default();
|
||||
if seg.rel.is_blocky() {
|
||||
seg_sizes.append(start_lsn, 0).unwrap();
|
||||
}
|
||||
|
||||
let file = EphemeralFile::create(conf, tenantid, timelineid)?;
|
||||
|
||||
Ok(InMemoryLayer {
|
||||
conf,
|
||||
timelineid,
|
||||
tenantid,
|
||||
seg,
|
||||
start_lsn,
|
||||
oldest_lsn,
|
||||
incremental: false,
|
||||
inner: RwLock::new(InMemoryLayerInner {
|
||||
end_lsn: None,
|
||||
dropped: false,
|
||||
file,
|
||||
page_versions: HashMap::new(),
|
||||
seg_sizes,
|
||||
latest_lsn: oldest_lsn,
|
||||
}),
|
||||
})
|
||||
}
|
||||
|
||||
// Write operations
|
||||
|
||||
/// Remember new page version, as a WAL record over previous version
|
||||
pub fn put_wal_record(
|
||||
&self,
|
||||
lsn: Lsn,
|
||||
blknum: SegmentBlk,
|
||||
rec: ZenithWalRecord,
|
||||
) -> Result<u32> {
|
||||
self.put_page_version(blknum, lsn, PageVersion::Wal(rec))
|
||||
}
|
||||
|
||||
/// Remember new page version, as a full page image
|
||||
pub fn put_page_image(&self, blknum: SegmentBlk, lsn: Lsn, img: Bytes) -> Result<u32> {
|
||||
self.put_page_version(blknum, lsn, PageVersion::Page(img))
|
||||
}
|
||||
|
||||
/// Common subroutine of the public put_wal_record() and put_page_image() functions.
|
||||
/// Adds the page version to the in-memory tree
|
||||
pub fn put_page_version(&self, blknum: SegmentBlk, lsn: Lsn, pv: PageVersion) -> Result<u32> {
|
||||
assert!((0..RELISH_SEG_SIZE).contains(&blknum));
|
||||
|
||||
trace!(
|
||||
"put_page_version blk {} of {} at {}/{}",
|
||||
blknum,
|
||||
self.seg.rel,
|
||||
self.timelineid,
|
||||
lsn
|
||||
);
|
||||
let mut inner = self.inner.write().unwrap();
|
||||
|
||||
inner.assert_writeable();
|
||||
assert!(lsn >= inner.latest_lsn);
|
||||
inner.latest_lsn = lsn;
|
||||
|
||||
// Write the page version to the file, and remember its offset in 'page_versions'
|
||||
{
|
||||
let off = inner.write_pv(&pv)?;
|
||||
let vec_map = inner.page_versions.entry(blknum).or_default();
|
||||
let old = vec_map.append_or_update_last(lsn, off).unwrap().0;
|
||||
if old.is_some() {
|
||||
// We already had an entry for this LSN. That's odd..
|
||||
warn!(
|
||||
"Page version of rel {} blk {} at {} already exists",
|
||||
self.seg.rel, blknum, lsn
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
// Also update the relation size, if this extended the relation.
|
||||
if self.seg.rel.is_blocky() {
|
||||
let newsize = blknum + 1;
|
||||
|
||||
// use inner get_seg_size, since calling self.get_seg_size will try to acquire the lock,
|
||||
// which we've just acquired above
|
||||
let oldsize = inner.get_seg_size(lsn);
|
||||
if newsize > oldsize {
|
||||
trace!(
|
||||
"enlarging segment {} from {} to {} blocks at {}",
|
||||
self.seg,
|
||||
oldsize,
|
||||
newsize,
|
||||
lsn
|
||||
);
|
||||
|
||||
// If we are extending the relation by more than one page, initialize the "gap"
|
||||
// with zeros
|
||||
//
|
||||
// XXX: What if the caller initializes the gap with subsequent call with same LSN?
|
||||
// I don't think that can happen currently, but that is highly dependent on how
|
||||
// PostgreSQL writes its WAL records and there's no guarantee of it. If it does
|
||||
// happen, we would hit the "page version already exists" warning above on the
|
||||
// subsequent call to initialize the gap page.
|
||||
for gapblknum in oldsize..blknum {
|
||||
let zeropv = PageVersion::Page(ZERO_PAGE.clone());
|
||||
trace!(
|
||||
"filling gap blk {} with zeros for write of {}",
|
||||
gapblknum,
|
||||
blknum
|
||||
);
|
||||
|
||||
// Write the page version to the file, and remember its offset in
|
||||
// 'page_versions'
|
||||
{
|
||||
let off = inner.write_pv(&zeropv)?;
|
||||
let vec_map = inner.page_versions.entry(gapblknum).or_default();
|
||||
let old = vec_map.append_or_update_last(lsn, off).unwrap().0;
|
||||
if old.is_some() {
|
||||
warn!(
|
||||
"Page version of seg {} blk {} at {} already exists",
|
||||
self.seg, gapblknum, lsn
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
inner.seg_sizes.append_or_update_last(lsn, newsize).unwrap();
|
||||
return Ok(newsize - oldsize);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(0)
|
||||
}
|
||||
|
||||
/// Remember that the relation was truncated at given LSN
|
||||
pub fn put_truncation(&self, lsn: Lsn, new_size: SegmentBlk) {
|
||||
assert!(
|
||||
self.seg.rel.is_blocky(),
|
||||
"put_truncation() called on a non-blocky rel"
|
||||
);
|
||||
|
||||
let mut inner = self.inner.write().unwrap();
|
||||
inner.assert_writeable();
|
||||
|
||||
// check that this we truncate to a smaller size than segment was before the truncation
|
||||
let old_size = inner.get_seg_size(lsn);
|
||||
assert!(new_size < old_size);
|
||||
|
||||
let (old, _delta_size) = inner
|
||||
.seg_sizes
|
||||
.append_or_update_last(lsn, new_size)
|
||||
.unwrap();
|
||||
|
||||
if old.is_some() {
|
||||
// We already had an entry for this LSN. That's odd..
|
||||
warn!("Inserting truncation, but had an entry for the LSN already");
|
||||
}
|
||||
}
|
||||
|
||||
/// Remember that the segment was dropped at given LSN
|
||||
pub fn drop_segment(&self, lsn: Lsn) {
|
||||
let mut inner = self.inner.write().unwrap();
|
||||
|
||||
assert!(inner.end_lsn.is_none());
|
||||
assert!(!inner.dropped);
|
||||
inner.dropped = true;
|
||||
assert!(self.start_lsn < lsn);
|
||||
inner.end_lsn = Some(lsn);
|
||||
|
||||
trace!("dropped segment {} at {}", self.seg, lsn);
|
||||
}
|
||||
|
||||
///
|
||||
/// Initialize a new InMemoryLayer for, by copying the state at the given
|
||||
/// point in time from given existing layer.
|
||||
///
|
||||
pub fn create_successor_layer(
|
||||
conf: &'static PageServerConf,
|
||||
src: Arc<dyn Layer>,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
start_lsn: Lsn,
|
||||
oldest_lsn: Lsn,
|
||||
) -> Result<InMemoryLayer> {
|
||||
let seg = src.get_seg_tag();
|
||||
|
||||
assert!(oldest_lsn.is_aligned());
|
||||
|
||||
trace!(
|
||||
"initializing new InMemoryLayer for writing {} on timeline {} at {}",
|
||||
seg,
|
||||
timelineid,
|
||||
start_lsn,
|
||||
);
|
||||
|
||||
// Copy the segment size at the start LSN from the predecessor layer.
|
||||
let mut seg_sizes = VecMap::default();
|
||||
if seg.rel.is_blocky() {
|
||||
let size = src.get_seg_size(start_lsn)?;
|
||||
seg_sizes.append(start_lsn, size).unwrap();
|
||||
}
|
||||
|
||||
let file = EphemeralFile::create(conf, tenantid, timelineid)?;
|
||||
|
||||
Ok(InMemoryLayer {
|
||||
conf,
|
||||
timelineid,
|
||||
tenantid,
|
||||
seg,
|
||||
start_lsn,
|
||||
oldest_lsn,
|
||||
incremental: true,
|
||||
inner: RwLock::new(InMemoryLayerInner {
|
||||
end_lsn: None,
|
||||
dropped: false,
|
||||
file,
|
||||
page_versions: HashMap::new(),
|
||||
seg_sizes,
|
||||
latest_lsn: oldest_lsn,
|
||||
}),
|
||||
})
|
||||
}
|
||||
|
||||
pub fn is_writeable(&self) -> bool {
|
||||
let inner = self.inner.read().unwrap();
|
||||
inner.end_lsn.is_none()
|
||||
}
|
||||
|
||||
/// Make the layer non-writeable. Only call once.
|
||||
/// Records the end_lsn for non-dropped layers.
|
||||
/// `end_lsn` is inclusive
|
||||
pub fn freeze(&self, end_lsn: Lsn) {
|
||||
let mut inner = self.inner.write().unwrap();
|
||||
|
||||
if inner.end_lsn.is_some() {
|
||||
assert!(inner.dropped);
|
||||
} else {
|
||||
assert!(!inner.dropped);
|
||||
assert!(self.start_lsn < end_lsn + 1);
|
||||
inner.end_lsn = Some(Lsn(end_lsn.0 + 1));
|
||||
|
||||
if let Some((lsn, _)) = inner.seg_sizes.as_slice().last() {
|
||||
assert!(lsn <= &end_lsn, "{:?} {:?}", lsn, end_lsn);
|
||||
}
|
||||
|
||||
for (_blk, vec_map) in inner.page_versions.iter() {
|
||||
for (lsn, _pos) in vec_map.as_slice() {
|
||||
assert!(*lsn <= end_lsn);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Write the this frozen in-memory layer to disk.
|
||||
///
|
||||
/// Returns new layers that replace this one.
|
||||
/// If not dropped and reconstruct_pages is true, returns a new image layer containing the page versions
|
||||
/// at the `end_lsn`. Can also return a DeltaLayer that includes all the
|
||||
/// WAL records between start and end LSN. (The delta layer is not needed
|
||||
/// when a new relish is created with a single LSN, so that the start and
|
||||
/// end LSN are the same.)
|
||||
pub fn write_to_disk(
|
||||
&self,
|
||||
timeline: &LayeredTimeline,
|
||||
reconstruct_pages: bool,
|
||||
) -> Result<LayersOnDisk> {
|
||||
trace!(
|
||||
"write_to_disk {} get_end_lsn is {}",
|
||||
self.filename().display(),
|
||||
self.get_end_lsn()
|
||||
);
|
||||
|
||||
// Grab the lock in read-mode. We hold it over the I/O, but because this
|
||||
// layer is not writeable anymore, no one should be trying to acquire the
|
||||
// write lock on it, so we shouldn't block anyone. There's one exception
|
||||
// though: another thread might have grabbed a reference to this layer
|
||||
// in `get_layer_for_write' just before the checkpointer called
|
||||
// `freeze`, and then `write_to_disk` on it. When the thread gets the
|
||||
// lock, it will see that it's not writeable anymore and retry, but it
|
||||
// would have to wait until we release it. That race condition is very
|
||||
// rare though, so we just accept the potential latency hit for now.
|
||||
let inner = self.inner.read().unwrap();
|
||||
|
||||
// Since `end_lsn` is exclusive, subtract 1 to calculate the last LSN
|
||||
// that is included.
|
||||
let end_lsn_exclusive = inner.end_lsn.unwrap();
|
||||
let end_lsn_inclusive = Lsn(end_lsn_exclusive.0 - 1);
|
||||
|
||||
// Figure out if we should create a delta layer, image layer, or both.
|
||||
let image_lsn: Option<Lsn>;
|
||||
let delta_end_lsn: Option<Lsn>;
|
||||
if self.is_dropped() || !reconstruct_pages {
|
||||
// The segment was dropped. Create just a delta layer containing all the
|
||||
// changes up to and including the drop.
|
||||
delta_end_lsn = Some(end_lsn_exclusive);
|
||||
image_lsn = None;
|
||||
} else if self.start_lsn == end_lsn_inclusive {
|
||||
// The layer contains exactly one LSN. It's enough to write an image
|
||||
// layer at that LSN.
|
||||
delta_end_lsn = None;
|
||||
image_lsn = Some(end_lsn_inclusive);
|
||||
} else {
|
||||
// Create a delta layer with all the changes up to the end LSN,
|
||||
// and an image layer at the end LSN.
|
||||
//
|
||||
// Note that we the delta layer does *not* include the page versions
|
||||
// at the end LSN. They are included in the image layer, and there's
|
||||
// no need to store them twice.
|
||||
delta_end_lsn = Some(end_lsn_inclusive);
|
||||
image_lsn = Some(end_lsn_inclusive);
|
||||
}
|
||||
|
||||
let mut delta_layers = Vec::new();
|
||||
let mut image_layers = Vec::new();
|
||||
|
||||
if let Some(delta_end_lsn) = delta_end_lsn {
|
||||
let mut delta_layer_writer = DeltaLayerWriter::new(
|
||||
self.conf,
|
||||
self.timelineid,
|
||||
self.tenantid,
|
||||
self.seg,
|
||||
self.start_lsn,
|
||||
delta_end_lsn,
|
||||
self.is_dropped(),
|
||||
)?;
|
||||
|
||||
// Write all page versions, in block + LSN order
|
||||
let mut buf: Vec<u8> = Vec::new();
|
||||
|
||||
let pv_iter = inner.page_versions.iter();
|
||||
let mut pages: Vec<(&SegmentBlk, &VecMap<Lsn, u64>)> = pv_iter.collect();
|
||||
pages.sort_by_key(|(blknum, _vec_map)| *blknum);
|
||||
for (blknum, vec_map) in pages {
|
||||
for (lsn, pos) in vec_map.as_slice() {
|
||||
if *lsn < delta_end_lsn {
|
||||
let len = inner.read_pv_bytes(*pos, &mut buf)?;
|
||||
delta_layer_writer.put_page_version(*blknum, *lsn, &buf[..len])?;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Create seg_sizes
|
||||
let seg_sizes = if delta_end_lsn == end_lsn_exclusive {
|
||||
inner.seg_sizes.clone()
|
||||
} else {
|
||||
inner.seg_sizes.split_at(&end_lsn_exclusive).0
|
||||
};
|
||||
|
||||
let delta_layer = delta_layer_writer.finish(seg_sizes)?;
|
||||
delta_layers.push(delta_layer);
|
||||
}
|
||||
|
||||
drop(inner);
|
||||
|
||||
// Write a new base image layer at the cutoff point
|
||||
if let Some(image_lsn) = image_lsn {
|
||||
let size = if self.seg.rel.is_blocky() {
|
||||
self.get_seg_size(image_lsn)?
|
||||
} else {
|
||||
1
|
||||
};
|
||||
let mut image_layer_writer = ImageLayerWriter::new(
|
||||
self.conf,
|
||||
self.timelineid,
|
||||
self.tenantid,
|
||||
self.seg,
|
||||
image_lsn,
|
||||
size,
|
||||
)?;
|
||||
|
||||
for blknum in 0..size {
|
||||
let img = timeline.materialize_page(self.seg, blknum, image_lsn, &*self)?;
|
||||
|
||||
image_layer_writer.put_page_image(&img)?;
|
||||
}
|
||||
let image_layer = image_layer_writer.finish()?;
|
||||
image_layers.push(image_layer);
|
||||
}
|
||||
|
||||
Ok(LayersOnDisk {
|
||||
delta_layers,
|
||||
image_layers,
|
||||
})
|
||||
}
|
||||
}
|
||||
468
pageserver/src/layered_repository/interval_tree.rs
Normal file
468
pageserver/src/layered_repository/interval_tree.rs
Normal file
@@ -0,0 +1,468 @@
|
||||
///
|
||||
/// IntervalTree is data structure for holding intervals. It is generic
|
||||
/// to make unit testing possible, but the only real user of it is the layer map,
|
||||
///
|
||||
/// It's inspired by the "segment tree" or a "statistic tree" as described in
|
||||
/// https://en.wikipedia.org/wiki/Segment_tree. However, we use a B-tree to hold
|
||||
/// the points instead of a binary tree. This is called an "interval tree" instead
|
||||
/// of "segment tree" because the term "segment" is already using Zenith to mean
|
||||
/// something else. To add to the confusion, there is another data structure known
|
||||
/// as "interval tree" out there (see https://en.wikipedia.org/wiki/Interval_tree),
|
||||
/// for storing intervals, but this isn't that.
|
||||
///
|
||||
/// The basic idea is to have a B-tree of "interesting Points". At each Point,
|
||||
/// there is a list of intervals that contain the point. The Points are formed
|
||||
/// from the start bounds of each interval; there is a Point for each distinct
|
||||
/// start bound.
|
||||
///
|
||||
/// Operations:
|
||||
///
|
||||
/// To find intervals that contain a given point, you search the b-tree to find
|
||||
/// the nearest Point <= search key. Then you just return the list of intervals.
|
||||
///
|
||||
/// To insert an interval, find the Point with start key equal to the inserted item.
|
||||
/// If the Point doesn't exist yet, create it, by copying all the items from the
|
||||
/// previous Point that cover the new Point. Then walk right, inserting the new
|
||||
/// interval to all the Points that are contained by the new interval (including the
|
||||
/// newly created Point).
|
||||
///
|
||||
/// To remove an interval, you scan the tree for all the Points that are contained by
|
||||
/// the removed interval, and remove it from the list in each Point.
|
||||
///
|
||||
/// Requirements and assumptions:
|
||||
///
|
||||
/// - Can store overlapping items
|
||||
/// - But there are not many overlapping items
|
||||
/// - The interval bounds don't change after it is added to the tree
|
||||
/// - Intervals are uniquely identified by pointer equality. You must not be insert the
|
||||
/// same interval object twice, and `remove` uses pointer equality to remove the right
|
||||
/// interval. It is OK to have two intervals with the same bounds, however.
|
||||
///
|
||||
use std::collections::BTreeMap;
|
||||
use std::fmt::Debug;
|
||||
use std::ops::Range;
|
||||
use std::sync::Arc;
|
||||
|
||||
pub struct IntervalTree<I: ?Sized>
|
||||
where
|
||||
I: IntervalItem,
|
||||
{
|
||||
points: BTreeMap<I::Key, Point<I>>,
|
||||
}
|
||||
|
||||
struct Point<I: ?Sized> {
|
||||
/// All intervals that contain this point, in no particular order.
|
||||
///
|
||||
/// We assume that there aren't a lot of overlappingg intervals, so that this vector
|
||||
/// never grows very large. If that assumption doesn't hold, we could keep this ordered
|
||||
/// by the end bound, to speed up `search`. But as long as there are only a few elements,
|
||||
/// a linear search is OK.
|
||||
elements: Vec<Arc<I>>,
|
||||
}
|
||||
|
||||
/// Abstraction for an interval that can be stored in the tree
|
||||
///
|
||||
/// The start bound is inclusive and the end bound is exclusive. End must be greater
|
||||
/// than start.
|
||||
pub trait IntervalItem {
|
||||
type Key: Ord + Copy + Debug + Sized;
|
||||
|
||||
fn start_key(&self) -> Self::Key;
|
||||
fn end_key(&self) -> Self::Key;
|
||||
|
||||
fn bounds(&self) -> Range<Self::Key> {
|
||||
self.start_key()..self.end_key()
|
||||
}
|
||||
}
|
||||
|
||||
impl<I: ?Sized> IntervalTree<I>
|
||||
where
|
||||
I: IntervalItem,
|
||||
{
|
||||
/// Return an element that contains 'key', or precedes it.
|
||||
///
|
||||
/// If there are multiple candidates, returns the one with the highest 'end' key.
|
||||
pub fn search(&self, key: I::Key) -> Option<Arc<I>> {
|
||||
// Find the greatest point that precedes or is equal to the search key. If there is
|
||||
// none, returns None.
|
||||
let (_, p) = self.points.range(..=key).next_back()?;
|
||||
|
||||
// Find the element with the highest end key at this point
|
||||
let highest_item = p
|
||||
.elements
|
||||
.iter()
|
||||
.reduce(|a, b| {
|
||||
// starting with Rust 1.53, could use `std::cmp::min_by_key` here
|
||||
if a.end_key() > b.end_key() {
|
||||
a
|
||||
} else {
|
||||
b
|
||||
}
|
||||
})
|
||||
.unwrap();
|
||||
Some(Arc::clone(highest_item))
|
||||
}
|
||||
|
||||
/// Iterate over all items with start bound >= 'key'
|
||||
pub fn iter_newer(&self, key: I::Key) -> IntervalIter<I> {
|
||||
IntervalIter {
|
||||
point_iter: self.points.range(key..),
|
||||
elem_iter: None,
|
||||
}
|
||||
}
|
||||
|
||||
/// Iterate over all items
|
||||
pub fn iter(&self) -> IntervalIter<I> {
|
||||
IntervalIter {
|
||||
point_iter: self.points.range(..),
|
||||
elem_iter: None,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn insert(&mut self, item: Arc<I>) {
|
||||
let start_key = item.start_key();
|
||||
let end_key = item.end_key();
|
||||
assert!(start_key < end_key);
|
||||
let bounds = start_key..end_key;
|
||||
|
||||
// Find the starting point and walk forward from there
|
||||
let mut found_start_point = false;
|
||||
let iter = self.points.range_mut(bounds);
|
||||
for (point_key, point) in iter {
|
||||
if *point_key == start_key {
|
||||
found_start_point = true;
|
||||
// It is an error to insert the same item to the tree twice.
|
||||
assert!(
|
||||
!point.elements.iter().any(|x| Arc::ptr_eq(x, &item)),
|
||||
"interval is already in the tree"
|
||||
);
|
||||
}
|
||||
point.elements.push(Arc::clone(&item));
|
||||
}
|
||||
if !found_start_point {
|
||||
// Create a new Point for the starting point
|
||||
|
||||
// Look at the previous point, and copy over elements that overlap with this
|
||||
// new point
|
||||
let mut new_elements: Vec<Arc<I>> = Vec::new();
|
||||
if let Some((_, prev_point)) = self.points.range(..start_key).next_back() {
|
||||
let overlapping_prev_elements = prev_point
|
||||
.elements
|
||||
.iter()
|
||||
.filter(|x| x.bounds().contains(&start_key))
|
||||
.cloned();
|
||||
|
||||
new_elements.extend(overlapping_prev_elements);
|
||||
}
|
||||
new_elements.push(item);
|
||||
|
||||
let new_point = Point {
|
||||
elements: new_elements,
|
||||
};
|
||||
self.points.insert(start_key, new_point);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn remove(&mut self, item: &Arc<I>) {
|
||||
// range search points
|
||||
let start_key = item.start_key();
|
||||
let end_key = item.end_key();
|
||||
let bounds = start_key..end_key;
|
||||
|
||||
let mut points_to_remove: Vec<I::Key> = Vec::new();
|
||||
let mut found_start_point = false;
|
||||
for (point_key, point) in self.points.range_mut(bounds) {
|
||||
if *point_key == start_key {
|
||||
found_start_point = true;
|
||||
}
|
||||
let len_before = point.elements.len();
|
||||
point.elements.retain(|other| !Arc::ptr_eq(other, item));
|
||||
let len_after = point.elements.len();
|
||||
assert_eq!(len_after + 1, len_before);
|
||||
if len_after == 0 {
|
||||
points_to_remove.push(*point_key);
|
||||
}
|
||||
}
|
||||
assert!(found_start_point);
|
||||
|
||||
for k in points_to_remove {
|
||||
self.points.remove(&k).unwrap();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub struct IntervalIter<'a, I: ?Sized>
|
||||
where
|
||||
I: IntervalItem,
|
||||
{
|
||||
point_iter: std::collections::btree_map::Range<'a, I::Key, Point<I>>,
|
||||
elem_iter: Option<(I::Key, std::slice::Iter<'a, Arc<I>>)>,
|
||||
}
|
||||
|
||||
impl<'a, I> Iterator for IntervalIter<'a, I>
|
||||
where
|
||||
I: IntervalItem + ?Sized,
|
||||
{
|
||||
type Item = Arc<I>;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
// Iterate over all elements in all the points in 'point_iter'. To avoid
|
||||
// returning the same element twice, we only return each element at its
|
||||
// starting point.
|
||||
loop {
|
||||
// Return next remaining element from the current point
|
||||
if let Some((point_key, elem_iter)) = &mut self.elem_iter {
|
||||
for elem in elem_iter {
|
||||
if elem.start_key() == *point_key {
|
||||
return Some(Arc::clone(elem));
|
||||
}
|
||||
}
|
||||
}
|
||||
// No more elements at this point. Move to next point.
|
||||
if let Some((point_key, point)) = self.point_iter.next() {
|
||||
self.elem_iter = Some((*point_key, point.elements.iter()));
|
||||
continue;
|
||||
} else {
|
||||
// No more points, all done
|
||||
return None;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<I: ?Sized> Default for IntervalTree<I>
|
||||
where
|
||||
I: IntervalItem,
|
||||
{
|
||||
fn default() -> Self {
|
||||
IntervalTree {
|
||||
points: BTreeMap::new(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use std::fmt;
|
||||
|
||||
#[derive(Debug)]
|
||||
struct MockItem {
|
||||
start_key: u32,
|
||||
end_key: u32,
|
||||
val: String,
|
||||
}
|
||||
impl IntervalItem for MockItem {
|
||||
type Key = u32;
|
||||
|
||||
fn start_key(&self) -> u32 {
|
||||
self.start_key
|
||||
}
|
||||
fn end_key(&self) -> u32 {
|
||||
self.end_key
|
||||
}
|
||||
}
|
||||
impl MockItem {
|
||||
fn new(start_key: u32, end_key: u32) -> Self {
|
||||
MockItem {
|
||||
start_key,
|
||||
end_key,
|
||||
val: format!("{}-{}", start_key, end_key),
|
||||
}
|
||||
}
|
||||
fn new_str(start_key: u32, end_key: u32, val: &str) -> Self {
|
||||
MockItem {
|
||||
start_key,
|
||||
end_key,
|
||||
val: format!("{}-{}: {}", start_key, end_key, val),
|
||||
}
|
||||
}
|
||||
}
|
||||
impl fmt::Display for MockItem {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
write!(f, "{}", self.val)
|
||||
}
|
||||
}
|
||||
#[rustfmt::skip]
|
||||
fn assert_search(
|
||||
tree: &IntervalTree<MockItem>,
|
||||
key: u32,
|
||||
expected: &[&str],
|
||||
) -> Option<Arc<MockItem>> {
|
||||
if let Some(v) = tree.search(key) {
|
||||
let vstr = v.to_string();
|
||||
|
||||
assert!(!expected.is_empty(), "search with {} returned {}, expected None", key, v);
|
||||
assert!(
|
||||
expected.contains(&vstr.as_str()),
|
||||
"search with {} returned {}, expected one of: {:?}",
|
||||
key, v, expected,
|
||||
);
|
||||
|
||||
Some(v)
|
||||
} else {
|
||||
assert!(
|
||||
expected.is_empty(),
|
||||
"search with {} returned None, expected one of {:?}",
|
||||
key, expected
|
||||
);
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
fn assert_contents(tree: &IntervalTree<MockItem>, expected: &[&str]) {
|
||||
let mut contents: Vec<String> = tree.iter().map(|e| e.to_string()).collect();
|
||||
contents.sort();
|
||||
assert_eq!(contents, expected);
|
||||
}
|
||||
|
||||
fn dump_tree(tree: &IntervalTree<MockItem>) {
|
||||
for (point_key, point) in tree.points.iter() {
|
||||
print!("{}:", point_key);
|
||||
for e in point.elements.iter() {
|
||||
print!(" {}", e);
|
||||
}
|
||||
println!();
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_interval_tree_simple() {
|
||||
let mut tree: IntervalTree<MockItem> = IntervalTree::default();
|
||||
|
||||
// Simple, non-overlapping ranges.
|
||||
tree.insert(Arc::new(MockItem::new(10, 11)));
|
||||
tree.insert(Arc::new(MockItem::new(11, 12)));
|
||||
tree.insert(Arc::new(MockItem::new(12, 13)));
|
||||
tree.insert(Arc::new(MockItem::new(18, 19)));
|
||||
tree.insert(Arc::new(MockItem::new(17, 18)));
|
||||
tree.insert(Arc::new(MockItem::new(15, 16)));
|
||||
|
||||
assert_search(&tree, 9, &[]);
|
||||
assert_search(&tree, 10, &["10-11"]);
|
||||
assert_search(&tree, 11, &["11-12"]);
|
||||
assert_search(&tree, 12, &["12-13"]);
|
||||
assert_search(&tree, 13, &["12-13"]);
|
||||
assert_search(&tree, 14, &["12-13"]);
|
||||
assert_search(&tree, 15, &["15-16"]);
|
||||
assert_search(&tree, 16, &["15-16"]);
|
||||
assert_search(&tree, 17, &["17-18"]);
|
||||
assert_search(&tree, 18, &["18-19"]);
|
||||
assert_search(&tree, 19, &["18-19"]);
|
||||
assert_search(&tree, 20, &["18-19"]);
|
||||
|
||||
// remove a few entries and search around them again
|
||||
tree.remove(&assert_search(&tree, 10, &["10-11"]).unwrap()); // first entry
|
||||
tree.remove(&assert_search(&tree, 12, &["12-13"]).unwrap()); // entry in the middle
|
||||
tree.remove(&assert_search(&tree, 18, &["18-19"]).unwrap()); // last entry
|
||||
assert_search(&tree, 9, &[]);
|
||||
assert_search(&tree, 10, &[]);
|
||||
assert_search(&tree, 11, &["11-12"]);
|
||||
assert_search(&tree, 12, &["11-12"]);
|
||||
assert_search(&tree, 14, &["11-12"]);
|
||||
assert_search(&tree, 15, &["15-16"]);
|
||||
assert_search(&tree, 17, &["17-18"]);
|
||||
assert_search(&tree, 18, &["17-18"]);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_interval_tree_overlap() {
|
||||
let mut tree: IntervalTree<MockItem> = IntervalTree::default();
|
||||
|
||||
// Overlapping items
|
||||
tree.insert(Arc::new(MockItem::new(22, 24)));
|
||||
tree.insert(Arc::new(MockItem::new(23, 25)));
|
||||
let x24_26 = Arc::new(MockItem::new(24, 26));
|
||||
tree.insert(Arc::clone(&x24_26));
|
||||
let x26_28 = Arc::new(MockItem::new(26, 28));
|
||||
tree.insert(Arc::clone(&x26_28));
|
||||
tree.insert(Arc::new(MockItem::new(25, 27)));
|
||||
|
||||
assert_search(&tree, 22, &["22-24"]);
|
||||
assert_search(&tree, 23, &["22-24", "23-25"]);
|
||||
assert_search(&tree, 24, &["23-25", "24-26"]);
|
||||
assert_search(&tree, 25, &["24-26", "25-27"]);
|
||||
assert_search(&tree, 26, &["25-27", "26-28"]);
|
||||
assert_search(&tree, 27, &["26-28"]);
|
||||
assert_search(&tree, 28, &["26-28"]);
|
||||
assert_search(&tree, 29, &["26-28"]);
|
||||
|
||||
tree.remove(&x24_26);
|
||||
tree.remove(&x26_28);
|
||||
assert_search(&tree, 23, &["22-24", "23-25"]);
|
||||
assert_search(&tree, 24, &["23-25"]);
|
||||
assert_search(&tree, 25, &["25-27"]);
|
||||
assert_search(&tree, 26, &["25-27"]);
|
||||
assert_search(&tree, 27, &["25-27"]);
|
||||
assert_search(&tree, 28, &["25-27"]);
|
||||
assert_search(&tree, 29, &["25-27"]);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_interval_tree_nested() {
|
||||
let mut tree: IntervalTree<MockItem> = IntervalTree::default();
|
||||
|
||||
// Items containing other items
|
||||
tree.insert(Arc::new(MockItem::new(31, 39)));
|
||||
tree.insert(Arc::new(MockItem::new(32, 34)));
|
||||
tree.insert(Arc::new(MockItem::new(33, 35)));
|
||||
tree.insert(Arc::new(MockItem::new(30, 40)));
|
||||
|
||||
assert_search(&tree, 30, &["30-40"]);
|
||||
assert_search(&tree, 31, &["30-40", "31-39"]);
|
||||
assert_search(&tree, 32, &["30-40", "32-34", "31-39"]);
|
||||
assert_search(&tree, 33, &["30-40", "32-34", "33-35", "31-39"]);
|
||||
assert_search(&tree, 34, &["30-40", "33-35", "31-39"]);
|
||||
assert_search(&tree, 35, &["30-40", "31-39"]);
|
||||
assert_search(&tree, 36, &["30-40", "31-39"]);
|
||||
assert_search(&tree, 37, &["30-40", "31-39"]);
|
||||
assert_search(&tree, 38, &["30-40", "31-39"]);
|
||||
assert_search(&tree, 39, &["30-40"]);
|
||||
assert_search(&tree, 40, &["30-40"]);
|
||||
assert_search(&tree, 41, &["30-40"]);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_interval_tree_duplicates() {
|
||||
let mut tree: IntervalTree<MockItem> = IntervalTree::default();
|
||||
|
||||
// Duplicate keys
|
||||
let item_a = Arc::new(MockItem::new_str(55, 56, "a"));
|
||||
tree.insert(Arc::clone(&item_a));
|
||||
let item_b = Arc::new(MockItem::new_str(55, 56, "b"));
|
||||
tree.insert(Arc::clone(&item_b));
|
||||
let item_c = Arc::new(MockItem::new_str(55, 56, "c"));
|
||||
tree.insert(Arc::clone(&item_c));
|
||||
let item_d = Arc::new(MockItem::new_str(54, 56, "d"));
|
||||
tree.insert(Arc::clone(&item_d));
|
||||
let item_e = Arc::new(MockItem::new_str(55, 57, "e"));
|
||||
tree.insert(Arc::clone(&item_e));
|
||||
|
||||
dump_tree(&tree);
|
||||
|
||||
assert_search(
|
||||
&tree,
|
||||
55,
|
||||
&["55-56: a", "55-56: b", "55-56: c", "54-56: d", "55-57: e"],
|
||||
);
|
||||
tree.remove(&item_b);
|
||||
dump_tree(&tree);
|
||||
|
||||
assert_contents(&tree, &["54-56: d", "55-56: a", "55-56: c", "55-57: e"]);
|
||||
|
||||
tree.remove(&item_d);
|
||||
dump_tree(&tree);
|
||||
assert_contents(&tree, &["55-56: a", "55-56: c", "55-57: e"]);
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic]
|
||||
fn test_interval_tree_insert_twice() {
|
||||
let mut tree: IntervalTree<MockItem> = IntervalTree::default();
|
||||
|
||||
// Inserting the same item twice is not cool
|
||||
let item = Arc::new(MockItem::new(1, 2));
|
||||
tree.insert(Arc::clone(&item));
|
||||
tree.insert(Arc::clone(&item)); // fails assertion
|
||||
}
|
||||
}
|
||||
494
pageserver/src/layered_repository/layer_map.rs
Normal file
494
pageserver/src/layered_repository/layer_map.rs
Normal file
@@ -0,0 +1,494 @@
|
||||
//!
|
||||
//! The layer map tracks what layers exist for all the relishes in a timeline.
|
||||
//!
|
||||
//! When the timeline is first accessed, the server lists of all layer files
|
||||
//! in the timelines/<timelineid> directory, and populates this map with
|
||||
//! ImageLayer and DeltaLayer structs corresponding to each file. When new WAL
|
||||
//! is received, we create InMemoryLayers to hold the incoming records. Now and
|
||||
//! then, in the checkpoint() function, the in-memory layers are frozen, forming
|
||||
//! new image and delta layers and corresponding files are written to disk.
|
||||
//!
|
||||
|
||||
use crate::layered_repository::interval_tree::{IntervalItem, IntervalIter, IntervalTree};
|
||||
use crate::layered_repository::storage_layer::{Layer, SegmentTag};
|
||||
use crate::layered_repository::InMemoryLayer;
|
||||
use crate::relish::*;
|
||||
use anyhow::Result;
|
||||
use lazy_static::lazy_static;
|
||||
use std::cmp::Ordering;
|
||||
use std::collections::{BinaryHeap, HashMap};
|
||||
use std::sync::Arc;
|
||||
use zenith_metrics::{register_int_gauge, IntGauge};
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
use super::global_layer_map::{LayerId, GLOBAL_LAYER_MAP};
|
||||
|
||||
lazy_static! {
|
||||
static ref NUM_INMEMORY_LAYERS: IntGauge =
|
||||
register_int_gauge!("pageserver_inmemory_layers", "Number of layers in memory")
|
||||
.expect("failed to define a metric");
|
||||
static ref NUM_ONDISK_LAYERS: IntGauge =
|
||||
register_int_gauge!("pageserver_ondisk_layers", "Number of layers on-disk")
|
||||
.expect("failed to define a metric");
|
||||
}
|
||||
|
||||
///
|
||||
/// LayerMap tracks what layers exist on a timeline.
|
||||
///
|
||||
#[derive(Default)]
|
||||
pub struct LayerMap {
|
||||
/// All the layers keyed by segment tag
|
||||
segs: HashMap<SegmentTag, SegEntry>,
|
||||
|
||||
/// All in-memory layers, ordered by 'oldest_lsn' and generation
|
||||
/// of each layer. This allows easy access to the in-memory layer that
|
||||
/// contains the oldest WAL record.
|
||||
open_layers: BinaryHeap<OpenLayerEntry>,
|
||||
|
||||
/// Generation number, used to distinguish newly inserted entries in the
|
||||
/// binary heap from older entries during checkpoint.
|
||||
current_generation: u64,
|
||||
}
|
||||
|
||||
impl LayerMap {
|
||||
///
|
||||
/// Look up a layer using the given segment tag and LSN. This differs from a
|
||||
/// plain key-value lookup in that if there is any layer that covers the
|
||||
/// given LSN, or precedes the given LSN, it is returned. In other words,
|
||||
/// you don't need to know the exact start LSN of the layer.
|
||||
///
|
||||
pub fn get(&self, tag: &SegmentTag, lsn: Lsn) -> Option<Arc<dyn Layer>> {
|
||||
let segentry = self.segs.get(tag)?;
|
||||
|
||||
segentry.get(lsn)
|
||||
}
|
||||
|
||||
///
|
||||
/// Get the open layer for given segment for writing. Or None if no open
|
||||
/// layer exists.
|
||||
///
|
||||
pub fn get_open(&self, tag: &SegmentTag) -> Option<Arc<InMemoryLayer>> {
|
||||
let segentry = self.segs.get(tag)?;
|
||||
|
||||
segentry
|
||||
.open_layer_id
|
||||
.and_then(|layer_id| GLOBAL_LAYER_MAP.read().unwrap().get(&layer_id))
|
||||
}
|
||||
|
||||
///
|
||||
/// Insert an open in-memory layer
|
||||
///
|
||||
pub fn insert_open(&mut self, layer: Arc<InMemoryLayer>) {
|
||||
let segentry = self.segs.entry(layer.get_seg_tag()).or_default();
|
||||
|
||||
let layer_id = segentry.update_open(Arc::clone(&layer));
|
||||
|
||||
let oldest_lsn = layer.get_oldest_lsn();
|
||||
|
||||
// After a crash and restart, 'oldest_lsn' of the oldest in-memory
|
||||
// layer becomes the WAL streaming starting point, so it better not point
|
||||
// in the middle of a WAL record.
|
||||
assert!(oldest_lsn.is_aligned());
|
||||
|
||||
// Also add it to the binary heap
|
||||
let open_layer_entry = OpenLayerEntry {
|
||||
oldest_lsn: layer.get_oldest_lsn(),
|
||||
layer_id,
|
||||
generation: self.current_generation,
|
||||
};
|
||||
self.open_layers.push(open_layer_entry);
|
||||
|
||||
NUM_INMEMORY_LAYERS.inc();
|
||||
}
|
||||
|
||||
/// Remove an open in-memory layer
|
||||
pub fn remove_open(&mut self, layer_id: LayerId) {
|
||||
// Note: we don't try to remove the entry from the binary heap.
|
||||
// It will be removed lazily by peek_oldest_open() when it's made it to
|
||||
// the top of the heap.
|
||||
|
||||
let layer_opt = {
|
||||
let mut global_map = GLOBAL_LAYER_MAP.write().unwrap();
|
||||
let layer_opt = global_map.get(&layer_id);
|
||||
global_map.remove(&layer_id);
|
||||
// TODO it's bad that a ref can still exist after being evicted from cache
|
||||
layer_opt
|
||||
};
|
||||
|
||||
if let Some(layer) = layer_opt {
|
||||
let mut segentry = self.segs.get_mut(&layer.get_seg_tag()).unwrap();
|
||||
|
||||
if segentry.open_layer_id == Some(layer_id) {
|
||||
// Also remove it from the SegEntry of this segment
|
||||
segentry.open_layer_id = None;
|
||||
} else {
|
||||
// We could have already updated segentry.open for
|
||||
// dropped (non-writeable) layer. This is fine.
|
||||
assert!(!layer.is_writeable());
|
||||
assert!(layer.is_dropped());
|
||||
}
|
||||
|
||||
NUM_INMEMORY_LAYERS.dec();
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Insert an on-disk layer
|
||||
///
|
||||
pub fn insert_historic(&mut self, layer: Arc<dyn Layer>) {
|
||||
let segentry = self.segs.entry(layer.get_seg_tag()).or_default();
|
||||
segentry.insert_historic(layer);
|
||||
|
||||
NUM_ONDISK_LAYERS.inc();
|
||||
}
|
||||
|
||||
///
|
||||
/// Remove an on-disk layer from the map.
|
||||
///
|
||||
/// This should be called when the corresponding file on disk has been deleted.
|
||||
///
|
||||
pub fn remove_historic(&mut self, layer: Arc<dyn Layer>) {
|
||||
let tag = layer.get_seg_tag();
|
||||
|
||||
if let Some(segentry) = self.segs.get_mut(&tag) {
|
||||
segentry.historic.remove(&layer);
|
||||
}
|
||||
NUM_ONDISK_LAYERS.dec();
|
||||
}
|
||||
|
||||
// List relations along with a flag that marks if they exist at the given lsn.
|
||||
// spcnode 0 and dbnode 0 have special meanings and mean all tabespaces/databases.
|
||||
// Pass Tag if we're only interested in some relations.
|
||||
pub fn list_relishes(&self, tag: Option<RelTag>, lsn: Lsn) -> Result<HashMap<RelishTag, bool>> {
|
||||
let mut rels: HashMap<RelishTag, bool> = HashMap::new();
|
||||
|
||||
for (seg, segentry) in self.segs.iter() {
|
||||
match seg.rel {
|
||||
RelishTag::Relation(reltag) => {
|
||||
if let Some(request_rel) = tag {
|
||||
if (request_rel.spcnode == 0 || reltag.spcnode == request_rel.spcnode)
|
||||
&& (request_rel.dbnode == 0 || reltag.dbnode == request_rel.dbnode)
|
||||
{
|
||||
if let Some(exists) = segentry.exists_at_lsn(lsn)? {
|
||||
rels.insert(seg.rel, exists);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
_ => {
|
||||
if tag == None {
|
||||
if let Some(exists) = segentry.exists_at_lsn(lsn)? {
|
||||
rels.insert(seg.rel, exists);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
Ok(rels)
|
||||
}
|
||||
|
||||
/// Is there a newer image layer for given segment?
|
||||
///
|
||||
/// This is used for garbage collection, to determine if an old layer can
|
||||
/// be deleted.
|
||||
/// We ignore segments newer than disk_consistent_lsn because they will be removed at restart
|
||||
pub fn newer_image_layer_exists(
|
||||
&self,
|
||||
seg: SegmentTag,
|
||||
lsn: Lsn,
|
||||
disk_consistent_lsn: Lsn,
|
||||
) -> bool {
|
||||
if let Some(segentry) = self.segs.get(&seg) {
|
||||
segentry.newer_image_layer_exists(lsn, disk_consistent_lsn)
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
/// Is there any layer for given segment that is alive at the lsn?
|
||||
///
|
||||
/// This is a public wrapper for SegEntry fucntion,
|
||||
/// used for garbage collection, to determine if some alive layer
|
||||
/// exists at the lsn. If so, we shouldn't delete a newer dropped layer
|
||||
/// to avoid incorrectly making it visible.
|
||||
pub fn layer_exists_at_lsn(&self, seg: SegmentTag, lsn: Lsn) -> Result<bool> {
|
||||
Ok(if let Some(segentry) = self.segs.get(&seg) {
|
||||
segentry.exists_at_lsn(lsn)?.unwrap_or(false)
|
||||
} else {
|
||||
false
|
||||
})
|
||||
}
|
||||
|
||||
/// Return the oldest in-memory layer, along with its generation number.
|
||||
pub fn peek_oldest_open(&mut self) -> Option<(LayerId, Arc<InMemoryLayer>, u64)> {
|
||||
let global_map = GLOBAL_LAYER_MAP.read().unwrap();
|
||||
|
||||
while let Some(oldest_entry) = self.open_layers.peek() {
|
||||
if let Some(layer) = global_map.get(&oldest_entry.layer_id) {
|
||||
return Some((oldest_entry.layer_id, layer, oldest_entry.generation));
|
||||
} else {
|
||||
self.open_layers.pop();
|
||||
}
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
/// Increment the generation number used to stamp open in-memory layers. Layers
|
||||
/// added with `insert_open` after this call will be associated with the new
|
||||
/// generation. Returns the new generation number.
|
||||
pub fn increment_generation(&mut self) -> u64 {
|
||||
self.current_generation += 1;
|
||||
self.current_generation
|
||||
}
|
||||
|
||||
pub fn iter_historic_layers(&self) -> HistoricLayerIter {
|
||||
HistoricLayerIter {
|
||||
seg_iter: self.segs.iter(),
|
||||
iter: None,
|
||||
}
|
||||
}
|
||||
|
||||
/// debugging function to print out the contents of the layer map
|
||||
#[allow(unused)]
|
||||
pub fn dump(&self) -> Result<()> {
|
||||
println!("Begin dump LayerMap");
|
||||
for (seg, segentry) in self.segs.iter() {
|
||||
if let Some(open) = &segentry.open_layer_id {
|
||||
if let Some(layer) = GLOBAL_LAYER_MAP.read().unwrap().get(open) {
|
||||
layer.dump()?;
|
||||
} else {
|
||||
println!("layer not found in global map");
|
||||
}
|
||||
}
|
||||
|
||||
for layer in segentry.historic.iter() {
|
||||
layer.dump()?;
|
||||
}
|
||||
}
|
||||
println!("End dump LayerMap");
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl IntervalItem for dyn Layer {
|
||||
type Key = Lsn;
|
||||
|
||||
fn start_key(&self) -> Lsn {
|
||||
self.get_start_lsn()
|
||||
}
|
||||
fn end_key(&self) -> Lsn {
|
||||
self.get_end_lsn()
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Per-segment entry in the LayerMap::segs hash map. Holds all the layers
|
||||
/// associated with the segment.
|
||||
///
|
||||
/// The last layer that is open for writes is always an InMemoryLayer,
|
||||
/// and is kept in a separate field, because there can be only one for
|
||||
/// each segment. The older layers, stored on disk, are kept in an
|
||||
/// IntervalTree.
|
||||
#[derive(Default)]
|
||||
struct SegEntry {
|
||||
open_layer_id: Option<LayerId>,
|
||||
historic: IntervalTree<dyn Layer>,
|
||||
}
|
||||
|
||||
impl SegEntry {
|
||||
/// Does the segment exist at given LSN?
|
||||
/// Return None if object is not found in this SegEntry.
|
||||
fn exists_at_lsn(&self, lsn: Lsn) -> Result<Option<bool>> {
|
||||
if let Some(layer) = self.get(lsn) {
|
||||
Ok(Some(layer.get_seg_exists(lsn)?))
|
||||
} else {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get(&self, lsn: Lsn) -> Option<Arc<dyn Layer>> {
|
||||
if let Some(open_layer_id) = &self.open_layer_id {
|
||||
let open_layer = GLOBAL_LAYER_MAP.read().unwrap().get(open_layer_id)?;
|
||||
if open_layer.get_start_lsn() <= lsn {
|
||||
return Some(open_layer);
|
||||
}
|
||||
}
|
||||
|
||||
self.historic.search(lsn)
|
||||
}
|
||||
|
||||
pub fn newer_image_layer_exists(&self, lsn: Lsn, disk_consistent_lsn: Lsn) -> bool {
|
||||
// We only check on-disk layers, because
|
||||
// in-memory layers are not durable
|
||||
|
||||
// The end-LSN is exclusive, while disk_consistent_lsn is
|
||||
// inclusive. For example, if disk_consistent_lsn is 100, it is
|
||||
// OK for a delta layer to have end LSN 101, but if the end LSN
|
||||
// is 102, then it might not have been fully flushed to disk
|
||||
// before crash.
|
||||
self.historic
|
||||
.iter_newer(lsn)
|
||||
.any(|layer| !layer.is_incremental() && layer.get_end_lsn() <= disk_consistent_lsn + 1)
|
||||
}
|
||||
|
||||
// Set new open layer for a SegEntry.
|
||||
// It's ok to rewrite previous open layer,
|
||||
// but only if it is not writeable anymore.
|
||||
pub fn update_open(&mut self, layer: Arc<InMemoryLayer>) -> LayerId {
|
||||
if let Some(prev_open_layer_id) = &self.open_layer_id {
|
||||
if let Some(prev_open_layer) = GLOBAL_LAYER_MAP.read().unwrap().get(prev_open_layer_id)
|
||||
{
|
||||
assert!(!prev_open_layer.is_writeable());
|
||||
}
|
||||
}
|
||||
let open_layer_id = GLOBAL_LAYER_MAP.write().unwrap().insert(layer);
|
||||
self.open_layer_id = Some(open_layer_id);
|
||||
open_layer_id
|
||||
}
|
||||
|
||||
pub fn insert_historic(&mut self, layer: Arc<dyn Layer>) {
|
||||
self.historic.insert(layer);
|
||||
}
|
||||
}
|
||||
|
||||
/// Entry held in LayerMap::open_layers, with boilerplate comparison routines
|
||||
/// to implement a min-heap ordered by 'oldest_lsn' and 'generation'
|
||||
///
|
||||
/// The generation number associated with each entry can be used to distinguish
|
||||
/// recently-added entries (i.e after last call to increment_generation()) from older
|
||||
/// entries with the same 'oldest_lsn'.
|
||||
struct OpenLayerEntry {
|
||||
oldest_lsn: Lsn, // copy of layer.get_oldest_lsn()
|
||||
generation: u64,
|
||||
layer_id: LayerId,
|
||||
}
|
||||
impl Ord for OpenLayerEntry {
|
||||
fn cmp(&self, other: &Self) -> Ordering {
|
||||
// BinaryHeap is a max-heap, and we want a min-heap. Reverse the ordering here
|
||||
// to get that. Entries with identical oldest_lsn are ordered by generation
|
||||
other
|
||||
.oldest_lsn
|
||||
.cmp(&self.oldest_lsn)
|
||||
.then_with(|| other.generation.cmp(&self.generation))
|
||||
}
|
||||
}
|
||||
impl PartialOrd for OpenLayerEntry {
|
||||
fn partial_cmp(&self, other: &Self) -> Option<Ordering> {
|
||||
Some(self.cmp(other))
|
||||
}
|
||||
}
|
||||
impl PartialEq for OpenLayerEntry {
|
||||
fn eq(&self, other: &Self) -> bool {
|
||||
self.cmp(other) == Ordering::Equal
|
||||
}
|
||||
}
|
||||
impl Eq for OpenLayerEntry {}
|
||||
|
||||
/// Iterator returned by LayerMap::iter_historic_layers()
|
||||
pub struct HistoricLayerIter<'a> {
|
||||
seg_iter: std::collections::hash_map::Iter<'a, SegmentTag, SegEntry>,
|
||||
iter: Option<IntervalIter<'a, dyn Layer>>,
|
||||
}
|
||||
|
||||
impl<'a> Iterator for HistoricLayerIter<'a> {
|
||||
type Item = Arc<dyn Layer>;
|
||||
|
||||
fn next(&mut self) -> std::option::Option<<Self as std::iter::Iterator>::Item> {
|
||||
loop {
|
||||
if let Some(x) = &mut self.iter {
|
||||
if let Some(x) = x.next() {
|
||||
return Some(Arc::clone(&x));
|
||||
}
|
||||
}
|
||||
if let Some((_tag, segentry)) = self.seg_iter.next() {
|
||||
self.iter = Some(segentry.historic.iter());
|
||||
continue;
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use crate::config::PageServerConf;
|
||||
use std::str::FromStr;
|
||||
use zenith_utils::zid::{ZTenantId, ZTimelineId};
|
||||
|
||||
/// Arbitrary relation tag, for testing.
|
||||
const TESTREL_A: RelishTag = RelishTag::Relation(RelTag {
|
||||
spcnode: 0,
|
||||
dbnode: 111,
|
||||
relnode: 1000,
|
||||
forknum: 0,
|
||||
});
|
||||
|
||||
lazy_static! {
|
||||
static ref DUMMY_TIMELINEID: ZTimelineId =
|
||||
ZTimelineId::from_str("00000000000000000000000000000000").unwrap();
|
||||
static ref DUMMY_TENANTID: ZTenantId =
|
||||
ZTenantId::from_str("00000000000000000000000000000000").unwrap();
|
||||
}
|
||||
|
||||
/// Construct a dummy InMemoryLayer for testing
|
||||
fn dummy_inmem_layer(
|
||||
conf: &'static PageServerConf,
|
||||
segno: u32,
|
||||
start_lsn: Lsn,
|
||||
oldest_lsn: Lsn,
|
||||
) -> Arc<InMemoryLayer> {
|
||||
Arc::new(
|
||||
InMemoryLayer::create(
|
||||
conf,
|
||||
*DUMMY_TIMELINEID,
|
||||
*DUMMY_TENANTID,
|
||||
SegmentTag {
|
||||
rel: TESTREL_A,
|
||||
segno,
|
||||
},
|
||||
start_lsn,
|
||||
oldest_lsn,
|
||||
)
|
||||
.unwrap(),
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_open_layers() -> Result<()> {
|
||||
let conf = PageServerConf::dummy_conf(PageServerConf::test_repo_dir("dummy_inmem_layer"));
|
||||
let conf = Box::leak(Box::new(conf));
|
||||
std::fs::create_dir_all(conf.timeline_path(&DUMMY_TIMELINEID, &DUMMY_TENANTID))?;
|
||||
|
||||
let mut layers = LayerMap::default();
|
||||
|
||||
let gen1 = layers.increment_generation();
|
||||
layers.insert_open(dummy_inmem_layer(conf, 0, Lsn(0x100), Lsn(0x100)));
|
||||
layers.insert_open(dummy_inmem_layer(conf, 1, Lsn(0x100), Lsn(0x200)));
|
||||
layers.insert_open(dummy_inmem_layer(conf, 2, Lsn(0x100), Lsn(0x120)));
|
||||
layers.insert_open(dummy_inmem_layer(conf, 3, Lsn(0x100), Lsn(0x110)));
|
||||
|
||||
let gen2 = layers.increment_generation();
|
||||
layers.insert_open(dummy_inmem_layer(conf, 4, Lsn(0x100), Lsn(0x110)));
|
||||
layers.insert_open(dummy_inmem_layer(conf, 5, Lsn(0x100), Lsn(0x100)));
|
||||
|
||||
// A helper function (closure) to pop the next oldest open entry from the layer map,
|
||||
// and assert that it is what we'd expect
|
||||
let mut assert_pop_layer = |expected_segno: u32, expected_generation: u64| {
|
||||
let (layer_id, l, generation) = layers.peek_oldest_open().unwrap();
|
||||
assert!(l.get_seg_tag().segno == expected_segno);
|
||||
assert!(generation == expected_generation);
|
||||
layers.remove_open(layer_id);
|
||||
};
|
||||
|
||||
assert_pop_layer(0, gen1); // 0x100
|
||||
assert_pop_layer(5, gen2); // 0x100
|
||||
assert_pop_layer(3, gen1); // 0x110
|
||||
assert_pop_layer(4, gen2); // 0x110
|
||||
assert_pop_layer(2, gen1); // 0x120
|
||||
assert_pop_layer(1, gen1); // 0x200
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
228
pageserver/src/layered_repository/metadata.rs
Normal file
228
pageserver/src/layered_repository/metadata.rs
Normal file
@@ -0,0 +1,228 @@
|
||||
//! Every image of a certain timeline from [`crate::layered_repository::LayeredRepository`]
|
||||
//! has a metadata that needs to be stored persistently.
|
||||
//!
|
||||
//! Later, the file gets is used in [`crate::remote_storage::storage_sync`] as a part of
|
||||
//! external storage import and export operations.
|
||||
//!
|
||||
//! The module contains all structs and related helper methods related to timeline metadata.
|
||||
|
||||
use std::{convert::TryInto, path::PathBuf};
|
||||
|
||||
use anyhow::ensure;
|
||||
use zenith_utils::{
|
||||
bin_ser::BeSer,
|
||||
lsn::Lsn,
|
||||
zid::{ZTenantId, ZTimelineId},
|
||||
};
|
||||
|
||||
use crate::config::PageServerConf;
|
||||
|
||||
// Taken from PG_CONTROL_MAX_SAFE_SIZE
|
||||
const METADATA_MAX_SAFE_SIZE: usize = 512;
|
||||
const METADATA_CHECKSUM_SIZE: usize = std::mem::size_of::<u32>();
|
||||
const METADATA_MAX_DATA_SIZE: usize = METADATA_MAX_SAFE_SIZE - METADATA_CHECKSUM_SIZE;
|
||||
|
||||
/// The name of the metadata file pageserver creates per timeline.
|
||||
pub const METADATA_FILE_NAME: &str = "metadata";
|
||||
|
||||
/// Metadata stored on disk for each timeline
|
||||
///
|
||||
/// The fields correspond to the values we hold in memory, in LayeredTimeline.
|
||||
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct TimelineMetadata {
|
||||
disk_consistent_lsn: Lsn,
|
||||
// This is only set if we know it. We track it in memory when the page
|
||||
// server is running, but we only track the value corresponding to
|
||||
// 'last_record_lsn', not 'disk_consistent_lsn' which can lag behind by a
|
||||
// lot. We only store it in the metadata file when we flush *all* the
|
||||
// in-memory data so that 'last_record_lsn' is the same as
|
||||
// 'disk_consistent_lsn'. That's OK, because after page server restart, as
|
||||
// soon as we reprocess at least one record, we will have a valid
|
||||
// 'prev_record_lsn' value in memory again. This is only really needed when
|
||||
// doing a clean shutdown, so that there is no more WAL beyond
|
||||
// 'disk_consistent_lsn'
|
||||
prev_record_lsn: Option<Lsn>,
|
||||
ancestor_timeline: Option<ZTimelineId>,
|
||||
ancestor_lsn: Lsn,
|
||||
latest_gc_cutoff_lsn: Lsn,
|
||||
initdb_lsn: Lsn,
|
||||
}
|
||||
|
||||
/// Points to a place in pageserver's local directory,
|
||||
/// where certain timeline's metadata file should be located.
|
||||
pub fn metadata_path(
|
||||
conf: &'static PageServerConf,
|
||||
timelineid: ZTimelineId,
|
||||
tenantid: ZTenantId,
|
||||
) -> PathBuf {
|
||||
conf.timeline_path(&timelineid, &tenantid)
|
||||
.join(METADATA_FILE_NAME)
|
||||
}
|
||||
|
||||
impl TimelineMetadata {
|
||||
pub fn new(
|
||||
disk_consistent_lsn: Lsn,
|
||||
prev_record_lsn: Option<Lsn>,
|
||||
ancestor_timeline: Option<ZTimelineId>,
|
||||
ancestor_lsn: Lsn,
|
||||
latest_gc_cutoff_lsn: Lsn,
|
||||
initdb_lsn: Lsn,
|
||||
) -> Self {
|
||||
Self {
|
||||
disk_consistent_lsn,
|
||||
prev_record_lsn,
|
||||
ancestor_timeline,
|
||||
ancestor_lsn,
|
||||
latest_gc_cutoff_lsn,
|
||||
initdb_lsn,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn from_bytes(metadata_bytes: &[u8]) -> anyhow::Result<Self> {
|
||||
ensure!(
|
||||
metadata_bytes.len() == METADATA_MAX_SAFE_SIZE,
|
||||
"metadata bytes size is wrong"
|
||||
);
|
||||
|
||||
let data = &metadata_bytes[..METADATA_MAX_DATA_SIZE];
|
||||
let calculated_checksum = crc32c::crc32c(data);
|
||||
|
||||
let checksum_bytes: &[u8; METADATA_CHECKSUM_SIZE] =
|
||||
metadata_bytes[METADATA_MAX_DATA_SIZE..].try_into()?;
|
||||
let expected_checksum = u32::from_le_bytes(*checksum_bytes);
|
||||
ensure!(
|
||||
calculated_checksum == expected_checksum,
|
||||
"metadata checksum mismatch"
|
||||
);
|
||||
|
||||
let data = TimelineMetadata::from(serialize::DeTimelineMetadata::des_prefix(data)?);
|
||||
assert!(data.disk_consistent_lsn.is_aligned());
|
||||
|
||||
Ok(data)
|
||||
}
|
||||
|
||||
pub fn to_bytes(&self) -> anyhow::Result<Vec<u8>> {
|
||||
let serializeable_metadata = serialize::SeTimelineMetadata::from(self);
|
||||
let mut metadata_bytes = serialize::SeTimelineMetadata::ser(&serializeable_metadata)?;
|
||||
assert!(metadata_bytes.len() <= METADATA_MAX_DATA_SIZE);
|
||||
metadata_bytes.resize(METADATA_MAX_SAFE_SIZE, 0u8);
|
||||
|
||||
let checksum = crc32c::crc32c(&metadata_bytes[..METADATA_MAX_DATA_SIZE]);
|
||||
metadata_bytes[METADATA_MAX_DATA_SIZE..].copy_from_slice(&u32::to_le_bytes(checksum));
|
||||
Ok(metadata_bytes)
|
||||
}
|
||||
|
||||
/// [`Lsn`] that corresponds to the corresponding timeline directory
|
||||
/// contents, stored locally in the pageserver workdir.
|
||||
pub fn disk_consistent_lsn(&self) -> Lsn {
|
||||
self.disk_consistent_lsn
|
||||
}
|
||||
|
||||
pub fn prev_record_lsn(&self) -> Option<Lsn> {
|
||||
self.prev_record_lsn
|
||||
}
|
||||
|
||||
pub fn ancestor_timeline(&self) -> Option<ZTimelineId> {
|
||||
self.ancestor_timeline
|
||||
}
|
||||
|
||||
pub fn ancestor_lsn(&self) -> Lsn {
|
||||
self.ancestor_lsn
|
||||
}
|
||||
|
||||
pub fn latest_gc_cutoff_lsn(&self) -> Lsn {
|
||||
self.latest_gc_cutoff_lsn
|
||||
}
|
||||
|
||||
pub fn initdb_lsn(&self) -> Lsn {
|
||||
self.initdb_lsn
|
||||
}
|
||||
}
|
||||
|
||||
/// This module is for direct conversion of metadata to bytes and back.
|
||||
/// For a certain metadata, besides the conversion a few verification steps has to
|
||||
/// be done, so all serde derives are hidden from the user, to avoid accidental
|
||||
/// verification-less metadata creation.
|
||||
mod serialize {
|
||||
use serde::{Deserialize, Serialize};
|
||||
use zenith_utils::{lsn::Lsn, zid::ZTimelineId};
|
||||
|
||||
use super::TimelineMetadata;
|
||||
|
||||
#[derive(Serialize)]
|
||||
pub(super) struct SeTimelineMetadata<'a> {
|
||||
disk_consistent_lsn: &'a Lsn,
|
||||
prev_record_lsn: &'a Option<Lsn>,
|
||||
ancestor_timeline: &'a Option<ZTimelineId>,
|
||||
ancestor_lsn: &'a Lsn,
|
||||
latest_gc_cutoff_lsn: &'a Lsn,
|
||||
initdb_lsn: &'a Lsn,
|
||||
}
|
||||
|
||||
impl<'a> From<&'a TimelineMetadata> for SeTimelineMetadata<'a> {
|
||||
fn from(other: &'a TimelineMetadata) -> Self {
|
||||
Self {
|
||||
disk_consistent_lsn: &other.disk_consistent_lsn,
|
||||
prev_record_lsn: &other.prev_record_lsn,
|
||||
ancestor_timeline: &other.ancestor_timeline,
|
||||
ancestor_lsn: &other.ancestor_lsn,
|
||||
latest_gc_cutoff_lsn: &other.latest_gc_cutoff_lsn,
|
||||
initdb_lsn: &other.initdb_lsn,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Deserialize)]
|
||||
pub(super) struct DeTimelineMetadata {
|
||||
disk_consistent_lsn: Lsn,
|
||||
prev_record_lsn: Option<Lsn>,
|
||||
ancestor_timeline: Option<ZTimelineId>,
|
||||
ancestor_lsn: Lsn,
|
||||
latest_gc_cutoff_lsn: Lsn,
|
||||
initdb_lsn: Lsn,
|
||||
}
|
||||
|
||||
impl From<DeTimelineMetadata> for TimelineMetadata {
|
||||
fn from(other: DeTimelineMetadata) -> Self {
|
||||
Self {
|
||||
disk_consistent_lsn: other.disk_consistent_lsn,
|
||||
prev_record_lsn: other.prev_record_lsn,
|
||||
ancestor_timeline: other.ancestor_timeline,
|
||||
ancestor_lsn: other.ancestor_lsn,
|
||||
latest_gc_cutoff_lsn: other.latest_gc_cutoff_lsn,
|
||||
initdb_lsn: other.initdb_lsn,
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use crate::repository::repo_harness::TIMELINE_ID;
|
||||
|
||||
use super::*;
|
||||
|
||||
#[test]
|
||||
fn metadata_serializes_correctly() {
|
||||
let original_metadata = TimelineMetadata {
|
||||
disk_consistent_lsn: Lsn(0x200),
|
||||
prev_record_lsn: Some(Lsn(0x100)),
|
||||
ancestor_timeline: Some(TIMELINE_ID),
|
||||
ancestor_lsn: Lsn(0),
|
||||
latest_gc_cutoff_lsn: Lsn(0),
|
||||
initdb_lsn: Lsn(0),
|
||||
};
|
||||
|
||||
let metadata_bytes = original_metadata
|
||||
.to_bytes()
|
||||
.expect("Should serialize correct metadata to bytes");
|
||||
|
||||
let deserialized_metadata = TimelineMetadata::from_bytes(&metadata_bytes)
|
||||
.expect("Should deserialize its own bytes");
|
||||
|
||||
assert_eq!(
|
||||
deserialized_metadata, original_metadata,
|
||||
"Metadata that was serialized to bytes and deserialized back should not change"
|
||||
);
|
||||
}
|
||||
}
|
||||
55
pageserver/src/layered_repository/par_fsync.rs
Normal file
55
pageserver/src/layered_repository/par_fsync.rs
Normal file
@@ -0,0 +1,55 @@
|
||||
use std::{
|
||||
io,
|
||||
path::{Path, PathBuf},
|
||||
sync::atomic::{AtomicUsize, Ordering},
|
||||
};
|
||||
|
||||
use crate::virtual_file::VirtualFile;
|
||||
|
||||
fn fsync_path(path: &Path) -> io::Result<()> {
|
||||
let file = VirtualFile::open(path)?;
|
||||
file.sync_all()
|
||||
}
|
||||
|
||||
fn parallel_worker(paths: &[PathBuf], next_path_idx: &AtomicUsize) -> io::Result<()> {
|
||||
while let Some(path) = paths.get(next_path_idx.fetch_add(1, Ordering::Relaxed)) {
|
||||
fsync_path(path)?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn par_fsync(paths: &[PathBuf]) -> io::Result<()> {
|
||||
const PARALLEL_PATH_THRESHOLD: usize = 1;
|
||||
if paths.len() <= PARALLEL_PATH_THRESHOLD {
|
||||
for path in paths {
|
||||
fsync_path(path)?;
|
||||
}
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
/// Use at most this number of threads.
|
||||
/// Increasing this limit will
|
||||
/// - use more memory
|
||||
/// - increase the cost of spawn/join latency
|
||||
const MAX_NUM_THREADS: usize = 64;
|
||||
let num_threads = paths.len().min(MAX_NUM_THREADS);
|
||||
let next_path_idx = AtomicUsize::new(0);
|
||||
|
||||
crossbeam_utils::thread::scope(|s| -> io::Result<()> {
|
||||
let mut handles = vec![];
|
||||
// Spawn `num_threads - 1`, as the current thread is also a worker.
|
||||
for _ in 1..num_threads {
|
||||
handles.push(s.spawn(|_| parallel_worker(paths, &next_path_idx)));
|
||||
}
|
||||
|
||||
parallel_worker(paths, &next_path_idx)?;
|
||||
|
||||
for handle in handles {
|
||||
handle.join().unwrap()?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
})
|
||||
.unwrap()
|
||||
}
|
||||
187
pageserver/src/layered_repository/storage_layer.rs
Normal file
187
pageserver/src/layered_repository/storage_layer.rs
Normal file
@@ -0,0 +1,187 @@
|
||||
//!
|
||||
//! Common traits and structs for layers
|
||||
//!
|
||||
|
||||
use crate::relish::RelishTag;
|
||||
use crate::repository::{BlockNumber, ZenithWalRecord};
|
||||
use crate::{ZTenantId, ZTimelineId};
|
||||
use anyhow::Result;
|
||||
use bytes::Bytes;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use std::fmt;
|
||||
use std::path::PathBuf;
|
||||
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
// Size of one segment in pages (10 MB)
|
||||
pub const RELISH_SEG_SIZE: u32 = 10 * 1024 * 1024 / 8192;
|
||||
|
||||
///
|
||||
/// Each relish stored in the repository is divided into fixed-sized "segments",
|
||||
/// with 10 MB of key-space, or 1280 8k pages each.
|
||||
///
|
||||
#[derive(Debug, PartialEq, Eq, PartialOrd, Hash, Ord, Clone, Copy, Serialize, Deserialize)]
|
||||
pub struct SegmentTag {
|
||||
pub rel: RelishTag,
|
||||
pub segno: u32,
|
||||
}
|
||||
|
||||
/// SegmentBlk represents a block number within a segment, or the size of segment.
|
||||
///
|
||||
/// This is separate from BlockNumber, which is used for block number within the
|
||||
/// whole relish. Since this is just a type alias, the compiler will let you mix
|
||||
/// them freely, but we use the type alias as documentation to make it clear
|
||||
/// which one we're dealing with.
|
||||
///
|
||||
/// (We could turn this into "struct SegmentBlk(u32)" to forbid accidentally
|
||||
/// assigning a BlockNumber to SegmentBlk or vice versa, but that makes
|
||||
/// operations more verbose).
|
||||
pub type SegmentBlk = u32;
|
||||
|
||||
impl fmt::Display for SegmentTag {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
write!(f, "{}.{}", self.rel, self.segno)
|
||||
}
|
||||
}
|
||||
|
||||
impl SegmentTag {
|
||||
/// Given a relish and block number, calculate the corresponding segment and
|
||||
/// block number within the segment.
|
||||
pub const fn from_blknum(rel: RelishTag, blknum: BlockNumber) -> (SegmentTag, SegmentBlk) {
|
||||
(
|
||||
SegmentTag {
|
||||
rel,
|
||||
segno: blknum / RELISH_SEG_SIZE,
|
||||
},
|
||||
blknum % RELISH_SEG_SIZE,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Represents a version of a page at a specific LSN. The LSN is the key of the
|
||||
/// entry in the 'page_versions' hash, it is not duplicated here.
|
||||
///
|
||||
/// A page version can be stored as a full page image, or as WAL record that needs
|
||||
/// to be applied over the previous page version to reconstruct this version.
|
||||
#[derive(Debug, Clone, Serialize, Deserialize)]
|
||||
pub enum PageVersion {
|
||||
Page(Bytes),
|
||||
Wal(ZenithWalRecord),
|
||||
}
|
||||
|
||||
///
|
||||
/// Struct used to communicate across calls to 'get_page_reconstruct_data'.
|
||||
///
|
||||
/// Before first call to get_page_reconstruct_data, you can fill in 'page_img'
|
||||
/// if you have an older cached version of the page available. That can save
|
||||
/// work in 'get_page_reconstruct_data', as it can stop searching for page
|
||||
/// versions when all the WAL records going back to the cached image have been
|
||||
/// collected.
|
||||
///
|
||||
/// When get_page_reconstruct_data returns Complete, 'page_img' is set to an
|
||||
/// image of the page, or the oldest WAL record in 'records' is a will_init-type
|
||||
/// record that initializes the page without requiring a previous image.
|
||||
///
|
||||
/// If 'get_page_reconstruct_data' returns Continue, some 'records' may have
|
||||
/// been collected, but there are more records outside the current layer. Pass
|
||||
/// the same PageReconstructData struct in the next 'get_page_reconstruct_data'
|
||||
/// call, to collect more records.
|
||||
///
|
||||
pub struct PageReconstructData {
|
||||
pub records: Vec<(Lsn, ZenithWalRecord)>,
|
||||
pub page_img: Option<(Lsn, Bytes)>,
|
||||
}
|
||||
|
||||
/// Return value from Layer::get_page_reconstruct_data
|
||||
pub enum PageReconstructResult {
|
||||
/// Got all the data needed to reconstruct the requested page
|
||||
Complete,
|
||||
/// This layer didn't contain all the required data, the caller should look up
|
||||
/// the predecessor layer at the returned LSN and collect more data from there.
|
||||
Continue(Lsn),
|
||||
/// This layer didn't contain data needed to reconstruct the page version at
|
||||
/// the returned LSN. This is usually considered an error, but might be OK
|
||||
/// in some circumstances.
|
||||
Missing(Lsn),
|
||||
}
|
||||
|
||||
///
|
||||
/// A Layer corresponds to one RELISH_SEG_SIZE slice of a relish in a range of LSNs.
|
||||
/// There are two kinds of layers, in-memory and on-disk layers. In-memory
|
||||
/// layers are used to ingest incoming WAL, and provide fast access
|
||||
/// to the recent page versions. On-disk layers are stored as files on disk, and
|
||||
/// are immutable. This trait presents the common functionality of
|
||||
/// in-memory and on-disk layers.
|
||||
///
|
||||
pub trait Layer: Send + Sync {
|
||||
fn get_tenant_id(&self) -> ZTenantId;
|
||||
|
||||
/// Identify the timeline this relish belongs to
|
||||
fn get_timeline_id(&self) -> ZTimelineId;
|
||||
|
||||
/// Identify the relish segment
|
||||
fn get_seg_tag(&self) -> SegmentTag;
|
||||
|
||||
/// Inclusive start bound of the LSN range that this layer holds
|
||||
fn get_start_lsn(&self) -> Lsn;
|
||||
|
||||
/// Exclusive end bound of the LSN range that this layer holds.
|
||||
///
|
||||
/// - For an open in-memory layer, this is MAX_LSN.
|
||||
/// - For a frozen in-memory layer or a delta layer, this is a valid end bound.
|
||||
/// - An image layer represents snapshot at one LSN, so end_lsn is always the snapshot LSN + 1
|
||||
fn get_end_lsn(&self) -> Lsn;
|
||||
|
||||
/// Is the segment represented by this layer dropped by PostgreSQL?
|
||||
fn is_dropped(&self) -> bool;
|
||||
|
||||
/// Filename used to store this layer on disk. (Even in-memory layers
|
||||
/// implement this, to print a handy unique identifier for the layer for
|
||||
/// log messages, even though they're never not on disk.)
|
||||
fn filename(&self) -> PathBuf;
|
||||
|
||||
///
|
||||
/// Return data needed to reconstruct given page at LSN.
|
||||
///
|
||||
/// It is up to the caller to collect more data from previous layer and
|
||||
/// perform WAL redo, if necessary.
|
||||
///
|
||||
/// See PageReconstructResult for possible return values. The collected data
|
||||
/// is appended to reconstruct_data; the caller should pass an empty struct
|
||||
/// on first call, or a struct with a cached older image of the page if one
|
||||
/// is available. If this returns PageReconstructResult::Continue, look up
|
||||
/// the predecessor layer and call again with the same 'reconstruct_data' to
|
||||
/// collect more data.
|
||||
fn get_page_reconstruct_data(
|
||||
&self,
|
||||
blknum: SegmentBlk,
|
||||
lsn: Lsn,
|
||||
reconstruct_data: &mut PageReconstructData,
|
||||
) -> Result<PageReconstructResult>;
|
||||
|
||||
/// Return size of the segment at given LSN. (Only for blocky relations.)
|
||||
fn get_seg_size(&self, lsn: Lsn) -> Result<SegmentBlk>;
|
||||
|
||||
/// Does the segment exist at given LSN? Or was it dropped before it.
|
||||
fn get_seg_exists(&self, lsn: Lsn) -> Result<bool>;
|
||||
|
||||
/// Does this layer only contain some data for the segment (incremental),
|
||||
/// or does it contain a version of every page? This is important to know
|
||||
/// for garbage collecting old layers: an incremental layer depends on
|
||||
/// the previous non-incremental layer.
|
||||
fn is_incremental(&self) -> bool;
|
||||
|
||||
/// Returns true for layers that are represented in memory.
|
||||
fn is_in_memory(&self) -> bool;
|
||||
|
||||
/// Release memory used by this layer. There is no corresponding 'load'
|
||||
/// function, that's done implicitly when you call one of the get-functions.
|
||||
fn unload(&self) -> Result<()>;
|
||||
|
||||
/// Permanently remove this layer from disk.
|
||||
fn delete(&self) -> Result<()>;
|
||||
|
||||
/// Dump summary of the contents of the layer to stdout
|
||||
fn dump(&self) -> Result<()>;
|
||||
}
|
||||
@@ -1,142 +1,45 @@
|
||||
use serde::{Deserialize, Serialize};
|
||||
|
||||
use std::fmt;
|
||||
use std::path::PathBuf;
|
||||
use std::str::FromStr;
|
||||
use std::time::Duration;
|
||||
|
||||
pub mod basebackup;
|
||||
pub mod branches;
|
||||
pub mod object_key;
|
||||
pub mod object_repository;
|
||||
pub mod object_store;
|
||||
pub mod config;
|
||||
pub mod http;
|
||||
pub mod import_datadir;
|
||||
pub mod layered_repository;
|
||||
pub mod page_cache;
|
||||
pub mod page_service;
|
||||
pub mod relish;
|
||||
pub mod remote_storage;
|
||||
pub mod repository;
|
||||
pub mod restore_local_repo;
|
||||
pub mod rocksdb_storage;
|
||||
pub mod inmem_storage;
|
||||
pub mod tui;
|
||||
pub mod tui_event;
|
||||
mod tui_logger;
|
||||
pub mod waldecoder;
|
||||
pub mod tenant_mgr;
|
||||
pub mod tenant_threads;
|
||||
pub mod thread_mgr;
|
||||
pub mod virtual_file;
|
||||
pub mod walingest;
|
||||
pub mod walreceiver;
|
||||
pub mod walrecord;
|
||||
pub mod walredo;
|
||||
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct PageServerConf {
|
||||
pub daemonize: bool,
|
||||
pub interactive: bool,
|
||||
pub listen_addr: String,
|
||||
pub gc_horizon: u64,
|
||||
pub gc_period: Duration,
|
||||
use lazy_static::lazy_static;
|
||||
use zenith_metrics::{register_int_gauge_vec, IntGaugeVec};
|
||||
use zenith_utils::zid::{ZTenantId, ZTimelineId};
|
||||
|
||||
// Repository directory, relative to current working directory.
|
||||
// Normally, the page server changes the current working directory
|
||||
// to the repository, and 'workdir' is always '.'. But we don't do
|
||||
// that during unit testing, because the current directory is global
|
||||
// to the process but different unit tests work on different
|
||||
// repositories.
|
||||
pub workdir: PathBuf,
|
||||
|
||||
pub pg_distrib_dir: PathBuf,
|
||||
lazy_static! {
|
||||
static ref LIVE_CONNECTIONS_COUNT: IntGaugeVec = register_int_gauge_vec!(
|
||||
"pageserver_live_connections_count",
|
||||
"Number of live network connections",
|
||||
&["pageserver_connection_kind"]
|
||||
)
|
||||
.expect("failed to define a metric");
|
||||
}
|
||||
|
||||
impl PageServerConf {
|
||||
//
|
||||
// Repository paths, relative to workdir.
|
||||
//
|
||||
pub const LOG_FILE_NAME: &str = "pageserver.log";
|
||||
|
||||
fn tag_path(&self, name: &str) -> PathBuf {
|
||||
self.workdir.join("refs").join("tags").join(name)
|
||||
}
|
||||
|
||||
fn branch_path(&self, name: &str) -> PathBuf {
|
||||
self.workdir.join("refs").join("branches").join(name)
|
||||
}
|
||||
|
||||
fn timeline_path(&self, timelineid: ZTimelineId) -> PathBuf {
|
||||
self.workdir.join("timelines").join(timelineid.to_string())
|
||||
}
|
||||
|
||||
fn snapshots_path(&self, timelineid: ZTimelineId) -> PathBuf {
|
||||
self.timeline_path(timelineid).join("snapshots")
|
||||
}
|
||||
|
||||
fn ancestor_path(&self, timelineid: ZTimelineId) -> PathBuf {
|
||||
self.timeline_path(timelineid).join("ancestor")
|
||||
}
|
||||
|
||||
//
|
||||
// Postgres distribution paths
|
||||
//
|
||||
|
||||
pub fn pg_bin_dir(&self) -> PathBuf {
|
||||
self.pg_distrib_dir.join("bin")
|
||||
}
|
||||
|
||||
pub fn pg_lib_dir(&self) -> PathBuf {
|
||||
self.pg_distrib_dir.join("lib")
|
||||
}
|
||||
}
|
||||
|
||||
/// Zenith Timeline ID is a 128-bit random ID.
|
||||
///
|
||||
/// Zenith timeline IDs are different from PostgreSQL timeline
|
||||
/// IDs. They serve a similar purpose though: they differentiate
|
||||
/// between different "histories" of the same cluster. However,
|
||||
/// PostgreSQL timeline IDs are a bit cumbersome, because they are only
|
||||
/// 32-bits wide, and they must be in ascending order in any given
|
||||
/// timeline history. Those limitations mean that we cannot generate a
|
||||
/// new PostgreSQL timeline ID by just generating a random number. And
|
||||
/// that in turn is problematic for the "pull/push" workflow, where you
|
||||
/// have a local copy of a zenith repository, and you periodically sync
|
||||
/// the local changes with a remote server. When you work "detached"
|
||||
/// from the remote server, you cannot create a PostgreSQL timeline ID
|
||||
/// that's guaranteed to be different from all existing timelines in
|
||||
/// the remote server. For example, if two people are having a clone of
|
||||
/// the repository on their laptops, and they both create a new branch
|
||||
/// with different name. What timeline ID would they assign to their
|
||||
/// branches? If they pick the same one, and later try to push the
|
||||
/// branches to the same remote server, they will get mixed up.
|
||||
///
|
||||
/// To avoid those issues, Zenith has its own concept of timelines that
|
||||
/// is separate from PostgreSQL timelines, and doesn't have those
|
||||
/// limitations. A zenith timeline is identified by a 128-bit ID, which
|
||||
/// is usually printed out as a hex string.
|
||||
#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Hash, Serialize, Deserialize)]
|
||||
pub struct ZTimelineId([u8; 16]);
|
||||
|
||||
impl FromStr for ZTimelineId {
|
||||
type Err = hex::FromHexError;
|
||||
|
||||
fn from_str(s: &str) -> Result<ZTimelineId, Self::Err> {
|
||||
let timelineid = hex::decode(s)?;
|
||||
|
||||
let mut buf: [u8; 16] = [0u8; 16];
|
||||
buf.copy_from_slice(timelineid.as_slice());
|
||||
Ok(ZTimelineId(buf))
|
||||
}
|
||||
}
|
||||
|
||||
impl ZTimelineId {
|
||||
pub fn from(b: [u8; 16]) -> ZTimelineId {
|
||||
ZTimelineId(b)
|
||||
}
|
||||
|
||||
pub fn get_from_buf(buf: &mut dyn bytes::Buf) -> ZTimelineId {
|
||||
let mut arr = [0u8; 16];
|
||||
buf.copy_to_slice(&mut arr);
|
||||
ZTimelineId::from(arr)
|
||||
}
|
||||
|
||||
pub fn as_arr(&self) -> [u8; 16] {
|
||||
self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for ZTimelineId {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
f.write_str(&hex::encode(self.0))
|
||||
}
|
||||
/// Config for the Repository checkpointer
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
pub enum CheckpointConfig {
|
||||
// Flush in-memory data that is older than this
|
||||
Distance(u64),
|
||||
// Flush all in-memory data
|
||||
Flush,
|
||||
// Flush all in-memory data and reconstruct all page images
|
||||
Forced,
|
||||
}
|
||||
|
||||
@@ -1,84 +0,0 @@
|
||||
use crate::repository::{BufferTag, RelTag};
|
||||
use crate::waldecoder::TransactionId;
|
||||
use crate::ZTimelineId;
|
||||
use serde::{Deserialize, Serialize};
|
||||
|
||||
///
|
||||
/// ObjectKey is the key type used to identify objects stored in an object
|
||||
/// repository. It is shared between object_repository.rs and object_store.rs.
|
||||
/// It is mostly opaque to ObjectStore, it just stores and retrieves objects
|
||||
/// using the key given by the caller.
|
||||
#[derive(Debug, Clone, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct ObjectKey {
|
||||
pub timeline: ZTimelineId,
|
||||
pub tag: ObjectTag,
|
||||
}
|
||||
|
||||
///
|
||||
/// Non-relation transaction status files (clog (a.k.a. pg_xact) and pg_multixact)
|
||||
/// in Postgres are handled by SLRU (Simple LRU) buffer, hence the name.
|
||||
///
|
||||
/// These files are global for a postgres instance.
|
||||
///
|
||||
/// These files are divided into segments, which are divided into pages
|
||||
/// of the same BLCKSZ as used for relation files.
|
||||
///
|
||||
#[derive(Debug, Clone, Copy, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct SlruBufferTag {
|
||||
pub blknum: u32,
|
||||
}
|
||||
|
||||
///
|
||||
/// Special type of Postgres files: pg_filenode.map is needed to map
|
||||
/// catalog table OIDs to filenode numbers, which define filename.
|
||||
///
|
||||
/// Each database has a map file for its local mapped catalogs,
|
||||
/// and there is a separate map file for shared catalogs.
|
||||
///
|
||||
/// These files have untypical size of 512 bytes.
|
||||
///
|
||||
/// See PostgreSQL relmapper.c for details.
|
||||
///
|
||||
#[derive(Debug, Clone, Copy, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct DatabaseTag {
|
||||
pub spcnode: u32,
|
||||
pub dbnode: u32,
|
||||
}
|
||||
|
||||
///
|
||||
/// Non-relation files that keep state for prepared transactions.
|
||||
/// Unlike other files these are not divided into pages.
|
||||
///
|
||||
/// See PostgreSQL twophase.c for details.
|
||||
///
|
||||
#[derive(Debug, Clone, Copy, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct PrepareTag {
|
||||
pub xid: TransactionId,
|
||||
}
|
||||
|
||||
/// ObjectTag is a part of ObjectKey that is specific to the type of
|
||||
/// the stored object.
|
||||
///
|
||||
/// NB: the order of the enum values is significant! In particular,
|
||||
/// rocksdb_storage.rs assumes that TimelineMetadataTag is first
|
||||
///
|
||||
#[derive(Debug, Clone, Copy, Serialize, Deserialize, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub enum ObjectTag {
|
||||
// dummy tag preceeding all other keys
|
||||
FirstTag,
|
||||
TimelineMetadataTag,
|
||||
// Special entry that represents PostgreSQL checkpoint.
|
||||
// We use it to track fields needed to restore controlfile checkpoint.
|
||||
Checkpoint,
|
||||
// Various types of non-relation files.
|
||||
// We need them to bootstrap compute node.
|
||||
ControlFile,
|
||||
Clog(SlruBufferTag),
|
||||
MultiXactMembers(SlruBufferTag),
|
||||
MultiXactOffsets(SlruBufferTag),
|
||||
FileNodeMap(DatabaseTag),
|
||||
TwoPhase(PrepareTag),
|
||||
// put relations at the end of enum to allow efficient iterations through non-rel objects
|
||||
RelationMetadata(RelTag),
|
||||
RelationBuffer(BufferTag),
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,88 +0,0 @@
|
||||
//! Low-level key-value storage abstraction.
|
||||
//!
|
||||
use crate::object_key::*;
|
||||
use crate::repository::RelTag;
|
||||
use crate::ZTimelineId;
|
||||
use anyhow::Result;
|
||||
use std::collections::HashSet;
|
||||
use std::iter::Iterator;
|
||||
use zenith_utils::lsn::Lsn;
|
||||
|
||||
///
|
||||
/// Low-level storage abstraction.
|
||||
///
|
||||
/// All the data in the repository is stored in a key-value store. This trait
|
||||
/// abstracts the details of the key-value store.
|
||||
///
|
||||
/// A simple key-value store would support just GET and PUT operations with
|
||||
/// a key, but the upper layer needs slightly complicated read operations
|
||||
///
|
||||
/// The most frequently used function is 'object_versions'. It is used
|
||||
/// to look up a page version. It is LSN aware, in that the caller
|
||||
/// specifies an LSN, and the function returns all values for that
|
||||
/// block with the same or older LSN.
|
||||
///
|
||||
pub trait ObjectStore: Send + Sync {
|
||||
///
|
||||
/// Store a value with given key.
|
||||
///
|
||||
fn put(&self, key: &ObjectKey, lsn: Lsn, value: &[u8]) -> Result<()>;
|
||||
|
||||
/// Read entry with the exact given key.
|
||||
///
|
||||
/// This is used for retrieving metadata with special key that doesn't
|
||||
/// correspond to any real relation.
|
||||
fn get(&self, key: &ObjectKey, lsn: Lsn) -> Result<Vec<u8>>;
|
||||
|
||||
/// Read key greater or equal than specified
|
||||
fn get_next_key(&self, key: &ObjectKey) -> Result<Option<ObjectKey>>;
|
||||
|
||||
/// Iterate through all page versions of one object.
|
||||
///
|
||||
/// Returns all page versions in descending LSN order, along with the LSN
|
||||
/// of each page version.
|
||||
fn object_versions<'a>(
|
||||
&'a self,
|
||||
key: &ObjectKey,
|
||||
lsn: Lsn,
|
||||
) -> Result<Box<dyn Iterator<Item = (Lsn, Vec<u8>)> + 'a>>;
|
||||
|
||||
/// Iterate through versions of all objects in a timeline.
|
||||
///
|
||||
/// Returns objects in increasing key-version order.
|
||||
/// Returns all versions up to and including the specified LSN.
|
||||
fn objects<'a>(
|
||||
&'a self,
|
||||
timeline: ZTimelineId,
|
||||
lsn: Lsn,
|
||||
) -> Result<Box<dyn Iterator<Item = Result<(ObjectTag, Lsn, Vec<u8>)>> + 'a>>;
|
||||
|
||||
/// Iterate through all keys with given tablespace and database ID, and LSN <= 'lsn'.
|
||||
/// Both dbnode and spcnode can be InvalidId (0) which means get all relations in tablespace/cluster
|
||||
///
|
||||
/// This is used to implement 'create database'
|
||||
fn list_rels(
|
||||
&self,
|
||||
timelineid: ZTimelineId,
|
||||
spcnode: u32,
|
||||
dbnode: u32,
|
||||
lsn: Lsn,
|
||||
) -> Result<HashSet<RelTag>>;
|
||||
|
||||
/// Iterate through objects tags. If nonrel_only, then only non-relationa data is iterated.
|
||||
///
|
||||
/// This is used to implement GC and preparing tarball for new node startup
|
||||
/// Returns objects in increasing key-version order.
|
||||
fn list_objects<'a>(
|
||||
&'a self,
|
||||
timelineid: ZTimelineId,
|
||||
nonrel_only: bool,
|
||||
lsn: Lsn,
|
||||
) -> Result<Box<dyn Iterator<Item = ObjectTag> + 'a>>;
|
||||
|
||||
/// Unlink object (used by GC). This mehod may actually delete object or just mark it for deletion.
|
||||
fn unlink(&self, key: &ObjectKey, lsn: Lsn) -> Result<()>;
|
||||
|
||||
// Compact storage and remove versions marged for deletion
|
||||
fn compact(&self);
|
||||
}
|
||||
@@ -1,37 +1,778 @@
|
||||
//! This module acts as a switchboard to access different repositories managed by this
|
||||
//! page server. Currently, a Page Server can only manage one repository, so there
|
||||
//! isn't much here. If we implement multi-tenancy, this will probably be changed into
|
||||
//! a hash map, keyed by the tenant ID.
|
||||
//!
|
||||
//! Global page cache
|
||||
//!
|
||||
//! The page cache uses up most of the memory in the page server. It is shared
|
||||
//! by all tenants, and it is used to store different kinds of pages. Sharing
|
||||
//! the cache allows memory to be dynamically allocated where it's needed the
|
||||
//! most.
|
||||
//!
|
||||
//! The page cache consists of fixed-size buffers, 8 kB each to match the
|
||||
//! PostgreSQL buffer size, and a Slot struct for each buffer to contain
|
||||
//! information about what's stored in the buffer.
|
||||
//!
|
||||
//! # Locking
|
||||
//!
|
||||
//! There are two levels of locking involved: There's one lock for the "mapping"
|
||||
//! from page identifier (tenant ID, timeline ID, rel, block, LSN) to the buffer
|
||||
//! slot, and a separate lock on each slot. To read or write the contents of a
|
||||
//! slot, you must hold the lock on the slot in read or write mode,
|
||||
//! respectively. To change the mapping of a slot, i.e. to evict a page or to
|
||||
//! assign a buffer for a page, you must hold the mapping lock and the lock on
|
||||
//! the slot at the same time.
|
||||
//!
|
||||
//! Whenever you need to hold both locks simultenously, the slot lock must be
|
||||
//! acquired first. This consistent ordering avoids deadlocks. To look up a page
|
||||
//! in the cache, you would first look up the mapping, while holding the mapping
|
||||
//! lock, and then lock the slot. You must release the mapping lock in between,
|
||||
//! to obey the lock ordering and avoid deadlock.
|
||||
//!
|
||||
//! A slot can momentarily have invalid contents, even if it's already been
|
||||
//! inserted to the mapping, but you must hold the write-lock on the slot until
|
||||
//! the contents are valid. If you need to release the lock without initializing
|
||||
//! the contents, you must remove the mapping first. We make that easy for the
|
||||
//! callers with PageWriteGuard: when lock_for_write() returns an uninitialized
|
||||
//! page, the caller must explicitly call guard.mark_valid() after it has
|
||||
//! initialized it. If the guard is dropped without calling mark_valid(), the
|
||||
//! mapping is automatically removed and the slot is marked free.
|
||||
//!
|
||||
|
||||
use crate::object_repository::ObjectRepository;
|
||||
use crate::repository::Repository;
|
||||
//use crate::rocksdb_storage::RocksObjectStore;
|
||||
use crate::inmem_storage::InmemObjectStore;
|
||||
use crate::walredo::PostgresRedoManager;
|
||||
use crate::PageServerConf;
|
||||
use lazy_static::lazy_static;
|
||||
use std::sync::{Arc, Mutex};
|
||||
use std::{
|
||||
collections::{hash_map::Entry, HashMap},
|
||||
convert::TryInto,
|
||||
sync::{
|
||||
atomic::{AtomicU8, AtomicUsize, Ordering},
|
||||
RwLock, RwLockReadGuard, RwLockWriteGuard,
|
||||
},
|
||||
};
|
||||
|
||||
lazy_static! {
|
||||
pub static ref REPOSITORY: Mutex<Option<Arc<dyn Repository>>> = Mutex::new(None);
|
||||
}
|
||||
use once_cell::sync::OnceCell;
|
||||
use tracing::error;
|
||||
use zenith_utils::{
|
||||
lsn::Lsn,
|
||||
zid::{ZTenantId, ZTimelineId},
|
||||
};
|
||||
|
||||
use crate::layered_repository::writeback_ephemeral_file;
|
||||
use crate::{config::PageServerConf, relish::RelTag};
|
||||
|
||||
static PAGE_CACHE: OnceCell<PageCache> = OnceCell::new();
|
||||
const TEST_PAGE_CACHE_SIZE: usize = 10;
|
||||
|
||||
///
|
||||
/// Initialize the page cache. This must be called once at page server startup.
|
||||
///
|
||||
pub fn init(conf: &'static PageServerConf) {
|
||||
let mut m = REPOSITORY.lock().unwrap();
|
||||
|
||||
//let obj_store = RocksObjectStore::open(conf).unwrap();
|
||||
let obj_store = InmemObjectStore::open(conf).unwrap();
|
||||
|
||||
// Set up a WAL redo manager, for applying WAL records.
|
||||
let walredo_mgr = PostgresRedoManager::new(conf);
|
||||
|
||||
// we have already changed current dir to the repository.
|
||||
let repo = ObjectRepository::new(conf, Arc::new(obj_store), Arc::new(walredo_mgr));
|
||||
|
||||
*m = Some(Arc::new(repo));
|
||||
if PAGE_CACHE
|
||||
.set(PageCache::new(conf.page_cache_size))
|
||||
.is_err()
|
||||
{
|
||||
panic!("page cache already initialized");
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get_repository() -> Arc<dyn Repository> {
|
||||
let o = &REPOSITORY.lock().unwrap();
|
||||
Arc::clone(o.as_ref().unwrap())
|
||||
///
|
||||
/// Get a handle to the page cache.
|
||||
///
|
||||
pub fn get() -> &'static PageCache {
|
||||
//
|
||||
// In unit tests, page server startup doesn't happen and no one calls
|
||||
// page_cache::init(). Initialize it here with a tiny cache, so that the
|
||||
// page cache is usable in unit tests.
|
||||
//
|
||||
if cfg!(test) {
|
||||
PAGE_CACHE.get_or_init(|| PageCache::new(TEST_PAGE_CACHE_SIZE))
|
||||
} else {
|
||||
PAGE_CACHE.get().expect("page cache not initialized")
|
||||
}
|
||||
}
|
||||
|
||||
pub const PAGE_SZ: usize = postgres_ffi::pg_constants::BLCKSZ as usize;
|
||||
const MAX_USAGE_COUNT: u8 = 5;
|
||||
|
||||
///
|
||||
/// CacheKey uniquely identifies a "thing" to cache in the page cache.
|
||||
///
|
||||
#[derive(Debug, PartialEq, Eq, Clone)]
|
||||
enum CacheKey {
|
||||
MaterializedPage {
|
||||
hash_key: MaterializedPageHashKey,
|
||||
lsn: Lsn,
|
||||
},
|
||||
EphemeralPage {
|
||||
file_id: u64,
|
||||
blkno: u32,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Debug, PartialEq, Eq, Hash, Clone)]
|
||||
struct MaterializedPageHashKey {
|
||||
tenant_id: ZTenantId,
|
||||
timeline_id: ZTimelineId,
|
||||
rel_tag: RelTag,
|
||||
blknum: u32,
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
struct Version {
|
||||
lsn: Lsn,
|
||||
slot_idx: usize,
|
||||
}
|
||||
|
||||
struct Slot {
|
||||
inner: RwLock<SlotInner>,
|
||||
usage_count: AtomicU8,
|
||||
}
|
||||
|
||||
struct SlotInner {
|
||||
key: Option<CacheKey>,
|
||||
buf: &'static mut [u8; PAGE_SZ],
|
||||
dirty: bool,
|
||||
}
|
||||
|
||||
impl Slot {
|
||||
/// Increment usage count on the buffer, with ceiling at MAX_USAGE_COUNT.
|
||||
fn inc_usage_count(&self) {
|
||||
let _ = self
|
||||
.usage_count
|
||||
.fetch_update(Ordering::Relaxed, Ordering::Relaxed, |val| {
|
||||
if val == MAX_USAGE_COUNT {
|
||||
None
|
||||
} else {
|
||||
Some(val + 1)
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
/// Decrement usage count on the buffer, unless it's already zero. Returns
|
||||
/// the old usage count.
|
||||
fn dec_usage_count(&self) -> u8 {
|
||||
let count_res =
|
||||
self.usage_count
|
||||
.fetch_update(Ordering::Relaxed, Ordering::Relaxed, |val| {
|
||||
if val == 0 {
|
||||
None
|
||||
} else {
|
||||
Some(val - 1)
|
||||
}
|
||||
});
|
||||
|
||||
match count_res {
|
||||
Ok(usage_count) => usage_count,
|
||||
Err(usage_count) => usage_count,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub struct PageCache {
|
||||
/// This contains the mapping from the cache key to buffer slot that currently
|
||||
/// contains the page, if any.
|
||||
///
|
||||
/// TODO: This is protected by a single lock. If that becomes a bottleneck,
|
||||
/// this HashMap can be replaced with a more concurrent version, there are
|
||||
/// plenty of such crates around.
|
||||
///
|
||||
/// If you add support for caching different kinds of objects, each object kind
|
||||
/// can have a separate mapping map, next to this field.
|
||||
materialized_page_map: RwLock<HashMap<MaterializedPageHashKey, Vec<Version>>>,
|
||||
|
||||
ephemeral_page_map: RwLock<HashMap<(u64, u32), usize>>,
|
||||
|
||||
/// The actual buffers with their metadata.
|
||||
slots: Box<[Slot]>,
|
||||
|
||||
/// Index of the next candidate to evict, for the Clock replacement algorithm.
|
||||
/// This is interpreted modulo the page cache size.
|
||||
next_evict_slot: AtomicUsize,
|
||||
}
|
||||
|
||||
///
|
||||
/// PageReadGuard is a "lease" on a buffer, for reading. The page is kept locked
|
||||
/// until the guard is dropped.
|
||||
///
|
||||
pub struct PageReadGuard<'i>(RwLockReadGuard<'i, SlotInner>);
|
||||
|
||||
impl std::ops::Deref for PageReadGuard<'_> {
|
||||
type Target = [u8; PAGE_SZ];
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
self.0.buf
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// PageWriteGuard is a lease on a buffer for modifying it. The page is kept locked
|
||||
/// until the guard is dropped.
|
||||
///
|
||||
/// Counterintuitively, this is used even for a read, if the requested page is not
|
||||
/// currently found in the page cache. In that case, the caller of lock_for_read()
|
||||
/// is expected to fill in the page contents and call mark_valid(). Similarly
|
||||
/// lock_for_write() can return an invalid buffer that the caller is expected to
|
||||
/// to initialize.
|
||||
///
|
||||
pub struct PageWriteGuard<'i> {
|
||||
inner: RwLockWriteGuard<'i, SlotInner>,
|
||||
|
||||
// Are the page contents currently valid?
|
||||
valid: bool,
|
||||
}
|
||||
|
||||
impl std::ops::DerefMut for PageWriteGuard<'_> {
|
||||
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||
self.inner.buf
|
||||
}
|
||||
}
|
||||
|
||||
impl std::ops::Deref for PageWriteGuard<'_> {
|
||||
type Target = [u8; PAGE_SZ];
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
self.inner.buf
|
||||
}
|
||||
}
|
||||
|
||||
impl PageWriteGuard<'_> {
|
||||
/// Mark that the buffer contents are now valid.
|
||||
pub fn mark_valid(&mut self) {
|
||||
assert!(self.inner.key.is_some());
|
||||
assert!(
|
||||
!self.valid,
|
||||
"mark_valid called on a buffer that was already valid"
|
||||
);
|
||||
self.valid = true;
|
||||
}
|
||||
pub fn mark_dirty(&mut self) {
|
||||
// only ephemeral pages can be dirty ATM.
|
||||
assert!(matches!(
|
||||
self.inner.key,
|
||||
Some(CacheKey::EphemeralPage { .. })
|
||||
));
|
||||
self.inner.dirty = true;
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for PageWriteGuard<'_> {
|
||||
///
|
||||
/// If the buffer was allocated for a page that was not already in the
|
||||
/// cache, but the lock_for_read/write() caller dropped the buffer without
|
||||
/// initializing it, remove the mapping from the page cache.
|
||||
///
|
||||
fn drop(&mut self) {
|
||||
assert!(self.inner.key.is_some());
|
||||
if !self.valid {
|
||||
let self_key = self.inner.key.as_ref().unwrap();
|
||||
PAGE_CACHE.get().unwrap().remove_mapping(self_key);
|
||||
self.inner.key = None;
|
||||
self.inner.dirty = false;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// lock_for_read() return value
|
||||
pub enum ReadBufResult<'a> {
|
||||
Found(PageReadGuard<'a>),
|
||||
NotFound(PageWriteGuard<'a>),
|
||||
}
|
||||
|
||||
/// lock_for_write() return value
|
||||
pub enum WriteBufResult<'a> {
|
||||
Found(PageWriteGuard<'a>),
|
||||
NotFound(PageWriteGuard<'a>),
|
||||
}
|
||||
|
||||
impl PageCache {
|
||||
//
|
||||
// Section 1.1: Public interface functions for looking up and memorizing materialized page
|
||||
// versions in the page cache
|
||||
//
|
||||
|
||||
/// Look up a materialized page version.
|
||||
///
|
||||
/// The 'lsn' is an upper bound, this will return the latest version of
|
||||
/// the given block, but not newer than 'lsn'. Returns the actual LSN of the
|
||||
/// returned page.
|
||||
pub fn lookup_materialized_page(
|
||||
&self,
|
||||
tenant_id: ZTenantId,
|
||||
timeline_id: ZTimelineId,
|
||||
rel_tag: RelTag,
|
||||
blknum: u32,
|
||||
lsn: Lsn,
|
||||
) -> Option<(Lsn, PageReadGuard)> {
|
||||
let mut cache_key = CacheKey::MaterializedPage {
|
||||
hash_key: MaterializedPageHashKey {
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
rel_tag,
|
||||
blknum,
|
||||
},
|
||||
lsn,
|
||||
};
|
||||
|
||||
if let Some(guard) = self.try_lock_for_read(&mut cache_key) {
|
||||
if let CacheKey::MaterializedPage { hash_key: _, lsn } = cache_key {
|
||||
Some((lsn, guard))
|
||||
} else {
|
||||
panic!("unexpected key type in slot");
|
||||
}
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Store an image of the given page in the cache.
|
||||
///
|
||||
pub fn memorize_materialized_page(
|
||||
&self,
|
||||
tenant_id: ZTenantId,
|
||||
timeline_id: ZTimelineId,
|
||||
rel_tag: RelTag,
|
||||
blknum: u32,
|
||||
lsn: Lsn,
|
||||
img: &[u8],
|
||||
) {
|
||||
let cache_key = CacheKey::MaterializedPage {
|
||||
hash_key: MaterializedPageHashKey {
|
||||
tenant_id,
|
||||
timeline_id,
|
||||
rel_tag,
|
||||
blknum,
|
||||
},
|
||||
lsn,
|
||||
};
|
||||
|
||||
match self.lock_for_write(&cache_key) {
|
||||
WriteBufResult::Found(write_guard) => {
|
||||
// We already had it in cache. Another thread must've put it there
|
||||
// concurrently. Check that it had the same contents that we
|
||||
// replayed.
|
||||
assert!(*write_guard == img);
|
||||
}
|
||||
WriteBufResult::NotFound(mut write_guard) => {
|
||||
write_guard.copy_from_slice(img);
|
||||
write_guard.mark_valid();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Section 1.2: Public interface functions for working with Ephemeral pages.
|
||||
|
||||
pub fn read_ephemeral_buf(&self, file_id: u64, blkno: u32) -> ReadBufResult {
|
||||
let mut cache_key = CacheKey::EphemeralPage { file_id, blkno };
|
||||
|
||||
self.lock_for_read(&mut cache_key)
|
||||
}
|
||||
|
||||
pub fn write_ephemeral_buf(&self, file_id: u64, blkno: u32) -> WriteBufResult {
|
||||
let cache_key = CacheKey::EphemeralPage { file_id, blkno };
|
||||
|
||||
self.lock_for_write(&cache_key)
|
||||
}
|
||||
|
||||
/// Immediately drop all buffers belonging to given file, without writeback
|
||||
pub fn drop_buffers_for_ephemeral(&self, drop_file_id: u64) {
|
||||
for slot_idx in 0..self.slots.len() {
|
||||
let slot = &self.slots[slot_idx];
|
||||
|
||||
let mut inner = slot.inner.write().unwrap();
|
||||
if let Some(key) = &inner.key {
|
||||
match key {
|
||||
CacheKey::EphemeralPage { file_id, blkno: _ } if *file_id == drop_file_id => {
|
||||
// remove mapping for old buffer
|
||||
self.remove_mapping(key);
|
||||
inner.key = None;
|
||||
inner.dirty = false;
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Section 2: Internal interface functions for lookup/update.
|
||||
//
|
||||
// To add support for a new kind of "thing" to cache, you will need
|
||||
// to add public interface routines above, and code to deal with the
|
||||
// "mappings" after this section. But the routines in this section should
|
||||
// not require changes.
|
||||
|
||||
/// Look up a page in the cache.
|
||||
///
|
||||
/// If the search criteria is not exact, *cache_key is updated with the key
|
||||
/// for exact key of the returned page. (For materialized pages, that means
|
||||
/// that the LSN in 'cache_key' is updated with the LSN of the returned page
|
||||
/// version.)
|
||||
///
|
||||
/// If no page is found, returns None and *cache_key is left unmodified.
|
||||
///
|
||||
fn try_lock_for_read(&self, cache_key: &mut CacheKey) -> Option<PageReadGuard> {
|
||||
let cache_key_orig = cache_key.clone();
|
||||
if let Some(slot_idx) = self.search_mapping(cache_key) {
|
||||
// The page was found in the mapping. Lock the slot, and re-check
|
||||
// that it's still what we expected (because we released the mapping
|
||||
// lock already, another thread could have evicted the page)
|
||||
let slot = &self.slots[slot_idx];
|
||||
let inner = slot.inner.read().unwrap();
|
||||
if inner.key.as_ref() == Some(cache_key) {
|
||||
slot.inc_usage_count();
|
||||
return Some(PageReadGuard(inner));
|
||||
} else {
|
||||
// search_mapping might have modified the search key; restore it.
|
||||
*cache_key = cache_key_orig;
|
||||
}
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
/// Return a locked buffer for given block.
|
||||
///
|
||||
/// Like try_lock_for_read(), if the search criteria is not exact and the
|
||||
/// page is already found in the cache, *cache_key is updated.
|
||||
///
|
||||
/// If the page is not found in the cache, this allocates a new buffer for
|
||||
/// it. The caller may then initialize the buffer with the contents, and
|
||||
/// call mark_valid().
|
||||
///
|
||||
/// Example usage:
|
||||
///
|
||||
/// ```ignore
|
||||
/// let cache = page_cache::get();
|
||||
///
|
||||
/// match cache.lock_for_read(&key) {
|
||||
/// ReadBufResult::Found(read_guard) => {
|
||||
/// // The page was found in cache. Use it
|
||||
/// },
|
||||
/// ReadBufResult::NotFound(write_guard) => {
|
||||
/// // The page was not found in cache. Read it from disk into the
|
||||
/// // buffer.
|
||||
/// //read_my_page_from_disk(write_guard);
|
||||
///
|
||||
/// // The buffer contents are now valid. Tell the page cache.
|
||||
/// write_guard.mark_valid();
|
||||
/// },
|
||||
/// }
|
||||
/// ```
|
||||
///
|
||||
fn lock_for_read(&self, cache_key: &mut CacheKey) -> ReadBufResult {
|
||||
loop {
|
||||
// First check if the key already exists in the cache.
|
||||
if let Some(read_guard) = self.try_lock_for_read(cache_key) {
|
||||
return ReadBufResult::Found(read_guard);
|
||||
}
|
||||
|
||||
// Not found. Find a victim buffer
|
||||
let (slot_idx, mut inner) = self.find_victim();
|
||||
|
||||
// Insert mapping for this. At this point, we may find that another
|
||||
// thread did the same thing concurrently. In that case, we evicted
|
||||
// our victim buffer unnecessarily. Put it into the free list and
|
||||
// continue with the slot that the other thread chose.
|
||||
if let Some(_existing_slot_idx) = self.try_insert_mapping(cache_key, slot_idx) {
|
||||
// TODO: put to free list
|
||||
|
||||
// We now just loop back to start from beginning. This is not
|
||||
// optimal, we'll perform the lookup in the mapping again, which
|
||||
// is not really necessary because we already got
|
||||
// 'existing_slot_idx'. But this shouldn't happen often enough
|
||||
// to matter much.
|
||||
continue;
|
||||
}
|
||||
|
||||
// Make the slot ready
|
||||
let slot = &self.slots[slot_idx];
|
||||
inner.key = Some(cache_key.clone());
|
||||
inner.dirty = false;
|
||||
slot.usage_count.store(1, Ordering::Relaxed);
|
||||
|
||||
return ReadBufResult::NotFound(PageWriteGuard {
|
||||
inner,
|
||||
valid: false,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
/// Look up a page in the cache and lock it in write mode. If it's not
|
||||
/// found, returns None.
|
||||
///
|
||||
/// When locking a page for writing, the search criteria is always "exact".
|
||||
fn try_lock_for_write(&self, cache_key: &CacheKey) -> Option<PageWriteGuard> {
|
||||
if let Some(slot_idx) = self.search_mapping_for_write(cache_key) {
|
||||
// The page was found in the mapping. Lock the slot, and re-check
|
||||
// that it's still what we expected (because we don't released the mapping
|
||||
// lock already, another thread could have evicted the page)
|
||||
let slot = &self.slots[slot_idx];
|
||||
let inner = slot.inner.write().unwrap();
|
||||
if inner.key.as_ref() == Some(cache_key) {
|
||||
slot.inc_usage_count();
|
||||
return Some(PageWriteGuard { inner, valid: true });
|
||||
}
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
/// Return a write-locked buffer for given block.
|
||||
///
|
||||
/// Similar to lock_for_read(), but the returned buffer is write-locked and
|
||||
/// may be modified by the caller even if it's already found in the cache.
|
||||
fn lock_for_write(&self, cache_key: &CacheKey) -> WriteBufResult {
|
||||
loop {
|
||||
// First check if the key already exists in the cache.
|
||||
if let Some(write_guard) = self.try_lock_for_write(cache_key) {
|
||||
return WriteBufResult::Found(write_guard);
|
||||
}
|
||||
|
||||
// Not found. Find a victim buffer
|
||||
let (slot_idx, mut inner) = self.find_victim();
|
||||
|
||||
// Insert mapping for this. At this point, we may find that another
|
||||
// thread did the same thing concurrently. In that case, we evicted
|
||||
// our victim buffer unnecessarily. Put it into the free list and
|
||||
// continue with the slot that the other thread chose.
|
||||
if let Some(_existing_slot_idx) = self.try_insert_mapping(cache_key, slot_idx) {
|
||||
// TODO: put to free list
|
||||
|
||||
// We now just loop back to start from beginning. This is not
|
||||
// optimal, we'll perform the lookup in the mapping again, which
|
||||
// is not really necessary because we already got
|
||||
// 'existing_slot_idx'. But this shouldn't happen often enough
|
||||
// to matter much.
|
||||
continue;
|
||||
}
|
||||
|
||||
// Make the slot ready
|
||||
let slot = &self.slots[slot_idx];
|
||||
inner.key = Some(cache_key.clone());
|
||||
inner.dirty = false;
|
||||
slot.usage_count.store(1, Ordering::Relaxed);
|
||||
|
||||
return WriteBufResult::NotFound(PageWriteGuard {
|
||||
inner,
|
||||
valid: false,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Section 3: Mapping functions
|
||||
//
|
||||
|
||||
/// Search for a page in the cache using the given search key.
|
||||
///
|
||||
/// Returns the slot index, if any. If the search criteria is not exact,
|
||||
/// *cache_key is updated with the actual key of the found page.
|
||||
///
|
||||
/// NOTE: We don't hold any lock on the mapping on return, so the slot might
|
||||
/// get recycled for an unrelated page immediately after this function
|
||||
/// returns. The caller is responsible for re-checking that the slot still
|
||||
/// contains the page with the same key before using it.
|
||||
///
|
||||
fn search_mapping(&self, cache_key: &mut CacheKey) -> Option<usize> {
|
||||
match cache_key {
|
||||
CacheKey::MaterializedPage { hash_key, lsn } => {
|
||||
let map = self.materialized_page_map.read().unwrap();
|
||||
let versions = map.get(hash_key)?;
|
||||
|
||||
let version_idx = match versions.binary_search_by_key(lsn, |v| v.lsn) {
|
||||
Ok(version_idx) => version_idx,
|
||||
Err(0) => return None,
|
||||
Err(version_idx) => version_idx - 1,
|
||||
};
|
||||
let version = &versions[version_idx];
|
||||
*lsn = version.lsn;
|
||||
Some(version.slot_idx)
|
||||
}
|
||||
CacheKey::EphemeralPage { file_id, blkno } => {
|
||||
let map = self.ephemeral_page_map.read().unwrap();
|
||||
Some(*map.get(&(*file_id, *blkno))?)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Search for a page in the cache using the given search key.
|
||||
///
|
||||
/// Like 'search_mapping, but performs an "exact" search. Used for
|
||||
/// allocating a new buffer.
|
||||
fn search_mapping_for_write(&self, key: &CacheKey) -> Option<usize> {
|
||||
match key {
|
||||
CacheKey::MaterializedPage { hash_key, lsn } => {
|
||||
let map = self.materialized_page_map.read().unwrap();
|
||||
let versions = map.get(hash_key)?;
|
||||
|
||||
if let Ok(version_idx) = versions.binary_search_by_key(lsn, |v| v.lsn) {
|
||||
Some(versions[version_idx].slot_idx)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
CacheKey::EphemeralPage { file_id, blkno } => {
|
||||
let map = self.ephemeral_page_map.read().unwrap();
|
||||
Some(*map.get(&(*file_id, *blkno))?)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Remove mapping for given key.
|
||||
///
|
||||
fn remove_mapping(&self, old_key: &CacheKey) {
|
||||
match old_key {
|
||||
CacheKey::MaterializedPage {
|
||||
hash_key: old_hash_key,
|
||||
lsn: old_lsn,
|
||||
} => {
|
||||
let mut map = self.materialized_page_map.write().unwrap();
|
||||
if let Entry::Occupied(mut old_entry) = map.entry(old_hash_key.clone()) {
|
||||
let versions = old_entry.get_mut();
|
||||
|
||||
if let Ok(version_idx) = versions.binary_search_by_key(old_lsn, |v| v.lsn) {
|
||||
versions.remove(version_idx);
|
||||
if versions.is_empty() {
|
||||
old_entry.remove_entry();
|
||||
}
|
||||
}
|
||||
} else {
|
||||
panic!("could not find old key in mapping")
|
||||
}
|
||||
}
|
||||
CacheKey::EphemeralPage { file_id, blkno } => {
|
||||
let mut map = self.ephemeral_page_map.write().unwrap();
|
||||
map.remove(&(*file_id, *blkno))
|
||||
.expect("could not find old key in mapping");
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
///
|
||||
/// Insert mapping for given key.
|
||||
///
|
||||
/// If a mapping already existed for the given key, returns the slot index
|
||||
/// of the existing mapping and leaves it untouched.
|
||||
fn try_insert_mapping(&self, new_key: &CacheKey, slot_idx: usize) -> Option<usize> {
|
||||
match new_key {
|
||||
CacheKey::MaterializedPage {
|
||||
hash_key: new_key,
|
||||
lsn: new_lsn,
|
||||
} => {
|
||||
let mut map = self.materialized_page_map.write().unwrap();
|
||||
let versions = map.entry(new_key.clone()).or_default();
|
||||
match versions.binary_search_by_key(new_lsn, |v| v.lsn) {
|
||||
Ok(version_idx) => Some(versions[version_idx].slot_idx),
|
||||
Err(version_idx) => {
|
||||
versions.insert(
|
||||
version_idx,
|
||||
Version {
|
||||
lsn: *new_lsn,
|
||||
slot_idx,
|
||||
},
|
||||
);
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
CacheKey::EphemeralPage { file_id, blkno } => {
|
||||
let mut map = self.ephemeral_page_map.write().unwrap();
|
||||
match map.entry((*file_id, *blkno)) {
|
||||
Entry::Occupied(entry) => Some(*entry.get()),
|
||||
Entry::Vacant(entry) => {
|
||||
entry.insert(slot_idx);
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
//
|
||||
// Section 4: Misc internal helpers
|
||||
//
|
||||
|
||||
/// Find a slot to evict.
|
||||
///
|
||||
/// On return, the slot is empty and write-locked.
|
||||
fn find_victim(&self) -> (usize, RwLockWriteGuard<SlotInner>) {
|
||||
let iter_limit = self.slots.len() * 2;
|
||||
let mut iters = 0;
|
||||
loop {
|
||||
let slot_idx = self.next_evict_slot.fetch_add(1, Ordering::Relaxed) % self.slots.len();
|
||||
|
||||
let slot = &self.slots[slot_idx];
|
||||
|
||||
if slot.dec_usage_count() == 0 || iters >= iter_limit {
|
||||
let mut inner = slot.inner.write().unwrap();
|
||||
|
||||
if let Some(old_key) = &inner.key {
|
||||
if inner.dirty {
|
||||
if let Err(err) = Self::writeback(old_key, inner.buf) {
|
||||
// Writing the page to disk failed.
|
||||
//
|
||||
// FIXME: What to do here, when? We could propagate the error to the
|
||||
// caller, but victim buffer is generally unrelated to the original
|
||||
// call. It can even belong to a different tenant. Currently, we
|
||||
// report the error to the log and continue the clock sweep to find
|
||||
// a different victim. But if the problem persists, the page cache
|
||||
// could fill up with dirty pages that we cannot evict, and we will
|
||||
// loop retrying the writebacks indefinitely.
|
||||
error!("writeback of buffer {:?} failed: {}", old_key, err);
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
// remove mapping for old buffer
|
||||
self.remove_mapping(old_key);
|
||||
inner.dirty = false;
|
||||
inner.key = None;
|
||||
}
|
||||
return (slot_idx, inner);
|
||||
}
|
||||
|
||||
iters += 1;
|
||||
}
|
||||
}
|
||||
|
||||
fn writeback(cache_key: &CacheKey, buf: &[u8]) -> Result<(), std::io::Error> {
|
||||
match cache_key {
|
||||
CacheKey::MaterializedPage {
|
||||
hash_key: _,
|
||||
lsn: _,
|
||||
} => {
|
||||
panic!("unexpected dirty materialized page");
|
||||
}
|
||||
CacheKey::EphemeralPage { file_id, blkno } => {
|
||||
writeback_ephemeral_file(*file_id, *blkno, buf)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Initialize a new page cache
|
||||
///
|
||||
/// This should be called only once at page server startup.
|
||||
fn new(num_pages: usize) -> Self {
|
||||
assert!(num_pages > 0, "page cache size must be > 0");
|
||||
|
||||
let page_buffer = Box::leak(vec![0u8; num_pages * PAGE_SZ].into_boxed_slice());
|
||||
|
||||
let slots = page_buffer
|
||||
.chunks_exact_mut(PAGE_SZ)
|
||||
.map(|chunk| {
|
||||
let buf: &mut [u8; PAGE_SZ] = chunk.try_into().unwrap();
|
||||
|
||||
Slot {
|
||||
inner: RwLock::new(SlotInner {
|
||||
key: None,
|
||||
buf,
|
||||
dirty: false,
|
||||
}),
|
||||
usage_count: AtomicU8::new(0),
|
||||
}
|
||||
})
|
||||
.collect();
|
||||
|
||||
Self {
|
||||
materialized_page_map: Default::default(),
|
||||
ephemeral_page_map: Default::default(),
|
||||
slots,
|
||||
next_evict_slot: AtomicUsize::new(0),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user